CA2413748C - Production of aromatic carboxylic acids - Google Patents
Production of aromatic carboxylic acids Download PDFInfo
- Publication number
- CA2413748C CA2413748C CA2413748A CA2413748A CA2413748C CA 2413748 C CA2413748 C CA 2413748C CA 2413748 A CA2413748 A CA 2413748A CA 2413748 A CA2413748 A CA 2413748A CA 2413748 C CA2413748 C CA 2413748C
- Authority
- CA
- Canada
- Prior art keywords
- reaction
- heat
- reactor
- water
- oxidant
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Fee Related
Links
- 238000004519 manufacturing process Methods 0.000 title claims abstract description 25
- -1 aromatic carboxylic acids Chemical class 0.000 title description 12
- 238000006243 chemical reaction Methods 0.000 claims abstract description 132
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims abstract description 117
- 239000003054 catalyst Substances 0.000 claims abstract description 71
- 238000000034 method Methods 0.000 claims abstract description 62
- 230000008569 process Effects 0.000 claims abstract description 61
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 claims abstract description 57
- 239000002243 precursor Substances 0.000 claims abstract description 52
- 239000007800 oxidant agent Substances 0.000 claims abstract description 48
- 230000001590 oxidative effect Effects 0.000 claims abstract description 48
- 239000003125 aqueous solvent Substances 0.000 claims abstract description 21
- 238000007254 oxidation reaction Methods 0.000 claims description 52
- 239000000376 reactant Substances 0.000 claims description 52
- 239000000047 product Substances 0.000 claims description 44
- 239000012452 mother liquor Substances 0.000 claims description 41
- 239000012530 fluid Substances 0.000 claims description 37
- 239000012429 reaction media Substances 0.000 claims description 21
- 239000002244 precipitate Substances 0.000 claims description 8
- 238000004064 recycling Methods 0.000 claims description 2
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 claims 1
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 184
- URLKBWYHVLBVBO-UHFFFAOYSA-N Para-Xylene Chemical group CC1=CC=C(C)C=C1 URLKBWYHVLBVBO-UHFFFAOYSA-N 0.000 description 108
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 67
- 239000001301 oxygen Substances 0.000 description 40
- 229910052760 oxygen Inorganic materials 0.000 description 40
- 230000003647 oxidation Effects 0.000 description 39
- GOUHYARYYWKXHS-UHFFFAOYSA-N 4-formylbenzoic acid Chemical compound OC(=O)C1=CC=C(C=O)C=C1 GOUHYARYYWKXHS-UHFFFAOYSA-N 0.000 description 36
- 239000000243 solution Substances 0.000 description 32
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 30
- 238000002156 mixing Methods 0.000 description 28
- 239000000543 intermediate Substances 0.000 description 24
- 239000002904 solvent Substances 0.000 description 24
- 229910001882 dioxygen Inorganic materials 0.000 description 21
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 18
- 238000002474 experimental method Methods 0.000 description 18
- 238000010438 heat treatment Methods 0.000 description 18
- 238000011084 recovery Methods 0.000 description 17
- 239000007788 liquid Substances 0.000 description 16
- 239000002638 heterogeneous catalyst Substances 0.000 description 15
- 238000000926 separation method Methods 0.000 description 15
- 238000011027 product recovery Methods 0.000 description 13
- 239000012265 solid product Substances 0.000 description 13
- 239000005711 Benzoic acid Substances 0.000 description 12
- 235000010233 benzoic acid Nutrition 0.000 description 12
- 239000006227 byproduct Substances 0.000 description 12
- 239000000203 mixture Substances 0.000 description 12
- 238000002347 injection Methods 0.000 description 11
- 239000007924 injection Substances 0.000 description 11
- LPNBBFKOUUSUDB-UHFFFAOYSA-N p-toluic acid Chemical compound CC1=CC=C(C(O)=O)C=C1 LPNBBFKOUUSUDB-UHFFFAOYSA-N 0.000 description 11
- 238000002425 crystallisation Methods 0.000 description 10
- 230000000694 effects Effects 0.000 description 10
- 239000002815 homogeneous catalyst Substances 0.000 description 10
- 239000012071 phase Substances 0.000 description 10
- 238000010926 purge Methods 0.000 description 9
- 239000002002 slurry Substances 0.000 description 9
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 8
- 238000001816 cooling Methods 0.000 description 8
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 description 8
- 230000003068 static effect Effects 0.000 description 8
- 150000001299 aldehydes Chemical class 0.000 description 7
- 238000004458 analytical method Methods 0.000 description 7
- 239000007789 gas Substances 0.000 description 7
- 230000000750 progressive effect Effects 0.000 description 7
- 239000007787 solid Substances 0.000 description 7
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical group OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 6
- 150000001875 compounds Chemical class 0.000 description 6
- 239000013078 crystal Substances 0.000 description 6
- RJYMRRJVDRJMJW-UHFFFAOYSA-L dibromomanganese Chemical compound Br[Mn]Br RJYMRRJVDRJMJW-UHFFFAOYSA-L 0.000 description 6
- 238000005406 washing Methods 0.000 description 6
- 238000010924 continuous production Methods 0.000 description 5
- 239000012065 filter cake Substances 0.000 description 5
- 239000003960 organic solvent Substances 0.000 description 5
- 229920000728 polyester Polymers 0.000 description 5
- 238000012546 transfer Methods 0.000 description 5
- 238000011144 upstream manufacturing Methods 0.000 description 5
- 238000013459 approach Methods 0.000 description 4
- 229910052799 carbon Inorganic materials 0.000 description 4
- 238000005260 corrosion Methods 0.000 description 4
- 230000007797 corrosion Effects 0.000 description 4
- 238000005984 hydrogenation reaction Methods 0.000 description 4
- 239000007791 liquid phase Substances 0.000 description 4
- 229910052757 nitrogen Inorganic materials 0.000 description 4
- 238000000746 purification Methods 0.000 description 4
- ARCGXLSVLAOJQL-UHFFFAOYSA-N trimellitic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C(C(O)=O)=C1 ARCGXLSVLAOJQL-UHFFFAOYSA-N 0.000 description 4
- MARCAKLHFUYDJE-UHFFFAOYSA-N 1,2-xylene;hydrate Chemical compound O.CC1=CC=CC=C1C MARCAKLHFUYDJE-UHFFFAOYSA-N 0.000 description 3
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 229910017052 cobalt Inorganic materials 0.000 description 3
- 239000010941 cobalt Substances 0.000 description 3
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 3
- 239000007857 degradation product Substances 0.000 description 3
- 239000008367 deionised water Substances 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 229910001385 heavy metal Inorganic materials 0.000 description 3
- 239000012535 impurity Substances 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 238000001556 precipitation Methods 0.000 description 3
- 238000012545 processing Methods 0.000 description 3
- 230000009467 reduction Effects 0.000 description 3
- 229910001220 stainless steel Inorganic materials 0.000 description 3
- 239000010935 stainless steel Substances 0.000 description 3
- 239000011550 stock solution Substances 0.000 description 3
- 238000010626 work up procedure Methods 0.000 description 3
- PNVDDTCIZTWBNJ-UHFFFAOYSA-N 1-oxofluorene-2,6-dicarboxylic acid Chemical compound C1=C(C(O)=O)C=C2C3=CC=C(C(=O)O)C(=O)C3=CC2=C1 PNVDDTCIZTWBNJ-UHFFFAOYSA-N 0.000 description 2
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 description 2
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical class [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- 239000004411 aluminium Substances 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- 239000000872 buffer Substances 0.000 description 2
- 239000007853 buffer solution Substances 0.000 description 2
- 238000000975 co-precipitation Methods 0.000 description 2
- 238000011109 contamination Methods 0.000 description 2
- 238000007796 conventional method Methods 0.000 description 2
- 238000013461 design Methods 0.000 description 2
- 238000007865 diluting Methods 0.000 description 2
- VIQSRHWJEKERKR-UHFFFAOYSA-L disodium;terephthalate Chemical compound [Na+].[Na+].[O-]C(=O)C1=CC=C(C([O-])=O)C=C1 VIQSRHWJEKERKR-UHFFFAOYSA-L 0.000 description 2
- 238000005516 engineering process Methods 0.000 description 2
- 230000007613 environmental effect Effects 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 239000013505 freshwater Substances 0.000 description 2
- 238000004128 high performance liquid chromatography Methods 0.000 description 2
- 229910052748 manganese Inorganic materials 0.000 description 2
- 239000011572 manganese Substances 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 229910000510 noble metal Inorganic materials 0.000 description 2
- 239000008188 pellet Substances 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 238000005201 scrubbing Methods 0.000 description 2
- JHJLBTNAGRQEKS-UHFFFAOYSA-M sodium bromide Chemical compound [Na+].[Br-] JHJLBTNAGRQEKS-UHFFFAOYSA-M 0.000 description 2
- 239000011877 solvent mixture Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- RVHSTXJKKZWWDQ-UHFFFAOYSA-N 1,1,1,2-tetrabromoethane Chemical compound BrCC(Br)(Br)Br RVHSTXJKKZWWDQ-UHFFFAOYSA-N 0.000 description 1
- GDQBOARUYXETBF-UHFFFAOYSA-N 1-oxofluorene-2,3-dicarboxylic acid Chemical compound C1=CC=C2C3=CC(C(=O)O)=C(C(O)=O)C(=O)C3=CC2=C1 GDQBOARUYXETBF-UHFFFAOYSA-N 0.000 description 1
- KNSIQMPBRNAYMV-UHFFFAOYSA-N 2-(4-carboxyphenyl)terephthalic acid Chemical group C1=CC(C(=O)O)=CC=C1C1=CC(C(O)=O)=CC=C1C(O)=O KNSIQMPBRNAYMV-UHFFFAOYSA-N 0.000 description 1
- LSTRKXWIZZZYAS-UHFFFAOYSA-N 2-bromoacetyl bromide Chemical compound BrCC(Br)=O LSTRKXWIZZZYAS-UHFFFAOYSA-N 0.000 description 1
- LFEWXDOYPCWFHR-UHFFFAOYSA-N 4-(4-carboxybenzoyl)benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1C(=O)C1=CC=C(C(O)=O)C=C1 LFEWXDOYPCWFHR-UHFFFAOYSA-N 0.000 description 1
- ZUTFCPOKQHJATC-UHFFFAOYSA-N 9,10-dioxoanthracene-2,6-dicarboxylic acid Chemical compound OC(=O)C1=CC=C2C(=O)C3=CC(C(=O)O)=CC=C3C(=O)C2=C1 ZUTFCPOKQHJATC-UHFFFAOYSA-N 0.000 description 1
- KXIAWAGIHRYYML-UHFFFAOYSA-N 9h-fluorene-2,6-dicarboxylic acid Chemical compound C1=C(C(O)=O)C=C2C3=CC=C(C(=O)O)C=C3CC2=C1 KXIAWAGIHRYYML-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 229910052684 Cerium Inorganic materials 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- 238000002441 X-ray diffraction Methods 0.000 description 1
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 description 1
- MCMNRKCIXSYSNV-UHFFFAOYSA-N ZrO2 Inorganic materials O=[Zr]=O MCMNRKCIXSYSNV-UHFFFAOYSA-N 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- SWLVFNYSXGMGBS-UHFFFAOYSA-N ammonium bromide Chemical compound [NH4+].[Br-] SWLVFNYSXGMGBS-UHFFFAOYSA-N 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 229940040526 anhydrous sodium acetate Drugs 0.000 description 1
- XAAYMWLCUICVSL-UHFFFAOYSA-N anthracene-2,6-dicarboxylic acid Chemical compound C1=C(C(O)=O)C=CC2=CC3=CC(C(=O)O)=CC=C3C=C21 XAAYMWLCUICVSL-UHFFFAOYSA-N 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 238000010923 batch production Methods 0.000 description 1
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- 150000004768 bromobenzenes Chemical class 0.000 description 1
- 229910002091 carbon monoxide Inorganic materials 0.000 description 1
- 229910002090 carbon oxide Inorganic materials 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 238000007084 catalytic combustion reaction Methods 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 239000003518 caustics Substances 0.000 description 1
- ZMIGMASIKSOYAM-UHFFFAOYSA-N cerium Chemical compound [Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce] ZMIGMASIKSOYAM-UHFFFAOYSA-N 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 239000007806 chemical reaction intermediate Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 239000000567 combustion gas Substances 0.000 description 1
- 238000002485 combustion reaction Methods 0.000 description 1
- 239000002131 composite material Substances 0.000 description 1
- 230000006835 compression Effects 0.000 description 1
- 238000007906 compression Methods 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000006114 decarboxylation reaction Methods 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- 230000001066 destructive effect Effects 0.000 description 1
- SIEILFNCEFEENQ-UHFFFAOYSA-N dibromoacetic acid Chemical compound OC(=O)C(Br)Br SIEILFNCEFEENQ-UHFFFAOYSA-N 0.000 description 1
- GWZCCUDJHOGOSO-UHFFFAOYSA-N diphenic acid Chemical compound OC(=O)C1=CC=CC=C1C1=CC=CC=C1C(O)=O GWZCCUDJHOGOSO-UHFFFAOYSA-N 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- GCFVRZICQMJVAZ-UHFFFAOYSA-N ethene;dihydrobromide Chemical compound Br.Br.C=C GCFVRZICQMJVAZ-UHFFFAOYSA-N 0.000 description 1
- 238000007380 fibre production Methods 0.000 description 1
- 239000000446 fuel Substances 0.000 description 1
- 229910052735 hafnium Inorganic materials 0.000 description 1
- VBJZVLUMGGDVMO-UHFFFAOYSA-N hafnium atom Chemical compound [Hf] VBJZVLUMGGDVMO-UHFFFAOYSA-N 0.000 description 1
- 229910000856 hastalloy Inorganic materials 0.000 description 1
- 238000007172 homogeneous catalysis Methods 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 238000007689 inspection Methods 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 229910052747 lanthanoid Inorganic materials 0.000 description 1
- 150000002602 lanthanoids Chemical class 0.000 description 1
- 150000002697 manganese compounds Chemical class 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 150000002736 metal compounds Chemical class 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 229910052750 molybdenum Inorganic materials 0.000 description 1
- 239000011733 molybdenum Substances 0.000 description 1
- KYTZHLUVELPASH-UHFFFAOYSA-N naphthalene-1,2-dicarboxylic acid Chemical compound C1=CC=CC2=C(C(O)=O)C(C(=O)O)=CC=C21 KYTZHLUVELPASH-UHFFFAOYSA-N 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 239000011368 organic material Substances 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- RVTZCBVAJQQJTK-UHFFFAOYSA-N oxygen(2-);zirconium(4+) Chemical compound [O-2].[O-2].[Zr+4] RVTZCBVAJQQJTK-UHFFFAOYSA-N 0.000 description 1
- FXLOVSHXALFLKQ-UHFFFAOYSA-N p-tolualdehyde Chemical compound CC1=CC=C(C=O)C=C1 FXLOVSHXALFLKQ-UHFFFAOYSA-N 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 238000004806 packaging method and process Methods 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 230000037361 pathway Effects 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 239000011148 porous material Substances 0.000 description 1
- IOLCXVTUBQKXJR-UHFFFAOYSA-M potassium bromide Chemical compound [K+].[Br-] IOLCXVTUBQKXJR-UHFFFAOYSA-M 0.000 description 1
- 238000010791 quenching Methods 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 230000003134 recirculating effect Effects 0.000 description 1
- 230000000630 rising effect Effects 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 239000011949 solid catalyst Substances 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 238000009284 supercritical water oxidation Methods 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- 239000010936 titanium Substances 0.000 description 1
- 229910052719 titanium Inorganic materials 0.000 description 1
- 229910052720 vanadium Inorganic materials 0.000 description 1
- GPPXJZIENCGNKB-UHFFFAOYSA-N vanadium Chemical compound [V]#[V] GPPXJZIENCGNKB-UHFFFAOYSA-N 0.000 description 1
- 239000003643 water by type Substances 0.000 description 1
- 229910052726 zirconium Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C51/00—Preparation of carboxylic acids or their salts, halides or anhydrides
- C07C51/16—Preparation of carboxylic acids or their salts, halides or anhydrides by oxidation
- C07C51/21—Preparation of carboxylic acids or their salts, halides or anhydrides by oxidation with molecular oxygen
- C07C51/255—Preparation of carboxylic acids or their salts, halides or anhydrides by oxidation with molecular oxygen of compounds containing six-membered aromatic rings without ring-splitting
- C07C51/265—Preparation of carboxylic acids or their salts, halides or anhydrides by oxidation with molecular oxygen of compounds containing six-membered aromatic rings without ring-splitting having alkyl side chains which are oxidised to carboxyl groups
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y02—TECHNOLOGIES OR APPLICATIONS FOR MITIGATION OR ADAPTATION AGAINST CLIMATE CHANGE
- Y02P—CLIMATE CHANGE MITIGATION TECHNOLOGIES IN THE PRODUCTION OR PROCESSING OF GOODS
- Y02P20/00—Technologies relating to chemical industry
- Y02P20/50—Improvements relating to the production of bulk chemicals
- Y02P20/54—Improvements relating to the production of bulk chemicals using solvents, e.g. supercritical solvents or ionic liquids
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y02—TECHNOLOGIES OR APPLICATIONS FOR MITIGATION OR ADAPTATION AGAINST CLIMATE CHANGE
- Y02P—CLIMATE CHANGE MITIGATION TECHNOLOGIES IN THE PRODUCTION OR PROCESSING OF GOODS
- Y02P20/00—Technologies relating to chemical industry
- Y02P20/50—Improvements relating to the production of bulk chemicals
- Y02P20/582—Recycling of unreacted starting or intermediate materials
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US21938800P | 2000-07-19 | 2000-07-19 | |
| US60/219,388 | 2000-07-19 | ||
| US09/905,094 | 2001-07-13 | ||
| US09/905,094 US6765113B2 (en) | 2000-07-19 | 2001-07-13 | Production of aromatic carboxylic acids |
| PCT/US2001/022474 WO2002006201A1 (en) | 2000-07-19 | 2001-07-17 | Production of aromatic carboxylic acids |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| CA2413748A1 CA2413748A1 (en) | 2002-01-24 |
| CA2413748C true CA2413748C (en) | 2010-12-14 |
Family
ID=26913840
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA2413748A Expired - Fee Related CA2413748C (en) | 2000-07-19 | 2001-07-17 | Production of aromatic carboxylic acids |
Country Status (19)
| Country | Link |
|---|---|
| US (2) | US6765113B2 (enExample) |
| EP (1) | EP1301456B1 (enExample) |
| JP (1) | JP2004504289A (enExample) |
| KR (1) | KR20030019595A (enExample) |
| CN (1) | CN1213015C (enExample) |
| AR (1) | AR029852A1 (enExample) |
| AT (1) | ATE400543T1 (enExample) |
| AU (1) | AU2001275960A1 (enExample) |
| BR (1) | BR0112990B1 (enExample) |
| CA (1) | CA2413748C (enExample) |
| DE (1) | DE60134744D1 (enExample) |
| DZ (1) | DZ3117A1 (enExample) |
| EG (1) | EG22982A (enExample) |
| ES (1) | ES2309080T3 (enExample) |
| IN (1) | IN2002MU01837A (enExample) |
| MX (1) | MX236902B (enExample) |
| MY (1) | MY127798A (enExample) |
| RU (1) | RU2003104827A (enExample) |
| WO (1) | WO2002006201A1 (enExample) |
Families Citing this family (75)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US6765113B2 (en) * | 2000-07-19 | 2004-07-20 | E.I. Du Pont De Nemours And Company | Production of aromatic carboxylic acids |
| DE60141420D1 (de) * | 2001-05-15 | 2010-04-08 | Mitsubishi Chem Corp | Verfahren zur herstellung einer verbindung |
| ES2295644T3 (es) * | 2002-07-09 | 2008-04-16 | Invista Technologies S.A.R.L. | Procedimiento para producir acidos dicarboxilicos aromaticos en condiciones supercriticas. |
| JP3987929B2 (ja) * | 2003-04-17 | 2007-10-10 | 独立行政法人産業技術総合研究所 | 第三級カルボン酸の製造法 |
| US7049465B2 (en) * | 2003-07-10 | 2006-05-23 | Eastman Chemical Company | Process for energy recovery in processes for the preparation of aromatic carboxylic acids |
| US7213540B2 (en) * | 2004-02-05 | 2007-05-08 | Eastman Chemical Company | Steam recompression in carboxylic acid processes |
| JP2006016304A (ja) * | 2004-06-30 | 2006-01-19 | Mitsui Chemicals Inc | 芳香族カルボン酸の製造方法 |
| US7572932B2 (en) * | 2004-09-02 | 2009-08-11 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7608732B2 (en) * | 2005-03-08 | 2009-10-27 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7692036B2 (en) * | 2004-11-29 | 2010-04-06 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7608733B2 (en) | 2004-09-02 | 2009-10-27 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7361784B2 (en) | 2004-09-02 | 2008-04-22 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7495125B2 (en) | 2004-09-02 | 2009-02-24 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7381836B2 (en) * | 2004-09-02 | 2008-06-03 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7482482B2 (en) | 2004-09-02 | 2009-01-27 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7507857B2 (en) | 2004-09-02 | 2009-03-24 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7390921B2 (en) | 2004-09-02 | 2008-06-24 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7399882B2 (en) | 2004-09-02 | 2008-07-15 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7371894B2 (en) * | 2004-09-02 | 2008-05-13 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7683210B2 (en) * | 2004-09-02 | 2010-03-23 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7563926B2 (en) | 2004-09-02 | 2009-07-21 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7589231B2 (en) | 2004-09-02 | 2009-09-15 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7586000B2 (en) * | 2004-09-02 | 2009-09-08 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7572936B2 (en) * | 2004-09-02 | 2009-08-11 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7568361B2 (en) | 2004-09-02 | 2009-08-04 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7504535B2 (en) | 2004-09-02 | 2009-03-17 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7910769B2 (en) * | 2004-09-02 | 2011-03-22 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7692037B2 (en) | 2004-09-02 | 2010-04-06 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7582793B2 (en) * | 2004-09-02 | 2009-09-01 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7741515B2 (en) | 2004-09-02 | 2010-06-22 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| CA2581706A1 (en) * | 2004-10-01 | 2006-04-20 | William Barry Thomas | Process for producing heteroaromatic carboxylic acids |
| US7560566B2 (en) * | 2004-10-01 | 2009-07-14 | Invista North America S.A.R.L. | Process for producing heteroaromatic carboxylic acids |
| WO2006068472A1 (en) * | 2004-12-20 | 2006-06-29 | Process Design Center B.V. | Process for preparing aromatic carboxylic acids |
| JP4734505B2 (ja) * | 2005-01-26 | 2011-07-27 | 独立行政法人科学技術振興機構 | マイクロリアクター及びそれを用いた接触反応方法 |
| US7884231B2 (en) * | 2005-05-19 | 2011-02-08 | Eastman Chemical Company | Process to produce an enriched composition |
| US7557243B2 (en) * | 2005-05-19 | 2009-07-07 | Eastman Chemical Company | Enriched terephthalic acid composition |
| US7919652B2 (en) * | 2005-05-19 | 2011-04-05 | Eastman Chemical Company | Process to produce an enriched composition through the use of a catalyst removal zone and an enrichment zone |
| US20060264662A1 (en) * | 2005-05-19 | 2006-11-23 | Gibson Philip E | Esterification of an enriched composition |
| US20060264656A1 (en) * | 2005-05-19 | 2006-11-23 | Fujitsu Limited | Enrichment process using compounds useful in a polyester process |
| US7897809B2 (en) * | 2005-05-19 | 2011-03-01 | Eastman Chemical Company | Process to produce an enrichment feed |
| US20060264664A1 (en) * | 2005-05-19 | 2006-11-23 | Parker Kenny R | Esterification of an exchange solvent enriched composition |
| US7741516B2 (en) * | 2005-05-19 | 2010-06-22 | Eastman Chemical Company | Process to enrich a carboxylic acid composition |
| US7834208B2 (en) * | 2005-05-19 | 2010-11-16 | Eastman Chemical Company | Process to produce a post catalyst removal composition |
| US7880031B2 (en) * | 2005-05-19 | 2011-02-01 | Eastman Chemical Company | Process to produce an enrichment feed |
| US7884232B2 (en) * | 2005-06-16 | 2011-02-08 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7678727B2 (en) * | 2005-12-20 | 2010-03-16 | Chevron U.S.A. Inc. | Regeneration of ionic catalyst by hydrogenation using a homogeneous catalyst |
| US7732363B2 (en) * | 2005-12-20 | 2010-06-08 | Chevron U.S.A. Inc. | Regeneration of acidic catalysts |
| US7355068B2 (en) | 2006-01-04 | 2008-04-08 | Eastman Chemical Company | Oxidation system with internal secondary reactor |
| US7358389B2 (en) * | 2006-01-04 | 2008-04-15 | Eastman Chemical Company | Oxidation system employing internal structure for enhanced hydrodynamics |
| US7420082B2 (en) * | 2006-03-01 | 2008-09-02 | Eastman Chemical Company | Polycarboxylic acid production system employing hot liquor removal downstream of oxidative digestion |
| US20070208194A1 (en) | 2006-03-01 | 2007-09-06 | Woodruff Thomas E | Oxidation system with sidedraw secondary reactor |
| US20070208199A1 (en) * | 2006-03-01 | 2007-09-06 | Kenny Randolph Parker | Methods and apparatus for isolating carboxylic acid |
| US7501537B2 (en) * | 2006-03-01 | 2009-03-10 | Eastman Chemical Company | Polycarboxylic acid production system employing oxidative digestion with reduced or eliminated upstream liquor exchange |
| US7888529B2 (en) * | 2006-03-01 | 2011-02-15 | Eastman Chemical Company | Process to produce a post catalyst removal composition |
| US8173836B2 (en) * | 2006-03-01 | 2012-05-08 | Grupo Petrotemex, S.A. De C.V. | Method and apparatus for drying carboxylic acid |
| US7462736B2 (en) * | 2006-03-01 | 2008-12-09 | Eastman Chemical Company | Methods and apparatus for isolating carboxylic acid |
| US8697906B2 (en) * | 2006-03-01 | 2014-04-15 | Grupo Petrotemex, S.A. De C.V. | Methods and apparatus for producing a low-moisture carboxylic acid wet cake |
| US7863483B2 (en) * | 2006-03-01 | 2011-01-04 | Eastman Chemical Company | Carboxylic acid production process |
| US7816556B2 (en) * | 2006-03-01 | 2010-10-19 | Eastman Chemical Company | Polycarboxylic acid production system employing enhanced multistage oxidative digestion |
| US7772424B2 (en) * | 2006-03-01 | 2010-08-10 | Eastman Chemical Company | Polycarboxylic acid production system employing enhanced evaporative concentration downstream of oxidative digestion |
| US7847121B2 (en) * | 2006-03-01 | 2010-12-07 | Eastman Chemical Company | Carboxylic acid production process |
| DE102006016302A1 (de) * | 2006-04-06 | 2007-10-25 | Süd-Chemie AG | Verfahren zur Oxidation von Alkylbenzolen |
| US7674739B2 (en) * | 2006-04-21 | 2010-03-09 | Chevron U.S.A. Inc. | Regeneration of ionic liquid catalyst using a metal in the absence of added hydrogen |
| JP5344510B2 (ja) * | 2006-07-28 | 2013-11-20 | 国立大学法人東北大学 | 酸化方法 |
| GB0621970D0 (en) * | 2006-11-03 | 2006-12-13 | Invista Technologies S O R L | Oxidation reactions-1 |
| GB0621968D0 (en) * | 2006-11-03 | 2006-12-13 | Invista Technologies S O R L | Oxidation reactions-II |
| US7465824B2 (en) * | 2007-02-08 | 2008-12-16 | Bp Corporation North America Inc. | Process for the production of high purity aromatic carboxylic acids using a benzoic acid and water solvent for oxidation and purification |
| WO2009093862A2 (ko) * | 2008-01-25 | 2009-07-30 | Samsung Petrochemical Co., Ltd. | 다단계의 산화방식을 적용한 친환경적인 테레프탈산 제조방법 |
| GB0807904D0 (en) * | 2008-04-30 | 2008-06-04 | Invista Technologies Srl | Oxidation reactions |
| GB0808200D0 (en) * | 2008-05-06 | 2008-06-11 | Invista Technologies Srl | Power recovery |
| US20130255259A1 (en) * | 2008-10-24 | 2013-10-03 | Invista North America S.A R.L. | Power recovery for use in start-up or re-start of a pure terephthalic acid production process |
| US20100113735A1 (en) * | 2008-10-31 | 2010-05-06 | Eastman Chemical Company | Integrated Co-Production of Dicarboxylic Acids |
| KR101792347B1 (ko) * | 2014-10-31 | 2017-11-01 | 주식회사 엘지화학 | 증류 장치 |
| CN104907008B (zh) * | 2015-06-04 | 2017-10-27 | 河北科技大学 | 一种甲苯直接氧化制备苯甲酸和苯甲醛的反应装置和方法 |
| WO2019028097A1 (en) * | 2017-08-01 | 2019-02-07 | Bp Corporation North America Inc. | METHOD FOR PREHEATING WATER OF BOILER SUPPLY IN THE MANUFACTURE OF PURIFIED AROMATIC CARBOXYLIC ACIDS |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2245528A (en) * | 1938-10-18 | 1941-06-10 | Du Pont | Catalytic oxidation of alkyl substituted aromatic compounds |
| US4550198A (en) * | 1982-11-04 | 1985-10-29 | Georgia Tech Research Institute | Purification of terephthalic acid by supercritical fluid extraction |
| US5171880A (en) * | 1987-09-01 | 1992-12-15 | Allied-Signal Inc. | Oxidation of organic compounds having benzylic carbon atoms in water |
| GB9102393D0 (en) | 1991-02-05 | 1991-03-20 | Ici Plc | Production of terephthalic acid |
| GB9104776D0 (en) | 1991-03-07 | 1991-04-17 | Ici Plc | Process for the production of terephthalic acid |
| US5250193A (en) * | 1992-07-28 | 1993-10-05 | Air Products And Chemicals, Inc. | Wet oxidation of aqueous streams |
| US5674405A (en) * | 1995-07-28 | 1997-10-07 | Modar, Inc. | Method for hydrothermal oxidation |
| TR199902058T2 (xx) | 1997-02-27 | 2000-09-21 | E.I. Du Pont De Nemours & Company | Tereftalik asit �retimi. |
| JP2001079571A (ja) * | 1999-09-14 | 2001-03-27 | Toshiba Corp | 超臨界水酸化反応方法、超臨界水反応プラントおよびユーティリティプラント |
| US6765113B2 (en) * | 2000-07-19 | 2004-07-20 | E.I. Du Pont De Nemours And Company | Production of aromatic carboxylic acids |
-
2001
- 2001-07-13 US US09/905,094 patent/US6765113B2/en not_active Expired - Fee Related
- 2001-07-17 ES ES01953518T patent/ES2309080T3/es not_active Expired - Lifetime
- 2001-07-17 EG EG20010781A patent/EG22982A/xx active
- 2001-07-17 RU RU2003104827/04A patent/RU2003104827A/ru not_active Application Discontinuation
- 2001-07-17 CN CNB018131026A patent/CN1213015C/zh not_active Expired - Fee Related
- 2001-07-17 BR BRPI0112990-2A patent/BR0112990B1/pt not_active IP Right Cessation
- 2001-07-17 MY MYPI20013369A patent/MY127798A/en unknown
- 2001-07-17 AT AT01953518T patent/ATE400543T1/de not_active IP Right Cessation
- 2001-07-17 DE DE60134744T patent/DE60134744D1/de not_active Expired - Lifetime
- 2001-07-17 WO PCT/US2001/022474 patent/WO2002006201A1/en not_active Ceased
- 2001-07-17 AU AU2001275960A patent/AU2001275960A1/en not_active Abandoned
- 2001-07-17 EP EP01953518A patent/EP1301456B1/en not_active Expired - Lifetime
- 2001-07-17 KR KR20037000823A patent/KR20030019595A/ko not_active Ceased
- 2001-07-17 CA CA2413748A patent/CA2413748C/en not_active Expired - Fee Related
- 2001-07-17 JP JP2002512108A patent/JP2004504289A/ja active Pending
- 2001-07-17 MX MXPA03000502 patent/MX236902B/es active IP Right Grant
- 2001-07-18 AR ARP010103438A patent/AR029852A1/es active IP Right Grant
- 2001-07-18 DZ DZ010051A patent/DZ3117A1/xx active
-
2002
- 2002-12-18 IN IN1837MU2002 patent/IN2002MU01837A/en unknown
-
2004
- 2004-04-28 US US10/833,442 patent/US7238833B2/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| BR0112990B1 (pt) | 2012-12-11 |
| IN2002MU01837A (enExample) | 2005-02-04 |
| US20020028968A1 (en) | 2002-03-07 |
| EG22982A (en) | 2003-12-31 |
| US20040199006A1 (en) | 2004-10-07 |
| ES2309080T3 (es) | 2008-12-16 |
| RU2003104827A (ru) | 2004-07-10 |
| KR20030019595A (ko) | 2003-03-06 |
| WO2002006201A1 (en) | 2002-01-24 |
| AU2001275960A1 (en) | 2002-01-30 |
| EP1301456B1 (en) | 2008-07-09 |
| DZ3117A1 (fr) | 2004-09-19 |
| US6765113B2 (en) | 2004-07-20 |
| CA2413748A1 (en) | 2002-01-24 |
| MY127798A (en) | 2006-12-29 |
| EP1301456A1 (en) | 2003-04-16 |
| CN1443152A (zh) | 2003-09-17 |
| US7238833B2 (en) | 2007-07-03 |
| BR0112990A (pt) | 2003-06-24 |
| JP2004504289A (ja) | 2004-02-12 |
| MXPA03000502A (es) | 2003-10-15 |
| ATE400543T1 (de) | 2008-07-15 |
| CN1213015C (zh) | 2005-08-03 |
| MX236902B (es) | 2006-05-15 |
| AR029852A1 (es) | 2003-07-16 |
| DE60134744D1 (de) | 2008-08-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA2413748C (en) | Production of aromatic carboxylic acids | |
| Hamley et al. | Selective partial oxidation in supercritical water: the continuous generation of terephthalic acid from para-xylene in high yield | |
| US5004830A (en) | Process for oxidation of alkyl aromatic compounds | |
| SA03240429B1 (ar) | عملية لإنتاج أحماض كربوكسيلية أروماتية aromatic carboxylic acids | |
| CN102076408B (zh) | 用于制备芳族羧酸的在超临界或近超临界水中的催化氧化反应 | |
| EP3089957B1 (en) | Purification of aromatic carboxylic acids | |
| WO2001051442A2 (en) | Improved process for producing carboxylic acids | |
| EP1542958B1 (en) | Process for producing aromatic dicarboxylic acids under supercritical conditions | |
| ZA200210037B (en) | Production of aromatic carboxylic acids. | |
| TS et al. | PONTDENEMOURS AND COMPANY [US/US]; 1007 | |
| WO2008057924A1 (en) | Oxidation reaction for producing aromatic carboxylic acids | |
| WO2008070365A2 (en) | Oxidation reaction for producing aromatic carboxylic acids | |
| HK1158133A (en) | Catalytic oxidation reactions in supercritical or near-supercritical water for the production of an aromatic carboxylic acid |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| EEER | Examination request | ||
| MKLA | Lapsed |
Effective date: 20130717 |