CA2371726A1 - Cyclocarbamate derivatives as progesterone receptor modulators - Google Patents
Cyclocarbamate derivatives as progesterone receptor modulators Download PDFInfo
- Publication number
- CA2371726A1 CA2371726A1 CA002371726A CA2371726A CA2371726A1 CA 2371726 A1 CA2371726 A1 CA 2371726A1 CA 002371726 A CA002371726 A CA 002371726A CA 2371726 A CA2371726 A CA 2371726A CA 2371726 A1 CA2371726 A1 CA 2371726A1
- Authority
- CA
- Canada
- Prior art keywords
- substituted
- alkyl
- oxazin
- dihydro
- dimethyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Abandoned
Links
- 239000002379 progesterone receptor modulator Substances 0.000 title description 4
- 229940095745 sex hormone and modulator of the genital system progesterone receptor modulator Drugs 0.000 title description 4
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 145
- 150000001875 compounds Chemical class 0.000 claims abstract description 137
- 238000000034 method Methods 0.000 claims abstract description 114
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 96
- 125000004103 aminoalkyl group Chemical group 0.000 claims abstract description 64
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 claims abstract description 54
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 43
- 150000002367 halogens Chemical class 0.000 claims abstract description 43
- 125000003118 aryl group Chemical group 0.000 claims abstract description 38
- 150000003839 salts Chemical class 0.000 claims abstract description 33
- 125000003342 alkenyl group Chemical group 0.000 claims abstract description 29
- 125000003107 substituted aryl group Chemical group 0.000 claims abstract description 29
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 27
- 125000001424 substituent group Chemical group 0.000 claims abstract description 26
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims abstract description 22
- 125000000304 alkynyl group Chemical group 0.000 claims abstract description 21
- 125000005842 heteroatom Chemical group 0.000 claims abstract description 21
- 229910052717 sulfur Inorganic materials 0.000 claims abstract description 16
- 125000004426 substituted alkynyl group Chemical group 0.000 claims abstract description 12
- 239000008194 pharmaceutical composition Substances 0.000 claims abstract description 6
- 229910052757 nitrogen Inorganic materials 0.000 claims description 78
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 73
- 125000000623 heterocyclic group Chemical group 0.000 claims description 24
- 229910052739 hydrogen Inorganic materials 0.000 claims description 23
- -1 -OH Chemical group 0.000 claims description 20
- 125000005309 thioalkoxy group Chemical group 0.000 claims description 19
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 16
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 10
- KVMSWMUZFCLLFV-UHFFFAOYSA-N 3-(4,4-dimethyl-2-oxo-1h-3,1-benzoxazin-6-yl)-5-fluorobenzonitrile Chemical compound C1=C2C(C)(C)OC(=O)NC2=CC=C1C1=CC(F)=CC(C#N)=C1 KVMSWMUZFCLLFV-UHFFFAOYSA-N 0.000 claims description 8
- 241000124008 Mammalia Species 0.000 claims description 8
- JCXJVPUVTGWSNB-UHFFFAOYSA-N Nitrogen dioxide Chemical group O=[N]=O JCXJVPUVTGWSNB-UHFFFAOYSA-N 0.000 claims description 8
- 125000002373 5 membered heterocyclic group Chemical group 0.000 claims description 7
- 229940088597 hormone Drugs 0.000 claims description 7
- 239000005556 hormone Substances 0.000 claims description 7
- HVXMMYUSBANZAI-UHFFFAOYSA-N 3-(4,4-dimethyl-2-oxo-1h-3,1-benzoxazin-6-yl)benzonitrile Chemical compound C1=C2C(C)(C)OC(=O)NC2=CC=C1C1=CC=CC(C#N)=C1 HVXMMYUSBANZAI-UHFFFAOYSA-N 0.000 claims description 6
- 229910052731 fluorine Inorganic materials 0.000 claims description 6
- UWIIXWIVGXAFAN-UHFFFAOYSA-N 6-(3-bromo-5-fluorophenyl)-4,4-dimethyl-1h-3,1-benzoxazin-2-one Chemical compound C1=C2C(C)(C)OC(=O)NC2=CC=C1C1=CC(F)=CC(Br)=C1 UWIIXWIVGXAFAN-UHFFFAOYSA-N 0.000 claims description 5
- 230000001419 dependent effect Effects 0.000 claims description 5
- YMIYWAUOFRPGBF-UHFFFAOYSA-N 3-fluoro-5-[1-(methoxymethyl)-4,4-dimethyl-2-oxo-3,1-benzoxazin-6-yl]benzonitrile Chemical compound C=1C=C2N(COC)C(=O)OC(C)(C)C2=CC=1C1=CC(F)=CC(C#N)=C1 YMIYWAUOFRPGBF-UHFFFAOYSA-N 0.000 claims description 4
- PPDYGKBOJSGKBD-UHFFFAOYSA-N 6-(3-bromophenyl)-4,4-dimethyl-1h-3,1-benzoxazin-2-one Chemical compound C1=C2C(C)(C)OC(=O)NC2=CC=C1C1=CC=CC(Br)=C1 PPDYGKBOJSGKBD-UHFFFAOYSA-N 0.000 claims description 4
- 201000009273 Endometriosis Diseases 0.000 claims description 4
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 4
- 206010046798 Uterine leiomyoma Diseases 0.000 claims description 4
- 150000001555 benzenes Chemical group 0.000 claims description 4
- 239000011737 fluorine Substances 0.000 claims description 4
- 201000010260 leiomyoma Diseases 0.000 claims description 4
- 125000005017 substituted alkenyl group Chemical group 0.000 claims description 4
- 125000004001 thioalkyl group Chemical group 0.000 claims description 4
- PNEKYSUBNQXRHM-UHFFFAOYSA-N 4,4-dimethyl-6-(1-methylpyrrol-2-yl)-1h-3,1-benzoxazin-2-one Chemical compound CN1C=CC=C1C1=CC=C(NC(=O)OC2(C)C)C2=C1 PNEKYSUBNQXRHM-UHFFFAOYSA-N 0.000 claims description 3
- QWIQKRAABPUAGQ-UHFFFAOYSA-N 4,4-dimethyl-6-[2-(1,2,4-thiadiazol-3-yl)phenyl]-1h-3,1-benzoxazin-2-one Chemical compound C1=C2C(C)(C)OC(=O)NC2=CC=C1C1=CC=CC=C1C=1N=CSN=1 QWIQKRAABPUAGQ-UHFFFAOYSA-N 0.000 claims description 3
- DZRIKLQQKVBDJJ-UHFFFAOYSA-N 4,4-dimethyl-6-[3-(2-trimethylsilylethynyl)phenyl]-1h-3,1-benzoxazin-2-one Chemical compound C1=C2C(C)(C)OC(=O)NC2=CC=C1C1=CC=CC(C#C[Si](C)(C)C)=C1 DZRIKLQQKVBDJJ-UHFFFAOYSA-N 0.000 claims description 3
- QYXWQJJMCRIUKE-UHFFFAOYSA-N 5-(4,4-dimethyl-2-oxo-1h-3,1-benzoxazin-6-yl)-2-fluorobenzonitrile Chemical compound C1=C2C(C)(C)OC(=O)NC2=CC=C1C1=CC=C(F)C(C#N)=C1 QYXWQJJMCRIUKE-UHFFFAOYSA-N 0.000 claims description 3
- WRAWKFUWOAFTDQ-UHFFFAOYSA-N 5-(4,4-dimethyl-2-oxo-1h-3,1-benzoxazin-6-yl)furan-2-carbonitrile Chemical compound C1=C2C(C)(C)OC(=O)NC2=CC=C1C1=CC=C(C#N)O1 WRAWKFUWOAFTDQ-UHFFFAOYSA-N 0.000 claims description 3
- MESNIJJPCGWIQB-UHFFFAOYSA-N 6-(3-acetylphenyl)-4,4-dimethyl-1h-3,1-benzoxazin-2-one Chemical compound CC(=O)C1=CC=CC(C=2C=C3C(C)(C)OC(=O)NC3=CC=2)=C1 MESNIJJPCGWIQB-UHFFFAOYSA-N 0.000 claims description 3
- LGLOOLWMNDHTKN-UHFFFAOYSA-N 6-(3-bromo-5-fluorophenyl)-4,4-dicyclopropyl-1h-3,1-benzoxazin-2-one Chemical compound FC1=CC(Br)=CC(C=2C=C3C(C4CC4)(C4CC4)OC(=O)NC3=CC=2)=C1 LGLOOLWMNDHTKN-UHFFFAOYSA-N 0.000 claims description 3
- JRDFVXBVDLMFJH-UHFFFAOYSA-N 6-(3-bromo-5-methylphenyl)-4,4-dimethyl-1h-3,1-benzoxazin-2-one Chemical compound CC1=CC(Br)=CC(C=2C=C3C(C)(C)OC(=O)NC3=CC=2)=C1 JRDFVXBVDLMFJH-UHFFFAOYSA-N 0.000 claims description 3
- PRCXSDHAGJJCKC-UHFFFAOYSA-N 6-(3-chloro-4-fluorophenyl)-4,4-dimethyl-1h-3,1-benzoxazin-2-one Chemical compound C1=C2C(C)(C)OC(=O)NC2=CC=C1C1=CC=C(F)C(Cl)=C1 PRCXSDHAGJJCKC-UHFFFAOYSA-N 0.000 claims description 3
- VMPIROWONHUKCP-UHFFFAOYSA-N 6-(3-chlorophenyl)-4,4-dimethyl-1h-3,1-benzoxazin-2-one Chemical compound C1=C2C(C)(C)OC(=O)NC2=CC=C1C1=CC=CC(Cl)=C1 VMPIROWONHUKCP-UHFFFAOYSA-N 0.000 claims description 3
- UNTRVRJHIUBUIT-UHFFFAOYSA-N 6-(3-chlorophenyl)-4-methyl-1,4-dihydro-3,1-benzoxazin-2-one Chemical compound C1=C2C(C)OC(=O)NC2=CC=C1C1=CC=CC(Cl)=C1 UNTRVRJHIUBUIT-UHFFFAOYSA-N 0.000 claims description 3
- YKEDHPYOLSKGHE-UHFFFAOYSA-N 6-(3-ethynylphenyl)-4,4-dimethyl-1h-3,1-benzoxazin-2-one Chemical compound C1=C2C(C)(C)OC(=O)NC2=CC=C1C1=CC=CC(C#C)=C1 YKEDHPYOLSKGHE-UHFFFAOYSA-N 0.000 claims description 3
- QTVMSASXEDWDST-UHFFFAOYSA-N 6-(5-bromopyridin-3-yl)-4,4-dimethyl-1h-3,1-benzoxazin-2-one Chemical compound C1=C2C(C)(C)OC(=O)NC2=CC=C1C1=CN=CC(Br)=C1 QTVMSASXEDWDST-UHFFFAOYSA-N 0.000 claims description 3
- FKJUYZPFOJIRIG-UHFFFAOYSA-N 6-chloro-4-methyl-4-(trifluoromethyl)-1h-3,1-benzoxazin-2-one Chemical compound C1=C(Cl)C=C2C(C)(C(F)(F)F)OC(=O)NC2=C1 FKJUYZPFOJIRIG-UHFFFAOYSA-N 0.000 claims description 3
- CDVKDGYSTHYNBL-UHFFFAOYSA-N [6-(3-cyano-5-fluorophenyl)-4,4-dimethyl-3,1-benzoxazin-2-yl] dihydrogen phosphate Chemical compound C1=C2C(C)(C)OC(OP(O)(O)=O)=NC2=CC=C1C1=CC(F)=CC(C#N)=C1 CDVKDGYSTHYNBL-UHFFFAOYSA-N 0.000 claims description 3
- 210000000481 breast Anatomy 0.000 claims description 3
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 3
- FEVGHBLMPKIPFU-UHFFFAOYSA-N tert-butyl 2-(4,4-dimethyl-2-oxo-1h-3,1-benzoxazin-6-yl)pyrrole-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1C=CC=C1C1=CC=C(NC(=O)OC2(C)C)C2=C1 FEVGHBLMPKIPFU-UHFFFAOYSA-N 0.000 claims description 3
- WBRVELFLQXWPBG-UHFFFAOYSA-N 2-(4,4-dimethyl-2-oxo-1h-3,1-benzoxazin-6-yl)thiophene-3-carbonitrile Chemical compound C1=C2C(C)(C)OC(=O)NC2=CC=C1C=1SC=CC=1C#N WBRVELFLQXWPBG-UHFFFAOYSA-N 0.000 claims description 2
- IDIRENXOSJYSCR-UHFFFAOYSA-N 2-[3-(4,4-dimethyl-2-oxo-1h-3,1-benzoxazin-6-yl)phenyl]acetonitrile Chemical compound C1=C2C(C)(C)OC(=O)NC2=CC=C1C1=CC=CC(CC#N)=C1 IDIRENXOSJYSCR-UHFFFAOYSA-N 0.000 claims description 2
- VHIBSIPZVHZJEI-UHFFFAOYSA-N 3-(2-oxospiro[1h-3,1-benzoxazine-4,1'-cyclohexane]-6-yl)benzonitrile Chemical compound O1C(=O)NC2=CC=C(C=3C=C(C=CC=3)C#N)C=C2C21CCCCC2 VHIBSIPZVHZJEI-UHFFFAOYSA-N 0.000 claims description 2
- LTCHZBXTHMXHAR-UHFFFAOYSA-N 3-(4,4-dicyclopropyl-2-oxo-1h-3,1-benzoxazin-6-yl)-5-fluorobenzonitrile Chemical compound FC1=CC(C#N)=CC(C=2C=C3C(C4CC4)(C4CC4)OC(=O)NC3=CC=2)=C1 LTCHZBXTHMXHAR-UHFFFAOYSA-N 0.000 claims description 2
- NLEVEIAQKTVSTO-UHFFFAOYSA-N 3-(4,4-dimethyl-2-oxo-1h-3,1-benzoxazin-6-yl)-5-(trifluoromethoxy)benzonitrile Chemical compound C1=C2C(C)(C)OC(=O)NC2=CC=C1C1=CC(OC(F)(F)F)=CC(C#N)=C1 NLEVEIAQKTVSTO-UHFFFAOYSA-N 0.000 claims description 2
- JGYMUYVJOIEFFQ-UHFFFAOYSA-N 3-(4,4-dimethyl-2-oxo-1h-3,1-benzoxazin-6-yl)-5-methoxybenzonitrile Chemical compound COC1=CC(C#N)=CC(C=2C=C3C(C)(C)OC(=O)NC3=CC=2)=C1 JGYMUYVJOIEFFQ-UHFFFAOYSA-N 0.000 claims description 2
- UAMDLTQRXMVMJV-UHFFFAOYSA-N 3-[1-(diethoxymethyl)-4,4-dimethyl-2-oxo-3,1-benzoxazin-6-yl]-5-fluorobenzonitrile Chemical compound C=1C=C2N(C(OCC)OCC)C(=O)OC(C)(C)C2=CC=1C1=CC(F)=CC(C#N)=C1 UAMDLTQRXMVMJV-UHFFFAOYSA-N 0.000 claims description 2
- JBBNXDUWXGONHM-UHFFFAOYSA-N 3-[3-(4,4-dimethyl-2-oxo-1h-3,1-benzoxazin-6-yl)phenyl]prop-2-ynenitrile Chemical compound C1=C2C(C)(C)OC(=O)NC2=CC=C1C1=CC=CC(C#CC#N)=C1 JBBNXDUWXGONHM-UHFFFAOYSA-N 0.000 claims description 2
- QRNMAUBTQDBSSM-UHFFFAOYSA-N 3-fluoro-5-(2-oxospiro[1h-3,1-benzoxazine-4,1'-cyclohexane]-6-yl)benzonitrile Chemical compound FC1=CC(C#N)=CC(C=2C=C3C4(CCCCC4)OC(=O)NC3=CC=2)=C1 QRNMAUBTQDBSSM-UHFFFAOYSA-N 0.000 claims description 2
- PKVIKTBQZZTING-UHFFFAOYSA-N 3-fluoro-5-(8-fluoro-4,4-dimethyl-2-oxo-1h-3,1-benzoxazin-6-yl)benzonitrile Chemical compound C1=C2C(C)(C)OC(=O)NC2=C(F)C=C1C1=CC(F)=CC(C#N)=C1 PKVIKTBQZZTING-UHFFFAOYSA-N 0.000 claims description 2
- MEIWUXZPJSPWJO-UHFFFAOYSA-N 4,4-diethyl-6-(3-nitrophenyl)-1h-3,1-benzoxazin-2-one Chemical compound C1=C2C(CC)(CC)OC(=O)NC2=CC=C1C1=CC=CC([N+]([O-])=O)=C1 MEIWUXZPJSPWJO-UHFFFAOYSA-N 0.000 claims description 2
- SMKZYKBPVNAOJL-UHFFFAOYSA-N 4,4-dimethyl-6-(1h-pyrrol-2-yl)-1h-3,1-benzoxazin-2-one Chemical compound C1=C2C(C)(C)OC(=O)NC2=CC=C1C1=CC=CN1 SMKZYKBPVNAOJL-UHFFFAOYSA-N 0.000 claims description 2
- AXVHYEZJTTVOJH-UHFFFAOYSA-N 4,4-dimethyl-6-(3-nitrophenyl)-1h-3,1-benzoxazin-2-one Chemical compound C1=C2C(C)(C)OC(=O)NC2=CC=C1C1=CC=CC([N+]([O-])=O)=C1 AXVHYEZJTTVOJH-UHFFFAOYSA-N 0.000 claims description 2
- CHSVPWMJSJAVAI-UHFFFAOYSA-N 4,4-dimethyl-6-[3-(1,3-thiazol-2-yl)phenyl]-1h-3,1-benzoxazin-2-one Chemical compound C1=C2C(C)(C)OC(=O)NC2=CC=C1C(C=1)=CC=CC=1C1=NC=CS1 CHSVPWMJSJAVAI-UHFFFAOYSA-N 0.000 claims description 2
- RHSCGZFJZHKZNC-UHFFFAOYSA-N 4,4-dimethyl-6-[3-(2h-tetrazol-5-yl)phenyl]-1h-3,1-benzoxazin-2-one Chemical compound C1=C2C(C)(C)OC(=O)NC2=CC=C1C(C=1)=CC=CC=1C1=NN=NN1 RHSCGZFJZHKZNC-UHFFFAOYSA-N 0.000 claims description 2
- GNFOFPBRTHXTEC-UHFFFAOYSA-N 4-(8-fluoro-4,4-dimethyl-2-oxo-1h-3,1-benzoxazin-6-yl)thiophene-2-carbonitrile Chemical compound C1=C2C(C)(C)OC(=O)NC2=C(F)C=C1C1=CSC(C#N)=C1 GNFOFPBRTHXTEC-UHFFFAOYSA-N 0.000 claims description 2
- JXNHGWCUOXLKRL-UHFFFAOYSA-N 4-benzyl-6-(3-chlorophenyl)-4-methyl-1h-3,1-benzoxazin-2-one Chemical compound O1C(=O)NC2=CC=C(C=3C=C(Cl)C=CC=3)C=C2C1(C)CC1=CC=CC=C1 JXNHGWCUOXLKRL-UHFFFAOYSA-N 0.000 claims description 2
- SVVIWFMTYDOJQX-UHFFFAOYSA-N 5-(2-oxospiro[1h-3,1-benzoxazine-4,1'-cyclohexane]-6-yl)thiophene-2-carbonitrile Chemical compound O1C(=O)NC2=CC=C(C=3SC(=CC=3)C#N)C=C2C21CCCCC2 SVVIWFMTYDOJQX-UHFFFAOYSA-N 0.000 claims description 2
- QAXWFQCRQFUILZ-UHFFFAOYSA-N 5-(4,4-dimethyl-2-oxo-1h-3,1-benzoxazin-6-yl)-4-ethylthiophene-2-carbonitrile Chemical compound C1=C(C#N)SC(C=2C=C3C(C)(C)OC(=O)NC3=CC=2)=C1CC QAXWFQCRQFUILZ-UHFFFAOYSA-N 0.000 claims description 2
- FUMWUTSVOOBPCJ-UHFFFAOYSA-N 5-(4,4-dimethyl-2-oxo-1h-3,1-benzoxazin-6-yl)-4-methylthiophene-2-carbonitrile Chemical compound C1=C(C#N)SC(C=2C=C3C(C)(C)OC(=O)NC3=CC=2)=C1C FUMWUTSVOOBPCJ-UHFFFAOYSA-N 0.000 claims description 2
- SHQHKBVTNRRGGP-UHFFFAOYSA-N 5-(4,4-dimethyl-2-oxo-1h-3,1-benzoxazin-6-yl)-4-propylthiophene-2-carbonitrile Chemical compound C1=C(C#N)SC(C=2C=C3C(C)(C)OC(=O)NC3=CC=2)=C1CCC SHQHKBVTNRRGGP-UHFFFAOYSA-N 0.000 claims description 2
- OUVMNSFSOSJAQL-UHFFFAOYSA-N 5-(4,4-dimethyl-2-oxo-1h-3,1-benzoxazin-6-yl)benzene-1,3-dicarbonitrile Chemical compound C1=C2C(C)(C)OC(=O)NC2=CC=C1C1=CC(C#N)=CC(C#N)=C1 OUVMNSFSOSJAQL-UHFFFAOYSA-N 0.000 claims description 2
- HEGVHYGSMSJKPP-UHFFFAOYSA-N 5-(4,4-dimethyl-2-oxo-1h-3,1-benzoxazin-6-yl)pyridine-3-carbonitrile Chemical compound C1=C2C(C)(C)OC(=O)NC2=CC=C1C1=CN=CC(C#N)=C1 HEGVHYGSMSJKPP-UHFFFAOYSA-N 0.000 claims description 2
- BGAWWRLMFNCAKP-UHFFFAOYSA-N 5-(4,4-dimethyl-2-oxo-1h-3,1-benzoxazin-6-yl)thiophene-2-carbonitrile Chemical compound C1=C2C(C)(C)OC(=O)NC2=CC=C1C1=CC=C(C#N)S1 BGAWWRLMFNCAKP-UHFFFAOYSA-N 0.000 claims description 2
- 125000004070 6 membered heterocyclic group Chemical group 0.000 claims description 2
- MGCPANQAGXWBFT-UHFFFAOYSA-N 6-(2-chlorophenyl)-4,4-dimethyl-1h-3,1-benzoxazin-2-one Chemical compound C1=C2C(C)(C)OC(=O)NC2=CC=C1C1=CC=CC=C1Cl MGCPANQAGXWBFT-UHFFFAOYSA-N 0.000 claims description 2
- OXOFQEFTKANGHA-UHFFFAOYSA-N 6-(3,4-difluorophenyl)-4,4-dimethyl-1h-3,1-benzoxazin-2-one Chemical compound C1=C2C(C)(C)OC(=O)NC2=CC=C1C1=CC=C(F)C(F)=C1 OXOFQEFTKANGHA-UHFFFAOYSA-N 0.000 claims description 2
- GRPMNBASJAVOAN-UHFFFAOYSA-N 6-(3,5-dichlorophenyl)-4,4-dimethyl-1h-3,1-benzoxazin-2-one Chemical compound C1=C2C(C)(C)OC(=O)NC2=CC=C1C1=CC(Cl)=CC(Cl)=C1 GRPMNBASJAVOAN-UHFFFAOYSA-N 0.000 claims description 2
- XKXYGOFFUINVOY-UHFFFAOYSA-N 6-(3,5-difluorophenyl)-4,4-dimethyl-1h-3,1-benzoxazin-2-one Chemical compound C1=C2C(C)(C)OC(=O)NC2=CC=C1C1=CC(F)=CC(F)=C1 XKXYGOFFUINVOY-UHFFFAOYSA-N 0.000 claims description 2
- DUGCMPPGABAONL-UHFFFAOYSA-N 6-(3,5-dinitrophenyl)-4,4-dimethyl-1h-3,1-benzoxazin-2-one Chemical compound C1=C2C(C)(C)OC(=O)NC2=CC=C1C1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1 DUGCMPPGABAONL-UHFFFAOYSA-N 0.000 claims description 2
- COCHTGRDEIHWSU-UHFFFAOYSA-N 6-(3-bromo-5-fluorophenyl)-1,4,4-trimethyl-3,1-benzoxazin-2-one Chemical compound C=1C=C2N(C)C(=O)OC(C)(C)C2=CC=1C1=CC(F)=CC(Br)=C1 COCHTGRDEIHWSU-UHFFFAOYSA-N 0.000 claims description 2
- QXXOGHDDSWRZPI-UHFFFAOYSA-N 6-(3-chloro-4-fluorophenyl)-8-fluoro-4,4-dimethyl-1h-3,1-benzoxazin-2-one Chemical compound C1=C2C(C)(C)OC(=O)NC2=C(F)C=C1C1=CC=C(F)C(Cl)=C1 QXXOGHDDSWRZPI-UHFFFAOYSA-N 0.000 claims description 2
- QFJFPUFDMQGULL-UHFFFAOYSA-N 6-(3-chloro-5-fluorophenyl)-4,4-dimethyl-1h-3,1-benzoxazin-2-one Chemical compound C1=C2C(C)(C)OC(=O)NC2=CC=C1C1=CC(F)=CC(Cl)=C1 QFJFPUFDMQGULL-UHFFFAOYSA-N 0.000 claims description 2
- BVPSAWJCIXNPDT-UHFFFAOYSA-N 6-(3-chlorophenyl)-4,4-bis(prop-1-ynyl)-1h-3,1-benzoxazin-2-one Chemical compound C1=C2C(C#CC)(C#CC)OC(=O)NC2=CC=C1C1=CC=CC(Cl)=C1 BVPSAWJCIXNPDT-UHFFFAOYSA-N 0.000 claims description 2
- UVVCMVFRQNXKIS-UHFFFAOYSA-N 6-(3-chlorophenyl)-4,4-dicyclopropyl-1h-3,1-benzoxazin-2-one Chemical compound ClC1=CC=CC(C=2C=C3C(C4CC4)(C4CC4)OC(=O)NC3=CC=2)=C1 UVVCMVFRQNXKIS-UHFFFAOYSA-N 0.000 claims description 2
- ZFMGZMLOROWZPV-UHFFFAOYSA-N 6-(3-chlorophenyl)-4,4-diethyl-1h-3,1-benzoxazin-2-one Chemical compound C1=C2C(CC)(CC)OC(=O)NC2=CC=C1C1=CC=CC(Cl)=C1 ZFMGZMLOROWZPV-UHFFFAOYSA-N 0.000 claims description 2
- CPDGATVXBVRXCW-UHFFFAOYSA-N 6-(3-chlorophenyl)-4-cyclopropyl-4-methyl-1h-3,1-benzoxazin-2-one Chemical compound C1=C2C(C)(C3CC3)OC(=O)NC2=CC=C1C1=CC=CC(Cl)=C1 CPDGATVXBVRXCW-UHFFFAOYSA-N 0.000 claims description 2
- DGTZEHQWPNSIJS-UHFFFAOYSA-N 6-(3-chlorophenyl)-4-cyclopropyl-4-prop-1-ynyl-1h-3,1-benzoxazin-2-one Chemical compound C1=C2C(C#CC)(C3CC3)OC(=O)NC2=CC=C1C1=CC=CC(Cl)=C1 DGTZEHQWPNSIJS-UHFFFAOYSA-N 0.000 claims description 2
- WAXDJIOKYGGYRK-UHFFFAOYSA-N 6-(3-chlorophenyl)-4-ethyl-1,4-dihydro-3,1-benzoxazin-2-one Chemical compound C1=C2C(CC)OC(=O)NC2=CC=C1C1=CC=CC(Cl)=C1 WAXDJIOKYGGYRK-UHFFFAOYSA-N 0.000 claims description 2
- OVZBDRQFIYMAJF-UHFFFAOYSA-N 6-(3-chlorophenyl)-4-ethynyl-4-methyl-1h-3,1-benzoxazin-2-one Chemical compound C1=C2C(C)(C#C)OC(=O)NC2=CC=C1C1=CC=CC(Cl)=C1 OVZBDRQFIYMAJF-UHFFFAOYSA-N 0.000 claims description 2
- YTLKMKKTJYVGCW-UHFFFAOYSA-N 6-(3-chlorophenyl)-4-methyl-4-phenyl-1h-3,1-benzoxazin-2-one Chemical compound C1=C2C(C)(C=3C=CC=CC=3)OC(=O)NC2=CC=C1C1=CC=CC(Cl)=C1 YTLKMKKTJYVGCW-UHFFFAOYSA-N 0.000 claims description 2
- HZDVGBZUSRBRKH-UHFFFAOYSA-N 6-(3-chlorophenyl)-4-methyl-4-prop-1-ynyl-1h-3,1-benzoxazin-2-one Chemical compound C1=C2C(C#CC)(C)OC(=O)NC2=CC=C1C1=CC=CC(Cl)=C1 HZDVGBZUSRBRKH-UHFFFAOYSA-N 0.000 claims description 2
- RTYILLPPQLHABM-UHFFFAOYSA-N 6-(3-chlorophenyl)-4-phenyl-1,4-dihydro-3,1-benzoxazin-2-one Chemical compound ClC1=CC=CC(C=2C=C3C(C=4C=CC=CC=4)OC(=O)NC3=CC=2)=C1 RTYILLPPQLHABM-UHFFFAOYSA-N 0.000 claims description 2
- GKEMTHTTWRREOR-UHFFFAOYSA-N 6-(3-chlorophenyl)spiro[1h-3,1-benzoxazine-4,1'-cyclopentane]-2-one Chemical compound ClC1=CC=CC(C=2C=C3C4(CCCC4)OC(=O)NC3=CC=2)=C1 GKEMTHTTWRREOR-UHFFFAOYSA-N 0.000 claims description 2
- PXPJJZAEWGAMEB-UHFFFAOYSA-N 6-(3-methoxyphenyl)-4-methyl-4-(trifluoromethyl)-1h-3,1-benzoxazin-2-one Chemical compound COC1=CC=CC(C=2C=C3C(C)(OC(=O)NC3=CC=2)C(F)(F)F)=C1 PXPJJZAEWGAMEB-UHFFFAOYSA-N 0.000 claims description 2
- OPDCNYIKZJFXTA-UHFFFAOYSA-N 6-[3,5-bis(trifluoromethyl)phenyl]-4,4-dimethyl-1h-3,1-benzoxazin-2-one Chemical compound C1=C2C(C)(C)OC(=O)NC2=CC=C1C1=CC(C(F)(F)F)=CC(C(F)(F)F)=C1 OPDCNYIKZJFXTA-UHFFFAOYSA-N 0.000 claims description 2
- LBLQYBYBFGZIGA-UHFFFAOYSA-N 6-[3-fluoro-5-(trifluoromethyl)phenyl]-4,4-dimethyl-1h-3,1-benzoxazin-2-one Chemical compound C1=C2C(C)(C)OC(=O)NC2=CC=C1C1=CC(F)=CC(C(F)(F)F)=C1 LBLQYBYBFGZIGA-UHFFFAOYSA-N 0.000 claims description 2
- DZNDZMZTJDGMNC-UHFFFAOYSA-N 7-(3-methoxyphenyl)-4,4-dimethyl-1h-3,1-benzoxazin-2-one Chemical compound COC1=CC=CC(C=2C=C3C(C(OC(=O)N3)(C)C)=CC=2)=C1 DZNDZMZTJDGMNC-UHFFFAOYSA-N 0.000 claims description 2
- 125000005330 8 membered heterocyclic group Chemical group 0.000 claims description 2
- 206010004446 Benign prostatic hyperplasia Diseases 0.000 claims description 2
- 201000009030 Carcinoma Diseases 0.000 claims description 2
- 208000004403 Prostatic Hyperplasia Diseases 0.000 claims description 2
- 208000009956 adenocarcinoma Diseases 0.000 claims description 2
- 210000001072 colon Anatomy 0.000 claims description 2
- 210000004696 endometrium Anatomy 0.000 claims description 2
- 230000012173 estrus Effects 0.000 claims description 2
- 206010027191 meningioma Diseases 0.000 claims description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 2
- 230000002632 myometrial effect Effects 0.000 claims description 2
- 210000001672 ovary Anatomy 0.000 claims description 2
- 230000001817 pituitary effect Effects 0.000 claims description 2
- 210000002307 prostate Anatomy 0.000 claims description 2
- RWZWZULHLIFOAI-UHFFFAOYSA-N tert-butyl 6-(3-cyano-5-fluorophenyl)-4,4-dimethyl-2-oxo-3,1-benzoxazine-1-carboxylate Chemical compound C=1C=C2N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C2=CC=1C1=CC(F)=CC(C#N)=C1 RWZWZULHLIFOAI-UHFFFAOYSA-N 0.000 claims description 2
- 125000006664 (C1-C3) perfluoroalkyl group Chemical group 0.000 claims 4
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 claims 4
- 201000010099 disease Diseases 0.000 claims 2
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims 2
- 230000001613 neoplastic effect Effects 0.000 claims 2
- VRJCQRGVUDAVSG-UHFFFAOYSA-N 2-(4,4-dimethyl-2-oxo-1H-3,1-benzoxazin-6-yl)-5-nitropyrrole-1-carboxylic acid Chemical compound CC1(C2=C(NC(O1)=O)C=CC(=C2)C=1N(C(=CC=1)[N+](=O)[O-])C(=O)O)C VRJCQRGVUDAVSG-UHFFFAOYSA-N 0.000 claims 1
- MMRUWYPAERDHDX-UHFFFAOYSA-N 3-(4,4-dimethyl-2-oxo-1h-3,1-benzoxazin-6-yl)-2-fluorobenzonitrile Chemical compound C1=C2C(C)(C)OC(=O)NC2=CC=C1C1=CC=CC(C#N)=C1F MMRUWYPAERDHDX-UHFFFAOYSA-N 0.000 claims 1
- VRFFPOVHAWBDBG-UHFFFAOYSA-N 3-(4,4-dimethyl-2-oxo-1h-3,1-benzoxazin-6-yl)-4-fluorobenzonitrile Chemical compound C1=C2C(C)(C)OC(=O)NC2=CC=C1C1=CC(C#N)=CC=C1F VRFFPOVHAWBDBG-UHFFFAOYSA-N 0.000 claims 1
- GRRPAAFLOYWEHA-UHFFFAOYSA-N 3-(4,4-dimethyl-2-oxo-1h-3,1-benzoxazin-6-yl)-5-methylbenzonitrile Chemical compound CC1=CC(C#N)=CC(C=2C=C3C(C)(C)OC(=O)NC3=CC=2)=C1 GRRPAAFLOYWEHA-UHFFFAOYSA-N 0.000 claims 1
- NTBMICWLTLYFGW-UHFFFAOYSA-N 3-chloro-5-(4,4-dimethyl-2-oxo-1h-3,1-benzoxazin-6-yl)benzonitrile Chemical compound C1=C2C(C)(C)OC(=O)NC2=CC=C1C1=CC(Cl)=CC(C#N)=C1 NTBMICWLTLYFGW-UHFFFAOYSA-N 0.000 claims 1
- YYHMNNAXMFGWBB-UHFFFAOYSA-N 4,4-dimethyl-6-(1-methyl-5-nitropyrrol-2-yl)-1h-3,1-benzoxazin-2-one Chemical compound C1=C([N+]([O-])=O)N(C)C(C=2C=C3C(C)(C)OC(=O)NC3=CC=2)=C1 YYHMNNAXMFGWBB-UHFFFAOYSA-N 0.000 claims 1
- QHHQRGUMAXRMAY-UHFFFAOYSA-N 4-(2-oxospiro[1h-3,1-benzoxazine-4,1'-cyclohexane]-6-yl)thiophene-2-carbonitrile Chemical compound O1C(=O)NC2=CC=C(C=3C=C(SC=3)C#N)C=C2C21CCCCC2 QHHQRGUMAXRMAY-UHFFFAOYSA-N 0.000 claims 1
- IRWYDKDYOSVIDZ-UHFFFAOYSA-N 4-(4,4-dicyclopropyl-2-oxo-1h-3,1-benzoxazin-6-yl)thiophene-2-carbonitrile Chemical compound O1C(=O)NC2=CC=C(C=3C=C(SC=3)C#N)C=C2C1(C1CC1)C1CC1 IRWYDKDYOSVIDZ-UHFFFAOYSA-N 0.000 claims 1
- IJSGDARRCNDONL-UHFFFAOYSA-N 4-(4,4-dimethyl-2-oxo-1h-3,1-benzoxazin-6-yl)furan-2-carbonitrile Chemical compound C1=C2C(C)(C)OC(=O)NC2=CC=C1C1=COC(C#N)=C1 IJSGDARRCNDONL-UHFFFAOYSA-N 0.000 claims 1
- OTDVEVBRJYVJHY-UHFFFAOYSA-N 4-(4,4-dimethyl-2-oxo-1h-3,1-benzoxazin-6-yl)thiophene-2-carbonitrile Chemical compound C1=C2C(C)(C)OC(=O)NC2=CC=C1C1=CSC(C#N)=C1 OTDVEVBRJYVJHY-UHFFFAOYSA-N 0.000 claims 1
- DNRMTRMFSKNGIV-UHFFFAOYSA-N 4-butyl-5-(4,4-dimethyl-2-oxo-1h-3,1-benzoxazin-6-yl)thiophene-2-carbonitrile Chemical compound C1=C(C#N)SC(C=2C=C3C(C)(C)OC(=O)NC3=CC=2)=C1CCCC DNRMTRMFSKNGIV-UHFFFAOYSA-N 0.000 claims 1
- BGHLZYDCBNMWCU-UHFFFAOYSA-N 5-(4,4-dimethyl-2-oxo-1h-3,1-benzoxazin-6-yl)thiophene-3-carbonitrile Chemical compound C1=C2C(C)(C)OC(=O)NC2=CC=C1C1=CC(C#N)=CS1 BGHLZYDCBNMWCU-UHFFFAOYSA-N 0.000 claims 1
- RGFZPIHTBCRGJA-UHFFFAOYSA-N 6-(2-fluorophenyl)-4,4-dimethyl-1h-3,1-benzoxazin-2-one Chemical compound C1=C2C(C)(C)OC(=O)NC2=CC=C1C1=CC=CC=C1F RGFZPIHTBCRGJA-UHFFFAOYSA-N 0.000 claims 1
- SNZNCFSHRLBZQL-UHFFFAOYSA-N 6-(3-benzoylphenyl)-4,4-dimethyl-1h-3,1-benzoxazin-2-one Chemical compound C1=C2C(C)(C)OC(=O)NC2=CC=C1C(C=1)=CC=CC=1C(=O)C1=CC=CC=C1 SNZNCFSHRLBZQL-UHFFFAOYSA-N 0.000 claims 1
- CSEZCWXODWQLCM-UHFFFAOYSA-N 6-(3-fluoro-5-methoxyphenyl)-4,4-dimethyl-1h-3,1-benzoxazin-2-one Chemical compound COC1=CC(F)=CC(C=2C=C3C(C)(C)OC(=O)NC3=CC=2)=C1 CSEZCWXODWQLCM-UHFFFAOYSA-N 0.000 claims 1
- VOXOVWZYJPEBBX-UHFFFAOYSA-N 6-(3-fluoro-5-nitrophenyl)-4,4-dimethyl-1h-3,1-benzoxazin-2-one Chemical compound C1=C2C(C)(C)OC(=O)NC2=CC=C1C1=CC(F)=CC([N+]([O-])=O)=C1 VOXOVWZYJPEBBX-UHFFFAOYSA-N 0.000 claims 1
- JZLBNVXFYMIYPW-UHFFFAOYSA-N 6-(3-fluoro-5-thiophen-3-ylphenyl)-4,4-dimethyl-1h-3,1-benzoxazin-2-one Chemical compound C1=C2C(C)(C)OC(=O)NC2=CC=C1C(C=1)=CC(F)=CC=1C=1C=CSC=1 JZLBNVXFYMIYPW-UHFFFAOYSA-N 0.000 claims 1
- RRSKDZKYPQSTFG-UHFFFAOYSA-N 6-(3-fluorophenyl)-4,4-dimethyl-1h-3,1-benzoxazin-2-one Chemical compound C1=C2C(C)(C)OC(=O)NC2=CC=C1C1=CC=CC(F)=C1 RRSKDZKYPQSTFG-UHFFFAOYSA-N 0.000 claims 1
- XCKPZLTYDJLOFR-UHFFFAOYSA-N 6-(3-methoxyphenyl)-4,4-dimethyl-1h-3,1-benzoxazin-2-one Chemical compound COC1=CC=CC(C=2C=C3C(C)(C)OC(=O)NC3=CC=2)=C1 XCKPZLTYDJLOFR-UHFFFAOYSA-N 0.000 claims 1
- HQEDEYRIOUJUKO-UHFFFAOYSA-N 6-(3-nitrophenyl)spiro[1h-3,1-benzoxazine-4,1'-cyclohexane]-2-one Chemical compound [O-][N+](=O)C1=CC=CC(C=2C=C3C4(CCCCC4)OC(=O)NC3=CC=2)=C1 HQEDEYRIOUJUKO-UHFFFAOYSA-N 0.000 claims 1
- ZFFAAIRKIJZJRS-UHFFFAOYSA-N 6-(4-chlorophenyl)-4,4-dimethyl-1h-3,1-benzoxazin-2-one Chemical compound C1=C2C(C)(C)OC(=O)NC2=CC=C1C1=CC=C(Cl)C=C1 ZFFAAIRKIJZJRS-UHFFFAOYSA-N 0.000 claims 1
- XFAUSYJDWOPPLR-UHFFFAOYSA-N 6-(4-fluorophenyl)-4,4-dimethyl-1h-3,1-benzoxazin-2-one Chemical compound C1=C2C(C)(C)OC(=O)NC2=CC=C1C1=CC=C(F)C=C1 XFAUSYJDWOPPLR-UHFFFAOYSA-N 0.000 claims 1
- QBIGFWOGRAVJFF-UHFFFAOYSA-N 6-[3-bromo-5-(trifluoromethoxy)phenyl]-4,4-dimethyl-1h-3,1-benzoxazin-2-one Chemical compound C1=C2C(C)(C)OC(=O)NC2=CC=C1C1=CC(Br)=CC(OC(F)(F)F)=C1 QBIGFWOGRAVJFF-UHFFFAOYSA-N 0.000 claims 1
- 230000001939 inductive effect Effects 0.000 claims 1
- 239000005557 antagonist Substances 0.000 abstract description 24
- 102000003998 progesterone receptors Human genes 0.000 abstract description 24
- 108090000468 progesterone receptors Proteins 0.000 abstract description 24
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 abstract description 11
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 317
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 170
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 156
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 140
- 238000005160 1H NMR spectroscopy Methods 0.000 description 136
- 239000007787 solid Substances 0.000 description 131
- 239000000243 solution Substances 0.000 description 116
- 235000019439 ethyl acetate Nutrition 0.000 description 109
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 106
- 229940093499 ethyl acetate Drugs 0.000 description 99
- 239000000203 mixture Substances 0.000 description 72
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 68
- 239000002904 solvent Substances 0.000 description 61
- 239000012044 organic layer Substances 0.000 description 51
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 45
- 239000012267 brine Substances 0.000 description 42
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 42
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 41
- 238000002330 electrospray ionisation mass spectrometry Methods 0.000 description 41
- 239000011541 reaction mixture Substances 0.000 description 40
- RJKFOVLPORLFTN-LEKSSAKUSA-N Progesterone Chemical compound C1CC2=CC(=O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H](C(=O)C)[C@@]1(C)CC2 RJKFOVLPORLFTN-LEKSSAKUSA-N 0.000 description 38
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 36
- ZADPBFCGQRWHPN-UHFFFAOYSA-N boronic acid Chemical compound OBO ZADPBFCGQRWHPN-UHFFFAOYSA-N 0.000 description 36
- 238000006243 chemical reaction Methods 0.000 description 36
- 229910002027 silica gel Inorganic materials 0.000 description 35
- 239000000741 silica gel Substances 0.000 description 35
- 238000011282 treatment Methods 0.000 description 35
- OKKJLVBELUTLKV-UHFFFAOYSA-N methanol Natural products OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 32
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 31
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 30
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 26
- 229910052799 carbon Inorganic materials 0.000 description 26
- 210000004027 cell Anatomy 0.000 description 26
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 25
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 24
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 24
- NFHFRUOZVGFOOS-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 24
- QHWLPZYUNQBUGQ-UHFFFAOYSA-N (4,4-dimethyl-2-oxo-1h-3,1-benzoxazin-6-yl)boronic acid Chemical compound C1=C(B(O)O)C=C2C(C)(C)OC(=O)NC2=C1 QHWLPZYUNQBUGQ-UHFFFAOYSA-N 0.000 description 23
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 23
- 238000005481 NMR spectroscopy Methods 0.000 description 22
- 238000003818 flash chromatography Methods 0.000 description 21
- 238000010992 reflux Methods 0.000 description 21
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 18
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 18
- 231100000673 dose–response relationship Toxicity 0.000 description 18
- 239000002609 medium Substances 0.000 description 18
- 239000000186 progesterone Substances 0.000 description 17
- 229960003387 progesterone Drugs 0.000 description 17
- 229910000029 sodium carbonate Inorganic materials 0.000 description 17
- 239000012298 atmosphere Substances 0.000 description 15
- 239000003921 oil Substances 0.000 description 15
- 235000019198 oils Nutrition 0.000 description 15
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 14
- 230000000694 effects Effects 0.000 description 14
- 229920006395 saturated elastomer Polymers 0.000 description 14
- 230000000708 anti-progestin effect Effects 0.000 description 13
- 239000003418 antiprogestin Substances 0.000 description 13
- 229910052786 argon Inorganic materials 0.000 description 13
- 238000005859 coupling reaction Methods 0.000 description 13
- 102000027411 intracellular receptors Human genes 0.000 description 13
- 108091008582 intracellular receptors Proteins 0.000 description 13
- 239000010410 layer Substances 0.000 description 13
- 238000012360 testing method Methods 0.000 description 13
- JRXGULDSFFLUAO-UHFFFAOYSA-N 6-bromo-4,4-dimethyl-1h-3,1-benzoxazin-2-one Chemical compound C1=C(Br)C=C2C(C)(C)OC(=O)NC2=C1 JRXGULDSFFLUAO-UHFFFAOYSA-N 0.000 description 12
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 12
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- 235000019270 ammonium chloride Nutrition 0.000 description 12
- 238000003556 assay Methods 0.000 description 12
- 239000003153 chemical reaction reagent Substances 0.000 description 12
- VKHAHZOOUSRJNA-GCNJZUOMSA-N mifepristone Chemical compound C1([C@@H]2C3=C4CCC(=O)C=C4CC[C@H]3[C@@H]3CC[C@@]([C@]3(C2)C)(O)C#CC)=CC=C(N(C)C)C=C1 VKHAHZOOUSRJNA-GCNJZUOMSA-N 0.000 description 12
- 235000017550 sodium carbonate Nutrition 0.000 description 12
- 239000013078 crystal Substances 0.000 description 11
- 239000003446 ligand Substances 0.000 description 11
- 239000000583 progesterone congener Substances 0.000 description 11
- 238000000746 purification Methods 0.000 description 11
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 10
- 239000000556 agonist Substances 0.000 description 10
- 239000000843 powder Substances 0.000 description 10
- UCSJYZPVAKXKNQ-HZYVHMACSA-N streptomycin Chemical compound CN[C@H]1[C@H](O)[C@@H](O)[C@H](CO)O[C@H]1O[C@@H]1[C@](C=O)(O)[C@H](C)O[C@H]1O[C@@H]1[C@@H](NC(N)=N)[C@H](O)[C@@H](NC(N)=N)[C@H](O)[C@H]1O UCSJYZPVAKXKNQ-HZYVHMACSA-N 0.000 description 10
- LWIHDJKSTIGBAC-UHFFFAOYSA-K tripotassium phosphate Chemical compound [K+].[K+].[K+].[O-]P([O-])([O-])=O LWIHDJKSTIGBAC-UHFFFAOYSA-K 0.000 description 10
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 9
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 9
- 239000005089 Luciferase Substances 0.000 description 9
- 241001465754 Metazoa Species 0.000 description 9
- 238000004458 analytical method Methods 0.000 description 9
- 239000002585 base Substances 0.000 description 9
- 239000001963 growth medium Substances 0.000 description 9
- MZRVEZGGRBJDDB-UHFFFAOYSA-N n-Butyllithium Substances [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 9
- 239000000047 product Substances 0.000 description 9
- 239000003981 vehicle Substances 0.000 description 9
- WTWHARNMMYPRFM-UHFFFAOYSA-N 1-[2-amino-5-(3-chlorophenyl)phenyl]ethanone Chemical compound C1=C(N)C(C(=O)C)=CC(C=2C=C(Cl)C=CC=2)=C1 WTWHARNMMYPRFM-UHFFFAOYSA-N 0.000 description 8
- HQQTZCPKNZVLFF-UHFFFAOYSA-N 4h-1,2-benzoxazin-3-one Chemical class C1=CC=C2ONC(=O)CC2=C1 HQQTZCPKNZVLFF-UHFFFAOYSA-N 0.000 description 8
- 102220497176 Small vasohibin-binding protein_T47D_mutation Human genes 0.000 description 8
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 8
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 8
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 8
- 125000004432 carbon atom Chemical group C* 0.000 description 8
- 238000004587 chromatography analysis Methods 0.000 description 8
- 239000001301 oxygen Substances 0.000 description 8
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 8
- 238000002360 preparation method Methods 0.000 description 8
- 229910000104 sodium hydride Inorganic materials 0.000 description 8
- 125000000547 substituted alkyl group Chemical group 0.000 description 8
- JUNDJWOLDSCTFK-MTZCLOFQSA-N trimegestone Chemical compound C1CC2=CC(=O)CCC2=C2[C@@H]1[C@@H]1CC[C@@](C(=O)[C@@H](O)C)(C)[C@@]1(C)CC2 JUNDJWOLDSCTFK-MTZCLOFQSA-N 0.000 description 8
- 229950008546 trimegestone Drugs 0.000 description 8
- 241000700159 Rattus Species 0.000 description 7
- 230000016117 decidualization Effects 0.000 description 7
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 7
- 235000019341 magnesium sulphate Nutrition 0.000 description 7
- 239000002244 precipitate Substances 0.000 description 7
- 238000010898 silica gel chromatography Methods 0.000 description 7
- UCPYLLCMEDAXFR-UHFFFAOYSA-N triphosgene Chemical compound ClC(Cl)(Cl)OC(=O)OC(Cl)(Cl)Cl UCPYLLCMEDAXFR-UHFFFAOYSA-N 0.000 description 7
- SDEAGACSNFSZCU-UHFFFAOYSA-N (3-chlorophenyl)boronic acid Chemical compound OB(O)C1=CC=CC(Cl)=C1 SDEAGACSNFSZCU-UHFFFAOYSA-N 0.000 description 6
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 6
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 6
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 6
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 6
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 230000037396 body weight Effects 0.000 description 6
- 239000003054 catalyst Substances 0.000 description 6
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 6
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 6
- DLEDOFVPSDKWEF-UHFFFAOYSA-N lithium butane Chemical compound [Li+].CCC[CH2-] DLEDOFVPSDKWEF-UHFFFAOYSA-N 0.000 description 6
- NXPHGHWWQRMDIA-UHFFFAOYSA-M magnesium;carbanide;bromide Chemical compound [CH3-].[Mg+2].[Br-] NXPHGHWWQRMDIA-UHFFFAOYSA-M 0.000 description 6
- KDLHZDBZIXYQEI-UHFFFAOYSA-N palladium Substances [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 6
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 6
- 230000036515 potency Effects 0.000 description 6
- 239000012312 sodium hydride Substances 0.000 description 6
- NLLGFYPSWCMUIV-UHFFFAOYSA-N (3-methoxyphenyl)boronic acid Chemical compound COC1=CC=CC(B(O)O)=C1 NLLGFYPSWCMUIV-UHFFFAOYSA-N 0.000 description 5
- WOVKYSAHUYNSMH-RRKCRQDMSA-N 5-bromodeoxyuridine Chemical compound C1[C@H](O)[C@@H](CO)O[C@H]1N1C(=O)NC(=O)C(Br)=C1 WOVKYSAHUYNSMH-RRKCRQDMSA-N 0.000 description 5
- 108091003079 Bovine Serum Albumin Proteins 0.000 description 5
- 229930182555 Penicillin Natural products 0.000 description 5
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 description 5
- 239000002253 acid Substances 0.000 description 5
- 150000001408 amides Chemical class 0.000 description 5
- 230000001911 anti-progestational effect Effects 0.000 description 5
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 5
- 238000004440 column chromatography Methods 0.000 description 5
- 239000012153 distilled water Substances 0.000 description 5
- 239000012091 fetal bovine serum Substances 0.000 description 5
- 239000005457 ice water Substances 0.000 description 5
- 239000007788 liquid Substances 0.000 description 5
- 229960002985 medroxyprogesterone acetate Drugs 0.000 description 5
- PSGAAPLEWMOORI-PEINSRQWSA-N medroxyprogesterone acetate Chemical compound C([C@@]12C)CC(=O)C=C1[C@@H](C)C[C@@H]1[C@@H]2CC[C@]2(C)[C@@](OC(C)=O)(C(C)=O)CC[C@H]21 PSGAAPLEWMOORI-PEINSRQWSA-N 0.000 description 5
- 238000001543 one-way ANOVA Methods 0.000 description 5
- 229940049954 penicillin Drugs 0.000 description 5
- 229910000027 potassium carbonate Inorganic materials 0.000 description 5
- 229910000160 potassium phosphate Inorganic materials 0.000 description 5
- 235000011009 potassium phosphates Nutrition 0.000 description 5
- 230000001072 progestational effect Effects 0.000 description 5
- 108090000623 proteins and genes Proteins 0.000 description 5
- 230000004044 response Effects 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- 229960005322 streptomycin Drugs 0.000 description 5
- CUKXRHLWPSBCTI-UHFFFAOYSA-N 2-amino-5-bromobenzoic acid Chemical compound NC1=CC=C(Br)C=C1C(O)=O CUKXRHLWPSBCTI-UHFFFAOYSA-N 0.000 description 4
- DJYVXBJLHPKUKS-UHFFFAOYSA-N 4-bromothiophene-2-carbonitrile Chemical compound BrC1=CSC(C#N)=C1 DJYVXBJLHPKUKS-UHFFFAOYSA-N 0.000 description 4
- HJCMDXDYPOUFDY-WHFBIAKZSA-N Ala-Gln Chemical compound C[C@H](N)C(=O)N[C@H](C(O)=O)CCC(N)=O HJCMDXDYPOUFDY-WHFBIAKZSA-N 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- 239000006144 Dulbecco’s modified Eagle's medium Substances 0.000 description 4
- 239000007818 Grignard reagent Substances 0.000 description 4
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 4
- 241000396922 Pontia daplidice Species 0.000 description 4
- NKANXQFJJICGDU-QPLCGJKRSA-N Tamoxifen Chemical compound C=1C=CC=CC=1C(/CC)=C(C=1C=CC(OCCN(C)C)=CC=1)/C1=CC=CC=C1 NKANXQFJJICGDU-QPLCGJKRSA-N 0.000 description 4
- ABZAUPLPHPBYRJ-UHFFFAOYSA-N [2-amino-5-(3-chlorophenyl)phenyl]-cyclopropylmethanone Chemical compound NC1=CC=C(C=2C=C(Cl)C=CC=2)C=C1C(=O)C1CC1 ABZAUPLPHPBYRJ-UHFFFAOYSA-N 0.000 description 4
- 125000004448 alkyl carbonyl group Chemical group 0.000 description 4
- 125000005157 alkyl carboxy group Chemical group 0.000 description 4
- RWZYAGGXGHYGMB-UHFFFAOYSA-N anthranilic acid Chemical class NC1=CC=CC=C1C(O)=O RWZYAGGXGHYGMB-UHFFFAOYSA-N 0.000 description 4
- 125000004104 aryloxy group Chemical group 0.000 description 4
- 238000009835 boiling Methods 0.000 description 4
- 229910052794 bromium Inorganic materials 0.000 description 4
- 239000002285 corn oil Substances 0.000 description 4
- 235000005687 corn oil Nutrition 0.000 description 4
- 238000010168 coupling process Methods 0.000 description 4
- 239000012039 electrophile Substances 0.000 description 4
- 150000004795 grignard reagents Chemical class 0.000 description 4
- 238000000338 in vitro Methods 0.000 description 4
- 238000001727 in vivo Methods 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 229910052759 nickel Inorganic materials 0.000 description 4
- 125000002524 organometallic group Chemical group 0.000 description 4
- SUSQOBVLVYHIEX-UHFFFAOYSA-N phenylacetonitrile Chemical compound N#CCC1=CC=CC=C1 SUSQOBVLVYHIEX-UHFFFAOYSA-N 0.000 description 4
- SQGYOTSLMSWVJD-UHFFFAOYSA-N silver(1+) nitrate Chemical compound [Ag+].[O-]N(=O)=O SQGYOTSLMSWVJD-UHFFFAOYSA-N 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- 239000012279 sodium borohydride Substances 0.000 description 4
- 229910000033 sodium borohydride Inorganic materials 0.000 description 4
- DYHSDKLCOJIUFX-UHFFFAOYSA-N tert-butoxycarbonyl anhydride Chemical compound CC(C)(C)OC(=O)OC(=O)OC(C)(C)C DYHSDKLCOJIUFX-UHFFFAOYSA-N 0.000 description 4
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 4
- WWYNJERNGUHSAO-XUDSTZEESA-N (+)-Norgestrel Chemical compound O=C1CC[C@@H]2[C@H]3CC[C@](CC)([C@](CC4)(O)C#C)[C@@H]4[C@@H]3CCC2=C1 WWYNJERNGUHSAO-XUDSTZEESA-N 0.000 description 3
- ZEPPUPGCWVPEKC-UHFFFAOYSA-N (4,4-dicyclopropyl-2-oxo-1h-3,1-benzoxazin-6-yl)boronic acid Chemical compound C12=CC(B(O)O)=CC=C2NC(=O)OC1(C1CC1)C1CC1 ZEPPUPGCWVPEKC-UHFFFAOYSA-N 0.000 description 3
- KZPYGQFFRCFCPP-UHFFFAOYSA-N 1,1'-bis(diphenylphosphino)ferrocene Chemical compound [Fe+2].C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1 KZPYGQFFRCFCPP-UHFFFAOYSA-N 0.000 description 3
- OZAZWBXVBDWROJ-UHFFFAOYSA-N 2-amino-5-bromo-n-methoxy-n-methylbenzamide Chemical compound CON(C)C(=O)C1=CC(Br)=CC=C1N OZAZWBXVBDWROJ-UHFFFAOYSA-N 0.000 description 3
- IADLVSLZPQYXIF-UHFFFAOYSA-N 3-bromo-5-fluorobenzonitrile Chemical compound FC1=CC(Br)=CC(C#N)=C1 IADLVSLZPQYXIF-UHFFFAOYSA-N 0.000 description 3
- ZNRGSYUVFVNSAW-UHFFFAOYSA-N 3-nitrophenylboronic acid Chemical compound OB(O)C1=CC=CC([N+]([O-])=O)=C1 ZNRGSYUVFVNSAW-UHFFFAOYSA-N 0.000 description 3
- 229960000549 4-dimethylaminophenol Drugs 0.000 description 3
- LRQOLFHQTKOVQZ-UHFFFAOYSA-N 5-bromo-4-methylthiophene-2-carbonitrile Chemical compound CC=1C=C(C#N)SC=1Br LRQOLFHQTKOVQZ-UHFFFAOYSA-N 0.000 description 3
- YVVHCBNJWHPMCQ-UHFFFAOYSA-N 5-bromothiophene-2-carbonitrile Chemical compound BrC1=CC=C(C#N)S1 YVVHCBNJWHPMCQ-UHFFFAOYSA-N 0.000 description 3
- BDOVHAHBVXFECD-UHFFFAOYSA-N 6-bromo-8-fluoro-4,4-dimethyl-4a,5-dihydro-1h-3,1-benzoxazin-2-one Chemical compound C1=C(Br)CC2C(C)(C)OC(=O)NC2=C1F BDOVHAHBVXFECD-UHFFFAOYSA-N 0.000 description 3
- DTCGVZAAHFIXNU-UHFFFAOYSA-N 8-fluoro-4,4-dimethyl-4a,5-dihydro-1h-3,1-benzoxazin-2-one Chemical compound C1=CCC2C(C)(C)OC(=O)NC2=C1F DTCGVZAAHFIXNU-UHFFFAOYSA-N 0.000 description 3
- 238000008940 Alkaline Phosphatase assay kit Methods 0.000 description 3
- 241001553178 Arachis glabrata Species 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 108020004414 DNA Proteins 0.000 description 3
- 108060001084 Luciferase Proteins 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 3
- 239000004480 active ingredient Substances 0.000 description 3
- 125000003282 alkyl amino group Chemical group 0.000 description 3
- 238000000540 analysis of variance Methods 0.000 description 3
- 238000013459 approach Methods 0.000 description 3
- 150000001543 aryl boronic acids Chemical class 0.000 description 3
- 125000005110 aryl thio group Chemical group 0.000 description 3
- 239000012131 assay buffer Substances 0.000 description 3
- 238000004113 cell culture Methods 0.000 description 3
- 238000001516 cell proliferation assay Methods 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 230000008878 coupling Effects 0.000 description 3
- 239000006185 dispersion Substances 0.000 description 3
- 125000001207 fluorophenyl group Chemical group 0.000 description 3
- 238000005462 in vivo assay Methods 0.000 description 3
- 238000010348 incorporation Methods 0.000 description 3
- 238000011534 incubation Methods 0.000 description 3
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 3
- 150000002576 ketones Chemical class 0.000 description 3
- 229960004400 levonorgestrel Drugs 0.000 description 3
- QBNOPZJAURRQCE-UHFFFAOYSA-M magnesium;prop-1-yne;bromide Chemical compound [Mg+2].[Br-].CC#[C-] QBNOPZJAURRQCE-UHFFFAOYSA-M 0.000 description 3
- 230000004048 modification Effects 0.000 description 3
- 238000012986 modification Methods 0.000 description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 description 3
- 230000003287 optical effect Effects 0.000 description 3
- 125000005010 perfluoroalkyl group Chemical group 0.000 description 3
- 239000013612 plasmid Substances 0.000 description 3
- 229920001223 polyethylene glycol Polymers 0.000 description 3
- 235000011056 potassium acetate Nutrition 0.000 description 3
- 239000001632 sodium acetate Substances 0.000 description 3
- 235000017281 sodium acetate Nutrition 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 3
- 150000003431 steroids Chemical class 0.000 description 3
- 238000007920 subcutaneous administration Methods 0.000 description 3
- 125000005415 substituted alkoxy group Chemical group 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- 230000009466 transformation Effects 0.000 description 3
- GKASDNZWUGIAMG-UHFFFAOYSA-N triethyl orthoformate Chemical compound CCOC(OCC)OCC GKASDNZWUGIAMG-UHFFFAOYSA-N 0.000 description 3
- DTQVDTLACAAQTR-UHFFFAOYSA-N trifluoroacetic acid Substances OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 3
- GHYOCDFICYLMRF-UTIIJYGPSA-N (2S,3R)-N-[(2S)-3-(cyclopenten-1-yl)-1-[(2R)-2-methyloxiran-2-yl]-1-oxopropan-2-yl]-3-hydroxy-3-(4-methoxyphenyl)-2-[[(2S)-2-[(2-morpholin-4-ylacetyl)amino]propanoyl]amino]propanamide Chemical class C1(=CCCC1)C[C@@H](C(=O)[C@@]1(OC1)C)NC([C@H]([C@@H](C1=CC=C(C=C1)OC)O)NC([C@H](C)NC(CN1CCOCC1)=O)=O)=O GHYOCDFICYLMRF-UTIIJYGPSA-N 0.000 description 2
- KQWBQTOZXPPFIY-UHFFFAOYSA-N (3-bromo-5-fluorophenyl)methanol Chemical compound OCC1=CC(F)=CC(Br)=C1 KQWBQTOZXPPFIY-UHFFFAOYSA-N 0.000 description 2
- GVJHHUAWPYXKBD-UHFFFAOYSA-N (±)-α-Tocopherol Chemical compound OC1=C(C)C(C)=C2OC(CCCC(C)CCCC(C)CCCC(C)C)(C)CCC2=C1C GVJHHUAWPYXKBD-UHFFFAOYSA-N 0.000 description 2
- QFMZQPDHXULLKC-UHFFFAOYSA-N 1,2-bis(diphenylphosphino)ethane Chemical compound C=1C=CC=CC=1P(C=1C=CC=CC=1)CCP(C=1C=CC=CC=1)C1=CC=CC=C1 QFMZQPDHXULLKC-UHFFFAOYSA-N 0.000 description 2
- ASWYHZXKFSLNLN-UHFFFAOYSA-N 1,3-dibromo-5-fluorobenzene Chemical compound FC1=CC(Br)=CC(Br)=C1 ASWYHZXKFSLNLN-UHFFFAOYSA-N 0.000 description 2
- APLKINOTQCGFDO-UHFFFAOYSA-N 1-(2-amino-5-bromophenyl)cyclohexan-1-ol Chemical compound NC1=CC=C(Br)C=C1C1(O)CCCCC1 APLKINOTQCGFDO-UHFFFAOYSA-N 0.000 description 2
- NOKSRMDODJGCPZ-UHFFFAOYSA-N 1-(2-amino-5-chlorophenyl)-2,2,2-trifluoroethanone Chemical compound NC1=CC=C(Cl)C=C1C(=O)C(F)(F)F NOKSRMDODJGCPZ-UHFFFAOYSA-N 0.000 description 2
- FCONRVIXCJULNY-UHFFFAOYSA-N 1-[2-amino-5-(3-chlorophenyl)phenyl]-1-cyclopropylethanol Chemical compound C=1C(C=2C=C(Cl)C=CC=2)=CC=C(N)C=1C(O)(C)C1CC1 FCONRVIXCJULNY-UHFFFAOYSA-N 0.000 description 2
- SBNHRAJJQMVJLJ-UHFFFAOYSA-N 1-[2-amino-5-(3-chlorophenyl)phenyl]ethanol Chemical compound C1=C(N)C(C(O)C)=CC(C=2C=C(Cl)C=CC=2)=C1 SBNHRAJJQMVJLJ-UHFFFAOYSA-N 0.000 description 2
- DAUWIPUGOIFZNF-UHFFFAOYSA-N 1-bromo-3-(bromomethyl)-5-fluorobenzene Chemical compound FC1=CC(Br)=CC(CBr)=C1 DAUWIPUGOIFZNF-UHFFFAOYSA-N 0.000 description 2
- SINBGNJPYWNUQI-UHFFFAOYSA-N 2,2,2-trifluoro-1-imidazol-1-ylethanone Chemical compound FC(F)(F)C(=O)N1C=CN=C1 SINBGNJPYWNUQI-UHFFFAOYSA-N 0.000 description 2
- BWZVCCNYKMEVEX-UHFFFAOYSA-N 2,4,6-Trimethylpyridine Chemical compound CC1=CC(C)=NC(C)=C1 BWZVCCNYKMEVEX-UHFFFAOYSA-N 0.000 description 2
- FSKMLBLIAOVQCF-UHFFFAOYSA-N 2-(3-bromo-5-fluorophenyl)acetonitrile Chemical compound FC1=CC(Br)=CC(CC#N)=C1 FSKMLBLIAOVQCF-UHFFFAOYSA-N 0.000 description 2
- UUZYFBXKWIQKTF-UHFFFAOYSA-N 2-(3-bromophenyl)acetonitrile Chemical compound BrC1=CC=CC(CC#N)=C1 UUZYFBXKWIQKTF-UHFFFAOYSA-N 0.000 description 2
- HPBRUWHVFSFZTL-UHFFFAOYSA-N 2-amino-5-(3-fluorophenyl)benzonitrile Chemical compound C1=C(C#N)C(N)=CC=C1C1=CC=CC(F)=C1 HPBRUWHVFSFZTL-UHFFFAOYSA-N 0.000 description 2
- OATYCBHROMXWJO-UHFFFAOYSA-N 2-amino-5-bromobenzonitrile Chemical compound NC1=CC=C(Br)C=C1C#N OATYCBHROMXWJO-UHFFFAOYSA-N 0.000 description 2
- KNSTZQXNNWCUGL-UHFFFAOYSA-N 3-(3-bromophenyl)-1,2,4-thiadiazole Chemical compound BrC1=CC=CC(C2=NSC=N2)=C1 KNSTZQXNNWCUGL-UHFFFAOYSA-N 0.000 description 2
- STXAVEHFKAXGOX-UHFFFAOYSA-N 3-bromobenzonitrile Chemical compound BrC1=CC=CC(C#N)=C1 STXAVEHFKAXGOX-UHFFFAOYSA-N 0.000 description 2
- MRBLJJBXZYRVOR-UHFFFAOYSA-N 3-fluoro-5-(8-methoxy-4,4-dimethyl-2-oxo-1h-3,1-benzoxazin-6-yl)benzonitrile Chemical compound C=1C(C(OC(=O)N2)(C)C)=C2C(OC)=CC=1C1=CC(F)=CC(C#N)=C1 MRBLJJBXZYRVOR-UHFFFAOYSA-N 0.000 description 2
- NRMITPJXKLMJIJ-UHFFFAOYSA-N 4,4-diethyl-6-iodo-1h-3,1-benzoxazin-2-one Chemical compound C1=C(I)C=C2C(CC)(CC)OC(=O)NC2=C1 NRMITPJXKLMJIJ-UHFFFAOYSA-N 0.000 description 2
- SAEGXQBZONVMAM-UHFFFAOYSA-N 4-(4,4-dimethyl-2-oxo-1h-3,1-benzoxazin-6-yl)furan-2-carbaldehyde Chemical compound C1=C2C(C)(C)OC(=O)NC2=CC=C1C1=COC(C=O)=C1 SAEGXQBZONVMAM-UHFFFAOYSA-N 0.000 description 2
- ZLXSSLJXCUISKG-UHFFFAOYSA-N 4-bromo-2-(bromomethyl)-1-fluorobenzene Chemical compound FC1=CC=C(Br)C=C1CBr ZLXSSLJXCUISKG-UHFFFAOYSA-N 0.000 description 2
- CFPMNZZMIBAQEJ-UHFFFAOYSA-N 5-bromo-4-butylthiophene-2-carbonitrile Chemical compound CCCCC=1C=C(C#N)SC=1Br CFPMNZZMIBAQEJ-UHFFFAOYSA-N 0.000 description 2
- BNLFPKVPRIIJGE-UHFFFAOYSA-N 5-bromo-4-ethylthiophene-2-carbaldehyde Chemical compound CCC=1C=C(C=O)SC=1Br BNLFPKVPRIIJGE-UHFFFAOYSA-N 0.000 description 2
- FRIMNHRWPJLINA-UHFFFAOYSA-N 5-bromo-4-ethylthiophene-2-carbonitrile Chemical compound CCC=1C=C(C#N)SC=1Br FRIMNHRWPJLINA-UHFFFAOYSA-N 0.000 description 2
- FATNNNCLTSHUQL-UHFFFAOYSA-N 5-bromo-4-methylthiophene-2-carbaldehyde Chemical compound CC=1C=C(C=O)SC=1Br FATNNNCLTSHUQL-UHFFFAOYSA-N 0.000 description 2
- VXVRWMSCGJBZCB-UHFFFAOYSA-N 5-bromo-4-propylthiophene-2-carbaldehyde Chemical compound CCCC=1C=C(C=O)SC=1Br VXVRWMSCGJBZCB-UHFFFAOYSA-N 0.000 description 2
- MZMCUPHVWYWUCW-UHFFFAOYSA-N 5-bromo-4-propylthiophene-2-carbonitrile Chemical compound CCCC=1C=C(C#N)SC=1Br MZMCUPHVWYWUCW-UHFFFAOYSA-N 0.000 description 2
- NUYCDCOSTCEBOV-UHFFFAOYSA-N 6-(3-bromophenyl)-1,4,4-trimethyl-3,1-benzoxazin-2-one Chemical compound C=1C=C2N(C)C(=O)OC(C)(C)C2=CC=1C1=CC=CC(Br)=C1 NUYCDCOSTCEBOV-UHFFFAOYSA-N 0.000 description 2
- IVANWHKRFWVGAC-UHFFFAOYSA-N 6-bromo-8-methoxy-4,4-dimethyl-1h-3,1-benzoxazin-2-one Chemical compound N1C(=O)OC(C)(C)C2=C1C(OC)=CC(Br)=C2 IVANWHKRFWVGAC-UHFFFAOYSA-N 0.000 description 2
- GWBGZJLTOSNYNW-UHFFFAOYSA-N 6-bromospiro[1h-3,1-benzoxazine-4,1'-cyclohexane]-2-one Chemical compound C12=CC(Br)=CC=C2NC(=O)OC21CCCCC2 GWBGZJLTOSNYNW-UHFFFAOYSA-N 0.000 description 2
- VDHPBJRTXBMHFE-UHFFFAOYSA-N 6-chlorospiro[1h-3,1-benzoxazine-4,1'-cyclobutane]-2-one Chemical compound C12=CC(Cl)=CC=C2NC(=O)OC21CCC2 VDHPBJRTXBMHFE-UHFFFAOYSA-N 0.000 description 2
- WSXPMYHLJIIVFV-UHFFFAOYSA-N 6-iodo-4,4-dimethyl-1h-3,1-benzoxazin-2-one Chemical compound C1=C(I)C=C2C(C)(C)OC(=O)NC2=C1 WSXPMYHLJIIVFV-UHFFFAOYSA-N 0.000 description 2
- NIZXOVYCLLXMQN-UHFFFAOYSA-N 8-methoxy-4,4-dimethyl-1h-3,1-benzoxazin-2-one Chemical compound N1C(=O)OC(C)(C)C2=C1C(OC)=CC=C2 NIZXOVYCLLXMQN-UHFFFAOYSA-N 0.000 description 2
- 102000002260 Alkaline Phosphatase Human genes 0.000 description 2
- 108020004774 Alkaline Phosphatase Proteins 0.000 description 2
- 240000008025 Alternanthera ficoidea Species 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- 102100032187 Androgen receptor Human genes 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- 206010006187 Breast cancer Diseases 0.000 description 2
- 208000026310 Breast neoplasm Diseases 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- OIFBSDVPJOWBCH-UHFFFAOYSA-N Diethyl carbonate Chemical compound CCOC(=O)OCC OIFBSDVPJOWBCH-UHFFFAOYSA-N 0.000 description 2
- 229940102550 Estrogen receptor antagonist Drugs 0.000 description 2
- 108090000079 Glucocorticoid Receptors Proteins 0.000 description 2
- 102100033417 Glucocorticoid receptor Human genes 0.000 description 2
- 101000574060 Homo sapiens Progesterone receptor Proteins 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- 108090000375 Mineralocorticoid Receptors Proteins 0.000 description 2
- 102100021316 Mineralocorticoid receptor Human genes 0.000 description 2
- 206010028980 Neoplasm Diseases 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical group CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- 206010061535 Ovarian neoplasm Diseases 0.000 description 2
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 229940123788 Progesterone receptor antagonist Drugs 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 2
- OKJPEAGHQZHRQV-UHFFFAOYSA-N Triiodomethane Natural products IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- 208000002495 Uterine Neoplasms Diseases 0.000 description 2
- BOUZGNDQSMQDHP-UHFFFAOYSA-N [2-amino-5-(3-chlorophenyl)phenyl]-dicyclopropylmethanol Chemical compound NC1=CC=C(C=2C=C(Cl)C=CC=2)C=C1C(O)(C1CC1)C1CC1 BOUZGNDQSMQDHP-UHFFFAOYSA-N 0.000 description 2
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 2
- 239000012346 acetyl chloride Substances 0.000 description 2
- 230000009471 action Effects 0.000 description 2
- 239000000908 ammonium hydroxide Substances 0.000 description 2
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 2
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 2
- 235000011130 ammonium sulphate Nutrition 0.000 description 2
- 108010080146 androgen receptors Proteins 0.000 description 2
- 230000002051 biphasic effect Effects 0.000 description 2
- 239000004305 biphenyl Substances 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- XJHCXCQVJFPJIK-UHFFFAOYSA-M caesium fluoride Chemical compound [F-].[Cs+] XJHCXCQVJFPJIK-UHFFFAOYSA-M 0.000 description 2
- 201000011510 cancer Diseases 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 150000001721 carbon Chemical group 0.000 description 2
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 230000004663 cell proliferation Effects 0.000 description 2
- 239000003610 charcoal Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- IJOOHPMOJXWVHK-UHFFFAOYSA-N chlorotrimethylsilane Chemical compound C[Si](C)(C)Cl IJOOHPMOJXWVHK-UHFFFAOYSA-N 0.000 description 2
- 238000012761 co-transfection Methods 0.000 description 2
- 239000012230 colorless oil Substances 0.000 description 2
- 230000002860 competitive effect Effects 0.000 description 2
- 230000002508 compound effect Effects 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000002178 crystalline material Substances 0.000 description 2
- NXQGGXCHGDYOHB-UHFFFAOYSA-L cyclopenta-1,4-dien-1-yl(diphenyl)phosphane;dichloropalladium;iron(2+) Chemical compound [Fe+2].Cl[Pd]Cl.[CH-]1C=CC(P(C=2C=CC=CC=2)C=2C=CC=CC=2)=C1.[CH-]1C=CC(P(C=2C=CC=CC=2)C=2C=CC=CC=2)=C1 NXQGGXCHGDYOHB-UHFFFAOYSA-L 0.000 description 2
- IEJIGPNLZYLLBP-UHFFFAOYSA-N dimethyl carbonate Chemical compound COC(=O)OC IEJIGPNLZYLLBP-UHFFFAOYSA-N 0.000 description 2
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 2
- 239000003937 drug carrier Substances 0.000 description 2
- 229920001971 elastomer Polymers 0.000 description 2
- 238000004520 electroporation Methods 0.000 description 2
- 239000003797 essential amino acid Substances 0.000 description 2
- 235000020776 essential amino acid Nutrition 0.000 description 2
- 102000015694 estrogen receptors Human genes 0.000 description 2
- 108010038795 estrogen receptors Proteins 0.000 description 2
- YHEJTSIKXGRFGZ-UHFFFAOYSA-N ethyl 3-(3-bromophenyl)-1,2,4-thiadiazole-5-carboxylate Chemical compound S1C(C(=O)OCC)=NC(C=2C=C(Br)C=CC=2)=N1 YHEJTSIKXGRFGZ-UHFFFAOYSA-N 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 239000000284 extract Substances 0.000 description 2
- 230000035558 fertility Effects 0.000 description 2
- 239000012530 fluid Substances 0.000 description 2
- 238000002825 functional assay Methods 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 125000001072 heteroaryl group Chemical group 0.000 description 2
- 238000002657 hormone replacement therapy Methods 0.000 description 2
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 2
- USZLCYNVCCDPLQ-UHFFFAOYSA-N hydron;n-methoxymethanamine;chloride Chemical compound Cl.CNOC USZLCYNVCCDPLQ-UHFFFAOYSA-N 0.000 description 2
- 230000036512 infertility Effects 0.000 description 2
- 239000003112 inhibitor Substances 0.000 description 2
- AMXOYNBUYSYVKV-UHFFFAOYSA-M lithium bromide Chemical compound [Li+].[Br-] AMXOYNBUYSYVKV-UHFFFAOYSA-M 0.000 description 2
- HSZCZNFXUDYRKD-UHFFFAOYSA-M lithium iodide Chemical compound [Li+].[I-] HSZCZNFXUDYRKD-UHFFFAOYSA-M 0.000 description 2
- 238000003670 luciferase enzyme activity assay Methods 0.000 description 2
- VFZXMEQGIIWBFJ-UHFFFAOYSA-M magnesium;cyclopropane;bromide Chemical compound [Mg+2].[Br-].C1C[CH-]1 VFZXMEQGIIWBFJ-UHFFFAOYSA-M 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- XMYQHJDBLRZMLW-UHFFFAOYSA-N methanolamine Chemical compound NCO XMYQHJDBLRZMLW-UHFFFAOYSA-N 0.000 description 2
- 244000005700 microbiome Species 0.000 description 2
- 125000001979 organolithium group Chemical group 0.000 description 2
- 150000002902 organometallic compounds Chemical class 0.000 description 2
- 229910052763 palladium Inorganic materials 0.000 description 2
- 230000036961 partial effect Effects 0.000 description 2
- ANRQGKOBLBYXFM-UHFFFAOYSA-M phenylmagnesium bromide Chemical compound Br[Mg]C1=CC=CC=C1 ANRQGKOBLBYXFM-UHFFFAOYSA-M 0.000 description 2
- 239000003755 preservative agent Substances 0.000 description 2
- 230000002265 prevention Effects 0.000 description 2
- 125000006239 protecting group Chemical group 0.000 description 2
- 230000001681 protective effect Effects 0.000 description 2
- 239000002287 radioligand Substances 0.000 description 2
- 102000005962 receptors Human genes 0.000 description 2
- 108020003175 receptors Proteins 0.000 description 2
- 230000002829 reductive effect Effects 0.000 description 2
- 238000006798 ring closing metathesis reaction Methods 0.000 description 2
- 229910001961 silver nitrate Inorganic materials 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 238000003860 storage Methods 0.000 description 2
- 125000004434 sulfur atom Chemical group 0.000 description 2
- 239000000375 suspending agent Substances 0.000 description 2
- 229960001603 tamoxifen Drugs 0.000 description 2
- JVLDMPMIRUNODL-UHFFFAOYSA-N tert-butyl 2-(4,4-dimethyl-2-oxo-1h-3,1-benzoxazin-6-yl)-5-nitropyrrole-1-carboxylate Chemical compound C1=C([N+]([O-])=O)N(C(=O)OC(C)(C)C)C(C=2C=C3C(C)(C)OC(=O)NC3=CC=2)=C1 JVLDMPMIRUNODL-UHFFFAOYSA-N 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 229940086542 triethylamine Drugs 0.000 description 2
- WRECIMRULFAWHA-UHFFFAOYSA-N trimethyl borate Chemical compound COB(OC)OC WRECIMRULFAWHA-UHFFFAOYSA-N 0.000 description 2
- PYOKUURKVVELLB-UHFFFAOYSA-N trimethyl orthoformate Chemical compound COC(OC)OC PYOKUURKVVELLB-UHFFFAOYSA-N 0.000 description 2
- NHDIQVFFNDKAQU-UHFFFAOYSA-N tripropan-2-yl borate Chemical compound CC(C)OB(OC(C)C)OC(C)C NHDIQVFFNDKAQU-UHFFFAOYSA-N 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- RRCMGJCFMJBHQC-UHFFFAOYSA-N (2-chlorophenyl)boronic acid Chemical compound OB(O)C1=CC=CC=C1Cl RRCMGJCFMJBHQC-UHFFFAOYSA-N 0.000 description 1
- DKYRKAIKWFHQHM-UHFFFAOYSA-N (3,5-dichlorophenyl)boronic acid Chemical compound OB(O)C1=CC(Cl)=CC(Cl)=C1 DKYRKAIKWFHQHM-UHFFFAOYSA-N 0.000 description 1
- WJDZZXIDQYKVDG-UHFFFAOYSA-N (3-chloro-4-fluorophenyl)boronic acid Chemical compound OB(O)C1=CC=C(F)C(Cl)=C1 WJDZZXIDQYKVDG-UHFFFAOYSA-N 0.000 description 1
- KNXQDJCZSVHEIW-UHFFFAOYSA-N (3-fluorophenyl)boronic acid Chemical compound OB(O)C1=CC=CC(F)=C1 KNXQDJCZSVHEIW-UHFFFAOYSA-N 0.000 description 1
- CAYQIZIAYYNFCS-UHFFFAOYSA-N (4-chlorophenyl)boronic acid Chemical compound OB(O)C1=CC=C(Cl)C=C1 CAYQIZIAYYNFCS-UHFFFAOYSA-N 0.000 description 1
- IEXUMDBQLIVNHZ-YOUGDJEHSA-N (8s,11r,13r,14s,17s)-11-[4-(dimethylamino)phenyl]-17-hydroxy-17-(3-hydroxypropyl)-13-methyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one Chemical compound C1=CC(N(C)C)=CC=C1[C@@H]1C2=C3CCC(=O)C=C3CC[C@H]2[C@H](CC[C@]2(O)CCCO)[C@@]2(C)C1 IEXUMDBQLIVNHZ-YOUGDJEHSA-N 0.000 description 1
- DHKHKXVYLBGOIT-UHFFFAOYSA-N 1,1-Diethoxyethane Chemical compound CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 1
- IRFSXVIRXMYULF-UHFFFAOYSA-N 1,2-dihydroquinoline Chemical compound C1=CC=C2C=CCNC2=C1 IRFSXVIRXMYULF-UHFFFAOYSA-N 0.000 description 1
- AUHZEENZYGFFBQ-UHFFFAOYSA-N 1,3,5-Me3C6H3 Natural products CC1=CC(C)=CC(C)=C1 AUHZEENZYGFFBQ-UHFFFAOYSA-N 0.000 description 1
- DPKKOVGCHDUSAI-UHFFFAOYSA-N 1,3-dibromo-5-methylbenzene Chemical compound CC1=CC(Br)=CC(Br)=C1 DPKKOVGCHDUSAI-UHFFFAOYSA-N 0.000 description 1
- JSRLURSZEMLAFO-UHFFFAOYSA-N 1,3-dibromobenzene Chemical compound BrC1=CC=CC(Br)=C1 JSRLURSZEMLAFO-UHFFFAOYSA-N 0.000 description 1
- ULTHEAFYOOPTTB-UHFFFAOYSA-N 1,4-dibromobutane Chemical compound BrCCCCBr ULTHEAFYOOPTTB-UHFFFAOYSA-N 0.000 description 1
- IBODDUNKEPPBKW-UHFFFAOYSA-N 1,5-dibromopentane Chemical compound BrCCCCCBr IBODDUNKEPPBKW-UHFFFAOYSA-N 0.000 description 1
- UTZBDLKKTXTCTG-UHFFFAOYSA-N 1-[2-amino-5-(3-chlorophenyl)phenyl]-1-cyclopropylbut-2-yn-1-ol Chemical compound C=1C(C=2C=C(Cl)C=CC=2)=CC=C(N)C=1C(O)(C#CC)C1CC1 UTZBDLKKTXTCTG-UHFFFAOYSA-N 0.000 description 1
- VMUCFHJYKAWIJB-UHFFFAOYSA-N 1-[2-amino-5-(3-chlorophenyl)phenyl]-1-cyclopropylbut-2-yn-1-ol 6-(3-chlorophenyl)-4-cyclopropyl-4-prop-1-ynyl-1H-3,1-benzoxazin-2-one Chemical compound NC1=C(C=C(C=C1)C1=CC(=CC=C1)Cl)C(O)(C#CC)C1CC1.ClC=1C=C(C=CC1)C1=CC2=C(NC(OC2(C#CC)C2CC2)=O)C=C1 VMUCFHJYKAWIJB-UHFFFAOYSA-N 0.000 description 1
- ZQDRGAYEWFJADQ-UHFFFAOYSA-N 1-[2-amino-5-(3-chlorophenyl)phenyl]but-2-yn-1-one Chemical compound C1=C(N)C(C(=O)C#CC)=CC(C=2C=C(Cl)C=CC=2)=C1 ZQDRGAYEWFJADQ-UHFFFAOYSA-N 0.000 description 1
- IGUGGBXXKSHVGF-UHFFFAOYSA-N 1-[2-amino-5-(3-chlorophenyl)phenyl]propan-1-ol Chemical compound C1=C(N)C(C(O)CC)=CC(C=2C=C(Cl)C=CC=2)=C1 IGUGGBXXKSHVGF-UHFFFAOYSA-N 0.000 description 1
- LFXSGTSISRJDKE-UHFFFAOYSA-N 1-[2-amino-5-(3-fluorophenyl)phenyl]ethanol Chemical compound C1=C(N)C(C(O)C)=CC(C=2C=C(F)C=CC=2)=C1 LFXSGTSISRJDKE-UHFFFAOYSA-N 0.000 description 1
- HDIUXGGZFPVMFR-UHFFFAOYSA-N 1-[2-amino-5-(3-fluorophenyl)phenyl]ethanone Chemical compound C1=C(N)C(C(=O)C)=CC(C=2C=C(F)C=CC=2)=C1 HDIUXGGZFPVMFR-UHFFFAOYSA-N 0.000 description 1
- IPWBFGUBXWMIPR-UHFFFAOYSA-N 1-bromo-2-fluorobenzene Chemical compound FC1=CC=CC=C1Br IPWBFGUBXWMIPR-UHFFFAOYSA-N 0.000 description 1
- JHLKSIOJYMGSMB-UHFFFAOYSA-N 1-bromo-3,5-difluorobenzene Chemical compound FC1=CC(F)=CC(Br)=C1 JHLKSIOJYMGSMB-UHFFFAOYSA-N 0.000 description 1
- OLDMYNWXIGPOCI-UHFFFAOYSA-N 1-bromo-3,5-dinitrobenzene Chemical compound [O-][N+](=O)C1=CC(Br)=CC([N+]([O-])=O)=C1 OLDMYNWXIGPOCI-UHFFFAOYSA-N 0.000 description 1
- GGMDFPMASIXEIR-UHFFFAOYSA-N 1-bromo-3-chloro-5-fluorobenzene Chemical compound FC1=CC(Cl)=CC(Br)=C1 GGMDFPMASIXEIR-UHFFFAOYSA-N 0.000 description 1
- LIGBGEJPUQBLTG-UHFFFAOYSA-N 1-bromo-3-fluoro-5-(trifluoromethyl)benzene Chemical compound FC1=CC(Br)=CC(C(F)(F)F)=C1 LIGBGEJPUQBLTG-UHFFFAOYSA-N 0.000 description 1
- XVNQVSGOIUYOPB-UHFFFAOYSA-N 1-bromo-3-fluoro-5-methoxybenzene Chemical compound COC1=CC(F)=CC(Br)=C1 XVNQVSGOIUYOPB-UHFFFAOYSA-N 0.000 description 1
- SWXVEPMSQBEVRH-UHFFFAOYSA-N 1-bromo-3-fluoro-5-nitrobenzene Chemical compound [O-][N+](=O)C1=CC(F)=CC(Br)=C1 SWXVEPMSQBEVRH-UHFFFAOYSA-N 0.000 description 1
- AITNMTXHTIIIBB-UHFFFAOYSA-N 1-bromo-4-fluorobenzene Chemical compound FC1=CC=C(Br)C=C1 AITNMTXHTIIIBB-UHFFFAOYSA-N 0.000 description 1
- AXZLAPAZYKLQHX-UHFFFAOYSA-N 1-bromo-5-chlorocyclohexa-2,4-diene-1-carbonitrile Chemical compound ClC1=CC=CC(Br)(C#N)C1 AXZLAPAZYKLQHX-UHFFFAOYSA-N 0.000 description 1
- FKDODJLQMYPCJG-UHFFFAOYSA-N 1-bromo-6-fluorocyclohexa-2,4-diene-1-carbonitrile Chemical compound FC1C=CC=CC1(Br)C#N FKDODJLQMYPCJG-UHFFFAOYSA-N 0.000 description 1
- AVRPFRMDMNDIDH-UHFFFAOYSA-N 1h-quinazolin-2-one Chemical class C1=CC=CC2=NC(O)=NC=C21 AVRPFRMDMNDIDH-UHFFFAOYSA-N 0.000 description 1
- JVSFQJZRHXAUGT-UHFFFAOYSA-N 2,2-dimethylpropanoyl chloride Chemical compound CC(C)(C)C(Cl)=O JVSFQJZRHXAUGT-UHFFFAOYSA-N 0.000 description 1
- BVCOJESIQPNOIF-UHFFFAOYSA-N 2-(2-bromophenyl)acetonitrile Chemical compound BrC1=CC=CC=C1CC#N BVCOJESIQPNOIF-UHFFFAOYSA-N 0.000 description 1
- RXWOHFUULDINMC-UHFFFAOYSA-N 2-(3-nitrothiophen-2-yl)acetic acid Chemical compound OC(=O)CC=1SC=CC=1[N+]([O-])=O RXWOHFUULDINMC-UHFFFAOYSA-N 0.000 description 1
- KCWMGRAMUYTYKZ-UHFFFAOYSA-N 2-(4,4-dimethyl-2-oxo-1h-3,1-benzoxazin-6-yl)pyrrole-1-carboxylic acid Chemical compound C1=C2C(C)(C)OC(=O)NC2=CC=C1C1=CC=CN1C(O)=O KCWMGRAMUYTYKZ-UHFFFAOYSA-N 0.000 description 1
- QLASQEZPJFNZQC-UHFFFAOYSA-N 2-(4-bromo-2-fluorophenyl)acetonitrile Chemical compound FC1=CC(Br)=CC=C1CC#N QLASQEZPJFNZQC-UHFFFAOYSA-N 0.000 description 1
- CVMIQENCTVIYOH-UHFFFAOYSA-N 2-(5-bromo-2-fluorophenyl)acetonitrile Chemical compound FC1=CC=C(Br)C=C1CC#N CVMIQENCTVIYOH-UHFFFAOYSA-N 0.000 description 1
- WUYNZPVTHRDYDT-UHFFFAOYSA-N 2-(6-bromopyridin-2-yl)acetonitrile Chemical compound BrC1=CC=CC(CC#N)=N1 WUYNZPVTHRDYDT-UHFFFAOYSA-N 0.000 description 1
- CHCAGFNTASDQFX-UHFFFAOYSA-N 2-(bromomethyl)-4-fluorobenzonitrile Chemical compound FC1=CC=C(C#N)C(CBr)=C1 CHCAGFNTASDQFX-UHFFFAOYSA-N 0.000 description 1
- WXYIAVSQWBJLGI-UHFFFAOYSA-N 2-[2-amino-5-(3-chlorophenyl)phenyl]-1-phenylpropan-2-ol Chemical compound C=1C(C=2C=C(Cl)C=CC=2)=CC=C(N)C=1C(O)(C)CC1=CC=CC=C1 WXYIAVSQWBJLGI-UHFFFAOYSA-N 0.000 description 1
- ISAGHPZBJVZKEI-UHFFFAOYSA-N 2-amino-5-(3-chlorophenyl)benzonitrile Chemical compound C1=C(C#N)C(N)=CC=C1C1=CC=CC(Cl)=C1 ISAGHPZBJVZKEI-UHFFFAOYSA-N 0.000 description 1
- GOLGILSVWFKZRQ-UHFFFAOYSA-N 2-amino-5-iodobenzoic acid Chemical compound NC1=CC=C(I)C=C1C(O)=O GOLGILSVWFKZRQ-UHFFFAOYSA-N 0.000 description 1
- ZHJBVCPDQAQBND-UHFFFAOYSA-N 2-bromo-2-(2-fluorophenyl)acetonitrile Chemical compound FC1=CC=CC=C1C(Br)C#N ZHJBVCPDQAQBND-UHFFFAOYSA-N 0.000 description 1
- KNBLITSBUDZSJW-UHFFFAOYSA-N 2-bromo-3-butylthiophene Chemical compound CCCCC=1C=CSC=1Br KNBLITSBUDZSJW-UHFFFAOYSA-N 0.000 description 1
- MPTKQBAGXQUSMP-UHFFFAOYSA-N 2-bromo-3-ethylthiophene Chemical compound CCC=1C=CSC=1Br MPTKQBAGXQUSMP-UHFFFAOYSA-N 0.000 description 1
- YYJBWYBULYUKMR-UHFFFAOYSA-N 2-bromo-3-methylthiophene Chemical compound CC=1C=CSC=1Br YYJBWYBULYUKMR-UHFFFAOYSA-N 0.000 description 1
- ILVHEUHJIIECNK-UHFFFAOYSA-N 2-bromo-3-propylthiophene Chemical compound CCCC=1C=CSC=1Br ILVHEUHJIIECNK-UHFFFAOYSA-N 0.000 description 1
- AFMPMSCZPVNPEM-UHFFFAOYSA-N 2-bromobenzonitrile Chemical compound BrC1=CC=CC=C1C#N AFMPMSCZPVNPEM-UHFFFAOYSA-N 0.000 description 1
- GHMDOVNPFWGFSZ-UHFFFAOYSA-N 2-bromothiophene-3-carbonitrile Chemical compound BrC=1SC=CC=1C#N GHMDOVNPFWGFSZ-UHFFFAOYSA-N 0.000 description 1
- 125000004637 2-oxopiperidinyl group Chemical group O=C1N(CCCC1)* 0.000 description 1
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- UAIUNKRWKOVEES-UHFFFAOYSA-N 3,3',5,5'-tetramethylbenzidine Chemical compound CC1=C(N)C(C)=CC(C=2C=C(C)C(N)=C(C)C=2)=C1 UAIUNKRWKOVEES-UHFFFAOYSA-N 0.000 description 1
- SOSPMXMEOFGPIM-UHFFFAOYSA-N 3,5-dibromopyridine Chemical compound BrC1=CN=CC(Br)=C1 SOSPMXMEOFGPIM-UHFFFAOYSA-N 0.000 description 1
- MFNUOXULYAMTRI-UHFFFAOYSA-N 3-(3-chlorophenyl)-n-methoxy-n-methylbenzamide Chemical compound CON(C)C(=O)C1=CC=CC(C=2C=C(Cl)C=CC=2)=C1 MFNUOXULYAMTRI-UHFFFAOYSA-N 0.000 description 1
- OUAZPCKRSSEQKB-UHFFFAOYSA-N 3-bromo-2-fluorobenzaldehyde Chemical compound FC1=C(Br)C=CC=C1C=O OUAZPCKRSSEQKB-UHFFFAOYSA-N 0.000 description 1
- UVKURTLVTLRSSM-UHFFFAOYSA-N 3-bromo-2-fluorobenzoic acid Chemical compound OC(=O)C1=CC=CC(Br)=C1F UVKURTLVTLRSSM-UHFFFAOYSA-N 0.000 description 1
- MEFQRXHVMJPOKZ-UHFFFAOYSA-N 3-bromo-5-fluorobenzaldehyde Chemical compound FC1=CC(Br)=CC(C=O)=C1 MEFQRXHVMJPOKZ-UHFFFAOYSA-N 0.000 description 1
- MUBJNMWVQGHHLG-UHFFFAOYSA-N 3-bromobenzenesulfonamide Chemical compound NS(=O)(=O)C1=CC=CC(Br)=C1 MUBJNMWVQGHHLG-UHFFFAOYSA-N 0.000 description 1
- 125000006275 3-bromophenyl group Chemical group [H]C1=C([H])C(Br)=C([H])C(*)=C1[H] 0.000 description 1
- GLQNIDBIWCJFBX-UHFFFAOYSA-N 3-fluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid Chemical compound CC(C)(C)OC(=O)NC1=C(F)C=CC=C1C(O)=O GLQNIDBIWCJFBX-UHFFFAOYSA-N 0.000 description 1
- IWIKQDJVPWMONO-UHFFFAOYSA-N 3-fluoro-5-(8-hydroxy-4,4-dimethyl-2-oxo-1h-3,1-benzoxazin-6-yl)benzonitrile Chemical compound C1=C2C(C)(C)OC(=O)NC2=C(O)C=C1C1=CC(F)=CC(C#N)=C1 IWIKQDJVPWMONO-UHFFFAOYSA-N 0.000 description 1
- SXOPCLUOUFQBJV-UHFFFAOYSA-N 3-methoxyanthranilic acid Chemical compound COC1=CC=CC(C(O)=O)=C1N SXOPCLUOUFQBJV-UHFFFAOYSA-N 0.000 description 1
- XZKIHKMTEMTJQX-UHFFFAOYSA-N 4-Nitrophenyl Phosphate Chemical compound OP(O)(=O)OC1=CC=C([N+]([O-])=O)C=C1 XZKIHKMTEMTJQX-UHFFFAOYSA-N 0.000 description 1
- UAQBYHRNBMVANO-UHFFFAOYSA-N 4-[2-amino-5-(3-chlorophenyl)phenyl]hepta-2,5-diyn-4-ol Chemical compound C1=C(N)C(C(O)(C#CC)C#CC)=CC(C=2C=C(Cl)C=CC=2)=C1 UAQBYHRNBMVANO-UHFFFAOYSA-N 0.000 description 1
- YMQPKONILWWJQG-UHFFFAOYSA-N 4-bromo-1,2-difluorobenzene Chemical compound FC1=CC=C(Br)C=C1F YMQPKONILWWJQG-UHFFFAOYSA-N 0.000 description 1
- VXKYOKPNAXNAFU-UHFFFAOYSA-N 4-bromo-1-fluoro-2-methylbenzene Chemical compound CC1=CC(Br)=CC=C1F VXKYOKPNAXNAFU-UHFFFAOYSA-N 0.000 description 1
- CJTIWGBQCVYTQE-UHFFFAOYSA-N 4-bromo-2-chloro-1-fluorobenzene Chemical compound FC1=CC=C(Br)C=C1Cl CJTIWGBQCVYTQE-UHFFFAOYSA-N 0.000 description 1
- DWNXGZBXFDNKOR-UHFFFAOYSA-N 4-bromo-2-fluoro-1-methoxybenzene Chemical compound COC1=CC=C(Br)C=C1F DWNXGZBXFDNKOR-UHFFFAOYSA-N 0.000 description 1
- HGXWRDPQFZKOLZ-UHFFFAOYSA-N 4-bromo-2-fluorobenzonitrile Chemical compound FC1=CC(Br)=CC=C1C#N HGXWRDPQFZKOLZ-UHFFFAOYSA-N 0.000 description 1
- KYMCOOXGQFSTAY-UHFFFAOYSA-N 4-bromofuran-2-carbonitrile Chemical compound BrC1=COC(C#N)=C1 KYMCOOXGQFSTAY-UHFFFAOYSA-N 0.000 description 1
- QSNSCYSYFYORTR-UHFFFAOYSA-N 4-chloroaniline Chemical compound NC1=CC=C(Cl)C=C1 QSNSCYSYFYORTR-UHFFFAOYSA-N 0.000 description 1
- XMDVCIIVGMQKQX-UHFFFAOYSA-N 5-(3-bromophenyl)-1,3,4-oxathiazol-2-one Chemical compound BrC1=CC=CC(C=2OC(=O)SN=2)=C1 XMDVCIIVGMQKQX-UHFFFAOYSA-N 0.000 description 1
- KWRORTRHBGUOOB-UHFFFAOYSA-N 5-(8-bromo-4,4-dimethyl-2-oxo-1h-3,1-benzoxazin-6-yl)-2-fluorobenzonitrile Chemical compound C1=C2C(C)(C)OC(=O)NC2=C(Br)C=C1C1=CC=C(F)C(C#N)=C1 KWRORTRHBGUOOB-UHFFFAOYSA-N 0.000 description 1
- GYCNHFWRPJXTSB-UHFFFAOYSA-N 5-bromo-2-fluorobenzonitrile Chemical compound FC1=CC=C(Br)C=C1C#N GYCNHFWRPJXTSB-UHFFFAOYSA-N 0.000 description 1
- QDCIJCPHCWULQI-UHFFFAOYSA-N 5-bromo-4-butylthiophene-2-carbaldehyde Chemical compound CCCCC=1C=C(C=O)SC=1Br QDCIJCPHCWULQI-UHFFFAOYSA-N 0.000 description 1
- KEODZYDOBHDZOT-UHFFFAOYSA-N 5-bromobenzene-1,3-dicarbonitrile Chemical compound BrC1=CC(C#N)=CC(C#N)=C1 KEODZYDOBHDZOT-UHFFFAOYSA-N 0.000 description 1
- VWVGOXGBMHAFFK-UHFFFAOYSA-N 5-bromofuran-2-carbonitrile Chemical compound BrC1=CC=C(C#N)O1 VWVGOXGBMHAFFK-UHFFFAOYSA-N 0.000 description 1
- WGOLHUGPTDEKCF-UHFFFAOYSA-N 5-bromopyridin-2-amine Chemical compound NC1=CC=C(Br)C=N1 WGOLHUGPTDEKCF-UHFFFAOYSA-N 0.000 description 1
- FTFFHWWIPOQCBC-UHFFFAOYSA-N 5-bromopyridine-3-carbonitrile Chemical compound BrC1=CN=CC(C#N)=C1 FTFFHWWIPOQCBC-UHFFFAOYSA-N 0.000 description 1
- GFBVUFQNHLUCPX-UHFFFAOYSA-N 5-bromothiophene-2-carbaldehyde Chemical compound BrC1=CC=C(C=O)S1 GFBVUFQNHLUCPX-UHFFFAOYSA-N 0.000 description 1
- WXJQQLDICAOBJB-UHFFFAOYSA-N 5-bromothiophene-2-sulfonamide Chemical compound NS(=O)(=O)C1=CC=C(Br)S1 WXJQQLDICAOBJB-UHFFFAOYSA-N 0.000 description 1
- SXWMTJRCGWONCL-UHFFFAOYSA-N 5-bromothiophene-3-carbonitrile Chemical compound BrC1=CC(C#N)=CS1 SXWMTJRCGWONCL-UHFFFAOYSA-N 0.000 description 1
- WSVDXJQFTJMIHQ-UHFFFAOYSA-N 6-(3-fluorophenyl)-4-methyl-1,4-dihydro-3,1-benzoxazin-2-one Chemical compound C1=C2C(C)OC(=O)NC2=CC=C1C1=CC=CC(F)=C1 WSVDXJQFTJMIHQ-UHFFFAOYSA-N 0.000 description 1
- UQCKRDHXLLJWMS-UHFFFAOYSA-N 6-(3-methoxyphenyl)spiro[1h-3,1-benzoxazine-4,1'-cyclobutane]-2-one Chemical compound COC1=CC=CC(C=2C=C3C4(CCC4)OC(=O)NC3=CC=2)=C1 UQCKRDHXLLJWMS-UHFFFAOYSA-N 0.000 description 1
- GFKRJZASOHKQCZ-UHFFFAOYSA-N 6-[5-(diethoxymethyl)furan-3-yl]-4,4-dimethyl-1h-3,1-benzoxazin-2-one Chemical compound O1C(C(OCC)OCC)=CC(C=2C=C3C(C)(C)OC(=O)NC3=CC=2)=C1 GFKRJZASOHKQCZ-UHFFFAOYSA-N 0.000 description 1
- BZIHMJOJAJSHGD-UHFFFAOYSA-N 6-[5-(hydroxyiminomethyl)furan-3-yl]-4,4-dimethyl-1h-3,1-benzoxazin-2-one Chemical compound C1=C2C(C)(C)OC(=O)NC2=CC=C1C1=COC(C=NO)=C1 BZIHMJOJAJSHGD-UHFFFAOYSA-N 0.000 description 1
- DXSMYDSFWCOSFM-UHFFFAOYSA-N 6-bromo-1h-3,1-benzoxazine-2,4-dione Chemical compound N1C(=O)OC(=O)C2=CC(Br)=CC=C21 DXSMYDSFWCOSFM-UHFFFAOYSA-N 0.000 description 1
- IJWDLYZNLACGOE-UHFFFAOYSA-N 6-bromo-4,4-dimethyl-1h-3,1-benzoxazin-2-one;1-bromo-3-fluorobenzene Chemical compound FC1=CC=CC(Br)=C1.C1=C(Br)C=C2C(C)(C)OC(=O)NC2=C1 IJWDLYZNLACGOE-UHFFFAOYSA-N 0.000 description 1
- IBQGECUALBHUHV-UHFFFAOYSA-N 6-chloro-4h-1,2-benzoxazin-3-one Chemical class O1NC(=O)CC2=CC(Cl)=CC=C21 IBQGECUALBHUHV-UHFFFAOYSA-N 0.000 description 1
- UOCAJNJVHUIDQN-UHFFFAOYSA-N 8-bromo-6-(3-chloro-4-fluorophenyl)-4,4-dimethyl-1h-3,1-benzoxazin-2-one Chemical compound C1=C2C(C)(C)OC(=O)NC2=C(Br)C=C1C1=CC=C(F)C(Cl)=C1 UOCAJNJVHUIDQN-UHFFFAOYSA-N 0.000 description 1
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 102000052567 Anaphase-Promoting Complex-Cyclosome Apc1 Subunit Human genes 0.000 description 1
- 244000105624 Arachis hypogaea Species 0.000 description 1
- 206010003497 Asphyxia Diseases 0.000 description 1
- KHBQMWCZKVMBLN-UHFFFAOYSA-N Benzenesulfonamide Chemical compound NS(=O)(=O)C1=CC=CC=C1 KHBQMWCZKVMBLN-UHFFFAOYSA-N 0.000 description 1
- 238000010599 BrdU assay Methods 0.000 description 1
- 239000004255 Butylated hydroxyanisole Substances 0.000 description 1
- 239000004322 Butylated hydroxytoluene Substances 0.000 description 1
- NLZUEZXRPGMBCV-UHFFFAOYSA-N Butylhydroxytoluene Chemical compound CC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 NLZUEZXRPGMBCV-UHFFFAOYSA-N 0.000 description 1
- ILGDOCLBOPKKHA-UHFFFAOYSA-N CC1(OC(NC2=C1C=C(C=C2OC)C2=C(C#N)C=C(C=C2)F)=O)C Chemical compound CC1(OC(NC2=C1C=C(C=C2OC)C2=C(C#N)C=C(C=C2)F)=O)C ILGDOCLBOPKKHA-UHFFFAOYSA-N 0.000 description 1
- DVNFCSFJNVDQIL-UHFFFAOYSA-M C[Mg]Br.[N] Chemical compound C[Mg]Br.[N] DVNFCSFJNVDQIL-UHFFFAOYSA-M 0.000 description 1
- 101100297347 Caenorhabditis elegans pgl-3 gene Proteins 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- QDHHCQZDFGDHMP-UHFFFAOYSA-N Chloramine Chemical compound ClN QDHHCQZDFGDHMP-UHFFFAOYSA-N 0.000 description 1
- XJUZRXYOEPSWMB-UHFFFAOYSA-N Chloromethyl methyl ether Chemical compound COCCl XJUZRXYOEPSWMB-UHFFFAOYSA-N 0.000 description 1
- 208000017667 Chronic Disease Diseases 0.000 description 1
- GSNUFIFRDBKVIE-UHFFFAOYSA-N DMF Natural products CC1=CC=C(C)O1 GSNUFIFRDBKVIE-UHFFFAOYSA-N 0.000 description 1
- 230000006820 DNA synthesis Effects 0.000 description 1
- 235000019739 Dicalciumphosphate Nutrition 0.000 description 1
- 238000008157 ELISA kit Methods 0.000 description 1
- 241000400611 Eucalyptus deanei Species 0.000 description 1
- 241000233866 Fungi Species 0.000 description 1
- 108010078851 HIV Reverse Transcriptase Proteins 0.000 description 1
- 101000738977 Homo sapiens Reverse transcriptase/ribonuclease H Proteins 0.000 description 1
- 206010071119 Hormone-dependent prostate cancer Diseases 0.000 description 1
- DOMWKUIIPQCAJU-LJHIYBGHSA-N Hydroxyprogesterone caproate Chemical compound C1CC2=CC(=O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@@](C(C)=O)(OC(=O)CCCCC)[C@@]1(C)CC2 DOMWKUIIPQCAJU-LJHIYBGHSA-N 0.000 description 1
- 229920002153 Hydroxypropyl cellulose Polymers 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 1
- OPFJDXRVMFKJJO-ZHHKINOHSA-N N-{[3-(2-benzamido-4-methyl-1,3-thiazol-5-yl)-pyrazol-5-yl]carbonyl}-G-dR-G-dD-dD-dD-NH2 Chemical compound S1C(C=2NN=C(C=2)C(=O)NCC(=O)N[C@H](CCCN=C(N)N)C(=O)NCC(=O)N[C@H](CC(O)=O)C(=O)N[C@H](CC(O)=O)C(=O)N[C@H](CC(O)=O)C(N)=O)=C(C)N=C1NC(=O)C1=CC=CC=C1 OPFJDXRVMFKJJO-ZHHKINOHSA-N 0.000 description 1
- 238000011887 Necropsy Methods 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 206010033128 Ovarian cancer Diseases 0.000 description 1
- 229910020667 PBr3 Inorganic materials 0.000 description 1
- 235000019483 Peanut oil Nutrition 0.000 description 1
- 102000003992 Peroxidases Human genes 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 206010060862 Prostate cancer Diseases 0.000 description 1
- 208000000236 Prostatic Neoplasms Diseases 0.000 description 1
- 108091006463 SLC25A24 Proteins 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 108010085012 Steroid Receptors Proteins 0.000 description 1
- 238000006619 Stille reaction Methods 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- STSCVKRWJPWALQ-UHFFFAOYSA-N TRIFLUOROACETIC ACID ETHYL ESTER Chemical compound CCOC(=O)C(F)(F)F STSCVKRWJPWALQ-UHFFFAOYSA-N 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- 102000040945 Transcription factor Human genes 0.000 description 1
- 108091023040 Transcription factor Proteins 0.000 description 1
- 239000013504 Triton X-100 Substances 0.000 description 1
- 229920004890 Triton X-100 Polymers 0.000 description 1
- 229930003316 Vitamin D Natural products 0.000 description 1
- QYSXJUFSXHHAJI-XFEUOLMDSA-N Vitamin D3 Natural products C1(/[C@@H]2CC[C@@H]([C@]2(CCC1)C)[C@H](C)CCCC(C)C)=C/C=C1\C[C@@H](O)CCC1=C QYSXJUFSXHHAJI-XFEUOLMDSA-N 0.000 description 1
- 229930003427 Vitamin E Natural products 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- ZWGMJLNXIVRFRJ-UHFFFAOYSA-N [1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrol-2-yl]boronic acid Chemical compound CC(C)(C)OC(=O)N1C=CC=C1B(O)O ZWGMJLNXIVRFRJ-UHFFFAOYSA-N 0.000 description 1
- AHWZCYVXODSVGD-UHFFFAOYSA-N [2,3-bis(trifluoromethyl)phenyl]boronic acid Chemical compound OB(O)C1=CC=CC(C(F)(F)F)=C1C(F)(F)F AHWZCYVXODSVGD-UHFFFAOYSA-N 0.000 description 1
- YOACKUBEIQZNIM-UHFFFAOYSA-N [N].C1=C(C#N)C(N)=CC=C1C1=CC=CC(Cl)=C1 Chemical compound [N].C1=C(C#N)C(N)=CC=C1C1=CC=CC(Cl)=C1 YOACKUBEIQZNIM-UHFFFAOYSA-N 0.000 description 1
- ABXSJIXCMARDGV-UHFFFAOYSA-N [N].[Br] Chemical compound [N].[Br] ABXSJIXCMARDGV-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 238000005576 amination reaction Methods 0.000 description 1
- 125000005428 anthryl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C3C(*)=C([H])C([H])=C([H])C3=C([H])C2=C1[H] 0.000 description 1
- 239000003242 anti bacterial agent Substances 0.000 description 1
- 229940088710 antibiotic agent Drugs 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 235000006708 antioxidants Nutrition 0.000 description 1
- 239000002249 anxiolytic agent Substances 0.000 description 1
- 230000000949 anxiolytic effect Effects 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 150000001499 aryl bromides Chemical class 0.000 description 1
- 150000001503 aryl iodides Chemical class 0.000 description 1
- 238000006254 arylation reaction Methods 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 229960005070 ascorbic acid Drugs 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- 125000002785 azepinyl group Chemical group 0.000 description 1
- 230000001580 bacterial effect Effects 0.000 description 1
- AYJRCSIUFZENHW-DEQYMQKBSA-L barium(2+);oxomethanediolate Chemical compound [Ba+2].[O-][14C]([O-])=O AYJRCSIUFZENHW-DEQYMQKBSA-L 0.000 description 1
- 150000003936 benzamides Chemical class 0.000 description 1
- KXDAEFPNCMNJSK-UHFFFAOYSA-N benzene carboxamide Natural products NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 1
- 125000000499 benzofuranyl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 description 1
- 150000008359 benzonitriles Chemical class 0.000 description 1
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 description 1
- WVDDGKGOMKODPV-UHFFFAOYSA-N benzyl alcohol Substances OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- AZWXAPCAJCYGIA-UHFFFAOYSA-N bis(2-methylpropyl)alumane Chemical compound CC(C)C[AlH]CC(C)C AZWXAPCAJCYGIA-UHFFFAOYSA-N 0.000 description 1
- IPWKHHSGDUIRAH-UHFFFAOYSA-N bis(pinacolato)diboron Chemical compound O1C(C)(C)C(C)(C)OB1B1OC(C)(C)C(C)(C)O1 IPWKHHSGDUIRAH-UHFFFAOYSA-N 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- 229950011563 brofoxine Drugs 0.000 description 1
- LKXYJYDRLBPHRS-UHFFFAOYSA-N bromocyclopropane Chemical compound BrC1CC1 LKXYJYDRLBPHRS-UHFFFAOYSA-N 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 235000019282 butylated hydroxyanisole Nutrition 0.000 description 1
- 235000010354 butylated hydroxytoluene Nutrition 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 244000309466 calf Species 0.000 description 1
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 1
- 125000002915 carbonyl group Chemical class [*:2]C([*:1])=O 0.000 description 1
- 230000021523 carboxylation Effects 0.000 description 1
- 238000006473 carboxylation reaction Methods 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000008004 cell lysis buffer Substances 0.000 description 1
- 239000006285 cell suspension Substances 0.000 description 1
- 238000012512 characterization method Methods 0.000 description 1
- 229940061627 chloromethyl methyl ether Drugs 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 229940125797 compound 12 Drugs 0.000 description 1
- 229940125782 compound 2 Drugs 0.000 description 1
- 229940126086 compound 21 Drugs 0.000 description 1
- 229940126214 compound 3 Drugs 0.000 description 1
- DOBRDRYODQBAMW-UHFFFAOYSA-N copper(i) cyanide Chemical compound [Cu+].N#[C-] DOBRDRYODQBAMW-UHFFFAOYSA-N 0.000 description 1
- OPQARKPSCNTWTJ-UHFFFAOYSA-L copper(ii) acetate Chemical compound [Cu+2].CC([O-])=O.CC([O-])=O OPQARKPSCNTWTJ-UHFFFAOYSA-L 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- SHQSVMDWKBRBGB-UHFFFAOYSA-N cyclobutanone Chemical compound O=C1CCC1 SHQSVMDWKBRBGB-UHFFFAOYSA-N 0.000 description 1
- YEIOLSIOGKBJAR-UHFFFAOYSA-N cyclopenta-1,3-dien-1-yl(diphenyl)phosphanium;dichloronickel;iron(2+) Chemical compound [Cl-].[Cl-].[Fe+2].[Ni+2].C1=C[CH-]C([PH+](C=2C=CC=CC=2)C=2C=CC=CC=2)=C1.C1=C[CH-]C([PH+](C=2C=CC=CC=2)C=2C=CC=CC=2)=C1 YEIOLSIOGKBJAR-UHFFFAOYSA-N 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 230000018109 developmental process Effects 0.000 description 1
- JGFBRKRYDCGYKD-UHFFFAOYSA-N dibutyl(oxo)tin Chemical compound CCCC[Sn](=O)CCCC JGFBRKRYDCGYKD-UHFFFAOYSA-N 0.000 description 1
- NEFBYIFKOOEVPA-UHFFFAOYSA-K dicalcium phosphate Chemical compound [Ca+2].[Ca+2].[O-]P([O-])([O-])=O NEFBYIFKOOEVPA-UHFFFAOYSA-K 0.000 description 1
- 229940038472 dicalcium phosphate Drugs 0.000 description 1
- 229910000390 dicalcium phosphate Inorganic materials 0.000 description 1
- LGTLXDJOAJDFLR-UHFFFAOYSA-N diethyl chlorophosphate Chemical compound CCOP(Cl)(=O)OCC LGTLXDJOAJDFLR-UHFFFAOYSA-N 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 238000009792 diffusion process Methods 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 239000002612 dispersion medium Substances 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 239000008157 edible vegetable oil Substances 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 150000002084 enol ethers Chemical class 0.000 description 1
- 238000006911 enzymatic reaction Methods 0.000 description 1
- 238000001952 enzyme assay Methods 0.000 description 1
- 210000000981 epithelium Anatomy 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- HASJWDPFBRPJNC-UHFFFAOYSA-N ethyl 4-[(4-ethoxycarbonylanilino)methylamino]benzoate Chemical compound C1=CC(C(=O)OCC)=CC=C1NCNC1=CC=C(C(=O)OCC)C=C1 HASJWDPFBRPJNC-UHFFFAOYSA-N 0.000 description 1
- OAYLNYINCPYISS-UHFFFAOYSA-N ethyl acetate;hexane Chemical compound CCCCCC.CCOC(C)=O OAYLNYINCPYISS-UHFFFAOYSA-N 0.000 description 1
- MSMGXWFHBSCQFB-UHFFFAOYSA-N ethyl cyanoformate Chemical compound CCOC(=O)C#N MSMGXWFHBSCQFB-UHFFFAOYSA-N 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000000834 fixative Substances 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 235000013355 food flavoring agent Nutrition 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 230000005714 functional activity Effects 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- WIGCFUFOHFEKBI-UHFFFAOYSA-N gamma-tocopherol Natural products CC(C)CCCC(C)CCCC(C)CCCC1CCC2C(C)C(O)C(C)C(C)C2O1 WIGCFUFOHFEKBI-UHFFFAOYSA-N 0.000 description 1
- 229940083124 ganglion-blocking antiadrenergic secondary and tertiary amines Drugs 0.000 description 1
- 238000003304 gavage Methods 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 239000001863 hydroxypropyl cellulose Substances 0.000 description 1
- 235000010977 hydroxypropyl cellulose Nutrition 0.000 description 1
- XDTYIDUXWQLBFV-UHFFFAOYSA-N imidazo[4,5-h][1,2]benzoxazin-3-one Chemical class C1=CC2=NC=NC2=C2ONC(=O)C=C21 XDTYIDUXWQLBFV-UHFFFAOYSA-N 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 238000000099 in vitro assay Methods 0.000 description 1
- 125000001041 indolyl group Chemical group 0.000 description 1
- 230000006698 induction Effects 0.000 description 1
- 231100000546 inhibition of ovulation Toxicity 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- VYFOAVADNIHPTR-UHFFFAOYSA-N isatoic anhydride Chemical class NC1=CC=CC=C1CO VYFOAVADNIHPTR-UHFFFAOYSA-N 0.000 description 1
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 description 1
- 125000000842 isoxazolyl group Chemical group 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 125000000468 ketone group Chemical group 0.000 description 1
- 238000002372 labelling Methods 0.000 description 1
- 150000002596 lactones Chemical class 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 239000012280 lithium aluminium hydride Substances 0.000 description 1
- UBJFKNSINUCEAL-UHFFFAOYSA-N lithium;2-methylpropane Chemical compound [Li+].C[C-](C)C UBJFKNSINUCEAL-UHFFFAOYSA-N 0.000 description 1
- WGOPGODQLGJZGL-UHFFFAOYSA-N lithium;butane Chemical compound [Li+].CC[CH-]C WGOPGODQLGJZGL-UHFFFAOYSA-N 0.000 description 1
- 244000144972 livestock Species 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- LROBJRRFCPYLIT-UHFFFAOYSA-M magnesium;ethyne;bromide Chemical compound [Mg+2].[Br-].[C-]#C LROBJRRFCPYLIT-UHFFFAOYSA-M 0.000 description 1
- QGEFGPVWRJCFQP-UHFFFAOYSA-M magnesium;methanidylbenzene;bromide Chemical compound [Mg+2].[Br-].[CH2-]C1=CC=CC=C1 QGEFGPVWRJCFQP-UHFFFAOYSA-M 0.000 description 1
- DQEUYIQDSMINEY-UHFFFAOYSA-M magnesium;prop-1-ene;bromide Chemical compound [Mg+2].[Br-].[CH2-]C=C DQEUYIQDSMINEY-UHFFFAOYSA-M 0.000 description 1
- 230000003211 malignant effect Effects 0.000 description 1
- 239000012528 membrane Substances 0.000 description 1
- 210000004379 membrane Anatomy 0.000 description 1
- 108020004999 messenger RNA Proteins 0.000 description 1
- 239000003863 metallic catalyst Substances 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- ZWOFHFOFKBYRHV-UHFFFAOYSA-N methyl 3-bromo-2-fluorobenzoate Chemical compound COC(=O)C1=CC=CC(Br)=C1F ZWOFHFOFKBYRHV-UHFFFAOYSA-N 0.000 description 1
- DVSDBMFJEQPWNO-UHFFFAOYSA-N methyllithium Chemical compound C[Li] DVSDBMFJEQPWNO-UHFFFAOYSA-N 0.000 description 1
- 239000008108 microcrystalline cellulose Substances 0.000 description 1
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 1
- 229940016286 microcrystalline cellulose Drugs 0.000 description 1
- 229960003248 mifepristone Drugs 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 239000007758 minimum essential medium Substances 0.000 description 1
- 125000002950 monocyclic group Chemical group 0.000 description 1
- 125000002757 morpholinyl group Chemical group 0.000 description 1
- ZEOQPNRYUCROGZ-UHFFFAOYSA-N n,n-dibutylbutan-1-amine;hydrobromide Chemical compound [Br-].CCCC[NH+](CCCC)CCCC ZEOQPNRYUCROGZ-UHFFFAOYSA-N 0.000 description 1
- KRKPYFLIYNGWTE-UHFFFAOYSA-N n,o-dimethylhydroxylamine Chemical compound CNOC KRKPYFLIYNGWTE-UHFFFAOYSA-N 0.000 description 1
- BCYGKMDWQBWUSC-UHFFFAOYSA-N n-(4-bromo-2-fluorophenyl)acetamide Chemical compound CC(=O)NC1=CC=C(Br)C=C1F BCYGKMDWQBWUSC-UHFFFAOYSA-N 0.000 description 1
- IZISMXMXCLUHGI-UHFFFAOYSA-N n-(4-chlorophenyl)-2,2-dimethylpropanamide Chemical compound CC(C)(C)C(=O)NC1=CC=C(Cl)C=C1 IZISMXMXCLUHGI-UHFFFAOYSA-N 0.000 description 1
- RVIWEEPJDGUIDT-UHFFFAOYSA-N n-[(3-bromo-2-fluorophenyl)methylidene]hydroxylamine Chemical compound ON=CC1=CC=CC(Br)=C1F RVIWEEPJDGUIDT-UHFFFAOYSA-N 0.000 description 1
- KUDPGZONDFORKU-UHFFFAOYSA-N n-chloroaniline Chemical class ClNC1=CC=CC=C1 KUDPGZONDFORKU-UHFFFAOYSA-N 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 125000006501 nitrophenyl group Chemical group 0.000 description 1
- 239000002736 nonionic surfactant Substances 0.000 description 1
- 239000012038 nucleophile Substances 0.000 description 1
- 239000012434 nucleophilic reagent Substances 0.000 description 1
- 229940078552 o-xylene Drugs 0.000 description 1
- 229950011093 onapristone Drugs 0.000 description 1
- 238000009806 oophorectomy Methods 0.000 description 1
- 238000000424 optical density measurement Methods 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 230000002611 ovarian Effects 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 125000002971 oxazolyl group Chemical group 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 150000002940 palladium Chemical class 0.000 description 1
- YJVFFLUZDVXJQI-UHFFFAOYSA-L palladium(ii) acetate Chemical compound [Pd+2].CC([O-])=O.CC([O-])=O YJVFFLUZDVXJQI-UHFFFAOYSA-L 0.000 description 1
- 238000001408 paramagnetic relaxation enhancement Methods 0.000 description 1
- 239000000312 peanut oil Substances 0.000 description 1
- 108040007629 peroxidase activity proteins Proteins 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 125000005561 phenanthryl group Chemical group 0.000 description 1
- FVZVCSNXTFCBQU-UHFFFAOYSA-N phosphanyl Chemical group [PH2] FVZVCSNXTFCBQU-UHFFFAOYSA-N 0.000 description 1
- IPNPIHIZVLFAFP-UHFFFAOYSA-N phosphorus tribromide Chemical compound BrP(Br)Br IPNPIHIZVLFAFP-UHFFFAOYSA-N 0.000 description 1
- 125000004193 piperazinyl group Chemical group 0.000 description 1
- 125000003386 piperidinyl group Chemical group 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 230000002335 preservative effect Effects 0.000 description 1
- 239000000651 prodrug Substances 0.000 description 1
- 229940002612 prodrug Drugs 0.000 description 1
- 238000000159 protein binding assay Methods 0.000 description 1
- 102000004169 proteins and genes Human genes 0.000 description 1
- 239000003586 protic polar solvent Substances 0.000 description 1
- 125000003373 pyrazinyl group Chemical group 0.000 description 1
- 125000002098 pyridazinyl group Chemical group 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 1
- 238000010791 quenching Methods 0.000 description 1
- 230000000171 quenching effect Effects 0.000 description 1
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 1
- 239000002516 radical scavenger Substances 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 238000006748 scratching Methods 0.000 description 1
- 230000002393 scratching effect Effects 0.000 description 1
- 239000008159 sesame oil Substances 0.000 description 1
- 235000011803 sesame oil Nutrition 0.000 description 1
- 229910052814 silicon oxide Inorganic materials 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- 239000008247 solid mixture Substances 0.000 description 1
- 210000002325 somatostatin-secreting cell Anatomy 0.000 description 1
- 125000003003 spiro group Chemical group 0.000 description 1
- 238000013223 sprague-dawley female rat Methods 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000008223 sterile water Substances 0.000 description 1
- 102000005969 steroid hormone receptors Human genes 0.000 description 1
- 210000004722 stifle Anatomy 0.000 description 1
- 230000000638 stimulation Effects 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 239000011550 stock solution Substances 0.000 description 1
- 238000010254 subcutaneous injection Methods 0.000 description 1
- 239000007929 subcutaneous injection Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 238000001356 surgical procedure Methods 0.000 description 1
- 239000012730 sustained-release form Substances 0.000 description 1
- GFYHSKONPJXCDE-UHFFFAOYSA-N sym-collidine Natural products CC1=CN=C(C)C(C)=C1 GFYHSKONPJXCDE-UHFFFAOYSA-N 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- JRMUNVKIHCOMHV-UHFFFAOYSA-M tetrabutylammonium bromide Chemical compound [Br-].CCCC[N+](CCCC)(CCCC)CCCC JRMUNVKIHCOMHV-UHFFFAOYSA-M 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 230000004797 therapeutic response Effects 0.000 description 1
- 125000006089 thiamorpholinyl sulfoxide group Chemical group 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- 125000004568 thiomorpholinyl group Chemical group 0.000 description 1
- QNMBSXGYAQZCTN-UHFFFAOYSA-N thiophen-3-ylboronic acid Chemical compound OB(O)C=1C=CSC=1 QNMBSXGYAQZCTN-UHFFFAOYSA-N 0.000 description 1
- 210000001541 thymus gland Anatomy 0.000 description 1
- 238000001890 transfection Methods 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
- WUOFQGMXQCSPPV-UHFFFAOYSA-N tributyl(1,3-thiazol-2-yl)stannane Chemical compound CCCC[Sn](CCCC)(CCCC)C1=NC=CS1 WUOFQGMXQCSPPV-UHFFFAOYSA-N 0.000 description 1
- ITMCEJHCFYSIIV-UHFFFAOYSA-M triflate Chemical compound [O-]S(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-M 0.000 description 1
- PNQBEPDZQUOCNY-UHFFFAOYSA-N trifluoroacetyl chloride Chemical compound FC(F)(F)C(Cl)=O PNQBEPDZQUOCNY-UHFFFAOYSA-N 0.000 description 1
- SEDZOYHHAIAQIW-UHFFFAOYSA-N trimethylsilyl azide Chemical compound C[Si](C)(C)N=[N+]=[N-] SEDZOYHHAIAQIW-UHFFFAOYSA-N 0.000 description 1
- CWMFRHBXRUITQE-UHFFFAOYSA-N trimethylsilylacetylene Chemical group C[Si](C)(C)C#C CWMFRHBXRUITQE-UHFFFAOYSA-N 0.000 description 1
- 238000011144 upstream manufacturing Methods 0.000 description 1
- 206010046766 uterine cancer Diseases 0.000 description 1
- 210000004291 uterus Anatomy 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 235000019166 vitamin D Nutrition 0.000 description 1
- 239000011710 vitamin D Substances 0.000 description 1
- 150000003710 vitamin D derivatives Chemical class 0.000 description 1
- 235000019165 vitamin E Nutrition 0.000 description 1
- 229940046009 vitamin E Drugs 0.000 description 1
- 239000011709 vitamin E Substances 0.000 description 1
- 229940046008 vitamin d Drugs 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
- GTLDTDOJJJZVBW-UHFFFAOYSA-N zinc cyanide Chemical compound [Zn+2].N#[C-].N#[C-] GTLDTDOJJJZVBW-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D265/00—Heterocyclic compounds containing six-membered rings having one nitrogen atom and one oxygen atom as the only ring hetero atoms
- C07D265/04—1,3-Oxazines; Hydrogenated 1,3-oxazines
- C07D265/12—1,3-Oxazines; Hydrogenated 1,3-oxazines condensed with carbocyclic rings or ring systems
- C07D265/14—1,3-Oxazines; Hydrogenated 1,3-oxazines condensed with carbocyclic rings or ring systems condensed with one six-membered ring
- C07D265/18—1,3-Oxazines; Hydrogenated 1,3-oxazines condensed with carbocyclic rings or ring systems condensed with one six-membered ring with hetero atoms directly attached in position 2
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings
- C07D413/04—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings
- C07D413/10—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings linked by a carbon chain containing aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings
- C07D417/04—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings directly linked by a ring-member-to-ring-member bond
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Steroid Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (5)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
US18301299P | 1999-05-04 | 1999-05-04 | |
US60/183,012 | 1999-05-04 | ||
US09/552,633 US6509334B1 (en) | 1999-05-04 | 2000-04-19 | Cyclocarbamate derivatives as progesterone receptor modulators |
US09/552,633 | 2000-04-19 | ||
PCT/US2000/011822 WO2000066571A1 (en) | 1999-05-04 | 2000-05-01 | Cyclocarbamate derivatives as progesterone receptor modulators |
Publications (1)
Publication Number | Publication Date |
---|---|
CA2371726A1 true CA2371726A1 (en) | 2000-11-09 |
Family
ID=26878647
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
CA002371726A Abandoned CA2371726A1 (en) | 1999-05-04 | 2000-05-01 | Cyclocarbamate derivatives as progesterone receptor modulators |
Country Status (19)
Country | Link |
---|---|
EP (1) | EP1173426A1 (xx) |
JP (1) | JP2002543193A (xx) |
KR (1) | KR20010114250A (xx) |
CN (1) | CN1145618C (xx) |
AU (1) | AU766428B2 (xx) |
BG (1) | BG106079A (xx) |
BR (1) | BR0010213A (xx) |
CA (1) | CA2371726A1 (xx) |
CZ (1) | CZ20013951A3 (xx) |
EA (1) | EA004512B1 (xx) |
HU (1) | HUP0201609A3 (xx) |
IL (1) | IL146280A0 (xx) |
MX (1) | MXPA01011286A (xx) |
NO (1) | NO321361B1 (xx) |
NZ (1) | NZ515355A (xx) |
PL (1) | PL351127A1 (xx) |
SG (1) | SG114650A1 (xx) |
SK (1) | SK15912001A3 (xx) |
TR (1) | TR200103286T2 (xx) |
Families Citing this family (4)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
DE602005007021D1 (de) * | 2004-04-27 | 2008-07-03 | Wyeth Corp | Cyanopyrrolhaltige cyclische carbamat- und thiocarbamatbiaryle und verfahren zu deren herstellung |
US20100160304A1 (en) * | 2005-01-19 | 2010-06-24 | Dainippon Sumitomo Pharma Co., Ltd | Aromatic sulfone compound as aldosterone receptor modulator |
WO2009044788A1 (ja) | 2007-10-05 | 2009-04-09 | Banyu Pharmaceutical Co., Ltd. | ベンゾオキサジノン誘導体 |
CN111925353B (zh) * | 2020-08-31 | 2022-04-08 | 苏州大学附属第二医院 | 一种2-噻吩甲腈的制备方法 |
Family Cites Families (4)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
EP0510235A1 (en) * | 1991-04-26 | 1992-10-28 | Dong-A Pharm. Co., Ltd. | Novel benzoxazine or benzothiazine derivatives and process for the preparation of the same |
WO1995020389A1 (en) * | 1994-01-28 | 1995-08-03 | Merck & Co., Inc. | Benzoxazinones as inhibitors of hiv reverse transcriptase |
PT800519E (pt) * | 1994-12-22 | 2004-03-31 | Ligand Pharm Inc | Compostos moduladores de receptores de esteroides e metodos |
CA2268953A1 (en) * | 1996-10-02 | 1998-04-09 | Du Pont Pharmaceuticals Company | 4,4-disubstituted-1,4-dihydro-2h-3,1-benzoxazin-2-ones useful as hiv reverse transcriptase inhibitors and intermediates and processes for making the same |
-
2000
- 2000-05-01 CZ CZ20013951A patent/CZ20013951A3/cs unknown
- 2000-05-01 SG SG200400080A patent/SG114650A1/en unknown
- 2000-05-01 PL PL00351127A patent/PL351127A1/xx not_active Application Discontinuation
- 2000-05-01 EP EP00928689A patent/EP1173426A1/en not_active Withdrawn
- 2000-05-01 CA CA002371726A patent/CA2371726A1/en not_active Abandoned
- 2000-05-01 EA EA200101176A patent/EA004512B1/ru not_active IP Right Cessation
- 2000-05-01 IL IL14628000A patent/IL146280A0/xx unknown
- 2000-05-01 BR BR0010213-0A patent/BR0010213A/pt not_active Application Discontinuation
- 2000-05-01 SK SK1591-2001A patent/SK15912001A3/sk unknown
- 2000-05-01 MX MXPA01011286A patent/MXPA01011286A/es unknown
- 2000-05-01 TR TR2001/03286T patent/TR200103286T2/xx unknown
- 2000-05-01 HU HU0201609A patent/HUP0201609A3/hu unknown
- 2000-05-01 CN CNB008071004A patent/CN1145618C/zh not_active Expired - Fee Related
- 2000-05-01 JP JP2000615601A patent/JP2002543193A/ja active Pending
- 2000-05-01 AU AU46886/00A patent/AU766428B2/en not_active Ceased
- 2000-05-01 KR KR1020017013970A patent/KR20010114250A/ko not_active Application Discontinuation
- 2000-05-01 NZ NZ515355A patent/NZ515355A/xx unknown
-
2001
- 2001-11-02 NO NO20015378A patent/NO321361B1/no not_active Application Discontinuation
- 2001-11-02 BG BG106079A patent/BG106079A/xx unknown
Also Published As
Publication number | Publication date |
---|---|
NO20015378D0 (no) | 2001-11-02 |
EA200101176A1 (ru) | 2002-04-25 |
KR20010114250A (ko) | 2001-12-31 |
BR0010213A (pt) | 2002-02-19 |
TR200103286T2 (tr) | 2002-07-22 |
CZ20013951A3 (cs) | 2002-05-15 |
IL146280A0 (en) | 2002-07-25 |
NO20015378L (no) | 2002-01-03 |
CN1349517A (zh) | 2002-05-15 |
SK15912001A3 (sk) | 2002-06-04 |
AU766428B2 (en) | 2003-10-16 |
HUP0201609A3 (en) | 2002-12-28 |
MXPA01011286A (es) | 2003-07-14 |
JP2002543193A (ja) | 2002-12-17 |
HUP0201609A2 (en) | 2002-08-28 |
NZ515355A (en) | 2004-02-27 |
AU4688600A (en) | 2000-11-17 |
BG106079A (en) | 2002-05-31 |
SG114650A1 (en) | 2005-09-28 |
NO321361B1 (no) | 2006-05-02 |
PL351127A1 (en) | 2003-03-24 |
CN1145618C (zh) | 2004-04-14 |
EA004512B1 (ru) | 2004-04-29 |
EP1173426A1 (en) | 2002-01-23 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
US6566358B2 (en) | Cyclocarbamate derivatives as progesterone receptor modulators | |
US6436929B1 (en) | Cyclothiocarbamate derivatives as progesterone receptor modulators | |
US6444668B1 (en) | Combination regimens using progesterone receptor modulators | |
EP1175411B1 (en) | Cyclothiocarbamate derivatives as progesterone receptor modulators | |
EP1173210B1 (en) | Contraceptive compositions containing antiprogestinic and progestinic | |
AU766428B2 (en) | Cyclocarbamate derivatives as progesterone receptor modulators |
Legal Events
Date | Code | Title | Description |
---|---|---|---|
EEER | Examination request | ||
FZDE | Discontinued |