CH496705A - Verfahren zur Herstellung von Bipyridyliumsalzen - Google Patents
Verfahren zur Herstellung von BipyridyliumsalzenInfo
- Publication number
- CH496705A CH496705A CH782766A CH782766A CH496705A CH 496705 A CH496705 A CH 496705A CH 782766 A CH782766 A CH 782766A CH 782766 A CH782766 A CH 782766A CH 496705 A CH496705 A CH 496705A
- Authority
- CH
- Switzerland
- Prior art keywords
- metal
- pyridine
- compound
- disubstituted
- reaction product
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 18
- 150000003839 salts Chemical class 0.000 title claims description 10
- 238000002360 preparation method Methods 0.000 title claims description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N pyridine Substances C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 33
- 239000007795 chemical reaction product Substances 0.000 claims description 20
- 229910052757 nitrogen Inorganic materials 0.000 claims description 18
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 14
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 13
- 150000002896 organic halogen compounds Chemical class 0.000 claims description 13
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 11
- -1 N, N'-disubstituted 4,4'-bipyridylium salts Chemical class 0.000 claims description 9
- 229910052751 metal Inorganic materials 0.000 claims description 6
- 239000002184 metal Substances 0.000 claims description 6
- 150000003222 pyridines Chemical class 0.000 claims description 6
- 229910021529 ammonia Inorganic materials 0.000 claims description 5
- 150000001875 compounds Chemical class 0.000 claims description 5
- 125000005843 halogen group Chemical group 0.000 claims description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 4
- 239000007788 liquid Substances 0.000 claims description 4
- 239000007800 oxidant agent Substances 0.000 claims description 4
- 229910052708 sodium Inorganic materials 0.000 claims description 4
- 239000011734 sodium Substances 0.000 claims description 4
- 239000002253 acid Substances 0.000 claims description 3
- 229910052783 alkali metal Inorganic materials 0.000 claims description 3
- 150000001340 alkali metals Chemical class 0.000 claims description 3
- 150000001350 alkyl halides Chemical class 0.000 claims description 3
- 230000015572 biosynthetic process Effects 0.000 claims description 3
- 239000003960 organic solvent Substances 0.000 claims description 3
- 125000001424 substituent group Chemical group 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 2
- 150000001342 alkaline earth metals Chemical class 0.000 claims description 2
- 150000001450 anions Chemical class 0.000 claims description 2
- 239000003795 chemical substances by application Substances 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 150000002894 organic compounds Chemical class 0.000 claims description 2
- 229910052700 potassium Inorganic materials 0.000 claims description 2
- 239000011591 potassium Substances 0.000 claims description 2
- 230000001419 dependent effect Effects 0.000 claims 2
- 150000007824 aliphatic compounds Chemical class 0.000 claims 1
- 125000001033 ether group Chemical group 0.000 claims 1
- 229910052736 halogen Inorganic materials 0.000 claims 1
- 150000002367 halogens Chemical class 0.000 claims 1
- 230000001590 oxidative effect Effects 0.000 claims 1
- 238000006243 chemical reaction Methods 0.000 description 11
- 239000002904 solvent Substances 0.000 description 7
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 6
- NEHMKBQYUWJMIP-UHFFFAOYSA-N chloromethane Chemical compound ClC NEHMKBQYUWJMIP-UHFFFAOYSA-N 0.000 description 6
- 239000000725 suspension Substances 0.000 description 6
- 239000011541 reaction mixture Substances 0.000 description 4
- KIEFQUXBBALVKN-UHFFFAOYSA-N 2-(1,2,3,4-tetrahydropyridin-2-yl)pyridine Chemical group N1C=CCCC1C1=CC=CC=N1 KIEFQUXBBALVKN-UHFFFAOYSA-N 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- 229910052786 argon Inorganic materials 0.000 description 3
- SBZXBUIDTXKZTM-UHFFFAOYSA-N diglyme Chemical compound COCCOCCOC SBZXBUIDTXKZTM-UHFFFAOYSA-N 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- 229940050176 methyl chloride Drugs 0.000 description 3
- AZQWKYJCGOJGHM-UHFFFAOYSA-N 1,4-benzoquinone Chemical compound O=C1C=CC(=O)C=C1 AZQWKYJCGOJGHM-UHFFFAOYSA-N 0.000 description 2
- PBYLFGPWFUSZRA-UHFFFAOYSA-N 1-methyl-4-(1-methylpiperidin-4-yl)-2h-pyridine Chemical group C1CN(C)CCC1C1=CCN(C)C=C1 PBYLFGPWFUSZRA-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- 239000002002 slurry Substances 0.000 description 2
- 239000006188 syrup Substances 0.000 description 2
- 235000020357 syrup Nutrition 0.000 description 2
- SPEUIVXLLWOEMJ-UHFFFAOYSA-N 1,1-dimethoxyethane Chemical compound COC(C)OC SPEUIVXLLWOEMJ-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- ROFVEXUMMXZLPA-UHFFFAOYSA-N Bipyridyl Chemical class N1=CC=CC=C1C1=CC=CC=N1 ROFVEXUMMXZLPA-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 239000001089 [(2R)-oxolan-2-yl]methanol Substances 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 150000001491 aromatic compounds Chemical class 0.000 description 1
- 150000004054 benzoquinones Chemical class 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000002360 explosive Substances 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000004009 herbicide Substances 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- FIKAKWIAUPDISJ-UHFFFAOYSA-L paraquat dichloride Chemical compound [Cl-].[Cl-].C1=C[N+](C)=CC=C1C1=CC=[N+](C)C=C1 FIKAKWIAUPDISJ-UHFFFAOYSA-L 0.000 description 1
- 229920000570 polyether Polymers 0.000 description 1
- GWKKVWOEQGDUSY-UHFFFAOYSA-N pyridine;sodium Chemical compound [Na].C1=CC=NC=C1 GWKKVWOEQGDUSY-UHFFFAOYSA-N 0.000 description 1
- 150000004053 quinones Chemical class 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- BSYVTEYKTMYBMK-UHFFFAOYSA-N tetrahydrofurfuryl alcohol Chemical compound OCC1CCCO1 BSYVTEYKTMYBMK-UHFFFAOYSA-N 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/06—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom containing only hydrogen and carbon atoms in addition to the ring nitrogen atom
- C07D213/22—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom containing only hydrogen and carbon atoms in addition to the ring nitrogen atom containing two or more pyridine rings directly linked together, e.g. bipyridyl
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/68—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D211/70—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyridine Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB22774/65A GB1074994A (en) | 1965-05-28 | 1965-05-28 | Production of bipyridylium salts |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH496705A true CH496705A (de) | 1970-09-30 |
Family
ID=10184864
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH782766A CH496705A (de) | 1965-05-28 | 1966-05-31 | Verfahren zur Herstellung von Bipyridyliumsalzen |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US3491104A (enExample) |
| AT (1) | AT265258B (enExample) |
| BE (1) | BE681787A (enExample) |
| BR (1) | BR6679982D0 (enExample) |
| CH (1) | CH496705A (enExample) |
| DE (1) | DE1695245B2 (enExample) |
| DK (1) | DK119611B (enExample) |
| ES (1) | ES327223A1 (enExample) |
| GB (1) | GB1074994A (enExample) |
| IL (1) | IL25853A (enExample) |
| NL (2) | NL6607292A (enExample) |
| SE (1) | SE338047B (enExample) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3997708A (en) * | 1969-01-10 | 1976-12-14 | Phillips Petroleum Company | Organocalcium pyridine-type polymerization initiators |
| DE2811803A1 (de) * | 1978-03-15 | 1979-09-27 | Schering Ag | Verfahren zur herstellung von 4.4'-bipyridyl und dessen alkylderivaten |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1070504A (en) * | 1963-01-31 | 1967-06-01 | Ici Ltd | Herbicidal compositions |
| SE309742B (enExample) * | 1964-02-15 | 1969-03-31 | Dynamit Nobel Ag |
-
0
- NL NL131924D patent/NL131924C/xx active
-
1965
- 1965-05-28 GB GB22774/65A patent/GB1074994A/en not_active Expired
-
1966
- 1966-05-20 US US551532A patent/US3491104A/en not_active Expired - Lifetime
- 1966-05-25 DE DE1966J0030927 patent/DE1695245B2/de active Granted
- 1966-05-26 NL NL6607292A patent/NL6607292A/xx unknown
- 1966-05-26 IL IL25853A patent/IL25853A/xx unknown
- 1966-05-26 AT AT501366A patent/AT265258B/de active
- 1966-05-27 ES ES0327223A patent/ES327223A1/es not_active Expired
- 1966-05-27 SE SE07332/66A patent/SE338047B/xx unknown
- 1966-05-27 BE BE681787D patent/BE681787A/xx unknown
- 1966-05-27 DK DK275566AA patent/DK119611B/da unknown
- 1966-05-27 BR BR179982/66A patent/BR6679982D0/pt unknown
- 1966-05-31 CH CH782766A patent/CH496705A/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| BE681787A (enExample) | 1966-11-28 |
| BR6679982D0 (pt) | 1973-09-06 |
| DK119611B (da) | 1971-02-01 |
| NL6607292A (enExample) | 1966-11-29 |
| NL131924C (enExample) | |
| DE1695245B2 (de) | 1976-12-23 |
| GB1074994A (en) | 1967-07-05 |
| ES327223A1 (es) | 1967-09-01 |
| US3491104A (en) | 1970-01-20 |
| AT265258B (de) | 1968-10-10 |
| IL25853A (en) | 1970-08-19 |
| SE338047B (enExample) | 1971-08-30 |
| DE1695245A1 (de) | 1972-04-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH496705A (de) | Verfahren zur Herstellung von Bipyridyliumsalzen | |
| EP0305648B1 (de) | Verfahren zur Herstellung von 4,4'-Dinitrostilben-2,2'-disulfonsäure | |
| DE2922688C2 (de) | Verfahren zur Nitrosierung von Phenolen zu Benzochinonoximen | |
| DE3689764T2 (de) | Zwischenprodukte und Verfahren zu ihrer Herstellung. | |
| DE2902541C2 (enExample) | ||
| DE3326436C2 (enExample) | ||
| DE2415748A1 (de) | Verfahren zur herstellung von polyhalogenierten nicotinsaeuren | |
| DE2651371A1 (de) | Quaternaere ammoniumsalze | |
| DE1921957C3 (de) | Verfahren zur Herstellung von 1, l'-disubstituierten 4,4'-Bipyridy liumsalzen | |
| DE1545991C (de) | Verfahren zur Herstellung von herbici den Stoffen | |
| DE2256253C3 (de) | Verfahren zur Herstellung von Phthalimide- oder Cyclohexen-1,2-dicarboximidothionophosphaten | |
| DE1445918C (de) | Verfahren zur Herstellung von gegebenenfalls durch eine oder mehrere niedermolekulare Alkylgruppen substituierten Bipyridylen | |
| DE1961623C (de) | 2 (2 Butinyloxy) phenol | |
| DE4111214A1 (de) | Verfahren zur herstellung von 2-chlorpyridinen | |
| AT239243B (de) | Verfahren zur Herstellung von 2, 3-Dicyan-1, 4-dithia-anthrahydrochinon und -anthrachinon | |
| DE1296642B (de) | Verfahren zur Herstellung von ª, ªÏ-Diaminoalkancarbonsaeuren | |
| DE946802C (de) | Verfahren zur Herstellung von Verbindungen der Pyridinreihe | |
| DE2024983C3 (de) | Hydrogensulfate quaternärer Tetraalkylammoniumverbindungen, Verfahren zu deren Herstellung und deren Verwendung | |
| DE1919180C3 (de) | Substituierte Methylsulfensäureamide, Verfahren zu ihrer Herstellung und diese enthaltende Mittel | |
| AT354628B (de) | Verfahren zur debromierung von 11a-brom-6- demethyl-6-deoxy-6-methylen-5-oxytetracyclin- sulfosalicylat | |
| AT257602B (de) | Verfahren zur Herstellung eines N,N'-disubstituierten 4,4'-Dipyridyliumsalzes | |
| DE2518516C3 (de) | 2-(3,45-Trimethoxybenzyl)-3,4-dimethylpyridin | |
| DE2024805C3 (de) | Verfahren zur Herstellung von 2-Amino-3-chlorpyrazin | |
| CH647240A5 (de) | Verfahren zur herstellung von 2-oxo-dihydrobenzo(d)(1,3)-oxazinen und o-aminobenzylalkoholen. | |
| DE820303C (de) | Verfahren zur Herstellung organischer Saeuren sowie deren Ester |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased |