CA2067495C - Silica sols, a process for the production of silica sols and use of the sols - Google Patents
Silica sols, a process for the production of silica sols and use of the solsInfo
- Publication number
- CA2067495C CA2067495C CA002067495A CA2067495A CA2067495C CA 2067495 C CA2067495 C CA 2067495C CA 002067495 A CA002067495 A CA 002067495A CA 2067495 A CA2067495 A CA 2067495A CA 2067495 C CA2067495 C CA 2067495C
- Authority
- CA
- Canada
- Prior art keywords
- process according
- cationic
- sol
- suspension
- sols
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 title claims abstract description 129
- 239000000377 silicon dioxide Substances 0.000 title claims abstract description 62
- 238000000034 method Methods 0.000 title claims description 37
- 238000004519 manufacturing process Methods 0.000 title claims description 23
- 229910052681 coesite Inorganic materials 0.000 claims abstract description 38
- 229910052906 cristobalite Inorganic materials 0.000 claims abstract description 38
- 235000012239 silicon dioxide Nutrition 0.000 claims abstract description 38
- 229910052682 stishovite Inorganic materials 0.000 claims abstract description 38
- 229910052905 tridymite Inorganic materials 0.000 claims abstract description 38
- 229920006317 cationic polymer Polymers 0.000 claims abstract description 35
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 claims abstract description 19
- 235000019353 potassium silicate Nutrition 0.000 claims abstract description 15
- 239000002253 acid Substances 0.000 claims abstract description 14
- 230000020477 pH reduction Effects 0.000 claims abstract description 10
- 125000002091 cationic group Chemical group 0.000 claims description 60
- 229920002472 Starch Polymers 0.000 claims description 30
- 235000019698 starch Nutrition 0.000 claims description 30
- 239000008107 starch Substances 0.000 claims description 30
- 239000002245 particle Substances 0.000 claims description 21
- 239000000725 suspension Substances 0.000 claims description 15
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 13
- 229910052782 aluminium Inorganic materials 0.000 claims description 13
- 150000001875 compounds Chemical class 0.000 claims description 13
- 229920002401 polyacrylamide Polymers 0.000 claims description 13
- -1 ammonium ions Chemical class 0.000 claims description 12
- 239000000835 fiber Substances 0.000 claims description 11
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 claims description 10
- 239000000945 filler Substances 0.000 claims description 9
- 229920001059 synthetic polymer Polymers 0.000 claims description 8
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 claims description 6
- 125000000129 anionic group Chemical group 0.000 claims description 6
- 150000002500 ions Chemical class 0.000 claims description 6
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 claims description 4
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 4
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 claims description 4
- 229910052700 potassium Inorganic materials 0.000 claims description 4
- BNGXYYYYKUGPPF-UHFFFAOYSA-M (3-methylphenyl)methyl-triphenylphosphanium;chloride Chemical compound [Cl-].CC1=CC=CC(C[P+](C=2C=CC=CC=2)(C=2C=CC=CC=2)C=2C=CC=CC=2)=C1 BNGXYYYYKUGPPF-UHFFFAOYSA-M 0.000 claims description 3
- 229910001413 alkali metal ion Inorganic materials 0.000 claims description 3
- 229940037003 alum Drugs 0.000 claims description 3
- 150000004645 aluminates Chemical class 0.000 claims description 3
- 150000001768 cations Chemical class 0.000 claims description 3
- 239000001913 cellulose Substances 0.000 claims description 3
- 229920002678 cellulose Polymers 0.000 claims description 3
- 239000011591 potassium Substances 0.000 claims description 3
- 238000004448 titration Methods 0.000 claims description 3
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 claims description 2
- 239000000908 ammonium hydroxide Substances 0.000 claims description 2
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 claims description 2
- 229910052921 ammonium sulfate Inorganic materials 0.000 claims description 2
- 235000011130 ammonium sulphate Nutrition 0.000 claims description 2
- 239000001569 carbon dioxide Substances 0.000 claims description 2
- 229910002092 carbon dioxide Inorganic materials 0.000 claims description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 claims description 2
- 239000011707 mineral Substances 0.000 claims description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims 7
- 239000001166 ammonium sulphate Substances 0.000 claims 1
- 239000003513 alkali Substances 0.000 abstract description 8
- 239000000654 additive Substances 0.000 abstract description 4
- 239000000123 paper Substances 0.000 description 25
- 229910000272 alkali metal oxide Inorganic materials 0.000 description 11
- 230000014759 maintenance of location Effects 0.000 description 10
- KKCBUQHMOMHUOY-UHFFFAOYSA-N Na2O Inorganic materials [O-2].[Na+].[Na+] KKCBUQHMOMHUOY-UHFFFAOYSA-N 0.000 description 8
- 239000000126 substance Substances 0.000 description 8
- 229920000642 polymer Polymers 0.000 description 7
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 6
- 238000007792 addition Methods 0.000 description 6
- 230000000694 effects Effects 0.000 description 6
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 229920002907 Guar gum Polymers 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- 229920001131 Pulp (paper) Polymers 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 238000001879 gelation Methods 0.000 description 3
- 239000000665 guar gum Substances 0.000 description 3
- 229960002154 guar gum Drugs 0.000 description 3
- 235000010417 guar gum Nutrition 0.000 description 3
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 2
- OCKGFTQIICXDQW-ZEQRLZLVSA-N 5-[(1r)-1-hydroxy-2-[4-[(2r)-2-hydroxy-2-(4-methyl-1-oxo-3h-2-benzofuran-5-yl)ethyl]piperazin-1-yl]ethyl]-4-methyl-3h-2-benzofuran-1-one Chemical compound C1=C2C(=O)OCC2=C(C)C([C@@H](O)CN2CCN(CC2)C[C@H](O)C2=CC=C3C(=O)OCC3=C2C)=C1 OCKGFTQIICXDQW-ZEQRLZLVSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- 235000018185 Betula X alpestris Nutrition 0.000 description 2
- 235000018212 Betula X uliginosa Nutrition 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- 235000008331 Pinus X rigitaeda Nutrition 0.000 description 2
- 235000011613 Pinus brutia Nutrition 0.000 description 2
- 241000018646 Pinus brutia Species 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical class [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- 150000001450 anions Chemical class 0.000 description 2
- 235000014633 carbohydrates Nutrition 0.000 description 2
- 150000001720 carbohydrates Chemical class 0.000 description 2
- 230000001419 dependent effect Effects 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 238000003860 storage Methods 0.000 description 2
- 238000006467 substitution reaction Methods 0.000 description 2
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- 229920003043 Cellulose fiber Polymers 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 239000004890 Hydrophobing Agent Substances 0.000 description 1
- 239000007832 Na2SO4 Substances 0.000 description 1
- 229910020284 Na2SO4.10H2O Inorganic materials 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- FKNQFGJONOIPTF-UHFFFAOYSA-N Sodium cation Chemical compound [Na+] FKNQFGJONOIPTF-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 239000003729 cation exchange resin Substances 0.000 description 1
- 229920001429 chelating resin Polymers 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 208000037516 chromosome inversion disease Diseases 0.000 description 1
- 239000008119 colloidal silica Substances 0.000 description 1
- 229940000425 combination drug Drugs 0.000 description 1
- 229910052593 corundum Inorganic materials 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 239000010440 gypsum Substances 0.000 description 1
- 229910052602 gypsum Inorganic materials 0.000 description 1
- 239000011121 hardwood Substances 0.000 description 1
- 239000008131 herbal destillate Substances 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- 229920000831 ionic polymer Polymers 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000012764 mineral filler Substances 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 230000001151 other effect Effects 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 239000011087 paperboard Substances 0.000 description 1
- 229920000962 poly(amidoamine) Polymers 0.000 description 1
- 229920000371 poly(diallyldimethylammonium chloride) polymer Polymers 0.000 description 1
- 238000005086 pumping Methods 0.000 description 1
- 229910001415 sodium ion Inorganic materials 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- RSIJVJUOQBWMIM-UHFFFAOYSA-L sodium sulfate decahydrate Chemical compound O.O.O.O.O.O.O.O.O.O.[Na+].[Na+].[O-]S([O-])(=O)=O RSIJVJUOQBWMIM-UHFFFAOYSA-L 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000011122 softwood Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical compound [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 229910001845 yogo sapphire Inorganic materials 0.000 description 1
Classifications
-
- D—TEXTILES; PAPER
- D21—PAPER-MAKING; PRODUCTION OF CELLULOSE
- D21H—PULP COMPOSITIONS; PREPARATION THEREOF NOT COVERED BY SUBCLASSES D21C OR D21D; IMPREGNATING OR COATING OF PAPER; TREATMENT OF FINISHED PAPER NOT COVERED BY CLASS B31 OR SUBCLASS D21G; PAPER NOT OTHERWISE PROVIDED FOR
- D21H17/00—Non-fibrous material added to the pulp, characterised by its constitution; Paper-impregnating material characterised by its constitution
- D21H17/63—Inorganic compounds
- D21H17/67—Water-insoluble compounds, e.g. fillers, pigments
- D21H17/68—Water-insoluble compounds, e.g. fillers, pigments siliceous, e.g. clays
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01B—NON-METALLIC ELEMENTS; COMPOUNDS THEREOF; METALLOIDS OR COMPOUNDS THEREOF NOT COVERED BY SUBCLASS C01C
- C01B33/00—Silicon; Compounds thereof
- C01B33/113—Silicon oxides; Hydrates thereof
- C01B33/12—Silica; Hydrates thereof, e.g. lepidoic silicic acid
- C01B33/14—Colloidal silica, e.g. dispersions, gels, sols
- C01B33/146—After-treatment of sols
- C01B33/148—Concentration; Drying; Dehydration; Stabilisation; Purification
- C01B33/1485—Stabilisation, e.g. prevention of gelling; Purification
Landscapes
- Chemical & Material Sciences (AREA)
- Dispersion Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Organic Chemistry (AREA)
- Silicon Compounds (AREA)
- Paper (AREA)
- Diaphragms For Electromechanical Transducers (AREA)
- Electronic Switches (AREA)
- Making Paper Articles (AREA)
- Silicon Polymers (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| SE8903754A SE500367C2 (sv) | 1989-11-09 | 1989-11-09 | Silikasoler och förfarande för framställning av papper |
| SE8903754-3 | 1989-11-09 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| CA2067495A1 CA2067495A1 (en) | 1991-05-10 |
| CA2067495C true CA2067495C (en) | 1996-11-05 |
Family
ID=20377426
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA002067495A Expired - Lifetime CA2067495C (en) | 1989-11-09 | 1990-10-24 | Silica sols, a process for the production of silica sols and use of the sols |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US5447604A (enExample) |
| EP (1) | EP0502089B2 (enExample) |
| JP (1) | JPH04505315A (enExample) |
| AT (1) | ATE107609T1 (enExample) |
| AU (1) | AU635365B2 (enExample) |
| CA (1) | CA2067495C (enExample) |
| DE (1) | DE69010217T3 (enExample) |
| DK (1) | DK0502089T4 (enExample) |
| ES (1) | ES2055580T5 (enExample) |
| FI (1) | FI98234C (enExample) |
| NO (1) | NO308374B1 (enExample) |
| NZ (1) | NZ235964A (enExample) |
| SE (1) | SE500367C2 (enExample) |
| WO (1) | WO1991007351A1 (enExample) |
Families Citing this family (69)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| SE9003954L (sv) * | 1990-12-11 | 1992-06-12 | Eka Nobel Ab | Saett foer framstaellning av ark- eller banformiga cellulosafiberinnehaallande produkter |
| CA2108028C (en) * | 1991-07-02 | 1997-05-27 | Bruno Carre | A process for the manufacture of paper |
| US5810961A (en) | 1993-11-19 | 1998-09-22 | E. Khashoggi Industries, Llc | Methods for manufacturing molded sheets having a high starch content |
| US5679145A (en) | 1992-08-11 | 1997-10-21 | E. Khashoggi Industries | Starch-based compositions having uniformly dispersed fibers used to manufacture high strength articles having a fiber-reinforced, starch-bound cellular matrix |
| US5662731A (en) | 1992-08-11 | 1997-09-02 | E. Khashoggi Industries | Compositions for manufacturing fiber-reinforced, starch-bound articles having a foamed cellular matrix |
| US5709827A (en) | 1992-08-11 | 1998-01-20 | E. Khashoggi Industries | Methods for manufacturing articles having a starch-bound cellular matrix |
| SE501214C2 (sv) * | 1992-08-31 | 1994-12-12 | Eka Nobel Ab | Silikasol samt förfarande för framställning av papper under användande av solen |
| US5716675A (en) | 1992-11-25 | 1998-02-10 | E. Khashoggi Industries | Methods for treating the surface of starch-based articles with glycerin |
| US5736209A (en) | 1993-11-19 | 1998-04-07 | E. Kashoggi, Industries, Llc | Compositions having a high ungelatinized starch content and sheets molded therefrom |
| US6083586A (en) | 1993-11-19 | 2000-07-04 | E. Khashoggi Industries, Llc | Sheets having a starch-based binding matrix |
| US5843544A (en) | 1994-02-07 | 1998-12-01 | E. Khashoggi Industries | Articles which include a hinged starch-bound cellular matrix |
| US5776388A (en) | 1994-02-07 | 1998-07-07 | E. Khashoggi Industries, Llc | Methods for molding articles which include a hinged starch-bound cellular matrix |
| US5705203A (en) | 1994-02-07 | 1998-01-06 | E. Khashoggi Industries | Systems for molding articles which include a hinged starch-bound cellular matrix |
| DE4437118A1 (de) * | 1994-10-05 | 1996-04-11 | Technocell Dekor Gmbh & Co Kg | Basispapier für dekorative Beschichtungssysteme |
| US5571494A (en) * | 1995-01-20 | 1996-11-05 | J. M. Huber Corporation | Temperature-activated polysilicic acids |
| US5846384A (en) * | 1995-06-15 | 1998-12-08 | Eka Chemicals Ab | Process for the production of paper |
| SE9502522D0 (sv) * | 1995-07-07 | 1995-07-07 | Eka Nobel Ab | A process for the production of paper |
| US5595630A (en) * | 1995-08-31 | 1997-01-21 | E. I. Du Pont De Nemours And Company | Process for the manufacture of paper |
| US5620629A (en) * | 1995-09-28 | 1997-04-15 | Nalco Chemical Company | Colloidal silica/polyelectrolyte blends for natural water clarification |
| SE9600285D0 (sv) | 1996-01-26 | 1996-01-26 | Eka Nobel Ab | Modification of starch |
| US6168857B1 (en) | 1996-04-09 | 2001-01-02 | E. Khashoggi Industries, Llc | Compositions and methods for manufacturing starch-based compositions |
| DE19719899A1 (de) * | 1997-05-12 | 1998-11-19 | Clariant Gmbh | Weitgehend wasserunlösliche kationisierte Feststoffe sowie ihre Herstellung und Verwendung |
| WO1998056716A1 (en) | 1997-06-09 | 1998-12-17 | Akzo Nobel N.V. | Polysilicate microgels and silica-based materials |
| DE69841835D1 (de) * | 1997-06-09 | 2010-09-23 | Akzo Nobel Nv | Polysilikat-Mikrogele |
| IT1293068B1 (it) * | 1997-07-01 | 1999-02-11 | Kempro Italiana S R L | Procedimento per ottenere una sospensione di silice colloidale ad elevata concentrazione e prodotto cosi' ottenuto |
| CO5070714A1 (es) | 1998-03-06 | 2001-08-28 | Nalco Chemical Co | Proceso para la preparacion de silice coloidal estable |
| US7306700B1 (en) | 1998-04-27 | 2007-12-11 | Akzo Nobel Nv | Process for the production of paper |
| KR100403839B1 (ko) | 1998-04-27 | 2003-11-01 | 악조 노벨 엔.브이. | 제지 방법 |
| US6132625A (en) * | 1998-05-28 | 2000-10-17 | E. I. Du Pont De Nemours And Company | Method for treatment of aqueous streams comprising biosolids |
| US6083997A (en) | 1998-07-28 | 2000-07-04 | Nalco Chemical Company | Preparation of anionic nanocomposites and their use as retention and drainage aids in papermaking |
| AU6281399A (en) | 1998-10-02 | 2000-04-26 | Cabot Corporation | Silica dispersion, coating composition and recording medium |
| US7169261B2 (en) | 1999-05-04 | 2007-01-30 | Akzo Nobel N.V. | Silica-based sols |
| DE60029778T2 (de) * | 1999-05-04 | 2007-10-18 | Akzo Nobel N.V. | Sole auf der basis von kieselsäure |
| US6203711B1 (en) | 1999-05-21 | 2001-03-20 | E. I. Du Pont De Nemours And Company | Method for treatment of substantially aqueous fluids derived from processing inorganic materials |
| HUP0201396A3 (en) * | 1999-06-02 | 2005-07-28 | Nalco Chemical Co Naperville | Stable silica colloid solutions of high surface area and improved activity |
| AU2001288175A1 (en) | 2000-09-20 | 2002-04-02 | Akzo Nobel N.V. | A process for the production of paper |
| US6780330B2 (en) | 2001-03-09 | 2004-08-24 | E. I. Du Pont De Nemours And Company | Removal of biomaterials from aqueous streams |
| US7189776B2 (en) * | 2001-06-12 | 2007-03-13 | Akzo Nobel N.V. | Aqueous composition |
| US20030136534A1 (en) * | 2001-12-21 | 2003-07-24 | Hans Johansson-Vestin | Aqueous silica-containing composition |
| US7156955B2 (en) * | 2001-12-21 | 2007-01-02 | Akzo Nobel N.V. | Papermaking process using a specified NSF to silica-based particle ratio |
| US20040138438A1 (en) * | 2002-10-01 | 2004-07-15 | Fredrik Solhage | Cationised polysaccharide product |
| US20040104004A1 (en) * | 2002-10-01 | 2004-06-03 | Fredrik Solhage | Cationised polysaccharide product |
| US7303654B2 (en) * | 2002-11-19 | 2007-12-04 | Akzo Nobel N.V. | Cellulosic product and process for its production |
| ZA200508659B (en) * | 2003-05-09 | 2007-03-28 | Akzo Nobel Nv | A process for the production of paper |
| US7629392B2 (en) * | 2004-04-07 | 2009-12-08 | Akzo Nobel N.V. | Silica-based sols and their production and use |
| NZ549595A (en) * | 2004-04-07 | 2010-02-26 | Akzo Nobel Nv | Silica-based sols and their production and use |
| KR100853924B1 (ko) * | 2004-04-07 | 2008-08-25 | 악조 노벨 엔.브이. | 실리카-기초 졸 및 이의 제조 및 용도 |
| US7732495B2 (en) * | 2004-04-07 | 2010-06-08 | Akzo Nobel N.V. | Silica-based sols and their production and use |
| US20050257909A1 (en) * | 2004-05-18 | 2005-11-24 | Erik Lindgren | Board, packaging material and package as well as production and uses thereof |
| US7955473B2 (en) | 2004-12-22 | 2011-06-07 | Akzo Nobel N.V. | Process for the production of paper |
| US20060254464A1 (en) * | 2005-05-16 | 2006-11-16 | Akzo Nobel N.V. | Process for the production of paper |
| WO2007078245A1 (en) | 2005-12-30 | 2007-07-12 | Akzo Nobel N.V. | A process for the production of paper |
| US8273216B2 (en) * | 2005-12-30 | 2012-09-25 | Akzo Nobel N.V. | Process for the production of paper |
| US8728274B2 (en) * | 2006-09-22 | 2014-05-20 | Akzo Nobel N.V. | Treatment of pulp |
| EP2087171B1 (en) * | 2006-12-01 | 2011-09-07 | Akzo Nobel N.V. | Cellulosic product |
| KR100780289B1 (ko) | 2006-12-13 | 2007-11-28 | 날코 컴파니 | 높은 표면적 및 향상된 활성의 안정한 실리카 졸 |
| KR20090106471A (ko) * | 2006-12-21 | 2009-10-09 | 아크조 노벨 엔.브이. | 셀룰로스 제품의 제조 방법 |
| EP2147155A1 (en) * | 2007-05-23 | 2010-01-27 | Akzo Nobel N.V. | Process for the production of a cellulosic product |
| US8409647B2 (en) | 2008-08-12 | 2013-04-02 | E. I. Du Pont De Nemours And Company | Silica microgels for reducing chill haze |
| US8343337B2 (en) | 2008-10-29 | 2013-01-01 | E.I. Du Pont De Nemours And Company | Bitumen extraction process |
| EP2402503A1 (en) | 2010-06-30 | 2012-01-04 | Akzo Nobel Chemicals International B.V. | Process for the production of a cellulosic product |
| JP5657603B2 (ja) * | 2012-05-17 | 2015-01-21 | ナルコ ケミカル カンパニーNalco Chemical Company | 高表面積及び高活性の安定なシリカゾルの調製方法 |
| CA2835677C (en) | 2012-12-19 | 2017-01-17 | E. I. Du Pont De Nemours And Company | Improved bitumen extraction process |
| US10087081B2 (en) | 2013-03-08 | 2018-10-02 | Ecolab Usa Inc. | Process for producing high solids colloidal silica |
| AU2014235929B2 (en) | 2013-03-22 | 2017-07-13 | The Chemours Company Fc, Llc | Treatment of tailing streams |
| EP2981510A1 (en) | 2013-04-05 | 2016-02-10 | The Chemours Company FC, LLC | Treatment of tailings streams by underwater solidification |
| CA2823459C (en) * | 2013-08-09 | 2015-06-23 | Imperial Oil Resources Limited | Method of using a silicate-containing stream from a hydrocarbon operation or from a geothermal source to treat fluid tailings by chemically-induced micro-agglomeration |
| KR20160048836A (ko) | 2013-08-23 | 2016-05-04 | 아크조 노벨 케미칼즈 인터내셔널 비.브이. | 실리카 졸 |
| CA2931682C (en) * | 2013-11-25 | 2022-01-04 | Ecolab Usa Inc. | Stable aqueous colloidal silica product, and methods to make and use same |
Family Cites Families (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3533816A (en) * | 1965-10-22 | 1970-10-13 | Du Pont | Preparation of high ratio alkali metal silicates |
| US3655578A (en) * | 1969-05-08 | 1972-04-11 | Du Pont | High surface area stabilized silica sols and process for preparing same |
| AU546999B2 (en) * | 1980-05-28 | 1985-10-03 | Eka A.B. | Adding binder to paper making stock |
| US4385961A (en) * | 1981-02-26 | 1983-05-31 | Eka Aktiebolag | Papermaking |
| SE432951B (sv) * | 1980-05-28 | 1984-04-30 | Eka Ab | Pappersprodukt innehallande cellulosafibrer och ett bindemedelssystem som omfattar kolloidal kiselsyra och katjonisk sterkelse samt forfarande for framstellning av pappersprodukten |
| SE8107078L (sv) * | 1981-11-27 | 1983-05-28 | Eka Ab | Forfarande for papperstillverkning |
| DE3401485A1 (de) * | 1984-01-18 | 1985-12-05 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von molekularsiebformkoerpern |
| SE8403062L (sv) * | 1984-06-07 | 1985-12-08 | Eka Ab | Forfarande vid papperstillverkning |
| SE451739B (sv) * | 1985-04-03 | 1987-10-26 | Eka Nobel Ab | Papperstillverkningsforfarande och pappersprodukt varvid som avvattnings- och retentionsforbettrande kemikalie anvends katjonisk polyakrylamid och en speciell oorganisk kolloid |
| JPS6345113A (ja) * | 1986-08-13 | 1988-02-26 | Catalysts & Chem Ind Co Ltd | 低濁度および低粘度のシリカゾル |
| GB8621680D0 (en) * | 1986-09-09 | 1986-10-15 | Du Pont | Filler compositions |
| SE8701252D0 (sv) * | 1987-03-03 | 1987-03-25 | Eka Nobel Ab | Sett vid framstellning av papper |
| DE68914638T2 (de) * | 1988-01-13 | 1994-07-21 | Eka Nobel Inc | Polyaluminosilikat-mikrogel, verfahren und zusammensetzung. |
| US4946557A (en) * | 1988-03-08 | 1990-08-07 | Eka Nobel Ab | Process for the production of paper |
| SE467627B (sv) * | 1988-09-01 | 1992-08-17 | Eka Nobel Ab | Saett vid framstaellning av papper |
| DE3902754A1 (de) * | 1989-01-31 | 1990-08-02 | Henkel Kgaa | Verfahren zur hydrothermalen herstellung von natriumsilikatloesungen |
| DE3902753A1 (de) * | 1989-01-31 | 1990-08-02 | Henkel Kgaa | Verfahren zur hydrothermalen herstellung von kaliumsilikatloesungen mit hohem si0(pfeil abwaerts)2(pfeil abwaerts):k(pfeil abwaerts)2(pfeil abwaerts)0-molverhaeltnis |
| DE3902751A1 (de) * | 1989-01-31 | 1990-08-02 | Henkel Kgaa | Verfahren zur hydrothermalen herstellung von natriumsilikatloesungen mit hohem si0(pfeil abwaerts)2(pfeil abwaerts):na(pfeil abwaerts)2(pfeil abwaerts)-molverhaeltnis |
-
1989
- 1989-11-09 SE SE8903754A patent/SE500367C2/sv unknown
-
1990
- 1990-10-24 AT AT91900404T patent/ATE107609T1/de not_active IP Right Cessation
- 1990-10-24 CA CA002067495A patent/CA2067495C/en not_active Expired - Lifetime
- 1990-10-24 DK DK91900404T patent/DK0502089T4/da active
- 1990-10-24 US US07/855,649 patent/US5447604A/en not_active Expired - Lifetime
- 1990-10-24 WO PCT/SE1990/000690 patent/WO1991007351A1/en not_active Ceased
- 1990-10-24 EP EP91900404A patent/EP0502089B2/en not_active Expired - Lifetime
- 1990-10-24 DE DE69010217T patent/DE69010217T3/de not_active Expired - Lifetime
- 1990-10-24 ES ES91900404T patent/ES2055580T5/es not_active Expired - Lifetime
- 1990-10-24 AU AU67342/90A patent/AU635365B2/en not_active Expired
- 1990-10-24 JP JP2515830A patent/JPH04505315A/ja active Granted
- 1990-11-05 NZ NZ235964A patent/NZ235964A/xx unknown
-
1992
- 1992-05-06 FI FI922057A patent/FI98234C/fi active
- 1992-05-11 NO NO921849A patent/NO308374B1/no not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| FI98234C (fi) | 1997-05-12 |
| FI922057A0 (fi) | 1992-05-06 |
| SE500367C2 (sv) | 1994-06-13 |
| ES2055580T3 (es) | 1994-08-16 |
| NO921849L (no) | 1992-05-11 |
| EP0502089B1 (en) | 1994-06-22 |
| FI922057L (fi) | 1992-05-06 |
| SE8903754L (sv) | 1991-05-10 |
| FI98234B (fi) | 1997-01-31 |
| JPH0574524B2 (enExample) | 1993-10-18 |
| WO1991007351A1 (en) | 1991-05-30 |
| DK0502089T4 (da) | 1999-05-25 |
| CA2067495A1 (en) | 1991-05-10 |
| NZ235964A (en) | 1992-09-25 |
| DE69010217T2 (de) | 1994-10-13 |
| JPH04505315A (ja) | 1992-09-17 |
| AU635365B2 (en) | 1993-03-18 |
| EP0502089B2 (en) | 1998-08-19 |
| SE8903754D0 (sv) | 1989-11-09 |
| US5447604A (en) | 1995-09-05 |
| DK0502089T3 (da) | 1994-11-07 |
| NO921849D0 (no) | 1992-05-11 |
| ATE107609T1 (de) | 1994-07-15 |
| AU6734290A (en) | 1991-06-13 |
| EP0502089A1 (en) | 1992-09-09 |
| ES2055580T5 (es) | 1999-01-01 |
| DE69010217D1 (de) | 1994-07-28 |
| DE69010217T3 (de) | 1999-03-04 |
| NO308374B1 (no) | 2000-09-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA2067495C (en) | Silica sols, a process for the production of silica sols and use of the sols | |
| CA2067506C (en) | Silica sols, a process for the production of the silica sols and use of the sols | |
| US5127994A (en) | Process for the production of paper | |
| US5603805A (en) | Silica sols and use of the sols | |
| EP0500770B1 (en) | A process for the production of paper | |
| EP0357574B1 (en) | A process for the production of paper | |
| EP0394368B1 (en) | A process for the production of paper | |
| CA1337732C (en) | Process for the production of paper | |
| NO174783B (no) | Fremgangsmåte ved fremstilling av papir |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| EEER | Examination request | ||
| MKEX | Expiry |