CA2061006A1 - Catalyseur de polymerisation - Google Patents
Catalyseur de polymerisationInfo
- Publication number
- CA2061006A1 CA2061006A1 CA002061006A CA2061006A CA2061006A1 CA 2061006 A1 CA2061006 A1 CA 2061006A1 CA 002061006 A CA002061006 A CA 002061006A CA 2061006 A CA2061006 A CA 2061006A CA 2061006 A1 CA2061006 A1 CA 2061006A1
- Authority
- CA
- Canada
- Prior art keywords
- catalyst
- value
- phosphonitrile
- phosphonitrile halide
- halide catalyst
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Abandoned
Links
- 239000003054 catalyst Substances 0.000 title claims abstract description 87
- -1 phosphonitrile halide Chemical class 0.000 claims abstract description 50
- 238000000034 method Methods 0.000 claims abstract description 31
- 229920001296 polysiloxane Polymers 0.000 claims abstract description 11
- 125000005843 halogen group Chemical group 0.000 claims abstract description 6
- 230000003647 oxidation Effects 0.000 claims abstract description 3
- 238000007254 oxidation reaction Methods 0.000 claims abstract description 3
- 239000000203 mixture Substances 0.000 claims description 24
- 125000005375 organosiloxane group Chemical group 0.000 claims description 19
- 150000001875 compounds Chemical class 0.000 claims description 18
- 239000002841 Lewis acid Substances 0.000 claims description 17
- 150000007517 lewis acids Chemical class 0.000 claims description 17
- 239000002904 solvent Substances 0.000 claims description 17
- 238000006243 chemical reaction Methods 0.000 claims description 16
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical group ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 claims description 12
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 claims description 11
- 229910052698 phosphorus Inorganic materials 0.000 claims description 10
- 239000011574 phosphorus Substances 0.000 claims description 8
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims description 7
- 125000000217 alkyl group Chemical group 0.000 claims description 7
- 239000003153 chemical reaction reagent Substances 0.000 claims description 7
- 125000004432 carbon atom Chemical group C* 0.000 claims description 5
- 238000004519 manufacturing process Methods 0.000 claims description 5
- 229910052782 aluminium Inorganic materials 0.000 claims description 4
- 150000004945 aromatic hydrocarbons Chemical class 0.000 claims description 4
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 claims description 3
- 229910052787 antimony Inorganic materials 0.000 claims description 3
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 claims description 3
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- 238000010992 reflux Methods 0.000 claims description 3
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 2
- 125000004437 phosphorous atom Chemical group 0.000 claims description 2
- 239000000969 carrier Substances 0.000 claims 1
- 238000009833 condensation Methods 0.000 abstract description 4
- 230000005494 condensation Effects 0.000 abstract description 4
- 229910052736 halogen Inorganic materials 0.000 abstract description 4
- 125000004400 (C1-C12) alkyl group Chemical group 0.000 abstract 1
- 235000013870 dimethyl polysiloxane Nutrition 0.000 description 13
- 229920000435 poly(dimethylsiloxane) Polymers 0.000 description 11
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 9
- 239000004205 dimethyl polysiloxane Substances 0.000 description 7
- PBKONEOXTCPAFI-UHFFFAOYSA-N 1,2,4-trichlorobenzene Chemical compound ClC1=CC=C(Cl)C(Cl)=C1 PBKONEOXTCPAFI-UHFFFAOYSA-N 0.000 description 6
- 239000007795 chemical reaction product Substances 0.000 description 6
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 5
- 150000004820 halides Chemical class 0.000 description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 5
- LWIGVRDDANOFTD-UHFFFAOYSA-N hydroxy(dimethyl)silane Chemical compound C[SiH](C)O LWIGVRDDANOFTD-UHFFFAOYSA-N 0.000 description 5
- 239000000463 material Substances 0.000 description 5
- 229920000642 polymer Polymers 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical group [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 4
- 235000019270 ammonium chloride Nutrition 0.000 description 4
- 125000003118 aryl group Chemical group 0.000 description 4
- ZSTLPJLUQNQBDQ-UHFFFAOYSA-N azanylidyne(dihydroxy)-$l^{5}-phosphane Chemical compound OP(O)#N ZSTLPJLUQNQBDQ-UHFFFAOYSA-N 0.000 description 4
- 230000003197 catalytic effect Effects 0.000 description 4
- 125000004122 cyclic group Chemical group 0.000 description 4
- 229920005645 diorganopolysiloxane polymer Polymers 0.000 description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 4
- 238000006116 polymerization reaction Methods 0.000 description 4
- 229910052710 silicon Inorganic materials 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 3
- 239000000539 dimer Substances 0.000 description 3
- 230000006698 induction Effects 0.000 description 3
- 239000012442 inert solvent Substances 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 230000008707 rearrangement Effects 0.000 description 3
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical compound [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 description 2
- 239000000159 acid neutralizing agent Substances 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 125000000129 anionic group Chemical group 0.000 description 2
- 150000001450 anions Chemical class 0.000 description 2
- FAPDDOBMIUGHIN-UHFFFAOYSA-K antimony trichloride Chemical compound Cl[Sb](Cl)Cl FAPDDOBMIUGHIN-UHFFFAOYSA-K 0.000 description 2
- VMPVEPPRYRXYNP-UHFFFAOYSA-I antimony(5+);pentachloride Chemical compound Cl[Sb](Cl)(Cl)(Cl)Cl VMPVEPPRYRXYNP-UHFFFAOYSA-I 0.000 description 2
- 229910052796 boron Inorganic materials 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 238000007796 conventional method Methods 0.000 description 2
- KPUWHANPEXNPJT-UHFFFAOYSA-N disiloxane Chemical class [SiH3]O[SiH3] KPUWHANPEXNPJT-UHFFFAOYSA-N 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- FFUAGWLWBBFQJT-UHFFFAOYSA-N hexamethyldisilazane Chemical compound C[Si](C)(C)N[Si](C)(C)C FFUAGWLWBBFQJT-UHFFFAOYSA-N 0.000 description 2
- 125000001183 hydrocarbyl group Chemical group 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 239000010703 silicon Substances 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- WGTYBPLFGIVFAS-UHFFFAOYSA-M tetramethylammonium hydroxide Chemical compound [OH-].C[N+](C)(C)C WGTYBPLFGIVFAS-UHFFFAOYSA-M 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- 229910015844 BCl3 Inorganic materials 0.000 description 1
- 229910015900 BF3 Inorganic materials 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- AFCARXCZXQIEQB-UHFFFAOYSA-N N-[3-oxo-3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)propyl]-2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carboxamide Chemical group O=C(CCNC(=O)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F)N1CC2=C(CC1)NN=N2 AFCARXCZXQIEQB-UHFFFAOYSA-N 0.000 description 1
- 238000005481 NMR spectroscopy Methods 0.000 description 1
- 229910021295 PNCl2 Inorganic materials 0.000 description 1
- 229910003910 SiCl4 Inorganic materials 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 229910052776 Thorium Inorganic materials 0.000 description 1
- DOSPGQVUPLVLAS-UHFFFAOYSA-N [SiH3][O-].CCCC[P+](CCCC)(CCCC)CCCC Chemical compound [SiH3][O-].CCCC[P+](CCCC)(CCCC)CCCC DOSPGQVUPLVLAS-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- 125000000304 alkynyl group Chemical group 0.000 description 1
- 239000004411 aluminium Substances 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000004104 aryloxy group Chemical group 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 229910052790 beryllium Inorganic materials 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 1
- 125000004369 butenyl group Chemical group C(=CCC)* 0.000 description 1
- 125000004106 butoxy group Chemical group [*]OC([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 239000007810 chemical reaction solvent Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 1
- 125000000068 chlorophenyl group Chemical group 0.000 description 1
- 239000000306 component Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000010908 decantation Methods 0.000 description 1
- 125000003493 decenyl group Chemical group [H]C([*])=C([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 125000006038 hexenyl group Chemical group 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 229910001629 magnesium chloride Inorganic materials 0.000 description 1
- 229910001507 metal halide Inorganic materials 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- HMMGMWAXVFQUOA-UHFFFAOYSA-N octamethylcyclotetrasiloxane Chemical compound C[Si]1(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O1 HMMGMWAXVFQUOA-UHFFFAOYSA-N 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 125000000962 organic group Chemical group 0.000 description 1
- 150000003961 organosilicon compounds Chemical class 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- 229920001921 poly-methyl-phenyl-siloxane Polymers 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000006462 rearrangement reaction Methods 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- FDNAPBUWERUEDA-UHFFFAOYSA-N silicon tetrachloride Chemical compound Cl[Si](Cl)(Cl)Cl FDNAPBUWERUEDA-UHFFFAOYSA-N 0.000 description 1
- 229920002379 silicone rubber Polymers 0.000 description 1
- 239000004945 silicone rubber Substances 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 238000004611 spectroscopical analysis Methods 0.000 description 1
- 125000004079 stearyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 239000001117 sulphuric acid Substances 0.000 description 1
- 235000011149 sulphuric acid Nutrition 0.000 description 1
- 229910052718 tin Inorganic materials 0.000 description 1
- 229910052719 titanium Inorganic materials 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- FAQYAMRNWDIXMY-UHFFFAOYSA-N trichloroborane Chemical compound ClB(Cl)Cl FAQYAMRNWDIXMY-UHFFFAOYSA-N 0.000 description 1
- 125000000725 trifluoropropyl group Chemical group [H]C([H])(*)C([H])([H])C(F)(F)F 0.000 description 1
- 239000013638 trimer Substances 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 125000005023 xylyl group Chemical group 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G77/00—Macromolecular compounds obtained by reactions forming a linkage containing silicon with or without sulfur, nitrogen, oxygen or carbon in the main chain of the macromolecule
- C08G77/04—Polysiloxanes
- C08G77/06—Preparatory processes
- C08G77/08—Preparatory processes characterised by the catalysts used
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01B—NON-METALLIC ELEMENTS; COMPOUNDS THEREOF; METALLOIDS OR COMPOUNDS THEREOF NOT COVERED BY SUBCLASS C01C
- C01B21/00—Nitrogen; Compounds thereof
- C01B21/082—Compounds containing nitrogen and non-metals and optionally metals
- C01B21/097—Compounds containing nitrogen and non-metals and optionally metals containing phosphorus atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Inorganic Chemistry (AREA)
- Silicon Polymers (AREA)
- Transition And Organic Metals Composition Catalysts For Addition Polymerization (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB919103656A GB9103656D0 (en) | 1991-02-21 | 1991-02-21 | Catalyst for polymerisation |
| GB9103656.6 | 1991-02-21 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA2061006A1 true CA2061006A1 (fr) | 1992-08-22 |
Family
ID=10690358
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA002061006A Abandoned CA2061006A1 (fr) | 1991-02-21 | 1992-02-11 | Catalyseur de polymerisation |
Country Status (10)
| Country | Link |
|---|---|
| JP (1) | JP3207905B2 (fr) |
| KR (1) | KR100239611B1 (fr) |
| AU (1) | AU1108092A (fr) |
| CA (1) | CA2061006A1 (fr) |
| DE (1) | DE4205200A1 (fr) |
| ES (1) | ES2046103B1 (fr) |
| FR (1) | FR2676063B1 (fr) |
| GB (2) | GB9103656D0 (fr) |
| IT (1) | IT1256673B (fr) |
| NL (1) | NL9200225A (fr) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE4317909A1 (de) * | 1993-05-28 | 1994-12-01 | Wacker Chemie Gmbh | Verfahren zum Kondensieren und/oder Äquilibrieren von Organosiliciumverbindungen |
| DE4323185C1 (de) * | 1993-07-10 | 1995-01-19 | Nuenchritz Chemie Gmbh | Verfahren zur Herstellung von Polyorganosiloxanen |
| US5510441A (en) * | 1993-07-15 | 1996-04-23 | General Electric Company | Process for producing octamethyltrisiloxane |
| US5420221A (en) * | 1993-07-15 | 1995-05-30 | General Electric Company | Process for the production of linear organosiloxane polymers by disproportionation |
| US5403909A (en) * | 1993-07-15 | 1995-04-04 | General Electric Company | Catalysts for polycondensation and redistribution of organosiloxane polymers |
| US6136996A (en) * | 1995-12-13 | 2000-10-24 | General Electric Company | Catalysts for polycondensation and redistribution of organosiloxane polymers |
| US5698654A (en) * | 1996-07-30 | 1997-12-16 | General Electric Company | Process for preparing hydrogen siloxane copolymers |
| US5753751A (en) * | 1996-10-24 | 1998-05-19 | General Electric Company | Process for preparing self-curable alkenyl hydride siloxane copolymers and coating composition |
| GB9727136D0 (en) * | 1997-12-24 | 1998-02-25 | Dow Corning | Catalyst composition |
| US6040412A (en) * | 1998-10-14 | 2000-03-21 | Dow Corning S.A. | Process for preparing chain-extended organopolysiloxanes |
| GB9827069D0 (en) * | 1998-12-09 | 1999-02-03 | Dow Corning | Polymerisation catalyst |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1279019B (de) * | 1967-01-04 | 1968-10-03 | Wacker Chemie Gmbh | Verfahren zur Herstellung von Organohalogensiliciumverbindungen |
| US3449091A (en) * | 1967-01-27 | 1969-06-10 | Du Pont | Halide-modified phosphonitrilic chlorides |
| DE1802016A1 (de) * | 1967-10-12 | 1969-05-29 | Grace W R & Co | Additionsverbindungen linearer Phosphornitrilchlorid-Polymerer und Verfahren zu deren Herstellung |
| DE1794219B2 (de) * | 1968-09-25 | 1972-01-05 | Wacker Chemie GmbH, 8000 München | Verfahren zur herstellung von organopolysiloxanelastomeren |
| US3706775A (en) * | 1970-12-17 | 1972-12-19 | Wacker Chemie Gmbh | Method of preparing high molecular weight linear organopolysiloxanes |
| GB1436352A (en) * | 1972-03-06 | 1976-05-19 | Fmc Corp | Oligometric phosphazene derivatives having flame-retardant properties |
| JPS5819604B2 (ja) * | 1978-05-04 | 1983-04-19 | 大塚化学薬品株式会社 | ホスフアゼンオリゴマ−の製造法 |
| US4293675A (en) * | 1980-02-26 | 1981-10-06 | Minnesota Mining And Manufacturing Company | Antimony halide-organic phosphonate ester cationic polymerization catalysts |
| DE3524484A1 (de) * | 1985-07-09 | 1987-01-15 | Wacker Chemie Gmbh | Verfahren zur herstellung von linearen organopolysiloxanen mit triorganosiloxygruppen als endstaendigen einheiten |
| DE3725377A1 (de) * | 1987-07-31 | 1989-02-09 | Wacker Chemie Gmbh | Verfahren zum kondensieren und/oder aequilibrieren von organo(poly)siloxanen |
| DE3727182A1 (de) * | 1987-08-14 | 1989-02-23 | Wacker Chemie Gmbh | Herstellung und weiterverarbeitung von mischungen mit einem hohen anteil an organocyclosiloxanen |
| GB8902936D0 (en) * | 1989-02-09 | 1989-03-30 | Dow Corning | Process for the production of organosilicon compounds |
-
1991
- 1991-02-21 GB GB919103656A patent/GB9103656D0/en active Pending
-
1992
- 1992-02-07 NL NL9200225A patent/NL9200225A/nl active Search and Examination
- 1992-02-11 CA CA002061006A patent/CA2061006A1/fr not_active Abandoned
- 1992-02-12 ES ES09200289A patent/ES2046103B1/es not_active Expired - Fee Related
- 1992-02-14 GB GB9203217A patent/GB2252969A/en not_active Withdrawn
- 1992-02-19 KR KR1019920002458A patent/KR100239611B1/ko not_active IP Right Cessation
- 1992-02-20 JP JP03342992A patent/JP3207905B2/ja not_active Expired - Fee Related
- 1992-02-20 DE DE4205200A patent/DE4205200A1/de not_active Withdrawn
- 1992-02-20 AU AU11080/92A patent/AU1108092A/en not_active Abandoned
- 1992-02-20 IT ITTO920135A patent/IT1256673B/it active IP Right Grant
- 1992-02-20 FR FR9201919A patent/FR2676063B1/fr not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| GB2252969A (en) | 1992-08-26 |
| DE4205200A1 (de) | 1992-08-27 |
| ES2046103B1 (es) | 1994-08-01 |
| JPH04328128A (ja) | 1992-11-17 |
| ES2046103A1 (es) | 1994-01-16 |
| GB9203217D0 (en) | 1992-04-01 |
| NL9200225A (nl) | 1992-09-16 |
| ITTO920135A1 (it) | 1993-08-20 |
| ITTO920135A0 (it) | 1992-02-20 |
| GB9103656D0 (en) | 1991-04-10 |
| KR100239611B1 (ko) | 2000-01-15 |
| IT1256673B (it) | 1995-12-12 |
| KR920016472A (ko) | 1992-09-24 |
| JP3207905B2 (ja) | 2001-09-10 |
| FR2676063A1 (fr) | 1992-11-06 |
| AU1108092A (en) | 1992-08-27 |
| FR2676063B1 (fr) | 1993-10-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JP3657633B2 (ja) | オルガノシロキサン重合体の重縮合及び再分布用の新規触媒 | |
| US5210131A (en) | Method of making organopolysiloxanes | |
| EP0251435B1 (fr) | Procédé de préparation de résines de siloxane | |
| US5420221A (en) | Process for the production of linear organosiloxane polymers by disproportionation | |
| US4701490A (en) | Method for stabilizing organopolysiloxanes | |
| US5457220A (en) | Process for the production of crosslinked siloxanes by disproportionation | |
| US4975510A (en) | Process for preparing diorganopolysiloxanes having terminal triorganosiloxy units | |
| CA2061006A1 (fr) | Catalyseur de polymerisation | |
| US5380902A (en) | Process for the condensation and/or equilibration of organosilicon compounds | |
| US5424385A (en) | Phosphazenes containing organosilicon radicals, process for their preparation and their use | |
| US6048819A (en) | Catalyst composition | |
| US6136996A (en) | Catalysts for polycondensation and redistribution of organosiloxane polymers | |
| CA1285689C (fr) | Procede pour la stabilisation de chaines d'organopolysiloxanes | |
| US7015296B2 (en) | Preparation of linear organosiloxane polymers | |
| JP4507134B2 (ja) | 鎖延長オルガノポリシロキサンの製造方法 | |
| JPS59159829A (ja) | オルガノポリシロキサンの安定化法 | |
| GB2305661A (en) | Preparing phosphazene catalysts | |
| US5994490A (en) | Process for equilibrating and/or condensing organosilicon compounds | |
| US5716589A (en) | Method for making reaction products of phosphorus pentachloride and ammonium chloride | |
| JPH0641309A (ja) | ジオルガノシロキサン・ジオルガノシラザン共重合体の製造方法 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| EEER | Examination request | ||
| FZDE | Discontinued |