CA2229299A1 - Compounds containing urea and alkoxysilane groups - Google Patents
Compounds containing urea and alkoxysilane groups Download PDFInfo
- Publication number
- CA2229299A1 CA2229299A1 CA002229299A CA2229299A CA2229299A1 CA 2229299 A1 CA2229299 A1 CA 2229299A1 CA 002229299 A CA002229299 A CA 002229299A CA 2229299 A CA2229299 A CA 2229299A CA 2229299 A1 CA2229299 A1 CA 2229299A1
- Authority
- CA
- Canada
- Prior art keywords
- groups
- polyisocyanate
- compound
- isocyanate groups
- residue obtained
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Abandoned
Links
- 150000001875 compounds Chemical class 0.000 title claims abstract description 48
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 title claims abstract description 30
- 239000004202 carbamide Substances 0.000 title description 10
- 239000005056 polyisocyanate Substances 0.000 claims abstract description 85
- 229920001228 polyisocyanate Polymers 0.000 claims abstract description 84
- IQPQWNKOIGAROB-UHFFFAOYSA-N isocyanate group Chemical group [N-]=C=O IQPQWNKOIGAROB-UHFFFAOYSA-N 0.000 claims abstract description 29
- 238000000576 coating method Methods 0.000 claims abstract description 13
- 125000000962 organic group Chemical group 0.000 claims abstract description 13
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 9
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 7
- 239000001257 hydrogen Substances 0.000 claims abstract description 7
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 7
- -1 Z represents COOR Chemical group 0.000 claims abstract description 6
- 239000000853 adhesive Substances 0.000 claims abstract description 6
- 230000001070 adhesive effect Effects 0.000 claims abstract description 6
- 125000003118 aryl group Chemical group 0.000 claims abstract description 6
- 239000000565 sealant Substances 0.000 claims abstract description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims description 9
- ZFSLODLOARCGLH-UHFFFAOYSA-N isocyanuric acid Chemical group OC1=NC(O)=NC(O)=N1 ZFSLODLOARCGLH-UHFFFAOYSA-N 0.000 claims description 9
- AVWRKZWQTYIKIY-UHFFFAOYSA-N urea-1-carboxylic acid Chemical group NC(=O)NC(O)=O AVWRKZWQTYIKIY-UHFFFAOYSA-N 0.000 claims description 8
- 125000000217 alkyl group Chemical group 0.000 claims description 7
- PCHXZXKMYCGVFA-UHFFFAOYSA-N 1,3-diazetidine-2,4-dione Chemical group O=C1NC(=O)N1 PCHXZXKMYCGVFA-UHFFFAOYSA-N 0.000 claims description 6
- OHJMTUPIZMNBFR-UHFFFAOYSA-N biuret Chemical group NC(=O)NC(N)=O OHJMTUPIZMNBFR-UHFFFAOYSA-N 0.000 claims description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 5
- 239000011248 coating agent Substances 0.000 claims description 4
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 abstract description 4
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 21
- 239000000047 product Substances 0.000 description 17
- 239000007787 solid Substances 0.000 description 14
- 125000005442 diisocyanate group Chemical class 0.000 description 13
- 239000000203 mixture Substances 0.000 description 13
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 13
- 238000006243 chemical reaction Methods 0.000 description 11
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 10
- DKPFZGUDAPQIHT-UHFFFAOYSA-N butyl acetate Chemical compound CCCCOC(C)=O DKPFZGUDAPQIHT-UHFFFAOYSA-N 0.000 description 10
- 235000013877 carbamide Nutrition 0.000 description 10
- NIMLQBUJDJZYEJ-UHFFFAOYSA-N isophorone diisocyanate Chemical compound CC1(C)CC(N=C=O)CC(C)(CN=C=O)C1 NIMLQBUJDJZYEJ-UHFFFAOYSA-N 0.000 description 9
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical class OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 8
- 239000005058 Isophorone diisocyanate Substances 0.000 description 8
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 8
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 8
- BLRPTPMANUNPDV-UHFFFAOYSA-N Silane Chemical compound [SiH4] BLRPTPMANUNPDV-UHFFFAOYSA-N 0.000 description 8
- 125000004103 aminoalkyl group Chemical group 0.000 description 8
- 239000007788 liquid Substances 0.000 description 8
- 239000000178 monomer Substances 0.000 description 8
- 229910000077 silane Inorganic materials 0.000 description 8
- 239000002904 solvent Substances 0.000 description 8
- 239000008096 xylene Substances 0.000 description 8
- CKLJMWTZIZZHCS-REOHCLBHSA-L aspartate group Chemical class N[C@@H](CC(=O)[O-])C(=O)[O-] CKLJMWTZIZZHCS-REOHCLBHSA-L 0.000 description 7
- 239000003054 catalyst Substances 0.000 description 7
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 7
- 238000000034 method Methods 0.000 description 7
- 150000004756 silanes Chemical class 0.000 description 7
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 6
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 6
- 239000007795 chemical reaction product Substances 0.000 description 6
- KORSJDCBLAPZEQ-UHFFFAOYSA-N dicyclohexylmethane-4,4'-diisocyanate Chemical compound C1CC(N=C=O)CCC1CC1CCC(N=C=O)CC1 KORSJDCBLAPZEQ-UHFFFAOYSA-N 0.000 description 6
- 229940008841 1,6-hexamethylene diisocyanate Drugs 0.000 description 5
- 239000005057 Hexamethylene diisocyanate Substances 0.000 description 5
- CKLJMWTZIZZHCS-REOHCLBHSA-N L-aspartic acid Chemical compound OC(=O)[C@@H](N)CC(O)=O CKLJMWTZIZZHCS-REOHCLBHSA-N 0.000 description 5
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 5
- RRAMGCGOFNQTLD-UHFFFAOYSA-N hexamethylene diisocyanate Chemical compound O=C=NCCCCCCN=C=O RRAMGCGOFNQTLD-UHFFFAOYSA-N 0.000 description 5
- 239000012948 isocyanate Substances 0.000 description 5
- 150000002513 isocyanates Chemical class 0.000 description 5
- 239000011976 maleic acid Substances 0.000 description 5
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 5
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 4
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 4
- 229940009098 aspartate Drugs 0.000 description 4
- WERYXYBDKMZEQL-UHFFFAOYSA-N butane-1,4-diol Chemical compound OCCCCO WERYXYBDKMZEQL-UHFFFAOYSA-N 0.000 description 4
- MMJGQHYROJTOHX-JTQLQIEISA-N dibutyl (2s)-2-aminobutanedioate Chemical compound CCCCOC(=O)C[C@H](N)C(=O)OCCCC MMJGQHYROJTOHX-JTQLQIEISA-N 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid Chemical compound CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 4
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 4
- 229910052757 nitrogen Inorganic materials 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- QISOBCMNUJQOJU-UHFFFAOYSA-N 4-bromo-1h-pyrazole-5-carboxylic acid Chemical compound OC(=O)C=1NN=CC=1Br QISOBCMNUJQOJU-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- UKLDJPRMSDWDSL-UHFFFAOYSA-L [dibutyl(dodecanoyloxy)stannyl] dodecanoate Chemical compound CCCCCCCCCCCC(=O)O[Sn](CCCC)(CCCC)OC(=O)CCCCCCCCCCC UKLDJPRMSDWDSL-UHFFFAOYSA-L 0.000 description 3
- 150000001851 cinnamic acid derivatives Chemical class 0.000 description 3
- 239000012975 dibutyltin dilaurate Substances 0.000 description 3
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 3
- 125000000524 functional group Chemical group 0.000 description 3
- 150000002430 hydrocarbons Chemical group 0.000 description 3
- 238000006068 polycondensation reaction Methods 0.000 description 3
- 239000011347 resin Substances 0.000 description 3
- 229920005989 resin Polymers 0.000 description 3
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- WYTZZXDRDKSJID-UHFFFAOYSA-N (3-aminopropyl)triethoxysilane Chemical compound CCO[Si](OCC)(OCC)CCCN WYTZZXDRDKSJID-UHFFFAOYSA-N 0.000 description 2
- SJECZPVISLOESU-UHFFFAOYSA-N 3-trimethoxysilylpropan-1-amine Chemical compound CO[Si](OC)(OC)CCCN SJECZPVISLOESU-UHFFFAOYSA-N 0.000 description 2
- UPMLOUAZCHDJJD-UHFFFAOYSA-N 4,4'-Diphenylmethane Diisocyanate Chemical compound C1=CC(N=C=O)=CC=C1CC1=CC=C(N=C=O)C=C1 UPMLOUAZCHDJJD-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Chemical compound P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 description 2
- ZJCCRDAZUWHFQH-UHFFFAOYSA-N Trimethylolpropane Chemical compound CCC(CO)(CO)CO ZJCCRDAZUWHFQH-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000001530 fumaric acid Substances 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- 230000003606 oligomerizing effect Effects 0.000 description 2
- HXSACZWWBYWLIS-UHFFFAOYSA-N oxadiazine-4,5,6-trione Chemical compound O=C1ON=NC(=O)C1=O HXSACZWWBYWLIS-UHFFFAOYSA-N 0.000 description 2
- FDPIMTJIUBPUKL-UHFFFAOYSA-N pentan-3-one Chemical compound CCC(=O)CC FDPIMTJIUBPUKL-UHFFFAOYSA-N 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- 229920001296 polysiloxane Polymers 0.000 description 2
- 235000013772 propylene glycol Nutrition 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- IMNIMPAHZVJRPE-UHFFFAOYSA-N triethylenediamine Chemical compound C1CN2CCN1CC2 IMNIMPAHZVJRPE-UHFFFAOYSA-N 0.000 description 2
- WBYWAXJHAXSJNI-VOTSOKGWSA-M .beta-Phenylacrylic acid Natural products [O-]C(=O)\C=C\C1=CC=CC=C1 WBYWAXJHAXSJNI-VOTSOKGWSA-M 0.000 description 1
- FKTHNVSLHLHISI-UHFFFAOYSA-N 1,2-bis(isocyanatomethyl)benzene Chemical compound O=C=NCC1=CC=CC=C1CN=C=O FKTHNVSLHLHISI-UHFFFAOYSA-N 0.000 description 1
- QWOVEJBDMKHZQK-UHFFFAOYSA-N 1,3,5-tris(3-trimethoxysilylpropyl)-1,3,5-triazinane-2,4,6-trione Chemical compound CO[Si](OC)(OC)CCCN1C(=O)N(CCC[Si](OC)(OC)OC)C(=O)N(CCC[Si](OC)(OC)OC)C1=O QWOVEJBDMKHZQK-UHFFFAOYSA-N 0.000 description 1
- ZIZJPRKHEXCVLL-UHFFFAOYSA-N 1,3-bis(6-isocyanatohexyl)-1,3-diazetidine-2,4-dione Chemical compound O=C=NCCCCCCN1C(=O)N(CCCCCCN=C=O)C1=O ZIZJPRKHEXCVLL-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- ROHUXHMNZLHBSF-UHFFFAOYSA-N 1,4-bis(isocyanatomethyl)cyclohexane Chemical compound O=C=NCC1CCC(CN=C=O)CC1 ROHUXHMNZLHBSF-UHFFFAOYSA-N 0.000 description 1
- ALQLPWJFHRMHIU-UHFFFAOYSA-N 1,4-diisocyanatobenzene Chemical compound O=C=NC1=CC=C(N=C=O)C=C1 ALQLPWJFHRMHIU-UHFFFAOYSA-N 0.000 description 1
- SBJCUZQNHOLYMD-UHFFFAOYSA-N 1,5-Naphthalene diisocyanate Chemical compound C1=CC=C2C(N=C=O)=CC=CC2=C1N=C=O SBJCUZQNHOLYMD-UHFFFAOYSA-N 0.000 description 1
- ATOUXIOKEJWULN-UHFFFAOYSA-N 1,6-diisocyanato-2,2,4-trimethylhexane Chemical compound O=C=NCCC(C)CC(C)(C)CN=C=O ATOUXIOKEJWULN-UHFFFAOYSA-N 0.000 description 1
- VLNDSAWYJSNKOU-UHFFFAOYSA-N 1-isocyanato-4-[(4-isocyanato-3-methylcyclohexyl)methyl]-2-methylcyclohexane Chemical compound C1CC(N=C=O)C(C)CC1CC1CC(C)C(N=C=O)CC1 VLNDSAWYJSNKOU-UHFFFAOYSA-N 0.000 description 1
- PYTNYCJPQQTENF-UHFFFAOYSA-N 2-[methoxy(dimethyl)silyl]ethanamine Chemical compound CO[Si](C)(C)CCN PYTNYCJPQQTENF-UHFFFAOYSA-N 0.000 description 1
- HXLAEGYMDGUSBD-UHFFFAOYSA-N 3-[diethoxy(methyl)silyl]propan-1-amine Chemical compound CCO[Si](C)(OCC)CCCN HXLAEGYMDGUSBD-UHFFFAOYSA-N 0.000 description 1
- OXKAXHPVFLEQHV-UHFFFAOYSA-N 3-tri(propan-2-yloxy)silylpropan-1-amine Chemical compound CC(C)O[Si](OC(C)C)(OC(C)C)CCCN OXKAXHPVFLEQHV-UHFFFAOYSA-N 0.000 description 1
- JILBPZJGIGDIGK-UHFFFAOYSA-N 5-triethoxysilylpentan-1-amine Chemical compound CCO[Si](OCC)(OCC)CCCCCN JILBPZJGIGDIGK-UHFFFAOYSA-N 0.000 description 1
- FGGKLVJTJGWVGJ-UHFFFAOYSA-N 5-trimethoxysilylpentan-1-amine Chemical compound CO[Si](OC)(OC)CCCCCN FGGKLVJTJGWVGJ-UHFFFAOYSA-N 0.000 description 1
- 101100097467 Arabidopsis thaliana SYD gene Proteins 0.000 description 1
- WBYWAXJHAXSJNI-SREVYHEPSA-N Cinnamic acid Chemical compound OC(=O)\C=C/C1=CC=CC=C1 WBYWAXJHAXSJNI-SREVYHEPSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- IEPRKVQEAMIZSS-UHFFFAOYSA-N Di-Et ester-Fumaric acid Natural products CCOC(=O)C=CC(=O)OCC IEPRKVQEAMIZSS-UHFFFAOYSA-N 0.000 description 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 1
- IEPRKVQEAMIZSS-WAYWQWQTSA-N Diethyl maleate Chemical compound CCOC(=O)\C=C/C(=O)OCC IEPRKVQEAMIZSS-WAYWQWQTSA-N 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical class S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- 235000009161 Espostoa lanata Nutrition 0.000 description 1
- 240000001624 Espostoa lanata Species 0.000 description 1
- 101100495925 Schizosaccharomyces pombe (strain 972 / ATCC 24843) chr3 gene Proteins 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- TUVYSBJZBYRDHP-UHFFFAOYSA-N acetic acid;methoxymethane Chemical compound COC.CC(O)=O TUVYSBJZBYRDHP-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 235000003704 aspartic acid Nutrition 0.000 description 1
- HIFVAOIJYDXIJG-UHFFFAOYSA-N benzylbenzene;isocyanic acid Chemical class N=C=O.N=C=O.C=1C=CC=CC=1CC1=CC=CC=C1 HIFVAOIJYDXIJG-UHFFFAOYSA-N 0.000 description 1
- OQFSQFPPLPISGP-UHFFFAOYSA-N beta-carboxyaspartic acid Natural products OC(=O)C(N)C(C(O)=O)C(O)=O OQFSQFPPLPISGP-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- VPKDCDLSJZCGKE-UHFFFAOYSA-N carbodiimide group Chemical group N=C=N VPKDCDLSJZCGKE-UHFFFAOYSA-N 0.000 description 1
- 150000001718 carbodiimides Chemical class 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 229930016911 cinnamic acid Natural products 0.000 description 1
- 235000013985 cinnamic acid Nutrition 0.000 description 1
- 239000008199 coating composition Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 150000004985 diamines Chemical group 0.000 description 1
- VSNLCLFPPHBFLV-LBPRGKRZSA-N diethyl (2s)-2-(3-trimethoxysilylpropylamino)butanedioate Chemical compound CCOC(=O)C[C@@H](C(=O)OCC)NCCC[Si](OC)(OC)OC VSNLCLFPPHBFLV-LBPRGKRZSA-N 0.000 description 1
- HMNXRLQSCJJMBT-LURJTMIESA-N diethyl (2s)-2-aminobutanedioate Chemical compound CCOC(=O)C[C@H](N)C(=O)OCC HMNXRLQSCJJMBT-LURJTMIESA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- WJRBRSLFGCUECM-UHFFFAOYSA-N hydantoin Chemical group O=C1CNC(=O)N1 WJRBRSLFGCUECM-UHFFFAOYSA-N 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- BKUQMJAYHDQMFH-UHFFFAOYSA-N isocyanatomethylcyclopentane Chemical compound O=C=NCC1CCCC1 BKUQMJAYHDQMFH-UHFFFAOYSA-N 0.000 description 1
- 230000007775 late Effects 0.000 description 1
- 239000012263 liquid product Substances 0.000 description 1
- 150000002688 maleic acid derivatives Chemical class 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- WBYWAXJHAXSJNI-UHFFFAOYSA-N methyl p-hydroxycinnamate Natural products OC(=O)C=CC1=CC=CC=C1 WBYWAXJHAXSJNI-UHFFFAOYSA-N 0.000 description 1
- 239000010705 motor oil Substances 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 229910000073 phosphorus hydride Inorganic materials 0.000 description 1
- 239000002861 polymer material Substances 0.000 description 1
- 229920005862 polyol Polymers 0.000 description 1
- 150000003077 polyols Chemical class 0.000 description 1
- 229920006389 polyphenyl polymer Polymers 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- LLHKCFNBLRBOGN-UHFFFAOYSA-N propylene glycol methyl ether acetate Chemical compound COCC(C)OC(C)=O LLHKCFNBLRBOGN-UHFFFAOYSA-N 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 125000005373 siloxane group Chemical group [SiH2](O*)* 0.000 description 1
- 125000003808 silyl group Chemical group [H][Si]([H])([H])[*] 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 150000003509 tertiary alcohols Chemical class 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- UCSBCWBHZLSFGC-UHFFFAOYSA-N tributoxysilane Chemical compound CCCCO[SiH](OCCCC)OCCCC UCSBCWBHZLSFGC-UHFFFAOYSA-N 0.000 description 1
- 150000003672 ureas Chemical class 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G18/00—Polymeric products of isocyanates or isothiocyanates
- C08G18/06—Polymeric products of isocyanates or isothiocyanates with compounds having active hydrogen
- C08G18/28—Polymeric products of isocyanates or isothiocyanates with compounds having active hydrogen characterised by the compounds used containing active hydrogen
- C08G18/2805—Compounds having only one group containing active hydrogen
- C08G18/288—Compounds containing at least one heteroatom other than oxygen or nitrogen
- C08G18/289—Compounds containing at least one heteroatom other than oxygen or nitrogen containing silicon
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F7/00—Compounds containing elements of Groups 4 or 14 of the Periodic Table
- C07F7/02—Silicon compounds
- C07F7/08—Compounds having one or more C—Si linkages
- C07F7/18—Compounds having one or more C—Si linkages as well as one or more C—O—Si linkages
- C07F7/1804—Compounds having Si-O-C linkages
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Polyurethanes Or Polyureas (AREA)
- Paints Or Removers (AREA)
- Sealing Material Composition (AREA)
- Silicon Polymers (AREA)
- Adhesives Or Adhesive Processes (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US08/814,561 US5908948A (en) | 1997-03-11 | 1997-03-11 | Compounds containing urea and alkoxysilane groups |
| US08/814,561 | 1997-11-03 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA2229299A1 true CA2229299A1 (en) | 1999-05-03 |
Family
ID=25215434
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA002229299A Abandoned CA2229299A1 (en) | 1997-03-11 | 1998-02-11 | Compounds containing urea and alkoxysilane groups |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US5908948A (enExample) |
| EP (1) | EP0864575B1 (enExample) |
| JP (1) | JP4163782B2 (enExample) |
| AT (1) | ATE223423T1 (enExample) |
| CA (1) | CA2229299A1 (enExample) |
| DE (1) | DE69807549T2 (enExample) |
| ES (1) | ES2183244T3 (enExample) |
Families Citing this family (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US6077902A (en) * | 1998-10-14 | 2000-06-20 | Bayer Corporation | Moisture-curable compounds containing isocyanate and alkoxysilane groups |
| US6096823A (en) * | 1998-10-14 | 2000-08-01 | Bayer Corporation | Moisture-curable compounds containing isocyanate and alkoxysilane groups |
| US6046270A (en) * | 1998-10-14 | 2000-04-04 | Bayer Corporation | Silane-modified polyurethane resins, a process for their preparation and their use as moisture-curable resins |
| US6005047A (en) * | 1998-10-14 | 1999-12-21 | Bayer Corporation | Moisture-curable compounds containing isocyanate and alkoxysilane groups |
| US6063863A (en) * | 1998-12-23 | 2000-05-16 | Bayer Corporation | Aqueous compositions containing colloidal silica and compounds with alkoxysilane and/or silanol groups |
| US6111010A (en) * | 1998-12-23 | 2000-08-29 | Bayer Corporation | Aqueous compounds containing alkoxysilane and/or silanol groups |
| US6703453B1 (en) | 1999-06-25 | 2004-03-09 | Bayer Aktiengesellschaft | Condensation cross-linking polyurethane materials containing special aminosilanes, a method for the production thereof and their use |
| US6265517B1 (en) * | 1999-09-07 | 2001-07-24 | Bostik, Inc. | Silylated polyether sealant |
| US7057000B2 (en) | 2000-12-22 | 2006-06-06 | Bayer Materialscience Llc | Two-component coating compositions containing silane adhesion promoters |
| US6444325B1 (en) * | 2000-12-22 | 2002-09-03 | Bayer Corporation | Two-component coating compositions containing silane adhesion promoters |
| US7482420B2 (en) | 2004-03-24 | 2009-01-27 | Construction Research & Technology Gmbh | Silane-terminated polyurethanes with high strength and high elongation |
| EP1717254A1 (de) | 2005-04-29 | 2006-11-02 | Sika Technology AG | Feuchtigkeitshärtende Zusammensetzung mit erhöhter Dehnbarkeit |
| AU2007209359A1 (en) * | 2006-01-26 | 2007-08-02 | Sika Technology Ag | Moisture-curing compositions containing silane-functional polymers and aminosilane adducts with good adhesive properties |
| DE102008050916A1 (de) * | 2008-10-10 | 2010-04-15 | Basf Coatings Ag | Zweikomponenten-Polyurethan-Lack enthaltend silanisierte Polyisocyanathärter, Verfahren zur Herstellung von silanisierten Polyisocyanathärtern und nach dem Verfahren hergestellte Härter |
| US8293836B2 (en) | 2009-05-20 | 2012-10-23 | Basf Coatings Gmbh | Curable coating composition containing a compound having a uretdione group and a different functional group and cured coatings |
| WO2011131463A1 (de) | 2010-04-21 | 2011-10-27 | Basf Coatings Gmbh | Beschichtungsmittel mit hohem festkörpergehalt und gutem verlauf sowie daraus hergestellte mehrschichtlackierungen und deren verwendung |
| KR101906618B1 (ko) * | 2010-11-19 | 2018-10-10 | 바스프 코팅스 게엠베하 | 높은 고형물 함량 및 양호한 레벨링을 갖는 코팅 조성물, 및 이로부터 형성된 다층 표면 코팅, 및 이들의 용도 |
| US20160230042A1 (en) * | 2013-03-04 | 2016-08-11 | The Government Of The United States Of America, As Represented By The Secretary Of The Navy | Silane end capped substituted urea resins and coatings thereof |
| AU2014226366A1 (en) * | 2013-03-04 | 2015-06-25 | The Government Of The United States Of America, As Represented By The Secretary Of The Navy | Silane end capped substituted urea resins and coatings thereof |
| WO2019198746A1 (ja) * | 2018-04-12 | 2019-10-17 | 日本パーカライジング株式会社 | ポリシロキサン化合物及び組成物 |
Family Cites Families (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2832754A (en) * | 1955-01-21 | 1958-04-29 | Union Carbide Corp | Alkoxysilylpropylamines |
| US2971864A (en) * | 1958-03-26 | 1961-02-14 | Dow Corning | Aminated mono-organosilanes and method of dyeing glass therewith |
| GB1243190A (en) * | 1967-12-05 | 1971-08-18 | British Petroleum Co | Oxo catalyst |
| GB1243189A (en) * | 1967-12-05 | 1971-08-18 | British Petroleum Co | Oxo process |
| US3676478A (en) * | 1968-12-04 | 1972-07-11 | Bayer Ag | Silyl-substituted urea derivatives |
| US4481364A (en) * | 1983-09-26 | 1984-11-06 | Union Carbide Corporation | Preparation of aminopropyltrialkoxysilanes and/or aminoalkylalkoxysilanes |
| ATE113622T1 (de) * | 1989-06-23 | 1994-11-15 | Bayer Ag | Verfahren zur herstellung von überzügen. |
| US5236741A (en) * | 1989-06-23 | 1993-08-17 | Bayer Aktiengesellschaft | Process for the production of polyurethane coatings |
| DE4011044A1 (de) * | 1990-04-05 | 1991-10-10 | Fraunhofer Ges Forschung | Silane, verfahren zu ihrer herstellung und ihre verwendung zur herstellung von polymerisaten und polykondensaten |
| DE4029505A1 (de) * | 1990-09-18 | 1992-03-19 | Henkel Kgaa | Feuchtigkeitshaertende, alkoxysilanterminierte polyurethane |
| US5523443A (en) * | 1992-10-13 | 1996-06-04 | Caschem, Inc. | Dual curing conformal coatings |
| US5312943A (en) * | 1992-10-13 | 1994-05-17 | Caschem, Inc. | Dual curing conformal coatings |
| DE4237468A1 (de) * | 1992-11-06 | 1994-05-11 | Bayer Ag | Alkoxysilan- und Aminogruppen aufweisende Verbindungen |
| US5550272A (en) * | 1995-10-02 | 1996-08-27 | General Electric Company | Method for hydrosilating unsaturated monomers |
-
1997
- 1997-03-11 US US08/814,561 patent/US5908948A/en not_active Expired - Lifetime
-
1998
- 1998-02-11 CA CA002229299A patent/CA2229299A1/en not_active Abandoned
- 1998-02-26 AT AT98103320T patent/ATE223423T1/de not_active IP Right Cessation
- 1998-02-26 ES ES98103320T patent/ES2183244T3/es not_active Expired - Lifetime
- 1998-02-26 EP EP98103320A patent/EP0864575B1/en not_active Expired - Lifetime
- 1998-02-26 DE DE69807549T patent/DE69807549T2/de not_active Expired - Lifetime
- 1998-03-09 JP JP07306298A patent/JP4163782B2/ja not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| ATE223423T1 (de) | 2002-09-15 |
| US5908948A (en) | 1999-06-01 |
| EP0864575A2 (en) | 1998-09-16 |
| JP4163782B2 (ja) | 2008-10-08 |
| DE69807549D1 (de) | 2002-10-10 |
| DE69807549T2 (de) | 2003-01-16 |
| JPH10251272A (ja) | 1998-09-22 |
| EP0864575B1 (en) | 2002-09-04 |
| EP0864575A3 (en) | 1999-09-15 |
| ES2183244T3 (es) | 2003-03-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0864575B1 (en) | Compounds containing urea and alkoxysilane groups | |
| US5756751A (en) | Compounds containing alkoxysilane groups and hydantoin groups | |
| US6057415A (en) | Water dispersible polyisocyanates containing alkoxysilane groups | |
| CA2285776C (en) | Silane-modified polyurethane resins, a process for their preparation and their use as moisture-curable resins | |
| EP0949308B1 (en) | Water dispersible compounds containing alkoxysilane groups | |
| CA2431509C (en) | Two-component coating compositions containing silane adhesion promoters | |
| EP0949283B1 (en) | Aqueous two-component coating compositions | |
| JPH10251272A5 (enExample) | ||
| EP1013686B1 (en) | Aqueous compounds containing alkoxysilane and/or silanol groups | |
| EP1013685B1 (en) | Aqueous compositions containing colloidal silica and compounds with alkoxysilane and/or silanol groups | |
| EP0913402B1 (en) | Compounds containing alkoxysilane groups and hydantoin groups | |
| EP1349899B1 (en) | Two component polyurethane coating composition containing epoxy silane adhesion promoters | |
| US6169140B1 (en) | Moisture-curable compositions containing polyisocyanates and polyacrylates having alkoxysilane groups | |
| CA2304421C (en) | Moisture-curable compositions containing polyisocyanates and compounds with alkoxysilane groups | |
| CA2220326C (en) | Compounds containing alkoxysilane groups and hydantoin groups | |
| KR100500620B1 (ko) | 알콕시실란기및히단토인기함유화합물 | |
| MXPA98001777A (es) | Compuestos que contienen urea y gruposalcoxisilano | |
| JP4279368B2 (ja) | アルコキシシラン基とヒダントイン基とを有する化合物 | |
| CA2436003C (en) | Two-component coating compositions containing silane adhesion promoters | |
| PL185576B1 (pl) | Związki zawierające grupy alkoksysilanowe i grupy hydantoinowe | |
| CZ344597A3 (cs) | Sloučeniny obsahující alkoxysilanové skupiny a hydantoinové skupiny | |
| HK1019227B (en) | Compounds containing alkoxysilane groups and hydantoin groups |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| EEER | Examination request | ||
| FZDE | Discontinued |