CA2072836A1 - Pyrrolopyrazine derivatives - Google Patents
Pyrrolopyrazine derivativesInfo
- Publication number
- CA2072836A1 CA2072836A1 CA002072836A CA2072836A CA2072836A1 CA 2072836 A1 CA2072836 A1 CA 2072836A1 CA 002072836 A CA002072836 A CA 002072836A CA 2072836 A CA2072836 A CA 2072836A CA 2072836 A1 CA2072836 A1 CA 2072836A1
- Authority
- CA
- Canada
- Prior art keywords
- solution
- mixture
- treated
- methylene chloride
- formula
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Abandoned
Links
- LJWZSXDLNMOUIP-UHFFFAOYSA-N N1C=CN=C2N=CC=C21 Chemical class N1C=CN=C2N=CC=C21 LJWZSXDLNMOUIP-UHFFFAOYSA-N 0.000 title abstract description 3
- 150000001875 compounds Chemical class 0.000 claims abstract description 138
- -1 trifluoro-methanesulphonyloxy Chemical group 0.000 claims abstract description 47
- 239000002253 acid Substances 0.000 claims abstract description 35
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 34
- 239000001257 hydrogen Substances 0.000 claims abstract description 32
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 32
- 150000003839 salts Chemical class 0.000 claims abstract description 29
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 24
- 125000003118 aryl group Chemical group 0.000 claims abstract description 12
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 12
- 150000002367 halogens Chemical class 0.000 claims abstract description 12
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 9
- 150000002431 hydrogen Chemical class 0.000 claims abstract description 8
- 230000002265 prevention Effects 0.000 claims abstract description 8
- 208000010877 cognitive disease Diseases 0.000 claims abstract description 7
- 208000024827 Alzheimer disease Diseases 0.000 claims abstract description 6
- 208000020401 Depressive disease Diseases 0.000 claims abstract description 6
- 208000018737 Parkinson disease Diseases 0.000 claims abstract description 6
- 230000004770 neurodegeneration Effects 0.000 claims abstract description 6
- 208000015122 neurodegenerative disease Diseases 0.000 claims abstract description 6
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 claims abstract description 5
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 4
- 238000000034 method Methods 0.000 claims description 26
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 24
- 230000008569 process Effects 0.000 claims description 17
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims description 13
- 239000003814 drug Substances 0.000 claims description 9
- 239000000126 substance Substances 0.000 claims description 9
- QSLLFYVBWXWUQT-UHFFFAOYSA-N 7-Azaindolizine Chemical compound C1=NC=CN2C=CC=C21 QSLLFYVBWXWUQT-UHFFFAOYSA-N 0.000 claims description 8
- 238000004519 manufacturing process Methods 0.000 claims description 7
- 239000003795 chemical substances by application Substances 0.000 claims description 6
- 125000005951 trifluoromethanesulfonyloxy group Chemical group 0.000 claims description 5
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 claims description 4
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims description 4
- 238000005661 deetherification reaction Methods 0.000 claims description 4
- UAEHHIBHDBOMNA-UHFFFAOYSA-N 3-n-butyl-5,6,10,11-tetrahydro-8-methyl-benzo[g]pyrazino[1,2-a]indole Chemical compound C1=C2C(C)=NCCN2C2=C1CCC1=CC(CCCC)=CC=C12 UAEHHIBHDBOMNA-UHFFFAOYSA-N 0.000 claims description 3
- 239000013543 active substance Substances 0.000 claims description 3
- 125000005415 substituted alkoxy group Chemical group 0.000 claims description 3
- OSFLAQWWWPPKDO-UHFFFAOYSA-N 3-cyclohexyl-5,6,10,11-tetrahydro-8-methyl-benzo[g]pyrazino[1,2-a]indole Chemical compound CC1=NCCN(C=2C3=CC=4)C1=CC=2CCC3=CC=4C1CCCCC1 OSFLAQWWWPPKDO-UHFFFAOYSA-N 0.000 claims description 2
- NONULSBLMWKYMW-UHFFFAOYSA-N 3-cyclopentyloxy-5,6,10,11-tetrahydro-8-methylbenzo[g]pyrazino[1,2-a]indole Chemical compound CC1=NCCN(C=2C3=CC=4)C1=CC=2CCC3=CC=4OC1CCCC1 NONULSBLMWKYMW-UHFFFAOYSA-N 0.000 claims description 2
- WHXPSVFCNYDIMA-UHFFFAOYSA-N 5,13-dimethyl-14,17-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),3,5,11,13-hexaene Chemical compound C1CC2=CC(C)=CC=C2C2=C1C=C1N2CCN=C1C WHXPSVFCNYDIMA-UHFFFAOYSA-N 0.000 claims description 2
- 125000005530 alkylenedioxy group Chemical group 0.000 claims description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 2
- 239000012876 carrier material Substances 0.000 claims 2
- GFVQBYANQCSJHB-UHFFFAOYSA-N C1=C2C(C)=NCCN2C2=C1CCC1=CC(OC(C)C)=CC=C12 Chemical compound C1=C2C(C)=NCCN2C2=C1CCC1=CC(OC(C)C)=CC=C12 GFVQBYANQCSJHB-UHFFFAOYSA-N 0.000 claims 1
- 230000007131 anti Alzheimer effect Effects 0.000 claims 1
- 230000000648 anti-parkinson Effects 0.000 claims 1
- 239000000935 antidepressant agent Substances 0.000 claims 1
- 229940005513 antidepressants Drugs 0.000 claims 1
- 239000000939 antiparkinson agent Substances 0.000 claims 1
- 201000010099 disease Diseases 0.000 claims 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims 1
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 claims 1
- 230000036541 health Effects 0.000 abstract description 2
- 230000006872 improvement Effects 0.000 abstract description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 abstract 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 582
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 480
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 342
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 252
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 240
- 239000000243 solution Substances 0.000 description 239
- 239000000203 mixture Substances 0.000 description 206
- 229940073584 methylene chloride Drugs 0.000 description 194
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 190
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 186
- 239000002904 solvent Substances 0.000 description 156
- 229910052786 argon Inorganic materials 0.000 description 126
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 125
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 118
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 112
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 111
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 111
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 97
- 239000003921 oil Substances 0.000 description 91
- 235000019198 oils Nutrition 0.000 description 91
- 238000003756 stirring Methods 0.000 description 89
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 88
- 239000012074 organic phase Substances 0.000 description 87
- 239000012043 crude product Substances 0.000 description 75
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 73
- 239000011541 reaction mixture Substances 0.000 description 72
- 239000001530 fumaric acid Substances 0.000 description 67
- 235000011087 fumaric acid Nutrition 0.000 description 67
- 239000012047 saturated solution Substances 0.000 description 65
- 239000003480 eluent Substances 0.000 description 64
- 239000000741 silica gel Substances 0.000 description 64
- 229910002027 silica gel Inorganic materials 0.000 description 64
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 62
- 235000011121 sodium hydroxide Nutrition 0.000 description 62
- 229940083608 sodium hydroxide Drugs 0.000 description 62
- 238000006243 chemical reaction Methods 0.000 description 61
- 235000019341 magnesium sulphate Nutrition 0.000 description 59
- 239000008346 aqueous phase Substances 0.000 description 48
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 43
- 239000012071 phase Substances 0.000 description 42
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 40
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical class [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 37
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 37
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 description 36
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 36
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 34
- PNEYBMLMFCGWSK-UHFFFAOYSA-N Alumina Chemical compound [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 33
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 30
- 239000000284 extract Substances 0.000 description 30
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 27
- 239000007787 solid Substances 0.000 description 27
- GXWNSJYVSIJRLS-UHFFFAOYSA-N 6-bromo-8-methylimidazo[1,2-a]pyrazine Chemical compound CC1=NC(Br)=CN2C=CN=C12 GXWNSJYVSIJRLS-UHFFFAOYSA-N 0.000 description 25
- 238000010992 reflux Methods 0.000 description 25
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 23
- 235000011114 ammonium hydroxide Nutrition 0.000 description 23
- 229910000033 sodium borohydride Inorganic materials 0.000 description 23
- 239000012279 sodium borohydride Substances 0.000 description 23
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 22
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 21
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 20
- 235000011167 hydrochloric acid Nutrition 0.000 description 20
- 229960000443 hydrochloric acid Drugs 0.000 description 20
- 238000000746 purification Methods 0.000 description 20
- 238000001816 cooling Methods 0.000 description 19
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 18
- PZOUSPYUWWUPPK-UHFFFAOYSA-N indole Natural products CC1=CC=CC2=C1C=CN2 PZOUSPYUWWUPPK-UHFFFAOYSA-N 0.000 description 18
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine Natural products C1=CC=C2CC=NC2=C1 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 description 18
- DAKZISABEDGGSV-UHFFFAOYSA-N n-(2-aminoethyl)acetamide Chemical compound CC(=O)NCCN DAKZISABEDGGSV-UHFFFAOYSA-N 0.000 description 18
- 239000000725 suspension Substances 0.000 description 18
- 239000000047 product Substances 0.000 description 17
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 16
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 15
- GCZDLZHMAMLSJF-UHFFFAOYSA-N pyrazino[1,2-a]indole Chemical compound C1=CN=CC2=CC3=CC=CC=C3N21 GCZDLZHMAMLSJF-UHFFFAOYSA-N 0.000 description 15
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical compound [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 description 14
- KYQCOXFCLRTKLS-UHFFFAOYSA-N Pyrazine Chemical compound C1=CN=CC=N1 KYQCOXFCLRTKLS-UHFFFAOYSA-N 0.000 description 14
- 239000013078 crystal Substances 0.000 description 13
- 239000000706 filtrate Substances 0.000 description 13
- 230000007935 neutral effect Effects 0.000 description 13
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 12
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- 239000012442 inert solvent Substances 0.000 description 12
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 description 12
- FAMRKDQNMBBFBR-BQYQJAHWSA-N diethyl azodicarboxylate Substances CCOC(=O)\N=N\C(=O)OCC FAMRKDQNMBBFBR-BQYQJAHWSA-N 0.000 description 11
- FAMRKDQNMBBFBR-UHFFFAOYSA-N ethyl n-ethoxycarbonyliminocarbamate Chemical compound CCOC(=O)N=NC(=O)OCC FAMRKDQNMBBFBR-UHFFFAOYSA-N 0.000 description 11
- HZNVUJQVZSTENZ-UHFFFAOYSA-N 2,3-dichloro-5,6-dicyano-1,4-benzoquinone Chemical compound ClC1=C(Cl)C(=O)C(C#N)=C(C#N)C1=O HZNVUJQVZSTENZ-UHFFFAOYSA-N 0.000 description 10
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 9
- 102000010909 Monoamine Oxidase Human genes 0.000 description 9
- 108010062431 Monoamine oxidase Proteins 0.000 description 9
- KWYHDKDOAIKMQN-UHFFFAOYSA-N N,N,N',N'-tetramethylethylenediamine Chemical compound CN(C)CCN(C)C KWYHDKDOAIKMQN-UHFFFAOYSA-N 0.000 description 9
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 9
- 229960000510 ammonia Drugs 0.000 description 9
- 229910021529 ammonia Inorganic materials 0.000 description 9
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 9
- 239000002808 molecular sieve Substances 0.000 description 9
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 9
- RHUYHJGZWVXEHW-UHFFFAOYSA-N 1,1-Dimethyhydrazine Chemical compound CN(C)N RHUYHJGZWVXEHW-UHFFFAOYSA-N 0.000 description 8
- SPEUIVXLLWOEMJ-UHFFFAOYSA-N 1,1-dimethoxyethane Chemical compound COC(C)OC SPEUIVXLLWOEMJ-UHFFFAOYSA-N 0.000 description 8
- 238000009835 boiling Methods 0.000 description 8
- 239000002775 capsule Substances 0.000 description 8
- 239000005457 ice water Substances 0.000 description 8
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 8
- 239000000463 material Substances 0.000 description 8
- QZAYGJVTTNCVMB-UHFFFAOYSA-N serotonin Chemical compound C1=C(O)C=C2C(CCN)=CNC2=C1 QZAYGJVTTNCVMB-UHFFFAOYSA-N 0.000 description 8
- GGZQLTVZPOGLCC-UHFFFAOYSA-N 2-(2-bromoethyl)-1,3-dioxolane Chemical compound BrCCC1OCCO1 GGZQLTVZPOGLCC-UHFFFAOYSA-N 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 7
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 7
- PCNDJXKNXGMECE-UHFFFAOYSA-N Phenazine Natural products C1=CC=CC2=NC3=CC=CC=C3N=C21 PCNDJXKNXGMECE-UHFFFAOYSA-N 0.000 description 7
- 239000000969 carrier Substances 0.000 description 7
- 230000000694 effects Effects 0.000 description 7
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 7
- 239000011777 magnesium Substances 0.000 description 7
- 229910052749 magnesium Inorganic materials 0.000 description 7
- 229910001629 magnesium chloride Inorganic materials 0.000 description 7
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 7
- 235000006408 oxalic acid Nutrition 0.000 description 7
- ITMCEJHCFYSIIV-UHFFFAOYSA-N triflic acid Chemical compound OS(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-N 0.000 description 7
- KVIOIFKWKBDGAV-UHFFFAOYSA-N 58881-41-7 Chemical compound C1=CC=C2N3C(=O)C4=CC5=CC=CC=C5N4C(=O)C3=CC2=C1 KVIOIFKWKBDGAV-UHFFFAOYSA-N 0.000 description 6
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- 229910021589 Copper(I) bromide Inorganic materials 0.000 description 6
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 6
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 6
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 6
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 description 6
- 210000004556 brain Anatomy 0.000 description 6
- MKUWVMRNQOOSAT-UHFFFAOYSA-N but-3-en-2-ol Chemical compound CC(O)C=C MKUWVMRNQOOSAT-UHFFFAOYSA-N 0.000 description 6
- NKNDPYCGAZPOFS-UHFFFAOYSA-M copper(i) bromide Chemical compound Br[Cu] NKNDPYCGAZPOFS-UHFFFAOYSA-M 0.000 description 6
- YNHIGQDRGKUECZ-UHFFFAOYSA-N dichloropalladium;triphenylphosphanium Chemical compound Cl[Pd]Cl.C1=CC=CC=C1[PH+](C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1[PH+](C=1C=CC=CC=1)C1=CC=CC=C1 YNHIGQDRGKUECZ-UHFFFAOYSA-N 0.000 description 6
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 6
- 239000011734 sodium Substances 0.000 description 6
- HLVFKOKELQSXIQ-UHFFFAOYSA-N 1-bromo-2-methylpropane Chemical compound CC(C)CBr HLVFKOKELQSXIQ-UHFFFAOYSA-N 0.000 description 5
- 239000001828 Gelatine Substances 0.000 description 5
- 239000002585 base Substances 0.000 description 5
- 239000003054 catalyst Substances 0.000 description 5
- 229920000159 gelatin Polymers 0.000 description 5
- 235000019322 gelatine Nutrition 0.000 description 5
- 125000000814 indol-3-yl group Chemical group [H]C1=C([H])C([H])=C2N([H])C([H])=C([*])C2=C1[H] 0.000 description 5
- 239000008363 phosphate buffer Substances 0.000 description 5
- 235000017557 sodium bicarbonate Nutrition 0.000 description 5
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 5
- 239000000758 substrate Substances 0.000 description 5
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 5
- DIIIISSCIXVANO-UHFFFAOYSA-N 1,2-Dimethylhydrazine Chemical compound CNNC DIIIISSCIXVANO-UHFFFAOYSA-N 0.000 description 4
- HUTNOYOBQPAKIA-UHFFFAOYSA-N 1h-pyrazin-2-one Chemical compound OC1=CN=CC=N1 HUTNOYOBQPAKIA-UHFFFAOYSA-N 0.000 description 4
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 4
- BNANPEQZOWHZKY-UHFFFAOYSA-N 3-phenylfuran Chemical compound O1C=CC(C=2C=CC=CC=2)=C1 BNANPEQZOWHZKY-UHFFFAOYSA-N 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- BHHGXPLMPWCGHP-UHFFFAOYSA-N Phenethylamine Chemical compound NCCC1=CC=CC=C1 BHHGXPLMPWCGHP-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- 239000004480 active ingredient Substances 0.000 description 4
- 230000002152 alkylating effect Effects 0.000 description 4
- 230000029936 alkylation Effects 0.000 description 4
- 238000005804 alkylation reaction Methods 0.000 description 4
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 4
- 230000007062 hydrolysis Effects 0.000 description 4
- 238000006460 hydrolysis reaction Methods 0.000 description 4
- 210000004185 liver Anatomy 0.000 description 4
- 235000019359 magnesium stearate Nutrition 0.000 description 4
- 239000000825 pharmaceutical preparation Substances 0.000 description 4
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- RECLRGYKIVJLJW-WLHGVMLRSA-N (E)-but-2-enedioic acid 14,17-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,11,13,15-octaene Chemical compound OC(=O)\C=C\C(O)=O.C1=CN=CC2=CC3=CC=C(C=CC=C4)C4=C3N21 RECLRGYKIVJLJW-WLHGVMLRSA-N 0.000 description 3
- DIOHEXPTUTVCNX-UHFFFAOYSA-N 1,1,1-trifluoro-n-phenyl-n-(trifluoromethylsulfonyl)methanesulfonamide Chemical compound FC(F)(F)S(=O)(=O)N(S(=O)(=O)C(F)(F)F)C1=CC=CC=C1 DIOHEXPTUTVCNX-UHFFFAOYSA-N 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- HEWZVZIVELJPQZ-UHFFFAOYSA-N 2,2-dimethoxypropane Chemical compound COC(C)(C)OC HEWZVZIVELJPQZ-UHFFFAOYSA-N 0.000 description 3
- YZSSZUXGNZHGOI-UHFFFAOYSA-N 2-(6-chloro-1-oxo-3,4-dihydro-2h-naphthalen-2-yl)acetaldehyde Chemical compound O=C1C(CC=O)CCC2=CC(Cl)=CC=C21 YZSSZUXGNZHGOI-UHFFFAOYSA-N 0.000 description 3
- KCJYJBGXUCXUPC-UHFFFAOYSA-N 5-chloro-3,4-dihydro-2h-naphthalen-1-one Chemical compound O=C1CCCC2=C1C=CC=C2Cl KCJYJBGXUCXUPC-UHFFFAOYSA-N 0.000 description 3
- WQKHERPPDYPMNX-UHFFFAOYSA-N 6-chloro-3,4-dihydro-2h-naphthalen-1-one Chemical compound O=C1CCCC2=CC(Cl)=CC=C21 WQKHERPPDYPMNX-UHFFFAOYSA-N 0.000 description 3
- IIMAYXKDBHTQHC-UHFFFAOYSA-N 7-chloro-3,4-dihydro-2h-naphthalen-1-one Chemical compound C1CCC(=O)C2=CC(Cl)=CC=C21 IIMAYXKDBHTQHC-UHFFFAOYSA-N 0.000 description 3
- GABLTKRIYDNDIN-UHFFFAOYSA-N 7-methoxy-3,4-dihydro-2h-naphthalen-1-one Chemical compound C1CCC(=O)C2=CC(OC)=CC=C21 GABLTKRIYDNDIN-UHFFFAOYSA-N 0.000 description 3
- 229920002261 Corn starch Polymers 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 3
- 241001465754 Metazoa Species 0.000 description 3
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 3
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 3
- 241000700159 Rattus Species 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 3
- 150000001241 acetals Chemical class 0.000 description 3
- 239000002168 alkylating agent Substances 0.000 description 3
- 229940100198 alkylating agent Drugs 0.000 description 3
- 238000010936 aqueous wash Methods 0.000 description 3
- NJAPCAIWQRPQPY-UHFFFAOYSA-N benzyl hydrogen carbonate Chemical compound OC(=O)OCC1=CC=CC=C1 NJAPCAIWQRPQPY-UHFFFAOYSA-N 0.000 description 3
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 3
- 239000003153 chemical reaction reagent Substances 0.000 description 3
- 235000015165 citric acid Nutrition 0.000 description 3
- 238000003776 cleavage reaction Methods 0.000 description 3
- 239000008120 corn starch Substances 0.000 description 3
- 125000004122 cyclic group Chemical group 0.000 description 3
- UAOMVDZJSHZZME-UHFFFAOYSA-N diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 125000000623 heterocyclic group Chemical group 0.000 description 3
- 230000003301 hydrolyzing effect Effects 0.000 description 3
- 230000002401 inhibitory effect Effects 0.000 description 3
- 239000000543 intermediate Substances 0.000 description 3
- 229960004592 isopropanol Drugs 0.000 description 3
- 150000002576 ketones Chemical class 0.000 description 3
- 239000008101 lactose Substances 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- DIBKNTYAWRSTMR-UHFFFAOYSA-N n-[2-(2-phenylpyrrol-1-yl)ethyl]acetamide Chemical compound CC(=O)NCCN1C=CC=C1C1=CC=CC=C1 DIBKNTYAWRSTMR-UHFFFAOYSA-N 0.000 description 3
- 239000010502 orange oil Substances 0.000 description 3
- 150000002902 organometallic compounds Chemical class 0.000 description 3
- 125000004430 oxygen atom Chemical group O* 0.000 description 3
- 229920005862 polyol Polymers 0.000 description 3
- 150000003077 polyols Chemical class 0.000 description 3
- 229910000027 potassium carbonate Inorganic materials 0.000 description 3
- 235000011118 potassium hydroxide Nutrition 0.000 description 3
- 229940093932 potassium hydroxide Drugs 0.000 description 3
- 229930195734 saturated hydrocarbon Natural products 0.000 description 3
- 230000007017 scission Effects 0.000 description 3
- 239000000454 talc Substances 0.000 description 3
- 229910052623 talc Inorganic materials 0.000 description 3
- BFHSDXYLGTXGNL-UHFFFAOYSA-N trifluoromethanesulphonic acid 5,6,10,11-tetrahydro-8-methyl-benzo[g]pyrazino[1,2-a]indol-3-yl ester Chemical compound C1CC2=CC(OS(=O)(=O)C(F)(F)F)=CC=C2C2=C1C=C1N2CCN=C1C BFHSDXYLGTXGNL-UHFFFAOYSA-N 0.000 description 3
- MHSGOABISYIYKP-UHFFFAOYSA-N (4-nitrophenyl)methyl carbonochloridate Chemical compound [O-][N+](=O)C1=CC=C(COC(Cl)=O)C=C1 MHSGOABISYIYKP-UHFFFAOYSA-N 0.000 description 2
- HTSGKJQDMSTCGS-UHFFFAOYSA-N 1,4-bis(4-chlorophenyl)-2-(4-methylphenyl)sulfonylbutane-1,4-dione Chemical compound C1=CC(C)=CC=C1S(=O)(=O)C(C(=O)C=1C=CC(Cl)=CC=1)CC(=O)C1=CC=C(Cl)C=C1 HTSGKJQDMSTCGS-UHFFFAOYSA-N 0.000 description 2
- JWLGSVNRTDDKGR-UHFFFAOYSA-N 1-(3,4-dichlorophenyl)-3-(1,3-dioxolan-2-yl)propan-1-one Chemical compound C1=C(Cl)C(Cl)=CC=C1C(=O)CCC1OCCO1 JWLGSVNRTDDKGR-UHFFFAOYSA-N 0.000 description 2
- DXIQKQRFGMHJIO-UHFFFAOYSA-N 1-(3,4-dimethoxyphenyl)-3-(1,3-dioxolan-2-yl)propan-1-one Chemical compound C1=C(OC)C(OC)=CC=C1C(=O)CCC1OCCO1 DXIQKQRFGMHJIO-UHFFFAOYSA-N 0.000 description 2
- OVRLOLCHGXYIJS-UHFFFAOYSA-N 1-(3-chlorophenyl)-3-(1,3-dioxolan-2-yl)propan-1-one Chemical compound ClC1=CC=CC(C(=O)CCC2OCCO2)=C1 OVRLOLCHGXYIJS-UHFFFAOYSA-N 0.000 description 2
- CIKROGMCCUIOIG-UHFFFAOYSA-N 1-(4-chlorophenyl)-3-(1,3-dioxolan-2-yl)propan-1-one Chemical compound C1=CC(Cl)=CC=C1C(=O)CCC1OCCO1 CIKROGMCCUIOIG-UHFFFAOYSA-N 0.000 description 2
- CBYNAOPSOKJXSB-UHFFFAOYSA-N 1-(4-phenylfuran-2-yl)ethanone Chemical compound O1C(C(=O)C)=CC(C=2C=CC=CC=2)=C1 CBYNAOPSOKJXSB-UHFFFAOYSA-N 0.000 description 2
- UMXUMEUOAVLFHG-UHFFFAOYSA-N 1-(5-methyl-4-phenylfuran-2-yl)ethanone Chemical compound O1C(C(=O)C)=CC(C=2C=CC=CC=2)=C1C UMXUMEUOAVLFHG-UHFFFAOYSA-N 0.000 description 2
- OCFOYCLGYLFXCC-UHFFFAOYSA-N 1-Methylpyrrolo[1,2-a]pyrazine Chemical compound CC1=NC=CN2C=CC=C12 OCFOYCLGYLFXCC-UHFFFAOYSA-N 0.000 description 2
- 125000001462 1-pyrrolyl group Chemical group [*]N1C([H])=C([H])C([H])=C1[H] 0.000 description 2
- YINQQQIMYGTFTA-UHFFFAOYSA-N 14,17-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,11,13,15-octaene Chemical compound C1=CN=CC2=CC3=CC=C(C=CC=C4)C4=C3N21 YINQQQIMYGTFTA-UHFFFAOYSA-N 0.000 description 2
- FZNOKYHLALMXLO-UHFFFAOYSA-N 2-(2,2-dimethoxyethyl)-7-methoxy-3,4-dihydro-2h-naphthalen-1-one Chemical compound C1=C(OC)C=C2C(=O)C(CC(OC)OC)CCC2=C1 FZNOKYHLALMXLO-UHFFFAOYSA-N 0.000 description 2
- OJZSRUVBCLGKAG-UHFFFAOYSA-N 2-(4,5-dihydrobenzo[g]indol-1-yl)ethanamine Chemical compound C1CC2=CC=CC=C2C2=C1C=CN2CCN OJZSRUVBCLGKAG-UHFFFAOYSA-N 0.000 description 2
- PHCWZKUWUUIJDL-UHFFFAOYSA-N 2-(7-chloro-1-oxo-3,4-dihydro-2h-naphthalen-2-yl)acetaldehyde Chemical compound C1CC(CC=O)C(=O)C2=CC(Cl)=CC=C21 PHCWZKUWUUIJDL-UHFFFAOYSA-N 0.000 description 2
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 2
- WRPNFNWQXGYGFD-UHFFFAOYSA-N 2-but-2-enyl-6-methoxy-3,4-dihydro-2h-naphthalen-1-one Chemical compound O=C1C(CC=CC)CCC2=CC(OC)=CC=C21 WRPNFNWQXGYGFD-UHFFFAOYSA-N 0.000 description 2
- 125000000389 2-pyrrolyl group Chemical group [H]N1C([*])=C([H])C([H])=C1[H] 0.000 description 2
- OSCVKOWMUKOLIN-UHFFFAOYSA-N 3-(1,3-dioxolan-2-yl)-1-(4-methoxyphenyl)propan-1-one Chemical compound C1=CC(OC)=CC=C1C(=O)CCC1OCCO1 OSCVKOWMUKOLIN-UHFFFAOYSA-N 0.000 description 2
- BNJCHGPDDNPTFK-UHFFFAOYSA-N 3-(1,3-dioxolan-2-yl)-1-(4-methylphenyl)propan-1-one Chemical compound C1=CC(C)=CC=C1C(=O)CCC1OCCO1 BNJCHGPDDNPTFK-UHFFFAOYSA-N 0.000 description 2
- HBOMTRLZBYBMTJ-UHFFFAOYSA-N 3-methyl-14,17-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,11,13,15-octaene Chemical compound C1=NC=CN2C3=C4C(C)=CC=CC4=CC=C3C=C21 HBOMTRLZBYBMTJ-UHFFFAOYSA-N 0.000 description 2
- RPEDJQPGISTDHW-UHFFFAOYSA-N 5-chloro-2-(2,2-dimethoxyethyl)-3,4-dihydro-2h-naphthalen-1-one Chemical compound C1=CC=C2C(=O)C(CC(OC)OC)CCC2=C1Cl RPEDJQPGISTDHW-UHFFFAOYSA-N 0.000 description 2
- BTWYMHPLLHITLB-UHFFFAOYSA-N 7-chloro-2-(2,2-dimethoxyethyl)-3,4-dihydro-2h-naphthalen-1-one Chemical compound C1=C(Cl)C=C2C(=O)C(CC(OC)OC)CCC2=C1 BTWYMHPLLHITLB-UHFFFAOYSA-N 0.000 description 2
- 101100294106 Caenorhabditis elegans nhr-3 gene Proteins 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 2
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 2
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- VQTUBCCKSQIDNK-UHFFFAOYSA-N Isobutene Chemical group CC(C)=C VQTUBCCKSQIDNK-UHFFFAOYSA-N 0.000 description 2
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 2
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- 229920002472 Starch Polymers 0.000 description 2
- KYOIPUDHYRWSFO-UHFFFAOYSA-N [Br].[Li] Chemical group [Br].[Li] KYOIPUDHYRWSFO-UHFFFAOYSA-N 0.000 description 2
- 238000005798 acetal elimination reaction Methods 0.000 description 2
- 230000009471 action Effects 0.000 description 2
- 150000001299 aldehydes Chemical class 0.000 description 2
- 239000004411 aluminium Substances 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- 125000005605 benzo group Chemical group 0.000 description 2
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 2
- HSDAJNMJOMSNEV-UHFFFAOYSA-N benzyl chloroformate Chemical compound ClC(=O)OCC1=CC=CC=C1 HSDAJNMJOMSNEV-UHFFFAOYSA-N 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- 230000031709 bromination Effects 0.000 description 2
- 238000005893 bromination reaction Methods 0.000 description 2
- 239000000872 buffer Substances 0.000 description 2
- BTANRVKWQNVYAZ-UHFFFAOYSA-N butan-2-ol Chemical compound CCC(C)O BTANRVKWQNVYAZ-UHFFFAOYSA-N 0.000 description 2
- KBPLFHHGFOOTCA-UHFFFAOYSA-N caprylic alcohol Natural products CCCCCCCCO KBPLFHHGFOOTCA-UHFFFAOYSA-N 0.000 description 2
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 2
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 description 2
- 239000008139 complexing agent Substances 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 229910052802 copper Inorganic materials 0.000 description 2
- 239000010949 copper Substances 0.000 description 2
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 description 2
- MPTQRFCYZCXJFQ-UHFFFAOYSA-L copper(II) chloride dihydrate Chemical compound O.O.[Cl-].[Cl-].[Cu+2] MPTQRFCYZCXJFQ-UHFFFAOYSA-L 0.000 description 2
- NSNHWTBQMQIDCF-UHFFFAOYSA-N dihydrate;hydrochloride Chemical compound O.O.Cl NSNHWTBQMQIDCF-UHFFFAOYSA-N 0.000 description 2
- 229940113088 dimethylacetamide Drugs 0.000 description 2
- 239000008298 dragée Substances 0.000 description 2
- 239000003925 fat Substances 0.000 description 2
- 239000008098 formaldehyde solution Substances 0.000 description 2
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 2
- 150000007857 hydrazones Chemical class 0.000 description 2
- 238000005984 hydrogenation reaction Methods 0.000 description 2
- 125000000593 indol-1-yl group Chemical group [H]C1=C([H])C([H])=C2N([*])C([H])=C([H])C2=C1[H] 0.000 description 2
- PCKPVGOLPKLUHR-UHFFFAOYSA-N indoxyl Chemical compound C1=CC=C2C(O)=CNC2=C1 PCKPVGOLPKLUHR-UHFFFAOYSA-N 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 2
- 239000008108 microcrystalline cellulose Substances 0.000 description 2
- 229940016286 microcrystalline cellulose Drugs 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- KRKPYFLIYNGWTE-UHFFFAOYSA-N n,o-dimethylhydroxylamine Chemical compound CNOC KRKPYFLIYNGWTE-UHFFFAOYSA-N 0.000 description 2
- ZSZXEDLMJWCUOP-UHFFFAOYSA-N n-(2-benzo[g]indol-1-ylethyl)acetamide Chemical compound C1=CC=CC2=C3N(CCNC(=O)C)C=CC3=CC=C21 ZSZXEDLMJWCUOP-UHFFFAOYSA-N 0.000 description 2
- DAMIPLNLHLANRQ-UHFFFAOYSA-N n-[2-(2,3-diphenylpyrrol-1-yl)ethyl]acetamide Chemical compound CC(=O)NCCN1C=CC(C=2C=CC=CC=2)=C1C1=CC=CC=C1 DAMIPLNLHLANRQ-UHFFFAOYSA-N 0.000 description 2
- YLLQTQYGGRJZGW-UHFFFAOYSA-N n-[2-(4,5-dihydrobenzo[g]indol-1-yl)ethyl]acetamide Chemical compound C1CC2=CC=CC=C2C2=C1C=CN2CCNC(=O)C YLLQTQYGGRJZGW-UHFFFAOYSA-N 0.000 description 2
- IAAGQLVYVYUXAP-UHFFFAOYSA-N n-[2-(6-chloro-4,5-dihydrobenzo[g]indol-1-yl)ethyl]acetamide Chemical compound C1CC2=C(Cl)C=CC=C2C2=C1C=CN2CCNC(=O)C IAAGQLVYVYUXAP-UHFFFAOYSA-N 0.000 description 2
- UDHABQHTESOJKG-UHFFFAOYSA-N n-[2-(7-chloro-4,5-dihydrobenzo[g]indol-1-yl)ethyl]acetamide Chemical compound C1CC2=CC(Cl)=CC=C2C2=C1C=CN2CCNC(=O)C UDHABQHTESOJKG-UHFFFAOYSA-N 0.000 description 2
- ITLMNJNLJLVYAY-UHFFFAOYSA-N n-[2-[2-(3,4-dichlorophenyl)pyrrol-1-yl]ethyl]acetamide Chemical compound CC(=O)NCCN1C=CC=C1C1=CC=C(Cl)C(Cl)=C1 ITLMNJNLJLVYAY-UHFFFAOYSA-N 0.000 description 2
- NFOVPSZUBLGLHO-UHFFFAOYSA-N n-[2-[2-(3,4-dimethoxyphenyl)pyrrol-1-yl]ethyl]acetamide Chemical compound C1=C(OC)C(OC)=CC=C1C1=CC=CN1CCNC(C)=O NFOVPSZUBLGLHO-UHFFFAOYSA-N 0.000 description 2
- IPIUKSVLHFUUKM-UHFFFAOYSA-N n-[2-[2-(3-chlorophenyl)pyrrol-1-yl]ethyl]acetamide Chemical compound CC(=O)NCCN1C=CC=C1C1=CC=CC(Cl)=C1 IPIUKSVLHFUUKM-UHFFFAOYSA-N 0.000 description 2
- GGJAJAXCAXLSLS-UHFFFAOYSA-N n-[[2-(2,2-dimethoxyethyl)-4-methyl-3,4-dihydro-2h-naphthalen-1-ylidene]amino]-n-methylmethanamine Chemical compound C1=CC=C2C(=NN(C)C)C(CC(OC)OC)CC(C)C2=C1 GGJAJAXCAXLSLS-UHFFFAOYSA-N 0.000 description 2
- LMOKJSNQLDTCPD-UHFFFAOYSA-N n-[[2-(2,2-dimethoxyethyl)-7-methoxy-3,4-dihydro-2h-naphthalen-1-ylidene]amino]-n-methylmethanamine Chemical compound C1=C(OC)C=C2C(=NN(C)C)C(CC(OC)OC)CCC2=C1 LMOKJSNQLDTCPD-UHFFFAOYSA-N 0.000 description 2
- DOXOUZOVSZGWKC-UHFFFAOYSA-N n-[[6-chloro-2-(2,2-dimethoxyethyl)-3,4-dihydro-2h-naphthalen-1-ylidene]amino]-n-methylmethanamine Chemical compound ClC1=CC=C2C(=NN(C)C)C(CC(OC)OC)CCC2=C1 DOXOUZOVSZGWKC-UHFFFAOYSA-N 0.000 description 2
- YXCWFSHPIFYZHK-UHFFFAOYSA-N n-[[7-chloro-2-(2,2-dimethoxyethyl)-3,4-dihydro-2h-naphthalen-1-ylidene]amino]-n-methylmethanamine Chemical compound C1=C(Cl)C=C2C(=NN(C)C)C(CC(OC)OC)CCC2=C1 YXCWFSHPIFYZHK-UHFFFAOYSA-N 0.000 description 2
- ISWNUAFRSGDCAH-UHFFFAOYSA-N n-methoxy-n-methyl-1,3-benzodioxole-5-carboxamide Chemical compound CON(C)C(=O)C1=CC=C2OCOC2=C1 ISWNUAFRSGDCAH-UHFFFAOYSA-N 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 235000005985 organic acids Nutrition 0.000 description 2
- 230000001590 oxidative effect Effects 0.000 description 2
- 229910052698 phosphorus Inorganic materials 0.000 description 2
- 239000011574 phosphorus Substances 0.000 description 2
- VDVJGIYXDVPQLP-UHFFFAOYSA-N piperonylic acid Chemical compound OC(=O)C1=CC=C2OCOC2=C1 VDVJGIYXDVPQLP-UHFFFAOYSA-N 0.000 description 2
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 2
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 2
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 2
- AJVOPIPTURQEHS-UHFFFAOYSA-N pyrazine;hydroiodide Chemical compound [I-].C1=C[NH+]=CC=N1 AJVOPIPTURQEHS-UHFFFAOYSA-N 0.000 description 2
- GRJJQCWNZGRKAU-UHFFFAOYSA-N pyridin-1-ium;fluoride Chemical compound F.C1=CC=NC=C1 GRJJQCWNZGRKAU-UHFFFAOYSA-N 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- HNJBEVLQSNELDL-UHFFFAOYSA-N pyrrolidin-2-one Chemical compound O=C1CCCN1 HNJBEVLQSNELDL-UHFFFAOYSA-N 0.000 description 2
- 230000002285 radioactive effect Effects 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 150000003385 sodium Chemical class 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- 235000019698 starch Nutrition 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- KZNICNPSHKQLFF-UHFFFAOYSA-N succinimide Chemical compound O=C1CCC(=O)N1 KZNICNPSHKQLFF-UHFFFAOYSA-N 0.000 description 2
- 239000000829 suppository Substances 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- AFCAKJKUYFLYFK-UHFFFAOYSA-N tetrabutyltin Chemical compound CCCC[Sn](CCCC)(CCCC)CCCC AFCAKJKUYFLYFK-UHFFFAOYSA-N 0.000 description 2
- VXKWYPOMXBVZSJ-UHFFFAOYSA-N tetramethyltin Chemical compound C[Sn](C)(C)C VXKWYPOMXBVZSJ-UHFFFAOYSA-N 0.000 description 2
- GJBCTVKWKFFLEY-UHFFFAOYSA-N tributyl(cyclohex-2-en-1-yl)stannane Chemical compound CCCC[Sn](CCCC)(CCCC)C1CCCC=C1 GJBCTVKWKFFLEY-UHFFFAOYSA-N 0.000 description 2
- OBYRCTCRALMZKW-UHFFFAOYSA-N tributyl(cyclohexen-1-yl)stannane Chemical compound CCCC[Sn](CCCC)(CCCC)C1=CCCCC1 OBYRCTCRALMZKW-UHFFFAOYSA-N 0.000 description 2
- 235000015112 vegetable and seed oil Nutrition 0.000 description 2
- 239000008158 vegetable oil Substances 0.000 description 2
- 239000001993 wax Substances 0.000 description 2
- ZQTYQMYDIHMKQB-DSYKOEDSSA-N (1r,3r,4s)-bicyclo[2.2.1]heptan-3-ol Chemical compound C1C[C@@H]2[C@H](O)C[C@H]1C2 ZQTYQMYDIHMKQB-DSYKOEDSSA-N 0.000 description 1
- JYAVQXYSZFNTLX-WLHGVMLRSA-N (E)-but-2-enedioic acid 13-methyl-14,17-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,11,13-heptaene Chemical compound OC(=O)\C=C\C(O)=O.C1=CC=CC2=C3N4CCN=C(C)C4=CC3=CC=C21 JYAVQXYSZFNTLX-WLHGVMLRSA-N 0.000 description 1
- OTSCGMZYQVXSBI-WLHGVMLRSA-N (e)-but-2-enedioic acid;1,6-dimethyl-7-phenyl-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine Chemical compound OC(=O)\C=C\C(O)=O.C1=C2C(C)NCCN2C(C)=C1C1=CC=CC=C1 OTSCGMZYQVXSBI-WLHGVMLRSA-N 0.000 description 1
- DNHLQYWFZSXSGD-WLHGVMLRSA-N (e)-but-2-enedioic acid;1,7-dimethyl-6-phenyl-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine Chemical compound OC(=O)\C=C\C(O)=O.CC1NCCN2C1=CC(C)=C2C1=CC=CC=C1 DNHLQYWFZSXSGD-WLHGVMLRSA-N 0.000 description 1
- UOVPNGRLROAWHB-WLHGVMLRSA-N (e)-but-2-enedioic acid;1-methyl-6,7-diphenyl-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine Chemical compound OC(=O)\C=C\C(O)=O.CC1NCCN2C1=CC(C=1C=CC=CC=1)=C2C1=CC=CC=C1 UOVPNGRLROAWHB-WLHGVMLRSA-N 0.000 description 1
- KLFDUOQMSQAZKW-WLHGVMLRSA-N (e)-but-2-enedioic acid;1-methyl-6-(4-methylphenyl)-3,4-dihydropyrrolo[1,2-a]pyrazine Chemical compound OC(=O)\C=C\C(O)=O.CC1=NCCN2C1=CC=C2C1=CC=C(C)C=C1 KLFDUOQMSQAZKW-WLHGVMLRSA-N 0.000 description 1
- KAHQDXJSJDINFU-WLHGVMLRSA-N (e)-but-2-enedioic acid;1-methyl-6-phenyl-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine Chemical compound OC(=O)\C=C\C(O)=O.CC1NCCN2C1=CC=C2C1=CC=CC=C1 KAHQDXJSJDINFU-WLHGVMLRSA-N 0.000 description 1
- UWZJRTQUEBKBII-WLHGVMLRSA-N (e)-but-2-enedioic acid;1-methyl-6-phenyl-3,4-dihydropyrrolo[1,2-a]pyrazine Chemical compound OC(=O)\C=C\C(O)=O.CC1=NCCN2C1=CC=C2C1=CC=CC=C1 UWZJRTQUEBKBII-WLHGVMLRSA-N 0.000 description 1
- NXTGDFKXXFAPCG-WLHGVMLRSA-N (e)-but-2-enedioic acid;1-methylpyrrolo[1,2-a]pyrazine Chemical compound OC(=O)\C=C\C(O)=O.CC1=NC=CN2C=CC=C12 NXTGDFKXXFAPCG-WLHGVMLRSA-N 0.000 description 1
- KVZCBFQMPGTZNY-WLHGVMLRSA-N (e)-but-2-enedioic acid;2-(2-phenylpyrrol-1-yl)ethanamine Chemical compound OC(=O)\C=C\C(O)=O.NCCN1C=CC=C1C1=CC=CC=C1 KVZCBFQMPGTZNY-WLHGVMLRSA-N 0.000 description 1
- VJBLMHWIGHCAMS-WLHGVMLRSA-N (e)-but-2-enedioic acid;6-(3,4-dichlorophenyl)-1-methyl-3,4-dihydropyrrolo[1,2-a]pyrazine Chemical compound OC(=O)\C=C\C(O)=O.CC1=NCCN2C1=CC=C2C1=CC=C(Cl)C(Cl)=C1 VJBLMHWIGHCAMS-WLHGVMLRSA-N 0.000 description 1
- SQECBXIUXFWTDQ-WLHGVMLRSA-N (e)-but-2-enedioic acid;6-(3,4-dimethoxyphenyl)-1-methyl-3,4-dihydropyrrolo[1,2-a]pyrazine Chemical compound OC(=O)\C=C\C(O)=O.C1=C(OC)C(OC)=CC=C1C1=CC=C2N1CCN=C2C SQECBXIUXFWTDQ-WLHGVMLRSA-N 0.000 description 1
- SZJWCSCRLNAJJX-WLHGVMLRSA-N (e)-but-2-enedioic acid;6-(3-chlorophenyl)-1-methyl-3,4-dihydropyrrolo[1,2-a]pyrazine Chemical compound OC(=O)\C=C\C(O)=O.CC1=NCCN2C1=CC=C2C1=CC=CC(Cl)=C1 SZJWCSCRLNAJJX-WLHGVMLRSA-N 0.000 description 1
- JBBBLNKPUUMKQO-WLHGVMLRSA-N (e)-but-2-enedioic acid;6-(4-chlorophenyl)-1-methyl-3,4-dihydropyrrolo[1,2-a]pyrazine Chemical compound OC(=O)\C=C\C(O)=O.CC1=NCCN2C1=CC=C2C1=CC=C(Cl)C=C1 JBBBLNKPUUMKQO-WLHGVMLRSA-N 0.000 description 1
- OTKCEEWUXHVZQI-UHFFFAOYSA-N 1,2-diphenylethanone Chemical compound C=1C=CC=CC=1C(=O)CC1=CC=CC=C1 OTKCEEWUXHVZQI-UHFFFAOYSA-N 0.000 description 1
- WDQFELCEOPFLCZ-UHFFFAOYSA-N 1-(2-hydroxyethyl)pyrrolidin-2-one Chemical compound OCCN1CCCC1=O WDQFELCEOPFLCZ-UHFFFAOYSA-N 0.000 description 1
- YIWGJFPJRAEKMK-UHFFFAOYSA-N 1-(2H-benzotriazol-5-yl)-3-methyl-8-[2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carbonyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione Chemical compound CN1C(=O)N(c2ccc3n[nH]nc3c2)C2(CCN(CC2)C(=O)c2cnc(NCc3cccc(OC(F)(F)F)c3)nc2)C1=O YIWGJFPJRAEKMK-UHFFFAOYSA-N 0.000 description 1
- GLDUAYSMNDGNFP-UHFFFAOYSA-N 1-(3-phenyl-2h-furan-3-yl)ethanone Chemical compound C=1C=CC=CC=1C1(C(=O)C)COC=C1 GLDUAYSMNDGNFP-UHFFFAOYSA-N 0.000 description 1
- HMUNWXXNJPVALC-UHFFFAOYSA-N 1-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperazin-1-yl]-2-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)N1CCN(CC1)C(CN1CC2=C(CC1)NN=N2)=O HMUNWXXNJPVALC-UHFFFAOYSA-N 0.000 description 1
- DREFPQKRJDNSES-WLHGVMLRSA-N 10,11-dihydro-5,8-dimethylbenzo[g] pyrazino[1,2-a]indole fumarate Chemical compound OC(=O)\C=C\C(O)=O.C1=CC=CC2=C3N4CCN=C(C)C4=CC3=CC(C)=C21 DREFPQKRJDNSES-WLHGVMLRSA-N 0.000 description 1
- VEIYEOMQJQZICK-UHFFFAOYSA-N 13-methyl-14,17-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,11,13,15-octaene Chemical compound C1=CC=CC2=C3N4C=CN=C(C)C4=CC3=CC=C21 VEIYEOMQJQZICK-UHFFFAOYSA-N 0.000 description 1
- HPJMDPVBYTTYHR-UHFFFAOYSA-N 2-(1-oxo-2H-naphthalen-2-yl)acetaldehyde Chemical compound O=C1C(C=CC2=CC=CC=C12)CC=O HPJMDPVBYTTYHR-UHFFFAOYSA-N 0.000 description 1
- ALSOULJNZFBHNA-UHFFFAOYSA-N 2-(1-oxo-3,4-dihydro-2h-naphthalen-2-yl)acetaldehyde Chemical compound C1=CC=C2C(=O)C(CC=O)CCC2=C1 ALSOULJNZFBHNA-UHFFFAOYSA-N 0.000 description 1
- VLBZPIDESQOLLC-UHFFFAOYSA-N 2-(2,2-dimethoxyethyl)-4-methyl-3,4-dihydro-2h-naphthalen-1-one Chemical compound C1=CC=C2C(=O)C(CC(OC)OC)CC(C)C2=C1 VLBZPIDESQOLLC-UHFFFAOYSA-N 0.000 description 1
- RBJSNECKZSMJJP-UHFFFAOYSA-N 2-(4-methyl-1-oxo-3,4,4a,5-tetrahydro-2H-naphthalen-2-yl)acetaldehyde Chemical compound CC1CC(C(C2=CC=CCC12)=O)CC=O RBJSNECKZSMJJP-UHFFFAOYSA-N 0.000 description 1
- KZIYHBOERCULMC-UHFFFAOYSA-N 2-(5-chloro-1-oxo-3,4-dihydro-2h-naphthalen-2-yl)acetaldehyde Chemical compound O=C1C(CC=O)CCC2=C1C=CC=C2Cl KZIYHBOERCULMC-UHFFFAOYSA-N 0.000 description 1
- XPAWNIZABUCTTB-UHFFFAOYSA-N 2-(7-methoxy-1-oxo-3,4-dihydro-2h-naphthalen-2-yl)acetaldehyde Chemical compound C1CC(CC=O)C(=O)C2=CC(OC)=CC=C21 XPAWNIZABUCTTB-UHFFFAOYSA-N 0.000 description 1
- KKFDCBRMNNSAAW-UHFFFAOYSA-N 2-(morpholin-4-yl)ethanol Chemical compound OCCN1CCOCC1 KKFDCBRMNNSAAW-UHFFFAOYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- VTXNOVCTHUBABW-UHFFFAOYSA-N 3,4-dichlorobenzoyl chloride Chemical compound ClC(=O)C1=CC=C(Cl)C(Cl)=C1 VTXNOVCTHUBABW-UHFFFAOYSA-N 0.000 description 1
- VIOBGCWEHLRBEP-UHFFFAOYSA-N 3,4-dimethoxybenzoyl chloride Chemical compound COC1=CC=C(C(Cl)=O)C=C1OC VIOBGCWEHLRBEP-UHFFFAOYSA-N 0.000 description 1
- FZVUKKKWESOKEF-UHFFFAOYSA-N 3-(1,3-dioxolan-2-yl)-1-[4-(trifluoromethyl)phenyl]propan-1-one Chemical compound C1=CC(C(F)(F)F)=CC=C1C(=O)CCC1OCCO1 FZVUKKKWESOKEF-UHFFFAOYSA-N 0.000 description 1
- LLIMHPOEWHSGBA-UHFFFAOYSA-N 3-(1,3-dioxolan-2-yl)-1-phenylpropan-1-one Chemical compound C=1C=CC=CC=1C(=O)CCC1OCCO1 LLIMHPOEWHSGBA-UHFFFAOYSA-N 0.000 description 1
- IZYKZNLUKCURMZ-UHFFFAOYSA-N 3-(1,3-dioxolan-2-yl)-2-methyl-1-phenylpropan-1-one Chemical compound C=1C=CC=CC=1C(=O)C(C)CC1OCCO1 IZYKZNLUKCURMZ-UHFFFAOYSA-N 0.000 description 1
- WHIHIKVIWVIIER-UHFFFAOYSA-N 3-chlorobenzoyl chloride Chemical compound ClC(=O)C1=CC=CC(Cl)=C1 WHIHIKVIWVIIER-UHFFFAOYSA-N 0.000 description 1
- GBEWQUWWIPEGAA-UHFFFAOYSA-N 3-cyclohex-2-enyl-5,6,10,11-tetrahydro-8-methyl-benzo[g]pyrazino[1,2-a]indole Chemical compound CC1=NCCN(C=2C3=CC=4)C1=CC=2CCC3=CC=4C1CCCC=C1 GBEWQUWWIPEGAA-UHFFFAOYSA-N 0.000 description 1
- MYGIFHQZSUQEKT-UHFFFAOYSA-N 4,4-dimethoxy-1,2-diphenylbutan-1-one Chemical compound C=1C=CC=CC=1C(CC(OC)OC)C(=O)C1=CC=CC=C1 MYGIFHQZSUQEKT-UHFFFAOYSA-N 0.000 description 1
- FALDLHSSPVIMKL-UHFFFAOYSA-N 4,4-dimethoxy-1-phenylbutan-1-one Chemical compound COC(OC)CCC(=O)C1=CC=CC=C1 FALDLHSSPVIMKL-UHFFFAOYSA-N 0.000 description 1
- QEONMKRFAKEERT-UHFFFAOYSA-N 4-(1-methyl-3,4-dihydropyrrolo[1,2-a]pyrazin-6-yl)phenol Chemical compound CC1=NCCN2C1=CC=C2C1=CC=C(O)C=C1 QEONMKRFAKEERT-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- RKIDDEGICSMIJA-UHFFFAOYSA-N 4-chlorobenzoyl chloride Chemical compound ClC(=O)C1=CC=C(Cl)C=C1 RKIDDEGICSMIJA-UHFFFAOYSA-N 0.000 description 1
- SRLHDEROUKFEMJ-UHFFFAOYSA-N 4-methyl-3,4-dihydro-2h-naphthalen-1-one Chemical compound C1=CC=C2C(C)CCC(=O)C2=C1 SRLHDEROUKFEMJ-UHFFFAOYSA-N 0.000 description 1
- NQUVCRCCRXRJCK-UHFFFAOYSA-N 4-methylbenzoyl chloride Chemical compound CC1=CC=C(C(Cl)=O)C=C1 NQUVCRCCRXRJCK-UHFFFAOYSA-N 0.000 description 1
- ZNIKBLXYGUIJJQ-WLHGVMLRSA-N 5,6,10,11-tetrahydro-5,8-dimethylbenzo[g]pyrazino[1,2-a]indole fumarate Chemical compound OC(=O)\C=C\C(O)=O.C12=CC=CC=C2C(C)CC2=C1N1CCN=C(C)C1=C2 ZNIKBLXYGUIJJQ-WLHGVMLRSA-N 0.000 description 1
- OZNOVAGFRKRPFA-WLHGVMLRSA-N 5,6,8,9,10,11-hexahydro-5,8-dimethylbenzo[g]pyrazino[1,2-a]indole fumarate Chemical compound OC(=O)\C=C\C(O)=O.C12=CC=CC=C2C(C)CC2=C1N1CCNC(C)C1=C2 OZNOVAGFRKRPFA-WLHGVMLRSA-N 0.000 description 1
- JQBFOCMAKWEVNW-UHFFFAOYSA-N 5-cyclohexyloxy-13-methyl-14,17-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),3,5,11,13-hexaene Chemical compound CC1=NCCN(C=2C3=CC=4)C1=CC=2CCC3=CC=4OC1CCCCC1 JQBFOCMAKWEVNW-UHFFFAOYSA-N 0.000 description 1
- PKFHBJGERGISNR-UHFFFAOYSA-N 6-(3-chlorophenyl)-1-methyl-3,4-dihydropyrrolo[1,2-a]pyrazine Chemical compound CC1=NCCN2C1=CC=C2C1=CC=CC(Cl)=C1 PKFHBJGERGISNR-UHFFFAOYSA-N 0.000 description 1
- CONKBQPVFMXDOV-QHCPKHFHSA-N 6-[(5S)-5-[[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperazin-1-yl]methyl]-2-oxo-1,3-oxazolidin-3-yl]-3H-1,3-benzoxazol-2-one Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)N1CCN(CC1)C[C@H]1CN(C(O1)=O)C1=CC2=C(NC(O2)=O)C=C1 CONKBQPVFMXDOV-QHCPKHFHSA-N 0.000 description 1
- BTLHMMFSBLCZKN-UHFFFAOYSA-N 6-chloro-2-(2,2-dimethoxyethyl)-3,4-dihydro-2h-naphthalen-1-one Chemical compound ClC1=CC=C2C(=O)C(CC(OC)OC)CCC2=C1 BTLHMMFSBLCZKN-UHFFFAOYSA-N 0.000 description 1
- MNALUTYMBUBKNX-UHFFFAOYSA-N 6-methoxy-3,4-dihydro-2h-naphthalen-1-one Chemical compound O=C1CCCC2=CC(OC)=CC=C21 MNALUTYMBUBKNX-UHFFFAOYSA-N 0.000 description 1
- JQBCVHTVTBQPDN-UHFFFAOYSA-N Br.BrC1CCCC1.C1CC2CCC1C2 Chemical compound Br.BrC1CCCC1.C1CC2CCC1C2 JQBCVHTVTBQPDN-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 1
- 229910021592 Copper(II) chloride Inorganic materials 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 1
- QMMFVYPAHWMCMS-UHFFFAOYSA-N Dimethyl sulfide Chemical compound CSC QMMFVYPAHWMCMS-UHFFFAOYSA-N 0.000 description 1
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical class Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- 241000699666 Mus <mouse, genus> Species 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 102000004316 Oxidoreductases Human genes 0.000 description 1
- 108090000854 Oxidoreductases Proteins 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 239000007983 Tris buffer Substances 0.000 description 1
- JAWMENYCRQKKJY-UHFFFAOYSA-N [3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-ylmethyl)-1-oxa-2,8-diazaspiro[4.5]dec-2-en-8-yl]-[2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidin-5-yl]methanone Chemical compound N1N=NC=2CN(CCC=21)CC1=NOC2(C1)CCN(CC2)C(=O)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F JAWMENYCRQKKJY-UHFFFAOYSA-N 0.000 description 1
- RSWGJHLUYNHPMX-ONCXSQPRSA-N abietic acid Chemical compound C([C@@H]12)CC(C(C)C)=CC1=CC[C@@H]1[C@]2(C)CCC[C@@]1(C)C(O)=O RSWGJHLUYNHPMX-ONCXSQPRSA-N 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 239000003377 acid catalyst Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000004808 allyl alcohols Chemical class 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- MXMOTZIXVICDSD-UHFFFAOYSA-N anisoyl chloride Chemical compound COC1=CC=C(C(Cl)=O)C=C1 MXMOTZIXVICDSD-UHFFFAOYSA-N 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000012300 argon atmosphere Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- UDYGXWPMSJPFDG-UHFFFAOYSA-M benzyl(tributyl)azanium;bromide Chemical compound [Br-].CCCC[N+](CCCC)(CCCC)CC1=CC=CC=C1 UDYGXWPMSJPFDG-UHFFFAOYSA-M 0.000 description 1
- BRTFVKHPEHKBQF-UHFFFAOYSA-N bromocyclopentane Chemical compound BrC1CCCC1 BRTFVKHPEHKBQF-UHFFFAOYSA-N 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- 229960004424 carbon dioxide Drugs 0.000 description 1
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 210000001638 cerebellum Anatomy 0.000 description 1
- FZFAMSAMCHXGEF-UHFFFAOYSA-N chloro formate Chemical compound ClOC=O FZFAMSAMCHXGEF-UHFFFAOYSA-N 0.000 description 1
- 150000001860 citric acid derivatives Chemical class 0.000 description 1
- 239000003426 co-catalyst Substances 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 230000002301 combined effect Effects 0.000 description 1
- 125000000392 cycloalkenyl group Chemical group 0.000 description 1
- 125000000000 cycloalkoxy group Chemical group 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- HPXRVTGHNJAIIH-UHFFFAOYSA-N cyclohexanol Chemical compound OC1CCCCC1 HPXRVTGHNJAIIH-UHFFFAOYSA-N 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000002933 cyclohexyloxy group Chemical group C1(CCCCC1)O* 0.000 description 1
- XCIXKGXIYUWCLL-UHFFFAOYSA-N cyclopentanol Chemical compound OC1CCCC1 XCIXKGXIYUWCLL-UHFFFAOYSA-N 0.000 description 1
- 125000001887 cyclopentyloxy group Chemical group C1(CCCC1)O* 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 235000013681 dietary sucrose Nutrition 0.000 description 1
- 229940043279 diisopropylamine Drugs 0.000 description 1
- MCWXGJITAZMZEV-UHFFFAOYSA-N dimethoate Chemical class CNC(=O)CSP(=S)(OC)OC MCWXGJITAZMZEV-UHFFFAOYSA-N 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 1
- SDIXRDNYIMOKSG-UHFFFAOYSA-L disodium methyl arsenate Chemical compound [Na+].[Na+].C[As]([O-])([O-])=O SDIXRDNYIMOKSG-UHFFFAOYSA-L 0.000 description 1
- VDQVEACBQKUUSU-UHFFFAOYSA-M disodium;sulfanide Chemical compound [Na+].[Na+].[SH-] VDQVEACBQKUUSU-UHFFFAOYSA-M 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 235000019634 flavors Nutrition 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-L fumarate(2-) Chemical class [O-]C(=O)\C=C\C([O-])=O VZCYOOQTPOCHFL-OWOJBTEDSA-L 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 229960001031 glucose Drugs 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 150000002430 hydrocarbons Chemical group 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- USZLCYNVCCDPLQ-UHFFFAOYSA-N hydron;n-methoxymethanamine;chloride Chemical compound Cl.CNOC USZLCYNVCCDPLQ-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- JCYWCSGERIELPG-UHFFFAOYSA-N imes Chemical class CC1=CC(C)=CC(C)=C1N1C=CN(C=2C(=CC(C)=CC=2C)C)[C]1 JCYWCSGERIELPG-UHFFFAOYSA-N 0.000 description 1
- JBFYUZGYRGXSFL-UHFFFAOYSA-N imidazolide Chemical compound C1=C[N-]C=N1 JBFYUZGYRGXSFL-UHFFFAOYSA-N 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 238000011534 incubation Methods 0.000 description 1
- 229960004903 invert sugar Drugs 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 231100000636 lethal dose Toxicity 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- OVEHNNQXLPJPPL-UHFFFAOYSA-N lithium;n-propan-2-ylpropan-2-amine Chemical compound [Li].CC(C)NC(C)C OVEHNNQXLPJPPL-UHFFFAOYSA-N 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 150000002688 maleic acid derivatives Chemical class 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 230000001035 methylating effect Effects 0.000 description 1
- 230000011987 methylation Effects 0.000 description 1
- 238000007069 methylation reaction Methods 0.000 description 1
- ZGEGCLOFRBLKSE-UHFFFAOYSA-N methylene hexane Natural products CCCCCC=C ZGEGCLOFRBLKSE-UHFFFAOYSA-N 0.000 description 1
- XONPDZSGENTBNJ-UHFFFAOYSA-N molecular hydrogen;sodium Chemical class [Na].[H][H] XONPDZSGENTBNJ-UHFFFAOYSA-N 0.000 description 1
- TVMXDCGIABBOFY-UHFFFAOYSA-N n-Octanol Natural products CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 description 1
- XKYJBKYELTYGHZ-UHFFFAOYSA-N n-[2-(3-methyl-2-phenylpyrrol-1-yl)ethyl]acetamide Chemical compound CC(=O)NCCN1C=CC(C)=C1C1=CC=CC=C1 XKYJBKYELTYGHZ-UHFFFAOYSA-N 0.000 description 1
- UHXVUEHQUSKAFS-UHFFFAOYSA-N n-[2-(8-chloro-4,5-dihydrobenzo[g]indol-1-yl)ethyl]acetamide Chemical compound C1CC2=CC=C(Cl)C=C2C2=C1C=CN2CCNC(=O)C UHXVUEHQUSKAFS-UHFFFAOYSA-N 0.000 description 1
- HHGVVPQZRQOHNH-UHFFFAOYSA-N n-[2-[2-(1,3-benzodioxol-5-yl)pyrrol-1-yl]ethyl]acetamide Chemical compound CC(=O)NCCN1C=CC=C1C1=CC=C(OCO2)C2=C1 HHGVVPQZRQOHNH-UHFFFAOYSA-N 0.000 description 1
- GXJLBGOHEOYGDV-UHFFFAOYSA-N n-[2-[2-(4-chlorophenyl)pyrrol-1-yl]ethyl]acetamide Chemical compound CC(=O)NCCN1C=CC=C1C1=CC=C(Cl)C=C1 GXJLBGOHEOYGDV-UHFFFAOYSA-N 0.000 description 1
- HMBOYNDJFFCBGO-UHFFFAOYSA-N n-[2-[2-(4-hydroxyphenyl)pyrrol-1-yl]ethyl]acetamide Chemical compound CC(=O)NCCN1C=CC=C1C1=CC=C(O)C=C1 HMBOYNDJFFCBGO-UHFFFAOYSA-N 0.000 description 1
- QMCBXLRPDOOQSU-UHFFFAOYSA-N n-[2-[2-(4-methoxyphenyl)pyrrol-1-yl]ethyl]acetamide Chemical compound C1=CC(OC)=CC=C1C1=CC=CN1CCNC(C)=O QMCBXLRPDOOQSU-UHFFFAOYSA-N 0.000 description 1
- OAPYQYBEEXEHKZ-UHFFFAOYSA-N n-[2-[2-(4-methylphenyl)pyrrol-1-yl]ethyl]acetamide Chemical compound CC(=O)NCCN1C=CC=C1C1=CC=C(C)C=C1 OAPYQYBEEXEHKZ-UHFFFAOYSA-N 0.000 description 1
- LBQIQPZLLXOIHQ-UHFFFAOYSA-N n-[2-[2-[4-(trifluoromethyl)phenyl]pyrrol-1-yl]ethyl]acetamide Chemical compound CC(=O)NCCN1C=CC=C1C1=CC=C(C(F)(F)F)C=C1 LBQIQPZLLXOIHQ-UHFFFAOYSA-N 0.000 description 1
- MZUCBBLPGSGBJI-UHFFFAOYSA-N n-[[5-chloro-2-(2,2-dimethoxyethyl)-3,4-dihydro-2h-naphthalen-1-ylidene]amino]-n-methylmethanamine Chemical compound C1=CC=C2C(=NN(C)C)C(CC(OC)OC)CCC2=C1Cl MZUCBBLPGSGBJI-UHFFFAOYSA-N 0.000 description 1
- 150000002823 nitrates Chemical class 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 235000014571 nuts Nutrition 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 125000005447 octyloxy group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])O* 0.000 description 1
- 230000003204 osmotic effect Effects 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 125000004043 oxo group Chemical group O=* 0.000 description 1
- 238000005949 ozonolysis reaction Methods 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- KHIWWQKSHDUIBK-UHFFFAOYSA-N periodic acid Chemical compound OI(=O)(=O)=O KHIWWQKSHDUIBK-UHFFFAOYSA-N 0.000 description 1
- 230000003285 pharmacodynamic effect Effects 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-M phenolate Chemical compound [O-]C1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-M 0.000 description 1
- 229940031826 phenolate Drugs 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- 229960004838 phosphoric acid Drugs 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- NROKBHXJSPEDAR-UHFFFAOYSA-M potassium fluoride Chemical class [F-].[K+] NROKBHXJSPEDAR-UHFFFAOYSA-M 0.000 description 1
- 239000008057 potassium phosphate buffer Substances 0.000 description 1
- 238000011533 pre-incubation Methods 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 230000002335 preservative effect Effects 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000008707 rearrangement Effects 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 230000002829 reductive effect Effects 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- 239000010948 rhodium Substances 0.000 description 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 1
- QBERHIJABFXGRZ-UHFFFAOYSA-M rhodium;triphenylphosphane;chloride Chemical compound [Cl-].[Rh].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 QBERHIJABFXGRZ-UHFFFAOYSA-M 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 150000003333 secondary alcohols Chemical class 0.000 description 1
- 229940076279 serotonin Drugs 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- JQWHASGSAFIOCM-UHFFFAOYSA-M sodium periodate Chemical compound [Na+].[O-]I(=O)(=O)=O JQWHASGSAFIOCM-UHFFFAOYSA-M 0.000 description 1
- 229910052979 sodium sulfide Inorganic materials 0.000 description 1
- CMXPERZAMAQXSF-UHFFFAOYSA-M sodium;1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate;1,8-dihydroxyanthracene-9,10-dione Chemical compound [Na+].O=C1C2=CC=CC(O)=C2C(=O)C2=C1C=CC=C2O.CCCCC(CC)COC(=O)CC(S([O-])(=O)=O)C(=O)OCC(CC)CCCC CMXPERZAMAQXSF-UHFFFAOYSA-M 0.000 description 1
- WINYCIXPFGVTOS-UHFFFAOYSA-M sodium;dichloromethane;hydroxide Chemical compound [OH-].[Na+].ClCCl WINYCIXPFGVTOS-UHFFFAOYSA-M 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 150000003890 succinate salts Chemical class 0.000 description 1
- 229960002317 succinimide Drugs 0.000 description 1
- 229960004793 sucrose Drugs 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-N sulfonic acid Chemical compound OS(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-N 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 239000001117 sulphuric acid Substances 0.000 description 1
- 235000011149 sulphuric acid Nutrition 0.000 description 1
- 230000004083 survival effect Effects 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 150000003892 tartrate salts Chemical class 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000041 toxicology testing Toxicity 0.000 description 1
- 229910052723 transition metal Inorganic materials 0.000 description 1
- RUCOUXAHBYBPHL-UHFFFAOYSA-N tributyl(cyclopropyl)stannane Chemical compound CCCC[Sn](CCCC)(CCCC)C1CC1 RUCOUXAHBYBPHL-UHFFFAOYSA-N 0.000 description 1
- 229930195735 unsaturated hydrocarbon Natural products 0.000 description 1
- 239000003981 vehicle Substances 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/32—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D207/325—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms with substituted hydrocarbon radicals directly attached to the ring nitrogen atom
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/28—Drugs for disorders of the nervous system for treating neurodegenerative disorders of the central nervous system, e.g. nootropic agents, cognition enhancers, drugs for treating Alzheimer's disease or other forms of dementia
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/32—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D207/33—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms with substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/32—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D207/33—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms with substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D207/333—Radicals substituted by oxygen or sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/56—Ring systems containing three or more rings
- C07D209/58—[b]- or [c]-condensed
- C07D209/60—Naphtho [b] pyrroles; Hydrogenated naphtho [b] pyrroles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/38—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D307/40—Radicals substituted by oxygen atoms
- C07D307/46—Doubly bound oxygen atoms, or two oxygen atoms singly bound to the same carbon atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/04—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
- C07D487/04—Ortho-condensed systems
Landscapes
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Neurosurgery (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Biomedical Technology (AREA)
- Neurology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Life Sciences & Earth Sciences (AREA)
- Veterinary Medicine (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Pharmacology & Pharmacy (AREA)
- Public Health (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Psychiatry (AREA)
- Hospice & Palliative Care (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH195091 | 1991-07-02 | ||
| CH1950/91 | 1991-07-02 | ||
| CH1667/92 | 1992-05-22 | ||
| CH166792 | 1992-05-22 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA2072836A1 true CA2072836A1 (en) | 1993-01-03 |
Family
ID=25688329
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA002072836A Abandoned CA2072836A1 (en) | 1991-07-02 | 1992-06-30 | Pyrrolopyrazine derivatives |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US5292732A (OSRAM) |
| EP (1) | EP0521368A1 (OSRAM) |
| JP (1) | JPH0774217B2 (OSRAM) |
| CN (1) | CN1030986C (OSRAM) |
| AU (1) | AU654362B2 (OSRAM) |
| CA (1) | CA2072836A1 (OSRAM) |
| CS (1) | CS202292A3 (OSRAM) |
| FI (1) | FI100242B (OSRAM) |
| HU (1) | HUT70163A (OSRAM) |
| IE (1) | IE922152A1 (OSRAM) |
| IL (1) | IL102337A (OSRAM) |
| NO (1) | NO922604L (OSRAM) |
| NZ (1) | NZ243310A (OSRAM) |
| TW (1) | TW224974B (OSRAM) |
Families Citing this family (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0572863A1 (de) * | 1992-06-05 | 1993-12-08 | F. Hoffmann-La Roche Ag | ZNS Pyrazinoindole |
| US5378846A (en) * | 1993-06-11 | 1995-01-03 | Russian-American Institute For New Drug Development | 1,2,3,4-tetrahydropyrrolo-[1,2-a]-pyrazine derivatives |
| US5352096A (en) * | 1993-09-27 | 1994-10-04 | Chi Wen Chen | Air compressor for automobiles |
| TW334423B (en) * | 1993-10-22 | 1998-06-21 | Hoffmann La Roche | Tricyclic 1-aminoethylpyrrole-derivatives |
| UA66370C2 (en) | 1997-12-16 | 2004-05-17 | Lilly Co Eli | Arylpiperazines having activity to setotonin 1 receptors |
| HUP0201472A3 (en) | 1998-12-25 | 2006-03-28 | Shionogi & Co | Aromatic heterocycle compounds having hiv integrase inhibiting activities |
| WO2004112699A2 (en) * | 2003-06-12 | 2004-12-29 | Merck & Co., Inc. | Mitotic kinesin inhibitors |
| EP1741709A1 (en) * | 2005-06-28 | 2007-01-10 | Sanofi-Aventis Deutschland GmbH | Heteroaryl-substituted amides comprising a saturated linker group, and their use as pharmaceuticals |
| DE102006049452A1 (de) | 2006-10-17 | 2008-05-08 | Grünenthal GmbH | Substituierte Tetrahydropyrolopiperazin-Verbindungen und deren Verwendung in Arzneimitteln |
| SG185651A1 (en) | 2010-06-09 | 2012-12-28 | Janssen Pharmaceutica Nv | 5,6-dihydro-2h-[1,4]oxazin-3-yl-amine derivatives useful as inhibitors of beta-secretase (bace) |
| WO2012085038A1 (en) | 2010-12-22 | 2012-06-28 | Janssen Pharmaceutica Nv | 5,6-DIHYDRO-IMIDAZO[1,2-a]PYRAZIN-8-YLAMINE DERIVATIVES USEFUL AS INHIBITORS OF BETA-SECRETASE (BACE) |
| WO2012117027A1 (en) | 2011-03-01 | 2012-09-07 | Janssen Pharmaceutica Nv | 6,7-dihydro-pyrazolo[1,5-a]pyrazin-4-ylamine derivatives useful as inhibitors of beta-secretase (bace) |
| US9845326B2 (en) | 2011-03-09 | 2017-12-19 | Janssen Pharmaceutica Nv | Substituted 3,4-dihydropyrrolo[1,2-A]pyrazines as beta-secretase (BACE) inhibitors |
| WO2014097147A1 (en) * | 2012-12-19 | 2014-06-26 | Novartis Ag | Tricyclic compounds as cftr inhibitors |
| CN105452251B (zh) | 2013-06-12 | 2017-12-26 | 詹森药业有限公司 | 作为β‑分泌酶(BACE)抑制剂的4‑氨基‑6‑苯基‑5,6‑二氢咪唑并[1,5‑A]吡嗪‑3(2H)‑酮衍生物 |
| CN105324383B (zh) | 2013-06-12 | 2017-10-31 | 詹森药业有限公司 | 作为β‑分泌酶(BACE)抑制剂的4‑氨基‑6‑苯基‑6,7‑二氢[1,2,3]三唑并[1,5‑A]吡嗪衍生物 |
| WO2014198853A1 (en) | 2013-06-12 | 2014-12-18 | Janssen Pharmaceutica Nv | 4-amino-6-phenyl-5,6-dihydroimidazo[1,5-a]pyrazine derivatives as inhibitors of beta-secretase (bace) |
| MX2017008083A (es) | 2014-12-18 | 2017-10-31 | Janssen Pharmaceutica Nv | Compuestos 2,3,4,5-tetrahidropiridin-6-amina y 3,4-dihidro-2h-pirrol-5-amina inhibidores de beta-secretasa. |
| EP3609897A1 (en) * | 2017-04-12 | 2020-02-19 | H. Hoffnabb-La Roche Ag | A method for labeling of aldehyde containing target molecules |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1185080A (en) * | 1967-12-07 | 1970-03-18 | Beecham Group Ltd | Pyrrolidines |
| US3906010A (en) * | 1974-06-17 | 1975-09-16 | Morton Norwich Products Inc | Series of 5-aryl-2-furamidines |
| US3931247A (en) * | 1974-12-11 | 1976-01-06 | Morton-Norwich Products, Inc. | 5-(Substituted)phenylfurfuryl alcohols |
| JPS5811878B2 (ja) * | 1974-12-19 | 1983-03-04 | 大正製薬株式会社 | フロ ( 3 2−b ) インド−ルルイノ セイホウ |
| US4188389A (en) * | 1978-11-03 | 1980-02-12 | Ayerst Mckenna & Harrison, Inc. | 1,2,3,4-Tetrahydropyrrolo(1,2-A)pyrazines |
| JPS5852995B2 (ja) * | 1981-09-28 | 1983-11-26 | 武田薬品工業株式会社 | フルフラ−ル誘導体の製造法 |
| US4882354A (en) * | 1987-12-16 | 1989-11-21 | Norwich Eaton Pharmaceuticals, Inc. | N-hydroxy-5-phenyl-2-furancarboximidamides useful as cardiotonic agents |
-
1992
- 1992-06-12 TW TW081104600A patent/TW224974B/zh active
- 1992-06-23 EP EP92110531A patent/EP0521368A1/de not_active Ceased
- 1992-06-25 NZ NZ243310A patent/NZ243310A/en unknown
- 1992-06-26 IL IL10233792A patent/IL102337A/en not_active IP Right Cessation
- 1992-06-26 HU HU9202139A patent/HUT70163A/hu unknown
- 1992-06-26 US US07/905,584 patent/US5292732A/en not_active Expired - Fee Related
- 1992-06-29 CS CS922022A patent/CS202292A3/cs unknown
- 1992-06-29 AU AU19309/92A patent/AU654362B2/en not_active Ceased
- 1992-06-30 CA CA002072836A patent/CA2072836A1/en not_active Abandoned
- 1992-07-01 IE IE215292A patent/IE922152A1/en not_active Application Discontinuation
- 1992-07-01 NO NO92922604A patent/NO922604L/no unknown
- 1992-07-02 FI FI923073A patent/FI100242B/fi active
- 1992-07-02 CN CN92105314A patent/CN1030986C/zh not_active Expired - Fee Related
- 1992-07-02 JP JP4197449A patent/JPH0774217B2/ja not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| JPH06239865A (ja) | 1994-08-30 |
| IL102337A0 (en) | 1993-01-14 |
| NO922604L (no) | 1993-01-04 |
| US5292732A (en) | 1994-03-08 |
| IE922152A1 (en) | 1993-01-13 |
| IL102337A (en) | 1996-01-31 |
| NO922604D0 (no) | 1992-07-01 |
| FI923073A7 (fi) | 1993-01-03 |
| HUT70163A (en) | 1995-09-28 |
| CN1030986C (zh) | 1996-02-14 |
| HU9202139D0 (en) | 1992-10-28 |
| JPH0774217B2 (ja) | 1995-08-09 |
| AU654362B2 (en) | 1994-11-03 |
| FI100242B (fi) | 1997-10-31 |
| FI923073A0 (fi) | 1992-07-02 |
| TW224974B (OSRAM) | 1994-06-11 |
| AU1930992A (en) | 1993-01-07 |
| CS202292A3 (en) | 1993-01-13 |
| NZ243310A (en) | 1994-11-25 |
| EP0521368A1 (de) | 1993-01-07 |
| CN1068328A (zh) | 1993-01-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA2072836A1 (en) | Pyrrolopyrazine derivatives | |
| EP1192165B1 (en) | Substituted heterocycle fused gamma-carbolines | |
| CA1242193A (en) | 1-benzyl-aminoalkyl-pyrrolidinones and the acid addition salts thereof, processes for preparing them and pharmaceutical compositions | |
| Rawal et al. | Photocyclization strategy for the synthesis of antitumor agent CC-1065: synthesis of dideoxy PDE-I and PDE-II. Synthesis of thiophene and furan analogs of dideoxy PDE-I and PDE-II | |
| US7592454B2 (en) | Substituted hexahydro-pyridoindole derivatives as serotonin receptor agonists and antagonists | |
| CA1291484C (en) | 6-substituted-4-dialkylaminotetrahydrobenz¬c,d|indoles | |
| Allen et al. | Entry into 6-methoxy-D (+)-tryptophans. Stereospecific synthesis of 1-benzenesulfonyl-6-methoxy-D (+)-tryptophan ethyl ester | |
| CZ293628B6 (cs) | Benzyl(iden)laktamové deriváty a jejich použití a farmaceutické kompozice na jejich bázi | |
| Duan et al. | Rhodium (II)‐catalyzed [4+ 3] cyclization of triazoles with indole derivatives and its application in the total synthesis of (±)‐aurantioclavine | |
| CA1244414A (en) | Dibenzodiazepin derivatives, a process for their preparation and their use as medicaments | |
| Jones et al. | Direct synthesis of 2-acylindoles | |
| Kulagowski et al. | Generation and rearrangement of 4a H-carbazoles | |
| US3514462A (en) | 1 and 2 ethoxy 3,4,5,10 - tetrahydroazepino(3,4-b) and (2,3-b)indoles and corresponding amino derivatives thereof | |
| Clark et al. | Some observations on the formation of 1‐hydroxyindoles in the leimgruber‐batcho indole synthesis | |
| US5030636A (en) | Octahydrobenzo(f)quinoline derivatives | |
| JP2003064081A (ja) | 新規なオクタヒドロ−2H−ピリド〔1,2−a〕ピラジン化合物、それらの製造方法およびそれらを含む医薬組成物 | |
| US20020068748A1 (en) | Diazabicyclooctane derivatives and therapeutic uses thereof | |
| Whitehead et al. | Reactions of Orthoesters with Aryl Isocyanates | |
| CA1324607C (en) | Dipyrazoles useful as bronchodilators | |
| US4245095A (en) | Indolo isoquinoline compounds | |
| Moody et al. | Ring cleavage of a 3-azidothiophene: novel extrusion of acetylene | |
| US3503990A (en) | 6-aryl-4,5,6,7-tetrahydro-4-oxoindole derivatives | |
| Bajwa et al. | Fischer indole synthesis. The reaction of N′-alkyl-2, 6-dialkylphenylhydrazines with cyclohexanone | |
| JPS62240685A (ja) | 置換ピリミドインド−ル | |
| CZ202292A3 (cs) | Způsob zpracování slupek plodu ostropestřce mariánského |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| EEER | Examination request | ||
| FZDE | Discontinued |