CA1297441C - Stabilized built liquid detergent composition containing enzymes - Google Patents
Stabilized built liquid detergent composition containing enzymesInfo
- Publication number
- CA1297441C CA1297441C CA000514036A CA514036A CA1297441C CA 1297441 C CA1297441 C CA 1297441C CA 000514036 A CA000514036 A CA 000514036A CA 514036 A CA514036 A CA 514036A CA 1297441 C CA1297441 C CA 1297441C
- Authority
- CA
- Canada
- Prior art keywords
- alkali metal
- enzyme
- detergent composition
- water
- liquid detergent
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 239000000203 mixture Substances 0.000 title claims abstract description 132
- 239000003599 detergent Substances 0.000 title claims abstract description 84
- 102000004190 Enzymes Human genes 0.000 title claims abstract description 72
- 108090000790 Enzymes Proteins 0.000 title claims abstract description 72
- 239000007788 liquid Substances 0.000 title claims abstract description 60
- 229940088598 enzyme Drugs 0.000 claims abstract description 71
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 claims abstract description 65
- -1 alkali metal nitrilotriacetates Chemical class 0.000 claims abstract description 47
- 229910052783 alkali metal Inorganic materials 0.000 claims abstract description 31
- 235000011187 glycerol Nutrition 0.000 claims abstract description 31
- 150000003839 salts Chemical class 0.000 claims abstract description 29
- 235000019832 sodium triphosphate Nutrition 0.000 claims abstract description 25
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims abstract description 24
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 22
- 150000001340 alkali metals Chemical class 0.000 claims abstract description 14
- 150000007942 carboxylates Chemical class 0.000 claims abstract description 12
- 229930182556 Polyacetal Natural products 0.000 claims abstract description 11
- 150000001875 compounds Chemical class 0.000 claims abstract description 11
- 229920006324 polyoxymethylene Polymers 0.000 claims abstract description 11
- 239000002253 acid Substances 0.000 claims abstract description 9
- 150000001639 boron compounds Chemical class 0.000 claims abstract description 9
- 125000000129 anionic group Chemical group 0.000 claims abstract description 7
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 claims abstract description 6
- 239000004327 boric acid Substances 0.000 claims abstract description 6
- 150000007513 acids Chemical class 0.000 claims abstract description 5
- 229910011255 B2O3 Inorganic materials 0.000 claims abstract description 4
- 108091005658 Basic proteases Proteins 0.000 claims abstract description 4
- 229910000288 alkali metal carbonate Inorganic materials 0.000 claims abstract description 4
- 150000008041 alkali metal carbonates Chemical class 0.000 claims abstract description 4
- 108090000637 alpha-Amylases Proteins 0.000 claims abstract description 4
- 102000004139 alpha-Amylases Human genes 0.000 claims abstract description 4
- JKWMSGQKBLHBQQ-UHFFFAOYSA-N diboron trioxide Chemical compound O=BOB=O JKWMSGQKBLHBQQ-UHFFFAOYSA-N 0.000 claims abstract description 4
- 229910021538 borax Inorganic materials 0.000 claims description 30
- 239000004328 sodium tetraborate Substances 0.000 claims description 30
- 235000010339 sodium tetraborate Nutrition 0.000 claims description 29
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 claims description 25
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 claims description 23
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 claims description 21
- 125000000217 alkyl group Chemical group 0.000 claims description 17
- 230000000087 stabilizing effect Effects 0.000 claims description 17
- 238000000034 method Methods 0.000 claims description 14
- 239000011734 sodium Substances 0.000 claims description 13
- 229910052708 sodium Inorganic materials 0.000 claims description 13
- 239000002671 adjuvant Substances 0.000 claims description 12
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical group C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 11
- KDYFGRWQOYBRFD-UHFFFAOYSA-N succinic acid Chemical compound OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 claims description 11
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical group C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 claims description 10
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 claims description 10
- 229910000029 sodium carbonate Inorganic materials 0.000 claims description 10
- 239000002304 perfume Substances 0.000 claims description 9
- KRTNITDCKAVIFI-UHFFFAOYSA-N tridecyl benzenesulfonate Chemical compound CCCCCCCCCCCCCOS(=O)(=O)C1=CC=CC=C1 KRTNITDCKAVIFI-UHFFFAOYSA-N 0.000 claims description 6
- 150000004996 alkyl benzenes Chemical class 0.000 claims description 5
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 claims description 5
- 239000011976 maleic acid Substances 0.000 claims description 5
- 239000001384 succinic acid Substances 0.000 claims description 5
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 claims description 5
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 claims description 5
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 claims description 4
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 claims description 4
- 239000001630 malic acid Substances 0.000 claims description 4
- 235000011090 malic acid Nutrition 0.000 claims description 4
- GSPKZYJPUDYKPI-UHFFFAOYSA-N diethoxy sulfate Chemical compound CCOOS(=O)(=O)OOCC GSPKZYJPUDYKPI-UHFFFAOYSA-N 0.000 claims description 3
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 claims description 3
- 238000004900 laundering Methods 0.000 claims description 3
- BTBUEUYNUDRHOZ-UHFFFAOYSA-N Borate Chemical compound [O-]B([O-])[O-] BTBUEUYNUDRHOZ-UHFFFAOYSA-N 0.000 claims description 2
- 235000011054 acetic acid Nutrition 0.000 claims description 2
- 150000001243 acetic acids Chemical class 0.000 claims description 2
- 239000004744 fabric Substances 0.000 claims description 2
- 229910052751 metal Inorganic materials 0.000 claims description 2
- 239000002184 metal Substances 0.000 claims description 2
- 150000004672 propanoic acids Chemical class 0.000 claims description 2
- 235000019260 propionic acid Nutrition 0.000 claims description 2
- 230000000694 effects Effects 0.000 description 13
- UNXRWKVEANCORM-UHFFFAOYSA-I triphosphate(5-) Chemical compound [O-]P([O-])(=O)OP([O-])(=O)OP([O-])([O-])=O UNXRWKVEANCORM-UHFFFAOYSA-I 0.000 description 10
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 9
- 239000000463 material Substances 0.000 description 9
- 239000000047 product Substances 0.000 description 9
- 238000013019 agitation Methods 0.000 description 6
- 238000009472 formulation Methods 0.000 description 6
- 235000017550 sodium carbonate Nutrition 0.000 description 6
- 239000003381 stabilizer Substances 0.000 description 6
- 108010003855 mesentericopeptidase Proteins 0.000 description 5
- 239000001509 sodium citrate Substances 0.000 description 5
- NLJMYIDDQXHKNR-UHFFFAOYSA-K sodium citrate Chemical compound O.O.[Na+].[Na+].[Na+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O NLJMYIDDQXHKNR-UHFFFAOYSA-K 0.000 description 5
- 239000000243 solution Substances 0.000 description 5
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 4
- 108091005804 Peptidases Proteins 0.000 description 4
- 229940079919 digestives enzyme preparation Drugs 0.000 description 4
- 238000003860 storage Methods 0.000 description 4
- YGUMVDWOQQJBGA-VAWYXSNFSA-N 5-[(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)amino]-2-[(e)-2-[4-[(4-anilino-6-morpholin-4-yl-1,3,5-triazin-2-yl)amino]-2-sulfophenyl]ethenyl]benzenesulfonic acid Chemical compound C=1C=C(\C=C\C=2C(=CC(NC=3N=C(N=C(NC=4C=CC=CC=4)N=3)N3CCOCC3)=CC=2)S(O)(=O)=O)C(S(=O)(=O)O)=CC=1NC(N=C(N=1)N2CCOCC2)=NC=1NC1=CC=CC=C1 YGUMVDWOQQJBGA-VAWYXSNFSA-N 0.000 description 3
- CKLJMWTZIZZHCS-REOHCLBHSA-N L-aspartic acid Chemical compound OC(=O)[C@@H](N)CC(O)=O CKLJMWTZIZZHCS-REOHCLBHSA-N 0.000 description 3
- 102000035195 Peptidases Human genes 0.000 description 3
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 3
- 235000003704 aspartic acid Nutrition 0.000 description 3
- OQFSQFPPLPISGP-UHFFFAOYSA-N beta-carboxyaspartic acid Natural products OC(=O)C(N)C(C(O)=O)C(O)=O OQFSQFPPLPISGP-UHFFFAOYSA-N 0.000 description 3
- 150000001735 carboxylic acids Chemical class 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 239000007859 condensation product Substances 0.000 description 3
- 150000002191 fatty alcohols Chemical class 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- 230000003287 optical effect Effects 0.000 description 3
- 235000006408 oxalic acid Nutrition 0.000 description 3
- 229920000642 polymer Polymers 0.000 description 3
- 239000002002 slurry Substances 0.000 description 3
- 159000000000 sodium salts Chemical class 0.000 description 3
- ZDQYSKICYIVCPN-UHFFFAOYSA-L sodium succinate (anhydrous) Chemical compound [Na+].[Na+].[O-]C(=O)CCC([O-])=O ZDQYSKICYIVCPN-UHFFFAOYSA-L 0.000 description 3
- 238000005406 washing Methods 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 2
- 239000004471 Glycine Substances 0.000 description 2
- 229910019142 PO4 Inorganic materials 0.000 description 2
- 239000004365 Protease Substances 0.000 description 2
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 108010056079 Subtilisins Proteins 0.000 description 2
- 102000005158 Subtilisins Human genes 0.000 description 2
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 2
- 239000001768 carboxy methyl cellulose Substances 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- 238000004140 cleaning Methods 0.000 description 2
- 239000003086 colorant Substances 0.000 description 2
- 230000000875 corresponding effect Effects 0.000 description 2
- 239000008367 deionised water Substances 0.000 description 2
- 229910021641 deionized water Inorganic materials 0.000 description 2
- 150000001991 dicarboxylic acids Chemical class 0.000 description 2
- 239000000975 dye Substances 0.000 description 2
- 238000010348 incorporation Methods 0.000 description 2
- 238000011068 loading method Methods 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000002609 medium Substances 0.000 description 2
- 235000021317 phosphate Nutrition 0.000 description 2
- 229920005862 polyol Polymers 0.000 description 2
- 150000003077 polyols Chemical class 0.000 description 2
- 159000000001 potassium salts Chemical class 0.000 description 2
- 229940024999 proteolytic enzymes for treatment of wounds and ulcers Drugs 0.000 description 2
- HELHAJAZNSDZJO-OLXYHTOASA-L sodium L-tartrate Chemical compound [Na+].[Na+].[O-]C(=O)[C@H](O)[C@@H](O)C([O-])=O HELHAJAZNSDZJO-OLXYHTOASA-L 0.000 description 2
- 239000001632 sodium acetate Substances 0.000 description 2
- 235000017281 sodium acetate Nutrition 0.000 description 2
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 2
- HLBBKKJFGFRGMU-UHFFFAOYSA-M sodium formate Chemical compound [Na+].[O-]C=O HLBBKKJFGFRGMU-UHFFFAOYSA-M 0.000 description 2
- 229940023144 sodium glycolate Drugs 0.000 description 2
- 229940074404 sodium succinate Drugs 0.000 description 2
- 239000001433 sodium tartrate Substances 0.000 description 2
- 229960002167 sodium tartrate Drugs 0.000 description 2
- 235000011004 sodium tartrates Nutrition 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 230000001502 supplementing effect Effects 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 230000002195 synergetic effect Effects 0.000 description 2
- JEJAMASKDTUEBZ-UHFFFAOYSA-N tris(1,1,3-tribromo-2,2-dimethylpropyl) phosphate Chemical compound BrCC(C)(C)C(Br)(Br)OP(=O)(OC(Br)(Br)C(C)(C)CBr)OC(Br)(Br)C(C)(C)CBr JEJAMASKDTUEBZ-UHFFFAOYSA-N 0.000 description 2
- 239000010457 zeolite Substances 0.000 description 2
- SXFBQAMLJMDXOD-UHFFFAOYSA-N (+)-hydrogentartrate bitartrate salt Chemical compound OC(=O)C(O)C(O)C(O)=O.OC(=O)C(O)C(O)C(O)=O SXFBQAMLJMDXOD-UHFFFAOYSA-N 0.000 description 1
- UUFQTNFCRMXOAE-UHFFFAOYSA-N 1-methylmethylene Chemical compound C[CH] UUFQTNFCRMXOAE-UHFFFAOYSA-N 0.000 description 1
- HOZBSSWDEKVXNO-DKWTVANSSA-N 2-aminobutanedioic acid;(2s)-2-aminobutanedioic acid Chemical compound OC(=O)C(N)CC(O)=O.OC(=O)[C@@H](N)CC(O)=O HOZBSSWDEKVXNO-DKWTVANSSA-N 0.000 description 1
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 1
- 239000004382 Amylase Substances 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- 229920001634 Copolyester Polymers 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- QNAYBMKLOCPYGJ-REOHCLBHSA-N L-alanine Chemical compound C[C@H](N)C(O)=O QNAYBMKLOCPYGJ-REOHCLBHSA-N 0.000 description 1
- 239000004677 Nylon Substances 0.000 description 1
- 102100037486 Reverse transcriptase/ribonuclease H Human genes 0.000 description 1
- 239000004115 Sodium Silicate Substances 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- 239000004280 Sodium formate Substances 0.000 description 1
- PJANXHGTPQOBST-VAWYXSNFSA-N Stilbene Natural products C=1C=CC=CC=1/C=C/C1=CC=CC=C1 PJANXHGTPQOBST-VAWYXSNFSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 229910021536 Zeolite Inorganic materials 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 230000001154 acute effect Effects 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 235000004279 alanine Nutrition 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 239000002518 antifoaming agent Substances 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 230000003935 attention Effects 0.000 description 1
- IRERQBUNZFJFGC-UHFFFAOYSA-L azure blue Chemical compound [Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[Al+3].[Al+3].[Al+3].[Al+3].[Al+3].[Al+3].[S-]S[S-].[O-][Si]([O-])([O-])[O-].[O-][Si]([O-])([O-])[O-].[O-][Si]([O-])([O-])[O-].[O-][Si]([O-])([O-])[O-].[O-][Si]([O-])([O-])[O-].[O-][Si]([O-])([O-])[O-] IRERQBUNZFJFGC-UHFFFAOYSA-L 0.000 description 1
- 239000003899 bactericide agent Substances 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 238000006065 biodegradation reaction Methods 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 235000019219 chocolate Nutrition 0.000 description 1
- 229940125782 compound 2 Drugs 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 230000000368 destabilizing effect Effects 0.000 description 1
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical compound O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 description 1
- JSKIAGGRMZDKAV-UHFFFAOYSA-L disodium;2,2,3,3-tetrahydroxybutanedioate Chemical compound [Na+].[Na+].[O-]C(=O)C(O)(O)C(O)(O)C([O-])=O JSKIAGGRMZDKAV-UHFFFAOYSA-L 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 230000002255 enzymatic effect Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000004872 foam stabilizing agent Substances 0.000 description 1
- 230000006870 function Effects 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- 235000013882 gravy Nutrition 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 239000011256 inorganic filler Substances 0.000 description 1
- 229910003475 inorganic filler Inorganic materials 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- SKDZEPBJPGSFHS-UHFFFAOYSA-N n,n-bis(2-hydroxyethyl)tetradecanamide Chemical compound CCCCCCCCCCCCCC(=O)N(CCO)CCO SKDZEPBJPGSFHS-UHFFFAOYSA-N 0.000 description 1
- MGFYIUFZLHCRTH-UHFFFAOYSA-N nitrilotriacetic acid Chemical compound OC(=O)CN(CC(O)=O)CC(O)=O MGFYIUFZLHCRTH-UHFFFAOYSA-N 0.000 description 1
- 229920001778 nylon Polymers 0.000 description 1
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 1
- 238000004806 packaging method and process Methods 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 229920001495 poly(sodium acrylate) polymer Polymers 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 238000002203 pretreatment Methods 0.000 description 1
- 235000019419 proteases Nutrition 0.000 description 1
- 230000002797 proteolythic effect Effects 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- FQENQNTWSFEDLI-UHFFFAOYSA-J sodium diphosphate Chemical compound [Na+].[Na+].[Na+].[Na+].[O-]P([O-])(=O)OP([O-])([O-])=O FQENQNTWSFEDLI-UHFFFAOYSA-J 0.000 description 1
- 235000019254 sodium formate Nutrition 0.000 description 1
- DZCAZXAJPZCSCU-UHFFFAOYSA-K sodium nitrilotriacetate Chemical compound [Na+].[Na+].[Na+].[O-]C(=O)CN(CC([O-])=O)CC([O-])=O DZCAZXAJPZCSCU-UHFFFAOYSA-K 0.000 description 1
- NNMHYFLPFNGQFZ-UHFFFAOYSA-M sodium polyacrylate Chemical compound [Na+].[O-]C(=O)C=C NNMHYFLPFNGQFZ-UHFFFAOYSA-M 0.000 description 1
- 229910000031 sodium sesquicarbonate Inorganic materials 0.000 description 1
- 235000018341 sodium sesquicarbonate Nutrition 0.000 description 1
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 1
- 229910052911 sodium silicate Inorganic materials 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- PJANXHGTPQOBST-UHFFFAOYSA-N stilbene Chemical compound C=1C=CC=CC=1C=CC1=CC=CC=C1 PJANXHGTPQOBST-UHFFFAOYSA-N 0.000 description 1
- 235000021286 stilbenes Nutrition 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-L succinate(2-) Chemical compound [O-]C(=O)CCC([O-])=O KDYFGRWQOYBRFD-UHFFFAOYSA-L 0.000 description 1
- 150000003871 sulfonates Chemical class 0.000 description 1
- 239000013589 supplement Substances 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 239000000271 synthetic detergent Substances 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 108010075550 termamyl Proteins 0.000 description 1
- 125000005207 tetraalkylammonium group Chemical group 0.000 description 1
- 235000019818 tetrasodium diphosphate Nutrition 0.000 description 1
- WCTAGTRAWPDFQO-UHFFFAOYSA-K trisodium;hydrogen carbonate;carbonate Chemical compound [Na+].[Na+].[Na+].OC([O-])=O.[O-]C([O-])=O WCTAGTRAWPDFQO-UHFFFAOYSA-K 0.000 description 1
- 235000013799 ultramarine blue Nutrition 0.000 description 1
- 239000000341 volatile oil Substances 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D7/00—Compositions of detergents based essentially on non-surface-active compounds
- C11D7/02—Inorganic compounds
- C11D7/04—Water-soluble compounds
- C11D7/10—Salts
- C11D7/16—Phosphates including polyphosphates
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/16—Organic compounds
- C11D3/38—Products with no well-defined composition, e.g. natural products
- C11D3/386—Preparations containing enzymes, e.g. protease or amylase
- C11D3/38663—Stabilised liquid enzyme compositions
Landscapes
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Detergent Compositions (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US75952885A | 1985-07-26 | 1985-07-26 | |
| US759,528 | 1985-07-26 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1297441C true CA1297441C (en) | 1992-03-17 |
Family
ID=25055993
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000514036A Expired - Lifetime CA1297441C (en) | 1985-07-26 | 1986-07-17 | Stabilized built liquid detergent composition containing enzymes |
Country Status (33)
| Country | Link |
|---|---|
| JP (1) | JPS6232194A (show.php) |
| KR (1) | KR940010119B1 (show.php) |
| AT (1) | ATA199186A (show.php) |
| AU (1) | AU590891B2 (show.php) |
| BE (1) | BE905168A (show.php) |
| BR (1) | BR8603478A (show.php) |
| CA (1) | CA1297441C (show.php) |
| CH (1) | CH669959A5 (show.php) |
| DE (1) | DE3623942A1 (show.php) |
| DK (1) | DK164745C (show.php) |
| EG (1) | EG18014A (show.php) |
| ES (1) | ES2001484A6 (show.php) |
| FR (1) | FR2585363B1 (show.php) |
| GB (1) | GB2178054B (show.php) |
| GR (1) | GR861946B (show.php) |
| HK (1) | HK1793A (show.php) |
| IL (1) | IL79451A0 (show.php) |
| IN (1) | IN170205B (show.php) |
| IT (1) | IT1195983B (show.php) |
| LU (1) | LU86525A1 (show.php) |
| MX (1) | MX163853B (show.php) |
| MY (1) | MY102909A (show.php) |
| NL (1) | NL8601926A (show.php) |
| NO (1) | NO166006C (show.php) |
| NZ (1) | NZ216791A (show.php) |
| PH (1) | PH21637A (show.php) |
| PT (1) | PT83024B (show.php) |
| SE (1) | SE467827B (show.php) |
| SG (1) | SG108592G (show.php) |
| TR (1) | TR24209A (show.php) |
| ZA (1) | ZA865096B (show.php) |
| ZM (1) | ZM8086A1 (show.php) |
| ZW (1) | ZW13286A1 (show.php) |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| SE468518B (sv) * | 1985-07-26 | 1993-02-01 | Colgate Palmolive Co | Stabiliserad textilmjukgoerande enzyminnehaallande foerstaerkt flytande detergentkomposition och dess anvaendning vid tvaett av textilier |
| GB2200132B (en) * | 1986-12-15 | 1991-09-18 | Colgate Palmolive Co | Stabilised enzyme systems and compositions containing them |
| DE3704465C2 (de) * | 1987-02-13 | 1995-11-02 | Roehm Gmbh | Flüssig-Formulierungen von Enzymen |
| AU3667189A (en) * | 1988-06-23 | 1990-01-04 | Unilever Plc | Enzyme-containing liquid detergents |
| JP3058656B2 (ja) * | 1990-06-18 | 2000-07-04 | トーメー産業株式会社 | コンタクトレンズ用液剤組成物及びそれを用いたコンタクトレンズの洗浄若しくは保存方法 |
| EP0476726A1 (en) * | 1990-07-27 | 1992-03-25 | Unilever N.V. | Protease-containing liquid detergent compositions |
| DE4319578A1 (de) * | 1993-06-14 | 1994-12-15 | Henkel Kgaa | Waschmittel, enthaltend Aminosäuren und/oder deren Salze |
| US5672213A (en) * | 1995-08-18 | 1997-09-30 | Alcon Laboratories, Inc. | Liquid enzyme compositions containing aromatic acid derivatives |
| GB2367065B (en) * | 2000-09-20 | 2002-11-20 | Reckitt Benckiser Inc | Enzyme containing laundry booster compositions |
| KR20110100874A (ko) * | 2010-03-05 | 2011-09-15 | 박해성 | 보존성이 향상된 프로테아제 및 그 제조방법 |
| JP5950557B2 (ja) * | 2011-11-18 | 2016-07-13 | サラヤ株式会社 | 液体洗浄剤組成物 |
| DE102014224747A1 (de) * | 2014-12-03 | 2016-06-09 | Henkel Ag & Co. Kgaa | Enzymstabilisatoren |
Family Cites Families (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FI61715C (fi) * | 1976-11-01 | 1982-09-10 | Unilever Nv | Enzymer innehaollande stabiliserad flytande detergentkomposition |
| IT1129814B (it) * | 1980-07-02 | 1986-06-11 | Unilever Nv | Composizione detergente enzimatica liquida |
| DE3264685D1 (en) * | 1981-11-13 | 1985-08-14 | Unilever Nv | Enzymatic liquid cleaning composition |
| AU547579B2 (en) * | 1981-11-13 | 1985-10-24 | Unilever Plc | Low foaming liquid detergent composition |
| US4462922A (en) * | 1981-11-19 | 1984-07-31 | Lever Brothers Company | Enzymatic liquid detergent composition |
| US4529525A (en) * | 1982-08-30 | 1985-07-16 | Colgate-Palmolive Co. | Stabilized enzyme-containing detergent compositions |
| GB8305790D0 (en) * | 1983-03-02 | 1983-04-07 | Unilever Plc | Liquid detergent composition |
| GB8311314D0 (en) * | 1983-04-26 | 1983-06-02 | Unilever Plc | Aqueous enzyme-containing compositions |
| NZ208157A (en) * | 1983-05-31 | 1986-11-12 | Colgate Palmolive Co | Built single-phase liquid detergent compositions containing stabilised enzymes |
| US4507219A (en) * | 1983-08-12 | 1985-03-26 | The Proctor & Gamble Company | Stable liquid detergent compositions |
| DE3574729D1 (de) * | 1984-05-14 | 1990-01-18 | Procter & Gamble | Borsaeure enthaltende fluessige reinigungsmittel zur stabilisierung von enzymen. |
| US4747977A (en) * | 1984-11-09 | 1988-05-31 | The Procter & Gamble Company | Ethanol-free liquid laundry detergent compositions |
| SE468518B (sv) * | 1985-07-26 | 1993-02-01 | Colgate Palmolive Co | Stabiliserad textilmjukgoerande enzyminnehaallande foerstaerkt flytande detergentkomposition och dess anvaendning vid tvaett av textilier |
-
1986
- 1986-07-08 NZ NZ216791A patent/NZ216791A/xx unknown
- 1986-07-08 ZA ZA865096A patent/ZA865096B/xx unknown
- 1986-07-08 SE SE8603037A patent/SE467827B/sv not_active IP Right Cessation
- 1986-07-10 IN IN609/DEL/86A patent/IN170205B/en unknown
- 1986-07-16 ZW ZW132/86A patent/ZW13286A1/xx unknown
- 1986-07-16 ZM ZM80/86A patent/ZM8086A1/xx unknown
- 1986-07-16 DE DE3623942A patent/DE3623942A1/de not_active Ceased
- 1986-07-17 IL IL79451A patent/IL79451A0/xx not_active IP Right Cessation
- 1986-07-17 MX MX3178A patent/MX163853B/es unknown
- 1986-07-17 CA CA000514036A patent/CA1297441C/en not_active Expired - Lifetime
- 1986-07-18 FR FR868610495A patent/FR2585363B1/fr not_active Expired - Lifetime
- 1986-07-21 PT PT83024A patent/PT83024B/pt unknown
- 1986-07-21 PH PH34039A patent/PH21637A/en unknown
- 1986-07-22 AU AU60414/86A patent/AU590891B2/en not_active Ceased
- 1986-07-22 TR TR86/0405A patent/TR24209A/xx unknown
- 1986-07-23 AT AT0199186A patent/ATA199186A/de not_active IP Right Cessation
- 1986-07-23 BR BR8603478A patent/BR8603478A/pt not_active IP Right Cessation
- 1986-07-24 ES ES8600599A patent/ES2001484A6/es not_active Expired
- 1986-07-24 DK DK352786A patent/DK164745C/da not_active IP Right Cessation
- 1986-07-24 GR GR861946A patent/GR861946B/el unknown
- 1986-07-24 JP JP61174702A patent/JPS6232194A/ja active Pending
- 1986-07-24 GB GB8618042A patent/GB2178054B/en not_active Expired
- 1986-07-25 CH CH3006/86A patent/CH669959A5/de not_active IP Right Cessation
- 1986-07-25 LU LU86525A patent/LU86525A1/fr unknown
- 1986-07-25 IT IT48309/86A patent/IT1195983B/it active
- 1986-07-25 BE BE0/216972A patent/BE905168A/fr not_active IP Right Cessation
- 1986-07-25 KR KR1019860006066A patent/KR940010119B1/ko not_active Expired - Lifetime
- 1986-07-25 NO NO862997A patent/NO166006C/no unknown
- 1986-07-25 NL NL8601926A patent/NL8601926A/nl not_active Application Discontinuation
- 1986-07-27 EG EG473/86A patent/EG18014A/xx active
-
1987
- 1987-09-28 MY MYPI87002056A patent/MY102909A/en unknown
-
1992
- 1992-10-14 SG SG1085/92A patent/SG108592G/en unknown
-
1993
- 1993-01-14 HK HK17/93A patent/HK1793A/xx unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4900475A (en) | Stabilized built liquid detergent composition containing enzyme | |
| US4842758A (en) | Stabilized enzyme system for use in aqueous liquid built detergent compositions | |
| US4670179A (en) | Stabilized built single phase liquid detergent composition containing enzymes | |
| US3998750A (en) | Liquid detergent composition | |
| US4759876A (en) | Stable soil release promoting enzymatic liquid detergent composition | |
| CA1220741A (en) | Built single-phase liquid anionic detergent composition containing stabilized enzymes | |
| USH1776H (en) | Enzyme-containing heavy duty liquid detergent | |
| US5500151A (en) | Heavy duty fabric softening laundry detergent composition | |
| US5698507A (en) | Nonaqueous gelled automatic dishwashing composition | |
| IE57605B1 (en) | Stable liquid detergent compositions | |
| US4842769A (en) | Stabilized fabric softening built detergent composition containing enzymes | |
| CA1297441C (en) | Stabilized built liquid detergent composition containing enzymes | |
| NZ207692A (en) | Soil-release promoting liquid detergent containing terephthalate polymers | |
| CA1297440C (en) | Fabric softening liquid detergent | |
| US4652394A (en) | Built single phase liquid anionic detergent compositions containing stabilized enzymes | |
| EP0352244A2 (en) | Stabilized enzymatic liquid detergent | |
| IE58877B1 (en) | Stable soil release promoting enzymatic liquid detergent composition | |
| US4842767A (en) | Heavy duty built aqueous liquid detergent composition containing stabilized enzymes | |
| CA1220742A (en) | Stabilized built single-phase liquid detergent composition containing enzymes | |
| US5501820A (en) | Aqueous enzymatic detergent compositions | |
| JPH0555107B2 (show.php) | ||
| CA1151088A (en) | Aqueous compositions containing stabilized enzymes | |
| GB2169307A (en) | Concentrated single-phase built liquid detergent composition | |
| NZ206542A (en) | Enzyme-containing liquid detergent compositions | |
| IE853191L (en) | Detergent compositions |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKLA | Lapsed |