CA2743938A1 - Substituted isoindoles as bace inhibitors and their use - Google Patents
Substituted isoindoles as bace inhibitors and their use Download PDFInfo
- Publication number
- CA2743938A1 CA2743938A1 CA2743938A CA2743938A CA2743938A1 CA 2743938 A1 CA2743938 A1 CA 2743938A1 CA 2743938 A CA2743938 A CA 2743938A CA 2743938 A CA2743938 A CA 2743938A CA 2743938 A1 CA2743938 A1 CA 2743938A1
- Authority
- CA
- Canada
- Prior art keywords
- phenyl
- fluoro
- pyridyl
- 6alkyl
- isoindol
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Abandoned
Links
- 239000003112 inhibitor Substances 0.000 title description 17
- 150000002518 isoindoles Chemical class 0.000 title description 2
- 101150058765 BACE1 gene Proteins 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims abstract description 323
- 208000024827 Alzheimer disease Diseases 0.000 claims abstract description 121
- 206010012289 Dementia Diseases 0.000 claims abstract description 50
- 230000007170 pathology Effects 0.000 claims abstract description 44
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims abstract description 39
- 208000010877 cognitive disease Diseases 0.000 claims abstract description 36
- 201000010374 Down Syndrome Diseases 0.000 claims abstract description 21
- 206010044688 Trisomy 21 Diseases 0.000 claims abstract description 21
- 208000035475 disorder Diseases 0.000 claims abstract description 20
- 208000024891 symptom Diseases 0.000 claims abstract description 20
- 208000000044 Amnesia Diseases 0.000 claims abstract description 18
- 206010059245 Angiopathy Diseases 0.000 claims abstract description 18
- 208000005145 Cerebral amyloid angiopathy Diseases 0.000 claims abstract description 18
- 206010008111 Cerebral haemorrhage Diseases 0.000 claims abstract description 18
- 208000028698 Cognitive impairment Diseases 0.000 claims abstract description 18
- 208000026139 Memory disease Diseases 0.000 claims abstract description 18
- 208000018737 Parkinson disease Diseases 0.000 claims abstract description 18
- 206010036631 Presenile dementia Diseases 0.000 claims abstract description 18
- 206010039966 Senile dementia Diseases 0.000 claims abstract description 18
- 230000001054 cortical effect Effects 0.000 claims abstract description 18
- 230000006735 deficit Effects 0.000 claims abstract description 18
- 230000007850 degeneration Effects 0.000 claims abstract description 18
- 230000003412 degenerative effect Effects 0.000 claims abstract description 18
- 230000006984 memory degeneration Effects 0.000 claims abstract description 18
- 208000023060 memory loss Diseases 0.000 claims abstract description 18
- 208000027061 mild cognitive impairment Diseases 0.000 claims abstract description 18
- 230000004770 neurodegeneration Effects 0.000 claims abstract description 18
- 201000002212 progressive supranuclear palsy Diseases 0.000 claims abstract description 18
- 230000002792 vascular Effects 0.000 claims abstract description 18
- 239000008194 pharmaceutical composition Substances 0.000 claims abstract description 8
- -1 SO2R2 Chemical group 0.000 claims description 276
- 125000001072 heteroaryl group Chemical group 0.000 claims description 98
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims description 93
- 125000003118 aryl group Chemical group 0.000 claims description 89
- 229910052736 halogen Inorganic materials 0.000 claims description 76
- 150000003839 salts Chemical class 0.000 claims description 73
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 53
- 150000002367 halogens Chemical class 0.000 claims description 49
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 48
- 125000004076 pyridyl group Chemical group 0.000 claims description 48
- 125000000623 heterocyclic group Chemical group 0.000 claims description 44
- 229910052739 hydrogen Inorganic materials 0.000 claims description 41
- 239000001257 hydrogen Substances 0.000 claims description 41
- 238000000034 method Methods 0.000 claims description 40
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 38
- 125000005843 halogen group Chemical group 0.000 claims description 35
- 125000004528 pyrimidin-5-yl group Chemical group N1=CN=CC(=C1)* 0.000 claims description 32
- 125000000714 pyrimidinyl group Chemical group 0.000 claims description 32
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 claims description 31
- 125000003601 C2-C6 alkynyl group Chemical group 0.000 claims description 29
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 claims description 27
- 125000004452 carbocyclyl group Chemical group 0.000 claims description 25
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 claims description 22
- 239000003814 drug Substances 0.000 claims description 22
- 239000003795 chemical substances by application Substances 0.000 claims description 21
- 241000124008 Mammalia Species 0.000 claims description 20
- 125000004429 atom Chemical group 0.000 claims description 19
- 241000282414 Homo sapiens Species 0.000 claims description 17
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 claims description 16
- 125000000171 (C1-C6) haloalkyl group Chemical group 0.000 claims description 15
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 claims description 12
- 125000001028 difluoromethyl group Chemical group [H]C(F)(F)* 0.000 claims description 11
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 11
- 230000037411 cognitive enhancing Effects 0.000 claims description 10
- 125000001153 fluoro group Chemical group F* 0.000 claims description 10
- 230000006883 memory enhancing effect Effects 0.000 claims description 10
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 10
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims description 9
- 229940122601 Esterase inhibitor Drugs 0.000 claims description 7
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 7
- OEYIOHPDSNJKLS-UHFFFAOYSA-N choline Chemical compound C[N+](C)(C)CCO OEYIOHPDSNJKLS-UHFFFAOYSA-N 0.000 claims description 7
- 229960001231 choline Drugs 0.000 claims description 7
- 239000002329 esterase inhibitor Substances 0.000 claims description 7
- LTTXOTLFLGNIEX-UHFFFAOYSA-N 7-fluoro-3-[4-fluoro-3-(2-fluoro-3-methoxyphenyl)phenyl]-3-pyrimidin-5-ylisoindol-1-amine Chemical compound COC1=CC=CC(C=2C(=CC=C(C=2)C2(C3=C(C(=CC=C3)F)C(N)=N2)C=2C=NC=NC=2)F)=C1F LTTXOTLFLGNIEX-UHFFFAOYSA-N 0.000 claims description 5
- JCXJVPUVTGWSNB-UHFFFAOYSA-N Nitrogen dioxide Chemical group O=[N]=O JCXJVPUVTGWSNB-UHFFFAOYSA-N 0.000 claims description 5
- 239000012458 free base Substances 0.000 claims description 5
- MRXBCEQZNKUUIP-UHFFFAOYSA-N 3-[2-(difluoromethyl)pyridin-4-yl]-7-fluoro-3-(3-pyrimidin-5-ylphenyl)isoindol-1-amine Chemical compound C12=CC=CC(F)=C2C(N)=NC1(C=1C=C(N=CC=1)C(F)F)C(C=1)=CC=CC=1C1=CN=CN=C1 MRXBCEQZNKUUIP-UHFFFAOYSA-N 0.000 claims description 4
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 claims description 4
- JTYGZAPMRYLRCN-UHFFFAOYSA-N 7-fluoro-3-pyridin-4-yl-3-(3-pyrimidin-5-ylphenyl)isoindol-1-amine Chemical compound C12=CC=CC(F)=C2C(N)=NC1(C=1C=C(C=CC=1)C=1C=NC=NC=1)C1=CC=NC=C1 JTYGZAPMRYLRCN-UHFFFAOYSA-N 0.000 claims description 4
- 239000004480 active ingredient Substances 0.000 claims description 4
- 239000003085 diluting agent Substances 0.000 claims description 4
- 239000003937 drug carrier Substances 0.000 claims description 4
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 4
- 125000004527 pyrimidin-4-yl group Chemical group N1=CN=C(C=C1)* 0.000 claims description 4
- UDQUVXUVXUGJFO-QHCPKHFHSA-N (3s)-7-fluoro-3-(4-fluoro-3-pyrimidin-5-ylphenyl)-3-[2-(trifluoromethyl)pyridin-4-yl]isoindol-1-amine Chemical compound C1([C@@]2(N=C(C3=C(F)C=CC=C32)N)C=2C=C(C(F)=CC=2)C=2C=NC=NC=2)=CC=NC(C(F)(F)F)=C1 UDQUVXUVXUGJFO-QHCPKHFHSA-N 0.000 claims description 3
- KGVYPOMYHHXUNY-UHFFFAOYSA-N 3-(2-cyclopropylpyridin-4-yl)-7-fluoro-3-(2-pyrimidin-5-ylpyridin-4-yl)isoindol-1-amine Chemical compound C12=CC=CC(F)=C2C(N)=NC1(C=1C=C(N=CC=1)C=1C=NC=NC=1)C(C=1)=CC=NC=1C1CC1 KGVYPOMYHHXUNY-UHFFFAOYSA-N 0.000 claims description 3
- LDZVCIKKJQWJSC-UHFFFAOYSA-N 3-(3,4-difluoro-5-methoxyphenyl)-7-fluoro-3-(3-pyrimidin-5-ylphenyl)isoindol-1-amine Chemical compound FC1=C(F)C(OC)=CC(C2(C3=C(C(=CC=C3)F)C(N)=N2)C=2C=C(C=CC=2)C=2C=NC=NC=2)=C1 LDZVCIKKJQWJSC-UHFFFAOYSA-N 0.000 claims description 3
- ILXLQBORVUPKNC-UHFFFAOYSA-N 3-[2-(difluoromethyl)-6-methylpyridin-4-yl]-7-fluoro-3-(2-pyrimidin-5-ylpyridin-4-yl)isoindol-1-amine Chemical compound FC(F)C1=NC(C)=CC(C2(C3=C(C(=CC=C3)F)C(N)=N2)C=2C=C(N=CC=2)C=2C=NC=NC=2)=C1 ILXLQBORVUPKNC-UHFFFAOYSA-N 0.000 claims description 3
- YCGBLIMDVQUJHP-UHFFFAOYSA-N 3-[2-(difluoromethyl)-6-methylpyridin-4-yl]-7-fluoro-3-(3-pyrimidin-5-ylphenyl)isoindol-1-amine Chemical compound FC(F)C1=NC(C)=CC(C2(C3=C(C(=CC=C3)F)C(N)=N2)C=2C=C(C=CC=2)C=2C=NC=NC=2)=C1 YCGBLIMDVQUJHP-UHFFFAOYSA-N 0.000 claims description 3
- RQXMMNVOTVVZLE-UHFFFAOYSA-N 3-[3-(3-chlorophenyl)phenyl]-7-fluoro-3-pyridin-4-ylisoindol-1-amine Chemical compound C12=CC=CC(F)=C2C(N)=NC1(C=1C=C(C=CC=1)C=1C=C(Cl)C=CC=1)C1=CC=NC=C1 RQXMMNVOTVVZLE-UHFFFAOYSA-N 0.000 claims description 3
- KARKUCIOHOGNGJ-UHFFFAOYSA-N 5-[3-[3-amino-1-(2,6-dimethylpyridin-4-yl)-4-fluoroisoindol-1-yl]phenyl]pyridine-3-carbonitrile Chemical compound CC1=NC(C)=CC(C2(C3=C(C(=CC=C3)F)C(N)=N2)C=2C=C(C=CC=2)C=2C=C(C=NC=2)C#N)=C1 KARKUCIOHOGNGJ-UHFFFAOYSA-N 0.000 claims description 3
- IBKUXOABAPJTJV-UHFFFAOYSA-N 5-[3-[3-amino-4-fluoro-1-(2-methylpyridin-4-yl)isoindol-1-yl]-4-fluorophenyl]pyridine-3-carbonitrile Chemical compound C1=NC(C)=CC(C2(C3=C(C(=CC=C3)F)C(N)=N2)C=2C(=CC=C(C=2)C=2C=C(C=NC=2)C#N)F)=C1 IBKUXOABAPJTJV-UHFFFAOYSA-N 0.000 claims description 3
- YFSROEJZFCNGBG-UHFFFAOYSA-N 5-[3-amino-4-fluoro-1-(3-pyrimidin-5-ylphenyl)isoindol-1-yl]-2-methoxy-3-methylbenzonitrile Chemical compound C1=C(C#N)C(OC)=C(C)C=C1C1(C=2C=C(C=CC=2)C=2C=NC=NC=2)C(C=CC=C2F)=C2C(N)=N1 YFSROEJZFCNGBG-UHFFFAOYSA-N 0.000 claims description 3
- JOAINBRZFKXAKE-UHFFFAOYSA-N 5-[3-amino-4-fluoro-1-(3-pyrimidin-5-ylphenyl)isoindol-1-yl]-2-methoxybenzonitrile Chemical compound C1=C(C#N)C(OC)=CC=C1C1(C=2C=C(C=CC=2)C=2C=NC=NC=2)C(C=CC=C2F)=C2C(N)=N1 JOAINBRZFKXAKE-UHFFFAOYSA-N 0.000 claims description 3
- BQQVKWIMNRWXPB-UHFFFAOYSA-N 5-[5-(3-amino-4-fluoro-1-pyridin-4-ylisoindol-1-yl)-2-fluorophenyl]pyridine-3-carbonitrile Chemical compound C12=CC=CC(F)=C2C(N)=NC1(C=1C=C(C(F)=CC=1)C=1C=C(C=NC=1)C#N)C1=CC=NC=C1 BQQVKWIMNRWXPB-UHFFFAOYSA-N 0.000 claims description 3
- SZNCXZSQMMXATG-UHFFFAOYSA-N 5-chloro-7-fluoro-3-(2-methylpyridin-4-yl)-3-(3-pyrimidin-5-ylphenyl)isoindol-1-amine Chemical compound C1=NC(C)=CC(C2(C3=C(C(=CC(Cl)=C3)F)C(N)=N2)C=2C=C(C=CC=2)C=2C=NC=NC=2)=C1 SZNCXZSQMMXATG-UHFFFAOYSA-N 0.000 claims description 3
- VHTMYWKRQDERJA-UHFFFAOYSA-N 5-chloro-7-fluoro-3-(3-pyrimidin-5-ylphenyl)-3-[2-(trifluoromethyl)pyridin-4-yl]isoindol-1-amine Chemical compound C12=CC(Cl)=CC(F)=C2C(N)=NC1(C=1C=C(N=CC=1)C(F)(F)F)C(C=1)=CC=CC=1C1=CN=CN=C1 VHTMYWKRQDERJA-UHFFFAOYSA-N 0.000 claims description 3
- JQEPDWJPVSFHIP-UHFFFAOYSA-N 7-fluoro-3-(2-fluoro-5-pyridin-3-ylphenyl)-3-(2-methylpyridin-4-yl)isoindol-1-amine Chemical compound C1=NC(C)=CC(C2(C3=C(C(=CC=C3)F)C(N)=N2)C=2C(=CC=C(C=2)C=2C=NC=CC=2)F)=C1 JQEPDWJPVSFHIP-UHFFFAOYSA-N 0.000 claims description 3
- OCBQROJLCLXSKK-UHFFFAOYSA-N 7-fluoro-3-(2-fluoro-5-pyrimidin-5-ylphenyl)-3-(2-methylpyridin-4-yl)isoindol-1-amine Chemical compound C1=NC(C)=CC(C2(C3=C(C(=CC=C3)F)C(N)=N2)C=2C(=CC=C(C=2)C=2C=NC=NC=2)F)=C1 OCBQROJLCLXSKK-UHFFFAOYSA-N 0.000 claims description 3
- JPPFOTMIISPHLL-UHFFFAOYSA-N 7-fluoro-3-(2-fluoro-5-pyrimidin-5-ylphenyl)-3-[2-(trifluoromethyl)pyridin-4-yl]isoindol-1-amine Chemical compound C12=CC=CC(F)=C2C(N)=NC1(C=1C(=CC=C(C=1)C=1C=NC=NC=1)F)C1=CC=NC(C(F)(F)F)=C1 JPPFOTMIISPHLL-UHFFFAOYSA-N 0.000 claims description 3
- VUZSNSMEUFXECY-UHFFFAOYSA-N 7-fluoro-3-(2-methoxypyridin-4-yl)-3-(3-pyrazin-2-ylphenyl)isoindol-1-amine Chemical compound C1=NC(OC)=CC(C2(C3=C(C(=CC=C3)F)C(N)=N2)C=2C=C(C=CC=2)C=2N=CC=NC=2)=C1 VUZSNSMEUFXECY-UHFFFAOYSA-N 0.000 claims description 3
- KJPBADHCKFUMIL-UHFFFAOYSA-N 7-fluoro-3-(3-pyrimidin-5-ylphenyl)-3-[2-(trifluoromethyl)pyridin-4-yl]isoindol-1-amine Chemical compound C12=CC=CC(F)=C2C(N)=NC1(C=1C=C(N=CC=1)C(F)(F)F)C(C=1)=CC=CC=1C1=CN=CN=C1 KJPBADHCKFUMIL-UHFFFAOYSA-N 0.000 claims description 3
- LAYVJEWHRVBQSK-UHFFFAOYSA-N 7-fluoro-3-(4-fluoro-3-pyrimidin-5-ylphenyl)-3-(2-methoxypyridin-4-yl)isoindol-1-amine Chemical compound C1=NC(OC)=CC(C2(C3=C(C(=CC=C3)F)C(N)=N2)C=2C=C(C(F)=CC=2)C=2C=NC=NC=2)=C1 LAYVJEWHRVBQSK-UHFFFAOYSA-N 0.000 claims description 3
- UDQUVXUVXUGJFO-UHFFFAOYSA-N 7-fluoro-3-(4-fluoro-3-pyrimidin-5-ylphenyl)-3-[2-(trifluoromethyl)pyridin-4-yl]isoindol-1-amine Chemical compound C12=CC=CC(F)=C2C(N)=NC1(C=1C=C(C(F)=CC=1)C=1C=NC=NC=1)C1=CC=NC(C(F)(F)F)=C1 UDQUVXUVXUGJFO-UHFFFAOYSA-N 0.000 claims description 3
- HNKSCDQWGAJNMX-UHFFFAOYSA-N 7-fluoro-3-(4-fluoro-3-pyrimidin-5-ylphenyl)-3-pyridin-4-ylisoindol-1-amine Chemical compound C12=CC=CC(F)=C2C(N)=NC1(C=1C=C(C(F)=CC=1)C=1C=NC=NC=1)C1=CC=NC=C1 HNKSCDQWGAJNMX-UHFFFAOYSA-N 0.000 claims description 3
- AUBWOOMBEPBCKT-UHFFFAOYSA-N 7-fluoro-3-(4-methoxy-3,5-dimethylphenyl)-3-(2-pyrimidin-5-ylpyridin-4-yl)isoindol-1-amine Chemical compound C1=C(C)C(OC)=C(C)C=C1C1(C=2C=C(N=CC=2)C=2C=NC=NC=2)C(C=CC=C2F)=C2C(N)=N1 AUBWOOMBEPBCKT-UHFFFAOYSA-N 0.000 claims description 3
- SMSWJWMOZMPDKT-UHFFFAOYSA-N 7-fluoro-3-(4-methoxyphenyl)-3-(3-pyrimidin-5-ylphenyl)isoindol-1-amine Chemical compound C1=CC(OC)=CC=C1C1(C=2C=C(C=CC=2)C=2C=NC=NC=2)C(C=CC=C2F)=C2C(N)=N1 SMSWJWMOZMPDKT-UHFFFAOYSA-N 0.000 claims description 3
- SJVWTQHVLJCMFZ-UHFFFAOYSA-N 7-fluoro-3-(5-methoxy-4,6-dimethylpyridin-2-yl)-3-(2-pyrimidin-5-ylpyridin-4-yl)isoindol-1-amine Chemical compound N1=C(C)C(OC)=C(C)C=C1C1(C=2C=C(N=CC=2)C=2C=NC=NC=2)C(C=CC=C2F)=C2C(N)=N1 SJVWTQHVLJCMFZ-UHFFFAOYSA-N 0.000 claims description 3
- DJUIWDIVXGOXBA-UHFFFAOYSA-N 7-fluoro-3-(5-methoxy-4,6-dimethylpyridin-2-yl)-3-(3-pyrimidin-5-ylphenyl)isoindol-1-amine Chemical compound N1=C(C)C(OC)=C(C)C=C1C1(C=2C=C(C=CC=2)C=2C=NC=NC=2)C(C=CC=C2F)=C2C(N)=N1 DJUIWDIVXGOXBA-UHFFFAOYSA-N 0.000 claims description 3
- UIZDKBAPUDYRSG-UHFFFAOYSA-N 7-fluoro-3-[2-fluoro-5-(5-fluoropyridin-3-yl)phenyl]-3-(2-methylpyridin-4-yl)isoindol-1-amine Chemical compound C1=NC(C)=CC(C2(C3=C(C(=CC=C3)F)C(N)=N2)C=2C(=CC=C(C=2)C=2C=C(F)C=NC=2)F)=C1 UIZDKBAPUDYRSG-UHFFFAOYSA-N 0.000 claims description 3
- MGWNWXUQKGQHIA-UHFFFAOYSA-N 7-fluoro-3-[2-fluoro-5-(5-methylsulfonylpyridin-3-yl)phenyl]-3-[2-(trifluoromethyl)pyridin-4-yl]isoindol-1-amine Chemical compound CS(=O)(=O)C1=CN=CC(C=2C=C(C(F)=CC=2)C2(C3=C(C(=CC=C3)F)C(N)=N2)C=2C=C(N=CC=2)C(F)(F)F)=C1 MGWNWXUQKGQHIA-UHFFFAOYSA-N 0.000 claims description 3
- XZSIDTPFYUFTSR-UHFFFAOYSA-N 7-fluoro-3-[3-(2-fluoro-3-methoxyphenyl)phenyl]-3-pyridin-4-ylisoindol-1-amine Chemical compound COC1=CC=CC(C=2C=C(C=CC=2)C2(C3=C(C(=CC=C3)F)C(N)=N2)C=2C=CN=CC=2)=C1F XZSIDTPFYUFTSR-UHFFFAOYSA-N 0.000 claims description 3
- HLWMPHXAKRXVIS-UHFFFAOYSA-N 7-fluoro-3-[3-(5-fluoropyridin-3-yl)phenyl]-3-pyridin-4-ylisoindol-1-amine Chemical compound C12=CC=CC(F)=C2C(N)=NC1(C=1C=C(C=CC=1)C=1C=C(F)C=NC=1)C1=CC=NC=C1 HLWMPHXAKRXVIS-UHFFFAOYSA-N 0.000 claims description 3
- FURYISBFUICYBU-UHFFFAOYSA-N 7-fluoro-3-[4-fluoro-3-(4-methoxypyridin-2-yl)phenyl]-3-pyrimidin-5-ylisoindol-1-amine Chemical compound COC1=CC=NC(C=2C(=CC=C(C=2)C2(C3=C(C(=CC=C3)F)C(N)=N2)C=2C=NC=NC=2)F)=C1 FURYISBFUICYBU-UHFFFAOYSA-N 0.000 claims description 3
- MRXBCEQZNKUUIP-DEOSSOPVSA-N (3s)-3-[2-(difluoromethyl)pyridin-4-yl]-7-fluoro-3-(3-pyrimidin-5-ylphenyl)isoindol-1-amine Chemical compound C=1C([C@]2(N=C(C3=C(F)C=CC=C32)N)C=2C=C(N=CC=2)C(F)F)=CC=CC=1C1=CN=CN=C1 MRXBCEQZNKUUIP-DEOSSOPVSA-N 0.000 claims description 2
- JTYGZAPMRYLRCN-HSZRJFAPSA-N (3s)-7-fluoro-3-pyridin-4-yl-3-(3-pyrimidin-5-ylphenyl)isoindol-1-amine Chemical compound C1([C@@]2(N=C(C3=C(F)C=CC=C32)N)C=2C=C(C=CC=2)C=2C=NC=NC=2)=CC=NC=C1 JTYGZAPMRYLRCN-HSZRJFAPSA-N 0.000 claims description 2
- PXITVWWTDHUDOP-UHFFFAOYSA-N 2-[3-[3-amino-4-fluoro-1-(2-methoxypyridin-4-yl)isoindol-1-yl]phenyl]pyridine-4-carbonitrile Chemical compound C1=NC(OC)=CC(C2(C3=C(C(=CC=C3)F)C(N)=N2)C=2C=C(C=CC=2)C=2N=CC=C(C=2)C#N)=C1 PXITVWWTDHUDOP-UHFFFAOYSA-N 0.000 claims description 2
- IRZCDBOHKLZNFD-UHFFFAOYSA-N 2-[5-[3-amino-4-fluoro-1-(3-pyrimidin-5-ylphenyl)isoindol-1-yl]-2-methoxy-3-methylphenyl]acetonitrile Chemical compound C1=C(CC#N)C(OC)=C(C)C=C1C1(C=2C=C(C=CC=2)C=2C=NC=NC=2)C(C=CC=C2F)=C2C(N)=N1 IRZCDBOHKLZNFD-UHFFFAOYSA-N 0.000 claims description 2
- CJEIMBHNYRNICW-UHFFFAOYSA-N 3-(2,6-dimethylpyrimidin-4-yl)-7-fluoro-3-(3-pyrimidin-5-ylphenyl)isoindol-1-amine Chemical compound CC1=NC(C)=CC(C2(C3=C(C(=CC=C3)F)C(N)=N2)C=2C=C(C=CC=2)C=2C=NC=NC=2)=N1 CJEIMBHNYRNICW-UHFFFAOYSA-N 0.000 claims description 2
- QTHLBLQVGADVQB-UHFFFAOYSA-N 3-(2-cyclopropylpyridin-4-yl)-7-fluoro-3-(3-pyrazin-2-ylphenyl)isoindol-1-amine;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.C12=CC=CC(F)=C2C(N)=NC1(C=1C=C(N=CC=1)C1CC1)C(C=1)=CC=CC=1C1=CN=CC=N1 QTHLBLQVGADVQB-UHFFFAOYSA-N 0.000 claims description 2
- HLZIYZMSCOXBTI-UHFFFAOYSA-N 3-(2-cyclopropylpyridin-4-yl)-7-fluoro-3-(3-pyrimidin-5-ylphenyl)isoindol-1-amine Chemical compound C12=CC=CC(F)=C2C(N)=NC1(C=1C=C(C=CC=1)C=1C=NC=NC=1)C(C=1)=CC=NC=1C1CC1 HLZIYZMSCOXBTI-UHFFFAOYSA-N 0.000 claims description 2
- GKEMYVAIQCCEOA-UHFFFAOYSA-N 3-[2-(difluoromethyl)pyridin-4-yl]-7-fluoro-3-(2-pyrimidin-5-ylpyridin-4-yl)isoindol-1-amine Chemical compound C12=CC=CC(F)=C2C(N)=NC1(C=1C=C(N=CC=1)C=1C=NC=NC=1)C1=CC=NC(C(F)F)=C1 GKEMYVAIQCCEOA-UHFFFAOYSA-N 0.000 claims description 2
- WFGUJCYKTXOJNJ-UHFFFAOYSA-N 3-[5-(difluoromethoxy)-4,6-dimethylpyridin-2-yl]-7-fluoro-3-[2-(5-fluoropyridin-3-yl)pyridin-4-yl]isoindol-1-amine Chemical compound CC1=C(OC(F)F)C(C)=CC(C2(C3=C(C(=CC=C3)F)C(N)=N2)C=2C=C(N=CC=2)C=2C=C(F)C=NC=2)=N1 WFGUJCYKTXOJNJ-UHFFFAOYSA-N 0.000 claims description 2
- OSHCTQXVTOPUFG-UHFFFAOYSA-N 4-[3-amino-4-fluoro-1-[2-(trifluoromethyl)pyridin-4-yl]isoindol-1-yl]-2-pyrazin-2-ylphenol Chemical compound C12=CC=CC(F)=C2C(N)=NC1(C=1C=C(C(O)=CC=1)C=1N=CC=NC=1)C1=CC=NC(C(F)(F)F)=C1 OSHCTQXVTOPUFG-UHFFFAOYSA-N 0.000 claims description 2
- ABQKMSJSHIBKEW-UHFFFAOYSA-N 5-[3-[3-amino-4-fluoro-1-(2-methoxypyridin-4-yl)isoindol-1-yl]phenyl]pyridine-3-carbonitrile Chemical compound C1=NC(OC)=CC(C2(C3=C(C(=CC=C3)F)C(N)=N2)C=2C=C(C=CC=2)C=2C=C(C=NC=2)C#N)=C1 ABQKMSJSHIBKEW-UHFFFAOYSA-N 0.000 claims description 2
- IXJQLRGQVCIKGQ-UHFFFAOYSA-N 5-[3-[3-amino-4-fluoro-1-[2-(trifluoromethyl)pyridin-4-yl]isoindol-1-yl]-4-fluorophenyl]pyridine-3-carbonitrile Chemical compound C12=CC=CC(F)=C2C(N)=NC1(C=1C(=CC=C(C=1)C=1C=C(C=NC=1)C#N)F)C1=CC=NC(C(F)(F)F)=C1 IXJQLRGQVCIKGQ-UHFFFAOYSA-N 0.000 claims description 2
- LWWIAXXIXLRNGA-UHFFFAOYSA-N 5-[3-[3-amino-4-fluoro-1-[2-(trifluoromethyl)pyridin-4-yl]isoindol-1-yl]phenyl]pyridine-3-carbonitrile Chemical compound C12=CC=CC(F)=C2C(N)=NC1(C=1C=C(N=CC=1)C(F)(F)F)C(C=1)=CC=CC=1C1=CN=CC(C#N)=C1 LWWIAXXIXLRNGA-UHFFFAOYSA-N 0.000 claims description 2
- OJAQXSAISVSZNQ-UHFFFAOYSA-N 7-fluoro-3-(2-methoxypyridin-4-yl)-3-(3-pyrimidin-5-ylphenyl)isoindol-1-amine Chemical compound C1=NC(OC)=CC(C2(C3=C(C(=CC=C3)F)C(N)=N2)C=2C=C(C=CC=2)C=2C=NC=NC=2)=C1 OJAQXSAISVSZNQ-UHFFFAOYSA-N 0.000 claims description 2
- FBOVXQYTSORFCQ-UHFFFAOYSA-N 7-fluoro-3-(2-methoxypyridin-4-yl)-3-[3-(4-methoxypyridin-2-yl)phenyl]isoindol-1-amine Chemical compound COC1=CC=NC(C=2C=C(C=CC=2)C2(C3=C(C(=CC=C3)F)C(N)=N2)C=2C=C(OC)N=CC=2)=C1 FBOVXQYTSORFCQ-UHFFFAOYSA-N 0.000 claims description 2
- BFFLVDCVWYROAY-UHFFFAOYSA-N 7-fluoro-3-(3-fluoro-4-methoxy-5-methylphenyl)-3-(2-pyrimidin-5-ylpyridin-4-yl)isoindol-1-amine Chemical compound C1=C(F)C(OC)=C(C)C=C1C1(C=2C=C(N=CC=2)C=2C=NC=NC=2)C(C=CC=C2F)=C2C(N)=N1 BFFLVDCVWYROAY-UHFFFAOYSA-N 0.000 claims description 2
- OASJLOBJAWKJLW-UHFFFAOYSA-N 7-fluoro-3-(3-pyrazin-2-ylphenyl)-3-[2-(trifluoromethyl)pyridin-4-yl]isoindol-1-amine Chemical compound C12=CC=CC(F)=C2C(N)=NC1(C=1C=C(N=CC=1)C(F)(F)F)C(C=1)=CC=CC=1C1=CN=CC=N1 OASJLOBJAWKJLW-UHFFFAOYSA-N 0.000 claims description 2
- KYQCOXFCLRTKLS-UHFFFAOYSA-N Pyrazine Chemical compound C1=CN=CC=N1 KYQCOXFCLRTKLS-UHFFFAOYSA-N 0.000 claims description 2
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 claims description 2
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 claims 30
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 7
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 claims 3
- 125000006583 (C1-C3) haloalkyl group Chemical group 0.000 claims 3
- ZLJNYOGNQBCSPZ-UHFFFAOYSA-N 5-[5-[3-amino-4-fluoro-1-[2-(trifluoromethyl)pyridin-4-yl]isoindol-1-yl]-2-fluorophenyl]pyridine-3-carbonitrile Chemical compound C12=CC=CC(F)=C2C(N)=NC1(C=1C=C(C(F)=CC=1)C=1C=C(C=NC=1)C#N)C1=CC=NC(C(F)(F)F)=C1 ZLJNYOGNQBCSPZ-UHFFFAOYSA-N 0.000 claims 1
- JZSUZGNJXWXUQC-UHFFFAOYSA-N 7-fluoro-3-(4-methoxy-3-pyrimidin-5-ylphenyl)-3-[2-(trifluoromethyl)pyridin-4-yl]isoindol-1-amine Chemical compound COC1=CC=C(C2(C3=C(C(=CC=C3)F)C(N)=N2)C=2C=C(N=CC=2)C(F)(F)F)C=C1C1=CN=CN=C1 JZSUZGNJXWXUQC-UHFFFAOYSA-N 0.000 claims 1
- DCCOJOUQUIVBIQ-UHFFFAOYSA-N 7-fluoro-3-[6-methoxy-5-(trifluoromethyl)pyridin-3-yl]-3-(3-pyrimidin-5-ylphenyl)isoindol-1-amine Chemical compound C1=C(C(F)(F)F)C(OC)=NC=C1C1(C=2C=C(C=CC=2)C=2C=NC=NC=2)C(C=CC=C2F)=C2C(N)=N1 DCCOJOUQUIVBIQ-UHFFFAOYSA-N 0.000 claims 1
- 238000002560 therapeutic procedure Methods 0.000 abstract description 22
- 238000011282 treatment Methods 0.000 abstract description 20
- 201000010099 disease Diseases 0.000 abstract description 19
- 230000002265 prevention Effects 0.000 abstract description 2
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 166
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 158
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 143
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 126
- 239000000203 mixture Substances 0.000 description 111
- 238000000524 positive electrospray ionisation mass spectrometry Methods 0.000 description 104
- 238000005481 NMR spectroscopy Methods 0.000 description 59
- 239000000243 solution Substances 0.000 description 58
- 235000019439 ethyl acetate Nutrition 0.000 description 57
- 239000011541 reaction mixture Substances 0.000 description 53
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 53
- 229910001868 water Inorganic materials 0.000 description 52
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 48
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 44
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 42
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 42
- 238000005160 1H NMR spectroscopy Methods 0.000 description 41
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 41
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 40
- 101150041968 CDC13 gene Proteins 0.000 description 39
- 238000006243 chemical reaction Methods 0.000 description 39
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 38
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 38
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical class CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 36
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 31
- 229910052938 sodium sulfate Inorganic materials 0.000 description 31
- 235000011152 sodium sulphate Nutrition 0.000 description 31
- 239000002207 metabolite Substances 0.000 description 28
- 230000002829 reductive effect Effects 0.000 description 27
- 239000007832 Na2SO4 Substances 0.000 description 26
- 238000002953 preparative HPLC Methods 0.000 description 25
- HZFPPBMKGYINDF-UHFFFAOYSA-N pyrimidin-5-ylboronic acid Chemical compound OB(O)C1=CN=CN=C1 HZFPPBMKGYINDF-UHFFFAOYSA-N 0.000 description 25
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 24
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 24
- 102100021257 Beta-secretase 1 Human genes 0.000 description 23
- 238000000746 purification Methods 0.000 description 23
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 22
- 101000894895 Homo sapiens Beta-secretase 1 Proteins 0.000 description 21
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 21
- 125000004432 carbon atom Chemical group C* 0.000 description 21
- 238000001819 mass spectrum Methods 0.000 description 19
- 239000012071 phase Substances 0.000 description 19
- 235000017557 sodium bicarbonate Nutrition 0.000 description 19
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 19
- 239000002904 solvent Substances 0.000 description 19
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 18
- NXQGGXCHGDYOHB-UHFFFAOYSA-L cyclopenta-1,4-dien-1-yl(diphenyl)phosphane;dichloropalladium;iron(2+) Chemical compound [Fe+2].Cl[Pd]Cl.[CH-]1C=CC(P(C=2C=CC=CC=2)C=2C=CC=CC=2)=C1.[CH-]1C=CC(P(C=2C=CC=CC=2)C=2C=CC=CC=2)=C1 NXQGGXCHGDYOHB-UHFFFAOYSA-L 0.000 description 18
- NFHFRUOZVGFOOS-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 18
- 229920006395 saturated elastomer Polymers 0.000 description 18
- 238000003818 flash chromatography Methods 0.000 description 17
- 229910052757 nitrogen Inorganic materials 0.000 description 17
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 17
- 239000012044 organic layer Substances 0.000 description 17
- 239000000047 product Substances 0.000 description 17
- 239000012267 brine Substances 0.000 description 16
- 239000012074 organic phase Substances 0.000 description 16
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 16
- 239000012300 argon atmosphere Substances 0.000 description 15
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 15
- 229910000027 potassium carbonate Inorganic materials 0.000 description 14
- 239000000741 silica gel Substances 0.000 description 14
- 229910002027 silica gel Inorganic materials 0.000 description 14
- 229960004132 diethyl ether Drugs 0.000 description 13
- JMPUYSJSMKSCNC-UHFFFAOYSA-N n-[(3-bromophenyl)-(2-cyano-3-fluorophenyl)methylidene]-2-methylpropane-2-sulfinamide Chemical compound C=1C=CC(F)=C(C#N)C=1C(=NS(=O)C(C)(C)C)C1=CC=CC(Br)=C1 JMPUYSJSMKSCNC-UHFFFAOYSA-N 0.000 description 13
- 239000003643 water by type Substances 0.000 description 13
- UGJMXCAKCUNAIE-UHFFFAOYSA-N Gabapentin Chemical compound OC(=O)CC1(CN)CCCCC1 UGJMXCAKCUNAIE-UHFFFAOYSA-N 0.000 description 12
- 229910000069 nitrogen hydride Inorganic materials 0.000 description 12
- 125000001424 substituent group Chemical group 0.000 description 12
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 11
- 229910052796 boron Inorganic materials 0.000 description 11
- 238000001816 cooling Methods 0.000 description 11
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 10
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 10
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 10
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 10
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 10
- 210000004027 cell Anatomy 0.000 description 10
- 230000000694 effects Effects 0.000 description 10
- 238000004519 manufacturing process Methods 0.000 description 10
- KVWDHTXUZHCGIO-UHFFFAOYSA-N olanzapine Chemical compound C1CN(C)CCN1C1=NC2=CC=CC=C2NC2=C1C=C(C)S2 KVWDHTXUZHCGIO-UHFFFAOYSA-N 0.000 description 10
- 235000011181 potassium carbonates Nutrition 0.000 description 10
- 239000000377 silicon dioxide Substances 0.000 description 10
- 238000004293 19F NMR spectroscopy Methods 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 125000000217 alkyl group Chemical group 0.000 description 9
- FJDQFPXHSGXQBY-UHFFFAOYSA-L caesium carbonate Chemical compound [Cs+].[Cs+].[O-]C([O-])=O FJDQFPXHSGXQBY-UHFFFAOYSA-L 0.000 description 9
- 229910000024 caesium carbonate Inorganic materials 0.000 description 9
- 239000000706 filtrate Substances 0.000 description 9
- UBJFKNSINUCEAL-UHFFFAOYSA-N lithium;2-methylpropane Chemical compound [Li+].C[C-](C)C UBJFKNSINUCEAL-UHFFFAOYSA-N 0.000 description 9
- 239000000523 sample Substances 0.000 description 9
- XVCYODCCYCPADG-UHFFFAOYSA-N 2-(2-aminoethyldisulfanyl)ethanamine;sulfuric acid Chemical compound OS(O)(=O)=O.NCCSSCCN XVCYODCCYCPADG-UHFFFAOYSA-N 0.000 description 8
- USFZMSVCRYTOJT-UHFFFAOYSA-N Ammonium acetate Chemical compound N.CC(O)=O USFZMSVCRYTOJT-UHFFFAOYSA-N 0.000 description 8
- 102000004190 Enzymes Human genes 0.000 description 8
- 108090000790 Enzymes Proteins 0.000 description 8
- 150000001204 N-oxides Chemical class 0.000 description 8
- 238000000065 atmospheric pressure chemical ionisation Methods 0.000 description 8
- ADEBPBSSDYVVLD-UHFFFAOYSA-N donepezil Chemical compound O=C1C=2C=C(OC)C(OC)=CC=2CC1CC(CC1)CCN1CC1=CC=CC=C1 ADEBPBSSDYVVLD-UHFFFAOYSA-N 0.000 description 8
- 229940088598 enzyme Drugs 0.000 description 8
- 150000002500 ions Chemical class 0.000 description 8
- 239000010410 layer Substances 0.000 description 8
- AMXOYNBUYSYVKV-UHFFFAOYSA-M lithium bromide Chemical compound [Li+].[Br-] AMXOYNBUYSYVKV-UHFFFAOYSA-M 0.000 description 8
- 229960005017 olanzapine Drugs 0.000 description 8
- 125000006239 protecting group Chemical group 0.000 description 8
- 238000010992 reflux Methods 0.000 description 8
- JMXKSZRRTHPKDL-UHFFFAOYSA-N titanium ethoxide Chemical compound [Ti+4].CC[O-].CC[O-].CC[O-].CC[O-] JMXKSZRRTHPKDL-UHFFFAOYSA-N 0.000 description 8
- MSRILKIQRXUYCT-UHFFFAOYSA-M valproate semisodium Chemical compound [Na+].CCCC(C(O)=O)CCC.CCCC(C([O-])=O)CCC MSRILKIQRXUYCT-UHFFFAOYSA-M 0.000 description 8
- 229960000604 valproic acid Drugs 0.000 description 8
- KZPYGQFFRCFCPP-UHFFFAOYSA-N 1,1'-bis(diphenylphosphino)ferrocene Chemical compound [Fe+2].C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1 KZPYGQFFRCFCPP-UHFFFAOYSA-N 0.000 description 7
- 150000001412 amines Chemical class 0.000 description 7
- 229910021529 ammonia Inorganic materials 0.000 description 7
- 238000004458 analytical method Methods 0.000 description 7
- 238000003556 assay Methods 0.000 description 7
- 239000003693 atypical antipsychotic agent Substances 0.000 description 7
- 230000015572 biosynthetic process Effects 0.000 description 7
- 238000004128 high performance liquid chromatography Methods 0.000 description 7
- 239000007787 solid Substances 0.000 description 7
- 238000003756 stirring Methods 0.000 description 7
- SMIGHGQBFHXUSR-UHFFFAOYSA-N 3-(5-bromo-2-fluorophenyl)-7-fluoro-3-(2-methylpyridin-4-yl)isoindol-1-amine Chemical compound C1=NC(C)=CC(C2(C3=C(C(=CC=C3)F)C(N)=N2)C=2C(=CC=C(Br)C=2)F)=C1 SMIGHGQBFHXUSR-UHFFFAOYSA-N 0.000 description 6
- MTKKGHVQPVOXIL-UHFFFAOYSA-N 3h-isoindol-1-amine Chemical compound C1=CC=C2C(N)=NCC2=C1 MTKKGHVQPVOXIL-UHFFFAOYSA-N 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- CEUORZQYGODEFX-UHFFFAOYSA-N Aripirazole Chemical compound ClC1=CC=CC(N2CCN(CCCCOC=3C=C4NC(=O)CCC4=CC=3)CC2)=C1Cl CEUORZQYGODEFX-UHFFFAOYSA-N 0.000 description 6
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- FFGPTBGBLSHEPO-UHFFFAOYSA-N carbamazepine Chemical compound C1=CC2=CC=CC=C2N(C(=O)N)C2=CC=CC=C21 FFGPTBGBLSHEPO-UHFFFAOYSA-N 0.000 description 6
- 229960000623 carbamazepine Drugs 0.000 description 6
- 239000003153 chemical reaction reagent Substances 0.000 description 6
- 239000000460 chlorine Substances 0.000 description 6
- QZUDBNBUXVUHMW-UHFFFAOYSA-N clozapine Chemical compound C1CN(C)CCN1C1=NC2=CC(Cl)=CC=C2NC2=CC=CC=C12 QZUDBNBUXVUHMW-UHFFFAOYSA-N 0.000 description 6
- BSHICDXRSZQYBP-UHFFFAOYSA-N dichloromethane;palladium(2+) Chemical compound [Pd+2].ClCCl BSHICDXRSZQYBP-UHFFFAOYSA-N 0.000 description 6
- 229960002870 gabapentin Drugs 0.000 description 6
- 239000000543 intermediate Substances 0.000 description 6
- LDDHMLJTFXJGPI-UHFFFAOYSA-N memantine hydrochloride Chemical compound Cl.C1C(C2)CC3(C)CC1(C)CC2(N)C3 LDDHMLJTFXJGPI-UHFFFAOYSA-N 0.000 description 6
- 229910052751 metal Inorganic materials 0.000 description 6
- 239000002184 metal Substances 0.000 description 6
- 239000002243 precursor Substances 0.000 description 6
- 108090000623 proteins and genes Proteins 0.000 description 6
- 229960004431 quetiapine Drugs 0.000 description 6
- URKOMYMAXPYINW-UHFFFAOYSA-N quetiapine Chemical compound C1CN(CCOCCO)CCN1C1=NC2=CC=CC=C2SC2=CC=CC=C12 URKOMYMAXPYINW-UHFFFAOYSA-N 0.000 description 6
- RAPZEAPATHNIPO-UHFFFAOYSA-N risperidone Chemical compound FC1=CC=C2C(C3CCN(CC3)CCC=3C(=O)N4CCCCC4=NC=3C)=NOC2=C1 RAPZEAPATHNIPO-UHFFFAOYSA-N 0.000 description 6
- UHSKFQJFRQCDBE-UHFFFAOYSA-N ropinirole Chemical compound CCCN(CCC)CCC1=CC=CC2=C1CC(=O)N2 UHSKFQJFRQCDBE-UHFFFAOYSA-N 0.000 description 6
- AEQFSUDEHCCHBT-UHFFFAOYSA-M sodium valproate Chemical compound [Na+].CCCC(C([O-])=O)CCC AEQFSUDEHCCHBT-UHFFFAOYSA-M 0.000 description 6
- 239000000758 substrate Substances 0.000 description 6
- 229940102566 valproate Drugs 0.000 description 6
- MVWVFYHBGMAFLY-UHFFFAOYSA-N ziprasidone Chemical compound C1=CC=C2C(N3CCN(CC3)CCC3=CC=4CC(=O)NC=4C=C3Cl)=NSC2=C1 MVWVFYHBGMAFLY-UHFFFAOYSA-N 0.000 description 6
- OFSQTMAHHPTGOK-UHFFFAOYSA-N 3-(3-bromophenyl)-7-fluoro-3-(2-methoxypyridin-4-yl)isoindol-1-amine Chemical compound C1=NC(OC)=CC(C2(C3=C(C(=CC=C3)F)C(N)=N2)C=2C=C(Br)C=CC=2)=C1 OFSQTMAHHPTGOK-UHFFFAOYSA-N 0.000 description 5
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 5
- 239000005695 Ammonium acetate Substances 0.000 description 5
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 5
- 235000019257 ammonium acetate Nutrition 0.000 description 5
- 229940043376 ammonium acetate Drugs 0.000 description 5
- 239000008346 aqueous phase Substances 0.000 description 5
- 229910052786 argon Inorganic materials 0.000 description 5
- 230000008021 deposition Effects 0.000 description 5
- 238000001514 detection method Methods 0.000 description 5
- 239000000284 extract Substances 0.000 description 5
- 239000012634 fragment Substances 0.000 description 5
- 125000005842 heteroatom Chemical group 0.000 description 5
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 5
- 230000002401 inhibitory effect Effects 0.000 description 5
- 238000004895 liquid chromatography mass spectrometry Methods 0.000 description 5
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 5
- CAEKBVOHOUBTJK-UHFFFAOYSA-N n-[(3-bromo-4-fluorophenyl)-(2-cyano-3-fluorophenyl)methylidene]-2-methylpropane-2-sulfinamide Chemical compound C=1C=CC(F)=C(C#N)C=1C(=NS(=O)C(C)(C)C)C1=CC=C(F)C(Br)=C1 CAEKBVOHOUBTJK-UHFFFAOYSA-N 0.000 description 5
- 229910052760 oxygen Inorganic materials 0.000 description 5
- 125000003367 polycyclic group Chemical group 0.000 description 5
- 238000000926 separation method Methods 0.000 description 5
- 229910000029 sodium carbonate Inorganic materials 0.000 description 5
- 235000017550 sodium carbonate Nutrition 0.000 description 5
- 238000001228 spectrum Methods 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- 238000003786 synthesis reaction Methods 0.000 description 5
- CESUXLKAADQNTB-UHFFFAOYSA-N tert-butanesulfinamide Chemical compound CC(C)(C)S(N)=O CESUXLKAADQNTB-UHFFFAOYSA-N 0.000 description 5
- 238000002877 time resolved fluorescence resonance energy transfer Methods 0.000 description 5
- 238000004704 ultra performance liquid chromatography Methods 0.000 description 5
- RTHCYVBBDHJXIQ-MRXNPFEDSA-N (R)-fluoxetine Chemical compound O([C@H](CCNC)C=1C=CC=CC=1)C1=CC=C(C(F)(F)F)C=C1 RTHCYVBBDHJXIQ-MRXNPFEDSA-N 0.000 description 4
- ZEUITGRIYCTCEM-KRWDZBQOSA-N (S)-duloxetine Chemical compound C1([C@@H](OC=2C3=CC=CC=C3C=CC=2)CCNC)=CC=CS1 ZEUITGRIYCTCEM-KRWDZBQOSA-N 0.000 description 4
- MYZDBWLDNVOEIL-UHFFFAOYSA-N 3-(3-bromophenyl)-7-fluoro-3-pyridin-4-ylisoindol-1-amine Chemical compound C12=CC=CC(F)=C2C(N)=NC1(C=1C=C(Br)C=CC=1)C1=CC=NC=C1 MYZDBWLDNVOEIL-UHFFFAOYSA-N 0.000 description 4
- MNMLGZMORMDPJI-UHFFFAOYSA-N 4-bromo-2-(difluoromethyl)pyridine Chemical compound FC(F)C1=CC(Br)=CC=N1 MNMLGZMORMDPJI-UHFFFAOYSA-N 0.000 description 4
- QHLLEZOPZRBCOY-UHFFFAOYSA-N 4-bromo-2-(trifluoromethyl)pyridine Chemical compound FC(F)(F)C1=CC(Br)=CC=N1 QHLLEZOPZRBCOY-UHFFFAOYSA-N 0.000 description 4
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 4
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 4
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 4
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 4
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 4
- YLXDSYKOBKBWJQ-LBPRGKRZSA-N N-[2-[(8S)-2,6,7,8-tetrahydro-1H-cyclopenta[e]benzofuran-8-yl]ethyl]propanamide Chemical compound C1=C2OCCC2=C2[C@H](CCNC(=O)CC)CCC2=C1 YLXDSYKOBKBWJQ-LBPRGKRZSA-N 0.000 description 4
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 4
- 229910021120 PdC12 Inorganic materials 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 4
- KLKWZMKGTIQLOG-UHFFFAOYSA-N [3-fluoro-5-(2-methylpropoxy)phenyl]boronic acid Chemical compound CC(C)COC1=CC(F)=CC(B(O)O)=C1 KLKWZMKGTIQLOG-UHFFFAOYSA-N 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 229960002629 agomelatine Drugs 0.000 description 4
- YJYPHIXNFHFHND-UHFFFAOYSA-N agomelatine Chemical compound C1=CC=C(CCNC(C)=O)C2=CC(OC)=CC=C21 YJYPHIXNFHFHND-UHFFFAOYSA-N 0.000 description 4
- 125000001931 aliphatic group Chemical group 0.000 description 4
- 150000001336 alkenes Chemical class 0.000 description 4
- VIROVYVQCGLCII-UHFFFAOYSA-N amobarbital Chemical compound CC(C)CCC1(CC)C(=O)NC(=O)NC1=O VIROVYVQCGLCII-UHFFFAOYSA-N 0.000 description 4
- 229960004372 aripiprazole Drugs 0.000 description 4
- 239000012298 atmosphere Substances 0.000 description 4
- 239000002585 base Substances 0.000 description 4
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 description 4
- 210000004556 brain Anatomy 0.000 description 4
- ZRIHAIZYIMGOAB-UHFFFAOYSA-N butabarbital Chemical compound CCC(C)C1(CC)C(=O)NC(=O)NC1=O ZRIHAIZYIMGOAB-UHFFFAOYSA-N 0.000 description 4
- OVBXTKIWZAHFAC-UHFFFAOYSA-N butane;pyrazine;tin Chemical compound CCCC[Sn](CCCC)(CCCC)C1=CN=CC=N1 OVBXTKIWZAHFAC-UHFFFAOYSA-N 0.000 description 4
- 239000003054 catalyst Substances 0.000 description 4
- 229910052801 chlorine Inorganic materials 0.000 description 4
- 238000004587 chromatography analysis Methods 0.000 description 4
- 229960004170 clozapine Drugs 0.000 description 4
- DOBRDRYODQBAMW-UHFFFAOYSA-N copper(i) cyanide Chemical compound [Cu+].N#[C-] DOBRDRYODQBAMW-UHFFFAOYSA-N 0.000 description 4
- 125000000392 cycloalkenyl group Chemical group 0.000 description 4
- USVZFSNDGFNNJT-UHFFFAOYSA-N cyclopenta-1,4-dien-1-yl(diphenyl)phosphane (2,3-dichlorocyclopenta-1,4-dien-1-yl)-diphenylphosphane iron(2+) Chemical compound [Fe++].c1cc[c-](c1)P(c1ccccc1)c1ccccc1.Clc1c(cc[c-]1Cl)P(c1ccccc1)c1ccccc1 USVZFSNDGFNNJT-UHFFFAOYSA-N 0.000 description 4
- 238000011161 development Methods 0.000 description 4
- 230000018109 developmental process Effects 0.000 description 4
- NIJJYAXOARWZEE-UHFFFAOYSA-N di-n-propyl-acetic acid Natural products CCCC(C(O)=O)CCC NIJJYAXOARWZEE-UHFFFAOYSA-N 0.000 description 4
- 229940079593 drug Drugs 0.000 description 4
- 229960002866 duloxetine Drugs 0.000 description 4
- 239000003480 eluent Substances 0.000 description 4
- 229960002464 fluoxetine Drugs 0.000 description 4
- ASUTZQLVASHGKV-JDFRZJQESA-N galanthamine Chemical compound O1C(=C23)C(OC)=CC=C2CN(C)CC[C@]23[C@@H]1C[C@@H](O)C=C2 ASUTZQLVASHGKV-JDFRZJQESA-N 0.000 description 4
- LNEPOXFFQSENCJ-UHFFFAOYSA-N haloperidol Chemical compound C1CC(O)(C=2C=CC(Cl)=CC=2)CCN1CCCC(=O)C1=CC=C(F)C=C1 LNEPOXFFQSENCJ-UHFFFAOYSA-N 0.000 description 4
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 4
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 4
- FUKUFMFMCZIRNT-UHFFFAOYSA-N hydron;methanol;chloride Chemical compound Cl.OC FUKUFMFMCZIRNT-UHFFFAOYSA-N 0.000 description 4
- 238000002347 injection Methods 0.000 description 4
- 239000007924 injection Substances 0.000 description 4
- 229960001848 lamotrigine Drugs 0.000 description 4
- PYZRQGJRPPTADH-UHFFFAOYSA-N lamotrigine Chemical compound NC1=NC(N)=NN=C1C1=CC=CC(Cl)=C1Cl PYZRQGJRPPTADH-UHFFFAOYSA-N 0.000 description 4
- 229910052744 lithium Inorganic materials 0.000 description 4
- 229960004640 memantine Drugs 0.000 description 4
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Natural products C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- RQTLKEBDTYWITQ-UHFFFAOYSA-N n-[(2-bromopyridin-4-yl)-(2-cyano-3-fluorophenyl)methylidene]-2-methylpropane-2-sulfinamide Chemical compound C=1C=CC(F)=C(C#N)C=1C(=NS(=O)C(C)(C)C)C1=CC=NC(Br)=C1 RQTLKEBDTYWITQ-UHFFFAOYSA-N 0.000 description 4
- 239000012299 nitrogen atmosphere Substances 0.000 description 4
- 231100000252 nontoxic Toxicity 0.000 description 4
- 230000003000 nontoxic effect Effects 0.000 description 4
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 4
- WEXRUCMBJFQVBZ-UHFFFAOYSA-N pentobarbital Chemical compound CCCC(C)C1(CC)C(=O)NC(=O)NC1=O WEXRUCMBJFQVBZ-UHFFFAOYSA-N 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- FASDKYOPVNHBLU-ZETCQYMHSA-N pramipexole Chemical compound C1[C@@H](NCCC)CCC2=C1SC(N)=N2 FASDKYOPVNHBLU-ZETCQYMHSA-N 0.000 description 4
- 230000008569 process Effects 0.000 description 4
- 238000011321 prophylaxis Methods 0.000 description 4
- 235000018102 proteins Nutrition 0.000 description 4
- 102000004169 proteins and genes Human genes 0.000 description 4
- 229960001150 ramelteon Drugs 0.000 description 4
- 229960001534 risperidone Drugs 0.000 description 4
- MQTUXRKNJYPMCG-CYBMUJFWSA-N robalzotan Chemical compound C1CCC1N([C@H]1COC=2C(F)=CC=C(C=2C1)C(=O)N)C1CCC1 MQTUXRKNJYPMCG-CYBMUJFWSA-N 0.000 description 4
- 229950003023 robalzotan Drugs 0.000 description 4
- 238000010898 silica gel chromatography Methods 0.000 description 4
- 239000002594 sorbent Substances 0.000 description 4
- 229960001685 tacrine Drugs 0.000 description 4
- YLJREFDVOIBQDA-UHFFFAOYSA-N tacrine Chemical compound C1=CC=C2C(N)=C(CCCC3)C3=NC2=C1 YLJREFDVOIBQDA-UHFFFAOYSA-N 0.000 description 4
- IQIGRZVNRAMNTC-UHFFFAOYSA-M zinc;2-fluorobenzene-6-ide-1-carbonitrile;iodide Chemical compound I[Zn+].FC1=CC=C[C-]=C1C#N IQIGRZVNRAMNTC-UHFFFAOYSA-M 0.000 description 4
- 229960000607 ziprasidone Drugs 0.000 description 4
- CYEXXDYQJPRMIQ-UHFFFAOYSA-N (5-cyanopyridin-3-yl)boronic acid Chemical compound OB(O)C1=CN=CC(C#N)=C1 CYEXXDYQJPRMIQ-UHFFFAOYSA-N 0.000 description 3
- JURQSGAZGLRMIL-UHFFFAOYSA-N 2-bromo-4-chloro-6-fluorobenzonitrile Chemical compound FC1=CC(Cl)=CC(Br)=C1C#N JURQSGAZGLRMIL-UHFFFAOYSA-N 0.000 description 3
- HXEADAXXAJRDDB-UHFFFAOYSA-N 3-(3-bromo-4-fluorophenyl)-7-fluoro-3-[2-(trifluoromethyl)pyridin-4-yl]isoindol-1-amine Chemical compound C12=CC=CC(F)=C2C(N)=NC1(C=1C=C(Br)C(F)=CC=1)C1=CC=NC(C(F)(F)F)=C1 HXEADAXXAJRDDB-UHFFFAOYSA-N 0.000 description 3
- JVFUHEQKXUNHNR-UHFFFAOYSA-N 3-(3-bromo-4-fluorophenyl)-7-fluoro-3-pyrimidin-5-ylisoindol-1-amine Chemical compound C12=CC=CC(F)=C2C(N)=NC1(C=1C=C(Br)C(F)=CC=1)C1=CN=CN=C1 JVFUHEQKXUNHNR-UHFFFAOYSA-N 0.000 description 3
- XIVAMFWFRPYYMR-UHFFFAOYSA-N 3-(3-bromo-4-methoxyphenyl)-7-fluoro-3-[2-(trifluoromethyl)pyridin-4-yl]isoindol-1-amine Chemical compound C1=C(Br)C(OC)=CC=C1C1(C=2C=C(N=CC=2)C(F)(F)F)C(C=CC=C2F)=C2C(N)=N1 XIVAMFWFRPYYMR-UHFFFAOYSA-N 0.000 description 3
- KHWKXPWVVPEHCJ-UHFFFAOYSA-N 3-(3-bromophenyl)-3-(2-cyclopropylpyridin-4-yl)-7-fluoroisoindol-1-amine Chemical compound C12=CC=CC(F)=C2C(N)=NC1(C=1C=C(N=CC=1)C1CC1)C1=CC=CC(Br)=C1 KHWKXPWVVPEHCJ-UHFFFAOYSA-N 0.000 description 3
- ASVMJTYHEPDWGL-UHFFFAOYSA-N 3-(3-bromophenyl)-7-fluoro-3-[2-(trifluoromethyl)pyridin-4-yl]isoindol-1-amine Chemical compound C12=CC=CC(F)=C2C(N)=NC1(C=1C=C(N=CC=1)C(F)(F)F)C1=CC=CC(Br)=C1 ASVMJTYHEPDWGL-UHFFFAOYSA-N 0.000 description 3
- RSULQKUHUREIFI-UHFFFAOYSA-N 3-(5-bromo-2-fluorophenyl)-7-fluoro-3-[2-(trifluoromethyl)pyridin-4-yl]isoindol-1-amine Chemical compound C12=CC=CC(F)=C2C(N)=NC1(C=1C(=CC=C(Br)C=1)F)C1=CC=NC(C(F)(F)F)=C1 RSULQKUHUREIFI-UHFFFAOYSA-N 0.000 description 3
- NPUZZKZKHYZOEJ-UHFFFAOYSA-N 4-bromo-2-cyclopropylpyridine Chemical compound BrC1=CC=NC(C2CC2)=C1 NPUZZKZKHYZOEJ-UHFFFAOYSA-N 0.000 description 3
- GLMXOYJTFKWRKZ-UHFFFAOYSA-N 6-bromo-2,4-dimethylpyridin-3-ol Chemical compound CC1=CC(Br)=NC(C)=C1O GLMXOYJTFKWRKZ-UHFFFAOYSA-N 0.000 description 3
- PENZXXCPRLNOBE-UHFFFAOYSA-N 6-bromo-3-methoxy-2,4-dimethylpyridine Chemical compound COC1=C(C)C=C(Br)N=C1C PENZXXCPRLNOBE-UHFFFAOYSA-N 0.000 description 3
- HJCMDXDYPOUFDY-WHFBIAKZSA-N Ala-Gln Chemical compound C[C@H](N)C(=O)N[C@H](C(O)=O)CCC(N)=O HJCMDXDYPOUFDY-WHFBIAKZSA-N 0.000 description 3
- 208000037259 Amyloid Plaque Diseases 0.000 description 3
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 3
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 3
- 239000006144 Dulbecco’s modified Eagle's medium Substances 0.000 description 3
- 239000007983 Tris buffer Substances 0.000 description 3
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 3
- 125000003342 alkenyl group Chemical group 0.000 description 3
- 229940121363 anti-inflammatory agent Drugs 0.000 description 3
- 239000002260 anti-inflammatory agent Substances 0.000 description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 3
- 229910052794 bromium Inorganic materials 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 235000011089 carbon dioxide Nutrition 0.000 description 3
- 125000000753 cycloalkyl group Chemical group 0.000 description 3
- 231100000135 cytotoxicity Toxicity 0.000 description 3
- 230000003013 cytotoxicity Effects 0.000 description 3
- 238000004807 desolvation Methods 0.000 description 3
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 3
- 229960003530 donepezil Drugs 0.000 description 3
- 239000003797 essential amino acid Substances 0.000 description 3
- 235000020776 essential amino acid Nutrition 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 3
- 229910052740 iodine Inorganic materials 0.000 description 3
- 239000003446 ligand Substances 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 239000002609 medium Substances 0.000 description 3
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 3
- 150000007522 mineralic acids Chemical class 0.000 description 3
- 125000002950 monocyclic group Chemical group 0.000 description 3
- 239000001301 oxygen Chemical group 0.000 description 3
- 238000004237 preparative chromatography Methods 0.000 description 3
- 108090000765 processed proteins & peptides Proteins 0.000 description 3
- FXJZOUPFQNMFOR-UHFFFAOYSA-N pyrimidin-2-ylboronic acid Chemical compound OB(O)C1=NC=CC=N1 FXJZOUPFQNMFOR-UHFFFAOYSA-N 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 238000010257 thawing Methods 0.000 description 3
- 125000003944 tolyl group Chemical group 0.000 description 3
- QGAMJEFMDAVSKL-UHFFFAOYSA-N tributyl-(4-methoxypyridin-2-yl)stannane Chemical compound CCCC[Sn](CCCC)(CCCC)C1=CC(OC)=CC=N1 QGAMJEFMDAVSKL-UHFFFAOYSA-N 0.000 description 3
- DTQVDTLACAAQTR-UHFFFAOYSA-N trifluoroacetic acid Substances OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 3
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 3
- 229910052725 zinc Inorganic materials 0.000 description 3
- 239000011701 zinc Substances 0.000 description 3
- AHOUBRCZNHFOSL-YOEHRIQHSA-N (+)-Casbol Chemical compound C1=CC(F)=CC=C1[C@H]1[C@H](COC=2C=C3OCOC3=CC=2)CNCC1 AHOUBRCZNHFOSL-YOEHRIQHSA-N 0.000 description 2
- SNICXCGAKADSCV-JTQLQIEISA-N (-)-Nicotine Chemical compound CN1CCC[C@H]1C1=CC=CN=C1 SNICXCGAKADSCV-JTQLQIEISA-N 0.000 description 2
- CYPYTURSJDMMMP-WVCUSYJESA-N (1e,4e)-1,5-diphenylpenta-1,4-dien-3-one;palladium Chemical compound [Pd].[Pd].C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1 CYPYTURSJDMMMP-WVCUSYJESA-N 0.000 description 2
- JCKZNMSBFBPDPM-UHFFFAOYSA-N (2-fluoro-3-methoxyphenyl)boronic acid Chemical compound COC1=CC=CC(B(O)O)=C1F JCKZNMSBFBPDPM-UHFFFAOYSA-N 0.000 description 2
- LHYMPSWMHXUWSK-STZFKDTASA-N (2z)-4-(3,4-dichlorophenyl)-2-[[2-(4-methylpiperazin-1-yl)phenyl]methylidene]thiomorpholin-3-one Chemical compound C1CN(C)CCN1C1=CC=CC=C1\C=C/1C(=O)N(C=2C=C(Cl)C(Cl)=CC=2)CCS\1 LHYMPSWMHXUWSK-STZFKDTASA-N 0.000 description 2
- DIWRORZWFLOCLC-HNNXBMFYSA-N (3s)-7-chloro-5-(2-chlorophenyl)-3-hydroxy-1,3-dihydro-1,4-benzodiazepin-2-one Chemical compound N([C@H](C(NC1=CC=C(Cl)C=C11)=O)O)=C1C1=CC=CC=C1Cl DIWRORZWFLOCLC-HNNXBMFYSA-N 0.000 description 2
- FJIKWRGCXUCUIG-HNNXBMFYSA-N (3s)-7-chloro-5-(2-chlorophenyl)-3-hydroxy-1-methyl-3h-1,4-benzodiazepin-2-one Chemical compound O=C([C@H](O)N=1)N(C)C2=CC=C(Cl)C=C2C=1C1=CC=CC=C1Cl FJIKWRGCXUCUIG-HNNXBMFYSA-N 0.000 description 2
- FVEDGBRHTGXPOK-UHFFFAOYSA-N (5-fluoropyridin-3-yl)boronic acid Chemical compound OB(O)C1=CN=CC(F)=C1 FVEDGBRHTGXPOK-UHFFFAOYSA-N 0.000 description 2
- YGXNPQDXWDCWET-UHFFFAOYSA-N (5-methylsulfonylpyridin-3-yl)boronic acid Chemical compound CS(=O)(=O)C1=CN=CC(B(O)O)=C1 YGXNPQDXWDCWET-UHFFFAOYSA-N 0.000 description 2
- GBBSUAFBMRNDJC-MRXNPFEDSA-N (5R)-zopiclone Chemical compound C1CN(C)CCN1C(=O)O[C@@H]1C2=NC=CN=C2C(=O)N1C1=CC=C(Cl)C=N1 GBBSUAFBMRNDJC-MRXNPFEDSA-N 0.000 description 2
- ICPHJSKVAZMKIV-QGZVFWFLSA-N (5r)-7,8-dimethoxy-3-methyl-5-phenyl-1,2,4,5-tetrahydro-3-benzazepine Chemical compound C1([C@H]2CN(C)CCC=3C=C(C(=CC=32)OC)OC)=CC=CC=C1 ICPHJSKVAZMKIV-QGZVFWFLSA-N 0.000 description 2
- WSEQXVZVJXJVFP-HXUWFJFHSA-N (R)-citalopram Chemical compound C1([C@@]2(C3=CC=C(C=C3CO2)C#N)CCCN(C)C)=CC=C(F)C=C1 WSEQXVZVJXJVFP-HXUWFJFHSA-N 0.000 description 2
- VSWBSWWIRNCQIJ-GJZGRUSLSA-N (R,R)-asenapine Chemical compound O1C2=CC=CC=C2[C@@H]2CN(C)C[C@H]2C2=CC(Cl)=CC=C21 VSWBSWWIRNCQIJ-GJZGRUSLSA-N 0.000 description 2
- BGRJTUBHPOOWDU-NSHDSACASA-N (S)-(-)-sulpiride Chemical compound CCN1CCC[C@H]1CNC(=O)C1=CC(S(N)(=O)=O)=CC=C1OC BGRJTUBHPOOWDU-NSHDSACASA-N 0.000 description 2
- ZEHYJZXQEQOSON-AATRIKPKSA-N (e)-1-chloro-3-ethylpent-1-en-4-yn-3-ol Chemical compound CCC(O)(C#C)\C=C\Cl ZEHYJZXQEQOSON-AATRIKPKSA-N 0.000 description 2
- QECAKYKTTYQVKX-RMKNXTFCSA-N (e)-3-(2,5-dihydropyrrol-1-yl)-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one Chemical compound COC1=C(OC)C(OC)=CC(C(=O)\C=C\N2CC=CC2)=C1 QECAKYKTTYQVKX-RMKNXTFCSA-N 0.000 description 2
- TZJUVVIWVWFLCD-UHFFFAOYSA-N 1,1-dioxo-2-[4-[4-(2-pyrimidinyl)-1-piperazinyl]butyl]-1,2-benzothiazol-3-one Chemical compound O=S1(=O)C2=CC=CC=C2C(=O)N1CCCCN(CC1)CCN1C1=NC=CC=N1 TZJUVVIWVWFLCD-UHFFFAOYSA-N 0.000 description 2
- UNFQKKSADLVQJE-UHFFFAOYSA-N 1-(3-chlorophenyl)-3-(3-methyl-5-oxo-4h-imidazol-2-yl)urea;hydrate Chemical compound O.CN1CC(=O)N=C1NC(=O)NC1=CC=CC(Cl)=C1 UNFQKKSADLVQJE-UHFFFAOYSA-N 0.000 description 2
- QVZXBANNBNDOFW-UHFFFAOYSA-N 1-(4-phenylbutyl)piperidine Chemical compound C1CCCCN1CCCCC1=CC=CC=C1 QVZXBANNBNDOFW-UHFFFAOYSA-N 0.000 description 2
- QEMSVZNTSXPFJA-HNAYVOBHSA-N 1-[(1s,2s)-1-hydroxy-1-(4-hydroxyphenyl)propan-2-yl]-4-phenylpiperidin-4-ol Chemical compound C1([C@H](O)[C@H](C)N2CCC(O)(CC2)C=2C=CC=CC=2)=CC=C(O)C=C1 QEMSVZNTSXPFJA-HNAYVOBHSA-N 0.000 description 2
- IANQTJSKSUMEQM-UHFFFAOYSA-N 1-benzofuran Chemical compound C1=CC=C2OC=CC2=C1 IANQTJSKSUMEQM-UHFFFAOYSA-N 0.000 description 2
- WJFKNYWRSNBZNX-UHFFFAOYSA-N 10H-phenothiazine Chemical compound C1=CC=C2NC3=CC=CC=C3SC2=C1 WJFKNYWRSNBZNX-UHFFFAOYSA-N 0.000 description 2
- KYWMWUUMCDZISK-UHFFFAOYSA-N 2,2,5,5-tetrakis(trifluoromethyl)-1h-imidazol-4-amine Chemical compound NC1=NC(C(F)(F)F)(C(F)(F)F)NC1(C(F)(F)F)C(F)(F)F KYWMWUUMCDZISK-UHFFFAOYSA-N 0.000 description 2
- SGXOSZYAPUYDCF-UHFFFAOYSA-N 2-(2-bromopyridine-4-carbonyl)-6-fluorobenzonitrile Chemical compound FC1=CC=CC(C(=O)C=2C=C(Br)N=CC=2)=C1C#N SGXOSZYAPUYDCF-UHFFFAOYSA-N 0.000 description 2
- BYEQEFRUMVPYNZ-UHFFFAOYSA-N 2-(2-chloropyridine-4-carbonyl)-6-fluorobenzonitrile Chemical compound FC1=CC=CC(C(=O)C=2C=C(Cl)N=CC=2)=C1C#N BYEQEFRUMVPYNZ-UHFFFAOYSA-N 0.000 description 2
- SGTNSNPWRIOYBX-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-{[2-(3,4-dimethoxyphenyl)ethyl](methyl)amino}-2-(propan-2-yl)pentanenitrile Chemical compound C1=C(OC)C(OC)=CC=C1CCN(C)CCCC(C#N)(C(C)C)C1=CC=C(OC)C(OC)=C1 SGTNSNPWRIOYBX-UHFFFAOYSA-N 0.000 description 2
- HPAMAUCHZQCIHI-UHFFFAOYSA-N 2-(3-bromo-4-fluorobenzoyl)-6-fluorobenzonitrile Chemical compound C1=C(Br)C(F)=CC=C1C(=O)C1=CC=CC(F)=C1C#N HPAMAUCHZQCIHI-UHFFFAOYSA-N 0.000 description 2
- AYDQIUSYMHKITK-UHFFFAOYSA-N 2-(3-bromo-4-methoxybenzoyl)-6-fluorobenzonitrile Chemical compound C1=C(Br)C(OC)=CC=C1C(=O)C1=CC=CC(F)=C1C#N AYDQIUSYMHKITK-UHFFFAOYSA-N 0.000 description 2
- GYJZSZAJRWQZKK-UHFFFAOYSA-N 2-(3-bromobenzoyl)-4-chloro-6-fluorobenzonitrile Chemical compound FC1=CC(Cl)=CC(C(=O)C=2C=C(Br)C=CC=2)=C1C#N GYJZSZAJRWQZKK-UHFFFAOYSA-N 0.000 description 2
- ZPKCITAJMBTYJV-UHFFFAOYSA-N 2-(3-bromobenzoyl)-6-fluorobenzonitrile Chemical compound FC1=CC=CC(C(=O)C=2C=C(Br)C=CC=2)=C1C#N ZPKCITAJMBTYJV-UHFFFAOYSA-N 0.000 description 2
- XUNQXURPZRGGHJ-UHFFFAOYSA-N 2-(5-bromo-2-fluorobenzoyl)-6-fluorobenzonitrile Chemical compound FC1=CC=C(Br)C=C1C(=O)C1=CC=CC(F)=C1C#N XUNQXURPZRGGHJ-UHFFFAOYSA-N 0.000 description 2
- SPCKHVPPRJWQRZ-UHFFFAOYSA-N 2-benzhydryloxy-n,n-dimethylethanamine;2-hydroxypropane-1,2,3-tricarboxylic acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O.C=1C=CC=CC=1C(OCCN(C)C)C1=CC=CC=C1 SPCKHVPPRJWQRZ-UHFFFAOYSA-N 0.000 description 2
- DVJGNSPCQJBLRV-UHFFFAOYSA-N 2-fluoro-6-(2-methoxypyridine-4-carbonyl)benzonitrile Chemical compound C1=NC(OC)=CC(C(=O)C=2C(=C(F)C=CC=2)C#N)=C1 DVJGNSPCQJBLRV-UHFFFAOYSA-N 0.000 description 2
- NDNSYURGNSEPDJ-UHFFFAOYSA-N 2-methoxypyridine-4-carbonyl chloride Chemical compound COC1=CC(C(Cl)=O)=CC=N1 NDNSYURGNSEPDJ-UHFFFAOYSA-N 0.000 description 2
- NWPNXBQSRGKSJB-UHFFFAOYSA-N 2-methylbenzonitrile Chemical compound CC1=CC=CC=C1C#N NWPNXBQSRGKSJB-UHFFFAOYSA-N 0.000 description 2
- GTFCXOTXJVOQOJ-UHFFFAOYSA-N 2-trimethylstannylpyridine-4-carbonitrile Chemical compound C[Sn](C)(C)C1=CC(C#N)=CC=N1 GTFCXOTXJVOQOJ-UHFFFAOYSA-N 0.000 description 2
- SPSYMWKHDUJABD-UHFFFAOYSA-N 2h-isoindol-1-amine Chemical compound C1=CC=CC2=C(N)NC=C21 SPSYMWKHDUJABD-UHFFFAOYSA-N 0.000 description 2
- MLTXTSSDJJLCSH-UHFFFAOYSA-N 3-(2-bromopyridin-4-yl)-3-(2-cyclopropylpyridin-4-yl)-7-fluoroisoindol-1-amine Chemical compound C12=CC=CC(F)=C2C(N)=NC1(C=1C=C(N=CC=1)C1CC1)C1=CC=NC(Br)=C1 MLTXTSSDJJLCSH-UHFFFAOYSA-N 0.000 description 2
- IAKZHCSXDWDBBM-UHFFFAOYSA-N 3-(2-bromopyridin-4-yl)-3-[2-(difluoromethyl)pyridin-4-yl]-7-fluoroisoindol-1-amine Chemical compound C12=CC=CC(F)=C2C(N)=NC1(C=1C=C(N=CC=1)C(F)F)C1=CC=NC(Br)=C1 IAKZHCSXDWDBBM-UHFFFAOYSA-N 0.000 description 2
- JTJWDRDOEAWSAP-UHFFFAOYSA-N 3-(2-bromopyridin-4-yl)-7-fluoro-3-(3-fluoro-4-methoxy-5-methylphenyl)isoindol-1-amine Chemical compound C1=C(F)C(OC)=C(C)C=C1C1(C=2C=C(Br)N=CC=2)C(C=CC=C2F)=C2C(N)=N1 JTJWDRDOEAWSAP-UHFFFAOYSA-N 0.000 description 2
- CQZCFWNLPALUHE-UHFFFAOYSA-N 3-(2-bromopyridin-4-yl)-7-fluoro-3-(5-methoxy-4,6-dimethylpyridin-2-yl)isoindol-1-amine Chemical compound N1=C(C)C(OC)=C(C)C=C1C1(C=2C=C(Br)N=CC=2)C(C=CC=C2F)=C2C(N)=N1 CQZCFWNLPALUHE-UHFFFAOYSA-N 0.000 description 2
- RRAXNPAHVGPSEE-UHFFFAOYSA-N 3-(2-chloropyridin-4-yl)-3-[5-(difluoromethoxy)-4,6-dimethylpyridin-2-yl]-7-fluoroisoindol-1-amine Chemical compound CC1=C(OC(F)F)C(C)=CC(C2(C3=C(C(=CC=C3)F)C(N)=N2)C=2C=C(Cl)N=CC=2)=N1 RRAXNPAHVGPSEE-UHFFFAOYSA-N 0.000 description 2
- QFXWZQKMTDYQHX-UHFFFAOYSA-N 3-(3-bromo-4-fluorophenyl)-7-fluoro-3-pyridin-4-ylisoindol-1-amine Chemical compound C12=CC=CC(F)=C2C(N)=NC1(C=1C=C(Br)C(F)=CC=1)C1=CC=NC=C1 QFXWZQKMTDYQHX-UHFFFAOYSA-N 0.000 description 2
- KFINXZUDWTZUEW-UHFFFAOYSA-N 3-(3-bromophenyl)-3-(2,6-dimethylpyridin-4-yl)-7-fluoroisoindol-1-amine Chemical compound CC1=NC(C)=CC(C2(C3=C(C(=CC=C3)F)C(N)=N2)C=2C=C(Br)C=CC=2)=C1 KFINXZUDWTZUEW-UHFFFAOYSA-N 0.000 description 2
- AAYZKABRBPXFHL-UHFFFAOYSA-N 3-(3-bromophenyl)-3-(2,6-dimethylpyrimidin-4-yl)-7-fluoroisoindol-1-amine Chemical compound CC1=NC(C)=CC(C2(C3=C(C(=CC=C3)F)C(N)=N2)C=2C=C(Br)C=CC=2)=N1 AAYZKABRBPXFHL-UHFFFAOYSA-N 0.000 description 2
- CXZAHYRFCGSOBZ-UHFFFAOYSA-N 3-(3-bromophenyl)-3-(3,4-difluoro-5-methoxyphenyl)-7-fluoroisoindol-1-amine Chemical compound FC1=C(F)C(OC)=CC(C2(C3=C(C(=CC=C3)F)C(N)=N2)C=2C=C(Br)C=CC=2)=C1 CXZAHYRFCGSOBZ-UHFFFAOYSA-N 0.000 description 2
- QRJGFGVPEYVFAR-UHFFFAOYSA-N 3-(3-bromophenyl)-3-(3-chloro-4-methoxyphenyl)-7-fluoroisoindol-1-amine Chemical compound C1=C(Cl)C(OC)=CC=C1C1(C=2C=C(Br)C=CC=2)C(C=CC=C2F)=C2C(N)=N1 QRJGFGVPEYVFAR-UHFFFAOYSA-N 0.000 description 2
- DTJVUMRVFCXWNW-UHFFFAOYSA-N 3-(3-bromophenyl)-3-[2-(difluoromethyl)-6-methylpyridin-4-yl]-7-fluoroisoindol-1-amine Chemical compound FC(F)C1=NC(C)=CC(C2(C3=C(C(=CC=C3)F)C(N)=N2)C=2C=C(Br)C=CC=2)=C1 DTJVUMRVFCXWNW-UHFFFAOYSA-N 0.000 description 2
- MZOQLWSQXXPCKT-UHFFFAOYSA-N 3-(3-bromophenyl)-3-[2-(difluoromethyl)pyridin-4-yl]-7-fluoroisoindol-1-amine Chemical compound C12=CC=CC(F)=C2C(N)=NC1(C=1C=C(N=CC=1)C(F)F)C1=CC=CC(Br)=C1 MZOQLWSQXXPCKT-UHFFFAOYSA-N 0.000 description 2
- LLDKCHMGXFYGGO-UHFFFAOYSA-N 3-(3-bromophenyl)-5-chloro-7-fluoro-3-(2-methylpyridin-4-yl)isoindol-1-amine Chemical compound C1=NC(C)=CC(C2(C3=C(C(=CC(Cl)=C3)F)C(N)=N2)C=2C=C(Br)C=CC=2)=C1 LLDKCHMGXFYGGO-UHFFFAOYSA-N 0.000 description 2
- APJAJJHAXJLPEX-UHFFFAOYSA-N 3-(3-bromophenyl)-7-fluoro-3-(4-fluoro-3-methoxyphenyl)isoindol-1-amine Chemical compound C1=C(F)C(OC)=CC(C2(C3=C(C(=CC=C3)F)C(N)=N2)C=2C=C(Br)C=CC=2)=C1 APJAJJHAXJLPEX-UHFFFAOYSA-N 0.000 description 2
- KXTWUNJCHNJYIP-UHFFFAOYSA-N 3-(3-bromophenyl)-7-fluoro-3-(4-methoxyphenyl)isoindol-1-amine Chemical compound C1=CC(OC)=CC=C1C1(C=2C=C(Br)C=CC=2)C(C=CC=C2F)=C2C(N)=N1 KXTWUNJCHNJYIP-UHFFFAOYSA-N 0.000 description 2
- JWMSOQLGSUWCHM-UHFFFAOYSA-N 3-(3-bromophenyl)-7-fluoro-3-[6-methoxy-5-(trifluoromethyl)pyridin-3-yl]isoindol-1-amine Chemical compound C1=C(C(F)(F)F)C(OC)=NC=C1C1(C=2C=C(Br)C=CC=2)C(C=CC=C2F)=C2C(N)=N1 JWMSOQLGSUWCHM-UHFFFAOYSA-N 0.000 description 2
- ZRRSJJJAPBUJMB-UHFFFAOYSA-N 3-[3-(bromomethyl)-4-methoxy-5-methylphenyl]-7-fluoro-3-(3-pyrimidin-5-ylphenyl)isoindol-1-amine Chemical compound C1=C(CBr)C(OC)=C(C)C=C1C1(C=2C=C(C=CC=2)C=2C=NC=NC=2)C(C=CC=C2F)=C2C(N)=N1 ZRRSJJJAPBUJMB-UHFFFAOYSA-N 0.000 description 2
- FXZJKVODWNYPKK-UHFFFAOYSA-N 3-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-1h-quinazoline-2,4-dione Chemical compound ClC1=CC=CC(N2CCN(CCCN3C(C4=CC=CC=C4NC3=O)=O)CC2)=C1 FXZJKVODWNYPKK-UHFFFAOYSA-N 0.000 description 2
- CQPWLLBIKHZYNK-UHFFFAOYSA-N 3-[3-amino-6-chloro-4-fluoro-1-[2-(trifluoromethyl)pyridin-4-yl]isoindol-1-yl]phenol Chemical compound C12=CC(Cl)=CC(F)=C2C(N)=NC1(C=1C=C(N=CC=1)C(F)(F)F)C1=CC=CC(O)=C1 CQPWLLBIKHZYNK-UHFFFAOYSA-N 0.000 description 2
- UAAQIUYOLQEKLN-UHFFFAOYSA-N 3-bromo-4-methoxybenzoyl chloride Chemical compound COC1=CC=C(C(Cl)=O)C=C1Br UAAQIUYOLQEKLN-UHFFFAOYSA-N 0.000 description 2
- PBOOZQFGWNZNQE-UHFFFAOYSA-N 3-bromobenzoyl chloride Chemical compound ClC(=O)C1=CC=CC(Br)=C1 PBOOZQFGWNZNQE-UHFFFAOYSA-N 0.000 description 2
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 2
- GZPHSAQLYPIAIN-UHFFFAOYSA-N 3-pyridinecarbonitrile Chemical compound N#CC1=CC=CN=C1 GZPHSAQLYPIAIN-UHFFFAOYSA-N 0.000 description 2
- PMXMIIMHBWHSKN-UHFFFAOYSA-N 3-{2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]ethyl}-9-hydroxy-2-methyl-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one Chemical compound FC1=CC=C2C(C3CCN(CC3)CCC=3C(=O)N4CCCC(O)C4=NC=3C)=NOC2=C1 PMXMIIMHBWHSKN-UHFFFAOYSA-N 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- PCTRYMLLRKWXGF-UHFFFAOYSA-N 4-(butylamino)-1-ethyl-6-methyl-5-pyrazolo[3,4-b]pyridinecarboxylic acid ethyl ester Chemical compound CCCCNC1=C(C(=O)OCC)C(C)=NC2=C1C=NN2CC PCTRYMLLRKWXGF-UHFFFAOYSA-N 0.000 description 2
- YZFJZGHDTSNANK-UHFFFAOYSA-N 4-bromo-2-(difluoromethyl)-6-methylpyridine Chemical compound CC1=CC(Br)=CC(C(F)F)=N1 YZFJZGHDTSNANK-UHFFFAOYSA-N 0.000 description 2
- JFBMFWHEXBLFCR-UHFFFAOYSA-N 4-bromo-2-methylpyridine Chemical compound CC1=CC(Br)=CC=N1 JFBMFWHEXBLFCR-UHFFFAOYSA-N 0.000 description 2
- CKVQWOKUEZYWRQ-UHFFFAOYSA-N 4-bromopyridine-2-carbaldehyde Chemical compound BrC1=CC=NC(C=O)=C1 CKVQWOKUEZYWRQ-UHFFFAOYSA-N 0.000 description 2
- NSDUUSCVNGATGZ-UHFFFAOYSA-N 4-chloro-2-fluoro-6-(3-methoxybenzoyl)benzonitrile Chemical compound COC1=CC=CC(C(=O)C=2C(=C(F)C=C(Cl)C=2)C#N)=C1 NSDUUSCVNGATGZ-UHFFFAOYSA-N 0.000 description 2
- NPFILZKBYLIOSV-UHFFFAOYSA-N 4-chloro-2-fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile Chemical compound O1C(C)(C)C(C)(C)OB1C1=CC(Cl)=CC(F)=C1C#N NPFILZKBYLIOSV-UHFFFAOYSA-N 0.000 description 2
- RTLUPHDWSUGAOS-UHFFFAOYSA-N 4-iodopyridine Chemical compound IC1=CC=NC=C1 RTLUPHDWSUGAOS-UHFFFAOYSA-N 0.000 description 2
- XWVOEFLBOSSYGM-UHFFFAOYSA-N 4-morpholinyl-(3,4,5-trimethoxyphenyl)methanone Chemical compound COC1=C(OC)C(OC)=CC(C(=O)N2CCOCC2)=C1 XWVOEFLBOSSYGM-UHFFFAOYSA-N 0.000 description 2
- FUEROTNYTTVKDH-UHFFFAOYSA-N 5-[3-amino-1-(3-bromophenyl)-4-fluoroisoindol-1-yl]-2-methoxy-3-methylbenzonitrile Chemical compound C1=C(C#N)C(OC)=C(C)C=C1C1(C=2C=C(Br)C=CC=2)C(C=CC=C2F)=C2C(N)=N1 FUEROTNYTTVKDH-UHFFFAOYSA-N 0.000 description 2
- LEGBISULKASFCD-UHFFFAOYSA-N 5-bromo-2-fluorobenzoyl chloride Chemical compound FC1=CC=C(Br)C=C1C(Cl)=O LEGBISULKASFCD-UHFFFAOYSA-N 0.000 description 2
- HVYUMTFVACIQBI-UHFFFAOYSA-N 6-bromo-3-(difluoromethoxy)-2,4-dimethylpyridine Chemical compound CC1=CC(Br)=NC(C)=C1OC(F)F HVYUMTFVACIQBI-UHFFFAOYSA-N 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 2
- QYFHCFNBYQZGKW-BDQAORGHSA-N 8-[4-[[(3s)-5-methoxy-3,4-dihydro-2h-chromen-3-yl]-propylamino]butyl]-8-azaspiro[4.5]decane-7,9-dione;hydrochloride Chemical compound Cl.CCCN([C@H]1CC2=C(OC)C=CC=C2OC1)CCCCN(C(C1)=O)C(=O)CC21CCCC2 QYFHCFNBYQZGKW-BDQAORGHSA-N 0.000 description 2
- 231100000582 ATP assay Toxicity 0.000 description 2
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 2
- FDQGNLOWMMVRQL-UHFFFAOYSA-N Allobarbital Chemical compound C=CCC1(CC=C)C(=O)NC(=O)NC1=O FDQGNLOWMMVRQL-UHFFFAOYSA-N 0.000 description 2
- WKEMJKQOLOHJLZ-UHFFFAOYSA-N Almogran Chemical compound C1=C2C(CCN(C)C)=CNC2=CC=C1CS(=O)(=O)N1CCCC1 WKEMJKQOLOHJLZ-UHFFFAOYSA-N 0.000 description 2
- 102100028116 Amine oxidase [flavin-containing] B Human genes 0.000 description 2
- VCCBCXVFGHTDQN-UODBTFMRSA-N BIII-890CL Chemical compound O([C@H](CN1[C@@H]2CC3=C(O)C=CC=C3[C@](C2(C)C)(C)CC1)C)CC1=CC=CC=C1 VCCBCXVFGHTDQN-UODBTFMRSA-N 0.000 description 2
- 101710150192 Beta-secretase 1 Proteins 0.000 description 2
- CYGODHVAJQTCBG-UHFFFAOYSA-N Bifeprunox Chemical compound C=12OC(=O)NC2=CC=CC=1N(CC1)CCN1CC(C=1)=CC=CC=1C1=CC=CC=C1 CYGODHVAJQTCBG-UHFFFAOYSA-N 0.000 description 2
- VMIYHDSEFNYJSL-UHFFFAOYSA-N Bromazepam Chemical compound C12=CC(Br)=CC=C2NC(=O)CN=C1C1=CC=CC=N1 VMIYHDSEFNYJSL-UHFFFAOYSA-N 0.000 description 2
- UMSGKTJDUHERQW-UHFFFAOYSA-N Brotizolam Chemical compound C1=2C=C(Br)SC=2N2C(C)=NN=C2CN=C1C1=CC=CC=C1Cl UMSGKTJDUHERQW-UHFFFAOYSA-N 0.000 description 2
- RZZPDXZPRHQOCG-OJAKKHQRSA-O CDP-choline(1+) Chemical compound O[C@@H]1[C@H](O)[C@@H](COP(O)(=O)OP(O)(=O)OCC[N+](C)(C)C)O[C@H]1N1C(=O)N=C(N)C=C1 RZZPDXZPRHQOCG-OJAKKHQRSA-O 0.000 description 2
- KORNTPPJEAJQIU-KJXAQDMKSA-N Cabaser Chemical compound C1=CC([C@H]2C[C@H](CN(CC=C)[C@@H]2C2)C(=O)N(CCCN(C)C)C(=O)NCC)=C3C2=CNC3=C1 KORNTPPJEAJQIU-KJXAQDMKSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- GDLIGKIOYRNHDA-UHFFFAOYSA-N Clomipramine Chemical compound C1CC2=CC=C(Cl)C=C2N(CCCN(C)C)C2=CC=CC=C21 GDLIGKIOYRNHDA-UHFFFAOYSA-N 0.000 description 2
- HCYAFALTSJYZDH-UHFFFAOYSA-N Desimpramine Chemical compound C1CC2=CC=CC=C2N(CCCNC)C2=CC=CC=C21 HCYAFALTSJYZDH-UHFFFAOYSA-N 0.000 description 2
- 108010057987 Desmodus rotundus salivary plasminogen activator alpha 1 Proteins 0.000 description 2
- XIQVNETUBQGFHX-UHFFFAOYSA-N Ditropan Chemical compound C=1C=CC=CC=1C(O)(C(=O)OCC#CCN(CC)CC)C1CCCCC1 XIQVNETUBQGFHX-UHFFFAOYSA-N 0.000 description 2
- JMBQKKAJIKAWKF-UHFFFAOYSA-N Glutethimide Chemical compound C=1C=CC=CC=1C1(CC)CCC(=O)NC1=O JMBQKKAJIKAWKF-UHFFFAOYSA-N 0.000 description 2
- WYCLKVQLVUQKNZ-UHFFFAOYSA-N Halazepam Chemical compound N=1CC(=O)N(CC(F)(F)F)C2=CC=C(Cl)C=C2C=1C1=CC=CC=C1 WYCLKVQLVUQKNZ-UHFFFAOYSA-N 0.000 description 2
- 101000768078 Homo sapiens Amine oxidase [flavin-containing] B Proteins 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- WTDRDQBEARUVNC-LURJTMIESA-N L-DOPA Chemical compound OC(=O)[C@@H](N)CC1=CC=C(O)C(O)=C1 WTDRDQBEARUVNC-LURJTMIESA-N 0.000 description 2
- WTDRDQBEARUVNC-UHFFFAOYSA-N L-Dopa Natural products OC(=O)C(N)CC1=CC=C(O)C(O)=C1 WTDRDQBEARUVNC-UHFFFAOYSA-N 0.000 description 2
- 229910013470 LiC1 Inorganic materials 0.000 description 2
- NNJVILVZKWQKPM-UHFFFAOYSA-N Lidocaine Chemical compound CCN(CC)CC(=O)NC1=C(C)C=CC=C1C NNJVILVZKWQKPM-UHFFFAOYSA-N 0.000 description 2
- YJPIGAIKUZMOQA-UHFFFAOYSA-N Melatonin Natural products COC1=CC=C2N(C(C)=O)C=C(CCN)C2=C1 YJPIGAIKUZMOQA-UHFFFAOYSA-N 0.000 description 2
- NPPQSCRMBWNHMW-UHFFFAOYSA-N Meprobamate Chemical compound NC(=O)OCC(C)(CCC)COC(N)=O NPPQSCRMBWNHMW-UHFFFAOYSA-N 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- JEYCTXHKTXCGPB-UHFFFAOYSA-N Methaqualone Chemical compound CC1=CC=CC=C1N1C(=O)C2=CC=CC=C2N=C1C JEYCTXHKTXCGPB-UHFFFAOYSA-N 0.000 description 2
- 208000019695 Migraine disease Diseases 0.000 description 2
- HOKKHZGPKSLGJE-GSVOUGTGSA-N N-Methyl-D-aspartic acid Chemical compound CN[C@@H](C(O)=O)CC(O)=O HOKKHZGPKSLGJE-GSVOUGTGSA-N 0.000 description 2
- RTHCYVBBDHJXIQ-UHFFFAOYSA-N N-methyl-3-phenyl-3-[4-(trifluoromethyl)phenoxy]propan-1-amine Chemical compound C=1C=CC=CC=1C(CCNC)OC1=CC=C(C(F)(F)F)C=C1 RTHCYVBBDHJXIQ-UHFFFAOYSA-N 0.000 description 2
- CMWTZPSULFXXJA-UHFFFAOYSA-N Naproxen Natural products C1=C(C(C)C(O)=O)C=CC2=CC(OC)=CC=C21 CMWTZPSULFXXJA-UHFFFAOYSA-N 0.000 description 2
- 102000006538 Nitric Oxide Synthase Type I Human genes 0.000 description 2
- 108010008858 Nitric Oxide Synthase Type I Proteins 0.000 description 2
- 208000001294 Nociceptive Pain Diseases 0.000 description 2
- PHVGLTMQBUFIQQ-UHFFFAOYSA-N Nortryptiline Chemical compound C1CC2=CC=CC=C2C(=CCCNC)C2=CC=CC=C21 PHVGLTMQBUFIQQ-UHFFFAOYSA-N 0.000 description 2
- AHOUBRCZNHFOSL-UHFFFAOYSA-N Paroxetine hydrochloride Natural products C1=CC(F)=CC=C1C1C(COC=2C=C3OCOC3=CC=2)CNCC1 AHOUBRCZNHFOSL-UHFFFAOYSA-N 0.000 description 2
- PWRPUAKXMQAFCJ-UHFFFAOYSA-N Perlapine Chemical compound C1CN(C)CCN1C1=NC2=CC=CC=C2CC2=CC=CC=C12 PWRPUAKXMQAFCJ-UHFFFAOYSA-N 0.000 description 2
- RGCVKNLCSQQDEP-UHFFFAOYSA-N Perphenazine Chemical compound C1CN(CCO)CCN1CCCN1C2=CC(Cl)=CC=C2SC2=CC=CC=C21 RGCVKNLCSQQDEP-UHFFFAOYSA-N 0.000 description 2
- RMUCZJUITONUFY-UHFFFAOYSA-N Phenelzine Chemical compound NNCCC1=CC=CC=C1 RMUCZJUITONUFY-UHFFFAOYSA-N 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- MWQCHHACWWAQLJ-UHFFFAOYSA-N Prazepam Chemical compound O=C1CN=C(C=2C=CC=CC=2)C2=CC(Cl)=CC=C2N1CC1CC1 MWQCHHACWWAQLJ-UHFFFAOYSA-N 0.000 description 2
- QPCVHQBVMYCJOM-UHFFFAOYSA-N Propiverine Chemical compound C=1C=CC=CC=1C(C=1C=CC=CC=1)(OCCC)C(=O)OC1CCN(C)CC1 QPCVHQBVMYCJOM-UHFFFAOYSA-N 0.000 description 2
- IKMPWMZBZSAONZ-UHFFFAOYSA-N Quazepam Chemical compound FC1=CC=CC=C1C1=NCC(=S)N(CC(F)(F)F)C2=CC=C(Cl)C=C12 IKMPWMZBZSAONZ-UHFFFAOYSA-N 0.000 description 2
- BKRGVLQUQGGVSM-KBXCAEBGSA-N Revanil Chemical compound C1=CC(C=2[C@H](N(C)C[C@H](C=2)NC(=O)N(CC)CC)C2)=C3C2=CNC3=C1 BKRGVLQUQGGVSM-KBXCAEBGSA-N 0.000 description 2
- XSVMFMHYUFZWBK-NSHDSACASA-N Rivastigmine Chemical compound CCN(C)C(=O)OC1=CC=CC([C@H](C)N(C)C)=C1 XSVMFMHYUFZWBK-NSHDSACASA-N 0.000 description 2
- PPTYJKAXVCCBDU-UHFFFAOYSA-N Rohypnol Chemical compound N=1CC(=O)N(C)C2=CC=C([N+]([O-])=O)C=C2C=1C1=CC=CC=C1F PPTYJKAXVCCBDU-UHFFFAOYSA-N 0.000 description 2
- 208000013738 Sleep Initiation and Maintenance disease Diseases 0.000 description 2
- 239000005864 Sulphur Chemical group 0.000 description 2
- SEQDDYPDSLOBDC-UHFFFAOYSA-N Temazepam Chemical compound N=1C(O)C(=O)N(C)C2=CC=C(Cl)C=C2C=1C1=CC=CC=C1 SEQDDYPDSLOBDC-UHFFFAOYSA-N 0.000 description 2
- KLBQZWRITKRQQV-UHFFFAOYSA-N Thioridazine Chemical compound C12=CC(SC)=CC=C2SC2=CC=CC=C2N1CCC1CCCCN1C KLBQZWRITKRQQV-UHFFFAOYSA-N 0.000 description 2
- 108090000373 Tissue Plasminogen Activator Proteins 0.000 description 2
- 102000003978 Tissue Plasminogen Activator Human genes 0.000 description 2
- YYQRGCZGSFRBAM-UHFFFAOYSA-N Triclofos Chemical compound OP(O)(=O)OCC(Cl)(Cl)Cl YYQRGCZGSFRBAM-UHFFFAOYSA-N 0.000 description 2
- 206010046543 Urinary incontinence Diseases 0.000 description 2
- GDSCFOSHSOWNDL-UHFFFAOYSA-N Zolasepam Chemical compound N=1CC(=O)N(C)C(N(N=C2C)C)=C2C=1C1=CC=CC=C1F GDSCFOSHSOWNDL-UHFFFAOYSA-N 0.000 description 2
- QIHZPTTWMFMGNX-UHFFFAOYSA-N [3-[3-amino-6-chloro-4-fluoro-1-[2-(trifluoromethyl)pyridin-4-yl]isoindol-1-yl]phenyl] trifluoromethanesulfonate Chemical compound C12=CC(Cl)=CC(F)=C2C(N)=NC1(C=1C=C(N=CC=1)C(F)(F)F)C1=CC=CC(OS(=O)(=O)C(F)(F)F)=C1 QIHZPTTWMFMGNX-UHFFFAOYSA-N 0.000 description 2
- 229960000446 abciximab Drugs 0.000 description 2
- 229940056213 abilify Drugs 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 229940099983 activase Drugs 0.000 description 2
- 229960003148 adinazolam Drugs 0.000 description 2
- GJSLOMWRLALDCT-UHFFFAOYSA-N adinazolam Chemical compound C12=CC(Cl)=CC=C2N2C(CN(C)C)=NN=C2CN=C1C1=CC=CC=C1 GJSLOMWRLALDCT-UHFFFAOYSA-N 0.000 description 2
- 239000000556 agonist Substances 0.000 description 2
- 125000000304 alkynyl group Chemical group 0.000 description 2
- 229960000880 allobarbital Drugs 0.000 description 2
- 229960002133 almotriptan Drugs 0.000 description 2
- 229950000420 alnespirone Drugs 0.000 description 2
- 229950003674 alonimid Drugs 0.000 description 2
- 229960004538 alprazolam Drugs 0.000 description 2
- VREFGVBLTWBCJP-UHFFFAOYSA-N alprazolam Chemical compound C12=CC(Cl)=CC=C2N2C(C)=NN=C2CN=C1C1=CC=CC=C1 VREFGVBLTWBCJP-UHFFFAOYSA-N 0.000 description 2
- 229960003805 amantadine Drugs 0.000 description 2
- DKNWSYNQZKUICI-UHFFFAOYSA-N amantadine Chemical compound C1C(C2)CC3CC2CC1(N)C3 DKNWSYNQZKUICI-UHFFFAOYSA-N 0.000 description 2
- 229960003036 amisulpride Drugs 0.000 description 2
- NTJOBXMMWNYJFB-UHFFFAOYSA-N amisulpride Chemical compound CCN1CCCC1CNC(=O)C1=CC(S(=O)(=O)CC)=C(N)C=C1OC NTJOBXMMWNYJFB-UHFFFAOYSA-N 0.000 description 2
- 229960000836 amitriptyline Drugs 0.000 description 2
- KRMDCWKBEZIMAB-UHFFFAOYSA-N amitriptyline Chemical compound C1CC2=CC=CC=C2C(=CCCN(C)C)C2=CC=CC=C21 KRMDCWKBEZIMAB-UHFFFAOYSA-N 0.000 description 2
- 235000019270 ammonium chloride Nutrition 0.000 description 2
- 229960001301 amobarbital Drugs 0.000 description 2
- 229960002519 amoxapine Drugs 0.000 description 2
- QWGDMFLQWFTERH-UHFFFAOYSA-N amoxapine Chemical compound C12=CC(Cl)=CC=C2OC2=CC=CC=C2N=C1N1CCNCC1 QWGDMFLQWFTERH-UHFFFAOYSA-N 0.000 description 2
- 239000005557 antagonist Substances 0.000 description 2
- 229940125681 anticonvulsant agent Drugs 0.000 description 2
- 239000001961 anticonvulsive agent Substances 0.000 description 2
- 239000000935 antidepressant agent Substances 0.000 description 2
- 229940005513 antidepressants Drugs 0.000 description 2
- 239000000164 antipsychotic agent Substances 0.000 description 2
- 229940005529 antipsychotics Drugs 0.000 description 2
- 239000002249 anxiolytic agent Substances 0.000 description 2
- 230000000949 anxiolytic effect Effects 0.000 description 2
- 229940005530 anxiolytics Drugs 0.000 description 2
- 238000013459 approach Methods 0.000 description 2
- 229960005245 asenapine Drugs 0.000 description 2
- 229940127236 atypical antipsychotics Drugs 0.000 description 2
- 229940125717 barbiturate Drugs 0.000 description 2
- 229950001957 bentazepam Drugs 0.000 description 2
- AIZFEOPQVZBNGH-UHFFFAOYSA-N bentazepam Chemical compound C1=2C=3CCCCC=3SC=2NC(=O)CN=C1C1=CC=CC=C1 AIZFEOPQVZBNGH-UHFFFAOYSA-N 0.000 description 2
- GNRXCIONJWKSEA-UHFFFAOYSA-N benzoctamine Chemical compound C12=CC=CC=C2C2(CNC)C3=CC=CC=C3C1CC2 GNRXCIONJWKSEA-UHFFFAOYSA-N 0.000 description 2
- 229960001303 benzoctamine Drugs 0.000 description 2
- 229940049706 benzodiazepine Drugs 0.000 description 2
- 150000001557 benzodiazepines Chemical class 0.000 description 2
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 description 2
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 2
- 229950009087 bifeprunox Drugs 0.000 description 2
- IEPBPSSCIZTJIF-UHFFFAOYSA-N bis(2,2,2-trichloroethyl) carbonate Chemical compound ClC(Cl)(Cl)COC(=O)OCC(Cl)(Cl)Cl IEPBPSSCIZTJIF-UHFFFAOYSA-N 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- 229960002729 bromazepam Drugs 0.000 description 2
- 125000001246 bromo group Chemical group Br* 0.000 description 2
- 229960002802 bromocriptine Drugs 0.000 description 2
- OZVBMTJYIDMWIL-AYFBDAFISA-N bromocriptine Chemical compound C1=CC(C=2[C@H](N(C)C[C@@H](C=2)C(=O)N[C@]2(C(=O)N3[C@H](C(N4CCC[C@H]4[C@]3(O)O2)=O)CC(C)C)C(C)C)C2)=C3C2=C(Br)NC3=C1 OZVBMTJYIDMWIL-AYFBDAFISA-N 0.000 description 2
- 229960003051 brotizolam Drugs 0.000 description 2
- 229960001058 bupropion Drugs 0.000 description 2
- SNPPWIUOZRMYNY-UHFFFAOYSA-N bupropion Chemical compound CC(C)(C)NC(C)C(=O)C1=CC=CC(Cl)=C1 SNPPWIUOZRMYNY-UHFFFAOYSA-N 0.000 description 2
- QWCRAEMEVRGPNT-UHFFFAOYSA-N buspirone Chemical compound C1C(=O)N(CCCCN2CCN(CC2)C=2N=CC=CN=2)C(=O)CC21CCCC2 QWCRAEMEVRGPNT-UHFFFAOYSA-N 0.000 description 2
- 229960002495 buspirone Drugs 0.000 description 2
- 229940015694 butabarbital Drugs 0.000 description 2
- 229960002546 butalbital Drugs 0.000 description 2
- UZVHFVZFNXBMQJ-UHFFFAOYSA-N butalbital Chemical compound CC(C)CC1(CC=C)C(=O)NC(=O)NC1=O UZVHFVZFNXBMQJ-UHFFFAOYSA-N 0.000 description 2
- 229960004596 cabergoline Drugs 0.000 description 2
- XJHCXCQVJFPJIK-UHFFFAOYSA-M caesium fluoride Chemical compound [F-].[Cs+] XJHCXCQVJFPJIK-UHFFFAOYSA-M 0.000 description 2
- HLSLSXBFTXUKCY-UHFFFAOYSA-N capuride Chemical compound CCC(C)C(CC)C(=O)NC(N)=O HLSLSXBFTXUKCY-UHFFFAOYSA-N 0.000 description 2
- 229950003152 capuride Drugs 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 229960000590 celecoxib Drugs 0.000 description 2
- RZEKVGVHFLEQIL-UHFFFAOYSA-N celecoxib Chemical compound C1=CC(C)=CC=C1C1=CC(C(F)(F)F)=NN1C1=CC=C(S(N)(=O)=O)C=C1 RZEKVGVHFLEQIL-UHFFFAOYSA-N 0.000 description 2
- UKFDTMNJMKWWNK-UHFFFAOYSA-N chembl2104165 Chemical compound C12=CC(Cl)=CC=C2N\C(=N\CC2CC2)C[N+]([O-])=C1C1=CC=CC=C1 UKFDTMNJMKWWNK-UHFFFAOYSA-N 0.000 description 2
- 229960004782 chlordiazepoxide Drugs 0.000 description 2
- ANTSCNMPPGJYLG-UHFFFAOYSA-N chlordiazepoxide Chemical compound O=N=1CC(NC)=NC2=CC=C(Cl)C=C2C=1C1=CC=CC=C1 ANTSCNMPPGJYLG-UHFFFAOYSA-N 0.000 description 2
- 229960001076 chlorpromazine Drugs 0.000 description 2
- ZPEIMTDSQAKGNT-UHFFFAOYSA-N chlorpromazine Chemical compound C1=C(Cl)C=C2N(CCCN(C)C)C3=CC=CC=C3SC2=C1 ZPEIMTDSQAKGNT-UHFFFAOYSA-N 0.000 description 2
- 239000000544 cholinesterase inhibitor Substances 0.000 description 2
- 210000000349 chromosome Anatomy 0.000 description 2
- 229960001653 citalopram Drugs 0.000 description 2
- 229960001284 citicoline Drugs 0.000 description 2
- 238000003776 cleavage reaction Methods 0.000 description 2
- 229960004606 clomipramine Drugs 0.000 description 2
- DGBIGWXXNGSACT-UHFFFAOYSA-N clonazepam Chemical compound C12=CC([N+](=O)[O-])=CC=C2NC(=O)CN=C1C1=CC=CC=C1Cl DGBIGWXXNGSACT-UHFFFAOYSA-N 0.000 description 2
- 229960003120 clonazepam Drugs 0.000 description 2
- 229950000551 cloperidone Drugs 0.000 description 2
- 229960004362 clorazepate Drugs 0.000 description 2
- XDDJGVMJFWAHJX-UHFFFAOYSA-N clorazepic acid Chemical compound C12=CC(Cl)=CC=C2NC(=O)C(C(=O)O)N=C1C1=CC=CC=C1 XDDJGVMJFWAHJX-UHFFFAOYSA-N 0.000 description 2
- 229940068796 clozaril Drugs 0.000 description 2
- 239000000470 constituent Substances 0.000 description 2
- 238000011254 conventional chemotherapy Methods 0.000 description 2
- QTMDXZNDVAMKGV-UHFFFAOYSA-L copper(ii) bromide Chemical compound [Cu+2].[Br-].[Br-] QTMDXZNDVAMKGV-UHFFFAOYSA-L 0.000 description 2
- 229950005056 crobenetine Drugs 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 125000004122 cyclic group Chemical group 0.000 description 2
- 229950010040 cyprazepam Drugs 0.000 description 2
- 230000001086 cytosolic effect Effects 0.000 description 2
- 229960003914 desipramine Drugs 0.000 description 2
- 229950001282 desmoteplase Drugs 0.000 description 2
- UPMOVJBGNREKJV-CQOQZXRMSA-N dexclamol Chemical compound C12=CC=CC=C2CCC2=CC=CC3=C2[C@@H]1CN1CC[C@@](C(C)C)(O)C[C@@H]13 UPMOVJBGNREKJV-CQOQZXRMSA-N 0.000 description 2
- 229950005215 dexclamol Drugs 0.000 description 2
- 229960003529 diazepam Drugs 0.000 description 2
- AAOVKJBEBIDNHE-UHFFFAOYSA-N diazepam Chemical compound N=1CC(=O)N(C)C2=CC=C(Cl)C=C2C=1C1=CC=CC=C1 AAOVKJBEBIDNHE-UHFFFAOYSA-N 0.000 description 2
- ATKXDQOHNICLQW-UHFFFAOYSA-N dichloralphenazone Chemical compound OC(O)C(Cl)(Cl)Cl.OC(O)C(Cl)(Cl)Cl.CN1C(C)=CC(=O)N1C1=CC=CC=C1 ATKXDQOHNICLQW-UHFFFAOYSA-N 0.000 description 2
- 229960005422 dichloralphenazone Drugs 0.000 description 2
- 125000003963 dichloro group Chemical group Cl* 0.000 description 2
- DCOPUUMXTXDBNB-UHFFFAOYSA-N diclofenac Chemical compound OC(=O)CC1=CC=CC=C1NC1=C(Cl)C=CC=C1Cl DCOPUUMXTXDBNB-UHFFFAOYSA-N 0.000 description 2
- 229960001259 diclofenac Drugs 0.000 description 2
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 2
- IJKVHSBPTUYDLN-UHFFFAOYSA-N dihydroxy(oxo)silane Chemical compound O[Si](O)=O IJKVHSBPTUYDLN-UHFFFAOYSA-N 0.000 description 2
- 229960000520 diphenhydramine Drugs 0.000 description 2
- XLZOVRYBVCMCGL-BPNVQINPSA-L disodium;4-[(z)-[tert-butyl(oxido)azaniumylidene]methyl]benzene-1,3-disulfonate Chemical compound [Na+].[Na+].CC(C)(C)[N+](\[O-])=C\C1=CC=C(S([O-])(=O)=O)C=C1S([O-])(=O)=O XLZOVRYBVCMCGL-BPNVQINPSA-L 0.000 description 2
- 229940052760 dopamine agonists Drugs 0.000 description 2
- 239000003136 dopamine receptor stimulating agent Substances 0.000 description 2
- 239000000221 dopamine uptake inhibitor Substances 0.000 description 2
- 229960005426 doxepin Drugs 0.000 description 2
- ODQWQRRAPPTVAG-GZTJUZNOSA-N doxepin Chemical compound C1OC2=CC=CC=C2C(=C/CCN(C)C)/C2=CC=CC=C21 ODQWQRRAPPTVAG-GZTJUZNOSA-N 0.000 description 2
- 229960002472 eletriptan Drugs 0.000 description 2
- PWVXXGRKLHYWKM-LJQANCHMSA-N eletriptan Chemical compound CN1CCC[C@@H]1CC(C1=C2)=CNC1=CC=C2CCS(=O)(=O)C1=CC=CC=C1 PWVXXGRKLHYWKM-LJQANCHMSA-N 0.000 description 2
- 229950007566 elzasonan Drugs 0.000 description 2
- WSEQXVZVJXJVFP-FQEVSTJZSA-N escitalopram Chemical compound C1([C@]2(C3=CC=C(C=C3CO2)C#N)CCCN(C)C)=CC=C(F)C=C1 WSEQXVZVJXJVFP-FQEVSTJZSA-N 0.000 description 2
- 229960004341 escitalopram Drugs 0.000 description 2
- CDCHDCWJMGXXRH-UHFFFAOYSA-N estazolam Chemical compound C=1C(Cl)=CC=C(N2C=NN=C2CN=2)C=1C=2C1=CC=CC=C1 CDCHDCWJMGXXRH-UHFFFAOYSA-N 0.000 description 2
- 229960002336 estazolam Drugs 0.000 description 2
- GBBSUAFBMRNDJC-INIZCTEOSA-N eszopiclone Chemical compound C1CN(C)CCN1C(=O)O[C@H]1C2=NC=CN=C2C(=O)N1C1=CC=C(Cl)C=N1 GBBSUAFBMRNDJC-INIZCTEOSA-N 0.000 description 2
- 229960001578 eszopiclone Drugs 0.000 description 2
- DNJIEGIFACGWOD-UHFFFAOYSA-N ethanethiol Chemical compound CCS DNJIEGIFACGWOD-UHFFFAOYSA-N 0.000 description 2
- 229960004447 ethchlorvynol Drugs 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 229960001690 etomidate Drugs 0.000 description 2
- NPUKDXXFDDZOKR-LLVKDONJSA-N etomidate Chemical compound CCOC(=O)C1=CN=CN1[C@H](C)C1=CC=CC=C1 NPUKDXXFDDZOKR-LLVKDONJSA-N 0.000 description 2
- 229960004945 etoricoxib Drugs 0.000 description 2
- MNJVRJDLRVPLFE-UHFFFAOYSA-N etoricoxib Chemical compound C1=NC(C)=CC=C1C1=NC=C(Cl)C=C1C1=CC=C(S(C)(=O)=O)C=C1 MNJVRJDLRVPLFE-UHFFFAOYSA-N 0.000 description 2
- 229950002489 fenobam Drugs 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 229960002200 flunitrazepam Drugs 0.000 description 2
- 229960003528 flurazepam Drugs 0.000 description 2
- SAADBVWGJQAEFS-UHFFFAOYSA-N flurazepam Chemical compound N=1CC(=O)N(CCN(CC)CC)C2=CC=C(Cl)C=C2C=1C1=CC=CC=C1F SAADBVWGJQAEFS-UHFFFAOYSA-N 0.000 description 2
- CJOFXWAVKWHTFT-XSFVSMFZSA-N fluvoxamine Chemical compound COCCCC\C(=N/OCCN)C1=CC=C(C(F)(F)F)C=C1 CJOFXWAVKWHTFT-XSFVSMFZSA-N 0.000 description 2
- 229960004038 fluvoxamine Drugs 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- JMYCGCXYZZHWMO-UHFFFAOYSA-N fosazepam Chemical compound N=1CC(=O)N(CP(C)(=O)C)C2=CC=C(Cl)C=C2C=1C1=CC=CC=C1 JMYCGCXYZZHWMO-UHFFFAOYSA-N 0.000 description 2
- 229950006306 fosazepam Drugs 0.000 description 2
- 229960002284 frovatriptan Drugs 0.000 description 2
- SIBNYOSJIXCDRI-SECBINFHSA-N frovatriptan Chemical compound C1=C(C(N)=O)[CH]C2=C(C[C@H](NC)CC3)C3=NC2=C1 SIBNYOSJIXCDRI-SECBINFHSA-N 0.000 description 2
- 125000002541 furyl group Chemical group 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 229940003380 geodon Drugs 0.000 description 2
- QOIGKGMMAGJZNZ-UHFFFAOYSA-N gepirone Chemical compound O=C1CC(C)(C)CC(=O)N1CCCCN1CCN(C=2N=CC=CN=2)CC1 QOIGKGMMAGJZNZ-UHFFFAOYSA-N 0.000 description 2
- 229960000647 gepirone Drugs 0.000 description 2
- 229960002972 glutethimide Drugs 0.000 description 2
- 229960002158 halazepam Drugs 0.000 description 2
- 125000001188 haloalkyl group Chemical group 0.000 description 2
- 229960003878 haloperidol Drugs 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 2
- ZQDWXGKKHFNSQK-UHFFFAOYSA-N hydroxyzine Chemical compound C1CN(CCOCCO)CCN1C(C=1C=CC(Cl)=CC=1)C1=CC=CC=C1 ZQDWXGKKHFNSQK-UHFFFAOYSA-N 0.000 description 2
- 229960000930 hydroxyzine Drugs 0.000 description 2
- XMXHEBAFVSFQEX-UHFFFAOYSA-N iloperidone Chemical compound COC1=CC(C(C)=O)=CC=C1OCCCN1CCC(C=2C3=CC=C(F)C=C3ON=2)CC1 XMXHEBAFVSFQEX-UHFFFAOYSA-N 0.000 description 2
- 229960003162 iloperidone Drugs 0.000 description 2
- BCGWQEUPMDMJNV-UHFFFAOYSA-N imipramine Chemical compound C1CC2=CC=CC=C2N(CCCN(C)C)C2=CC=CC=C21 BCGWQEUPMDMJNV-UHFFFAOYSA-N 0.000 description 2
- 229960004801 imipramine Drugs 0.000 description 2
- 206010022437 insomnia Diseases 0.000 description 2
- 239000011630 iodine Substances 0.000 description 2
- 229950003599 ipsapirone Drugs 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- 229940060977 lidoderm Drugs 0.000 description 2
- 229960003587 lisuride Drugs 0.000 description 2
- 229960001078 lithium Drugs 0.000 description 2
- 229960004391 lorazepam Drugs 0.000 description 2
- 229960004033 lormetazepam Drugs 0.000 description 2
- 229960000423 loxapine Drugs 0.000 description 2
- YQZBAXDVDZTKEQ-UHFFFAOYSA-N loxapine succinate Chemical compound [H+].[H+].[O-]C(=O)CCC([O-])=O.C1CN(C)CCN1C1=NC2=CC=CC=C2OC2=CC=C(Cl)C=C12 YQZBAXDVDZTKEQ-UHFFFAOYSA-N 0.000 description 2
- 229960002373 loxoprofen Drugs 0.000 description 2
- BAZQYVYVKYOAGO-UHFFFAOYSA-M loxoprofen sodium hydrate Chemical compound O.O.[Na+].C1=CC(C(C([O-])=O)C)=CC=C1CC1C(=O)CCC1 BAZQYVYVKYOAGO-UHFFFAOYSA-M 0.000 description 2
- 229960000994 lumiracoxib Drugs 0.000 description 2
- KHPKQFYUPIUARC-UHFFFAOYSA-N lumiracoxib Chemical compound OC(=O)CC1=CC(C)=CC=C1NC1=C(F)C=CC=C1Cl KHPKQFYUPIUARC-UHFFFAOYSA-N 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- 235000019341 magnesium sulphate Nutrition 0.000 description 2
- LVKCSZQWLOVUGB-UHFFFAOYSA-M magnesium;propane;bromide Chemical compound [Mg+2].[Br-].C[CH-]C LVKCSZQWLOVUGB-UHFFFAOYSA-M 0.000 description 2
- 229960004090 maprotiline Drugs 0.000 description 2
- QSLMDECMDJKHMQ-GSXCWMCISA-N maprotiline Chemical compound C12=CC=CC=C2[C@@]2(CCCNC)C3=CC=CC=C3[C@@H]1CC2 QSLMDECMDJKHMQ-GSXCWMCISA-N 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- SFITWQDBYUMAPS-UHFFFAOYSA-N mecloqualone Chemical compound CC1=NC2=CC=CC=C2C(=O)N1C1=CC=CC=C1Cl SFITWQDBYUMAPS-UHFFFAOYSA-N 0.000 description 2
- 229950007403 mecloqualone Drugs 0.000 description 2
- 229960003987 melatonin Drugs 0.000 description 2
- DRLFMBDRBRZALE-UHFFFAOYSA-N melatonin Chemical compound COC1=CC=C2NC=C(CCNC(C)=O)C2=C1 DRLFMBDRBRZALE-UHFFFAOYSA-N 0.000 description 2
- 239000012528 membrane Substances 0.000 description 2
- ALARQZQTBTVLJV-UHFFFAOYSA-N mephobarbital Chemical compound C=1C=CC=CC=1C1(CC)C(=O)NC(=O)N(C)C1=O ALARQZQTBTVLJV-UHFFFAOYSA-N 0.000 description 2
- 229960004815 meprobamate Drugs 0.000 description 2
- SLVMESMUVMCQIY-UHFFFAOYSA-N mesoridazine Chemical compound CN1CCCCC1CCN1C2=CC(S(C)=O)=CC=C2SC2=CC=CC=C21 SLVMESMUVMCQIY-UHFFFAOYSA-N 0.000 description 2
- 229960000300 mesoridazine Drugs 0.000 description 2
- 229960002803 methaqualone Drugs 0.000 description 2
- 229960001703 methylphenobarbital Drugs 0.000 description 2
- 229950010642 midaflur Drugs 0.000 description 2
- 229960003793 midazolam Drugs 0.000 description 2
- DDLIGBOFAVUZHB-UHFFFAOYSA-N midazolam Chemical compound C12=CC(Cl)=CC=C2N2C(C)=NC=C2CN=C1C1=CC=CC=C1F DDLIGBOFAVUZHB-UHFFFAOYSA-N 0.000 description 2
- 206010027599 migraine Diseases 0.000 description 2
- 229940101972 mirapex Drugs 0.000 description 2
- 239000004050 mood stabilizer Substances 0.000 description 2
- 229940127237 mood stabilizer Drugs 0.000 description 2
- 230000035772 mutation Effects 0.000 description 2
- SNPIZVQQSHOMHS-UHFFFAOYSA-N n-[(2-chloropyridin-4-yl)-(2-cyano-3-fluorophenyl)methylidene]-2-methylpropane-2-sulfinamide Chemical compound C=1C=CC(F)=C(C#N)C=1C(=NS(=O)C(C)(C)C)C1=CC=NC(Cl)=C1 SNPIZVQQSHOMHS-UHFFFAOYSA-N 0.000 description 2
- QQIPWSPFYMIHBF-UHFFFAOYSA-N n-[(2-cyano-3-fluorophenyl)-(2-methoxypyridin-4-yl)methylidene]-2-methylpropane-2-sulfinamide Chemical compound C1=NC(OC)=CC(C(=NS(=O)C(C)(C)C)C=2C(=C(F)C=CC=2)C#N)=C1 QQIPWSPFYMIHBF-UHFFFAOYSA-N 0.000 description 2
- GAIDANOSEXTYDZ-UHFFFAOYSA-N n-[(3-bromophenyl)-(5-chloro-2-cyano-3-fluorophenyl)methylidene]-2-methylpropane-2-sulfinamide Chemical compound C=1C(Cl)=CC(F)=C(C#N)C=1C(=NS(=O)C(C)(C)C)C1=CC=CC(Br)=C1 GAIDANOSEXTYDZ-UHFFFAOYSA-N 0.000 description 2
- PWGRZMPIWQIYTA-UHFFFAOYSA-N n-[(5-chloro-2-cyano-3-fluorophenyl)-(3-methoxyphenyl)methylidene]-2-methylpropane-2-sulfinamide Chemical compound COC1=CC=CC(C(=NS(=O)C(C)(C)C)C=2C(=C(F)C=C(Cl)C=2)C#N)=C1 PWGRZMPIWQIYTA-UHFFFAOYSA-N 0.000 description 2
- NDVZIUGCCMZHLG-UHFFFAOYSA-N n-methyl-3-(2-methylsulfanylphenoxy)-3-phenylpropan-1-amine Chemical compound C=1C=CC=CC=1C(CCNC)OC1=CC=CC=C1SC NDVZIUGCCMZHLG-UHFFFAOYSA-N 0.000 description 2
- CMWTZPSULFXXJA-VIFPVBQESA-N naproxen Chemical compound C1=C([C@H](C)C(O)=O)C=CC2=CC(OC)=CC=C21 CMWTZPSULFXXJA-VIFPVBQESA-N 0.000 description 2
- 229960002009 naproxen Drugs 0.000 description 2
- 229960005254 naratriptan Drugs 0.000 description 2
- AMKVXSZCKVJAGH-UHFFFAOYSA-N naratriptan Chemical compound C12=CC(CCS(=O)(=O)NC)=CC=C2NC=C1C1CCN(C)CC1 AMKVXSZCKVJAGH-UHFFFAOYSA-N 0.000 description 2
- VRBKIVRKKCLPHA-UHFFFAOYSA-N nefazodone Chemical compound O=C1N(CCOC=2C=CC=CC=2)C(CC)=NN1CCCN(CC1)CCN1C1=CC=CC(Cl)=C1 VRBKIVRKKCLPHA-UHFFFAOYSA-N 0.000 description 2
- 229960001800 nefazodone Drugs 0.000 description 2
- 208000004296 neuralgia Diseases 0.000 description 2
- 208000021722 neuropathic pain Diseases 0.000 description 2
- 229960002715 nicotine Drugs 0.000 description 2
- SNICXCGAKADSCV-UHFFFAOYSA-N nicotine Natural products CN1CCCC1C1=CC=CN=C1 SNICXCGAKADSCV-UHFFFAOYSA-N 0.000 description 2
- CBDPCXYQNVDTMW-UHFFFAOYSA-N nisobamate Chemical compound NC(=O)OCC(C)(C(C)CC)COC(=O)NC(C)C CBDPCXYQNVDTMW-UHFFFAOYSA-N 0.000 description 2
- 229950008643 nisobamate Drugs 0.000 description 2
- KJONHKAYOJNZEC-UHFFFAOYSA-N nitrazepam Chemical compound C12=CC([N+](=O)[O-])=CC=C2NC(=O)CN=C1C1=CC=CC=C1 KJONHKAYOJNZEC-UHFFFAOYSA-N 0.000 description 2
- 229960001454 nitrazepam Drugs 0.000 description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 description 2
- 229960001158 nortriptyline Drugs 0.000 description 2
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 2
- 125000002524 organometallic group Chemical group 0.000 description 2
- ADIMAYPTOBDMTL-UHFFFAOYSA-N oxazepam Chemical compound C12=CC(Cl)=CC=C2NC(=O)C(O)N=C1C1=CC=CC=C1 ADIMAYPTOBDMTL-UHFFFAOYSA-N 0.000 description 2
- 229960004535 oxazepam Drugs 0.000 description 2
- 229960005434 oxybutynin Drugs 0.000 description 2
- 229960001057 paliperidone Drugs 0.000 description 2
- 229910052763 palladium Inorganic materials 0.000 description 2
- YJVFFLUZDVXJQI-UHFFFAOYSA-L palladium(ii) acetate Chemical compound [Pd+2].CC([O-])=O.CC([O-])=O YJVFFLUZDVXJQI-UHFFFAOYSA-L 0.000 description 2
- 229960005489 paracetamol Drugs 0.000 description 2
- 229960002296 paroxetine Drugs 0.000 description 2
- 229960001412 pentobarbital Drugs 0.000 description 2
- 229960004851 pergolide Drugs 0.000 description 2
- YEHCICAEULNIGD-MZMPZRCHSA-N pergolide Chemical compound C1=CC([C@H]2C[C@@H](CSC)CN([C@@H]2C2)CCC)=C3C2=CNC3=C1 YEHCICAEULNIGD-MZMPZRCHSA-N 0.000 description 2
- 229950009253 perlapine Drugs 0.000 description 2
- 229960000762 perphenazine Drugs 0.000 description 2
- 229960000964 phenelzine Drugs 0.000 description 2
- DDBREPKUVSBGFI-UHFFFAOYSA-N phenobarbital Chemical compound C=1C=CC=CC=1C1(CC)C(=O)NC(=O)NC1=O DDBREPKUVSBGFI-UHFFFAOYSA-N 0.000 description 2
- 229960002695 phenobarbital Drugs 0.000 description 2
- 229950000688 phenothiazine Drugs 0.000 description 2
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 2
- YVUQSNJEYSNKRX-UHFFFAOYSA-N pimozide Chemical compound C1=CC(F)=CC=C1C(C=1C=CC(F)=CC=1)CCCN1CCC(N2C(NC3=CC=CC=C32)=O)CC1 YVUQSNJEYSNKRX-UHFFFAOYSA-N 0.000 description 2
- 229960003634 pimozide Drugs 0.000 description 2
- 229960003089 pramipexole Drugs 0.000 description 2
- 229960004856 prazepam Drugs 0.000 description 2
- AYXYPKUFHZROOJ-ZETCQYMHSA-N pregabalin Chemical compound CC(C)C[C@H](CN)CC(O)=O AYXYPKUFHZROOJ-ZETCQYMHSA-N 0.000 description 2
- WIKYUJGCLQQFNW-UHFFFAOYSA-N prochlorperazine Chemical compound C1CN(C)CCN1CCCN1C2=CC(Cl)=CC=C2SC2=CC=CC=C21 WIKYUJGCLQQFNW-UHFFFAOYSA-N 0.000 description 2
- 229960003111 prochlorperazine Drugs 0.000 description 2
- 229960003510 propiverine Drugs 0.000 description 2
- 229960004134 propofol Drugs 0.000 description 2
- OLBCVFGFOZPWHH-UHFFFAOYSA-N propofol Chemical compound CC(C)C1=CC=CC(C(C)C)=C1O OLBCVFGFOZPWHH-UHFFFAOYSA-N 0.000 description 2
- 229960002601 protriptyline Drugs 0.000 description 2
- BWPIARFWQZKAIA-UHFFFAOYSA-N protriptyline Chemical compound C1=CC2=CC=CC=C2C(CCCNC)C2=CC=CC=C21 BWPIARFWQZKAIA-UHFFFAOYSA-N 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 2
- 229960001964 quazepam Drugs 0.000 description 2
- ZTHJULTYCAQOIJ-WXXKFALUSA-N quetiapine fumarate Chemical compound [H+].[H+].[O-]C(=O)\C=C\C([O-])=O.C1CN(CCOCCO)CCN1C1=NC2=CC=CC=C2SC2=CC=CC=C12.C1CN(CCOCCO)CCN1C1=NC2=CC=CC=C2SC2=CC=CC=C12 ZTHJULTYCAQOIJ-WXXKFALUSA-N 0.000 description 2
- RUOKEQAAGRXIBM-GFCCVEGCSA-N rasagiline Chemical compound C1=CC=C2[C@H](NCC#C)CCC2=C1 RUOKEQAAGRXIBM-GFCCVEGCSA-N 0.000 description 2
- 229960000245 rasagiline Drugs 0.000 description 2
- 238000009790 rate-determining step (RDS) Methods 0.000 description 2
- 239000011535 reaction buffer Substances 0.000 description 2
- 229960003770 reboxetine Drugs 0.000 description 2
- CBQGYUDMJHNJBX-RTBURBONSA-N reboxetine Chemical compound CCOC1=CC=CC=C1O[C@H](C=1C=CC=CC=1)[C@@H]1OCCNC1 CBQGYUDMJHNJBX-RTBURBONSA-N 0.000 description 2
- MQGIGGJUPITZSE-UHFFFAOYSA-N reclazepam Chemical compound C12=CC(Cl)=CC=C2N(C=2OCC(=O)N=2)CCN=C1C1=CC=CC=C1Cl MQGIGGJUPITZSE-UHFFFAOYSA-N 0.000 description 2
- 229950004797 reclazepam Drugs 0.000 description 2
- YGYBFMRFXNDIPO-QGZVFWFLSA-N repinotan Chemical compound O=S1(=O)C2=CC=CC=C2C(=O)N1CCCCNC[C@@H]1OC2=CC=CC=C2CC1 YGYBFMRFXNDIPO-QGZVFWFLSA-N 0.000 description 2
- 229950009693 repinotan Drugs 0.000 description 2
- 229940113775 requip Drugs 0.000 description 2
- 229940106887 risperdal Drugs 0.000 description 2
- 229960000425 rizatriptan Drugs 0.000 description 2
- TXHZXHICDBAVJW-UHFFFAOYSA-N rizatriptan Chemical compound C=1[C]2C(CCN(C)C)=CN=C2C=CC=1CN1C=NC=N1 TXHZXHICDBAVJW-UHFFFAOYSA-N 0.000 description 2
- 229960000371 rofecoxib Drugs 0.000 description 2
- RZJQGNCSTQAWON-UHFFFAOYSA-N rofecoxib Chemical compound C1=CC(S(=O)(=O)C)=CC=C1C1=C(C=2C=CC=CC=2)C(=O)OC1 RZJQGNCSTQAWON-UHFFFAOYSA-N 0.000 description 2
- 229950004692 roletamide Drugs 0.000 description 2
- 229960001879 ropinirole Drugs 0.000 description 2
- MGZRUJJLWFDVTE-UHFFFAOYSA-N s-ethyl 2-bromopyridine-4-carbothioate Chemical compound CCSC(=O)C1=CC=NC(Br)=C1 MGZRUJJLWFDVTE-UHFFFAOYSA-N 0.000 description 2
- 230000007017 scission Effects 0.000 description 2
- KQPKPCNLIDLUMF-UHFFFAOYSA-N secobarbital Chemical compound CCCC(C)C1(CC=C)C(=O)NC(=O)NC1=O KQPKPCNLIDLUMF-UHFFFAOYSA-N 0.000 description 2
- 229960002060 secobarbital Drugs 0.000 description 2
- MEZLKOACVSPNER-GFCCVEGCSA-N selegiline Chemical compound C#CCN(C)[C@H](C)CC1=CC=CC=C1 MEZLKOACVSPNER-GFCCVEGCSA-N 0.000 description 2
- 229940035004 seroquel Drugs 0.000 description 2
- GZKLJWGUPQBVJQ-UHFFFAOYSA-N sertindole Chemical compound C1=CC(F)=CC=C1N1C2=CC=C(Cl)C=C2C(C2CCN(CCN3C(NCC3)=O)CC2)=C1 GZKLJWGUPQBVJQ-UHFFFAOYSA-N 0.000 description 2
- 229960000652 sertindole Drugs 0.000 description 2
- VGKDLMBJGBXTGI-SJCJKPOMSA-N sertraline Chemical compound C1([C@@H]2CC[C@@H](C3=CC=CC=C32)NC)=CC=C(Cl)C(Cl)=C1 VGKDLMBJGBXTGI-SJCJKPOMSA-N 0.000 description 2
- 229960002073 sertraline Drugs 0.000 description 2
- UNAANXDKBXWMLN-UHFFFAOYSA-N sibutramine Chemical compound C=1C=C(Cl)C=CC=1C1(C(N(C)C)CC(C)C)CCC1 UNAANXDKBXWMLN-UHFFFAOYSA-N 0.000 description 2
- 229960004425 sibutramine Drugs 0.000 description 2
- FBOUYBDGKBSUES-VXKWHMMOSA-N solifenacin Chemical compound C1([C@H]2C3=CC=CC=C3CCN2C(O[C@@H]2C3CCN(CC3)C2)=O)=CC=CC=C1 FBOUYBDGKBSUES-VXKWHMMOSA-N 0.000 description 2
- 229960003855 solifenacin Drugs 0.000 description 2
- WZAIVXXKOAWTGQ-UHFFFAOYSA-N spiro[2,3-dihydronaphthalene-4,3'-piperidine]-1,2',6'-trione Chemical compound O=C1NC(=O)CCC11C2=CC=CC=C2C(=O)CC1 WZAIVXXKOAWTGQ-UHFFFAOYSA-N 0.000 description 2
- KXCAEQNNTZANTK-UHFFFAOYSA-N stannane Chemical compound [SnH4] KXCAEQNNTZANTK-UHFFFAOYSA-N 0.000 description 2
- 229910000080 stannane Inorganic materials 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 229960004940 sulpiride Drugs 0.000 description 2
- 229960003708 sumatriptan Drugs 0.000 description 2
- KQKPFRSPSRPDEB-UHFFFAOYSA-N sumatriptan Chemical compound CNS(=O)(=O)CC1=CC=C2NC=C(CCN(C)C)C2=C1 KQKPFRSPSRPDEB-UHFFFAOYSA-N 0.000 description 2
- IBAUKGNDWVSETP-UHFFFAOYSA-N suproclone Chemical compound C1CN(C(=O)CC)CCN1C(=O)OC1C(SCCS2)=C2C(=O)N1C1=CC=C(C=CC(Cl)=N2)C2=N1 IBAUKGNDWVSETP-UHFFFAOYSA-N 0.000 description 2
- 229950003877 suproclone Drugs 0.000 description 2
- RMXOUBDDDQUBKD-UHFFFAOYSA-N suriclone Chemical compound C1CN(C)CCN1C(=O)OC1C(SCCS2)=C2C(=O)N1C1=CC=C(C=CC(Cl)=N2)C2=N1 RMXOUBDDDQUBKD-UHFFFAOYSA-N 0.000 description 2
- 229950006866 suriclone Drugs 0.000 description 2
- 229940034173 symbyax Drugs 0.000 description 2
- 229940000238 tasmar Drugs 0.000 description 2
- 229960003188 temazepam Drugs 0.000 description 2
- 238000004809 thin layer chromatography Methods 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- 229960002784 thioridazine Drugs 0.000 description 2
- 210000001519 tissue Anatomy 0.000 description 2
- 239000010936 titanium Substances 0.000 description 2
- MIQPIUSUKVNLNT-UHFFFAOYSA-N tolcapone Chemical compound C1=CC(C)=CC=C1C(=O)C1=CC(O)=C(O)C([N+]([O-])=O)=C1 MIQPIUSUKVNLNT-UHFFFAOYSA-N 0.000 description 2
- OOGJQPCLVADCPB-HXUWFJFHSA-N tolterodine Chemical compound C1([C@@H](CCN(C(C)C)C(C)C)C=2C(=CC=C(C)C=2)O)=CC=CC=C1 OOGJQPCLVADCPB-HXUWFJFHSA-N 0.000 description 2
- 229960004045 tolterodine Drugs 0.000 description 2
- 229950002859 tracazolate Drugs 0.000 description 2
- 229910052723 transition metal Inorganic materials 0.000 description 2
- 150000003624 transition metals Chemical class 0.000 description 2
- 229950005135 traxoprodil Drugs 0.000 description 2
- 229960003991 trazodone Drugs 0.000 description 2
- PHLBKPHSAVXXEF-UHFFFAOYSA-N trazodone Chemical compound ClC1=CC=CC(N2CCN(CCCN3C(N4C=CC=CC4=N3)=O)CC2)=C1 PHLBKPHSAVXXEF-UHFFFAOYSA-N 0.000 description 2
- 229950002464 trepipam Drugs 0.000 description 2
- JOFWLTCLBGQGBO-UHFFFAOYSA-N triazolam Chemical compound C12=CC(Cl)=CC=C2N2C(C)=NN=C2CN=C1C1=CC=CC=C1Cl JOFWLTCLBGQGBO-UHFFFAOYSA-N 0.000 description 2
- 229960003386 triazolam Drugs 0.000 description 2
- HFFLGKNGCAIQMO-UHFFFAOYSA-N trichloroacetaldehyde Chemical compound ClC(Cl)(Cl)C=O HFFLGKNGCAIQMO-UHFFFAOYSA-N 0.000 description 2
- 229960001147 triclofos Drugs 0.000 description 2
- 229940086542 triethylamine Drugs 0.000 description 2
- ZEWQUBUPAILYHI-UHFFFAOYSA-N trifluoperazine Chemical compound C1CN(C)CCN1CCCN1C2=CC(C(F)(F)F)=CC=C2SC2=CC=CC=C21 ZEWQUBUPAILYHI-UHFFFAOYSA-N 0.000 description 2
- 229960002324 trifluoperazine Drugs 0.000 description 2
- 229950001577 trimetozine Drugs 0.000 description 2
- 229960002431 trimipramine Drugs 0.000 description 2
- ZSCDBOWYZJWBIY-UHFFFAOYSA-N trimipramine Chemical compound C1CC2=CC=CC=C2N(CC(CN(C)C)C)C2=CC=CC=C21 ZSCDBOWYZJWBIY-UHFFFAOYSA-N 0.000 description 2
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 2
- BWHDROKFUHTORW-UHFFFAOYSA-N tritert-butylphosphane Chemical compound CC(C)(C)P(C(C)(C)C)C(C)(C)C BWHDROKFUHTORW-UHFFFAOYSA-N 0.000 description 2
- DTMPGSXFUXZBDK-UHFFFAOYSA-N uldazepam Chemical compound C12=CC(Cl)=CC=C2N=C(NOCC=C)CN=C1C1=CC=CC=C1Cl DTMPGSXFUXZBDK-UHFFFAOYSA-N 0.000 description 2
- 229950004526 uldazepam Drugs 0.000 description 2
- 229960002004 valdecoxib Drugs 0.000 description 2
- LNPDTQAFDNKSHK-UHFFFAOYSA-N valdecoxib Chemical compound CC=1ON=C(C=2C=CC=CC=2)C=1C1=CC=C(S(N)(=O)=O)C=C1 LNPDTQAFDNKSHK-UHFFFAOYSA-N 0.000 description 2
- BDIAUFOIMFAIPU-UHFFFAOYSA-N valepotriate Natural products CC(C)CC(=O)OC1C=C(C(=COC2OC(=O)CC(C)C)COC(C)=O)C2C11CO1 BDIAUFOIMFAIPU-UHFFFAOYSA-N 0.000 description 2
- 229960004688 venlafaxine Drugs 0.000 description 2
- PNVNVHUZROJLTJ-UHFFFAOYSA-N venlafaxine Chemical compound C1=CC(OC)=CC=C1C(CN(C)C)C1(O)CCCCC1 PNVNVHUZROJLTJ-UHFFFAOYSA-N 0.000 description 2
- 229960001722 verapamil Drugs 0.000 description 2
- 239000011534 wash buffer Substances 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- HUNXMJYCHXQEGX-UHFFFAOYSA-N zaleplon Chemical compound CCN(C(C)=O)C1=CC=CC(C=2N3N=CC(=C3N=CC=2)C#N)=C1 HUNXMJYCHXQEGX-UHFFFAOYSA-N 0.000 description 2
- 229960004010 zaleplon Drugs 0.000 description 2
- IKVDXUFZJARKPF-UHFFFAOYSA-M zinc;cyclopropane;bromide Chemical compound Br[Zn+].C1C[CH-]1 IKVDXUFZJARKPF-UHFFFAOYSA-M 0.000 description 2
- 229960001366 zolazepam Drugs 0.000 description 2
- 229960001360 zolmitriptan Drugs 0.000 description 2
- ULSDMUVEXKOYBU-ZDUSSCGKSA-N zolmitriptan Chemical compound C1=C2C(CCN(C)C)=CNC2=CC=C1C[C@H]1COC(=O)N1 ULSDMUVEXKOYBU-ZDUSSCGKSA-N 0.000 description 2
- ZAFYATHCZYHLPB-UHFFFAOYSA-N zolpidem Chemical compound N1=C2C=CC(C)=CN2C(CC(=O)N(C)C)=C1C1=CC=C(C)C=C1 ZAFYATHCZYHLPB-UHFFFAOYSA-N 0.000 description 2
- 229960001475 zolpidem Drugs 0.000 description 2
- 229960000820 zopiclone Drugs 0.000 description 2
- HDOZVRUNCMBHFH-UHFFFAOYSA-N zotepine Chemical compound CN(C)CCOC1=CC2=CC=CC=C2SC2=CC=C(Cl)C=C12 HDOZVRUNCMBHFH-UHFFFAOYSA-N 0.000 description 2
- 229960004496 zotepine Drugs 0.000 description 2
- 229940039925 zyprexa Drugs 0.000 description 2
- UKSZBOKPHAQOMP-SVLSSHOZSA-N (1e,4e)-1,5-diphenylpenta-1,4-dien-3-one;palladium Chemical compound [Pd].C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1 UKSZBOKPHAQOMP-SVLSSHOZSA-N 0.000 description 1
- SDEAGACSNFSZCU-UHFFFAOYSA-N (3-chlorophenyl)boronic acid Chemical compound OB(O)C1=CC=CC(Cl)=C1 SDEAGACSNFSZCU-UHFFFAOYSA-N 0.000 description 1
- HUWSZNZAROKDRZ-RRLWZMAJSA-N (3r,4r)-3-azaniumyl-5-[[(2s,3r)-1-[(2s)-2,3-dicarboxypyrrolidin-1-yl]-3-methyl-1-oxopentan-2-yl]amino]-5-oxo-4-sulfanylpentane-1-sulfonate Chemical compound OS(=O)(=O)CC[C@@H](N)[C@@H](S)C(=O)N[C@@H]([C@H](C)CC)C(=O)N1CCC(C(O)=O)[C@H]1C(O)=O HUWSZNZAROKDRZ-RRLWZMAJSA-N 0.000 description 1
- MHVUUSQGWMQSMH-UHFFFAOYSA-N (4-bromopyridin-2-yl)methanol Chemical compound OCC1=CC(Br)=CC=N1 MHVUUSQGWMQSMH-UHFFFAOYSA-N 0.000 description 1
- RQTLKEBDTYWITQ-CJLVFECKSA-N (ne)-n-[(2-bromopyridin-4-yl)-(2-cyano-3-fluorophenyl)methylidene]-2-methylpropane-2-sulfinamide Chemical compound C=1C=CC(F)=C(C#N)C=1C(=N/S(=O)C(C)(C)C)/C1=CC=NC(Br)=C1 RQTLKEBDTYWITQ-CJLVFECKSA-N 0.000 description 1
- PRDMBDKMAJKUET-PTGBLXJZSA-N (ne)-n-[(3-bromo-4-methoxyphenyl)-(2-cyano-3-fluorophenyl)methylidene]-2-methylpropane-2-sulfinamide Chemical compound C1=C(Br)C(OC)=CC=C1C(=N/S(=O)C(C)(C)C)\C1=CC=CC(F)=C1C#N PRDMBDKMAJKUET-PTGBLXJZSA-N 0.000 description 1
- JMPUYSJSMKSCNC-OQKWZONESA-N (ne)-n-[(3-bromophenyl)-(2-cyano-3-fluorophenyl)methylidene]-2-methylpropane-2-sulfinamide Chemical compound C=1C=CC(F)=C(C#N)C=1C(=N/S(=O)C(C)(C)C)/C1=CC=CC(Br)=C1 JMPUYSJSMKSCNC-OQKWZONESA-N 0.000 description 1
- DIOHEXPTUTVCNX-UHFFFAOYSA-N 1,1,1-trifluoro-n-phenyl-n-(trifluoromethylsulfonyl)methanesulfonamide Chemical compound FC(F)(F)S(=O)(=O)N(S(=O)(=O)C(F)(F)F)C1=CC=CC=C1 DIOHEXPTUTVCNX-UHFFFAOYSA-N 0.000 description 1
- 125000004514 1,2,4-thiadiazolyl group Chemical group 0.000 description 1
- JSRLURSZEMLAFO-UHFFFAOYSA-N 1,3-dibromobenzene Chemical compound BrC1=CC=CC(Br)=C1 JSRLURSZEMLAFO-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- VYXHVRARDIDEHS-UHFFFAOYSA-N 1,5-cyclooctadiene Chemical compound C1CC=CCCC=C1 VYXHVRARDIDEHS-UHFFFAOYSA-N 0.000 description 1
- 239000004912 1,5-cyclooctadiene Substances 0.000 description 1
- 125000004973 1-butenyl group Chemical group C(=CCC)* 0.000 description 1
- 125000004776 1-fluoroethyl group Chemical group [H]C([H])([H])C([H])(F)* 0.000 description 1
- HNEGJTWNOOWEMH-UHFFFAOYSA-N 1-fluoropropane Chemical group [CH2]CCF HNEGJTWNOOWEMH-UHFFFAOYSA-N 0.000 description 1
- 125000006023 1-pentenyl group Chemical group 0.000 description 1
- 125000006017 1-propenyl group Chemical group 0.000 description 1
- PCMMSLVJMKQWMQ-UHFFFAOYSA-N 2,4-dibromopyridine Chemical compound BrC1=CC=NC(Br)=C1 PCMMSLVJMKQWMQ-UHFFFAOYSA-N 0.000 description 1
- YOLWXYGTOQALFW-UHFFFAOYSA-N 2,4-dimethylpyridin-3-ol Chemical compound CC1=CC=NC(C)=C1O YOLWXYGTOQALFW-UHFFFAOYSA-N 0.000 description 1
- AWBDARKONATUHX-UHFFFAOYSA-N 2-bromo-4-methoxypyridine Chemical compound COC1=CC=NC(Br)=C1 AWBDARKONATUHX-UHFFFAOYSA-N 0.000 description 1
- AWSJFEKOXQBDSL-UHFFFAOYSA-N 2-bromopyridine-4-carbonitrile Chemical compound BrC1=CC(C#N)=CC=N1 AWSJFEKOXQBDSL-UHFFFAOYSA-N 0.000 description 1
- YBTKGKVQEXAYEM-UHFFFAOYSA-N 2-bromopyridine-4-carboxylic acid Chemical compound OC(=O)C1=CC=NC(Br)=C1 YBTKGKVQEXAYEM-UHFFFAOYSA-N 0.000 description 1
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 1
- KKZUMAMOMRDVKA-UHFFFAOYSA-N 2-chloropropane Chemical group [CH2]C(C)Cl KKZUMAMOMRDVKA-UHFFFAOYSA-N 0.000 description 1
- NPRZWOJTSGFSBF-UHFFFAOYSA-N 2-chloropyridine-4-carbonyl chloride Chemical compound ClC(=O)C1=CC=NC(Cl)=C1 NPRZWOJTSGFSBF-UHFFFAOYSA-N 0.000 description 1
- DPNDWFVORIGXQO-UHFFFAOYSA-N 2-methoxypyridine-4-carboxylic acid Chemical compound COC1=CC(C(O)=O)=CC=N1 DPNDWFVORIGXQO-UHFFFAOYSA-N 0.000 description 1
- YOETUEMZNOLGDB-UHFFFAOYSA-N 2-methylpropyl carbonochloridate Chemical compound CC(C)COC(Cl)=O YOETUEMZNOLGDB-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- QVPNJFZOXOZJJQ-UHFFFAOYSA-N 3-(2-bromopyridin-4-yl)-7-fluoro-3-(4-methoxy-3,5-dimethylphenyl)isoindol-1-amine Chemical compound C1=C(C)C(OC)=C(C)C=C1C1(C=2C=C(Br)N=CC=2)C(C=CC=C2F)=C2C(N)=N1 QVPNJFZOXOZJJQ-UHFFFAOYSA-N 0.000 description 1
- ZGXHCIHFZFTEAM-UHFFFAOYSA-N 3-(2-chloropyridin-4-yl)-3-[2-(difluoromethyl)-6-methylpyridin-4-yl]-7-fluoroisoindol-1-amine Chemical compound FC(F)C1=NC(C)=CC(C2(C3=C(C(=CC=C3)F)C(N)=N2)C=2C=C(Cl)N=CC=2)=C1 ZGXHCIHFZFTEAM-UHFFFAOYSA-N 0.000 description 1
- GTTMGAGZGSBLMT-UHFFFAOYSA-N 3-(3-bromo-4-fluorophenyl)-7-fluoro-3-(2-methoxypyridin-4-yl)isoindol-1-amine Chemical compound C1=NC(OC)=CC(C2(C3=C(C(=CC=C3)F)C(N)=N2)C=2C=C(Br)C(F)=CC=2)=C1 GTTMGAGZGSBLMT-UHFFFAOYSA-N 0.000 description 1
- ZIVRKXOCORSIFE-UHFFFAOYSA-N 3-(3-chloro-4-methoxyphenyl)-7-fluoro-3-(3-pyrimidin-5-ylphenyl)isoindol-1-amine Chemical compound C1=C(Cl)C(OC)=CC=C1C1(C=2C=C(C=CC=2)C=2C=NC=NC=2)C(C=CC=C2F)=C2C(N)=N1 ZIVRKXOCORSIFE-UHFFFAOYSA-N 0.000 description 1
- HPHZOCIBMCWXCQ-UHFFFAOYSA-N 3-bromo-4-fluorobenzoyl chloride Chemical compound FC1=CC=C(C(Cl)=O)C=C1Br HPHZOCIBMCWXCQ-UHFFFAOYSA-N 0.000 description 1
- BBPZABXVRBFWGD-UHFFFAOYSA-N 3-bromo-4-methoxybenzoic acid Chemical compound COC1=CC=C(C(O)=O)C=C1Br BBPZABXVRBFWGD-UHFFFAOYSA-N 0.000 description 1
- 125000004975 3-butenyl group Chemical group C(CC=C)* 0.000 description 1
- 125000000474 3-butynyl group Chemical group [H]C#CC([H])([H])C([H])([H])* 0.000 description 1
- VFMTUTYBMBTIGA-UHFFFAOYSA-N 3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine Chemical compound O1C(C)(C)C(C)(C)OB1C1=CN=CC(F)=C1 VFMTUTYBMBTIGA-UHFFFAOYSA-N 0.000 description 1
- RUQIUASLAXJZIE-UHFFFAOYSA-N 3-methoxybenzoyl chloride Chemical compound COC1=CC=CC(C(Cl)=O)=C1 RUQIUASLAXJZIE-UHFFFAOYSA-N 0.000 description 1
- LZPWAYBEOJRFAX-UHFFFAOYSA-N 4,4,5,5-tetramethyl-1,3,2$l^{2}-dioxaborolane Chemical compound CC1(C)O[B]OC1(C)C LZPWAYBEOJRFAX-UHFFFAOYSA-N 0.000 description 1
- SEVMQEIGENUPIE-UHFFFAOYSA-N 4-bromo-1-fluoro-2-methoxybenzene Chemical compound COC1=CC(Br)=CC=C1F SEVMQEIGENUPIE-UHFFFAOYSA-N 0.000 description 1
- PTCKNLGMBFKIFP-UHFFFAOYSA-N 4-bromo-2,6-dimethylpyrimidine Chemical compound CC1=CC(Br)=NC(C)=N1 PTCKNLGMBFKIFP-UHFFFAOYSA-N 0.000 description 1
- FPIQNBOUYZLESW-UHFFFAOYSA-N 4-bromo-2-chloro-1-methoxybenzene Chemical compound COC1=CC=C(Br)C=C1Cl FPIQNBOUYZLESW-UHFFFAOYSA-N 0.000 description 1
- JRDMGVGCATYZPW-UHFFFAOYSA-N 4-chloro-2-fluorobenzonitrile Chemical compound FC1=CC(Cl)=CC=C1C#N JRDMGVGCATYZPW-UHFFFAOYSA-N 0.000 description 1
- 125000006042 4-hexenyl group Chemical group 0.000 description 1
- TXNLQUKVUJITMX-UHFFFAOYSA-N 4-tert-butyl-2-(4-tert-butylpyridin-2-yl)pyridine Chemical group CC(C)(C)C1=CC=NC(C=2N=CC=C(C=2)C(C)(C)C)=C1 TXNLQUKVUJITMX-UHFFFAOYSA-N 0.000 description 1
- BOIKCRIMIQAFQJ-UHFFFAOYSA-N 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carbonitrile Chemical compound O1C(C)(C)C(C)(C)OB1C1=CN=CC(C#N)=C1 BOIKCRIMIQAFQJ-UHFFFAOYSA-N 0.000 description 1
- LPJHXJVHSOVRCK-UHFFFAOYSA-N 5-[5-[3-amino-4-fluoro-1-[2-(trifluoromethyl)pyridin-4-yl]isoindol-1-yl]-2-fluorophenyl]pyridine-3-carbonitrile;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.C12=CC=CC(F)=C2C(N)=NC1(C=1C=C(C(F)=CC=1)C=1C=C(C=NC=1)C#N)C1=CC=NC(C(F)(F)F)=C1 LPJHXJVHSOVRCK-UHFFFAOYSA-N 0.000 description 1
- UDTVFZBQFYOZST-UHFFFAOYSA-N 5-bromo-1,2-difluoro-3-methoxybenzene Chemical compound COC1=CC(Br)=CC(F)=C1F UDTVFZBQFYOZST-UHFFFAOYSA-N 0.000 description 1
- VJBGQCXPLYNALH-UHFFFAOYSA-N 5-bromo-1-fluoro-2-methoxy-3-methylbenzene Chemical compound COC1=C(C)C=C(Br)C=C1F VJBGQCXPLYNALH-UHFFFAOYSA-N 0.000 description 1
- PEXAZYDITWXYNJ-UHFFFAOYSA-N 5-bromo-2-fluorobenzoic acid Chemical compound OC(=O)C1=CC(Br)=CC=C1F PEXAZYDITWXYNJ-UHFFFAOYSA-N 0.000 description 1
- MMARFGDTMJBIBK-UHFFFAOYSA-N 5-bromo-2-methoxy-1,3-dimethylbenzene Chemical compound COC1=C(C)C=C(Br)C=C1C MMARFGDTMJBIBK-UHFFFAOYSA-N 0.000 description 1
- GYCPLYCTMDTEPU-UHFFFAOYSA-N 5-bromopyrimidine Chemical compound BrC1=CN=CN=C1 GYCPLYCTMDTEPU-UHFFFAOYSA-N 0.000 description 1
- QNGXRTLQABNDEY-UHFFFAOYSA-N 5-chloro-7-fluoro-3-(3-methoxyphenyl)-3-[2-(trifluoromethyl)pyridin-4-yl]isoindol-1-amine Chemical compound COC1=CC=CC(C2(C3=C(C(=CC(Cl)=C3)F)C(N)=N2)C=2C=C(N=CC=2)C(F)(F)F)=C1 QNGXRTLQABNDEY-UHFFFAOYSA-N 0.000 description 1
- YSWCSGKWJKJWRB-UHFFFAOYSA-N 5-iodo-2-methoxy-3-(trifluoromethyl)pyridine Chemical compound COC1=NC=C(I)C=C1C(F)(F)F YSWCSGKWJKJWRB-UHFFFAOYSA-N 0.000 description 1
- UZSHWRAUEVAKFN-UHFFFAOYSA-N 7-fluoro-3-(4-fluoro-3-methoxyphenyl)-3-(3-pyrimidin-5-ylphenyl)isoindol-1-amine Chemical compound C1=C(F)C(OC)=CC(C2(C3=C(C(=CC=C3)F)C(N)=N2)C=2C=C(C=CC=2)C=2C=NC=NC=2)=C1 UZSHWRAUEVAKFN-UHFFFAOYSA-N 0.000 description 1
- LFGITHYVKKWFQI-UHFFFAOYSA-N 7-fluoro-3-(4-methoxy-3-pyrazin-2-ylphenyl)-3-[2-(trifluoromethyl)pyridin-4-yl]isoindol-1-amine Chemical compound COC1=CC=C(C2(C3=C(C(=CC=C3)F)C(N)=N2)C=2C=C(N=CC=2)C(F)(F)F)C=C1C1=CN=CC=N1 LFGITHYVKKWFQI-UHFFFAOYSA-N 0.000 description 1
- TWTDAOLZCWDJML-UHFFFAOYSA-N 7-fluoro-3-[2-fluoro-5-(5-methylsulfonylpyridin-3-yl)phenyl]-3-(2-methylpyridin-4-yl)isoindol-1-amine Chemical compound C1=NC(C)=CC(C2(C3=C(C(=CC=C3)F)C(N)=N2)C=2C(=CC=C(C=2)C=2C=C(C=NC=2)S(C)(=O)=O)F)=C1 TWTDAOLZCWDJML-UHFFFAOYSA-N 0.000 description 1
- 229940100578 Acetylcholinesterase inhibitor Drugs 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 108010043324 Amyloid Precursor Protein Secretases Proteins 0.000 description 1
- 102000002659 Amyloid Precursor Protein Secretases Human genes 0.000 description 1
- 101710137189 Amyloid-beta A4 protein Proteins 0.000 description 1
- 101710151993 Amyloid-beta precursor protein Proteins 0.000 description 1
- 102100022704 Amyloid-beta precursor protein Human genes 0.000 description 1
- 108010017640 Aspartic Acid Proteases Proteins 0.000 description 1
- 102000004580 Aspartic Acid Proteases Human genes 0.000 description 1
- JGLMVXWAHNTPRF-CMDGGOBGSA-N CCN1N=C(C)C=C1C(=O)NC1=NC2=CC(=CC(OC)=C2N1C\C=C\CN1C(NC(=O)C2=CC(C)=NN2CC)=NC2=CC(=CC(OCCCN3CCOCC3)=C12)C(N)=O)C(N)=O Chemical compound CCN1N=C(C)C=C1C(=O)NC1=NC2=CC(=CC(OC)=C2N1C\C=C\CN1C(NC(=O)C2=CC(C)=NN2CC)=NC2=CC(=CC(OCCCN3CCOCC3)=C12)C(N)=O)C(N)=O JGLMVXWAHNTPRF-CMDGGOBGSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- VOPWNXZWBYDODV-UHFFFAOYSA-N Chlorodifluoromethane Chemical compound FC(F)Cl VOPWNXZWBYDODV-UHFFFAOYSA-N 0.000 description 1
- 229910021590 Copper(II) bromide Inorganic materials 0.000 description 1
- YZCKVEUIGOORGS-OUBTZVSYSA-N Deuterium Chemical compound [2H] YZCKVEUIGOORGS-OUBTZVSYSA-N 0.000 description 1
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 1
- 102000010911 Enzyme Precursors Human genes 0.000 description 1
- 108010062466 Enzyme Precursors Proteins 0.000 description 1
- 229910052693 Europium Inorganic materials 0.000 description 1
- NCSLXGIFBLJQFW-UHFFFAOYSA-N FC1=CC=CC([Zn])=C1C#N Chemical compound FC1=CC=CC([Zn])=C1C#N NCSLXGIFBLJQFW-UHFFFAOYSA-N 0.000 description 1
- 239000007818 Grignard reagent Substances 0.000 description 1
- 238000010268 HPLC based assay Methods 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- CKLJMWTZIZZHCS-REOHCLBHSA-N L-aspartic acid Chemical compound OC(=O)[C@@H](N)CC(O)=O CKLJMWTZIZZHCS-REOHCLBHSA-N 0.000 description 1
- ROHFNLRQFUQHCH-YFKPBYRVSA-N L-leucine Chemical compound CC(C)C[C@H](N)C(O)=O ROHFNLRQFUQHCH-YFKPBYRVSA-N 0.000 description 1
- ROHFNLRQFUQHCH-UHFFFAOYSA-N Leucine Natural products CC(C)CC(N)C(O)=O ROHFNLRQFUQHCH-UHFFFAOYSA-N 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- 238000005684 Liebig rearrangement reaction Methods 0.000 description 1
- HBBGRARXTFLTSG-UHFFFAOYSA-N Lithium ion Chemical compound [Li+] HBBGRARXTFLTSG-UHFFFAOYSA-N 0.000 description 1
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- 108090000284 Pepsin A Proteins 0.000 description 1
- 102000057297 Pepsin A Human genes 0.000 description 1
- 108091005804 Peptidases Proteins 0.000 description 1
- 102000035195 Peptidases Human genes 0.000 description 1
- SCKXCAADGDQQCS-UHFFFAOYSA-N Performic acid Chemical compound OOC=O SCKXCAADGDQQCS-UHFFFAOYSA-N 0.000 description 1
- 241000283984 Rodentia Species 0.000 description 1
- FKNQFGJONOIPTF-UHFFFAOYSA-N Sodium cation Chemical compound [Na+] FKNQFGJONOIPTF-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 208000030886 Traumatic Brain injury Diseases 0.000 description 1
- GCTFWCDSFPMHHS-UHFFFAOYSA-M Tributyltin chloride Chemical compound CCCC[Sn](Cl)(CCCC)CCCC GCTFWCDSFPMHHS-UHFFFAOYSA-M 0.000 description 1
- OKJPEAGHQZHRQV-UHFFFAOYSA-N Triiodomethane Natural products IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 description 1
- YZCKVEUIGOORGS-NJFSPNSNSA-N Tritium Chemical compound [3H] YZCKVEUIGOORGS-NJFSPNSNSA-N 0.000 description 1
- ACIAHEMYLLBZOI-ZZXKWVIFSA-N Unsaturated alcohol Chemical compound CC\C(CO)=C/C ACIAHEMYLLBZOI-ZZXKWVIFSA-N 0.000 description 1
- 241000607479 Yersinia pestis Species 0.000 description 1
- LNUFLCYMSVYYNW-ZPJMAFJPSA-N [(2r,3r,4s,5r,6r)-2-[(2r,3r,4s,5r,6r)-6-[(2r,3r,4s,5r,6r)-6-[(2r,3r,4s,5r,6r)-6-[[(3s,5s,8r,9s,10s,13r,14s,17r)-10,13-dimethyl-17-[(2r)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1h-cyclopenta[a]phenanthren-3-yl]oxy]-4,5-disulfo Chemical compound O([C@@H]1[C@@H](COS(O)(=O)=O)O[C@@H]([C@@H]([C@H]1OS(O)(=O)=O)OS(O)(=O)=O)O[C@@H]1[C@@H](COS(O)(=O)=O)O[C@@H]([C@@H]([C@H]1OS(O)(=O)=O)OS(O)(=O)=O)O[C@@H]1[C@@H](COS(O)(=O)=O)O[C@H]([C@@H]([C@H]1OS(O)(=O)=O)OS(O)(=O)=O)O[C@@H]1C[C@@H]2CC[C@H]3[C@@H]4CC[C@@H]([C@]4(CC[C@@H]3[C@@]2(C)CC1)C)[C@H](C)CCCC(C)C)[C@H]1O[C@H](COS(O)(=O)=O)[C@@H](OS(O)(=O)=O)[C@H](OS(O)(=O)=O)[C@H]1OS(O)(=O)=O LNUFLCYMSVYYNW-ZPJMAFJPSA-N 0.000 description 1
- KTOUYOVQXRXTGT-UHFFFAOYSA-N [5-[3-amino-1-(3-bromophenyl)-4-fluoroisoindol-1-yl]-2-methoxy-3-methylphenyl]methanol Chemical compound C1=C(CO)C(OC)=C(C)C=C1C1(C=2C=C(Br)C=CC=2)C(C=CC=C2F)=C2C(N)=N1 KTOUYOVQXRXTGT-UHFFFAOYSA-N 0.000 description 1
- JXIBZKUGSNBSMD-UHFFFAOYSA-N [5-[3-amino-4-fluoro-1-(3-pyrimidin-5-ylphenyl)isoindol-1-yl]-2-methoxy-3-methylphenyl]methanol Chemical compound C1=C(CO)C(OC)=C(C)C=C1C1(C=2C=C(C=CC=2)C=2C=NC=NC=2)C(C=CC=C2F)=C2C(N)=N1 JXIBZKUGSNBSMD-UHFFFAOYSA-N 0.000 description 1
- VJZSTRLBFHZZRR-UHFFFAOYSA-N [N].CCCCC Chemical compound [N].CCCCC VJZSTRLBFHZZRR-UHFFFAOYSA-N 0.000 description 1
- 150000001241 acetals Chemical class 0.000 description 1
- WXVUZHSEHBJYHF-UHFFFAOYSA-N acetic acid;5-[3-[3-amino-4-fluoro-1-(2-methoxypyridin-4-yl)isoindol-1-yl]phenyl]pyridine-3-carbonitrile Chemical compound CC(O)=O.C1=NC(OC)=CC(C2(C3=C(C(=CC=C3)F)C(N)=N2)C=2C=C(C=CC=2)C=2C=C(C=NC=2)C#N)=C1 WXVUZHSEHBJYHF-UHFFFAOYSA-N 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 239000012042 active reagent Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000032683 aging Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 208000026935 allergic disease Diseases 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- DZHSAHHDTRWUTF-SIQRNXPUSA-N amyloid-beta polypeptide 42 Chemical compound C([C@@H](C(=O)N[C@@H](C)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@H](C(=O)NCC(=O)N[C@@H](CO)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CCCCN)C(=O)NCC(=O)N[C@@H](C)C(=O)N[C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)NCC(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](C(C)C)C(=O)NCC(=O)NCC(=O)N[C@@H](C(C)C)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](C)C(O)=O)[C@@H](C)CC)C(C)C)NC(=O)[C@H](CC=1C=CC=CC=1)NC(=O)[C@@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CC=1N=CNC=1)NC(=O)[C@H](CC=1N=CNC=1)NC(=O)[C@@H](NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)CNC(=O)[C@H](CO)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CC=1N=CNC=1)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CC=1C=CC=CC=1)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](C)NC(=O)[C@@H](N)CC(O)=O)C(C)C)C(C)C)C1=CC=CC=C1 DZHSAHHDTRWUTF-SIQRNXPUSA-N 0.000 description 1
- 230000002205 anti-dementic effect Effects 0.000 description 1
- 101150031224 app gene Proteins 0.000 description 1
- 229940039856 aricept Drugs 0.000 description 1
- 229940009098 aspartate Drugs 0.000 description 1
- 125000002393 azetidinyl group Chemical group 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 1
- BNBQRQQYDMDJAH-UHFFFAOYSA-N benzodioxan Chemical compound C1=CC=C2OCCOC2=C1 BNBQRQQYDMDJAH-UHFFFAOYSA-N 0.000 description 1
- 125000004618 benzofuryl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 description 1
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 125000002619 bicyclic group Chemical group 0.000 description 1
- 125000005620 boronic acid group Chemical group 0.000 description 1
- 210000005013 brain tissue Anatomy 0.000 description 1
- 230000005587 bubbling Effects 0.000 description 1
- 229910052792 caesium Inorganic materials 0.000 description 1
- TVFDJXOCXUVLDH-UHFFFAOYSA-N caesium atom Chemical compound [Cs] TVFDJXOCXUVLDH-UHFFFAOYSA-N 0.000 description 1
- 125000000609 carbazolyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3NC12)* 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 230000006037 cell lysis Effects 0.000 description 1
- 230000004663 cell proliferation Effects 0.000 description 1
- 230000001413 cellular effect Effects 0.000 description 1
- 238000000451 chemical ionisation Methods 0.000 description 1
- 238000002512 chemotherapy Methods 0.000 description 1
- 125000004773 chlorofluoromethyl group Chemical group [H]C(F)(Cl)* 0.000 description 1
- 238000013375 chromatographic separation Methods 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 239000002299 complementary DNA Substances 0.000 description 1
- 238000011443 conventional therapy Methods 0.000 description 1
- 150000004696 coordination complex Chemical class 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 238000006880 cross-coupling reaction Methods 0.000 description 1
- 125000001047 cyclobutenyl group Chemical group C1(=CCC1)* 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000002433 cyclopentenyl group Chemical group C1(=CCCC1)* 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000298 cyclopropenyl group Chemical group [H]C1=C([H])C1([H])* 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 239000011903 deuterated solvents Substances 0.000 description 1
- 229910052805 deuterium Inorganic materials 0.000 description 1
- 238000003745 diagnosis Methods 0.000 description 1
- LCSNDSFWVKMJCT-UHFFFAOYSA-N dicyclohexyl-(2-phenylphenyl)phosphane Chemical group C1CCCCC1P(C=1C(=CC=CC=1)C=1C=CC=CC=1)C1CCCCC1 LCSNDSFWVKMJCT-UHFFFAOYSA-N 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- CSJLBAMHHLJAAS-UHFFFAOYSA-N diethylaminosulfur trifluoride Chemical compound CCN(CC)S(F)(F)F CSJLBAMHHLJAAS-UHFFFAOYSA-N 0.000 description 1
- UBHZUDXTHNMNLD-UHFFFAOYSA-N dimethylsilane Chemical compound C[SiH2]C UBHZUDXTHNMNLD-UHFFFAOYSA-N 0.000 description 1
- KPUWHANPEXNPJT-UHFFFAOYSA-N disiloxane Chemical class [SiH3]O[SiH3] KPUWHANPEXNPJT-UHFFFAOYSA-N 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 238000003182 dose-response assay Methods 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- OGPBJKLSAFTDLK-UHFFFAOYSA-N europium atom Chemical compound [Eu] OGPBJKLSAFTDLK-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 230000005284 excitation Effects 0.000 description 1
- 229940108366 exelon Drugs 0.000 description 1
- 238000001400 expression cloning Methods 0.000 description 1
- 239000013604 expression vector Substances 0.000 description 1
- 238000004401 flow injection analysis Methods 0.000 description 1
- 238000002866 fluorescence resonance energy transfer Methods 0.000 description 1
- 125000004216 fluoromethyl group Chemical group [H]C([H])(F)* 0.000 description 1
- 125000001207 fluorophenyl group Chemical group 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 238000004108 freeze drying Methods 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 229960003980 galantamine Drugs 0.000 description 1
- ASUTZQLVASHGKV-UHFFFAOYSA-N galanthamine hydrochloride Natural products O1C(=C23)C(OC)=CC=C2CN(C)CCC23C1CC(O)C=C2 ASUTZQLVASHGKV-UHFFFAOYSA-N 0.000 description 1
- 238000002290 gas chromatography-mass spectrometry Methods 0.000 description 1
- 238000007429 general method Methods 0.000 description 1
- 150000004795 grignard reagents Chemical class 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000005980 hexynyl group Chemical group 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- RCCPEORTSYDPMB-UHFFFAOYSA-N hydroxy benzenecarboximidothioate Chemical compound OSC(=N)C1=CC=CC=C1 RCCPEORTSYDPMB-UHFFFAOYSA-N 0.000 description 1
- 238000003384 imaging method Methods 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 238000011534 incubation Methods 0.000 description 1
- 125000003453 indazolyl group Chemical group N1N=C(C2=C1C=CC=C2)* 0.000 description 1
- 125000003387 indolinyl group Chemical group N1(CCC2=CC=CC=C12)* 0.000 description 1
- 125000001041 indolyl group Chemical group 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000003999 initiator Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 125000002346 iodo group Chemical group I* 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 230000007794 irritation Effects 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000005956 isoquinolyl group Chemical group 0.000 description 1
- 125000001786 isothiazolyl group Chemical group 0.000 description 1
- 125000000842 isoxazolyl group Chemical group 0.000 description 1
- 238000002372 labelling Methods 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- 230000000670 limiting effect Effects 0.000 description 1
- 229910001416 lithium ion Inorganic materials 0.000 description 1
- KUJOABUXCGVGIY-UHFFFAOYSA-N lithium zinc Chemical compound [Li].[Zn] KUJOABUXCGVGIY-UHFFFAOYSA-N 0.000 description 1
- BNHFWQQYLUPDOG-UHFFFAOYSA-N lithium;1,2,2,3-tetramethylpiperidine Chemical compound [Li].CC1CCCN(C)C1(C)C BNHFWQQYLUPDOG-UHFFFAOYSA-N 0.000 description 1
- 238000004020 luminiscence type Methods 0.000 description 1
- RBWRWAUAVRMBAC-UHFFFAOYSA-M magnesium;methoxybenzene;bromide Chemical compound [Mg+2].[Br-].COC1=CC=[C-]C=C1 RBWRWAUAVRMBAC-UHFFFAOYSA-M 0.000 description 1
- 229910052748 manganese Inorganic materials 0.000 description 1
- 239000011572 manganese Substances 0.000 description 1
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Inorganic materials O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 description 1
- 230000003340 mental effect Effects 0.000 description 1
- 238000006263 metalation reaction Methods 0.000 description 1
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 1
- 230000005012 migration Effects 0.000 description 1
- 238000013508 migration Methods 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 125000002757 morpholinyl group Chemical group 0.000 description 1
- SAGGBOHVMAKRMQ-UHFFFAOYSA-N n-[(5-bromo-2-fluorophenyl)-(2-cyano-3-fluorophenyl)methylidene]-2-methylpropane-2-sulfinamide Chemical compound C=1C=CC(F)=C(C#N)C=1C(=NS(=O)C(C)(C)C)C1=CC(Br)=CC=C1F SAGGBOHVMAKRMQ-UHFFFAOYSA-N 0.000 description 1
- PSFIZKGZBDXQRY-UHFFFAOYSA-N n-[(5-bromo-2-fluorophenyl)-(2-cyano-3-fluorophenyl)methylidene]propane-2-sulfinamide Chemical compound C=1C=CC(F)=C(C#N)C=1C(=NS(=O)C(C)C)C1=CC(Br)=CC=C1F PSFIZKGZBDXQRY-UHFFFAOYSA-N 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229940033872 namenda Drugs 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 210000002682 neurofibrillary tangle Anatomy 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 239000012457 nonaqueous media Substances 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 230000002018 overexpression Effects 0.000 description 1
- 125000002971 oxazolyl group Chemical group 0.000 description 1
- 125000003566 oxetanyl group Chemical group 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 150000002940 palladium Chemical class 0.000 description 1
- LXNAVEXFUKBNMK-UHFFFAOYSA-N palladium(II) acetate Substances [Pd].CC(O)=O.CC(O)=O LXNAVEXFUKBNMK-UHFFFAOYSA-N 0.000 description 1
- PIBWKRNGBLPSSY-UHFFFAOYSA-L palladium(II) chloride Chemical compound Cl[Pd]Cl PIBWKRNGBLPSSY-UHFFFAOYSA-L 0.000 description 1
- UQPUONNXJVWHRM-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 UQPUONNXJVWHRM-UHFFFAOYSA-N 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 125000005981 pentynyl group Chemical group 0.000 description 1
- 229940111202 pepsin Drugs 0.000 description 1
- 229950000964 pepstatin Drugs 0.000 description 1
- 108010091212 pepstatin Proteins 0.000 description 1
- FAXGPCHRFPCXOO-LXTPJMTPSA-N pepstatin A Chemical compound OC(=O)C[C@H](O)[C@H](CC(C)C)NC(=O)[C@H](C)NC(=O)C[C@H](O)[C@H](CC(C)C)NC(=O)[C@H](C(C)C)NC(=O)[C@H](C(C)C)NC(=O)CC(C)C FAXGPCHRFPCXOO-LXTPJMTPSA-N 0.000 description 1
- 150000004965 peroxy acids Chemical class 0.000 description 1
- 239000002831 pharmacologic agent Substances 0.000 description 1
- 238000005191 phase separation Methods 0.000 description 1
- 125000004193 piperazinyl group Chemical group 0.000 description 1
- 125000003386 piperidinyl group Chemical group 0.000 description 1
- 238000011176 pooling Methods 0.000 description 1
- 235000015320 potassium carbonate Nutrition 0.000 description 1
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 102000004196 processed proteins & peptides Human genes 0.000 description 1
- 230000000750 progressive effect Effects 0.000 description 1
- 230000000069 prophylactic effect Effects 0.000 description 1
- 235000019833 protease Nutrition 0.000 description 1
- 238000000425 proton nuclear magnetic resonance spectrum Methods 0.000 description 1
- 125000000561 purinyl group Chemical group N1=C(N=C2N=CNC2=C1)* 0.000 description 1
- 125000003373 pyrazinyl group Chemical group 0.000 description 1
- 125000003226 pyrazolyl group Chemical group 0.000 description 1
- 125000002098 pyridazinyl group Chemical group 0.000 description 1
- ABMYEXAYWZJVOV-UHFFFAOYSA-N pyridin-3-ylboronic acid Chemical compound OB(O)C1=CC=CN=C1 ABMYEXAYWZJVOV-UHFFFAOYSA-N 0.000 description 1
- GPHQHTOMRSGBNZ-UHFFFAOYSA-N pyridine-4-carbonitrile Chemical compound N#CC1=CC=NC=C1 GPHQHTOMRSGBNZ-UHFFFAOYSA-N 0.000 description 1
- 150000003856 quaternary ammonium compounds Chemical class 0.000 description 1
- 125000005493 quinolyl group Chemical group 0.000 description 1
- 229940051845 razadyne Drugs 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 125000006413 ring segment Chemical group 0.000 description 1
- 229960004136 rivastigmine Drugs 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000009097 single-agent therapy Methods 0.000 description 1
- 229910001415 sodium ion Inorganic materials 0.000 description 1
- 239000012453 solvate Substances 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 230000003595 spectral effect Effects 0.000 description 1
- VNFWTIYUKDMAOP-UHFFFAOYSA-N sphos Chemical group COC1=CC=CC(OC)=C1C1=CC=CC=C1P(C1CCCCC1)C1CCCCC1 VNFWTIYUKDMAOP-UHFFFAOYSA-N 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 239000012089 stop solution Substances 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 125000001010 sulfinic acid amide group Chemical group 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 238000003419 tautomerization reaction Methods 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 1
- 125000003039 tetrahydroisoquinolinyl group Chemical group C1(NCCC2=CC=CC=C12)* 0.000 description 1
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 1
- 125000000147 tetrahydroquinolinyl group Chemical group N1(CCCC2=CC=CC=C12)* 0.000 description 1
- 125000003831 tetrazolyl group Chemical group 0.000 description 1
- 229940124597 therapeutic agent Drugs 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 125000000335 thiazolyl group Chemical group 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
- 230000009261 transgenic effect Effects 0.000 description 1
- 108091005703 transmembrane proteins Proteins 0.000 description 1
- 102000035160 transmembrane proteins Human genes 0.000 description 1
- 230000009529 traumatic brain injury Effects 0.000 description 1
- 125000004306 triazinyl group Chemical group 0.000 description 1
- 125000001425 triazolyl group Chemical group 0.000 description 1
- ITMCEJHCFYSIIV-UHFFFAOYSA-M triflate Chemical compound [O-]S(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-M 0.000 description 1
- CCRMAATUKBYMPA-UHFFFAOYSA-N trimethyltin Chemical compound C[Sn](C)C.C[Sn](C)C CCRMAATUKBYMPA-UHFFFAOYSA-N 0.000 description 1
- 229910052722 tritium Inorganic materials 0.000 description 1
- GPRLSGONYQIRFK-MNYXATJNSA-N triton Chemical compound [3H+] GPRLSGONYQIRFK-MNYXATJNSA-N 0.000 description 1
- 239000003981 vehicle Substances 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- GTLDTDOJJJZVBW-UHFFFAOYSA-N zinc cyanide Chemical compound [Zn+2].N#[C-].N#[C-] GTLDTDOJJJZVBW-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/14—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing three or more hetero rings
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/495—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with two or more nitrogen atoms as the only ring heteroatoms, e.g. piperazine or tetrazines
- A61K31/505—Pyrimidines; Hydrogenated pyrimidines, e.g. trimethoprim
- A61K31/506—Pyrimidines; Hydrogenated pyrimidines, e.g. trimethoprim not condensed and containing further heterocyclic rings
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/28—Drugs for disorders of the nervous system for treating neurodegenerative disorders of the central nervous system, e.g. nootropic agents, cognition enhancers, drugs for treating Alzheimer's disease or other forms of dementia
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D403/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00
- C07D403/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings
- C07D403/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D403/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00
- C07D403/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings
- C07D403/10—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings linked by a carbon chain containing aromatic rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Veterinary Medicine (AREA)
- Public Health (AREA)
- Medicinal Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- General Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Neurosurgery (AREA)
- Neurology (AREA)
- Biomedical Technology (AREA)
- Hospice & Palliative Care (AREA)
- Heart & Thoracic Surgery (AREA)
- Cardiology (AREA)
- Psychiatry (AREA)
- Epidemiology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pyridine Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (7)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US11463408P | 2008-11-14 | 2008-11-14 | |
| US61/114,634 | 2008-11-14 | ||
| US13976708P | 2008-12-22 | 2008-12-22 | |
| US61/139,767 | 2008-12-22 | ||
| US22165309P | 2009-06-30 | 2009-06-30 | |
| US61/221,653 | 2009-06-30 | ||
| PCT/SE2009/051295 WO2010056196A1 (en) | 2008-11-14 | 2009-11-13 | New compounds 578 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA2743938A1 true CA2743938A1 (en) | 2010-05-20 |
Family
ID=42170158
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA2743938A Abandoned CA2743938A1 (en) | 2008-11-14 | 2009-11-13 | Substituted isoindoles as bace inhibitors and their use |
Country Status (24)
| Country | Link |
|---|---|
| US (2) | US8030500B2 (enExample) |
| EP (1) | EP2367814A4 (enExample) |
| JP (1) | JP2012508734A (enExample) |
| KR (1) | KR20110091540A (enExample) |
| CN (1) | CN102282140A (enExample) |
| AR (1) | AR074341A1 (enExample) |
| AU (1) | AU2009314664A1 (enExample) |
| BR (1) | BRPI0921879A2 (enExample) |
| CA (1) | CA2743938A1 (enExample) |
| CL (1) | CL2011001098A1 (enExample) |
| CO (1) | CO6362004A2 (enExample) |
| CR (1) | CR20110255A (enExample) |
| CU (1) | CU20110106A7 (enExample) |
| DO (1) | DOP2011000138A (enExample) |
| EA (1) | EA201190020A1 (enExample) |
| EC (1) | ECSP11011051A (enExample) |
| IL (1) | IL212590A0 (enExample) |
| MX (1) | MX2011004918A (enExample) |
| NI (1) | NI201100099A (enExample) |
| PE (1) | PE20110875A1 (enExample) |
| TW (1) | TW201020244A (enExample) |
| UY (1) | UY32241A (enExample) |
| WO (1) | WO2010056196A1 (enExample) |
| ZA (1) | ZA201104396B (enExample) |
Families Citing this family (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CN101346357B (zh) | 2005-10-25 | 2014-04-02 | 盐野义制药株式会社 | 氨基二氢噻嗪衍生物 |
| TW200815349A (en) * | 2006-06-22 | 2008-04-01 | Astrazeneca Ab | New compounds |
| JP5383483B2 (ja) | 2007-04-24 | 2014-01-08 | 塩野義製薬株式会社 | アルツハイマー症治療用医薬組成物 |
| EP2689780A1 (en) | 2007-04-24 | 2014-01-29 | Shionogi & Co., Ltd. | Intermediates for aminodihydrothiazine derivatives substituted with a cyclic group |
| KR101324426B1 (ko) | 2008-06-13 | 2013-10-31 | 시오노기세야쿠 가부시키가이샤 | β 세크레타제 저해 작용을 갖는 황 함유 복소환 유도체 |
| CN102186841A (zh) | 2008-10-22 | 2011-09-14 | 盐野义制药株式会社 | 具有bace1抑制活性的2-氨基嘧啶-4-酮及2-氨基吡啶衍生物 |
| UA108363C2 (uk) | 2009-10-08 | 2015-04-27 | Похідні імінотіадіазиндіоксиду як інгібітори bace, композиція на їх основі і їх застосування | |
| EP2485591B1 (en) | 2009-10-08 | 2016-03-23 | Merck Sharp & Dohme Corp. | Iminothiadiazine dioxide compounds as bace inhibitors, compositions, and their use |
| KR20120104570A (ko) | 2009-12-11 | 2012-09-21 | 시오노기세야쿠 가부시키가이샤 | 옥사진 유도체 |
| US20110281894A1 (en) * | 2010-05-12 | 2011-11-17 | Astrazeneca Ab | Hemifumarate salt |
| EP2601197B1 (en) | 2010-08-05 | 2014-06-25 | Amgen Inc. | Amino-iso-indole, amino-aza-iso-indole, amino-dihydroisoquinoline and amino-benzoxazine compounds as beta-secretase modulators and methods of use |
| CN103261199A (zh) | 2010-10-29 | 2013-08-21 | 盐野义制药株式会社 | 萘啶衍生物 |
| EP2634188A4 (en) | 2010-10-29 | 2014-05-07 | Shionogi & Co | FUSIONED AMINODIHYDROPYRIMIDINE DERIVATIVE |
| US20120165346A1 (en) * | 2010-12-22 | 2012-06-28 | Astrazeneca Ab | Compounds and their use as BACE inhibitors |
| CN103608345A (zh) | 2011-04-26 | 2014-02-26 | 盐野义制药株式会社 | 噁嗪衍生物和含有该噁嗪衍生物的bace1抑制剂 |
| WO2014065434A1 (en) | 2012-10-24 | 2014-05-01 | Shionogi & Co., Ltd. | Dihydrooxazine or oxazepine derivatives having bace1 inhibitory activity |
| EP3353844B1 (en) | 2015-03-27 | 2022-05-11 | Mason K. Harrup | All-inorganic solvents for electrolytes |
| CN105272884B (zh) * | 2015-11-02 | 2017-05-24 | 浙江大学 | 一种邻氰基二苯甲酮衍生物的制备方法 |
| US10707531B1 (en) | 2016-09-27 | 2020-07-07 | New Dominion Enterprises Inc. | All-inorganic solvents for electrolytes |
Family Cites Families (80)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4605642A (en) | 1984-02-23 | 1986-08-12 | The Salk Institute For Biological Studies | CRF antagonists |
| US5063245A (en) | 1990-03-28 | 1991-11-05 | Nova Pharmaceutical Corporation | Corticotropin-releasing factor antagonism compounds |
| WO1995011968A1 (en) | 1993-10-27 | 1995-05-04 | Athena Neurosciences, Inc. | Transgenic animals harboring app allele having swedish mutation |
| US5877399A (en) | 1994-01-27 | 1999-03-02 | Johns Hopkins University | Transgenic mice expressing APP-Swedish mutation develop progressive neurologic disease |
| DE4419849A1 (de) | 1994-06-07 | 1995-12-14 | Hoechst Ag | Isoindolinpigmente |
| NZ284846A (en) | 1994-06-16 | 1998-12-23 | Pfizer | 1-substituted-pyrazolo[3,4-b]pyridin-5-carboxylic acid derivatives, preparation, use, intermediates and pharmaceutical compositions thereof |
| DE19516804A1 (de) | 1995-05-08 | 1996-11-14 | Hoechst Ag | Isoindolinpigmente auf Basis von Aminochinoxalindionen |
| JPH11507538A (ja) | 1995-06-07 | 1999-07-06 | アテナ ニューロサイエンシズ インコーポレイティド | β−セクレターゼ、β−セクレターゼに対する抗体、及びβ−セクレターゼ阻害を検出するためのアッセイ |
| US6211235B1 (en) | 1996-11-22 | 2001-04-03 | Elan Pharmaceuticals, Inc. | Compounds for inhibiting β-amyloid peptide release and/or its synthesis |
| GB9701684D0 (en) | 1997-01-28 | 1997-03-19 | Smithkline Beecham Plc | Novel compounds |
| ATE221886T1 (de) | 1997-09-02 | 2002-08-15 | Bristol Myers Squibb Pharma Co | Heterocyclyl-substituierte annellierte pyridine und pyrimidine als antagonisten des corticotropin freisetzenden hormons (crh), verwendbar für die behandlung von cns und stress |
| US5981168A (en) | 1998-05-15 | 1999-11-09 | The University Of British Columbia | Method and composition for modulating amyloidosis |
| NZ510708A (en) | 1998-09-24 | 2003-12-19 | Upjohn Co | Alzheimer's disease and Asp1 and Asp2 cleaving APP site (beta secretase) |
| US6245884B1 (en) | 1998-10-16 | 2001-06-12 | Vivian Y. H. Hook | Secretases related to alzheimer's dementia |
| HK1044545A1 (zh) | 1999-02-10 | 2002-10-25 | Elan Pharmaceuticals, Inc. | 贝他分泌酶组合物及其方法 |
| AU3770800A (en) | 1999-03-26 | 2000-10-16 | Amgen, Inc. | Beta secretase genes and polypeptides |
| WO2000077030A1 (en) | 1999-06-15 | 2000-12-21 | Elan Pharmaceuticals, Inc. | Statine-derived tetrapeptide inhibitors of beta-secretase |
| EP1194449B1 (en) | 1999-06-28 | 2010-09-22 | Oklahoma Medical Research Foundation | Inhibitors of memapsin 2 and use thereof |
| AU782312B2 (en) | 1999-09-23 | 2005-07-21 | Pharmacia & Upjohn Company | Alzheimer's disease secretase, APP substrates therefor, and uses therefor |
| GB9924957D0 (en) | 1999-10-21 | 1999-12-22 | Smithkline Beecham Plc | Novel treatment |
| PE20020276A1 (es) | 2000-06-30 | 2002-04-06 | Elan Pharm Inc | COMPUESTOS DE AMINA SUSTITUIDA COMO INHIBIDORES DE ß-SECRETASA PARA EL TRATAMIENTO DE ALZHEIMER |
| DE60116313T2 (de) | 2000-06-30 | 2006-08-31 | Elan Pharmaceuticals, Inc., San Francisco | Verbindungen zur behandlung der alzheimerischen krankheit |
| US6846813B2 (en) | 2000-06-30 | 2005-01-25 | Pharmacia & Upjohn Company | Compounds to treat alzheimer's disease |
| WO2002014264A2 (en) | 2000-08-11 | 2002-02-21 | The Brigham And Women's Hospital, Inc. | (hydroxyethyl)ureas as inhibitors of alzheimer's beta-amyloid production |
| WO2002025276A1 (en) | 2000-09-22 | 2002-03-28 | Wyeth | Crystal structure of bace and uses thereof |
| SG163508A1 (en) | 2003-12-15 | 2010-08-30 | Schering Corp | Heterocyclic aspartyl protease inhibitors |
| US7592348B2 (en) | 2003-12-15 | 2009-09-22 | Schering Corporation | Heterocyclic aspartyl protease inhibitors |
| WO2005097767A1 (en) | 2004-03-30 | 2005-10-20 | Merck & Co., Inc. | 2-aminothiazole compounds useful as aspartyl protease inhibitors |
| WO2005123672A2 (en) | 2004-06-14 | 2005-12-29 | Takeda San Diego, Inc. | Kinase inhibitors |
| JP2008503460A (ja) | 2004-06-16 | 2008-02-07 | ワイス | β−セクレターゼのインヒビターとしてのジフェニルイミダゾピリミジンおよびイミダゾールアミン |
| ATE444962T1 (de) | 2004-06-16 | 2009-10-15 | Wyeth Corp | Amino-5,5-diphenylimidazolon-derivate zur beta- sekretase-hemmung |
| TW200613272A (en) * | 2004-08-13 | 2006-05-01 | Astrazeneca Ab | Isoindolone compounds and their use as metabotropic glutamate receptor potentiators |
| EP1805171A4 (en) | 2004-09-21 | 2009-05-13 | Wyeth Corp | CRTH2 RECEPTOR ANTAGONISM DISPLAYING INDIGENOUS ACIDS AND APPLICATIONS THEREOF |
| EP1802587A4 (en) | 2004-10-15 | 2010-02-17 | Astrazeneca Ab | SUBSTITUTED AMINO BINDINGS AND THEIR APPLICATIONS |
| WO2006041405A1 (en) | 2004-10-15 | 2006-04-20 | Astrazeneca Ab | Substituted amino-pyrimidones and uses thereof |
| EP1831170A4 (en) | 2004-12-14 | 2009-10-14 | Astrazeneca Ab | SUBSTITUTED AMINOPYRIDINES AND THEIR USE |
| EP2264036A1 (en) * | 2005-01-14 | 2010-12-22 | Wyeth LLC (Formerly Known As Wyeth) | Amino-imidazolones for the inhibition of beta-secretase |
| CA2600570C (en) | 2005-03-14 | 2011-12-06 | Transtech Pharma, Inc. | Benzazole derivatives, compositions, and methods of use as .beta.-secretase inhibitors |
| EP1896032B1 (en) | 2005-06-14 | 2012-10-31 | Merck Sharp & Dohme Corp. | The preparation and use of compounds as protease inhibitors |
| EP1896406A2 (en) | 2005-06-14 | 2008-03-12 | Shering Corporation | The preparation and use of compounds as protease inhibitors |
| CA2609562A1 (en) | 2005-06-14 | 2006-12-28 | Schering Corporation | Macrocyclic heterocyclic aspartyl protease inhibitors |
| AU2006259574A1 (en) | 2005-06-14 | 2006-12-28 | Schering Corporation | The preparation and use of compounds as aspartyl protease inhibitors |
| SG162790A1 (en) | 2005-06-14 | 2010-07-29 | Schering Corp | Aspartyl protease inhibitors |
| US7759353B2 (en) | 2005-06-14 | 2010-07-20 | Schering Corporation | Substituted spiro iminopyrimidinones as aspartyl protease inhibitors, compositions, and methods of treatment |
| TW200738683A (en) | 2005-06-30 | 2007-10-16 | Wyeth Corp | Amino-5-(5-membered)heteroarylimidazolone compounds and the use thereof for β-secretase modulation |
| JP2009500329A (ja) | 2005-06-30 | 2009-01-08 | ワイス | アミノ−5−(6員)ヘテロアリールイミダゾロン化合物およびβ−セレクターゼ調節のためのその使用 |
| WO2007011810A1 (en) | 2005-07-18 | 2007-01-25 | Merck & Co., Inc. | Spiropiperidine beta-secretase inhibitors for the treatment of alzheimer's disease |
| US7601751B2 (en) | 2005-09-01 | 2009-10-13 | Bristol-Myers Squibb Company | Indole acetic acid acyl guanidines as β-secretase inhibitors |
| CN101346357B (zh) | 2005-10-25 | 2014-04-02 | 盐野义制药株式会社 | 氨基二氢噻嗪衍生物 |
| ATE478070T1 (de) | 2005-10-27 | 2010-09-15 | Schering Corp | Heterozyklische aspartyl-proteasehemmer |
| EP1943246A1 (en) | 2005-10-31 | 2008-07-16 | Schering Corporation | Aspartyl protease inhibitors |
| CN101360720A (zh) | 2005-11-15 | 2009-02-04 | 阿斯利康(瑞典)有限公司 | 新颖的2-氨基嘧啶酮衍生物及其用途 |
| EP1951682A4 (en) | 2005-11-15 | 2011-06-15 | Astrazeneca Ab | NEW 2-AMINOPYRIMIDONE OR 2-AMINOPYRIDINONE DERIVATIVES AND THEIR USE |
| CN101360722A (zh) | 2005-11-15 | 2009-02-04 | 阿斯利康(瑞典)有限公司 | 新颖的2-氨基嘧啶衍生物及其用途 |
| TW200804290A (en) | 2005-11-15 | 2008-01-16 | Astrazeneca Ab | Compounds and uses thereof |
| TW200734311A (en) | 2005-11-21 | 2007-09-16 | Astrazeneca Ab | New compounds |
| CN101360716A (zh) | 2005-11-21 | 2009-02-04 | 阿斯利康(瑞典)有限公司 | 新颖的2-氨基-咪唑-4-酮化合物及其在制备用于治疗认知缺损、阿尔茨海默病、神经变性和痴呆的药物中的用途 |
| AR058381A1 (es) | 2005-12-19 | 2008-01-30 | Astrazeneca Ab | Compuestos derivados de 2-aminopiridin-4-onas y una composicion farmaceutica |
| CN101460480A (zh) | 2006-04-05 | 2009-06-17 | 阿斯利康(瑞典)有限公司 | 2-氨基嘧啶-4-酮类化合物及其用于治疗或预防Aβ相关病理的用途 |
| TW200808751A (en) | 2006-04-13 | 2008-02-16 | Astrazeneca Ab | New compounds |
| US8168641B2 (en) | 2006-06-12 | 2012-05-01 | Schering Corporation | Aspartyl protease inhibitors |
| TW200815447A (en) | 2006-06-14 | 2008-04-01 | Astrazeneca Ab | Novel compounds IV |
| TW200815449A (en) | 2006-06-14 | 2008-04-01 | Astrazeneca Ab | Novel compounds II |
| TW200815443A (en) | 2006-06-14 | 2008-04-01 | Astrazeneca Ab | Novel compounds I |
| TW200808796A (en) | 2006-06-14 | 2008-02-16 | Astrazeneca Ab | New compounds III |
| TW200815349A (en) | 2006-06-22 | 2008-04-01 | Astrazeneca Ab | New compounds |
| WO2008063114A1 (en) | 2006-11-20 | 2008-05-29 | Astrazeneca Ab | Amino- imidazolones and their use as medicament for treating cognitive impairment alzheimer disease, neurodegeneration and dementia |
| WO2008076043A1 (en) | 2006-12-20 | 2008-06-26 | Astrazeneca Ab | Novel 2-amino-5,5-diaryl-imidazol-4-ones |
| TW200831484A (en) | 2006-12-20 | 2008-08-01 | Astrazeneca Ab | New compounds |
| TW200831091A (en) | 2006-12-20 | 2008-08-01 | Astrazeneca Ab | New compounds |
| TW200902503A (en) | 2007-05-15 | 2009-01-16 | Astrazeneca Ab | New compounds |
| TW200902499A (en) | 2007-05-15 | 2009-01-16 | Astrazeneca Ab | New compounds |
| WO2009005470A1 (en) * | 2007-07-05 | 2009-01-08 | Astrazeneca Ab | Aryl and heteroaryl substituted isoindole derivatives as bace inhibitors |
| WO2009005471A1 (en) * | 2007-07-05 | 2009-01-08 | Astrazeneca Ab | Aryl and heteroaryl substituted isoindole derivatives as bace inhibitors |
| WO2010056195A1 (en) | 2008-11-14 | 2010-05-20 | Astrazeneca Ab | New compounds 575 |
| US20100125081A1 (en) | 2008-11-14 | 2010-05-20 | Astrazeneca Ab | New compounds 574 |
| EP2485591B1 (en) | 2009-10-08 | 2016-03-23 | Merck Sharp & Dohme Corp. | Iminothiadiazine dioxide compounds as bace inhibitors, compositions, and their use |
| UA108363C2 (uk) | 2009-10-08 | 2015-04-27 | Похідні імінотіадіазиндіоксиду як інгібітори bace, композиція на їх основі і їх застосування | |
| EP2485920B1 (en) | 2009-10-08 | 2016-04-27 | Merck Sharp & Dohme Corp. | Pentafluorosulfur imino heterocyclic compounds as bace-1 inhibitors, compositions, and their use |
| US8557826B2 (en) | 2009-10-08 | 2013-10-15 | Merck Sharp & Dohme Corp. | Pentafluorosulfur imino heterocyclic compounds as BACE-1 inhibitors, compositions, and their use |
-
2009
- 2009-11-12 TW TW098138485A patent/TW201020244A/zh unknown
- 2009-11-13 PE PE2011001034A patent/PE20110875A1/es not_active Application Discontinuation
- 2009-11-13 UY UY0001032241A patent/UY32241A/es not_active Application Discontinuation
- 2009-11-13 US US12/618,212 patent/US8030500B2/en not_active Expired - Fee Related
- 2009-11-13 EP EP09826375A patent/EP2367814A4/en not_active Withdrawn
- 2009-11-13 JP JP2011536289A patent/JP2012508734A/ja active Pending
- 2009-11-13 WO PCT/SE2009/051295 patent/WO2010056196A1/en not_active Ceased
- 2009-11-13 CA CA2743938A patent/CA2743938A1/en not_active Abandoned
- 2009-11-13 BR BRPI0921879A patent/BRPI0921879A2/pt not_active Application Discontinuation
- 2009-11-13 CN CN2009801545281A patent/CN102282140A/zh active Pending
- 2009-11-13 AR ARP090104400A patent/AR074341A1/es unknown
- 2009-11-13 EA EA201190020A patent/EA201190020A1/ru unknown
- 2009-11-13 AU AU2009314664A patent/AU2009314664A1/en not_active Abandoned
- 2009-11-13 KR KR1020117013516A patent/KR20110091540A/ko not_active Withdrawn
- 2009-11-13 MX MX2011004918A patent/MX2011004918A/es not_active Application Discontinuation
-
2011
- 2011-04-28 IL IL212590A patent/IL212590A0/en unknown
- 2011-04-28 CO CO11052264A patent/CO6362004A2/es not_active Application Discontinuation
- 2011-05-13 CL CL2011001098A patent/CL2011001098A1/es unknown
- 2011-05-13 NI NI201100099A patent/NI201100099A/es unknown
- 2011-05-13 EC EC2011011051A patent/ECSP11011051A/es unknown
- 2011-05-13 DO DO2011000138A patent/DOP2011000138A/es unknown
- 2011-05-13 CR CR20110255A patent/CR20110255A/es unknown
- 2011-05-13 CU CU20110106A patent/CU20110106A7/es unknown
- 2011-06-13 ZA ZA2011/04396A patent/ZA201104396B/en unknown
- 2011-09-06 US US13/225,707 patent/US20110319426A1/en not_active Abandoned
Also Published As
| Publication number | Publication date |
|---|---|
| EA201190020A1 (ru) | 2012-02-28 |
| CL2011001098A1 (es) | 2012-02-24 |
| ECSP11011051A (es) | 2011-06-30 |
| MX2011004918A (es) | 2011-05-30 |
| AR074341A1 (es) | 2011-01-12 |
| US20110319426A1 (en) | 2011-12-29 |
| IL212590A0 (en) | 2011-07-31 |
| DOP2011000138A (es) | 2011-06-30 |
| EP2367814A4 (en) | 2012-07-04 |
| BRPI0921879A2 (pt) | 2018-10-16 |
| CN102282140A (zh) | 2011-12-14 |
| CO6362004A2 (es) | 2012-01-20 |
| CU20110106A7 (es) | 2012-01-31 |
| TW201020244A (en) | 2010-06-01 |
| NI201100099A (es) | 2012-03-19 |
| PE20110875A1 (es) | 2012-01-11 |
| UY32241A (es) | 2010-06-30 |
| CR20110255A (es) | 2011-07-04 |
| AU2009314664A1 (en) | 2011-06-23 |
| JP2012508734A (ja) | 2012-04-12 |
| EP2367814A1 (en) | 2011-09-28 |
| ZA201104396B (en) | 2012-03-28 |
| WO2010056196A1 (en) | 2010-05-20 |
| US20100125082A1 (en) | 2010-05-20 |
| KR20110091540A (ko) | 2011-08-11 |
| US8030500B2 (en) | 2011-10-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US8030500B2 (en) | Substituted isoindoles for the treatment and/or prevention of Aβ- related pathologies | |
| US20100125081A1 (en) | New compounds 574 | |
| US20100125087A1 (en) | New compounds 575 | |
| JP7789662B2 (ja) | Mta協働prmt5阻害剤 | |
| AU2004226165C1 (en) | Pyrimidin-4-one derivatives and their use as p38 kinase modulators | |
| KR101666517B1 (ko) | 암의 치료를 위한 wnt 신호전달 경로 억제제로서의 피리딘계 및 피리미딘계 화합물 | |
| EP3480193B1 (en) | Pyrazole derivatives as alk5 inhibitors and uses thereof | |
| KR101342184B1 (ko) | 사치환된 피리다진 헷지호그 경로 길항제 | |
| US20080161269A1 (en) | Compounds 620 | |
| WO2011002409A1 (en) | 5h-pyrrolo[3,4-£>]pyrazin-7-amine derivatives inhibitors of beta-secretase | |
| JP2009504804A5 (enExample) | ||
| WO2011002407A1 (en) | Novel compounds for treatment of neurodegeneration associated with diseases, such as alzheimer's disease or dementia | |
| WO2011002408A1 (en) | Novel compounds for treatment of neurodegeneration associated with diseases, such as alzheimer's disease or dementia | |
| WO2008121064A1 (en) | New imidazo[4,5-b]pyridine-6-halo-7-aryl/heteroaryl compounds 705 | |
| WO2016149058A1 (en) | Triazolyl pyrimidinone compounds as pde2 inhibitors | |
| EP4562002A1 (en) | Substituted bicyclic heteroaryl sulfonamide derivatives for the treatment of cancer | |
| WO2012087236A1 (en) | Compounds and their use as bace inhibitors | |
| HK1164846A (en) | New compounds 578 | |
| WO2022166468A1 (zh) | Bruton's酪氨酸激酶抑制剂及其应用 | |
| CN101501040A (zh) | 氨基-咪唑啉以及它们作为治疗认知缺损、阿尔茨海默病、神经变性和痴呆的药物的用途 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| FZDE | Discontinued |
Effective date: 20141113 |