CA2558243A1 - Inhibitors of histone deacetylase - Google Patents
Inhibitors of histone deacetylase Download PDFInfo
- Publication number
- CA2558243A1 CA2558243A1 CA002558243A CA2558243A CA2558243A1 CA 2558243 A1 CA2558243 A1 CA 2558243A1 CA 002558243 A CA002558243 A CA 002558243A CA 2558243 A CA2558243 A CA 2558243A CA 2558243 A1 CA2558243 A1 CA 2558243A1
- Authority
- CA
- Canada
- Prior art keywords
- thiazole
- piperazin
- carboxylic acid
- acid hydroxyamide
- phenyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Abandoned
Links
- 102000003964 Histone deacetylase Human genes 0.000 title abstract description 31
- 108090000353 Histone deacetylase Proteins 0.000 title abstract description 31
- 239000003112 inhibitor Substances 0.000 title description 9
- 150000001875 compounds Chemical class 0.000 claims abstract description 171
- 238000000034 method Methods 0.000 claims abstract description 76
- 239000008194 pharmaceutical composition Substances 0.000 claims abstract description 20
- 230000002062 proliferating effect Effects 0.000 claims abstract description 11
- -1 methylimidazolyl Chemical group 0.000 claims description 278
- ZXKINMCYCKHYFR-UHFFFAOYSA-N aminooxidanide Chemical compound [O-]N ZXKINMCYCKHYFR-UHFFFAOYSA-N 0.000 claims description 246
- 125000004194 piperazin-1-yl group Chemical group [H]N1C([H])([H])C([H])([H])N(*)C([H])([H])C1([H])[H] 0.000 claims description 129
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 91
- 125000001072 heteroaryl group Chemical group 0.000 claims description 89
- 229910052739 hydrogen Inorganic materials 0.000 claims description 73
- 125000002947 alkylene group Chemical group 0.000 claims description 72
- 125000003118 aryl group Chemical group 0.000 claims description 61
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 60
- 125000000217 alkyl group Chemical group 0.000 claims description 56
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 claims description 53
- 125000000623 heterocyclic group Chemical group 0.000 claims description 53
- 125000000547 substituted alkyl group Chemical group 0.000 claims description 36
- 125000003107 substituted aryl group Chemical group 0.000 claims description 36
- 239000001257 hydrogen Substances 0.000 claims description 32
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 claims description 30
- 125000004432 carbon atom Chemical group C* 0.000 claims description 27
- 125000004104 aryloxy group Chemical group 0.000 claims description 26
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 26
- 150000003839 salts Chemical class 0.000 claims description 25
- 125000002993 cycloalkylene group Chemical group 0.000 claims description 23
- 229910052757 nitrogen Inorganic materials 0.000 claims description 22
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 claims description 22
- 125000004450 alkenylene group Chemical group 0.000 claims description 20
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 20
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 20
- 125000001424 substituent group Chemical group 0.000 claims description 20
- 229940002612 prodrug Drugs 0.000 claims description 19
- 239000000651 prodrug Substances 0.000 claims description 19
- 125000003342 alkenyl group Chemical group 0.000 claims description 17
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 17
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 claims description 16
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims description 15
- 125000004442 acylamino group Chemical group 0.000 claims description 14
- 125000005346 substituted cycloalkyl group Chemical group 0.000 claims description 14
- 125000003545 alkoxy group Chemical group 0.000 claims description 13
- 125000000266 alpha-aminoacyl group Chemical group 0.000 claims description 13
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 13
- 125000005415 substituted alkoxy group Chemical group 0.000 claims description 13
- 125000005717 substituted cycloalkylene group Chemical group 0.000 claims description 13
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 12
- 125000002252 acyl group Chemical group 0.000 claims description 12
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 12
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims description 11
- 229910052799 carbon Inorganic materials 0.000 claims description 11
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 10
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical group [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 claims description 10
- 125000005017 substituted alkenyl group Chemical group 0.000 claims description 10
- 125000004001 thioalkyl group Chemical group 0.000 claims description 10
- 229910052720 vanadium Inorganic materials 0.000 claims description 10
- 230000000259 anti-tumor effect Effects 0.000 claims description 9
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 9
- 230000002401 inhibitory effect Effects 0.000 claims description 9
- 125000001541 3-thienyl group Chemical group S1C([H])=C([*])C([H])=C1[H] 0.000 claims description 8
- 239000002246 antineoplastic agent Substances 0.000 claims description 8
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 8
- 125000001544 thienyl group Chemical group 0.000 claims description 8
- 125000001624 naphthyl group Chemical group 0.000 claims description 7
- 125000003762 3,4-dimethoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C(OC([H])([H])[H])C([H])=C1* 0.000 claims description 6
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 claims description 6
- 125000004863 4-trifluoromethoxyphenyl group Chemical group [H]C1=C([H])C(OC(F)(F)F)=C([H])C([H])=C1* 0.000 claims description 6
- 239000003276 histone deacetylase inhibitor Substances 0.000 claims description 6
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 claims description 6
- 229910052727 yttrium Inorganic materials 0.000 claims description 6
- 229940100198 alkylating agent Drugs 0.000 claims description 5
- 239000002168 alkylating agent Substances 0.000 claims description 5
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 5
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 claims description 5
- 229910052697 platinum Inorganic materials 0.000 claims description 5
- 239000012440 retinoic acid metabolism blocking agent Substances 0.000 claims description 5
- 229940095743 selective estrogen receptor modulator Drugs 0.000 claims description 5
- 239000000333 selective estrogen receptor modulator Substances 0.000 claims description 5
- 229910052721 tungsten Inorganic materials 0.000 claims description 5
- WPIKKUSJZBLVPY-UHFFFAOYSA-N 2-[4-(4-acetylphenyl)sulfonylpiperazin-1-yl]-n-hydroxy-1,3-thiazole-5-carboxamide Chemical compound C1=CC(C(=O)C)=CC=C1S(=O)(=O)N1CCN(C=2SC(=CN=2)C(=O)NO)CC1 WPIKKUSJZBLVPY-UHFFFAOYSA-N 0.000 claims description 4
- WFYBTESVTKBMEB-UHFFFAOYSA-N 2-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]-n-hydroxy-1,3-thiazole-5-carboxamide Chemical compound S1C(C(=O)NO)=CN=C1N1CCN(S(=O)(=O)C=2C=CC(F)=CC=2)CC1 WFYBTESVTKBMEB-UHFFFAOYSA-N 0.000 claims description 4
- SOJXWCHXNJFSHA-UHFFFAOYSA-N 2-[4-[5-(dimethylamino)naphthalen-1-yl]sulfonylpiperazin-1-yl]-n-hydroxy-1,3-thiazole-5-carboxamide Chemical compound C1=CC=C2C(N(C)C)=CC=CC2=C1S(=O)(=O)N(CC1)CCN1C1=NC=C(C(=O)NO)S1 SOJXWCHXNJFSHA-UHFFFAOYSA-N 0.000 claims description 4
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 claims description 4
- 125000004198 2-fluorophenyl group Chemical group [H]C1=C([H])C(F)=C(*)C([H])=C1[H] 0.000 claims description 4
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 claims description 4
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 claims description 4
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 claims description 4
- 125000004211 3,5-difluorophenyl group Chemical group [H]C1=C(F)C([H])=C(*)C([H])=C1F 0.000 claims description 4
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 claims description 4
- 125000004180 3-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(F)=C1[H] 0.000 claims description 4
- 125000004207 3-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(OC([H])([H])[H])=C1[H] 0.000 claims description 4
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 claims description 4
- 125000004861 4-isopropyl phenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 4
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 claims description 4
- AOJJSUZBOXZQNB-TZSSRYMLSA-N Doxorubicin Chemical compound O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(=O)CO)[C@H]1C[C@H](N)[C@H](O)[C@H](C)O1 AOJJSUZBOXZQNB-TZSSRYMLSA-N 0.000 claims description 4
- 229940102550 Estrogen receptor antagonist Drugs 0.000 claims description 4
- NKANXQFJJICGDU-QPLCGJKRSA-N Tamoxifen Chemical compound C=1C=CC=CC=1C(/CC)=C(C=1C=CC(OCCN(C)C)=CC=1)/C1=CC=CC=C1 NKANXQFJJICGDU-QPLCGJKRSA-N 0.000 claims description 4
- 125000006268 biphenyl-3-yl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C1=C([H])C(*)=C([H])C([H])=C1[H] 0.000 claims description 4
- UKJLNMAFNRKWGR-UHFFFAOYSA-N cyclohexatrienamine Chemical group NC1=CC=C=C[CH]1 UKJLNMAFNRKWGR-UHFFFAOYSA-N 0.000 claims description 4
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 claims description 4
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 claims description 4
- DXASQZJWWGZNSF-UHFFFAOYSA-N n,n-dimethylmethanamine;sulfur trioxide Chemical group CN(C)C.O=S(=O)=O DXASQZJWWGZNSF-UHFFFAOYSA-N 0.000 claims description 4
- NDDBGRAAXATVPM-UHFFFAOYSA-N n-hydroxy-2-[4-(4-phenylphenyl)sulfonylpiperazin-1-yl]-1,3-thiazole-5-carboxamide Chemical compound S1C(C(=O)NO)=CN=C1N1CCN(S(=O)(=O)C=2C=CC(=CC=2)C=2C=CC=CC=2)CC1 NDDBGRAAXATVPM-UHFFFAOYSA-N 0.000 claims description 4
- PUEIPAZPNFIMBW-UHFFFAOYSA-N n-hydroxy-2-[4-[4-(trifluoromethoxy)phenyl]sulfonylpiperazin-1-yl]-1,3-thiazole-5-carboxamide Chemical compound S1C(C(=O)NO)=CN=C1N1CCN(S(=O)(=O)C=2C=CC(OC(F)(F)F)=CC=2)CC1 PUEIPAZPNFIMBW-UHFFFAOYSA-N 0.000 claims description 4
- KPDDJYNSRQPTKP-UHFFFAOYSA-N n-hydroxy-2-[4-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]-1,3-thiazole-5-carboxamide Chemical compound S1C(C(=O)NO)=CN=C1N1CCN(S(=O)(=O)C=2C=CC(=CC=2)C(F)(F)F)CC1 KPDDJYNSRQPTKP-UHFFFAOYSA-N 0.000 claims description 4
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 claims description 4
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 claims description 4
- 125000000335 thiazolyl group Chemical group 0.000 claims description 4
- HEUFSDCAWMYPTG-UHFFFAOYSA-N 2-[4-(2-phenylacetyl)piperazin-1-yl]-1,3-thiazole-5-carboxylic acid Chemical compound S1C(C(=O)O)=CN=C1N1CCN(C(=O)CC=2C=CC=CC=2)CC1 HEUFSDCAWMYPTG-UHFFFAOYSA-N 0.000 claims description 3
- GBYHFKMJQQDMBI-UHFFFAOYSA-N 2-[4-(3,4-dimethoxyphenyl)sulfonylpiperazin-1-yl]-n-hydroxy-1,3-thiazole-5-carboxamide Chemical compound C1=C(OC)C(OC)=CC=C1S(=O)(=O)N1CCN(C=2SC(=CN=2)C(=O)NO)CC1 GBYHFKMJQQDMBI-UHFFFAOYSA-N 0.000 claims description 3
- UFWOOUJZRJGIFE-UHFFFAOYSA-N 2-[4-(3,4-dimethylphenyl)sulfonylpiperazin-1-yl]-n-hydroxy-1,3-thiazole-5-carboxamide Chemical compound C1=C(C)C(C)=CC=C1S(=O)(=O)N1CCN(C=2SC(=CN=2)C(=O)NO)CC1 UFWOOUJZRJGIFE-UHFFFAOYSA-N 0.000 claims description 3
- NNKZQUPVEPHEPS-UHFFFAOYSA-N 2-[4-[(3,5-dimethyl-2h-1,2-oxazol-3-yl)sulfonyl]piperazin-1-yl]-n-hydroxy-1,3-thiazole-5-carboxamide Chemical compound N1OC(C)=CC1(C)S(=O)(=O)N1CCN(C=2SC(=CN=2)C(=O)NO)CC1 NNKZQUPVEPHEPS-UHFFFAOYSA-N 0.000 claims description 3
- YIVMOAUARZOMIP-UHFFFAOYSA-N 2-[4-[2-[3-(dimethylamino)phenyl]phenyl]sulfonylpiperazin-1-yl]-n-hydroxy-1,3-thiazole-5-carboxamide Chemical compound CN(C)C1=CC=CC(C=2C(=CC=CC=2)S(=O)(=O)N2CCN(CC2)C=2SC(=CN=2)C(=O)NO)=C1 YIVMOAUARZOMIP-UHFFFAOYSA-N 0.000 claims description 3
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 claims description 3
- 101001012157 Homo sapiens Receptor tyrosine-protein kinase erbB-2 Proteins 0.000 claims description 3
- 102100030086 Receptor tyrosine-protein kinase erbB-2 Human genes 0.000 claims description 3
- 229940122803 Vinca alkaloid Drugs 0.000 claims description 3
- 229930003316 Vitamin D Natural products 0.000 claims description 3
- QYSXJUFSXHHAJI-XFEUOLMDSA-N Vitamin D3 Natural products C1(/[C@@H]2CC[C@@H]([C@]2(CCC1)C)[C@H](C)CCCC(C)C)=C/C=C1\C[C@@H](O)CCC1=C QYSXJUFSXHHAJI-XFEUOLMDSA-N 0.000 claims description 3
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 claims description 3
- 229940045799 anthracyclines and related substance Drugs 0.000 claims description 3
- 125000000319 biphenyl-4-yl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 claims description 3
- 239000003968 dna methyltransferase inhibitor Substances 0.000 claims description 3
- 229940043355 kinase inhibitor Drugs 0.000 claims description 3
- ZRJUABKPNNHWEB-UHFFFAOYSA-N n-hydroxy-2-(4-thiophen-2-ylsulfonylpiperazin-1-yl)-1,3-thiazole-5-carboxamide Chemical compound S1C(C(=O)NO)=CN=C1N1CCN(S(=O)(=O)C=2SC=CC=2)CC1 ZRJUABKPNNHWEB-UHFFFAOYSA-N 0.000 claims description 3
- SINFIJWJVFHMHP-UHFFFAOYSA-N n-hydroxy-2-[4-(4-nitrophenyl)sulfonylpiperazin-1-yl]-1,3-thiazole-5-carboxamide Chemical compound S1C(C(=O)NO)=CN=C1N1CCN(S(=O)(=O)C=2C=CC(=CC=2)[N+]([O-])=O)CC1 SINFIJWJVFHMHP-UHFFFAOYSA-N 0.000 claims description 3
- DFQBYXXWJMNWLC-UHFFFAOYSA-N n-hydroxy-2-[4-(4-propan-2-ylphenyl)sulfonylpiperazin-1-yl]-1,3-thiazole-5-carboxamide Chemical compound C1=CC(C(C)C)=CC=C1S(=O)(=O)N1CCN(C=2SC(=CN=2)C(=O)NO)CC1 DFQBYXXWJMNWLC-UHFFFAOYSA-N 0.000 claims description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 3
- 239000003757 phosphotransferase inhibitor Substances 0.000 claims description 3
- 125000003386 piperidinyl group Chemical group 0.000 claims description 3
- 239000003528 protein farnesyltransferase inhibitor Substances 0.000 claims description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 3
- 235000019166 vitamin D Nutrition 0.000 claims description 3
- 239000011710 vitamin D Substances 0.000 claims description 3
- 150000003710 vitamin D derivatives Chemical class 0.000 claims description 3
- 229940046008 vitamin d Drugs 0.000 claims description 3
- 125000004916 (C1-C6) alkylcarbonyl group Chemical group 0.000 claims description 2
- JYRKKOKBUMZIPS-UHFFFAOYSA-N 2-(4-acetylpiperazin-1-yl)-1,3-thiazole-5-carboxylic acid Chemical compound C1CN(C(=O)C)CCN1C1=NC=C(C(O)=O)S1 JYRKKOKBUMZIPS-UHFFFAOYSA-N 0.000 claims description 2
- GALLLEJEOZLPMY-UHFFFAOYSA-N 2-(4-benzoylpiperazin-1-yl)-1,3-thiazole-5-carboxylic acid Chemical compound S1C(C(=O)O)=CN=C1N1CCN(C(=O)C=2C=CC=CC=2)CC1 GALLLEJEOZLPMY-UHFFFAOYSA-N 0.000 claims description 2
- HGKGJEZYUNSVHC-UHFFFAOYSA-N 2-(4-benzylpiperazin-1-yl)-n-hydroxy-1,3-thiazole-5-carboxamide Chemical compound S1C(C(=O)NO)=CN=C1N1CCN(CC=2C=CC=CC=2)CC1 HGKGJEZYUNSVHC-UHFFFAOYSA-N 0.000 claims description 2
- ZNHRIWFGFHOHDX-UHFFFAOYSA-N 2-(4-benzylsulfonylpiperazin-1-yl)-n-hydroxy-1,3-thiazole-5-carboxamide Chemical compound S1C(C(=O)NO)=CN=C1N1CCN(S(=O)(=O)CC=2C=CC=CC=2)CC1 ZNHRIWFGFHOHDX-UHFFFAOYSA-N 0.000 claims description 2
- FMNPXFRYSSBHOZ-UHFFFAOYSA-N 2-(4-ethylsulfonylpiperazin-1-yl)-n-hydroxy-1,3-thiazole-5-carboxamide Chemical compound C1CN(S(=O)(=O)CC)CCN1C1=NC=C(C(=O)NO)S1 FMNPXFRYSSBHOZ-UHFFFAOYSA-N 0.000 claims description 2
- MHBJCMOWAMOGOV-UHFFFAOYSA-N 2-[4-(2,1,3-benzothiadiazol-5-ylsulfonyl)piperazin-1-yl]-n-hydroxy-1,3-thiazole-5-carboxamide Chemical compound S1C(C(=O)NO)=CN=C1N1CCN(S(=O)(=O)C2=CC3=NSN=C3C=C2)CC1 MHBJCMOWAMOGOV-UHFFFAOYSA-N 0.000 claims description 2
- CGTHHJAXHDABPA-UHFFFAOYSA-N 2-[4-(2,3-dihydro-1-benzofuran-2-ylsulfonyl)piperazin-1-yl]-n-hydroxy-1,3-thiazole-5-carboxamide Chemical compound S1C(C(=O)NO)=CN=C1N1CCN(S(=O)(=O)C2OC3=CC=CC=C3C2)CC1 CGTHHJAXHDABPA-UHFFFAOYSA-N 0.000 claims description 2
- UKJCXLXVTHZMMK-UHFFFAOYSA-N 2-[4-(2,5-dimethoxyphenyl)sulfonylpiperazin-1-yl]-n-hydroxy-1,3-thiazole-5-carboxamide Chemical compound COC1=CC=C(OC)C(S(=O)(=O)N2CCN(CC2)C=2SC(=CN=2)C(=O)NO)=C1 UKJCXLXVTHZMMK-UHFFFAOYSA-N 0.000 claims description 2
- HBBKVCNUVSYCMM-UHFFFAOYSA-N 2-[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]-n-hydroxy-1,3-thiazole-5-carboxamide Chemical compound CC1=CC=C(C)C(S(=O)(=O)N2CCN(CC2)C=2SC(=CN=2)C(=O)NO)=C1 HBBKVCNUVSYCMM-UHFFFAOYSA-N 0.000 claims description 2
- BEPFYWFQTNUTIV-UHFFFAOYSA-N 2-[4-(2-aminoethyl)piperazin-1-yl]-n-hydroxy-1,3-thiazole-5-carboxamide Chemical compound C1CN(CCN)CCN1C1=NC=C(C(=O)NO)S1 BEPFYWFQTNUTIV-UHFFFAOYSA-N 0.000 claims description 2
- NBKWNKHXPLQXRE-UHFFFAOYSA-N 2-[4-(2-chloro-5-methoxyphenyl)sulfonylpiperazin-1-yl]-n-hydroxy-1,3-thiazole-5-carboxamide Chemical compound COC1=CC=C(Cl)C(S(=O)(=O)N2CCN(CC2)C=2SC(=CN=2)C(=O)NO)=C1 NBKWNKHXPLQXRE-UHFFFAOYSA-N 0.000 claims description 2
- OGSULBXSPWXVJZ-UHFFFAOYSA-N 2-[4-(3,4-difluorophenyl)sulfonylpiperazin-1-yl]-n-hydroxy-1,3-thiazole-5-carboxamide Chemical compound S1C(C(=O)NO)=CN=C1N1CCN(S(=O)(=O)C=2C=C(F)C(F)=CC=2)CC1 OGSULBXSPWXVJZ-UHFFFAOYSA-N 0.000 claims description 2
- LUEGKVZPBPBUAA-UHFFFAOYSA-N 2-[4-(3,4-dihydro-1,2-benzodioxin-3-ylsulfonyl)piperazin-1-yl]-n-hydroxy-1,3-thiazole-5-carboxamide Chemical compound S1C(C(=O)NO)=CN=C1N1CCN(S(=O)(=O)C2OOC3=CC=CC=C3C2)CC1 LUEGKVZPBPBUAA-UHFFFAOYSA-N 0.000 claims description 2
- IWKHJIZHKWNSPU-UHFFFAOYSA-N 2-[4-(3,5-difluorophenyl)sulfonylpiperazin-1-yl]-n-hydroxy-1,3-thiazole-5-carboxamide Chemical compound S1C(C(=O)NO)=CN=C1N1CCN(S(=O)(=O)C=2C=C(F)C=C(F)C=2)CC1 IWKHJIZHKWNSPU-UHFFFAOYSA-N 0.000 claims description 2
- YYMQWWSSJUUEAJ-UHFFFAOYSA-N 2-[4-(3-chloro-4-methylphenyl)sulfonylpiperazin-1-yl]-n-hydroxy-1,3-thiazole-5-carboxamide Chemical compound C1=C(Cl)C(C)=CC=C1S(=O)(=O)N1CCN(C=2SC(=CN=2)C(=O)NO)CC1 YYMQWWSSJUUEAJ-UHFFFAOYSA-N 0.000 claims description 2
- HMQYJPLXNUTWEL-UHFFFAOYSA-N 2-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]-n-hydroxy-1,3-thiazole-5-carboxamide Chemical compound S1C(C(=O)NO)=CN=C1N1CCN(S(=O)(=O)C=2C=C(Cl)C=CC=2)CC1 HMQYJPLXNUTWEL-UHFFFAOYSA-N 0.000 claims description 2
- FCUYTJOJEPTJPE-UHFFFAOYSA-N 2-[4-(3-fluoro-4-methylphenyl)sulfonylpiperazin-1-yl]-n-hydroxy-1,3-thiazole-5-carboxamide Chemical compound C1=C(F)C(C)=CC=C1S(=O)(=O)N1CCN(C=2SC(=CN=2)C(=O)NO)CC1 FCUYTJOJEPTJPE-UHFFFAOYSA-N 0.000 claims description 2
- JPVRFUFZJITWNO-UHFFFAOYSA-N 2-[4-(3-fluoro-4-pyrrolidin-1-ylphenyl)sulfonylpiperazin-1-yl]-n-hydroxy-1,3-thiazole-5-carboxamide Chemical compound S1C(C(=O)NO)=CN=C1N1CCN(S(=O)(=O)C=2C=C(F)C(N3CCCC3)=CC=2)CC1 JPVRFUFZJITWNO-UHFFFAOYSA-N 0.000 claims description 2
- WWTYHELDVQDSGS-UHFFFAOYSA-N 2-[4-(4-chloro-2,5-dimethylphenyl)sulfonylpiperazin-1-yl]-n-hydroxy-1,3-thiazole-5-carboxamide Chemical compound C1=C(Cl)C(C)=CC(S(=O)(=O)N2CCN(CC2)C=2SC(=CN=2)C(=O)NO)=C1C WWTYHELDVQDSGS-UHFFFAOYSA-N 0.000 claims description 2
- CCYVPHPXVQBMJP-UHFFFAOYSA-N 2-[4-(4-fluoro-2-methylphenyl)sulfonylpiperazin-1-yl]-n-hydroxy-1,3-thiazole-5-carboxamide Chemical compound CC1=CC(F)=CC=C1S(=O)(=O)N1CCN(C=2SC(=CN=2)C(=O)NO)CC1 CCYVPHPXVQBMJP-UHFFFAOYSA-N 0.000 claims description 2
- SJNRBXQBNVMAHD-UHFFFAOYSA-N 2-[4-(5-bromothiophen-2-yl)sulfonylpiperazin-1-yl]-n-hydroxy-1,3-thiazole-5-carboxamide Chemical compound S1C(C(=O)NO)=CN=C1N1CCN(S(=O)(=O)C=2SC(Br)=CC=2)CC1 SJNRBXQBNVMAHD-UHFFFAOYSA-N 0.000 claims description 2
- VIXYFHCVTWUEOQ-UHFFFAOYSA-N 2-[4-(benzenesulfonyl)piperazin-1-yl]-n-hydroxy-1,3-thiazole-5-carboxamide Chemical compound S1C(C(=O)NO)=CN=C1N1CCN(S(=O)(=O)C=2C=CC=CC=2)CC1 VIXYFHCVTWUEOQ-UHFFFAOYSA-N 0.000 claims description 2
- SZRLIGGFLWCVGB-UHFFFAOYSA-N 2-[4-[2-[3-[[2-(dimethylamino)ethyl-methylamino]methyl]phenyl]phenyl]sulfonylpiperazin-1-yl]-n-hydroxy-1,3-thiazole-5-carboxamide Chemical compound CN(C)CCN(C)CC1=CC=CC(C=2C(=CC=CC=2)S(=O)(=O)N2CCN(CC2)C=2SC(=CN=2)C(=O)NO)=C1 SZRLIGGFLWCVGB-UHFFFAOYSA-N 0.000 claims description 2
- CKDMDMZILKCVKD-UHFFFAOYSA-N 2-[4-[2-[3-[[bis(2-hydroxyethyl)amino]methyl]phenyl]phenyl]sulfonylpiperazin-1-yl]-n-hydroxy-1,3-thiazole-5-carboxamide Chemical compound OCCN(CCO)CC1=CC=CC(C=2C(=CC=CC=2)S(=O)(=O)N2CCN(CC2)C=2SC(=CN=2)C(=O)NO)=C1 CKDMDMZILKCVKD-UHFFFAOYSA-N 0.000 claims description 2
- MZZKPNDVZGJWIS-UHFFFAOYSA-N 2-[4-[3-(difluoromethoxy)phenyl]sulfonylpiperazin-1-yl]-n-hydroxy-1,3-thiazole-5-carboxamide Chemical compound S1C(C(=O)NO)=CN=C1N1CCN(S(=O)(=O)C=2C=C(OC(F)F)C=CC=2)CC1 MZZKPNDVZGJWIS-UHFFFAOYSA-N 0.000 claims description 2
- JVJPCFWFVBHBQZ-UHFFFAOYSA-N 2-[4-[4-(1,3-benzodioxol-5-yl)phenyl]sulfonylpiperazin-1-yl]-n-hydroxy-1,3-thiazole-5-carboxamide Chemical compound S1C(C(=O)NO)=CN=C1N1CCN(S(=O)(=O)C=2C=CC(=CC=2)C=2C=C3OCOC3=CC=2)CC1 JVJPCFWFVBHBQZ-UHFFFAOYSA-N 0.000 claims description 2
- GBICOHNNXMTKGH-UHFFFAOYSA-N 2-[4-[4-(2-chlorophenyl)phenyl]sulfonylpiperazin-1-yl]-n-hydroxy-1,3-thiazole-5-carboxamide Chemical compound S1C(C(=O)NO)=CN=C1N1CCN(S(=O)(=O)C=2C=CC(=CC=2)C=2C(=CC=CC=2)Cl)CC1 GBICOHNNXMTKGH-UHFFFAOYSA-N 0.000 claims description 2
- RBOUZBXUMBLELS-UHFFFAOYSA-N 2-[4-[4-(3-chlorophenyl)phenyl]sulfonylpiperazin-1-yl]-n-hydroxy-1,3-thiazole-5-carboxamide Chemical compound S1C(C(=O)NO)=CN=C1N1CCN(S(=O)(=O)C=2C=CC(=CC=2)C=2C=C(Cl)C=CC=2)CC1 RBOUZBXUMBLELS-UHFFFAOYSA-N 0.000 claims description 2
- KUJQVJQELSMKKL-UHFFFAOYSA-N 2-[4-[4-(4-fluorophenyl)phenyl]sulfonylpiperazin-1-yl]-n-hydroxy-1,3-thiazole-5-carboxamide Chemical compound S1C(C(=O)NO)=CN=C1N1CCN(S(=O)(=O)C=2C=CC(=CC=2)C=2C=CC(F)=CC=2)CC1 KUJQVJQELSMKKL-UHFFFAOYSA-N 0.000 claims description 2
- ZUOKLFZWOKZOIC-UHFFFAOYSA-N 2-[4-[4-[3-[(dimethylamino)methyl]furan-2-yl]phenyl]sulfonylpiperazin-1-yl]-n-hydroxy-1,3-thiazole-5-carboxamide Chemical compound C1=COC(C=2C=CC(=CC=2)S(=O)(=O)N2CCN(CC2)C=2SC(=CN=2)C(=O)NO)=C1CN(C)C ZUOKLFZWOKZOIC-UHFFFAOYSA-N 0.000 claims description 2
- 125000000022 2-aminoethyl group Chemical group [H]C([*])([H])C([H])([H])N([H])[H] 0.000 claims description 2
- 125000004199 4-trifluoromethylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C(F)(F)F 0.000 claims description 2
- NMUSYJAQQFHJEW-KVTDHHQDSA-N 5-azacytidine Chemical compound O=C1N=C(N)N=CN1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 NMUSYJAQQFHJEW-KVTDHHQDSA-N 0.000 claims description 2
- 125000006163 5-membered heteroaryl group Chemical group 0.000 claims description 2
- STQGQHZAVUOBTE-UHFFFAOYSA-N 7-Cyan-hept-2t-en-4,6-diinsaeure Natural products C1=2C(O)=C3C(=O)C=4C(OC)=CC=CC=4C(=O)C3=C(O)C=2CC(O)(C(C)=O)CC1OC1CC(N)C(O)C(C)O1 STQGQHZAVUOBTE-UHFFFAOYSA-N 0.000 claims description 2
- BFYIZQONLCFLEV-DAELLWKTSA-N Aromasine Chemical compound O=C1C=C[C@]2(C)[C@H]3CC[C@](C)(C(CC4)=O)[C@@H]4[C@@H]3CC(=C)C2=C1 BFYIZQONLCFLEV-DAELLWKTSA-N 0.000 claims description 2
- GAGWJHPBXLXJQN-UORFTKCHSA-N Capecitabine Chemical compound C1=C(F)C(NC(=O)OCCCCC)=NC(=O)N1[C@H]1[C@H](O)[C@H](O)[C@@H](C)O1 GAGWJHPBXLXJQN-UORFTKCHSA-N 0.000 claims description 2
- GAGWJHPBXLXJQN-UHFFFAOYSA-N Capecitabine Natural products C1=C(F)C(NC(=O)OCCCCC)=NC(=O)N1C1C(O)C(O)C(C)O1 GAGWJHPBXLXJQN-UHFFFAOYSA-N 0.000 claims description 2
- DLGOEMSEDOSKAD-UHFFFAOYSA-N Carmustine Chemical compound ClCCNC(=O)N(N=O)CCCl DLGOEMSEDOSKAD-UHFFFAOYSA-N 0.000 claims description 2
- CMSMOCZEIVJLDB-UHFFFAOYSA-N Cyclophosphamide Chemical compound ClCCN(CCCl)P1(=O)NCCCO1 CMSMOCZEIVJLDB-UHFFFAOYSA-N 0.000 claims description 2
- 229940123780 DNA topoisomerase I inhibitor Drugs 0.000 claims description 2
- 229940124087 DNA topoisomerase II inhibitor Drugs 0.000 claims description 2
- ZQZFYGIXNQKOAV-OCEACIFDSA-N Droloxifene Chemical compound C=1C=CC=CC=1C(/CC)=C(C=1C=C(O)C=CC=1)\C1=CC=C(OCCN(C)C)C=C1 ZQZFYGIXNQKOAV-OCEACIFDSA-N 0.000 claims description 2
- GHASVSINZRGABV-UHFFFAOYSA-N Fluorouracil Chemical compound FC1=CNC(=O)NC1=O GHASVSINZRGABV-UHFFFAOYSA-N 0.000 claims description 2
- VWUXBMIQPBEWFH-WCCTWKNTSA-N Fulvestrant Chemical compound OC1=CC=C2[C@H]3CC[C@](C)([C@H](CC4)O)[C@@H]4[C@@H]3[C@H](CCCCCCCCCS(=O)CCCC(F)(F)C(F)(F)F)CC2=C1 VWUXBMIQPBEWFH-WCCTWKNTSA-N 0.000 claims description 2
- SHGAZHPCJJPHSC-NUEINMDLSA-N Isotretinoin Chemical compound OC(=O)C=C(C)/C=C/C=C(C)C=CC1=C(C)CCCC1(C)C SHGAZHPCJJPHSC-NUEINMDLSA-N 0.000 claims description 2
- 239000005411 L01XE02 - Gefitinib Substances 0.000 claims description 2
- GQYIWUVLTXOXAJ-UHFFFAOYSA-N Lomustine Chemical compound ClCCN(N=O)C(=O)NC1CCCCC1 GQYIWUVLTXOXAJ-UHFFFAOYSA-N 0.000 claims description 2
- ZDZOTLJHXYCWBA-VCVYQWHSSA-N N-debenzoyl-N-(tert-butoxycarbonyl)-10-deacetyltaxol Chemical compound O([C@H]1[C@H]2[C@@](C([C@H](O)C3=C(C)[C@@H](OC(=O)[C@H](O)[C@@H](NC(=O)OC(C)(C)C)C=4C=CC=CC=4)C[C@]1(O)C3(C)C)=O)(C)[C@@H](O)C[C@H]1OC[C@]12OC(=O)C)C(=O)C1=CC=CC=C1 ZDZOTLJHXYCWBA-VCVYQWHSSA-N 0.000 claims description 2
- 229930012538 Paclitaxel Natural products 0.000 claims description 2
- 239000000365 Topoisomerase I Inhibitor Substances 0.000 claims description 2
- 239000000317 Topoisomerase II Inhibitor Substances 0.000 claims description 2
- JXLYSJRDGCGARV-WWYNWVTFSA-N Vinblastine Natural products O=C(O[C@H]1[C@](O)(C(=O)OC)[C@@H]2N(C)c3c(cc(c(OC)c3)[C@]3(C(=O)OC)c4[nH]c5c(c4CCN4C[C@](O)(CC)C[C@H](C3)C4)cccc5)[C@@]32[C@H]2[C@@]1(CC)C=CCN2CC3)C JXLYSJRDGCGARV-WWYNWVTFSA-N 0.000 claims description 2
- 125000006398 alkylpyrazinyl group Chemical group 0.000 claims description 2
- BIIVYFLTOXDAOV-YVEFUNNKSA-N alvocidib Chemical compound O[C@@H]1CN(C)CC[C@@H]1C1=C(O)C=C(O)C2=C1OC(C=1C(=CC=CC=1)Cl)=CC2=O BIIVYFLTOXDAOV-YVEFUNNKSA-N 0.000 claims description 2
- 125000006620 amino-(C1-C6) alkyl group Chemical group 0.000 claims description 2
- 125000005001 aminoaryl group Chemical group 0.000 claims description 2
- 229960002932 anastrozole Drugs 0.000 claims description 2
- YBBLVLTVTVSKRW-UHFFFAOYSA-N anastrozole Chemical compound N#CC(C)(C)C1=CC(C(C)(C#N)C)=CC(CN2N=CN=C2)=C1 YBBLVLTVTVSKRW-UHFFFAOYSA-N 0.000 claims description 2
- 239000003886 aromatase inhibitor Substances 0.000 claims description 2
- 229940046844 aromatase inhibitors Drugs 0.000 claims description 2
- 125000000732 arylene group Chemical group 0.000 claims description 2
- 229960002756 azacitidine Drugs 0.000 claims description 2
- VSRXQHXAPYXROS-UHFFFAOYSA-N azanide;cyclobutane-1,1-dicarboxylic acid;platinum(2+) Chemical group [NH2-].[NH2-].[Pt+2].OC(=O)C1(C(O)=O)CCC1 VSRXQHXAPYXROS-UHFFFAOYSA-N 0.000 claims description 2
- 239000004305 biphenyl Substances 0.000 claims description 2
- 235000010290 biphenyl Nutrition 0.000 claims description 2
- 229960004117 capecitabine Drugs 0.000 claims description 2
- 229960004562 carboplatin Drugs 0.000 claims description 2
- 229960005243 carmustine Drugs 0.000 claims description 2
- JCKYGMPEJWAADB-UHFFFAOYSA-N chlorambucil Chemical compound OC(=O)CCCC1=CC=C(N(CCCl)CCCl)C=C1 JCKYGMPEJWAADB-UHFFFAOYSA-N 0.000 claims description 2
- 229960004630 chlorambucil Drugs 0.000 claims description 2
- 229960004397 cyclophosphamide Drugs 0.000 claims description 2
- STQGQHZAVUOBTE-VGBVRHCVSA-N daunorubicin Chemical compound O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(C)=O)[C@H]1C[C@H](N)[C@H](O)[C@H](C)O1 STQGQHZAVUOBTE-VGBVRHCVSA-N 0.000 claims description 2
- 229960000975 daunorubicin Drugs 0.000 claims description 2
- 125000001664 diethylamino group Chemical group [H]C([H])([H])C([H])([H])N(*)C([H])([H])C([H])([H])[H] 0.000 claims description 2
- 229960003668 docetaxel Drugs 0.000 claims description 2
- 229960004679 doxorubicin Drugs 0.000 claims description 2
- 229950004203 droloxifene Drugs 0.000 claims description 2
- 229960005420 etoposide Drugs 0.000 claims description 2
- VJJPUSNTGOMMGY-MRVIYFEKSA-N etoposide Chemical compound COC1=C(O)C(OC)=CC([C@@H]2C3=CC=4OCOC=4C=C3[C@@H](O[C@H]3[C@@H]([C@@H](O)[C@@H]4O[C@H](C)OC[C@H]4O3)O)[C@@H]3[C@@H]2C(OC3)=O)=C1 VJJPUSNTGOMMGY-MRVIYFEKSA-N 0.000 claims description 2
- 229960000255 exemestane Drugs 0.000 claims description 2
- 229940087861 faslodex Drugs 0.000 claims description 2
- 229960002949 fluorouracil Drugs 0.000 claims description 2
- XGALLCVXEZPNRQ-UHFFFAOYSA-N gefitinib Chemical compound C=12C=C(OCCCN3CCOCC3)C(OC)=CC2=NC=NC=1NC1=CC=C(F)C(Cl)=C1 XGALLCVXEZPNRQ-UHFFFAOYSA-N 0.000 claims description 2
- 229960002584 gefitinib Drugs 0.000 claims description 2
- SDUQYLNIPVEERB-QPPQHZFASA-N gemcitabine Chemical compound O=C1N=C(N)C=CN1[C@H]1C(F)(F)[C@H](O)[C@@H](CO)O1 SDUQYLNIPVEERB-QPPQHZFASA-N 0.000 claims description 2
- 229960005277 gemcitabine Drugs 0.000 claims description 2
- 125000005549 heteroarylene group Chemical group 0.000 claims description 2
- 229960003685 imatinib mesylate Drugs 0.000 claims description 2
- YLMAHDNUQAMNNX-UHFFFAOYSA-N imatinib methanesulfonate Chemical compound CS(O)(=O)=O.C1CN(C)CCN1CC1=CC=C(C(=O)NC=2C=C(NC=3N=C(C=CN=3)C=3C=NC=CC=3)C(C)=CC=2)C=C1 YLMAHDNUQAMNNX-UHFFFAOYSA-N 0.000 claims description 2
- UWKQSNNFCGGAFS-XIFFEERXSA-N irinotecan Chemical compound C1=C2C(CC)=C3CN(C(C4=C([C@@](C(=O)OC4)(O)CC)C=4)=O)C=4C3=NC2=CC=C1OC(=O)N(CC1)CCC1N1CCCCC1 UWKQSNNFCGGAFS-XIFFEERXSA-N 0.000 claims description 2
- 229960004768 irinotecan Drugs 0.000 claims description 2
- 229960005280 isotretinoin Drugs 0.000 claims description 2
- 229960003881 letrozole Drugs 0.000 claims description 2
- HPJKCIUCZWXJDR-UHFFFAOYSA-N letrozole Chemical compound C1=CC(C#N)=CC=C1C(N1N=CN=C1)C1=CC=C(C#N)C=C1 HPJKCIUCZWXJDR-UHFFFAOYSA-N 0.000 claims description 2
- 229960002247 lomustine Drugs 0.000 claims description 2
- 229960001156 mitoxantrone Drugs 0.000 claims description 2
- KKZJGLLVHKMTCM-UHFFFAOYSA-N mitoxantrone Chemical compound O=C1C2=C(O)C=CC(O)=C2C(=O)C2=C1C(NCCNCCO)=CC=C2NCCNCCO KKZJGLLVHKMTCM-UHFFFAOYSA-N 0.000 claims description 2
- VGEMTTAUJZRGRU-UHFFFAOYSA-N n-hydroxy-2-(4-methylpiperazin-1-yl)-1,3-thiazole-5-carboxamide Chemical compound C1CN(C)CCN1C1=NC=C(C(=O)NO)S1 VGEMTTAUJZRGRU-UHFFFAOYSA-N 0.000 claims description 2
- IJNSDNBROSGXKW-UHFFFAOYSA-N n-hydroxy-2-(4-naphthalen-2-ylsulfonyl-1,4-diazepan-1-yl)-1,3-thiazole-5-carboxamide Chemical compound S1C(C(=O)NO)=CN=C1N1CCN(S(=O)(=O)C=2C=C3C=CC=CC3=CC=2)CCC1 IJNSDNBROSGXKW-UHFFFAOYSA-N 0.000 claims description 2
- SGGNCDFJUATHLZ-UHFFFAOYSA-N n-hydroxy-2-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)-1,3-thiazole-5-carboxamide Chemical compound S1C(C(=O)NO)=CN=C1N1CCN(S(=O)(=O)C=2C=C3C=CC=CC3=CC=2)CC1 SGGNCDFJUATHLZ-UHFFFAOYSA-N 0.000 claims description 2
- UJVYIBHDSFCMQY-UHFFFAOYSA-N n-hydroxy-2-(4-pyridin-3-ylsulfonylpiperazin-1-yl)-1,3-thiazole-5-carboxamide Chemical compound S1C(C(=O)NO)=CN=C1N1CCN(S(=O)(=O)C=2C=NC=CC=2)CC1 UJVYIBHDSFCMQY-UHFFFAOYSA-N 0.000 claims description 2
- VXHMTVRPLIJNIN-UHFFFAOYSA-N n-hydroxy-2-[4-(2-phenylethyl)piperazin-1-yl]-1,3-thiazole-5-carboxamide Chemical compound S1C(C(=O)NO)=CN=C1N1CCN(CCC=2C=CC=CC=2)CC1 VXHMTVRPLIJNIN-UHFFFAOYSA-N 0.000 claims description 2
- LGGMQGZFAYBHTL-UHFFFAOYSA-N n-hydroxy-2-[4-(4-methyl-3-nitrophenyl)sulfonylpiperazin-1-yl]-1,3-thiazole-5-carboxamide Chemical compound C1=C([N+]([O-])=O)C(C)=CC=C1S(=O)(=O)N1CCN(C=2SC(=CN=2)C(=O)NO)CC1 LGGMQGZFAYBHTL-UHFFFAOYSA-N 0.000 claims description 2
- CBENGOGZSZJEBZ-UHFFFAOYSA-N n-hydroxy-2-[4-(4-morpholin-4-ylphenyl)sulfonylpiperazin-1-yl]-1,3-thiazole-5-carboxamide Chemical compound S1C(C(=O)NO)=CN=C1N1CCN(S(=O)(=O)C=2C=CC(=CC=2)N2CCOCC2)CC1 CBENGOGZSZJEBZ-UHFFFAOYSA-N 0.000 claims description 2
- FTXSZIBXNNHLBU-UHFFFAOYSA-N n-hydroxy-2-[4-(4-morpholin-4-ylpyridin-3-yl)sulfonylpiperazin-1-yl]-1,3-thiazole-5-carboxamide Chemical compound S1C(C(=O)NO)=CN=C1N1CCN(S(=O)(=O)C=2C(=CC=NC=2)N2CCOCC2)CC1 FTXSZIBXNNHLBU-UHFFFAOYSA-N 0.000 claims description 2
- HLCHPPZAYUYWIB-UHFFFAOYSA-N n-hydroxy-2-[4-(4-piperidin-1-ylphenyl)sulfonylpiperazin-1-yl]-1,3-thiazole-5-carboxamide Chemical compound S1C(C(=O)NO)=CN=C1N1CCN(S(=O)(=O)C=2C=CC(=CC=2)N2CCCCC2)CC1 HLCHPPZAYUYWIB-UHFFFAOYSA-N 0.000 claims description 2
- OXBZLNULMDLLPE-UHFFFAOYSA-N n-hydroxy-2-[4-(4-pyridin-4-ylphenyl)sulfonylpiperazin-1-yl]-1,3-thiazole-5-carboxamide Chemical compound S1C(C(=O)NO)=CN=C1N1CCN(S(=O)(=O)C=2C=CC(=CC=2)C=2C=CN=CC=2)CC1 OXBZLNULMDLLPE-UHFFFAOYSA-N 0.000 claims description 2
- AAOPIDOKLLCKBP-UHFFFAOYSA-N n-hydroxy-2-[4-(6-phenoxypyridin-3-yl)sulfonylpiperazin-1-yl]-1,3-thiazole-5-carboxamide Chemical compound S1C(C(=O)NO)=CN=C1N1CCN(S(=O)(=O)C=2C=NC(OC=3C=CC=CC=3)=CC=2)CC1 AAOPIDOKLLCKBP-UHFFFAOYSA-N 0.000 claims description 2
- VSQICYOXROBZFR-UHFFFAOYSA-N n-hydroxy-2-[4-[2-[2-(pyrrolidin-1-ylmethyl)phenyl]phenyl]sulfonylpiperazin-1-yl]-1,3-thiazole-5-carboxamide Chemical compound S1C(C(=O)NO)=CN=C1N1CCN(S(=O)(=O)C=2C(=CC=CC=2)C=2C(=CC=CC=2)CN2CCCC2)CC1 VSQICYOXROBZFR-UHFFFAOYSA-N 0.000 claims description 2
- JINPBRIDPGDZQS-UHFFFAOYSA-N n-hydroxy-2-[4-[2-[3-(methoxymethyl)phenyl]phenyl]sulfonylpiperazin-1-yl]-1,3-thiazole-5-carboxamide Chemical compound COCC1=CC=CC(C=2C(=CC=CC=2)S(=O)(=O)N2CCN(CC2)C=2SC(=CN=2)C(=O)NO)=C1 JINPBRIDPGDZQS-UHFFFAOYSA-N 0.000 claims description 2
- KMEOHEQGGJIDNI-UHFFFAOYSA-N n-hydroxy-2-[4-[2-[3-(piperazin-1-ylmethyl)phenyl]phenyl]sulfonylpiperazin-1-yl]-1,3-thiazole-5-carboxamide Chemical compound S1C(C(=O)NO)=CN=C1N1CCN(S(=O)(=O)C=2C(=CC=CC=2)C=2C=C(CN3CCNCC3)C=CC=2)CC1 KMEOHEQGGJIDNI-UHFFFAOYSA-N 0.000 claims description 2
- GIWMTWHHTWTQCS-UHFFFAOYSA-N n-hydroxy-2-[4-[2-[3-[[2-hydroxyethyl(methyl)amino]methyl]phenyl]phenyl]sulfonylpiperazin-1-yl]-1,3-thiazole-5-carboxamide Chemical compound OCCN(C)CC1=CC=CC(C=2C(=CC=CC=2)S(=O)(=O)N2CCN(CC2)C=2SC(=CN=2)C(=O)NO)=C1 GIWMTWHHTWTQCS-UHFFFAOYSA-N 0.000 claims description 2
- KZYDIBRIDJXUMN-UHFFFAOYSA-N n-hydroxy-2-[4-[2-[3-[[2-methoxyethyl(methyl)amino]methyl]phenyl]phenyl]sulfonylpiperazin-1-yl]-1,3-thiazole-5-carboxamide Chemical compound COCCN(C)CC1=CC=CC(C=2C(=CC=CC=2)S(=O)(=O)N2CCN(CC2)C=2SC(=CN=2)C(=O)NO)=C1 KZYDIBRIDJXUMN-UHFFFAOYSA-N 0.000 claims description 2
- UNPIDFGLQQOGCB-UHFFFAOYSA-N n-hydroxy-2-[4-[2-[4-(morpholine-4-carbonyl)phenyl]phenyl]sulfonylpiperazin-1-yl]-1,3-thiazole-5-carboxamide Chemical compound S1C(C(=O)NO)=CN=C1N1CCN(S(=O)(=O)C=2C(=CC=CC=2)C=2C=CC(=CC=2)C(=O)N2CCOCC2)CC1 UNPIDFGLQQOGCB-UHFFFAOYSA-N 0.000 claims description 2
- SBLPZIHQUNGGHB-UHFFFAOYSA-N n-hydroxy-2-[4-[3-(methoxymethyl)phenyl]sulfonylpiperazin-1-yl]-1,3-thiazole-5-carboxamide Chemical compound COCC1=CC=CC(S(=O)(=O)N2CCN(CC2)C=2SC(=CN=2)C(=O)NO)=C1 SBLPZIHQUNGGHB-UHFFFAOYSA-N 0.000 claims description 2
- RHKBZPFMPOLACV-UHFFFAOYSA-N n-hydroxy-2-[4-[5-(2-methylsulfanylpyrimidin-4-yl)thiophen-2-yl]sulfonylpiperazin-1-yl]-1,3-thiazole-5-carboxamide Chemical compound CSC1=NC=CC(C=2SC(=CC=2)S(=O)(=O)N2CCN(CC2)C=2SC(=CN=2)C(=O)NO)=N1 RHKBZPFMPOLACV-UHFFFAOYSA-N 0.000 claims description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 2
- 150000003833 nucleoside derivatives Chemical class 0.000 claims description 2
- 229960001592 paclitaxel Drugs 0.000 claims description 2
- UBQKCCHYAOITMY-UHFFFAOYSA-N pyridin-2-ol Chemical compound OC1=CC=CC=N1 UBQKCCHYAOITMY-UHFFFAOYSA-N 0.000 claims description 2
- HNJBEVLQSNELDL-UHFFFAOYSA-N pyrrolidin-2-one Chemical compound O=C1CCCN1 HNJBEVLQSNELDL-UHFFFAOYSA-N 0.000 claims description 2
- GZUITABIAKMVPG-UHFFFAOYSA-N raloxifene Chemical compound C1=CC(O)=CC=C1C1=C(C(=O)C=2C=CC(OCCN3CCCCC3)=CC=2)C2=CC=C(O)C=C2S1 GZUITABIAKMVPG-UHFFFAOYSA-N 0.000 claims description 2
- 229960004622 raloxifene Drugs 0.000 claims description 2
- 229960001603 tamoxifen Drugs 0.000 claims description 2
- DKPFODGZWDEEBT-QFIAKTPHSA-N taxane Chemical class C([C@]1(C)CCC[C@@H](C)[C@H]1C1)C[C@H]2[C@H](C)CC[C@@H]1C2(C)C DKPFODGZWDEEBT-QFIAKTPHSA-N 0.000 claims description 2
- RCINICONZNJXQF-MZXODVADSA-N taxol Chemical compound O([C@@H]1[C@@]2(C[C@@H](C(C)=C(C2(C)C)[C@H](C([C@]2(C)[C@@H](O)C[C@H]3OC[C@]3([C@H]21)OC(C)=O)=O)OC(=O)C)OC(=O)[C@H](O)[C@@H](NC(=O)C=1C=CC=CC=1)C=1C=CC=CC=1)O)C(=O)C1=CC=CC=C1 RCINICONZNJXQF-MZXODVADSA-N 0.000 claims description 2
- 229960001278 teniposide Drugs 0.000 claims description 2
- NRUKOCRGYNPUPR-QBPJDGROSA-N teniposide Chemical compound COC1=C(O)C(OC)=CC([C@@H]2C3=CC=4OCOC=4C=C3[C@@H](O[C@H]3[C@@H]([C@@H](O)[C@@H]4O[C@@H](OC[C@H]4O3)C=3SC=CC=3)O)[C@@H]3[C@@H]2C(OC3)=O)=C1 NRUKOCRGYNPUPR-QBPJDGROSA-N 0.000 claims description 2
- UCFGDBYHRUNTLO-QHCPKHFHSA-N topotecan Chemical compound C1=C(O)C(CN(C)C)=C2C=C(CN3C4=CC5=C(C3=O)COC(=O)[C@]5(O)CC)C4=NC2=C1 UCFGDBYHRUNTLO-QHCPKHFHSA-N 0.000 claims description 2
- 229960000303 topotecan Drugs 0.000 claims description 2
- XFCLJVABOIYOMF-QPLCGJKRSA-N toremifene Chemical compound C1=CC(OCCN(C)C)=CC=C1C(\C=1C=CC=CC=1)=C(\CCCl)C1=CC=CC=C1 XFCLJVABOIYOMF-QPLCGJKRSA-N 0.000 claims description 2
- 229960005026 toremifene Drugs 0.000 claims description 2
- 229960003048 vinblastine Drugs 0.000 claims description 2
- JXLYSJRDGCGARV-XQKSVPLYSA-N vincaleukoblastine Chemical compound C([C@@H](C[C@]1(C(=O)OC)C=2C(=CC3=C([C@]45[C@H]([C@@]([C@H](OC(C)=O)[C@]6(CC)C=CCN([C@H]56)CC4)(O)C(=O)OC)N3C)C=2)OC)C[C@@](C2)(O)CC)N2CCC2=C1NC1=CC=CC=C21 JXLYSJRDGCGARV-XQKSVPLYSA-N 0.000 claims description 2
- OGWKCGZFUXNPDA-XQKSVPLYSA-N vincristine Chemical compound C([N@]1C[C@@H](C[C@]2(C(=O)OC)C=3C(=CC4=C([C@]56[C@H]([C@@]([C@H](OC(C)=O)[C@]7(CC)C=CCN([C@H]67)CC5)(O)C(=O)OC)N4C=O)C=3)OC)C[C@@](C1)(O)CC)CC1=C2NC2=CC=CC=C12 OGWKCGZFUXNPDA-XQKSVPLYSA-N 0.000 claims description 2
- 229960004528 vincristine Drugs 0.000 claims description 2
- OGWKCGZFUXNPDA-UHFFFAOYSA-N vincristine Natural products C1C(CC)(O)CC(CC2(C(=O)OC)C=3C(=CC4=C(C56C(C(C(OC(C)=O)C7(CC)C=CCN(C67)CC5)(O)C(=O)OC)N4C=O)C=3)OC)CN1CCC1=C2NC2=CC=CC=C12 OGWKCGZFUXNPDA-UHFFFAOYSA-N 0.000 claims description 2
- GBABOYUKABKIAF-GHYRFKGUSA-N vinorelbine Chemical compound C1N(CC=2C3=CC=CC=C3NC=22)CC(CC)=C[C@H]1C[C@]2(C(=O)OC)C1=CC([C@]23[C@H]([C@]([C@H](OC(C)=O)[C@]4(CC)C=CCN([C@H]34)CC2)(O)C(=O)OC)N2C)=C2C=C1OC GBABOYUKABKIAF-GHYRFKGUSA-N 0.000 claims description 2
- 229960002066 vinorelbine Drugs 0.000 claims description 2
- 229960001771 vorozole Drugs 0.000 claims description 2
- XLMPPFTZALNBFS-INIZCTEOSA-N vorozole Chemical compound C1([C@@H](C2=CC=C3N=NN(C3=C2)C)N2N=CN=C2)=CC=C(Cl)C=C1 XLMPPFTZALNBFS-INIZCTEOSA-N 0.000 claims description 2
- IVNTYHBEGAGEPJ-UHFFFAOYSA-N 2-[4-(2-chlorophenyl)sulfonylpiperazin-1-yl]-n-hydroxy-1,3-thiazole-5-carboxamide Chemical compound S1C(C(=O)NO)=CN=C1N1CCN(S(=O)(=O)C=2C(=CC=CC=2)Cl)CC1 IVNTYHBEGAGEPJ-UHFFFAOYSA-N 0.000 claims 2
- 108091008648 NR7C Proteins 0.000 claims 2
- 125000001475 halogen functional group Chemical group 0.000 claims 2
- LQLHVIFTEDYICJ-UHFFFAOYSA-N 2,2-dimethylpropyl 2-[4-[4-[5-(hydroxycarbamoyl)-1,3-thiazol-2-yl]piperazin-1-yl]sulfonylphenyl]pyrrole-1-carboxylate Chemical compound CC(C)(C)COC(=O)N1C=CC=C1C1=CC=C(S(=O)(=O)N2CCN(CC2)C=2SC(=CN=2)C(=O)NO)C=C1 LQLHVIFTEDYICJ-UHFFFAOYSA-N 0.000 claims 1
- BSIWYFYMUGNSEV-UHFFFAOYSA-N 2-(4-butylsulfonylpiperazin-1-yl)-n-hydroxy-1,3-thiazole-5-carboxamide Chemical compound C1CN(S(=O)(=O)CCCC)CCN1C1=NC=C(C(=O)NO)S1 BSIWYFYMUGNSEV-UHFFFAOYSA-N 0.000 claims 1
- DLUZRKPIGKPAEB-UHFFFAOYSA-N 2-[4-(2-chloro-6-methylphenyl)sulfonylpiperazin-1-yl]-n-hydroxy-1,3-thiazole-5-carboxamide Chemical compound CC1=CC=CC(Cl)=C1S(=O)(=O)N1CCN(C=2SC(=CN=2)C(=O)NO)CC1 DLUZRKPIGKPAEB-UHFFFAOYSA-N 0.000 claims 1
- VCNBNOOOLRICBH-UHFFFAOYSA-N 2-[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]-n-hydroxy-1,3-thiazole-5-carboxamide Chemical compound S1C(C(=O)NO)=CN=C1N1CCN(S(=O)(=O)C=2C(=CC=CC=2)F)CC1 VCNBNOOOLRICBH-UHFFFAOYSA-N 0.000 claims 1
- VFNIHKHYFYGUOG-UHFFFAOYSA-N 2-[4-(3,4-dichlorophenyl)sulfonylpiperazin-1-yl]-n-hydroxy-1,3-thiazole-5-carboxamide Chemical compound S1C(C(=O)NO)=CN=C1N1CCN(S(=O)(=O)C=2C=C(Cl)C(Cl)=CC=2)CC1 VFNIHKHYFYGUOG-UHFFFAOYSA-N 0.000 claims 1
- VVYQVRCQSJQWIB-UHFFFAOYSA-N 2-[4-(3,5-dimethylphenyl)sulfonylpiperazin-1-yl]-n-hydroxy-1,3-thiazole-5-carboxamide Chemical compound CC1=CC(C)=CC(S(=O)(=O)N2CCN(CC2)C=2SC(=CN=2)C(=O)NO)=C1 VVYQVRCQSJQWIB-UHFFFAOYSA-N 0.000 claims 1
- WPPONMCIPTVCRI-UHFFFAOYSA-N 2-[4-(3-chloro-2-methylphenyl)sulfonylpiperazin-1-yl]-n-hydroxy-1,3-thiazole-5-carboxamide Chemical compound CC1=C(Cl)C=CC=C1S(=O)(=O)N1CCN(C=2SC(=CN=2)C(=O)NO)CC1 WPPONMCIPTVCRI-UHFFFAOYSA-N 0.000 claims 1
- UZRVOYYTYJGWEG-UHFFFAOYSA-N 2-[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]-n-hydroxy-1,3-thiazole-5-carboxamide Chemical compound S1C(C(=O)NO)=CN=C1N1CCN(S(=O)(=O)C=2C=C(F)C=CC=2)CC1 UZRVOYYTYJGWEG-UHFFFAOYSA-N 0.000 claims 1
- MJVBBWXRUYVQKU-UHFFFAOYSA-N 2-[4-(4-tert-butylphenyl)sulfonylpiperazin-1-yl]-n-hydroxy-1,3-thiazole-5-carboxamide Chemical compound C1=CC(C(C)(C)C)=CC=C1S(=O)(=O)N1CCN(C=2SC(=CN=2)C(=O)NO)CC1 MJVBBWXRUYVQKU-UHFFFAOYSA-N 0.000 claims 1
- NOWZDNOALNWUAK-UHFFFAOYSA-N 2-[4-(5-fluoro-2-methylphenyl)sulfonylpiperazin-1-yl]-n-hydroxy-1,3-thiazole-5-carboxamide Chemical compound CC1=CC=C(F)C=C1S(=O)(=O)N1CCN(C=2SC(=CN=2)C(=O)NO)CC1 NOWZDNOALNWUAK-UHFFFAOYSA-N 0.000 claims 1
- JCEIDPBPPMXCCB-UHFFFAOYSA-N 2-[4-[2-[3-[[butyl(methyl)amino]methyl]phenyl]phenyl]sulfonylpiperazin-1-yl]-n-hydroxy-1,3-thiazole-5-carboxamide Chemical compound CCCCN(C)CC1=CC=CC(C=2C(=CC=CC=2)S(=O)(=O)N2CCN(CC2)C=2SC(=CN=2)C(=O)NO)=C1 JCEIDPBPPMXCCB-UHFFFAOYSA-N 0.000 claims 1
- CBMCMLPGEJVEAR-UHFFFAOYSA-N 2-[4-[4-(dimethylamino)phenyl]sulfonylpiperazin-1-yl]-n-hydroxy-1,3-thiazole-5-carboxamide Chemical compound C1=CC(N(C)C)=CC=C1S(=O)(=O)N1CCN(C=2SC(=CN=2)C(=O)NO)CC1 CBMCMLPGEJVEAR-UHFFFAOYSA-N 0.000 claims 1
- ANOHLIAESPOKSN-UHFFFAOYSA-N S1C(C(=O)O)=CN=C1N1CCN(S(=O)(=O)C=2C=CC(=CC=2)C=2SC=CC=2)CC1 Chemical compound S1C(C(=O)O)=CN=C1N1CCN(S(=O)(=O)C=2C=CC(=CC=2)C=2SC=CC=2)CC1 ANOHLIAESPOKSN-UHFFFAOYSA-N 0.000 claims 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 claims 1
- UZIAKLZEFQSJTJ-UHFFFAOYSA-N n-hydroxy-2-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)-1,3-thiazole-4-carboxamide Chemical compound ONC(=O)C1=CSC(N2CCN(CC2)S(=O)(=O)C=2C=C3C=CC=CC3=CC=2)=N1 UZIAKLZEFQSJTJ-UHFFFAOYSA-N 0.000 claims 1
- SSKYNXSNIGUKDC-UHFFFAOYSA-N n-hydroxy-2-[4-(2-hydroxyethyl)piperazin-1-yl]-1,3-thiazole-5-carboxamide Chemical compound C1CN(CCO)CCN1C1=NC=C(C(=O)NO)S1 SSKYNXSNIGUKDC-UHFFFAOYSA-N 0.000 claims 1
- DKSCRAVYVSPWKV-UHFFFAOYSA-N n-hydroxy-2-[4-(2-methylphenyl)sulfonylpiperazin-1-yl]-1,3-thiazole-5-carboxamide Chemical compound CC1=CC=CC=C1S(=O)(=O)N1CCN(C=2SC(=CN=2)C(=O)NO)CC1 DKSCRAVYVSPWKV-UHFFFAOYSA-N 0.000 claims 1
- UUPWQCDZTZZGNB-UHFFFAOYSA-N n-hydroxy-2-[4-(3-methylphenyl)sulfonylpiperazin-1-yl]-1,3-thiazole-5-carboxamide Chemical compound CC1=CC=CC(S(=O)(=O)N2CCN(CC2)C=2SC(=CN=2)C(=O)NO)=C1 UUPWQCDZTZZGNB-UHFFFAOYSA-N 0.000 claims 1
- XXKCPDYQVWWPMC-UHFFFAOYSA-N n-hydroxy-2-[4-(3-phenylphenyl)sulfonylpiperazin-1-yl]-1,3-thiazole-5-carboxamide Chemical compound S1C(C(=O)NO)=CN=C1N1CCN(S(=O)(=O)C=2C=C(C=CC=2)C=2C=CC=CC=2)CC1 XXKCPDYQVWWPMC-UHFFFAOYSA-N 0.000 claims 1
- FEYRMLFMNIJKTL-UHFFFAOYSA-N n-hydroxy-2-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]-1,3-thiazole-5-carboxamide Chemical compound C1=CC(OC)=CC=C1S(=O)(=O)N1CCN(C=2SC(=CN=2)C(=O)NO)CC1 FEYRMLFMNIJKTL-UHFFFAOYSA-N 0.000 claims 1
- HEHLTLQNCIOHCP-UHFFFAOYSA-N n-hydroxy-2-[4-[2-[3-(methylaminomethyl)phenyl]phenyl]sulfonylpiperazin-1-yl]-1,3-thiazole-5-carboxamide Chemical compound CNCC1=CC=CC(C=2C(=CC=CC=2)S(=O)(=O)N2CCN(CC2)C=2SC(=CN=2)C(=O)NO)=C1 HEHLTLQNCIOHCP-UHFFFAOYSA-N 0.000 claims 1
- QTHOMTMYOMNNAI-UHFFFAOYSA-N n-hydroxy-2-[4-[2-[4-(methanesulfonamido)phenyl]phenyl]sulfonylpiperazin-1-yl]-1,3-thiazole-5-carboxamide Chemical compound C1=CC(NS(=O)(=O)C)=CC=C1C1=CC=CC=C1S(=O)(=O)N1CCN(C=2SC(=CN=2)C(=O)NO)CC1 QTHOMTMYOMNNAI-UHFFFAOYSA-N 0.000 claims 1
- KBSCDPANXPAGRJ-UHFFFAOYSA-N n-hydroxy-2-[4-[4-(1h-pyrrol-2-yl)phenyl]sulfonylpiperazin-1-yl]-1,3-thiazole-5-carboxamide Chemical compound S1C(C(=O)NO)=CN=C1N1CCN(S(=O)(=O)C=2C=CC(=CC=2)C=2NC=CC=2)CC1 KBSCDPANXPAGRJ-UHFFFAOYSA-N 0.000 claims 1
- DAKJXQSEJLEHTI-UHFFFAOYSA-N n-hydroxy-2-[4-[4-[5-(pyrrolidin-1-ylmethyl)thiophen-3-yl]phenyl]sulfonylpiperazin-1-yl]-1,3-thiazole-5-carboxamide Chemical compound S1C(C(=O)NO)=CN=C1N1CCN(S(=O)(=O)C=2C=CC(=CC=2)C=2C=C(CN3CCCC3)SC=2)CC1 DAKJXQSEJLEHTI-UHFFFAOYSA-N 0.000 claims 1
- PULCLYYSXKIFAU-UHFFFAOYSA-N n-hydroxy-2-[4-[5-[3-(pyrrolidin-1-ylmethyl)phenyl]thiophen-2-yl]sulfonylpiperazin-1-yl]-1,3-thiazole-5-carboxamide Chemical compound S1C(C(=O)NO)=CN=C1N1CCN(S(=O)(=O)C=2SC(=CC=2)C=2C=C(CN3CCCC3)C=CC=2)CC1 PULCLYYSXKIFAU-UHFFFAOYSA-N 0.000 claims 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 claims 1
- 230000002255 enzymatic effect Effects 0.000 abstract description 4
- 230000001404 mediated effect Effects 0.000 abstract description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 196
- 238000005160 1H NMR spectroscopy Methods 0.000 description 166
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 166
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 166
- 238000004128 high performance liquid chromatography Methods 0.000 description 99
- 239000011541 reaction mixture Substances 0.000 description 97
- 239000000243 solution Substances 0.000 description 95
- 238000006243 chemical reaction Methods 0.000 description 87
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 82
- DJSTVAGEAPNZAE-UHFFFAOYSA-N n-hydroxy-1,3-thiazole-5-carboxamide Chemical compound ONC(=O)C1=CN=CS1 DJSTVAGEAPNZAE-UHFFFAOYSA-N 0.000 description 80
- 235000019439 ethyl acetate Nutrition 0.000 description 70
- 239000000203 mixture Substances 0.000 description 69
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 69
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 65
- 150000001408 amides Chemical class 0.000 description 59
- 239000007787 solid Substances 0.000 description 59
- 239000012044 organic layer Substances 0.000 description 56
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 54
- 229940093499 ethyl acetate Drugs 0.000 description 53
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 49
- 239000002253 acid Substances 0.000 description 47
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical class CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 47
- YZVFSQQHQPPKNX-UHFFFAOYSA-N 1,3-thiazole-5-carboxylic acid Chemical compound OC(=O)C1=CN=CS1 YZVFSQQHQPPKNX-UHFFFAOYSA-N 0.000 description 45
- 238000002360 preparation method Methods 0.000 description 45
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 43
- 230000002829 reductive effect Effects 0.000 description 43
- 239000000543 intermediate Substances 0.000 description 42
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 40
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 39
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 39
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 38
- 229910052938 sodium sulfate Inorganic materials 0.000 description 37
- 235000011152 sodium sulphate Nutrition 0.000 description 37
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 36
- 239000011734 sodium Substances 0.000 description 36
- 239000002904 solvent Substances 0.000 description 31
- 239000000741 silica gel Substances 0.000 description 30
- 229910002027 silica gel Inorganic materials 0.000 description 30
- 239000010410 layer Substances 0.000 description 29
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 29
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 28
- 239000000706 filtrate Substances 0.000 description 26
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 25
- UPUWMQZUXFAUCJ-UHFFFAOYSA-N 2,5-dihydro-1,2-thiazole Chemical compound C1SNC=C1 UPUWMQZUXFAUCJ-UHFFFAOYSA-N 0.000 description 25
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 25
- XDIBWBYTRTUUBJ-UHFFFAOYSA-N methyl 1,3-thiazole-5-carboxylate Chemical compound COC(=O)C1=CN=CS1 XDIBWBYTRTUUBJ-UHFFFAOYSA-N 0.000 description 25
- 239000012299 nitrogen atmosphere Substances 0.000 description 25
- 238000004809 thin layer chromatography Methods 0.000 description 25
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 24
- 239000004480 active ingredient Substances 0.000 description 24
- 238000004440 column chromatography Methods 0.000 description 24
- 229910052708 sodium Inorganic materials 0.000 description 23
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 22
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 22
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 21
- 238000009472 formulation Methods 0.000 description 21
- 238000002953 preparative HPLC Methods 0.000 description 21
- 229940086542 triethylamine Drugs 0.000 description 21
- 101150041968 CDC13 gene Proteins 0.000 description 20
- OKKJLVBELUTLKV-MZCSYVLQSA-N Deuterated methanol Chemical compound [2H]OC([2H])([2H])[2H] OKKJLVBELUTLKV-MZCSYVLQSA-N 0.000 description 20
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 20
- 230000000875 corresponding effect Effects 0.000 description 20
- 238000004895 liquid chromatography mass spectrometry Methods 0.000 description 20
- 239000012298 atmosphere Substances 0.000 description 19
- 238000007429 general method Methods 0.000 description 19
- 239000002244 precipitate Substances 0.000 description 19
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 18
- 230000015572 biosynthetic process Effects 0.000 description 17
- KDLHZDBZIXYQEI-UHFFFAOYSA-N palladium Substances [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 17
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 17
- DTQVDTLACAAQTR-UHFFFAOYSA-N trifluoroacetic acid Substances OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 17
- PYRZPBDTPRQYKG-UHFFFAOYSA-N cyclopentene-1-carboxylic acid Chemical compound OC(=O)C1=CCCC1 PYRZPBDTPRQYKG-UHFFFAOYSA-N 0.000 description 16
- 238000003786 synthesis reaction Methods 0.000 description 16
- 210000004027 cell Anatomy 0.000 description 15
- 239000003814 drug Substances 0.000 description 15
- WEYVCQFUGFRXOM-UHFFFAOYSA-N perazine Chemical compound C1CN(C)CCN1CCCN1C2=CC=CC=C2SC2=CC=CC=C21 WEYVCQFUGFRXOM-UHFFFAOYSA-N 0.000 description 15
- 229910000027 potassium carbonate Inorganic materials 0.000 description 15
- 238000003556 assay Methods 0.000 description 14
- 239000004615 ingredient Substances 0.000 description 14
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 14
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical class ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 13
- 238000001704 evaporation Methods 0.000 description 13
- HNLVIKMXFBRZDF-UHFFFAOYSA-N methyl 2-bromo-1,3-thiazole-5-carboxylate Chemical compound COC(=O)C1=CN=C(Br)S1 HNLVIKMXFBRZDF-UHFFFAOYSA-N 0.000 description 13
- 239000002585 base Substances 0.000 description 11
- 238000007796 conventional method Methods 0.000 description 11
- 229940079593 drug Drugs 0.000 description 11
- 230000008020 evaporation Effects 0.000 description 11
- 239000003826 tablet Substances 0.000 description 11
- QFLWZFQWSBQYPS-AWRAUJHKSA-N (3S)-3-[[(2S)-2-[[(2S)-2-[5-[(3aS,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]-3-methylbutanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-4-[1-bis(4-chlorophenoxy)phosphorylbutylamino]-4-oxobutanoic acid Chemical compound CCCC(NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](NC(=O)CCCCC1SC[C@@H]2NC(=O)N[C@H]12)C(C)C)P(=O)(Oc1ccc(Cl)cc1)Oc1ccc(Cl)cc1 QFLWZFQWSBQYPS-AWRAUJHKSA-N 0.000 description 10
- 108020004414 DNA Proteins 0.000 description 10
- 239000012267 brine Substances 0.000 description 10
- 238000004587 chromatography analysis Methods 0.000 description 10
- 230000000694 effects Effects 0.000 description 10
- 238000001914 filtration Methods 0.000 description 10
- 229910052736 halogen Inorganic materials 0.000 description 10
- 239000000047 product Substances 0.000 description 10
- 238000010992 reflux Methods 0.000 description 10
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 10
- 239000007858 starting material Substances 0.000 description 10
- 229920002472 Starch Polymers 0.000 description 9
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 9
- 125000005843 halogen group Chemical group 0.000 description 9
- 230000005764 inhibitory process Effects 0.000 description 9
- 239000000546 pharmaceutical excipient Substances 0.000 description 9
- 125000006239 protecting group Chemical group 0.000 description 9
- 238000000746 purification Methods 0.000 description 9
- 235000019698 starch Nutrition 0.000 description 9
- 239000012043 crude product Substances 0.000 description 8
- 150000002367 halogens Chemical class 0.000 description 8
- 239000008107 starch Substances 0.000 description 8
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical compound C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 7
- 125000000392 cycloalkenyl group Chemical group 0.000 description 7
- 201000010099 disease Diseases 0.000 description 7
- NPZTUJOABDZTLV-UHFFFAOYSA-N hydroxybenzotriazole Substances O=C1C=CC=C2NNN=C12 NPZTUJOABDZTLV-UHFFFAOYSA-N 0.000 description 7
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 7
- 235000019359 magnesium stearate Nutrition 0.000 description 7
- 108090000623 proteins and genes Proteins 0.000 description 7
- 230000002207 retinal effect Effects 0.000 description 7
- 238000003756 stirring Methods 0.000 description 7
- CWXPZXBSDSIRCS-UHFFFAOYSA-N tert-butyl piperazine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCNCC1 CWXPZXBSDSIRCS-UHFFFAOYSA-N 0.000 description 7
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 6
- NEAQRZUHTPSBBM-UHFFFAOYSA-N 2-hydroxy-3,3-dimethyl-7-nitro-4h-isoquinolin-1-one Chemical compound C1=C([N+]([O-])=O)C=C2C(=O)N(O)C(C)(C)CC2=C1 NEAQRZUHTPSBBM-UHFFFAOYSA-N 0.000 description 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 6
- 102000004190 Enzymes Human genes 0.000 description 6
- 108090000790 Enzymes Proteins 0.000 description 6
- 108010033040 Histones Proteins 0.000 description 6
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 6
- 206010028980 Neoplasm Diseases 0.000 description 6
- 238000004458 analytical method Methods 0.000 description 6
- 125000001246 bromo group Chemical group Br* 0.000 description 6
- 239000003054 catalyst Substances 0.000 description 6
- 230000004663 cell proliferation Effects 0.000 description 6
- 239000003795 chemical substances by application Substances 0.000 description 6
- 125000001309 chloro group Chemical group Cl* 0.000 description 6
- 208000035475 disorder Diseases 0.000 description 6
- 239000003937 drug carrier Substances 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- 239000000284 extract Substances 0.000 description 6
- 229940127084 other anti-cancer agent Drugs 0.000 description 6
- 229910052763 palladium Inorganic materials 0.000 description 6
- 229940124530 sulfonamide Drugs 0.000 description 6
- 229910052717 sulfur Inorganic materials 0.000 description 6
- IOOMXAQUNPWDLL-UHFFFAOYSA-N 2-[6-(diethylamino)-3-(diethyliminiumyl)-3h-xanthen-9-yl]-5-sulfobenzene-1-sulfonate Chemical compound C=12C=CC(=[N+](CC)CC)C=C2OC2=CC(N(CC)CC)=CC=C2C=1C1=CC=C(S(O)(=O)=O)C=C1S([O-])(=O)=O IOOMXAQUNPWDLL-UHFFFAOYSA-N 0.000 description 5
- 125000000590 4-methylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 5
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 5
- 102000006947 Histones Human genes 0.000 description 5
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 5
- 208000017442 Retinal disease Diseases 0.000 description 5
- 125000003277 amino group Chemical group 0.000 description 5
- 239000002775 capsule Substances 0.000 description 5
- 229920002678 cellulose Polymers 0.000 description 5
- 239000001913 cellulose Substances 0.000 description 5
- 235000010980 cellulose Nutrition 0.000 description 5
- 239000003153 chemical reaction reagent Substances 0.000 description 5
- 239000000460 chlorine Substances 0.000 description 5
- 208000019425 cirrhosis of liver Diseases 0.000 description 5
- 238000002425 crystallisation Methods 0.000 description 5
- 230000008025 crystallization Effects 0.000 description 5
- 239000002552 dosage form Substances 0.000 description 5
- 150000002148 esters Chemical class 0.000 description 5
- 229940011871 estrogen Drugs 0.000 description 5
- 239000000262 estrogen Substances 0.000 description 5
- 239000007903 gelatin capsule Substances 0.000 description 5
- 239000012442 inert solvent Substances 0.000 description 5
- MYWUZJCMWCOHBA-VIFPVBQESA-N methamphetamine Chemical compound CN[C@@H](C)CC1=CC=CC=C1 MYWUZJCMWCOHBA-VIFPVBQESA-N 0.000 description 5
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 5
- OPECTNGATDYLSS-UHFFFAOYSA-N naphthalene-2-sulfonyl chloride Chemical compound C1=CC=CC2=CC(S(=O)(=O)Cl)=CC=C21 OPECTNGATDYLSS-UHFFFAOYSA-N 0.000 description 5
- 239000002245 particle Substances 0.000 description 5
- 239000000843 powder Substances 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- RSJSYCZYQNJQPY-UHFFFAOYSA-N 3,4-dimethoxybenzenesulfonyl chloride Chemical compound COC1=CC=C(S(Cl)(=O)=O)C=C1OC RSJSYCZYQNJQPY-UHFFFAOYSA-N 0.000 description 4
- BQXUPNKLZNSUMC-YUQWMIPFSA-N CCN(CCCCCOCC(=O)N[C@H](C(=O)N1C[C@H](O)C[C@H]1C(=O)N[C@@H](C)c1ccc(cc1)-c1scnc1C)C(C)(C)C)CCOc1ccc(cc1)C(=O)c1c(sc2cc(O)ccc12)-c1ccc(O)cc1 Chemical compound CCN(CCCCCOCC(=O)N[C@H](C(=O)N1C[C@H](O)C[C@H]1C(=O)N[C@@H](C)c1ccc(cc1)-c1scnc1C)C(C)(C)C)CCOc1ccc(cc1)C(=O)c1c(sc2cc(O)ccc12)-c1ccc(O)cc1 BQXUPNKLZNSUMC-YUQWMIPFSA-N 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- 201000003883 Cystic fibrosis Diseases 0.000 description 4
- 206010012689 Diabetic retinopathy Diseases 0.000 description 4
- 208000010412 Glaucoma Diseases 0.000 description 4
- OPFJDXRVMFKJJO-ZHHKINOHSA-N N-{[3-(2-benzamido-4-methyl-1,3-thiazol-5-yl)-pyrazol-5-yl]carbonyl}-G-dR-G-dD-dD-dD-NH2 Chemical compound S1C(C=2NN=C(C=2)C(=O)NCC(=O)N[C@H](CCCN=C(N)N)C(=O)NCC(=O)N[C@H](CC(O)=O)C(=O)N[C@H](CC(O)=O)C(=O)N[C@H](CC(O)=O)C(N)=O)=C(C)N=C1NC(=O)C1=CC=CC=C1 OPFJDXRVMFKJJO-ZHHKINOHSA-N 0.000 description 4
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 4
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 4
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 4
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 4
- 230000001154 acute effect Effects 0.000 description 4
- 150000001412 amines Chemical class 0.000 description 4
- 125000001743 benzylic group Chemical group 0.000 description 4
- 206010006451 bronchitis Diseases 0.000 description 4
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 4
- 230000024245 cell differentiation Effects 0.000 description 4
- 229940126086 compound 21 Drugs 0.000 description 4
- 201000000159 corneal neovascularization Diseases 0.000 description 4
- 238000005859 coupling reaction Methods 0.000 description 4
- 125000004122 cyclic group Chemical group 0.000 description 4
- 102000015694 estrogen receptors Human genes 0.000 description 4
- 108010038795 estrogen receptors Proteins 0.000 description 4
- 238000000605 extraction Methods 0.000 description 4
- 125000005553 heteroaryloxy group Chemical group 0.000 description 4
- 125000005844 heterocyclyloxy group Chemical group 0.000 description 4
- 230000006195 histone acetylation Effects 0.000 description 4
- 239000005457 ice water Substances 0.000 description 4
- 208000028867 ischemia Diseases 0.000 description 4
- 238000002955 isolation Methods 0.000 description 4
- QKDOEERVGLWCDJ-UHFFFAOYSA-N methyl 2-[4-(3,4-dimethoxyphenyl)sulfonylpiperazin-1-yl]-1,3-thiazole-5-carboxylate Chemical compound S1C(C(=O)OC)=CN=C1N1CCN(S(=O)(=O)C=2C=C(OC)C(OC)=CC=2)CC1 QKDOEERVGLWCDJ-UHFFFAOYSA-N 0.000 description 4
- 150000004702 methyl esters Chemical class 0.000 description 4
- TZIHFWKZFHZASV-UHFFFAOYSA-N methyl formate Chemical compound COC=O TZIHFWKZFHZASV-UHFFFAOYSA-N 0.000 description 4
- 238000006386 neutralization reaction Methods 0.000 description 4
- 239000003960 organic solvent Substances 0.000 description 4
- NFHFRUOZVGFOOS-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 4
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 4
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 4
- 239000006187 pill Substances 0.000 description 4
- 238000001556 precipitation Methods 0.000 description 4
- 208000032253 retinal ischemia Diseases 0.000 description 4
- 229920006395 saturated elastomer Polymers 0.000 description 4
- 150000003512 tertiary amines Chemical class 0.000 description 4
- HUWSZNZAROKDRZ-RRLWZMAJSA-N (3r,4r)-3-azaniumyl-5-[[(2s,3r)-1-[(2s)-2,3-dicarboxypyrrolidin-1-yl]-3-methyl-1-oxopentan-2-yl]amino]-5-oxo-4-sulfanylpentane-1-sulfonate Chemical compound OS(=O)(=O)CC[C@@H](N)[C@@H](S)C(=O)N[C@@H]([C@H](C)CC)C(=O)N1CCC(C(O)=O)[C@H]1C(O)=O HUWSZNZAROKDRZ-RRLWZMAJSA-N 0.000 description 3
- KQZLRWGGWXJPOS-NLFPWZOASA-N 1-[(1R)-1-(2,4-dichlorophenyl)ethyl]-6-[(4S,5R)-4-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-5-methylcyclohexen-1-yl]pyrazolo[3,4-b]pyrazine-3-carbonitrile Chemical compound ClC1=C(C=CC(=C1)Cl)[C@@H](C)N1N=C(C=2C1=NC(=CN=2)C1=CC[C@@H]([C@@H](C1)C)N1[C@@H](CCC1)CO)C#N KQZLRWGGWXJPOS-NLFPWZOASA-N 0.000 description 3
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 3
- DJUWIZUEHXRECB-UHFFFAOYSA-N 2-bromo-1,3-thiazole-5-carbaldehyde Chemical compound BrC1=NC=C(C=O)S1 DJUWIZUEHXRECB-UHFFFAOYSA-N 0.000 description 3
- UHCDBMIOLNKDHG-UHFFFAOYSA-N 4-(trifluoromethoxy)benzenesulfonyl chloride Chemical compound FC(F)(F)OC1=CC=C(S(Cl)(=O)=O)C=C1 UHCDBMIOLNKDHG-UHFFFAOYSA-N 0.000 description 3
- OZDCZHDOIBUGAJ-UHFFFAOYSA-N 4-(trifluoromethyl)benzenesulfonyl chloride Chemical compound FC(F)(F)C1=CC=C(S(Cl)(=O)=O)C=C1 OZDCZHDOIBUGAJ-UHFFFAOYSA-N 0.000 description 3
- BFXHJFKKRGVUMU-UHFFFAOYSA-N 4-fluorobenzenesulfonyl chloride Chemical compound FC1=CC=C(S(Cl)(=O)=O)C=C1 BFXHJFKKRGVUMU-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- 208000026310 Breast neoplasm Diseases 0.000 description 3
- KLWPJMFMVPTNCC-UHFFFAOYSA-N Camptothecin Natural products CCC1(O)C(=O)OCC2=C1C=C3C4Nc5ccccc5C=C4CN3C2=O KLWPJMFMVPTNCC-UHFFFAOYSA-N 0.000 description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- 229940126639 Compound 33 Drugs 0.000 description 3
- 206010016654 Fibrosis Diseases 0.000 description 3
- 102000003893 Histone acetyltransferases Human genes 0.000 description 3
- 108090000246 Histone acetyltransferases Proteins 0.000 description 3
- 238000006546 Horner-Wadsworth-Emmons reaction Methods 0.000 description 3
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 description 3
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 3
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 3
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- 206010038923 Retinopathy Diseases 0.000 description 3
- PNUZDKCDAWUEGK-CYZMBNFOSA-N Sitafloxacin Chemical compound C([C@H]1N)N(C=2C(=C3C(C(C(C(O)=O)=CN3[C@H]3[C@H](C3)F)=O)=CC=2F)Cl)CC11CC1 PNUZDKCDAWUEGK-CYZMBNFOSA-N 0.000 description 3
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 3
- 229930006000 Sucrose Natural products 0.000 description 3
- 230000006907 apoptotic process Effects 0.000 description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 3
- CSKNSYBAZOQPLR-UHFFFAOYSA-N benzenesulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=CC=C1 CSKNSYBAZOQPLR-UHFFFAOYSA-N 0.000 description 3
- XSCHRSMBECNVNS-UHFFFAOYSA-N benzopyrazine Natural products N1=CC=NC2=CC=CC=C21 XSCHRSMBECNVNS-UHFFFAOYSA-N 0.000 description 3
- 230000008499 blood brain barrier function Effects 0.000 description 3
- 210000001218 blood-brain barrier Anatomy 0.000 description 3
- 229940127093 camptothecin Drugs 0.000 description 3
- 230000025084 cell cycle arrest Effects 0.000 description 3
- 230000010261 cell growth Effects 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- 229940125810 compound 20 Drugs 0.000 description 3
- 229940125877 compound 31 Drugs 0.000 description 3
- 230000008878 coupling Effects 0.000 description 3
- 238000010168 coupling process Methods 0.000 description 3
- 125000004980 cyclopropylene group Chemical group 0.000 description 3
- 230000004069 differentiation Effects 0.000 description 3
- 239000003085 diluting agent Substances 0.000 description 3
- VSJKWCGYPAHWDS-UHFFFAOYSA-N dl-camptothecin Natural products C1=CC=C2C=C(CN3C4=CC5=C(C3=O)COC(=O)C5(O)CC)C4=NC2=C1 VSJKWCGYPAHWDS-UHFFFAOYSA-N 0.000 description 3
- 125000005678 ethenylene group Chemical group [H]C([*:1])=C([H])[*:2] 0.000 description 3
- 210000003527 eukaryotic cell Anatomy 0.000 description 3
- 230000004761 fibrosis Effects 0.000 description 3
- 239000000796 flavoring agent Substances 0.000 description 3
- 125000000524 functional group Chemical group 0.000 description 3
- 230000012010 growth Effects 0.000 description 3
- 239000001963 growth medium Substances 0.000 description 3
- JAXFJECJQZDFJS-XHEPKHHKSA-N gtpl8555 Chemical compound OC(=O)C[C@H](N)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](C(C)C)C(=O)N1CCC[C@@H]1C(=O)N[C@H](B1O[C@@]2(C)[C@H]3C[C@H](C3(C)C)C[C@H]2O1)CCC1=CC=C(F)C=C1 JAXFJECJQZDFJS-XHEPKHHKSA-N 0.000 description 3
- 125000005842 heteroatom Chemical group 0.000 description 3
- 230000006197 histone deacetylation Effects 0.000 description 3
- 239000003701 inert diluent Substances 0.000 description 3
- UEXQBEVWFZKHNB-UHFFFAOYSA-N intermediate 29 Natural products C1=CC(N)=CC=C1NC1=NC=CC=N1 UEXQBEVWFZKHNB-UHFFFAOYSA-N 0.000 description 3
- 125000002346 iodo group Chemical group I* 0.000 description 3
- 239000008101 lactose Substances 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 239000011777 magnesium Substances 0.000 description 3
- 238000001819 mass spectrum Methods 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 239000002609 medium Substances 0.000 description 3
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 3
- 239000008108 microcrystalline cellulose Substances 0.000 description 3
- 229940016286 microcrystalline cellulose Drugs 0.000 description 3
- 229910052760 oxygen Inorganic materials 0.000 description 3
- 239000001301 oxygen Substances 0.000 description 3
- YJVFFLUZDVXJQI-UHFFFAOYSA-L palladium(ii) acetate Chemical compound [Pd+2].CC([O-])=O.CC([O-])=O YJVFFLUZDVXJQI-UHFFFAOYSA-L 0.000 description 3
- 125000004193 piperazinyl group Chemical group 0.000 description 3
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 3
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 3
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 3
- 239000011591 potassium Substances 0.000 description 3
- 102000004169 proteins and genes Human genes 0.000 description 3
- 230000009467 reduction Effects 0.000 description 3
- 230000003595 spectral effect Effects 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 238000006467 substitution reaction Methods 0.000 description 3
- 239000000758 substrate Substances 0.000 description 3
- 239000005720 sucrose Substances 0.000 description 3
- FDDDEECHVMSUSB-UHFFFAOYSA-N sulfanilamide Chemical compound NC1=CC=C(S(N)(=O)=O)C=C1 FDDDEECHVMSUSB-UHFFFAOYSA-N 0.000 description 3
- 239000000829 suppository Substances 0.000 description 3
- 239000000454 talc Substances 0.000 description 3
- 229910052623 talc Inorganic materials 0.000 description 3
- 238000012360 testing method Methods 0.000 description 3
- 230000001225 therapeutic effect Effects 0.000 description 3
- VNNLHYZDXIBHKZ-UHFFFAOYSA-N thiophene-2-sulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=CS1 VNNLHYZDXIBHKZ-UHFFFAOYSA-N 0.000 description 3
- 125000000464 thioxo group Chemical group S=* 0.000 description 3
- 230000037426 transcriptional repression Effects 0.000 description 3
- RTKIYFITIVXBLE-QEQCGCAPSA-N trichostatin A Chemical compound ONC(=O)/C=C/C(/C)=C/[C@@H](C)C(=O)C1=CC=C(N(C)C)C=C1 RTKIYFITIVXBLE-QEQCGCAPSA-N 0.000 description 3
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 3
- UDQTXCHQKHIQMH-KYGLGHNPSA-N (3ar,5s,6s,7r,7ar)-5-(difluoromethyl)-2-(ethylamino)-5,6,7,7a-tetrahydro-3ah-pyrano[3,2-d][1,3]thiazole-6,7-diol Chemical compound S1C(NCC)=N[C@H]2[C@@H]1O[C@H](C(F)F)[C@@H](O)[C@@H]2O UDQTXCHQKHIQMH-KYGLGHNPSA-N 0.000 description 2
- YQOLEILXOBUDMU-KRWDZBQOSA-N (4R)-5-[(6-bromo-3-methyl-2-pyrrolidin-1-ylquinoline-4-carbonyl)amino]-4-(2-chlorophenyl)pentanoic acid Chemical compound CC1=C(C2=C(C=CC(=C2)Br)N=C1N3CCCC3)C(=O)NC[C@H](CCC(=O)O)C4=CC=CC=C4Cl YQOLEILXOBUDMU-KRWDZBQOSA-N 0.000 description 2
- RXNPEQZHMGFNAY-GEALJGNFSA-N (5R)-4-[(1S,6R)-5-[(2S)-2-(4-chlorophenyl)-3-(propan-2-ylamino)propanoyl]-2,5-diazabicyclo[4.1.0]heptan-2-yl]-5-methyl-6,8-dihydro-5H-pyrido[2,3-d]pyrimidin-7-one Chemical compound C[C@@H]1CC(=O)NC2=C1C(=NC=N2)N3CCN([C@H]4[C@@H]3C4)C(=O)[C@H](CNC(C)C)C5=CC=C(C=C5)Cl RXNPEQZHMGFNAY-GEALJGNFSA-N 0.000 description 2
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 2
- UWYZHKAOTLEWKK-UHFFFAOYSA-N 1,2,3,4-tetrahydroisoquinoline Chemical compound C1=CC=C2CNCCC2=C1 UWYZHKAOTLEWKK-UHFFFAOYSA-N 0.000 description 2
- HYJQWMUBCRPGDS-UHFFFAOYSA-N 1,3-thiazole-2-sulfonyl chloride Chemical compound ClS(=O)(=O)C1=NC=CS1 HYJQWMUBCRPGDS-UHFFFAOYSA-N 0.000 description 2
- WZZBNLYBHUDSHF-DHLKQENFSA-N 1-[(3s,4s)-4-[8-(2-chloro-4-pyrimidin-2-yloxyphenyl)-7-fluoro-2-methylimidazo[4,5-c]quinolin-1-yl]-3-fluoropiperidin-1-yl]-2-hydroxyethanone Chemical compound CC1=NC2=CN=C3C=C(F)C(C=4C(=CC(OC=5N=CC=CN=5)=CC=4)Cl)=CC3=C2N1[C@H]1CCN(C(=O)CO)C[C@@H]1F WZZBNLYBHUDSHF-DHLKQENFSA-N 0.000 description 2
- OXTVBHDILDPYAS-UHFFFAOYSA-N 1-[4-(aminomethyl)-2,6-di(propan-2-yl)phenyl]-3-[1-butyl-4-[3-(3-hydroxypropoxy)phenyl]-2-oxo-1,8-naphthyridin-3-yl]urea;hydrochloride Chemical compound Cl.CC(C)C=1C=C(CN)C=C(C(C)C)C=1NC(=O)NC=1C(=O)N(CCCC)C2=NC=CC=C2C=1C1=CC=CC(OCCCO)=C1 OXTVBHDILDPYAS-UHFFFAOYSA-N 0.000 description 2
- FCEHBMOGCRZNNI-UHFFFAOYSA-N 1-benzothiophene Chemical compound C1=CC=C2SC=CC2=C1 FCEHBMOGCRZNNI-UHFFFAOYSA-N 0.000 description 2
- GCDPERPXPREHJF-UHFFFAOYSA-N 1-iodododecane Chemical compound CCCCCCCCCCCCI GCDPERPXPREHJF-UHFFFAOYSA-N 0.000 description 2
- KXUGUWTUFUWYRS-UHFFFAOYSA-N 1-methylimidazole-4-sulfonyl chloride Chemical compound CN1C=NC(S(Cl)(=O)=O)=C1 KXUGUWTUFUWYRS-UHFFFAOYSA-N 0.000 description 2
- RDAVKKQKMLINOH-UHFFFAOYSA-N 1-methylpyrazole-4-sulfonyl chloride Chemical compound CN1C=C(S(Cl)(=O)=O)C=N1 RDAVKKQKMLINOH-UHFFFAOYSA-N 0.000 description 2
- OJWPAXRMRPPQBG-UHFFFAOYSA-N 1-naphthalen-2-ylsulfonylpiperazine Chemical compound C=1C=C2C=CC=CC2=CC=1S(=O)(=O)N1CCNCC1 OJWPAXRMRPPQBG-UHFFFAOYSA-N 0.000 description 2
- VOXZDWNPVJITMN-ZBRFXRBCSA-N 17β-estradiol Chemical compound OC1=CC=C2[C@H]3CC[C@](C)([C@H](CC4)O)[C@@H]4[C@@H]3CCC2=C1 VOXZDWNPVJITMN-ZBRFXRBCSA-N 0.000 description 2
- PVJZBZSCGJAWNG-UHFFFAOYSA-N 2,4,6-trimethylbenzenesulfonyl chloride Chemical compound CC1=CC(C)=C(S(Cl)(=O)=O)C(C)=C1 PVJZBZSCGJAWNG-UHFFFAOYSA-N 0.000 description 2
- JJKSHSHZJOWSEC-UHFFFAOYSA-N 2,5-dichlorothiophene-3-sulfonyl chloride Chemical compound ClC1=CC(S(Cl)(=O)=O)=C(Cl)S1 JJKSHSHZJOWSEC-UHFFFAOYSA-N 0.000 description 2
- NQOZPTYIJQUKTJ-UHFFFAOYSA-N 2-[2-(3-methoxyphenyl)-4-oxo-6-(3-piperidin-1-ylpropoxy)quinazolin-3-yl]-n-propan-2-ylacetamide Chemical compound COC1=CC=CC(C=2N(C(=O)C3=CC(OCCCN4CCCCC4)=CC=C3N=2)CC(=O)NC(C)C)=C1 NQOZPTYIJQUKTJ-UHFFFAOYSA-N 0.000 description 2
- RYWCQJDEHXJHRI-XJMXIVSISA-N 2-[3-[5-[6-[3-[3-(carboxymethyl)phenyl]-4-[(2r,3s,4s,5s,6r)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]hexyl]-2-[(2r,3s,4s,5s,6r)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]phenyl]acetic acid Chemical compound O[C@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OC(C(=C1)C=2C=C(CC(O)=O)C=CC=2)=CC=C1CCCCCCC(C=C1C=2C=C(CC(O)=O)C=CC=2)=CC=C1O[C@@H]1[C@@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 RYWCQJDEHXJHRI-XJMXIVSISA-N 0.000 description 2
- PYRKKGOKRMZEIT-UHFFFAOYSA-N 2-[6-(2-cyclopropylethoxy)-9-(2-hydroxy-2-methylpropyl)-1h-phenanthro[9,10-d]imidazol-2-yl]-5-fluorobenzene-1,3-dicarbonitrile Chemical compound C1=C2C3=CC(CC(C)(O)C)=CC=C3C=3NC(C=4C(=CC(F)=CC=4C#N)C#N)=NC=3C2=CC=C1OCCC1CC1 PYRKKGOKRMZEIT-UHFFFAOYSA-N 0.000 description 2
- ASSKVPFEZFQQNQ-UHFFFAOYSA-N 2-benzoxazolinone Chemical compound C1=CC=C2OC(O)=NC2=C1 ASSKVPFEZFQQNQ-UHFFFAOYSA-N 0.000 description 2
- RXNZFHIEDZEUQM-UHFFFAOYSA-N 2-bromo-1,3-thiazole Chemical compound BrC1=NC=CS1 RXNZFHIEDZEUQM-UHFFFAOYSA-N 0.000 description 2
- JUIKUQOUMZUFQT-UHFFFAOYSA-N 2-bromoacetamide Chemical compound NC(=O)CBr JUIKUQOUMZUFQT-UHFFFAOYSA-N 0.000 description 2
- ZRWICZHXYMHBDP-UHFFFAOYSA-N 2-chlorosulfonylbenzoic acid Chemical compound OC(=O)C1=CC=CC=C1S(Cl)(=O)=O ZRWICZHXYMHBDP-UHFFFAOYSA-N 0.000 description 2
- NQVMZRZWNPTCJC-UHFFFAOYSA-N 2-methyl-1,3-thiazole-4-sulfonyl chloride Chemical compound CC1=NC(S(Cl)(=O)=O)=CS1 NQVMZRZWNPTCJC-UHFFFAOYSA-N 0.000 description 2
- HDECRAPHCDXMIJ-UHFFFAOYSA-N 2-methylbenzenesulfonyl chloride Chemical compound CC1=CC=CC=C1S(Cl)(=O)=O HDECRAPHCDXMIJ-UHFFFAOYSA-N 0.000 description 2
- LKFNLHZZPHHFEC-UHFFFAOYSA-N 2-phenylethanesulfonyl chloride Chemical compound ClS(=O)(=O)CCC1=CC=CC=C1 LKFNLHZZPHHFEC-UHFFFAOYSA-N 0.000 description 2
- 125000000389 2-pyrrolyl group Chemical group [H]N1C([*])=C([H])C([H])=C1[H] 0.000 description 2
- NYIBPWGZGSXURD-UHFFFAOYSA-N 3,4-dichlorobenzenesulfonyl chloride Chemical compound ClC1=CC=C(S(Cl)(=O)=O)C=C1Cl NYIBPWGZGSXURD-UHFFFAOYSA-N 0.000 description 2
- BTRCVKADYDVSLI-UHFFFAOYSA-N 3,5-bis(trifluoromethyl)benzenesulfonyl chloride Chemical compound FC(F)(F)C1=CC(C(F)(F)F)=CC(S(Cl)(=O)=O)=C1 BTRCVKADYDVSLI-UHFFFAOYSA-N 0.000 description 2
- RJSQINMKOSOUGT-UHFFFAOYSA-N 3,5-dichlorobenzenesulfonyl chloride Chemical compound ClC1=CC(Cl)=CC(S(Cl)(=O)=O)=C1 RJSQINMKOSOUGT-UHFFFAOYSA-N 0.000 description 2
- BGAJNPLDJJBRHK-UHFFFAOYSA-N 3-[2-[5-(3-chloro-4-propan-2-yloxyphenyl)-1,3,4-thiadiazol-2-yl]-3-methyl-6,7-dihydro-4h-pyrazolo[4,3-c]pyridin-5-yl]propanoic acid Chemical compound C1=C(Cl)C(OC(C)C)=CC=C1C1=NN=C(N2C(=C3CN(CCC(O)=O)CCC3=N2)C)S1 BGAJNPLDJJBRHK-UHFFFAOYSA-N 0.000 description 2
- GAIOPWBQKZMUNO-UHFFFAOYSA-N 3-[[5-fluoro-4-[4-methyl-2-(methylamino)-1,3-thiazol-5-yl]pyrimidin-2-yl]amino]benzenesulfonamide Chemical compound S1C(NC)=NC(C)=C1C1=NC(NC=2C=C(C=CC=2)S(N)(=O)=O)=NC=C1F GAIOPWBQKZMUNO-UHFFFAOYSA-N 0.000 description 2
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 2
- GRDXCFKBQWDAJH-UHFFFAOYSA-N 4-acetamidobenzenesulfonyl chloride Chemical compound CC(=O)NC1=CC=C(S(Cl)(=O)=O)C=C1 GRDXCFKBQWDAJH-UHFFFAOYSA-N 0.000 description 2
- KMMHZIBWCXYAAH-UHFFFAOYSA-N 4-bromobenzenesulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=C(Br)C=C1 KMMHZIBWCXYAAH-UHFFFAOYSA-N 0.000 description 2
- DBMFYTQPPBBKHI-UHFFFAOYSA-N 4-cyanobenzenesulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=C(C#N)C=C1 DBMFYTQPPBBKHI-UHFFFAOYSA-N 0.000 description 2
- 125000004860 4-ethylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])C([H])([H])[H] 0.000 description 2
- DTJVECUKADWGMO-UHFFFAOYSA-N 4-methoxybenzenesulfonyl chloride Chemical compound COC1=CC=C(S(Cl)(=O)=O)C=C1 DTJVECUKADWGMO-UHFFFAOYSA-N 0.000 description 2
- UUBHGAXBJMFHCV-UHFFFAOYSA-N 4-methyl-2-piperazin-1-yl-1,3-thiazole-5-carboxylic acid Chemical compound S1C(C(O)=O)=C(C)N=C1N1CCNCC1 UUBHGAXBJMFHCV-UHFFFAOYSA-N 0.000 description 2
- JXRGUPLJCCDGKG-UHFFFAOYSA-N 4-nitrobenzenesulfonyl chloride Chemical compound [O-][N+](=O)C1=CC=C(S(Cl)(=O)=O)C=C1 JXRGUPLJCCDGKG-UHFFFAOYSA-N 0.000 description 2
- YEZADZMMVHWFIY-UHFFFAOYSA-N 4-tert-butylbenzenesulfonyl chloride Chemical compound CC(C)(C)C1=CC=C(S(Cl)(=O)=O)C=C1 YEZADZMMVHWFIY-UHFFFAOYSA-N 0.000 description 2
- SRSGVKWWVXWSJT-ATVHPVEESA-N 5-[(z)-(5-fluoro-2-oxo-1h-indol-3-ylidene)methyl]-2,4-dimethyl-n-(2-pyrrolidin-1-ylethyl)-1h-pyrrole-3-carboxamide Chemical compound CC=1NC(\C=C/2C3=CC(F)=CC=C3NC\2=O)=C(C)C=1C(=O)NCCN1CCCC1 SRSGVKWWVXWSJT-ATVHPVEESA-N 0.000 description 2
- HWGVUNSKAPCFNF-UHFFFAOYSA-N 5-chloro-1,3-dimethylpyrazole-4-sulfonyl chloride Chemical compound CC1=NN(C)C(Cl)=C1S(Cl)(=O)=O HWGVUNSKAPCFNF-UHFFFAOYSA-N 0.000 description 2
- SORSTNOXGOXWAO-UHFFFAOYSA-N 5-chlorothiophene-2-sulfonyl chloride Chemical compound ClC1=CC=C(S(Cl)(=O)=O)S1 SORSTNOXGOXWAO-UHFFFAOYSA-N 0.000 description 2
- KDCGOANMDULRCW-UHFFFAOYSA-N 7H-purine Chemical compound N1=CNC2=NC=NC2=C1 KDCGOANMDULRCW-UHFFFAOYSA-N 0.000 description 2
- UJOBWOGCFQCDNV-UHFFFAOYSA-N 9H-carbazole Chemical compound C1=CC=C2C3=CC=CC=C3NC2=C1 UJOBWOGCFQCDNV-UHFFFAOYSA-N 0.000 description 2
- 201000011452 Adrenoleukodystrophy Diseases 0.000 description 2
- 208000024827 Alzheimer disease Diseases 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- 102000014654 Aromatase Human genes 0.000 description 2
- 108010078554 Aromatase Proteins 0.000 description 2
- 208000023275 Autoimmune disease Diseases 0.000 description 2
- 206010006187 Breast cancer Diseases 0.000 description 2
- 206010006458 Bronchitis chronic Diseases 0.000 description 2
- 206010007572 Cardiac hypertrophy Diseases 0.000 description 2
- 208000006029 Cardiomegaly Diseases 0.000 description 2
- 208000006545 Chronic Obstructive Pulmonary Disease Diseases 0.000 description 2
- 208000032544 Cicatrix Diseases 0.000 description 2
- 206010055665 Corneal neovascularisation Diseases 0.000 description 2
- 102100035861 Cytosolic 5'-nucleotidase 1A Human genes 0.000 description 2
- 201000003066 Diffuse Scleroderma Diseases 0.000 description 2
- 239000006144 Dulbecco’s modified Eagle's medium Substances 0.000 description 2
- 208000001708 Dupuytren contracture Diseases 0.000 description 2
- 208000001351 Epiretinal Membrane Diseases 0.000 description 2
- 241001504495 Erithacus Species 0.000 description 2
- 206010019280 Heart failures Diseases 0.000 description 2
- 102100038715 Histone deacetylase 8 Human genes 0.000 description 2
- 101000802744 Homo sapiens Cytosolic 5'-nucleotidase 1A Proteins 0.000 description 2
- 101001032118 Homo sapiens Histone deacetylase 8 Proteins 0.000 description 2
- 208000023105 Huntington disease Diseases 0.000 description 2
- 206010022489 Insulin Resistance Diseases 0.000 description 2
- 206010022941 Iridocyclitis Diseases 0.000 description 2
- 208000002260 Keloid Diseases 0.000 description 2
- 206010023330 Keloid scar Diseases 0.000 description 2
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 2
- 208000019693 Lung disease Diseases 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- 241000124008 Mammalia Species 0.000 description 2
- 102000009030 Member 1 Subfamily D ATP Binding Cassette Transporter Human genes 0.000 description 2
- 108010049137 Member 1 Subfamily D ATP Binding Cassette Transporter Proteins 0.000 description 2
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 2
- 208000003250 Mixed connective tissue disease Diseases 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- 108010047956 Nucleosomes Proteins 0.000 description 2
- 208000021957 Ocular injury Diseases 0.000 description 2
- PCNDJXKNXGMECE-UHFFFAOYSA-N Phenazine Natural products C1=CC=CC2=NC3=CC=CC=C3N=C21 PCNDJXKNXGMECE-UHFFFAOYSA-N 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- 208000002158 Proliferative Vitreoretinopathy Diseases 0.000 description 2
- 201000004681 Psoriasis Diseases 0.000 description 2
- KYQCOXFCLRTKLS-UHFFFAOYSA-N Pyrazine Chemical compound C1=CN=CC=N1 KYQCOXFCLRTKLS-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- 208000002367 Retinal Perforations Diseases 0.000 description 2
- 206010038848 Retinal detachment Diseases 0.000 description 2
- 208000007014 Retinitis pigmentosa Diseases 0.000 description 2
- 206010038934 Retinopathy proliferative Diseases 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 201000009594 Systemic Scleroderma Diseases 0.000 description 2
- 206010042953 Systemic sclerosis Diseases 0.000 description 2
- 229940123237 Taxane Drugs 0.000 description 2
- 241001116500 Taxus Species 0.000 description 2
- MUMGGOZAMZWBJJ-DYKIIFRCSA-N Testostosterone Chemical compound O=C1CC[C@]2(C)[C@H]3CC[C@](C)([C@H](CC4)O)[C@@H]4[C@@H]3CCC2=C1 MUMGGOZAMZWBJJ-DYKIIFRCSA-N 0.000 description 2
- 208000002903 Thalassemia Diseases 0.000 description 2
- 208000007536 Thrombosis Diseases 0.000 description 2
- RTKIYFITIVXBLE-UHFFFAOYSA-N Trichostatin A Natural products ONC(=O)C=CC(C)=CC(C)C(=O)C1=CC=C(N(C)C)C=C1 RTKIYFITIVXBLE-UHFFFAOYSA-N 0.000 description 2
- 206010046851 Uveitis Diseases 0.000 description 2
- NPUXORBZRBIOMQ-RUZDIDTESA-N [(2R)-1-[[4-[[3-(benzenesulfonylmethyl)-5-methylphenoxy]methyl]phenyl]methyl]-2-pyrrolidinyl]methanol Chemical compound C=1C(OCC=2C=CC(CN3[C@H](CCC3)CO)=CC=2)=CC(C)=CC=1CS(=O)(=O)C1=CC=CC=C1 NPUXORBZRBIOMQ-RUZDIDTESA-N 0.000 description 2
- DGEZNRSVGBDHLK-UHFFFAOYSA-N [1,10]phenanthroline Chemical compound C1=CN=C2C3=NC=CC=C3C=CC2=C1 DGEZNRSVGBDHLK-UHFFFAOYSA-N 0.000 description 2
- SMNRFWMNPDABKZ-WVALLCKVSA-N [[(2R,3S,4R,5S)-5-(2,6-dioxo-3H-pyridin-3-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [[[(2R,3S,4S,5R,6R)-4-fluoro-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl] hydrogen phosphate Chemical compound OC[C@H]1O[C@H](OP(O)(=O)OP(O)(=O)OP(O)(=O)OP(O)(=O)OC[C@H]2O[C@H]([C@H](O)[C@@H]2O)C2C=CC(=O)NC2=O)[C@H](O)[C@@H](F)[C@@H]1O SMNRFWMNPDABKZ-WVALLCKVSA-N 0.000 description 2
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 2
- 230000021736 acetylation Effects 0.000 description 2
- 238000006640 acetylation reaction Methods 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- DZBUGLKDJFMEHC-UHFFFAOYSA-N acridine Chemical compound C1=CC=CC2=CC3=CC=CC=C3N=C21 DZBUGLKDJFMEHC-UHFFFAOYSA-N 0.000 description 2
- 230000009471 action Effects 0.000 description 2
- OQIQSTLJSLGHID-WNWIJWBNSA-N aflatoxin B1 Chemical compound C=1([C@@H]2C=CO[C@@H]2OC=1C=C(C1=2)OC)C=2OC(=O)C2=C1CCC2=O OQIQSTLJSLGHID-WNWIJWBNSA-N 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 2
- 150000008041 alkali metal carbonates Chemical class 0.000 description 2
- 206010002026 amyotrophic lateral sclerosis Diseases 0.000 description 2
- 201000004612 anterior uveitis Diseases 0.000 description 2
- 208000006673 asthma Diseases 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- WEDIIKBPDQQQJU-UHFFFAOYSA-N butane-1-sulfonyl chloride Chemical compound CCCCS(Cl)(=O)=O WEDIIKBPDQQQJU-UHFFFAOYSA-N 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- FJDQFPXHSGXQBY-UHFFFAOYSA-L caesium carbonate Chemical compound [Cs+].[Cs+].[O-]C([O-])=O FJDQFPXHSGXQBY-UHFFFAOYSA-L 0.000 description 2
- 229910000024 caesium carbonate Inorganic materials 0.000 description 2
- VSJKWCGYPAHWDS-FQEVSTJZSA-N camptothecin Chemical class C1=CC=C2C=C(CN3C4=CC5=C(C3=O)COC(=O)[C@]5(O)CC)C4=NC2=C1 VSJKWCGYPAHWDS-FQEVSTJZSA-N 0.000 description 2
- 239000001768 carboxy methyl cellulose Substances 0.000 description 2
- 210000001715 carotid artery Anatomy 0.000 description 2
- 230000005779 cell damage Effects 0.000 description 2
- 239000003638 chemical reducing agent Substances 0.000 description 2
- 208000007451 chronic bronchitis Diseases 0.000 description 2
- 230000001684 chronic effect Effects 0.000 description 2
- 230000007882 cirrhosis Effects 0.000 description 2
- 229940125800 compound 12j Drugs 0.000 description 2
- 229940126540 compound 41 Drugs 0.000 description 2
- 229940125936 compound 42 Drugs 0.000 description 2
- 229940125844 compound 46 Drugs 0.000 description 2
- 208000018631 connective tissue disease Diseases 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 125000006165 cyclic alkyl group Chemical group 0.000 description 2
- 125000000000 cycloalkoxy group Chemical group 0.000 description 2
- 230000006378 damage Effects 0.000 description 2
- 238000003381 deacetylation reaction Methods 0.000 description 2
- 230000003412 degenerative effect Effects 0.000 description 2
- 230000003111 delayed effect Effects 0.000 description 2
- 238000010511 deprotection reaction Methods 0.000 description 2
- 201000001981 dermatomyositis Diseases 0.000 description 2
- ZHXTWWCDMUWMDI-UHFFFAOYSA-N dihydroxyboron Chemical compound O[B]O ZHXTWWCDMUWMDI-UHFFFAOYSA-N 0.000 description 2
- 208000037765 diseases and disorders Diseases 0.000 description 2
- 208000011325 dry age related macular degeneration Diseases 0.000 description 2
- 230000002497 edematous effect Effects 0.000 description 2
- 239000008387 emulsifying waxe Substances 0.000 description 2
- 239000012055 enteric layer Substances 0.000 description 2
- YJGVMLPVUAXIQN-UHFFFAOYSA-N epipodophyllotoxin Natural products COC1=C(OC)C(OC)=CC(C2C3=CC=4OCOC=4C=C3C(O)C3C2C(OC3)=O)=C1 YJGVMLPVUAXIQN-UHFFFAOYSA-N 0.000 description 2
- 229960005309 estradiol Drugs 0.000 description 2
- 229930182833 estradiol Natural products 0.000 description 2
- OAYLNYINCPYISS-UHFFFAOYSA-N ethyl acetate;hexane Chemical compound CCCCCC.CCOC(C)=O OAYLNYINCPYISS-UHFFFAOYSA-N 0.000 description 2
- 230000003176 fibrotic effect Effects 0.000 description 2
- 238000003818 flash chromatography Methods 0.000 description 2
- 235000019634 flavors Nutrition 0.000 description 2
- 125000001153 fluoro group Chemical group F* 0.000 description 2
- 125000002541 furyl group Chemical group 0.000 description 2
- 230000014509 gene expression Effects 0.000 description 2
- 230000002068 genetic effect Effects 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 208000014951 hematologic disease Diseases 0.000 description 2
- 208000034737 hemoglobinopathy Diseases 0.000 description 2
- BXWNKGSJHAJOGX-UHFFFAOYSA-N hexadecan-1-ol Chemical compound CCCCCCCCCCCCCCCCO BXWNKGSJHAJOGX-UHFFFAOYSA-N 0.000 description 2
- 230000001969 hypertrophic effect Effects 0.000 description 2
- 230000000642 iatrogenic effect Effects 0.000 description 2
- 238000011065 in-situ storage Methods 0.000 description 2
- 230000002779 inactivation Effects 0.000 description 2
- 238000001802 infusion Methods 0.000 description 2
- 208000018337 inherited hemoglobinopathy Diseases 0.000 description 2
- 208000014674 injury Diseases 0.000 description 2
- 238000001990 intravenous administration Methods 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- 201000004614 iritis Diseases 0.000 description 2
- AWJUIBRHMBBTKR-UHFFFAOYSA-N isoquinoline Chemical compound C1=NC=CC2=CC=CC=C21 AWJUIBRHMBBTKR-UHFFFAOYSA-N 0.000 description 2
- ZLTPDFXIESTBQG-UHFFFAOYSA-N isothiazole Chemical compound C=1C=NSC=1 ZLTPDFXIESTBQG-UHFFFAOYSA-N 0.000 description 2
- CTAPFRYPJLPFDF-UHFFFAOYSA-N isoxazole Chemical compound C=1C=NOC=1 CTAPFRYPJLPFDF-UHFFFAOYSA-N 0.000 description 2
- 210000001117 keloid Anatomy 0.000 description 2
- 238000002647 laser therapy Methods 0.000 description 2
- 229940057995 liquid paraffin Drugs 0.000 description 2
- RENRQMCACQEWFC-UGKGYDQZSA-N lnp023 Chemical compound C1([C@H]2N(CC=3C=4C=CNC=4C(C)=CC=3OC)CC[C@@H](C2)OCC)=CC=C(C(O)=O)C=C1 RENRQMCACQEWFC-UGKGYDQZSA-N 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- 230000014759 maintenance of location Effects 0.000 description 2
- 230000003211 malignant effect Effects 0.000 description 2
- 230000007246 mechanism Effects 0.000 description 2
- 208000030159 metabolic disease Diseases 0.000 description 2
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 2
- LXSUVYGZODASAI-UHFFFAOYSA-N methyl 2-chloro-3-oxopropanoate Chemical compound COC(=O)C(Cl)C=O LXSUVYGZODASAI-UHFFFAOYSA-N 0.000 description 2
- QABLOFMHHSOFRJ-UHFFFAOYSA-N methyl 2-chloroacetate Chemical compound COC(=O)CCl QABLOFMHHSOFRJ-UHFFFAOYSA-N 0.000 description 2
- HUNUAFNLLYVTQD-UHFFFAOYSA-N methyl 2-chlorosulfonylbenzoate Chemical compound COC(=O)C1=CC=CC=C1S(Cl)(=O)=O HUNUAFNLLYVTQD-UHFFFAOYSA-N 0.000 description 2
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- 201000006417 multiple sclerosis Diseases 0.000 description 2
- LDIWOVZVSLURNZ-UHFFFAOYSA-N n-hydroxy-1,3-thiazole-2-carboxamide Chemical compound ONC(=O)C1=NC=CS1 LDIWOVZVSLURNZ-UHFFFAOYSA-N 0.000 description 2
- DASJFYAPNPUBGG-UHFFFAOYSA-N naphthalene-1-sulfonyl chloride Chemical compound C1=CC=C2C(S(=O)(=O)Cl)=CC=CC2=C1 DASJFYAPNPUBGG-UHFFFAOYSA-N 0.000 description 2
- 230000005949 negative regulation of histone deacetylation Effects 0.000 description 2
- 201000003142 neovascular glaucoma Diseases 0.000 description 2
- 208000021971 neovascular inflammatory vitreoretinopathy Diseases 0.000 description 2
- 230000004770 neurodegeneration Effects 0.000 description 2
- 208000015122 neurodegenerative disease Diseases 0.000 description 2
- 210000001623 nucleosome Anatomy 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 230000020477 pH reduction Effects 0.000 description 2
- 239000012188 paraffin wax Substances 0.000 description 2
- 230000037361 pathway Effects 0.000 description 2
- 239000008177 pharmaceutical agent Substances 0.000 description 2
- 229940124531 pharmaceutical excipient Drugs 0.000 description 2
- RDOWQLZANAYVLL-UHFFFAOYSA-N phenanthridine Chemical compound C1=CC=C2C3=CC=CC=C3C=NC2=C1 RDOWQLZANAYVLL-UHFFFAOYSA-N 0.000 description 2
- 238000002428 photodynamic therapy Methods 0.000 description 2
- 229960001237 podophyllotoxin Drugs 0.000 description 2
- YJGVMLPVUAXIQN-XVVDYKMHSA-N podophyllotoxin Chemical class COC1=C(OC)C(OC)=CC([C@@H]2C3=CC=4OCOC=4C=C3[C@H](O)[C@@H]3[C@@H]2C(OC3)=O)=C1 YJGVMLPVUAXIQN-XVVDYKMHSA-N 0.000 description 2
- YVCVYCSAAZQOJI-UHFFFAOYSA-N podophyllotoxin Natural products COC1=C(O)C(OC)=CC(C2C3=CC=4OCOC=4C=C3C(O)C3C2C(OC3)=O)=C1 YVCVYCSAAZQOJI-UHFFFAOYSA-N 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 238000004321 preservation Methods 0.000 description 2
- 230000008569 process Effects 0.000 description 2
- 230000006785 proliferative vitreoretinopathy Effects 0.000 description 2
- DRINJBFRTLBHNF-UHFFFAOYSA-N propane-2-sulfonyl chloride Chemical compound CC(C)S(Cl)(=O)=O DRINJBFRTLBHNF-UHFFFAOYSA-N 0.000 description 2
- CDRNYKLYADJTMN-UHFFFAOYSA-N pyridine-3-sulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=CN=C1 CDRNYKLYADJTMN-UHFFFAOYSA-N 0.000 description 2
- 125000004076 pyridyl group Chemical group 0.000 description 2
- CULAGHAXBSYDOC-UHFFFAOYSA-N pyrimidine-2-sulfonyl chloride Chemical compound ClS(=O)(=O)C1=NC=CC=N1 CULAGHAXBSYDOC-UHFFFAOYSA-N 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 102000005962 receptors Human genes 0.000 description 2
- 108020003175 receptors Proteins 0.000 description 2
- 230000022532 regulation of transcription, DNA-dependent Effects 0.000 description 2
- QEVHRUUCFGRFIF-MDEJGZGSSA-N reserpine Chemical compound O([C@H]1[C@@H]([C@H]([C@H]2C[C@@H]3C4=C(C5=CC=C(OC)C=C5N4)CCN3C[C@H]2C1)C(=O)OC)OC)C(=O)C1=CC(OC)=C(OC)C(OC)=C1 QEVHRUUCFGRFIF-MDEJGZGSSA-N 0.000 description 2
- 210000001525 retina Anatomy 0.000 description 2
- 230000004264 retinal detachment Effects 0.000 description 2
- 208000004644 retinal vein occlusion Diseases 0.000 description 2
- 150000004508 retinoic acid derivatives Chemical class 0.000 description 2
- 230000002441 reversible effect Effects 0.000 description 2
- 206010039073 rheumatoid arthritis Diseases 0.000 description 2
- TZSZZENYCISATO-WIOPSUGQSA-N rodatristat Chemical compound CCOC(=O)[C@@H]1CC2(CN1)CCN(CC2)c1cc(O[C@H](c2ccc(Cl)cc2-c2ccccc2)C(F)(F)F)nc(N)n1 TZSZZENYCISATO-WIOPSUGQSA-N 0.000 description 2
- 231100000241 scar Toxicity 0.000 description 2
- 230000037387 scars Effects 0.000 description 2
- 208000007056 sickle cell anemia Diseases 0.000 description 2
- 238000010898 silica gel chromatography Methods 0.000 description 2
- 208000017520 skin disease Diseases 0.000 description 2
- DVWOYOSIEJRHKW-UIRZNSHLSA-M sodium (2S)-2-[[(2S)-2-[[(4,4-difluorocyclohexyl)-phenylmethoxy]carbonylamino]-4-methylpentanoyl]amino]-1-hydroxy-3-[(3S)-2-oxopyrrolidin-3-yl]propane-1-sulfonate Chemical compound FC1(CCC(CC1)C(OC(=O)N[C@H](C(=O)N[C@H](C(S(=O)(=O)[O-])O)C[C@H]1C(NCC1)=O)CC(C)C)C1=CC=CC=C1)F.[Na+] DVWOYOSIEJRHKW-UIRZNSHLSA-M 0.000 description 2
- WXMKPNITSTVMEF-UHFFFAOYSA-M sodium benzoate Chemical compound [Na+].[O-]C(=O)C1=CC=CC=C1 WXMKPNITSTVMEF-UHFFFAOYSA-M 0.000 description 2
- 239000004299 sodium benzoate Substances 0.000 description 2
- 235000010234 sodium benzoate Nutrition 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 2
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 2
- 239000012321 sodium triacetoxyborohydride Substances 0.000 description 2
- 239000008247 solid mixture Substances 0.000 description 2
- 208000002320 spinal muscular atrophy Diseases 0.000 description 2
- 125000005338 substituted cycloalkoxy group Chemical group 0.000 description 2
- 239000011593 sulfur Substances 0.000 description 2
- NBNBICNWNFQDDD-UHFFFAOYSA-N sulfuryl dibromide Chemical compound BrS(Br)(=O)=O NBNBICNWNFQDDD-UHFFFAOYSA-N 0.000 description 2
- OBTWBSRJZRCYQV-UHFFFAOYSA-N sulfuryl difluoride Chemical compound FS(F)(=O)=O OBTWBSRJZRCYQV-UHFFFAOYSA-N 0.000 description 2
- 238000001356 surgical procedure Methods 0.000 description 2
- 208000011580 syndromic disease Diseases 0.000 description 2
- 239000006188 syrup Substances 0.000 description 2
- 235000020357 syrup Nutrition 0.000 description 2
- 201000000596 systemic lupus erythematosus Diseases 0.000 description 2
- 150000003573 thiols Chemical class 0.000 description 2
- 125000004568 thiomorpholinyl group Chemical group 0.000 description 2
- 229930192474 thiophene Natural products 0.000 description 2
- 210000001519 tissue Anatomy 0.000 description 2
- 230000005945 translocation Effects 0.000 description 2
- 229960000575 trastuzumab Drugs 0.000 description 2
- 230000008733 trauma Effects 0.000 description 2
- PYOKUURKVVELLB-UHFFFAOYSA-N trimethyl orthoformate Chemical compound COC(OC)OC PYOKUURKVVELLB-UHFFFAOYSA-N 0.000 description 2
- 208000001072 type 2 diabetes mellitus Diseases 0.000 description 2
- 229920002554 vinyl polymer Polymers 0.000 description 2
- 238000005303 weighing Methods 0.000 description 2
- 239000000230 xanthan gum Substances 0.000 description 2
- 235000010493 xanthan gum Nutrition 0.000 description 2
- 229920001285 xanthan gum Polymers 0.000 description 2
- 229940082509 xanthan gum Drugs 0.000 description 2
- DNXHEGUUPJUMQT-UHFFFAOYSA-N (+)-estrone Natural products OC1=CC=C2C3CCC(C)(C(CC4)=O)C4C3CCC2=C1 DNXHEGUUPJUMQT-UHFFFAOYSA-N 0.000 description 1
- QYYZXEPEVBXNNA-QGZVFWFLSA-N (1R)-2-acetyl-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-5-methylsulfonyl-1,3-dihydroisoindole-1-carboxamide Chemical compound C(C)(=O)N1[C@H](C2=CC=C(C=C2C1)S(=O)(=O)C)C(=O)NC1=CC=C(C=C1)C(C(F)(F)F)(C(F)(F)F)O QYYZXEPEVBXNNA-QGZVFWFLSA-N 0.000 description 1
- ASGMFNBUXDJWJJ-JLCFBVMHSA-N (1R,3R)-3-[[3-bromo-1-[4-(5-methyl-1,3,4-thiadiazol-2-yl)phenyl]pyrazolo[3,4-d]pyrimidin-6-yl]amino]-N,1-dimethylcyclopentane-1-carboxamide Chemical compound BrC1=NN(C2=NC(=NC=C21)N[C@H]1C[C@@](CC1)(C(=O)NC)C)C1=CC=C(C=C1)C=1SC(=NN=1)C ASGMFNBUXDJWJJ-JLCFBVMHSA-N 0.000 description 1
- ABJSOROVZZKJGI-OCYUSGCXSA-N (1r,2r,4r)-2-(4-bromophenyl)-n-[(4-chlorophenyl)-(2-fluoropyridin-4-yl)methyl]-4-morpholin-4-ylcyclohexane-1-carboxamide Chemical compound C1=NC(F)=CC(C(NC(=O)[C@H]2[C@@H](C[C@@H](CC2)N2CCOCC2)C=2C=CC(Br)=CC=2)C=2C=CC(Cl)=CC=2)=C1 ABJSOROVZZKJGI-OCYUSGCXSA-N 0.000 description 1
- DOMQFIFVDIAOOT-ROUUACIJSA-N (2S,3R)-N-[4-(2,6-dimethoxyphenyl)-5-(5-methylpyridin-3-yl)-1,2,4-triazol-3-yl]-3-(5-methylpyrimidin-2-yl)butane-2-sulfonamide Chemical compound COC1=C(C(=CC=C1)OC)N1C(=NN=C1C=1C=NC=C(C=1)C)NS(=O)(=O)[C@@H](C)[C@H](C)C1=NC=C(C=N1)C DOMQFIFVDIAOOT-ROUUACIJSA-N 0.000 description 1
- IUSARDYWEPUTPN-OZBXUNDUSA-N (2r)-n-[(2s,3r)-4-[[(4s)-6-(2,2-dimethylpropyl)spiro[3,4-dihydropyrano[2,3-b]pyridine-2,1'-cyclobutane]-4-yl]amino]-3-hydroxy-1-[3-(1,3-thiazol-2-yl)phenyl]butan-2-yl]-2-methoxypropanamide Chemical compound C([C@H](NC(=O)[C@@H](C)OC)[C@H](O)CN[C@@H]1C2=CC(CC(C)(C)C)=CN=C2OC2(CCC2)C1)C(C=1)=CC=CC=1C1=NC=CS1 IUSARDYWEPUTPN-OZBXUNDUSA-N 0.000 description 1
- YJLIKUSWRSEPSM-WGQQHEPDSA-N (2r,3r,4s,5r)-2-[6-amino-8-[(4-phenylphenyl)methylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol Chemical compound C=1C=C(C=2C=CC=CC=2)C=CC=1CNC1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O YJLIKUSWRSEPSM-WGQQHEPDSA-N 0.000 description 1
- VIJSPAIQWVPKQZ-BLECARSGSA-N (2s)-2-[[(2s)-2-[[(2s)-2-[[(2s)-2-[[(2s)-2-[[(2s)-2-acetamido-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylpentanoyl]amino]-4,4-dimethylpentanoyl]amino]-4-methylpentanoyl]amino]propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid Chemical compound NC(=N)NCCC[C@@H](C(O)=O)NC(=O)[C@H](C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(C)(C)C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCCNC(N)=N)NC(C)=O VIJSPAIQWVPKQZ-BLECARSGSA-N 0.000 description 1
- STBLNCCBQMHSRC-BATDWUPUSA-N (2s)-n-[(3s,4s)-5-acetyl-7-cyano-4-methyl-1-[(2-methylnaphthalen-1-yl)methyl]-2-oxo-3,4-dihydro-1,5-benzodiazepin-3-yl]-2-(methylamino)propanamide Chemical compound O=C1[C@@H](NC(=O)[C@H](C)NC)[C@H](C)N(C(C)=O)C2=CC(C#N)=CC=C2N1CC1=C(C)C=CC2=CC=CC=C12 STBLNCCBQMHSRC-BATDWUPUSA-N 0.000 description 1
- TWYYFYNJOJGNFP-CUXYNZQBSA-N (2s,4r,5s,6s)-2-[(4s,5r)-4-acetyloxy-5-methyl-3-methylidene-6-phenylhexyl]-2-carbamoyl-4-[[(e,4s,6s)-4,6-dimethyloct-2-enoyl]oxymethyl]-5-hydroxy-1,3-dioxane-4,5,6-tricarboxylic acid Chemical compound O1[C@H](C(O)=O)[C@](C(O)=O)(O)[C@](COC(=O)/C=C/[C@@H](C)C[C@@H](C)CC)(C(O)=O)O[C@]1(C(N)=O)CCC(=C)[C@@H](OC(C)=O)[C@H](C)CC1=CC=CC=C1 TWYYFYNJOJGNFP-CUXYNZQBSA-N 0.000 description 1
- HJBGZJMKTOMQRR-UHFFFAOYSA-N (3-formylphenyl)boronic acid Chemical compound OB(O)C1=CC=CC(C=O)=C1 HJBGZJMKTOMQRR-UHFFFAOYSA-N 0.000 description 1
- IWZSHWBGHQBIML-ZGGLMWTQSA-N (3S,8S,10R,13S,14S,17S)-17-isoquinolin-7-yl-N,N,10,13-tetramethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-amine Chemical compound CN(C)[C@H]1CC[C@]2(C)C3CC[C@@]4(C)[C@@H](CC[C@@H]4c4ccc5ccncc5c4)[C@@H]3CC=C2C1 IWZSHWBGHQBIML-ZGGLMWTQSA-N 0.000 description 1
- MPDDTAJMJCESGV-CTUHWIOQSA-M (3r,5r)-7-[2-(4-fluorophenyl)-5-[methyl-[(1r)-1-phenylethyl]carbamoyl]-4-propan-2-ylpyrazol-3-yl]-3,5-dihydroxyheptanoate Chemical compound C1([C@@H](C)N(C)C(=O)C2=NN(C(CC[C@@H](O)C[C@@H](O)CC([O-])=O)=C2C(C)C)C=2C=CC(F)=CC=2)=CC=CC=C1 MPDDTAJMJCESGV-CTUHWIOQSA-M 0.000 description 1
- UKGJZDSUJSPAJL-YPUOHESYSA-N (e)-n-[(1r)-1-[3,5-difluoro-4-(methanesulfonamido)phenyl]ethyl]-3-[2-propyl-6-(trifluoromethyl)pyridin-3-yl]prop-2-enamide Chemical compound CCCC1=NC(C(F)(F)F)=CC=C1\C=C\C(=O)N[C@H](C)C1=CC(F)=C(NS(C)(=O)=O)C(F)=C1 UKGJZDSUJSPAJL-YPUOHESYSA-N 0.000 description 1
- 125000005838 1,3-cyclopentylene group Chemical group [H]C1([H])C([H])([H])C([H])([*:2])C([H])([H])C1([H])[*:1] 0.000 description 1
- OGYGFUAIIOPWQD-UHFFFAOYSA-N 1,3-thiazolidine Chemical compound C1CSCN1 OGYGFUAIIOPWQD-UHFFFAOYSA-N 0.000 description 1
- MJUVRTYWUMPBTR-MRXNPFEDSA-N 1-(2,2-difluoro-1,3-benzodioxol-5-yl)-n-[1-[(2r)-2,3-dihydroxypropyl]-6-fluoro-2-(1-hydroxy-2-methylpropan-2-yl)indol-5-yl]cyclopropane-1-carboxamide Chemical compound FC=1C=C2N(C[C@@H](O)CO)C(C(C)(CO)C)=CC2=CC=1NC(=O)C1(C=2C=C3OC(F)(F)OC3=CC=2)CC1 MJUVRTYWUMPBTR-MRXNPFEDSA-N 0.000 description 1
- ASOKPJOREAFHNY-UHFFFAOYSA-N 1-Hydroxybenzotriazole Chemical compound C1=CC=C2N(O)N=NC2=C1 ASOKPJOREAFHNY-UHFFFAOYSA-N 0.000 description 1
- PVOAHINGSUIXLS-UHFFFAOYSA-N 1-Methylpiperazine Chemical compound CN1CCNCC1 PVOAHINGSUIXLS-UHFFFAOYSA-N 0.000 description 1
- IQXXEPZFOOTTBA-UHFFFAOYSA-N 1-benzylpiperazine Chemical compound C=1C=CC=CC=1CN1CCNCC1 IQXXEPZFOOTTBA-UHFFFAOYSA-N 0.000 description 1
- JEVLAMZYGHEJIS-UHFFFAOYSA-N 1-thiophen-2-ylsulfonylpiperazine Chemical compound C=1C=CSC=1S(=O)(=O)N1CCNCC1 JEVLAMZYGHEJIS-UHFFFAOYSA-N 0.000 description 1
- WJFKNYWRSNBZNX-UHFFFAOYSA-N 10H-phenothiazine Chemical compound C1=CC=C2NC3=CC=CC=C3SC2=C1 WJFKNYWRSNBZNX-UHFFFAOYSA-N 0.000 description 1
- TZMSYXZUNZXBOL-UHFFFAOYSA-N 10H-phenoxazine Chemical compound C1=CC=C2NC3=CC=CC=C3OC2=C1 TZMSYXZUNZXBOL-UHFFFAOYSA-N 0.000 description 1
- 238000001644 13C nuclear magnetic resonance spectroscopy Methods 0.000 description 1
- BAXOFTOLAUCFNW-UHFFFAOYSA-N 1H-indazole Chemical compound C1=CC=C2C=NNC2=C1 BAXOFTOLAUCFNW-UHFFFAOYSA-N 0.000 description 1
- VEPOHXYIFQMVHW-XOZOLZJESA-N 2,3-dihydroxybutanedioic acid (2S,3S)-3,4-dimethyl-2-phenylmorpholine Chemical compound OC(C(O)C(O)=O)C(O)=O.C[C@H]1[C@@H](OCCN1C)c1ccccc1 VEPOHXYIFQMVHW-XOZOLZJESA-N 0.000 description 1
- WOECBBNSPCDDQE-UHFFFAOYSA-N 2-[4-[4-(furan-2-yl)phenyl]sulfonylpiperazin-1-yl]-n-hydroxy-1,3-thiazole-5-carboxamide Chemical compound S1C(C(=O)NO)=CN=C1N1CCN(S(=O)(=O)C=2C=CC(=CC=2)C=2OC=CC=2)CC1 WOECBBNSPCDDQE-UHFFFAOYSA-N 0.000 description 1
- FDLFJMALQUAPDM-UHFFFAOYSA-N 2-ethyl-1-phenylpiperazine Chemical compound CCC1CNCCN1C1=CC=CC=C1 FDLFJMALQUAPDM-UHFFFAOYSA-N 0.000 description 1
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- VLRSADZEDXVUPG-UHFFFAOYSA-N 2-naphthalen-1-ylpyridine Chemical compound N1=CC=CC=C1C1=CC=CC2=CC=CC=C12 VLRSADZEDXVUPG-UHFFFAOYSA-N 0.000 description 1
- 125000001622 2-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C(*)C([H])=C([H])C2=C1[H] 0.000 description 1
- VMZCDNSFRSVYKQ-UHFFFAOYSA-N 2-phenylacetyl chloride Chemical compound ClC(=O)CC1=CC=CC=C1 VMZCDNSFRSVYKQ-UHFFFAOYSA-N 0.000 description 1
- WFCSWCVEJLETKA-UHFFFAOYSA-N 2-piperazin-1-ylethanol Chemical compound OCCN1CCNCC1 WFCSWCVEJLETKA-UHFFFAOYSA-N 0.000 description 1
- JMTMSDXUXJISAY-UHFFFAOYSA-N 2H-benzotriazol-4-ol Chemical compound OC1=CC=CC2=C1N=NN2 JMTMSDXUXJISAY-UHFFFAOYSA-N 0.000 description 1
- VHMICKWLTGFITH-UHFFFAOYSA-N 2H-isoindole Chemical compound C1=CC=CC2=CNC=C21 VHMICKWLTGFITH-UHFFFAOYSA-N 0.000 description 1
- YGYGASJNJTYNOL-CQSZACIVSA-N 3-[(4r)-2,2-dimethyl-1,1-dioxothian-4-yl]-5-(4-fluorophenyl)-1h-indole-7-carboxamide Chemical compound C1CS(=O)(=O)C(C)(C)C[C@@H]1C1=CNC2=C(C(N)=O)C=C(C=3C=CC(F)=CC=3)C=C12 YGYGASJNJTYNOL-CQSZACIVSA-N 0.000 description 1
- ALFPDTHZOVXWLS-UHFFFAOYSA-N 3-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]-1h-1,2,4-triazole-5-carboxylic acid Chemical compound C1CN(C(=O)OC(C)(C)C)CCN1C1=NN=C(C(O)=O)N1 ALFPDTHZOVXWLS-UHFFFAOYSA-N 0.000 description 1
- MVRGLMCHDCMPKD-UHFFFAOYSA-N 3-amino-1h-1,2,4-triazole-5-carboxylic acid Chemical compound NC1=NNC(C(O)=O)=N1 MVRGLMCHDCMPKD-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- CBKDCOKSXCTDAA-UHFFFAOYSA-N 4,5,6,7-tetrahydro-1-benzothiophene Chemical compound C1CCCC2=C1C=CS2 CBKDCOKSXCTDAA-UHFFFAOYSA-N 0.000 description 1
- VJPPLCNBDLZIFG-ZDUSSCGKSA-N 4-[(3S)-3-(but-2-ynoylamino)piperidin-1-yl]-5-fluoro-2,3-dimethyl-1H-indole-7-carboxamide Chemical compound C(C#CC)(=O)N[C@@H]1CN(CCC1)C1=C2C(=C(NC2=C(C=C1F)C(=O)N)C)C VJPPLCNBDLZIFG-ZDUSSCGKSA-N 0.000 description 1
- XYWIPYBIIRTJMM-IBGZPJMESA-N 4-[[(2S)-2-[4-[5-chloro-2-[4-(trifluoromethyl)triazol-1-yl]phenyl]-5-methoxy-2-oxopyridin-1-yl]butanoyl]amino]-2-fluorobenzamide Chemical compound CC[C@H](N1C=C(OC)C(=CC1=O)C1=C(C=CC(Cl)=C1)N1C=C(N=N1)C(F)(F)F)C(=O)NC1=CC(F)=C(C=C1)C(N)=O XYWIPYBIIRTJMM-IBGZPJMESA-N 0.000 description 1
- FXVDNCRTKXMSEZ-UHFFFAOYSA-N 4-acetylbenzenesulfonyl chloride Chemical compound CC(=O)C1=CC=C(S(Cl)(=O)=O)C=C1 FXVDNCRTKXMSEZ-UHFFFAOYSA-N 0.000 description 1
- POXFXTSTVWDWIR-UHFFFAOYSA-N 4-iodobenzenesulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=C(I)C=C1 POXFXTSTVWDWIR-UHFFFAOYSA-N 0.000 description 1
- 125000004195 4-methylpiperazin-1-yl group Chemical group [H]C([H])([H])N1C([H])([H])C([H])([H])N(*)C([H])([H])C1([H])[H] 0.000 description 1
- ALBQXDHCMLLQMB-UHFFFAOYSA-N 4-phenylbenzenesulfonyl chloride Chemical compound C1=CC(S(=O)(=O)Cl)=CC=C1C1=CC=CC=C1 ALBQXDHCMLLQMB-UHFFFAOYSA-N 0.000 description 1
- GDRVFDDBLLKWRI-UHFFFAOYSA-N 4H-quinolizine Chemical compound C1=CC=CN2CC=CC=C21 GDRVFDDBLLKWRI-UHFFFAOYSA-N 0.000 description 1
- KUZSBKJSGSKPJH-VXGBXAGGSA-N 5-[(9R)-6-[(3R)-3-methylmorpholin-4-yl]-11-oxa-1,3,5-triazatricyclo[7.4.0.02,7]trideca-2,4,6-trien-4-yl]pyrazin-2-amine Chemical compound C[C@@H]1COCCN1c1nc(nc2N3CCOC[C@H]3Cc12)-c1cnc(N)cn1 KUZSBKJSGSKPJH-VXGBXAGGSA-N 0.000 description 1
- PDLIDTOGYMYMLD-UHFFFAOYSA-N 5-bromo-1h-1,2,4-triazole-3-carboxylic acid Chemical compound OC(=O)C1=NN=C(Br)N1 PDLIDTOGYMYMLD-UHFFFAOYSA-N 0.000 description 1
- GFBVUFQNHLUCPX-UHFFFAOYSA-N 5-bromothiophene-2-carbaldehyde Chemical compound BrC1=CC=C(C=O)S1 GFBVUFQNHLUCPX-UHFFFAOYSA-N 0.000 description 1
- ZKLBPUYMTHPNOQ-UHFFFAOYSA-N 5-bromothiophene-3-carbaldehyde Chemical compound BrC1=CC(C=O)=CS1 ZKLBPUYMTHPNOQ-UHFFFAOYSA-N 0.000 description 1
- UNQYAAAWKOOBFQ-UHFFFAOYSA-N 7-[(4-chlorophenyl)methyl]-8-[4-chloro-3-(trifluoromethoxy)phenoxy]-1-(3-hydroxypropyl)-3-methylpurine-2,6-dione Chemical compound C=1C=C(Cl)C=CC=1CN1C=2C(=O)N(CCCO)C(=O)N(C)C=2N=C1OC1=CC=C(Cl)C(OC(F)(F)F)=C1 UNQYAAAWKOOBFQ-UHFFFAOYSA-N 0.000 description 1
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 1
- ZRPZPNYZFSJUPA-UHFFFAOYSA-N ARS-1620 Chemical compound Oc1cccc(F)c1-c1c(Cl)cc2c(ncnc2c1F)N1CCN(CC1)C(=O)C=C ZRPZPNYZFSJUPA-UHFFFAOYSA-N 0.000 description 1
- 244000215068 Acacia senegal Species 0.000 description 1
- 235000006491 Acacia senegal Nutrition 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- 238000012935 Averaging Methods 0.000 description 1
- 108091003079 Bovine Serum Albumin Proteins 0.000 description 1
- 101100314454 Caenorhabditis elegans tra-1 gene Proteins 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- 108010077544 Chromatin Proteins 0.000 description 1
- 229940127007 Compound 39 Drugs 0.000 description 1
- 102000002004 Cytochrome P-450 Enzyme System Human genes 0.000 description 1
- 108010015742 Cytochrome P-450 Enzyme System Proteins 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- 102000053602 DNA Human genes 0.000 description 1
- 102000003915 DNA Topoisomerases Human genes 0.000 description 1
- 108090000323 DNA Topoisomerases Proteins 0.000 description 1
- 230000007067 DNA methylation Effects 0.000 description 1
- 231100001074 DNA strand break Toxicity 0.000 description 1
- 230000006820 DNA synthesis Effects 0.000 description 1
- XPDXVDYUQZHFPV-UHFFFAOYSA-N Dansyl Chloride Chemical compound C1=CC=C2C(N(C)C)=CC=CC2=C1S(Cl)(=O)=O XPDXVDYUQZHFPV-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- YXHKONLOYHBTNS-UHFFFAOYSA-N Diazomethane Chemical compound C=[N+]=[N-] YXHKONLOYHBTNS-UHFFFAOYSA-N 0.000 description 1
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 1
- DNXHEGUUPJUMQT-CBZIJGRNSA-N Estrone Chemical compound OC1=CC=C2[C@H]3CC[C@](C)(C(CC4)=O)[C@@H]4[C@@H]3CCC2=C1 DNXHEGUUPJUMQT-CBZIJGRNSA-N 0.000 description 1
- 239000001653 FEMA 3120 Substances 0.000 description 1
- 241000233866 Fungi Species 0.000 description 1
- 230000010190 G1 phase Effects 0.000 description 1
- 230000010337 G2 phase Effects 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- XDXDZDZNSLXDNA-TZNDIEGXSA-N Idarubicin Chemical compound C1[C@H](N)[C@H](O)[C@H](C)O[C@H]1O[C@@H]1C2=C(O)C(C(=O)C3=CC=CC=C3C3=O)=C3C(O)=C2C[C@@](O)(C(C)=O)C1 XDXDZDZNSLXDNA-TZNDIEGXSA-N 0.000 description 1
- XDXDZDZNSLXDNA-UHFFFAOYSA-N Idarubicin Natural products C1C(N)C(O)C(C)OC1OC1C2=C(O)C(C(=O)C3=CC=CC=C3C3=O)=C3C(O)=C2CC(O)(C(C)=O)C1 XDXDZDZNSLXDNA-UHFFFAOYSA-N 0.000 description 1
- WRYCSMQKUKOKBP-UHFFFAOYSA-N Imidazolidine Chemical compound C1CNCN1 WRYCSMQKUKOKBP-UHFFFAOYSA-N 0.000 description 1
- 206010061218 Inflammation Diseases 0.000 description 1
- ZDXPYRJPNDTMRX-VKHMYHEASA-N L-glutamine Chemical compound OC(=O)[C@@H](N)CCC(N)=O ZDXPYRJPNDTMRX-VKHMYHEASA-N 0.000 description 1
- 229930182816 L-glutamine Natural products 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- 102000016397 Methyltransferase Human genes 0.000 description 1
- 108060004795 Methyltransferase Proteins 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- FEYNFHSRETUBEM-UHFFFAOYSA-N N-[3-(1,1-difluoroethyl)phenyl]-1-(4-methoxyphenyl)-3-methyl-5-oxo-4H-pyrazole-4-carboxamide Chemical compound COc1ccc(cc1)N1N=C(C)C(C(=O)Nc2cccc(c2)C(C)(F)F)C1=O FEYNFHSRETUBEM-UHFFFAOYSA-N 0.000 description 1
- 238000005481 NMR spectroscopy Methods 0.000 description 1
- 239000007832 Na2SO4 Substances 0.000 description 1
- ZNSPHKJFQDEABI-NZQKXSOJSA-N Nc1nc(O[C@H](c2ccc(Cl)cc2-c2ccccc2)C(F)(F)F)cc(n1)N1CCC2(CN[C@@H](C2)C(O)=O)CC1 Chemical compound Nc1nc(O[C@H](c2ccc(Cl)cc2-c2ccccc2)C(F)(F)F)cc(n1)N1CCC2(CN[C@@H](C2)C(O)=O)CC1 ZNSPHKJFQDEABI-NZQKXSOJSA-N 0.000 description 1
- 206010029113 Neovascularisation Diseases 0.000 description 1
- 241000060390 Nothapodytes nimmoniana Species 0.000 description 1
- XSBMWMMFTITQEA-UHFFFAOYSA-N ONC(=O)C1=CN=C(S1)N1CCN(CC1)S(=O)(=O)C1=CC=CC=C1.ONC(=O)C1=CN=C(S1)N1CCN(CC1)S(=O)(=O)C1=CC=C(C=C1)C(C)=O Chemical compound ONC(=O)C1=CN=C(S1)N1CCN(CC1)S(=O)(=O)C1=CC=CC=C1.ONC(=O)C1=CN=C(S1)N1CCN(CC1)S(=O)(=O)C1=CC=C(C=C1)C(C)=O XSBMWMMFTITQEA-UHFFFAOYSA-N 0.000 description 1
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 1
- ZCQWOFVYLHDMMC-UHFFFAOYSA-N Oxazole Chemical compound C1=COC=N1 ZCQWOFVYLHDMMC-UHFFFAOYSA-N 0.000 description 1
- 201000010183 Papilledema Diseases 0.000 description 1
- 235000019483 Peanut oil Nutrition 0.000 description 1
- YNPNZTXNASCQKK-UHFFFAOYSA-N Phenanthrene Natural products C1=CC=C2C3=CC=CC=C3C=CC2=C1 YNPNZTXNASCQKK-UHFFFAOYSA-N 0.000 description 1
- 108091000080 Phosphotransferase Proteins 0.000 description 1
- 244000236480 Podophyllum peltatum Species 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-N Propionic acid Chemical compound CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 1
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 1
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 1
- 108020004511 Recombinant DNA Proteins 0.000 description 1
- 206010038886 Retinal oedema Diseases 0.000 description 1
- 206010038933 Retinopathy of prematurity Diseases 0.000 description 1
- 229920001800 Shellac Polymers 0.000 description 1
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical class [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 108700025695 Suppressor Genes Proteins 0.000 description 1
- 239000004098 Tetracycline Substances 0.000 description 1
- 101710183280 Topoisomerase Proteins 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- 239000007983 Tris buffer Substances 0.000 description 1
- 229910052770 Uranium Inorganic materials 0.000 description 1
- 206010054880 Vascular insufficiency Diseases 0.000 description 1
- 241000863480 Vinca Species 0.000 description 1
- 235000004552 Yucca aloifolia Nutrition 0.000 description 1
- 235000012044 Yucca brevifolia Nutrition 0.000 description 1
- 244000149006 Yucca filamentosa Species 0.000 description 1
- 235000017049 Yucca glauca Nutrition 0.000 description 1
- KSQVGVMZECCPAT-AEFFLSMTSA-N [(1R)-4-phenyl-1-[[(2R)-2-(pyrazine-2-carbonylamino)pentanoyl]amino]butyl]boronic acid Chemical compound B([C@H](CCCC1=CC=CC=C1)NC(=O)[C@@H](CCC)NC(=O)C2=NC=CN=C2)(O)O KSQVGVMZECCPAT-AEFFLSMTSA-N 0.000 description 1
- SPXSEZMVRJLHQG-XMMPIXPASA-N [(2R)-1-[[4-[(3-phenylmethoxyphenoxy)methyl]phenyl]methyl]pyrrolidin-2-yl]methanol Chemical compound C(C1=CC=CC=C1)OC=1C=C(OCC2=CC=C(CN3[C@H](CCC3)CO)C=C2)C=CC=1 SPXSEZMVRJLHQG-XMMPIXPASA-N 0.000 description 1
- PSLUFJFHTBIXMW-WYEYVKMPSA-N [(3r,4ar,5s,6s,6as,10s,10ar,10bs)-3-ethenyl-10,10b-dihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-6-(2-pyridin-2-ylethylcarbamoyloxy)-5,6,6a,8,9,10-hexahydro-2h-benzo[f]chromen-5-yl] acetate Chemical compound O([C@@H]1[C@@H]([C@]2(O[C@](C)(CC(=O)[C@]2(O)[C@@]2(C)[C@@H](O)CCC(C)(C)[C@@H]21)C=C)C)OC(=O)C)C(=O)NCCC1=CC=CC=N1 PSLUFJFHTBIXMW-WYEYVKMPSA-N 0.000 description 1
- VTCQEGLKZJGISL-UHFFFAOYSA-N [2-(4-fluorophenyl)phenyl]boronic acid Chemical compound OB(O)C1=CC=CC=C1C1=CC=C(F)C=C1 VTCQEGLKZJGISL-UHFFFAOYSA-N 0.000 description 1
- 230000005856 abnormality Effects 0.000 description 1
- 238000002835 absorbance Methods 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 229940081735 acetylcellulose Drugs 0.000 description 1
- 239000011149 active material Substances 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 125000004423 acyloxy group Chemical group 0.000 description 1
- 125000005073 adamantyl group Chemical group C12(CC3CC(CC(C1)C3)C2)* 0.000 description 1
- 230000001919 adrenal effect Effects 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 125000003172 aldehyde group Chemical group 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229930013930 alkaloid Natural products 0.000 description 1
- 150000003797 alkaloid derivatives Chemical class 0.000 description 1
- 125000003282 alkyl amino group Chemical group 0.000 description 1
- 230000002152 alkylating effect Effects 0.000 description 1
- IYABWNGZIDDRAK-UHFFFAOYSA-N allene Chemical group C=C=C IYABWNGZIDDRAK-UHFFFAOYSA-N 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- IMUDHTPIFIBORV-UHFFFAOYSA-N aminoethylpiperazine Chemical compound NCCN1CCNCC1 IMUDHTPIFIBORV-UHFFFAOYSA-N 0.000 description 1
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 230000003321 amplification Effects 0.000 description 1
- 210000003484 anatomy Anatomy 0.000 description 1
- 239000003098 androgen Substances 0.000 description 1
- 229940030486 androgens Drugs 0.000 description 1
- AEMFNILZOJDQLW-QAGGRKNESA-N androst-4-ene-3,17-dione Chemical compound O=C1CC[C@]2(C)[C@H]3CC[C@](C)(C(CC4)=O)[C@@H]4[C@@H]3CCC2=C1 AEMFNILZOJDQLW-QAGGRKNESA-N 0.000 description 1
- 229960005471 androstenedione Drugs 0.000 description 1
- AEMFNILZOJDQLW-UHFFFAOYSA-N androstenedione Natural products O=C1CCC2(C)C3CCC(C)(C(CC4)=O)C4C3CCC2=C1 AEMFNILZOJDQLW-UHFFFAOYSA-N 0.000 description 1
- 239000005557 antagonist Substances 0.000 description 1
- 125000005428 anthryl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C3C(*)=C([H])C([H])=C([H])C3=C([H])C2=C1[H] 0.000 description 1
- 239000003242 anti bacterial agent Substances 0.000 description 1
- 230000001028 anti-proliverative effect Effects 0.000 description 1
- 229940088710 antibiotic agent Drugs 0.000 description 1
- 229940045719 antineoplastic alkylating agent nitrosoureas Drugs 0.000 description 1
- 229940045696 antineoplastic drug podophyllotoxin derivative Drugs 0.000 description 1
- 238000003782 apoptosis assay Methods 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000003125 aqueous solvent Substances 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 239000012131 assay buffer Substances 0.000 description 1
- HONIICLYMWZJFZ-UHFFFAOYSA-N azetidine Chemical compound C1CNC1 HONIICLYMWZJFZ-UHFFFAOYSA-N 0.000 description 1
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- 150000005347 biaryls Chemical group 0.000 description 1
- 239000003181 biological factor Substances 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- 210000004556 brain Anatomy 0.000 description 1
- 230000005587 bubbling Effects 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 229910000389 calcium phosphate Inorganic materials 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- 239000000378 calcium silicate Substances 0.000 description 1
- 229910052918 calcium silicate Inorganic materials 0.000 description 1
- 229960003340 calcium silicate Drugs 0.000 description 1
- 235000012241 calcium silicate Nutrition 0.000 description 1
- OYACROKNLOSFPA-UHFFFAOYSA-N calcium;dioxido(oxo)silane Chemical compound [Ca+2].[O-][Si]([O-])=O OYACROKNLOSFPA-UHFFFAOYSA-N 0.000 description 1
- 201000011510 cancer Diseases 0.000 description 1
- 125000002837 carbocyclic group Chemical group 0.000 description 1
- 150000001718 carbodiimides Chemical class 0.000 description 1
- 150000001722 carbon compounds Chemical class 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 230000006369 cell cycle progression Effects 0.000 description 1
- 230000011712 cell development Effects 0.000 description 1
- 230000032823 cell division Effects 0.000 description 1
- 230000003915 cell function Effects 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- 210000004289 cerebral ventricle Anatomy 0.000 description 1
- 229960000541 cetyl alcohol Drugs 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- DGLFSNZWRYADFC-UHFFFAOYSA-N chembl2334586 Chemical compound C1CCC2=CN=C(N)N=C2C2=C1NC1=CC=C(C#CC(C)(O)C)C=C12 DGLFSNZWRYADFC-UHFFFAOYSA-N 0.000 description 1
- 238000010568 chiral column chromatography Methods 0.000 description 1
- 210000003483 chromatin Anatomy 0.000 description 1
- WCZVZNOTHYJIEI-UHFFFAOYSA-N cinnoline Chemical compound N1=NC=CC2=CC=CC=C21 WCZVZNOTHYJIEI-UHFFFAOYSA-N 0.000 description 1
- DQLATGHUWYMOKM-UHFFFAOYSA-L cisplatin Chemical compound N[Pt](N)(Cl)Cl DQLATGHUWYMOKM-UHFFFAOYSA-L 0.000 description 1
- 229960004316 cisplatin Drugs 0.000 description 1
- 238000010367 cloning Methods 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 239000003240 coconut oil Substances 0.000 description 1
- 235000019864 coconut oil Nutrition 0.000 description 1
- 230000002860 competitive effect Effects 0.000 description 1
- 229940125876 compound 15a Drugs 0.000 description 1
- 229940126214 compound 3 Drugs 0.000 description 1
- 229940125878 compound 36 Drugs 0.000 description 1
- 229940125807 compound 37 Drugs 0.000 description 1
- 229940127573 compound 38 Drugs 0.000 description 1
- 229940127271 compound 49 Drugs 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 230000002596 correlated effect Effects 0.000 description 1
- 235000012343 cottonseed oil Nutrition 0.000 description 1
- 239000002385 cottonseed oil Substances 0.000 description 1
- 239000013058 crude material Substances 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- SSJXIUAHEKJCMH-UHFFFAOYSA-N cyclohexane-1,2-diamine Chemical compound NC1CCCCC1N SSJXIUAHEKJCMH-UHFFFAOYSA-N 0.000 description 1
- VKIRRGRTJUUZHS-UHFFFAOYSA-N cyclohexane-1,4-diamine Chemical compound NC1CCC(N)CC1 VKIRRGRTJUUZHS-UHFFFAOYSA-N 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- WPJRFCZKZXBUNI-HCWXCVPCSA-N daunosamine Chemical compound C[C@H](O)[C@@H](O)[C@@H](N)CC=O WPJRFCZKZXBUNI-HCWXCVPCSA-N 0.000 description 1
- DEZRYPDIMOWBDS-UHFFFAOYSA-N dcm dichloromethane Chemical compound ClCCl.ClCCl DEZRYPDIMOWBDS-UHFFFAOYSA-N 0.000 description 1
- 230000003413 degradative effect Effects 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 239000008121 dextrose Substances 0.000 description 1
- 125000004663 dialkyl amino group Chemical group 0.000 description 1
- YNHIGQDRGKUECZ-UHFFFAOYSA-N dichloropalladium;triphenylphosphanium Chemical compound Cl[Pd]Cl.C1=CC=CC=C1[PH+](C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1[PH+](C=1C=CC=CC=1)C1=CC=CC=C1 YNHIGQDRGKUECZ-UHFFFAOYSA-N 0.000 description 1
- UXGNZZKBCMGWAZ-UHFFFAOYSA-N dimethylformamide dmf Chemical compound CN(C)C=O.CN(C)C=O UXGNZZKBCMGWAZ-UHFFFAOYSA-N 0.000 description 1
- 229910001873 dinitrogen Inorganic materials 0.000 description 1
- 230000008034 disappearance Effects 0.000 description 1
- CETRZFQIITUQQL-UHFFFAOYSA-N dmso dimethylsulfoxide Chemical compound CS(C)=O.CS(C)=O CETRZFQIITUQQL-UHFFFAOYSA-N 0.000 description 1
- 229940000406 drug candidate Drugs 0.000 description 1
- 238000012377 drug delivery Methods 0.000 description 1
- 238000007876 drug discovery Methods 0.000 description 1
- 229940112141 dry powder inhaler Drugs 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 210000001198 duodenum Anatomy 0.000 description 1
- 239000008157 edible vegetable oil Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 239000002702 enteric coating Substances 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 239000000328 estrogen antagonist Substances 0.000 description 1
- 229960003399 estrone Drugs 0.000 description 1
- AEOCXXJPGCBFJA-UHFFFAOYSA-N ethionamide Chemical compound CCC1=CC(C(N)=S)=CC=N1 AEOCXXJPGCBFJA-UHFFFAOYSA-N 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- XOTUBRNKFXTMTR-UHFFFAOYSA-N ethyl 2-piperazin-1-yl-1,3-thiazole-5-carboxylate Chemical compound S1C(C(=O)OCC)=CN=C1N1CCNCC1 XOTUBRNKFXTMTR-UHFFFAOYSA-N 0.000 description 1
- OJCSPXHYDFONPU-UHFFFAOYSA-N etoac etoac Chemical compound CCOC(C)=O.CCOC(C)=O OJCSPXHYDFONPU-UHFFFAOYSA-N 0.000 description 1
- 230000005284 excitation Effects 0.000 description 1
- 239000003777 experimental drug Substances 0.000 description 1
- 239000012091 fetal bovine serum Substances 0.000 description 1
- 239000012054 flavored emulsion Substances 0.000 description 1
- 235000020375 flavoured syrup Nutrition 0.000 description 1
- 235000013355 food flavoring agent Nutrition 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- 230000006870 function Effects 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 229940014259 gelatin Drugs 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 239000008240 homogeneous mixture Substances 0.000 description 1
- 229940088597 hormone Drugs 0.000 description 1
- 239000005556 hormone Substances 0.000 description 1
- 230000006607 hypermethylation Effects 0.000 description 1
- 239000000819 hypertonic solution Substances 0.000 description 1
- 229940021223 hypertonic solution Drugs 0.000 description 1
- 229960000908 idarubicin Drugs 0.000 description 1
- MTNDZQHUAFNZQY-UHFFFAOYSA-N imidazoline Chemical compound C1CN=CN1 MTNDZQHUAFNZQY-UHFFFAOYSA-N 0.000 description 1
- PZOUSPYUWWUPPK-UHFFFAOYSA-N indole Natural products CC1=CC=CC2=C1C=CN2 PZOUSPYUWWUPPK-UHFFFAOYSA-N 0.000 description 1
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine Natural products C1=CC=C2CC=NC2=C1 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 description 1
- LPAGFVYQRIESJQ-UHFFFAOYSA-N indoline Chemical compound C1=CC=C2NCCC2=C1 LPAGFVYQRIESJQ-UHFFFAOYSA-N 0.000 description 1
- HOBCFUWDNJPFHB-UHFFFAOYSA-N indolizine Chemical compound C1=CC=CN2C=CC=C21 HOBCFUWDNJPFHB-UHFFFAOYSA-N 0.000 description 1
- 125000003406 indolizinyl group Chemical group C=1(C=CN2C=CC=CC12)* 0.000 description 1
- 125000001041 indolyl group Chemical group 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 230000003834 intracellular effect Effects 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 208000032839 leukemia Diseases 0.000 description 1
- 230000000670 limiting effect Effects 0.000 description 1
- 125000005647 linker group Chemical group 0.000 description 1
- 150000002632 lipids Chemical class 0.000 description 1
- 238000004811 liquid chromatography Methods 0.000 description 1
- 239000011344 liquid material Substances 0.000 description 1
- 210000004185 liver Anatomy 0.000 description 1
- 239000007937 lozenge Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 125000003588 lysine group Chemical group [H]N([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])(N([H])[H])C(*)=O 0.000 description 1
- 229920002521 macromolecule Polymers 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 230000010534 mechanism of action Effects 0.000 description 1
- HAWPXGHAZFHHAD-UHFFFAOYSA-N mechlorethamine Chemical class ClCCN(C)CCCl HAWPXGHAZFHHAD-UHFFFAOYSA-N 0.000 description 1
- 229960004961 mechlorethamine Drugs 0.000 description 1
- LULAYUGMBFYYEX-UHFFFAOYSA-N metachloroperbenzoic acid Natural products OC(=O)C1=CC=CC(Cl)=C1 LULAYUGMBFYYEX-UHFFFAOYSA-N 0.000 description 1
- RWNSNWYEEZNILF-UHFFFAOYSA-N methyl 2-(4-benzoylpiperazin-1-yl)-1,3-thiazole-5-carboxylate Chemical compound S1C(C(=O)OC)=CN=C1N1CCN(C(=O)C=2C=CC=CC=2)CC1 RWNSNWYEEZNILF-UHFFFAOYSA-N 0.000 description 1
- AHBGQWZTGIEBBX-UHFFFAOYSA-N methyl 2-(4-benzylpiperazin-1-yl)-1,3-thiazole-5-carboxylate Chemical compound S1C(C(=O)OC)=CN=C1N1CCN(CC=2C=CC=CC=2)CC1 AHBGQWZTGIEBBX-UHFFFAOYSA-N 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 230000011987 methylation Effects 0.000 description 1
- 238000007069 methylation reaction Methods 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 238000003801 milling Methods 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 125000002757 morpholinyl group Chemical group 0.000 description 1
- NNKPHNTWNILINE-UHFFFAOYSA-N n-cyclopropyl-3-fluoro-4-methyl-5-[3-[[1-[2-[2-(methylamino)ethoxy]phenyl]cyclopropyl]amino]-2-oxopyrazin-1-yl]benzamide Chemical compound CNCCOC1=CC=CC=C1C1(NC=2C(N(C=3C(=C(F)C=C(C=3)C(=O)NC3CC3)C)C=CN=2)=O)CC1 NNKPHNTWNILINE-UHFFFAOYSA-N 0.000 description 1
- JGJAAYLZVQLUMB-UHFFFAOYSA-N n-hydroxy-2-[4-(4-propylphenyl)sulfonylpiperazin-1-yl]-1,3-thiazole-5-carboxamide Chemical compound C1=CC(CCC)=CC=C1S(=O)(=O)N1CCN(C=2SC(=CN=2)C(=O)NO)CC1 JGJAAYLZVQLUMB-UHFFFAOYSA-N 0.000 description 1
- FVNSAYDJOVKNGW-UHFFFAOYSA-N n-hydroxy-2-[4-(trifluoromethylsulfonyl)piperazin-1-yl]-1,3-thiazole-5-carboxamide Chemical compound S1C(C(=O)NO)=CN=C1N1CCN(S(=O)(=O)C(F)(F)F)CC1 FVNSAYDJOVKNGW-UHFFFAOYSA-N 0.000 description 1
- HSNLGFIDEBTSFY-UHFFFAOYSA-N n-hydroxy-2-[4-[2-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]-1,3-thiazole-5-carboxamide Chemical compound S1C(C(=O)NO)=CN=C1N1CCN(S(=O)(=O)C=2C(=CC=CC=2)C(F)(F)F)CC1 HSNLGFIDEBTSFY-UHFFFAOYSA-N 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000002105 nanoparticle Substances 0.000 description 1
- 230000009826 neoplastic cell growth Effects 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- OSTGTTZJOCZWJG-UHFFFAOYSA-N nitrosourea Chemical compound NC(=O)N=NO OSTGTTZJOCZWJG-UHFFFAOYSA-N 0.000 description 1
- 238000003199 nucleic acid amplification method Methods 0.000 description 1
- NLXXVSKHVGDQAT-UHFFFAOYSA-N o-(oxan-2-yl)hydroxylamine Chemical compound NOC1CCCCO1 NLXXVSKHVGDQAT-UHFFFAOYSA-N 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 239000012053 oil suspension Substances 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- PIDFDZJZLOTZTM-KHVQSSSXSA-N ombitasvir Chemical compound COC(=O)N[C@@H](C(C)C)C(=O)N1CCC[C@H]1C(=O)NC1=CC=C([C@H]2N([C@@H](CC2)C=2C=CC(NC(=O)[C@H]3N(CCC3)C(=O)[C@@H](NC(=O)OC)C(C)C)=CC=2)C=2C=CC(=CC=2)C(C)(C)C)C=C1 PIDFDZJZLOTZTM-KHVQSSSXSA-N 0.000 description 1
- 238000005457 optimization Methods 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 238000006053 organic reaction Methods 0.000 description 1
- 230000002611 ovarian Effects 0.000 description 1
- WCPAKWJPBJAGKN-UHFFFAOYSA-N oxadiazole Chemical compound C1=CON=N1 WCPAKWJPBJAGKN-UHFFFAOYSA-N 0.000 description 1
- 229910003445 palladium oxide Inorganic materials 0.000 description 1
- LXNAVEXFUKBNMK-UHFFFAOYSA-N palladium(II) acetate Substances [Pd].CC(O)=O.CC(O)=O LXNAVEXFUKBNMK-UHFFFAOYSA-N 0.000 description 1
- JQPTYAILLJKUCY-UHFFFAOYSA-N palladium(ii) oxide Chemical compound [O-2].[Pd+2] JQPTYAILLJKUCY-UHFFFAOYSA-N 0.000 description 1
- 239000000312 peanut oil Substances 0.000 description 1
- 230000002093 peripheral effect Effects 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 230000009038 pharmacological inhibition Effects 0.000 description 1
- 229950000688 phenothiazine Drugs 0.000 description 1
- 125000002467 phosphate group Chemical group [H]OP(=O)(O[H])O[*] 0.000 description 1
- CYQAYERJWZKYML-UHFFFAOYSA-N phosphorus pentasulfide Chemical compound S1P(S2)(=S)SP3(=S)SP1(=S)SP2(=S)S3 CYQAYERJWZKYML-UHFFFAOYSA-N 0.000 description 1
- 102000020233 phosphotransferase Human genes 0.000 description 1
- LFSXCDWNBUNEEM-UHFFFAOYSA-N phthalazine Chemical compound C1=NN=CC2=CC=CC=C21 LFSXCDWNBUNEEM-UHFFFAOYSA-N 0.000 description 1
- XKJCHHZQLQNZHY-UHFFFAOYSA-N phthalimide Chemical compound C1=CC=C2C(=O)NC(=O)C2=C1 XKJCHHZQLQNZHY-UHFFFAOYSA-N 0.000 description 1
- 230000004962 physiological condition Effects 0.000 description 1
- LWMPFIOTEAXAGV-UHFFFAOYSA-N piperidin-1-amine Chemical compound NN1CCCCC1 LWMPFIOTEAXAGV-UHFFFAOYSA-N 0.000 description 1
- PEUGKEHLRUVPAN-UHFFFAOYSA-N piperidin-3-amine Chemical compound NC1CCCNC1 PEUGKEHLRUVPAN-UHFFFAOYSA-N 0.000 description 1
- BCIIMDOZSUCSEN-UHFFFAOYSA-N piperidin-4-amine Chemical compound NC1CCNCC1 BCIIMDOZSUCSEN-UHFFFAOYSA-N 0.000 description 1
- LTEKQAPRXFBRNN-UHFFFAOYSA-N piperidin-4-ylmethanamine Chemical compound NCC1CCNCC1 LTEKQAPRXFBRNN-UHFFFAOYSA-N 0.000 description 1
- 239000003600 podophyllotoxin derivative Substances 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- LZMJNVRJMFMYQS-UHFFFAOYSA-N poseltinib Chemical compound C1CN(C)CCN1C(C=C1)=CC=C1NC1=NC(OC=2C=C(NC(=O)C=C)C=CC=2)=C(OC=C2)C2=N1 LZMJNVRJMFMYQS-UHFFFAOYSA-N 0.000 description 1
- 238000000524 positive electrospray ionisation mass spectrometry Methods 0.000 description 1
- 230000004481 post-translational protein modification Effects 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 150000003141 primary amines Chemical group 0.000 description 1
- 238000004393 prognosis Methods 0.000 description 1
- 230000005522 programmed cell death Effects 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 description 1
- KNNLWVUFUIAFJW-UHFFFAOYSA-N propyl benzenecarboperoxoate Chemical class CCCOOC(=O)C1=CC=CC=C1 KNNLWVUFUIAFJW-UHFFFAOYSA-N 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 238000000425 proton nuclear magnetic resonance spectrum Methods 0.000 description 1
- CPNGPNLZQNNVQM-UHFFFAOYSA-N pteridine Chemical compound N1=CN=CC2=NC=CN=C21 CPNGPNLZQNNVQM-UHFFFAOYSA-N 0.000 description 1
- 230000000541 pulsatile effect Effects 0.000 description 1
- 239000008213 purified water Substances 0.000 description 1
- PBMFSQRYOILNGV-UHFFFAOYSA-N pyridazine Chemical compound C1=CC=NN=C1 PBMFSQRYOILNGV-UHFFFAOYSA-N 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- AUKXFNABVHIUAC-UHFFFAOYSA-N pyrrolidin-2-ylmethylamine Chemical compound NCC1CCCN1 AUKXFNABVHIUAC-UHFFFAOYSA-N 0.000 description 1
- NGXSWUFDCSEIOO-UHFFFAOYSA-N pyrrolidin-3-amine Chemical compound NC1CCNC1 NGXSWUFDCSEIOO-UHFFFAOYSA-N 0.000 description 1
- 125000000168 pyrrolyl group Chemical group 0.000 description 1
- 238000010791 quenching Methods 0.000 description 1
- 230000000171 quenching effect Effects 0.000 description 1
- JWVCLYRUEFBMGU-UHFFFAOYSA-N quinazoline Chemical compound N1=CN=CC2=CC=CC=C21 JWVCLYRUEFBMGU-UHFFFAOYSA-N 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 230000007420 reactivation Effects 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 238000007634 remodeling Methods 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 230000000241 respiratory effect Effects 0.000 description 1
- 230000029058 respiratory gaseous exchange Effects 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 201000011195 retinal edema Diseases 0.000 description 1
- 238000004007 reversed phase HPLC Methods 0.000 description 1
- 238000012552 review Methods 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 125000006413 ring segment Chemical group 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- 239000012056 semi-solid material Substances 0.000 description 1
- 238000013207 serial dilution Methods 0.000 description 1
- 239000008159 sesame oil Substances 0.000 description 1
- 235000011803 sesame oil Nutrition 0.000 description 1
- 239000004208 shellac Substances 0.000 description 1
- ZLGIYFNHBLSMPS-ATJNOEHPSA-N shellac Chemical compound OCCCCCC(O)C(O)CCCCCCCC(O)=O.C1C23[C@H](C(O)=O)CCC2[C@](C)(CO)[C@@H]1C(C(O)=O)=C[C@@H]3O ZLGIYFNHBLSMPS-ATJNOEHPSA-N 0.000 description 1
- 229940113147 shellac Drugs 0.000 description 1
- 235000013874 shellac Nutrition 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 230000005783 single-strand break Effects 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- BEOOHQFXGBMRKU-UHFFFAOYSA-N sodium cyanoborohydride Chemical compound [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- 238000010186 staining Methods 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 230000000707 stereoselective effect Effects 0.000 description 1
- 239000012058 sterile packaged powder Substances 0.000 description 1
- 239000011550 stock solution Substances 0.000 description 1
- 210000002784 stomach Anatomy 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 1
- 150000003456 sulfonamides Chemical class 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
- HHVIBTZHLRERCL-UHFFFAOYSA-N sulfonyldimethane Chemical compound CS(C)(=O)=O HHVIBTZHLRERCL-UHFFFAOYSA-N 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- 230000000153 supplemental effect Effects 0.000 description 1
- 230000004083 survival effect Effects 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 230000002459 sustained effect Effects 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- 230000009885 systemic effect Effects 0.000 description 1
- 239000007916 tablet composition Substances 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 239000008399 tap water Substances 0.000 description 1
- 235000020679 tap water Nutrition 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- WDPWEXWMQDRXAL-UHFFFAOYSA-N tert-butyl 1,4-diazepane-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCCNCC1 WDPWEXWMQDRXAL-UHFFFAOYSA-N 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- CKXZPVPIDOJLLM-UHFFFAOYSA-N tert-butyl n-piperidin-4-ylcarbamate Chemical compound CC(C)(C)OC(=O)NC1CCNCC1 CKXZPVPIDOJLLM-UHFFFAOYSA-N 0.000 description 1
- 229960003604 testosterone Drugs 0.000 description 1
- 125000005207 tetraalkylammonium group Chemical group 0.000 description 1
- 229960002180 tetracycline Drugs 0.000 description 1
- 229930101283 tetracycline Natural products 0.000 description 1
- 235000019364 tetracycline Nutrition 0.000 description 1
- 150000003522 tetracyclines Chemical group 0.000 description 1
- WHRNULOCNSKMGB-UHFFFAOYSA-N tetrahydrofuran thf Chemical compound C1CCOC1.C1CCOC1 WHRNULOCNSKMGB-UHFFFAOYSA-N 0.000 description 1
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 1
- CZDYPVPMEAXLPK-UHFFFAOYSA-N tetramethylsilane Chemical compound C[Si](C)(C)C CZDYPVPMEAXLPK-UHFFFAOYSA-N 0.000 description 1
- 150000003536 tetrazoles Chemical class 0.000 description 1
- WROMPOXWARCANT-UHFFFAOYSA-N tfa trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.OC(=O)C(F)(F)F WROMPOXWARCANT-UHFFFAOYSA-N 0.000 description 1
- VLLMWSRANPNYQX-UHFFFAOYSA-N thiadiazole Chemical compound C1=CSN=N1.C1=CSN=N1 VLLMWSRANPNYQX-UHFFFAOYSA-N 0.000 description 1
- 125000000437 thiazol-2-yl group Chemical group [H]C1=C([H])N=C(*)S1 0.000 description 1
- 150000007979 thiazole derivatives Chemical class 0.000 description 1
- 150000003557 thiazoles Chemical class 0.000 description 1
- 150000003577 thiophenes Chemical class 0.000 description 1
- 239000012049 topical pharmaceutical composition Substances 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 231100000563 toxic property Toxicity 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 238000013518 transcription Methods 0.000 description 1
- 230000035897 transcription Effects 0.000 description 1
- 108091006108 transcriptional coactivators Proteins 0.000 description 1
- 230000037317 transdermal delivery Effects 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
- 238000000844 transformation Methods 0.000 description 1
- 230000001052 transient effect Effects 0.000 description 1
- 150000003852 triazoles Chemical class 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 1
- 210000004881 tumor cell Anatomy 0.000 description 1
- 230000004565 tumor cell growth Effects 0.000 description 1
- 238000009827 uniform distribution Methods 0.000 description 1
- 230000002792 vascular Effects 0.000 description 1
- 208000023577 vascular insufficiency disease Diseases 0.000 description 1
- 239000003981 vehicle Substances 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- WAEXFXRVDQXREF-UHFFFAOYSA-N vorinostat Chemical compound ONC(=O)CCCCCCC(=O)NC1=CC=CC=C1 WAEXFXRVDQXREF-UHFFFAOYSA-N 0.000 description 1
- 229960000237 vorinostat Drugs 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P1/00—Drugs for disorders of the alimentary tract or the digestive system
- A61P1/16—Drugs for disorders of the alimentary tract or the digestive system for liver or gallbladder disorders, e.g. hepatoprotective agents, cholagogues, litholytics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P11/00—Drugs for disorders of the respiratory system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P11/00—Drugs for disorders of the respiratory system
- A61P11/06—Antiasthmatics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P17/00—Drugs for dermatological disorders
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P17/00—Drugs for dermatological disorders
- A61P17/02—Drugs for dermatological disorders for treating wounds, ulcers, burns, scars, keloids, or the like
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P17/00—Drugs for dermatological disorders
- A61P17/06—Antipsoriatics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P19/00—Drugs for skeletal disorders
- A61P19/02—Drugs for skeletal disorders for joint disorders, e.g. arthritis, arthrosis
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P21/00—Drugs for disorders of the muscular or neuromuscular system
- A61P21/04—Drugs for disorders of the muscular or neuromuscular system for myasthenia gravis
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/14—Drugs for disorders of the nervous system for treating abnormal movements, e.g. chorea, dyskinesia
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/28—Drugs for disorders of the nervous system for treating neurodegenerative disorders of the central nervous system, e.g. nootropic agents, cognition enhancers, drugs for treating Alzheimer's disease or other forms of dementia
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P27/00—Drugs for disorders of the senses
- A61P27/02—Ophthalmic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P27/00—Drugs for disorders of the senses
- A61P27/02—Ophthalmic agents
- A61P27/06—Antiglaucoma agents or miotics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P29/00—Non-central analgesic, antipyretic or antiinflammatory agents, e.g. antirheumatic agents; Non-steroidal antiinflammatory drugs [NSAID]
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P3/00—Drugs for disorders of the metabolism
- A61P3/08—Drugs for disorders of the metabolism for glucose homeostasis
- A61P3/10—Drugs for disorders of the metabolism for glucose homeostasis for hyperglycaemia, e.g. antidiabetics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P37/00—Drugs for immunological or allergic disorders
- A61P37/02—Immunomodulators
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P37/00—Drugs for immunological or allergic disorders
- A61P37/02—Immunomodulators
- A61P37/06—Immunosuppressants, e.g. drugs for graft rejection
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P7/00—Drugs for disorders of the blood or the extracellular fluid
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P7/00—Drugs for disorders of the blood or the extracellular fluid
- A61P7/02—Antithrombotic agents; Anticoagulants; Platelet aggregation inhibitors
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P7/00—Drugs for disorders of the blood or the extracellular fluid
- A61P7/06—Antianaemics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/04—Inotropic agents, i.e. stimulants of cardiac contraction; Drugs for heart failure
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/10—Drugs for disorders of the cardiovascular system for treating ischaemic or atherosclerotic diseases, e.g. antianginal drugs, coronary vasodilators, drugs for myocardial infarction, retinopathy, cerebrovascula insufficiency, renal arteriosclerosis
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings
- C07D417/04—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing three or more hetero rings
Landscapes
- Health & Medical Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Engineering & Computer Science (AREA)
- Veterinary Medicine (AREA)
- Medicinal Chemistry (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Immunology (AREA)
- Diabetes (AREA)
- Neurology (AREA)
- Hematology (AREA)
- Biomedical Technology (AREA)
- Neurosurgery (AREA)
- Dermatology (AREA)
- Pulmonology (AREA)
- Ophthalmology & Optometry (AREA)
- Cardiology (AREA)
- Hospice & Palliative Care (AREA)
- Rheumatology (AREA)
- Physical Education & Sports Medicine (AREA)
- Orthopedic Medicine & Surgery (AREA)
- Heart & Thoracic Surgery (AREA)
- Gastroenterology & Hepatology (AREA)
- Psychiatry (AREA)
- Pain & Pain Management (AREA)
- Transplantation (AREA)
- Endocrinology (AREA)
- Vascular Medicine (AREA)
- Emergency Medicine (AREA)
- Obesity (AREA)
- Psychology (AREA)
- Urology & Nephrology (AREA)
Applications Claiming Priority (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US55164404P | 2004-03-08 | 2004-03-08 | |
| US60/551,644 | 2004-03-08 | ||
| US10/992,303 | 2004-11-17 | ||
| US10/992,303 US20050197336A1 (en) | 2004-03-08 | 2004-11-17 | Inhibitors of histone deacetylase |
| PCT/US2005/007906 WO2005086898A2 (en) | 2004-03-08 | 2005-03-08 | Inhibitors of histone deacetylase |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA2558243A1 true CA2558243A1 (en) | 2005-09-22 |
Family
ID=34915721
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA002558243A Abandoned CA2558243A1 (en) | 2004-03-08 | 2005-03-08 | Inhibitors of histone deacetylase |
Country Status (6)
| Country | Link |
|---|---|
| US (2) | US20050197336A1 (https=) |
| EP (1) | EP1755601A4 (https=) |
| JP (1) | JP2007527914A (https=) |
| AU (1) | AU2005221134A1 (https=) |
| CA (1) | CA2558243A1 (https=) |
| WO (1) | WO2005086898A2 (https=) |
Families Citing this family (58)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA2475766C (en) * | 2002-03-13 | 2012-06-05 | Janssen Pharmaceutica N.V. | Piperazinyl-, piperidinyl- and morpholinyl-derivatives as novel inhibitors of histone deacetylase |
| HRP20040805A2 (en) | 2002-03-13 | 2005-04-30 | Janssen Pharmaceutica N.V. | Carbonylamino derivatives as novel inhibitors histone deacetylase |
| MXPA04008797A (es) | 2002-03-13 | 2004-11-26 | Janssen Pharmaceutica Nv | Inhibidores de histona desacetilasa. |
| EA007099B1 (ru) | 2002-03-13 | 2006-06-30 | Янссен Фармацевтика Н. В. | Сульфонилпроизводные в качестве ингибиторов гистон-деацетилазы |
| TW200526626A (en) | 2003-09-13 | 2005-08-16 | Astrazeneca Ab | Chemical compounds |
| US20050197336A1 (en) * | 2004-03-08 | 2005-09-08 | Miikana Therapeutics Corporation | Inhibitors of histone deacetylase |
| EA012451B1 (ru) | 2004-03-11 | 2009-10-30 | 4Сц Аг | Новые амидозамещённые гидрокси-6-фенилфенантридины |
| US7345043B2 (en) * | 2004-04-01 | 2008-03-18 | Miikana Therapeutics | Inhibitors of histone deacetylase |
| KR101261305B1 (ko) | 2004-07-28 | 2013-05-08 | 얀센 파마슈티카 엔.브이. | 히스톤 디아세틸라제의 신규한 저해제로의 치환된 인돌릴알킬 아미노 유도체 |
| TW200630337A (en) * | 2004-10-14 | 2006-09-01 | Euro Celtique Sa | Piperidinyl compounds and the use thereof |
| US7772245B2 (en) * | 2005-02-14 | 2010-08-10 | Miikana Therapeutics, Inc. | Inhibitors of histone deacetylase |
| JP4058106B2 (ja) * | 2005-02-18 | 2008-03-05 | アストラゼネカ アクチボラグ | 抗菌性のピペリジン誘導体 |
| JP2008530193A (ja) * | 2005-02-18 | 2008-08-07 | アストラゼネカ アクチボラグ | 化合物 |
| WO2006092608A1 (en) * | 2005-03-04 | 2006-09-08 | Astrazeneca Ab | Tricyclic derivatives of azetidine and pyrrole with antibacterial activity |
| CN101171247A (zh) * | 2005-03-04 | 2008-04-30 | 阿斯利康(瑞典)有限公司 | 作为dna促旋酶和拓扑异构酶抑制剂的吡咯衍生物 |
| CN101137623B (zh) | 2005-03-15 | 2013-03-27 | 奈科明有限责任公司 | N-磺酰基吡咯及其作为组蛋白脱乙酰酶抑制剂的用途 |
| ES2553178T3 (es) | 2005-05-18 | 2015-12-04 | Janssen Pharmaceutica N.V. | Derivados sustituidos de aminopropenil piperidina o morfolina como nuevos inhibidores de histona deacetilasa |
| BRPI0616040A2 (pt) | 2005-09-21 | 2011-06-07 | Nycomed Gmbh | cloridrato de sulfonilpirról como inibidor de histona desacetilases |
| SI1928872T1 (sl) | 2005-09-21 | 2012-06-29 | 4Sc Ag | Novi sulfonilpiroli kot inhibitorji HDAC |
| JP5070214B2 (ja) * | 2005-10-27 | 2012-11-07 | ジヤンセン・フアーマシユーチカ・ナームローゼ・フエンノートシヤツプ | ヒストンデアセチラーゼの阻害剤としてのスクエア酸誘導体 |
| WO2007082876A1 (en) * | 2006-01-19 | 2007-07-26 | Janssen Pharmaceutica N.V. | Pyridine and pyrimidine derivatives as inhibitors of histone deacetylase |
| US7888360B2 (en) | 2006-01-19 | 2011-02-15 | Janssen Pharmaceutica N.V. | Pyridine and pyrimidine derivatives as inhibitors of histone deacetylase |
| EP1981875B1 (en) | 2006-01-19 | 2014-04-16 | Janssen Pharmaceutica N.V. | Substituted indolyl-alkyl-amino-derivatives as inhibitors of histone deacetylase |
| DK1981871T3 (da) | 2006-01-19 | 2012-02-13 | Janssen Pharmaceutica Nv | Heterocyclylalkylderivater som hidtil ukendte inhibitorer af histondeacetylase |
| WO2007082874A1 (en) * | 2006-01-19 | 2007-07-26 | Janssen Pharmaceutica N.V. | Pyridine and pyrimidine derivatives as inhibitors of histone deacetylase |
| CA2631876C (en) * | 2006-01-19 | 2014-05-27 | Janssen Pharmaceutica N.V. | Aminophenyl derivatives as inhibitors of histone deacetylase |
| CA2641579A1 (en) | 2006-02-07 | 2007-08-16 | Astellas Pharma Inc. | N-hydroxyacrylamide compounds |
| GB0603041D0 (en) * | 2006-02-15 | 2006-03-29 | Angeletti P Ist Richerche Bio | Therapeutic compounds |
| WO2007110449A1 (en) * | 2006-03-29 | 2007-10-04 | Euro-Celtique S.A. | Benzenesulfonamide compounds and their use |
| US8791264B2 (en) * | 2006-04-13 | 2014-07-29 | Purdue Pharma L.P. | Benzenesulfonamide compounds and their use as blockers of calcium channels |
| WO2007118854A1 (en) * | 2006-04-13 | 2007-10-25 | Euro-Celtique S.A. | Benzenesulfonamide compounds and the use thereof |
| US8017612B2 (en) | 2006-04-18 | 2011-09-13 | Japan Tobacco Inc. | Piperazine compound and use thereof as a HCV polymerase inhibitor |
| AU2007296743B2 (en) * | 2006-09-11 | 2012-02-16 | Curis, Inc. | Tyrosine kinase inhibitors containing a zinc binding moiety |
| WO2008033747A2 (en) * | 2006-09-11 | 2008-03-20 | Curis, Inc. | Multi-functional small molecules as anti-proliferative agents |
| CN105481788A (zh) * | 2006-10-28 | 2016-04-13 | 梅特希尔基因公司 | 组蛋白脱乙酰酶抑制剂 |
| CN101677977A (zh) * | 2006-11-10 | 2010-03-24 | 欣达克斯制药公司 | 用于治疗癌症的ERα+配体和组蛋白脱乙酰化酶抑制剂组合 |
| WO2008065409A2 (en) * | 2006-12-01 | 2008-06-05 | Betagenon Ab | Combination for use in the treatment of cancer, comprising tamoxifen or an aromatase inhibitor |
| WO2008124118A1 (en) | 2007-04-09 | 2008-10-16 | Purdue Pharma L.P. | Benzenesulfonyl compounds and the use therof |
| TW200906412A (en) * | 2007-06-12 | 2009-02-16 | Astrazeneca Ab | Piperidine compounds and uses thereof |
| US20100267779A1 (en) * | 2007-07-23 | 2010-10-21 | Syndax Pharmaceuticals, Inc. | Novel Compounds and Methods of Using Them |
| WO2009015203A1 (en) * | 2007-07-23 | 2009-01-29 | Syndax Pharmaceuticals, Inc. | Novel compounds and methods of using them |
| WO2009040659A2 (en) * | 2007-09-28 | 2009-04-02 | Purdue Pharma L.P. | Benzenesulfonamide compounds and the use thereof |
| WO2009049018A1 (en) * | 2007-10-10 | 2009-04-16 | Syndax Pharmaceuticals, Inc. | Novel compounds and methods of using them |
| US20090149511A1 (en) * | 2007-10-30 | 2009-06-11 | Syndax Pharmaceuticals, Inc. | Administration of an Inhibitor of HDAC and an mTOR Inhibitor |
| CN101918389A (zh) * | 2007-11-02 | 2010-12-15 | 梅特希尔基因公司 | 组蛋白脱乙酰酶抑制剂 |
| US20090131367A1 (en) * | 2007-11-19 | 2009-05-21 | The Regents Of The University Of Colorado | Combinations of HDAC Inhibitors and Proteasome Inhibitors |
| WO2009089598A2 (en) * | 2008-01-18 | 2009-07-23 | Katholieke Universiteit Leuven | Msmb-gene methylation based diagnosis, staging and prognosis of prostate cancer |
| WO2010141932A1 (en) | 2009-06-05 | 2010-12-09 | Link Medicine Corporation | Aminopyrrolidinone derivatives and uses thereof |
| US8394858B2 (en) * | 2009-12-03 | 2013-03-12 | Novartis Ag | Cyclohexane derivatives and uses thereof |
| WO2011106627A1 (en) * | 2010-02-26 | 2011-09-01 | Millennium Pharmaceuticals, Inc. | Substituted hydroxamic acids and uses thereof |
| WO2011153359A1 (en) | 2010-06-04 | 2011-12-08 | Albany Molecular Research, Inc. | Glycine transporter-1 inhibitors, methods of making them, and uses thereof |
| CN103169720B (zh) * | 2011-12-21 | 2016-12-07 | 张雅珍 | 蒽环类抗生素及其可药用盐在治疗视网膜静脉阻塞中的用途 |
| ITRM20120405A1 (it) * | 2012-08-09 | 2014-02-10 | C N C C S Scarl Collezione Naziona Le Dei Compost | Compounds for use in the treatment of disorders that are ameliorated by inhibition of hdac |
| EP3769757A3 (en) * | 2013-10-18 | 2021-10-06 | The General Hospital Corporation | Imaging histone deacetylases with a radiotracer using positron emission tomography |
| US9745253B2 (en) | 2015-03-13 | 2017-08-29 | Forma Therapeutics, Inc. | Alpha-cinnamide compounds and compositions as HDAC8 inhibitors |
| CN111484469B (zh) * | 2020-05-14 | 2022-07-05 | 遵义医科大学 | 吡喃亚基丙二腈类光敏剂先导化合物合成方法及其应用 |
| KR102514860B1 (ko) * | 2020-12-01 | 2023-03-29 | 한국과학기술연구원 | 5-ht7 세로토닌 수용체 활성 저해용 바이페닐 피롤리딘 및 바이페닐 다이하이드로이미다졸 유도체 및 이를 유효성분으로 포함하는 약학 조성물 |
| WO2025085848A1 (en) * | 2023-10-20 | 2025-04-24 | Arrepath, Inc. | Antibacterial compounds |
Family Cites Families (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5700811A (en) * | 1991-10-04 | 1997-12-23 | Sloan-Kettering Institute For Cancer Research | Potent inducers of terminal differentiation and method of use thereof |
| US5369108A (en) * | 1991-10-04 | 1994-11-29 | Sloan-Kettering Institute For Cancer Research | Potent inducers of terminal differentiation and methods of use thereof |
| EP0827742A1 (en) * | 1996-09-04 | 1998-03-11 | Vrije Universiteit Brussel | Use of histone deacetylase inhibitors for treating fribosis or cirrhosis |
| US5925672A (en) * | 1996-12-06 | 1999-07-20 | Neurosciences Research Foundation, Inc. | Methods of treating mental diseases, inflammation and pain |
| US6124495A (en) * | 1997-03-11 | 2000-09-26 | Beacon Laboratories, Inc. | Unsaturated oxyalkylene esters and uses thereof |
| EP1748046A3 (en) * | 1999-11-23 | 2007-08-22 | Methylgene, Inc. | Inhibitors of histone deacetylase |
| PE20020354A1 (es) * | 2000-09-01 | 2002-06-12 | Novartis Ag | Compuestos de hidroxamato como inhibidores de histona-desacetilasa (hda) |
| AU2002243231A1 (en) * | 2000-11-21 | 2002-07-24 | Wake Forest University | Method of treating autoimmune diseases |
| US7314953B2 (en) * | 2001-03-27 | 2008-01-01 | Errant Gene Therapeutics, Llc | Treatment of lung cells with histone deacetylase inhibitors |
| US6706686B2 (en) * | 2001-09-27 | 2004-03-16 | The Regents Of The University Of Colorado | Inhibition of histone deacetylase as a treatment for cardiac hypertrophy |
| AU2002340253C1 (en) * | 2001-10-16 | 2011-03-31 | Sloan-Kettering Institute For Cancer Research | Treatment of neurodegenerative diseases and cancer of the brain |
| SE520636C2 (sv) * | 2001-11-12 | 2003-08-05 | Stroemsholmen Ab | Anordning vid en energiackumelerande kolv-cylinderdon |
| JP2005525345A (ja) * | 2002-02-15 | 2005-08-25 | スローン−ケッタリング・インスティテュート・フォー・キャンサー・リサーチ | Trx媒介性疾患を処置する方法 |
| AU2003226014A1 (en) * | 2002-03-28 | 2003-10-13 | Brigham And Women's Hospital, Inc. | Histone deacetylase inhibitors for the treatment of multiple sclerosis, amyotrophic lateral sclerosis and alzheimer's disease |
| US20030206946A1 (en) * | 2002-04-26 | 2003-11-06 | Yih-Lin Chung | Methods for therapy of connective tissue disease |
| WO2003099760A1 (en) * | 2002-05-22 | 2003-12-04 | Errant Gene Therapeutics, Llc. | Histone deacetylase inhibitors based on trihalomethylcarbonyl compounds |
| SE0202157D0 (sv) * | 2002-07-09 | 2002-07-09 | Biovitrum Ab | Methods for identification of compounds modulating insulin resistance |
| JP2006512318A (ja) * | 2002-11-12 | 2006-04-13 | アルコン,インコーポレイテッド | 眼の血管新生もしくは水腫状の疾患および障害を処置するためのヒストンデアセチラーゼインヒビター |
| RU2324483C2 (ru) * | 2002-11-12 | 2008-05-20 | Алькон, Инк. | Ингибиторы гистондеацетилазы для лечения дегенеративных заболеваний глаз |
| US20040140461A1 (en) * | 2003-01-22 | 2004-07-22 | Lappen Alan Rick | Configurable fence and gate systems |
| US7381825B2 (en) * | 2003-03-17 | 2008-06-03 | Takeda San Diego, Inc. | Histone deacetylase inhibitors |
| US20050197336A1 (en) * | 2004-03-08 | 2005-09-08 | Miikana Therapeutics Corporation | Inhibitors of histone deacetylase |
| US7345043B2 (en) * | 2004-04-01 | 2008-03-18 | Miikana Therapeutics | Inhibitors of histone deacetylase |
-
2004
- 2004-11-17 US US10/992,303 patent/US20050197336A1/en not_active Abandoned
-
2005
- 2005-03-08 AU AU2005221134A patent/AU2005221134A1/en not_active Abandoned
- 2005-03-08 WO PCT/US2005/007906 patent/WO2005086898A2/en not_active Ceased
- 2005-03-08 EP EP05746174A patent/EP1755601A4/en not_active Withdrawn
- 2005-03-08 CA CA002558243A patent/CA2558243A1/en not_active Abandoned
- 2005-03-08 JP JP2007502989A patent/JP2007527914A/ja not_active Withdrawn
- 2005-03-08 US US11/075,603 patent/US20050250784A1/en not_active Abandoned
Also Published As
| Publication number | Publication date |
|---|---|
| JP2007527914A (ja) | 2007-10-04 |
| US20050250784A1 (en) | 2005-11-10 |
| US20050197336A1 (en) | 2005-09-08 |
| WO2005086898A3 (en) | 2006-02-09 |
| WO2005086898A2 (en) | 2005-09-22 |
| AU2005221134A1 (en) | 2005-09-22 |
| EP1755601A4 (en) | 2009-12-02 |
| EP1755601A2 (en) | 2007-02-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA2558243A1 (en) | Inhibitors of histone deacetylase | |
| US7345043B2 (en) | Inhibitors of histone deacetylase | |
| CN101370796B (zh) | 作为11β-HSD1抑制剂的噻唑类 | |
| JP4120586B2 (ja) | 2−アシルアミノチアゾール誘導体又はその塩 | |
| JP5746860B2 (ja) | ヒストンデアセチラーゼ阻害剤 | |
| CN1474803B (zh) | 酰胺衍生物及其制备药物的用途 | |
| TWI391386B (zh) | 化合物 | |
| CN101883760A (zh) | 用作电压-门控钠通道抑制剂的杂芳基酰胺类 | |
| AU765072B2 (en) | Heteroaryl amidines, methylamidines and guanidines as protease inhibitors, in particular as urokinase inhibitors | |
| MX2007007574A (es) | Derivados de piridina-carboxamida para uso como agentes anticancerosos. | |
| CA2695517A1 (en) | Alkylsulfonyl-substituted thiazolide compounds | |
| CN106414438B (zh) | 2-酰氨基噻唑衍生物或其盐 | |
| CN110049978A (zh) | 作为选择性hdac1,2抑制剂的哌嗪衍生物 | |
| CA2598043A1 (en) | Benzisothiazoles useful for treating or preventing hcv infection | |
| WO2002055484A1 (en) | Biaryl compound, process for producing the same, and agent | |
| CN103327972A (zh) | 取代的苯甲酰胺及其用途 | |
| US7037927B2 (en) | Amides that inhibit vanilloid receptor subtype 1 (VR1) receptor | |
| AU5671799A (en) | Heteroaryl amidines, methylamidines and guanidines as protease inhibitors | |
| ES2547072T3 (es) | Heteroaril benzamidas, composiciones y métodos de utilización | |
| CN104411311A (zh) | 取代的苯甲酰胺及其用途 | |
| JP2001519826A (ja) | 金属プロテイナーゼ阻害剤 | |
| CN101511791B (zh) | 用于治疗gpr38受体介导的疾病的哌嗪基衍生物 | |
| HK1145325A (en) | Aryl amides useful as inhibitors of voltage-gated sodium channels | |
| HK1146825A (en) | Heterocyclic inhibitors of c-met and uses thereof |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| FZDE | Dead |