CA1260934A - Purine derivatives - Google Patents
Purine derivativesInfo
- Publication number
- CA1260934A CA1260934A CA000492727A CA492727A CA1260934A CA 1260934 A CA1260934 A CA 1260934A CA 000492727 A CA000492727 A CA 000492727A CA 492727 A CA492727 A CA 492727A CA 1260934 A CA1260934 A CA 1260934A
- Authority
- CA
- Canada
- Prior art keywords
- methyl
- guanine
- acid addition
- acceptable acid
- pharmaceutically acceptable
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229940083251 peripheral vasodilators purine derivative Drugs 0.000 title abstract 2
- 125000000561 purinyl group Chemical class N1=C(N=C2N=CNC2=C1)* 0.000 title 1
- 238000000034 method Methods 0.000 claims abstract description 64
- 239000008194 pharmaceutical composition Substances 0.000 claims abstract description 4
- 238000004519 manufacturing process Methods 0.000 claims abstract description 3
- 150000001875 compounds Chemical class 0.000 claims description 127
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 86
- 150000003839 salts Chemical class 0.000 claims description 73
- 239000002253 acid Substances 0.000 claims description 65
- -1 4-pyridinyl Chemical group 0.000 claims description 38
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 36
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 32
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 claims description 27
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 claims description 27
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 claims description 24
- 229910052739 hydrogen Inorganic materials 0.000 claims description 23
- 230000008569 process Effects 0.000 claims description 21
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 16
- 125000001541 3-thienyl group Chemical group S1C([H])=C([*])C([H])=C1[H] 0.000 claims description 15
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 claims description 14
- 235000019253 formic acid Nutrition 0.000 claims description 14
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 claims description 13
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 claims description 13
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 13
- 125000003682 3-furyl group Chemical group O1C([H])=C([*])C([H])=C1[H] 0.000 claims description 12
- 239000002904 solvent Substances 0.000 claims description 12
- KDDQRKBRJSGMQE-UHFFFAOYSA-N 4-thiazolyl Chemical group [C]1=CSC=N1 KDDQRKBRJSGMQE-UHFFFAOYSA-N 0.000 claims description 11
- 229910052794 bromium Inorganic materials 0.000 claims description 11
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 claims description 10
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 8
- CWDWFSXUQODZGW-UHFFFAOYSA-N 5-thiazolyl Chemical group [C]1=CN=CS1 CWDWFSXUQODZGW-UHFFFAOYSA-N 0.000 claims description 6
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 claims description 6
- 229910052736 halogen Inorganic materials 0.000 claims description 6
- 150000002367 halogens Chemical class 0.000 claims description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 6
- 125000001544 thienyl group Chemical group 0.000 claims description 6
- 229910052801 chlorine Inorganic materials 0.000 claims description 5
- 229910052731 fluorine Inorganic materials 0.000 claims description 5
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 5
- HANOSGYMKMNFON-UHFFFAOYSA-N 2,8-diamino-9-(thiophen-2-ylmethyl)-3h-purin-6-one Chemical compound NC1=NC(C(N=C(N)N2)=O)=C2N1CC1=CC=CS1 HANOSGYMKMNFON-UHFFFAOYSA-N 0.000 claims description 4
- XGUKQMNJZJKOAB-UHFFFAOYSA-N 2-amino-9-(thiophen-2-ylmethyl)-3h-purin-6-one Chemical compound C1=NC=2C(=O)NC(N)=NC=2N1CC1=CC=CS1 XGUKQMNJZJKOAB-UHFFFAOYSA-N 0.000 claims description 4
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 claims description 4
- QKDLJUSXYAHDFI-UHFFFAOYSA-N 2,8-diamino-9-(furan-2-ylmethyl)-3h-purin-6-one Chemical compound NC1=NC(C(NC(N)=N2)=O)=C2N1CC1=CC=CO1 QKDLJUSXYAHDFI-UHFFFAOYSA-N 0.000 claims description 3
- 125000000335 thiazolyl group Chemical group 0.000 claims description 3
- DBZITYDGYMCEEO-UHFFFAOYSA-N 2,8-diamino-9-[(5-ethylthiophen-2-yl)methyl]-3h-purin-6-one Chemical compound S1C(CC)=CC=C1CN1C(N=C(N)NC2=O)=C2N=C1N DBZITYDGYMCEEO-UHFFFAOYSA-N 0.000 claims description 2
- RTFXTKZURZECQR-UHFFFAOYSA-N 2-amino-8-bromo-9-(thiophen-2-ylmethyl)-3h-purin-6-one Chemical compound BrC1=NC=2C(=O)NC(N)=NC=2N1CC1=CC=CS1 RTFXTKZURZECQR-UHFFFAOYSA-N 0.000 claims description 2
- KEZPNGRCBLGXDO-UHFFFAOYSA-N 2-amino-8-bromo-9-[(2-methylthiophen-3-yl)methyl]-3h-purin-6-one Chemical compound S1C=CC(CN2C3=C(C(NC(N)=N3)=O)N=C2Br)=C1C KEZPNGRCBLGXDO-UHFFFAOYSA-N 0.000 claims description 2
- YBCJDBQVUIVSEG-UHFFFAOYSA-N 2-amino-8-bromo-9-[(5-ethylthiophen-2-yl)methyl]-3h-purin-6-one Chemical compound S1C(CC)=CC=C1CN1C(N=C(N)NC2=O)=C2N=C1Br YBCJDBQVUIVSEG-UHFFFAOYSA-N 0.000 claims description 2
- IZJOIOLODSTRKQ-UHFFFAOYSA-N 2-amino-9-(thiophen-3-ylmethyl)-3h-purin-6-one Chemical compound C1=NC=2C(=O)NC(N)=NC=2N1CC=1C=CSC=1 IZJOIOLODSTRKQ-UHFFFAOYSA-N 0.000 claims description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims description 2
- 238000010438 heat treatment Methods 0.000 claims description 2
- DKAGJZJALZXOOV-UHFFFAOYSA-N hydrate;hydrochloride Chemical compound O.Cl DKAGJZJALZXOOV-UHFFFAOYSA-N 0.000 claims description 2
- 239000003960 organic solvent Substances 0.000 claims description 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims 10
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 claims 7
- 229910052740 iodine Inorganic materials 0.000 claims 4
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 claims 2
- FNHDYMUTPWGWOS-UHFFFAOYSA-N 2,8-diamino-9-(1-benzothiophen-3-ylmethyl)-3h-purin-6-one Chemical compound C1=CC=C2C(CN3C4=C(C(NC(N)=N4)=O)N=C3N)=CSC2=C1 FNHDYMUTPWGWOS-UHFFFAOYSA-N 0.000 claims 2
- AOZQVAGTXFWFQD-UHFFFAOYSA-N 2,8-diamino-9-(pyridin-2-ylmethyl)-3h-purin-6-one Chemical compound NC1=NC(C(NC(N)=N2)=O)=C2N1CC1=CC=CC=N1 AOZQVAGTXFWFQD-UHFFFAOYSA-N 0.000 claims 2
- KDXSWYYLKBNAER-UHFFFAOYSA-N 2,8-diamino-9-(thiophen-3-ylmethyl)-3h-purin-6-one Chemical compound NC1=NC(C(NC(N)=N2)=O)=C2N1CC=1C=CSC=1 KDXSWYYLKBNAER-UHFFFAOYSA-N 0.000 claims 2
- NMXRHXGJJDANLN-UHFFFAOYSA-N 2,8-diamino-9-[(3-methylthiophen-2-yl)methyl]-3h-purin-6-one Chemical compound C1=CSC(CN2C3=C(C(NC(N)=N3)=O)N=C2N)=C1C NMXRHXGJJDANLN-UHFFFAOYSA-N 0.000 claims 2
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 claims 2
- 125000002541 furyl group Chemical group 0.000 claims 2
- 125000004076 pyridyl group Chemical group 0.000 claims 2
- OUEAJDHPSCKTOL-UHFFFAOYSA-N 2,8-diamino-9-(1,3-thiazol-2-ylmethyl)-3h-purin-6-one Chemical compound NC1=NC(C(NC(N)=N2)=O)=C2N1CC1=NC=CS1 OUEAJDHPSCKTOL-UHFFFAOYSA-N 0.000 claims 1
- RDJGLISKLVKGGV-UHFFFAOYSA-N 2,8-diamino-9-(1,3-thiazol-4-ylmethyl)-3h-purin-6-one Chemical compound NC1=NC(C(NC(N)=N2)=O)=C2N1CC1=CSC=N1 RDJGLISKLVKGGV-UHFFFAOYSA-N 0.000 claims 1
- AJDORQFHCHJMCZ-UHFFFAOYSA-N 2,8-diamino-9-(2-thiophen-2-ylethyl)-3h-purin-6-one Chemical compound NC1=NC(C(NC(N)=N2)=O)=C2N1CCC1=CC=CS1 AJDORQFHCHJMCZ-UHFFFAOYSA-N 0.000 claims 1
- OLBVURXVSQVSRV-UHFFFAOYSA-N 2,8-diamino-9-(2-thiophen-2-ylethyl)-3h-purine-6-thione Chemical compound NC1=NC(C(NC(N)=N2)=S)=C2N1CCC1=CC=CS1 OLBVURXVSQVSRV-UHFFFAOYSA-N 0.000 claims 1
- CDHATTZGGFVACW-UHFFFAOYSA-N 2,8-diamino-9-(furan-3-ylmethyl)-3h-purin-6-one Chemical compound NC1=NC(C(NC(N)=N2)=O)=C2N1CC=1C=COC=1 CDHATTZGGFVACW-UHFFFAOYSA-N 0.000 claims 1
- QHVQPAAULQUWLA-UHFFFAOYSA-N 2,8-diamino-9-(pyridin-3-ylmethyl)-3h-purin-6-one Chemical compound NC1=NC(C(NC(N)=N2)=O)=C2N1CC1=CC=CN=C1 QHVQPAAULQUWLA-UHFFFAOYSA-N 0.000 claims 1
- FYCJQDWFIUYEPL-UHFFFAOYSA-N 2,8-diamino-9-(thiophen-2-ylmethyl)-3h-purin-6-one;hydrochloride Chemical compound Cl.NC1=NC2=C(O)N=C(N)N=C2N1CC1=CC=CS1 FYCJQDWFIUYEPL-UHFFFAOYSA-N 0.000 claims 1
- JQRCKWSHBHMVAU-UHFFFAOYSA-N 2,8-diamino-9-(thiophen-2-ylmethyl)-3h-purine-6-thione Chemical compound NC1=NC(C(NC(N)=N2)=S)=C2N1CC1=CC=CS1 JQRCKWSHBHMVAU-UHFFFAOYSA-N 0.000 claims 1
- AJNMPHPNOVEHBF-UHFFFAOYSA-N 2,8-diamino-9-(thiophen-3-ylmethyl)-3h-purine-6-thione Chemical compound NC1=NC(C(NC(N)=N2)=S)=C2N1CC=1C=CSC=1 AJNMPHPNOVEHBF-UHFFFAOYSA-N 0.000 claims 1
- JWQZLUAXHIVSJP-UHFFFAOYSA-N 2,8-diamino-9-[(2-methylthiophen-3-yl)methyl]-1H-purin-6-one hydrochloride Chemical compound Cl.NC=1N(C=2N=C(NC(C2N1)=O)N)CC1=C(SC=C1)C JWQZLUAXHIVSJP-UHFFFAOYSA-N 0.000 claims 1
- QRSOFZNQULEREN-UHFFFAOYSA-N 2,8-diamino-9-[(2-methylthiophen-3-yl)methyl]-3h-purin-6-one Chemical compound S1C=CC(CN2C3=C(C(NC(N)=N3)=O)N=C2N)=C1C QRSOFZNQULEREN-UHFFFAOYSA-N 0.000 claims 1
- CQZMNUUBBXPLCP-UHFFFAOYSA-N 2,8-diamino-9-[(4-methylthiophen-2-yl)methyl]-3h-purin-6-one Chemical compound CC1=CSC(CN2C3=C(C(NC(N)=N3)=O)N=C2N)=C1 CQZMNUUBBXPLCP-UHFFFAOYSA-N 0.000 claims 1
- ZSPGZPBMVGAGPM-UHFFFAOYSA-N 2,8-diamino-9-[(4-methylthiophen-3-yl)methyl]-3h-purin-6-one Chemical compound CC1=CSC=C1CN1C(N=C(N)NC2=O)=C2N=C1N ZSPGZPBMVGAGPM-UHFFFAOYSA-N 0.000 claims 1
- OOWHLGZDHQKYST-UHFFFAOYSA-N 2,8-diamino-9-[(5-methylfuran-2-yl)methyl]-3h-purin-6-one Chemical compound O1C(C)=CC=C1CN1C(N=C(N)NC2=O)=C2N=C1N OOWHLGZDHQKYST-UHFFFAOYSA-N 0.000 claims 1
- PMMCXQUAEVSGTO-UHFFFAOYSA-N 2,8-diamino-9-[(5-methylthiophen-2-yl)methyl]-3h-purin-6-one Chemical compound S1C(C)=CC=C1CN1C(N=C(N)NC2=O)=C2N=C1N PMMCXQUAEVSGTO-UHFFFAOYSA-N 0.000 claims 1
- CLPIEPMKBBVARB-UHFFFAOYSA-N 2,8-diamino-9-[(5-methylthiophen-3-yl)methyl]-3h-purin-6-one Chemical compound S1C(C)=CC(CN2C3=C(C(NC(N)=N3)=O)N=C2N)=C1 CLPIEPMKBBVARB-UHFFFAOYSA-N 0.000 claims 1
- PREHWLIZVPFWFS-UHFFFAOYSA-N 2-amino-8-bromo-9-(furan-2-ylmethyl)-3h-purin-6-one Chemical compound BrC1=NC=2C(=O)NC(N)=NC=2N1CC1=CC=CO1 PREHWLIZVPFWFS-UHFFFAOYSA-N 0.000 claims 1
- CWQGUURMARPOSM-UHFFFAOYSA-N 2-amino-8-bromo-9-(pyridin-3-ylmethyl)-3h-purin-6-one Chemical compound BrC1=NC=2C(=O)NC(N)=NC=2N1CC1=CC=CN=C1 CWQGUURMARPOSM-UHFFFAOYSA-N 0.000 claims 1
- AHQUKPPEAVWGPM-UHFFFAOYSA-N 2-amino-8-sulfanylidene-9-(thiophen-2-ylmethyl)-3,7-dihydropurin-6-one Chemical compound S=C1NC=2C(=O)NC(N)=NC=2N1CC1=CC=CS1 AHQUKPPEAVWGPM-UHFFFAOYSA-N 0.000 claims 1
- AVGUPPFXTBXGOO-UHFFFAOYSA-N 2-amino-9-(1-benzothiophen-3-ylmethyl)-3h-purin-6-one Chemical compound C1=CC=C2C(CN3C=4N=C(NC(=O)C=4N=C3)N)=CSC2=C1 AVGUPPFXTBXGOO-UHFFFAOYSA-N 0.000 claims 1
- VZDSMYDMHAIMIF-UHFFFAOYSA-N 2-amino-9-(1-benzothiophen-3-ylmethyl)-8-bromo-3h-purin-6-one Chemical compound C1=CC=C2C(CN3C=4N=C(NC(=O)C=4N=C3Br)N)=CSC2=C1 VZDSMYDMHAIMIF-UHFFFAOYSA-N 0.000 claims 1
- ZMKXIOIMNRMMNU-UHFFFAOYSA-N 2-amino-9-(furan-3-ylmethyl)-3h-purin-6-one Chemical compound C1=NC=2C(=O)NC(N)=NC=2N1CC=1C=COC=1 ZMKXIOIMNRMMNU-UHFFFAOYSA-N 0.000 claims 1
- YWDAJVWTHBUPME-UHFFFAOYSA-N 2-amino-9-(pyridin-2-ylmethyl)-3h-purin-6-one Chemical compound C1=NC=2C(=O)NC(N)=NC=2N1CC1=CC=CC=N1 YWDAJVWTHBUPME-UHFFFAOYSA-N 0.000 claims 1
- FWGSCBXLUQAPSJ-UHFFFAOYSA-N 2-amino-9-(pyridin-3-ylmethyl)-3h-purin-6-one Chemical compound C1=NC=2C(=O)NC(N)=NC=2N1CC1=CC=CN=C1 FWGSCBXLUQAPSJ-UHFFFAOYSA-N 0.000 claims 1
- AHAAXBSDIBQKNA-UHFFFAOYSA-N 2-amino-9-(thiophen-2-ylmethyl)-3,7-dihydropurine-6,8-dione Chemical compound O=C1NC=2C(=O)NC(N)=NC=2N1CC1=CC=CS1 AHAAXBSDIBQKNA-UHFFFAOYSA-N 0.000 claims 1
- NZGJOZPYJVYWIX-UHFFFAOYSA-N 2-amino-9-[(2,5-dimethylthiophen-3-yl)methyl]-3h-purin-6-one Chemical compound S1C(C)=CC(CN2C3=C(C(NC(N)=N3)=O)N=C2)=C1C NZGJOZPYJVYWIX-UHFFFAOYSA-N 0.000 claims 1
- CSRIGUNBCXUPSC-UHFFFAOYSA-N 2-amino-9-[(2-methylthiophen-3-yl)methyl]-3h-purin-6-one Chemical compound S1C=CC(CN2C3=C(C(NC(N)=N3)=O)N=C2)=C1C CSRIGUNBCXUPSC-UHFFFAOYSA-N 0.000 claims 1
- DSQAJRAGTMCJAH-UHFFFAOYSA-N 2-amino-9-[(3-methylthiophen-2-yl)methyl]-3h-purin-6-one Chemical compound C1=CSC(CN2C3=C(C(NC(N)=N3)=O)N=C2)=C1C DSQAJRAGTMCJAH-UHFFFAOYSA-N 0.000 claims 1
- JBKGOZGSAOGTMM-UHFFFAOYSA-N 2-amino-9-[(5-ethylthiophen-2-yl)methyl]-3h-purin-6-one Chemical compound S1C(CC)=CC=C1CN1C(N=C(N)NC2=O)=C2N=C1 JBKGOZGSAOGTMM-UHFFFAOYSA-N 0.000 claims 1
- SHOMFRMRWBQGSY-UHFFFAOYSA-N Cl.NC=1N(C=2N=C(NC(C2N1)=O)N)CC1=CSC(=C1)C Chemical compound Cl.NC=1N(C=2N=C(NC(C2N1)=O)N)CC1=CSC(=C1)C SHOMFRMRWBQGSY-UHFFFAOYSA-N 0.000 claims 1
- 239000007868 Raney catalyst Substances 0.000 claims 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 claims 1
- 229910000564 Raney nickel Inorganic materials 0.000 claims 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 claims 1
- 229960000583 acetic acid Drugs 0.000 claims 1
- 230000001476 alcoholic effect Effects 0.000 claims 1
- 229940040526 anhydrous sodium acetate Drugs 0.000 claims 1
- 239000012362 glacial acetic acid Substances 0.000 claims 1
- QZOXGUAYKVINCV-UHFFFAOYSA-N n-[8-acetamido-6-oxo-9-(thiophen-2-ylmethyl)-3h-purin-2-yl]acetamide Chemical compound CC(=O)NC1=NC(C(NC(NC(C)=O)=N2)=O)=C2N1CC1=CC=CS1 QZOXGUAYKVINCV-UHFFFAOYSA-N 0.000 claims 1
- UYTPUPDQBNUYGX-UHFFFAOYSA-N guanine Chemical class O=C1NC(N)=NC2=C1N=CN2 UYTPUPDQBNUYGX-UHFFFAOYSA-N 0.000 abstract description 47
- 208000023275 Autoimmune disease Diseases 0.000 abstract description 5
- 150000003212 purines Chemical class 0.000 abstract description 3
- FDGQSTZJBFJUBT-UHFFFAOYSA-N hypoxanthine Chemical class O=C1NC=NC2=C1NC=N2 FDGQSTZJBFJUBT-UHFFFAOYSA-N 0.000 abstract 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 44
- 125000001072 heteroaryl group Chemical group 0.000 description 42
- 239000000203 mixture Substances 0.000 description 40
- 229910001868 water Inorganic materials 0.000 description 33
- 238000010992 reflux Methods 0.000 description 25
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 24
- 238000006243 chemical reaction Methods 0.000 description 19
- 239000001257 hydrogen Substances 0.000 description 18
- 125000004432 carbon atom Chemical group C* 0.000 description 16
- 239000000047 product Substances 0.000 description 16
- 239000002585 base Substances 0.000 description 15
- 239000000725 suspension Substances 0.000 description 13
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 12
- 239000011541 reaction mixture Substances 0.000 description 12
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 11
- 239000000460 chlorine Substances 0.000 description 11
- 238000002360 preparation method Methods 0.000 description 11
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 10
- 125000003118 aryl group Chemical group 0.000 description 10
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 150000002431 hydrogen Chemical class 0.000 description 9
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 description 8
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 8
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 8
- 238000000746 purification Methods 0.000 description 8
- 238000004809 thin layer chromatography Methods 0.000 description 8
- 125000000217 alkyl group Chemical group 0.000 description 7
- MYWUZJCMWCOHBA-VIFPVBQESA-N methamphetamine Chemical compound CN[C@@H](C)CC1=CC=CC=C1 MYWUZJCMWCOHBA-VIFPVBQESA-N 0.000 description 7
- 239000002244 precipitate Substances 0.000 description 7
- JVBXVOWTABLYPX-UHFFFAOYSA-L sodium dithionite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])=O JVBXVOWTABLYPX-UHFFFAOYSA-L 0.000 description 7
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 7
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- 230000015572 biosynthetic process Effects 0.000 description 6
- 238000009835 boiling Methods 0.000 description 6
- 230000000694 effects Effects 0.000 description 6
- 238000001914 filtration Methods 0.000 description 6
- 150000002500 ions Chemical class 0.000 description 6
- 239000000463 material Substances 0.000 description 6
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 5
- 125000004429 atom Chemical group 0.000 description 5
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 5
- 239000003610 charcoal Substances 0.000 description 5
- 201000010099 disease Diseases 0.000 description 5
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 5
- 239000000543 intermediate Substances 0.000 description 5
- 229910052757 nitrogen Inorganic materials 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 4
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 4
- 239000000538 analytical sample Substances 0.000 description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 4
- 239000002552 dosage form Substances 0.000 description 4
- 239000012458 free base Substances 0.000 description 4
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 4
- 229910000027 potassium carbonate Inorganic materials 0.000 description 4
- 239000000377 silicon dioxide Substances 0.000 description 4
- 238000003786 synthesis reaction Methods 0.000 description 4
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 4
- VBWACOJLJYUFKJ-UHFFFAOYSA-N 2-amino-6-chloro-1h-pyrimidin-4-one Chemical compound NC1=NC(O)=CC(Cl)=N1 VBWACOJLJYUFKJ-UHFFFAOYSA-N 0.000 description 3
- UTTPUMOOQSNOHH-UHFFFAOYSA-N 2-amino-6-chloro-5-nitro-1h-pyrimidin-4-one Chemical compound NC1=NC(=O)C([N+]([O-])=O)=C(Cl)N1 UTTPUMOOQSNOHH-UHFFFAOYSA-N 0.000 description 3
- FLFZMCJIHCDWKG-UHFFFAOYSA-N 2-nitrosopyrimidine Chemical compound O=NC1=NC=CC=N1 FLFZMCJIHCDWKG-UHFFFAOYSA-N 0.000 description 3
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- 229910003204 NH2 Chemical group 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- 239000004480 active ingredient Substances 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 3
- 238000004587 chromatography analysis Methods 0.000 description 3
- 229910052681 coesite Inorganic materials 0.000 description 3
- 239000007822 coupling agent Substances 0.000 description 3
- 229910052906 cristobalite Inorganic materials 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 3
- XMJHPCRAQCTCFT-UHFFFAOYSA-N methyl chloroformate Chemical compound COC(Cl)=O XMJHPCRAQCTCFT-UHFFFAOYSA-N 0.000 description 3
- 125000000018 nitroso group Chemical group N(=O)* 0.000 description 3
- 238000005580 one pot reaction Methods 0.000 description 3
- 150000007530 organic bases Chemical class 0.000 description 3
- 235000011181 potassium carbonates Nutrition 0.000 description 3
- ZNNZYHKDIALBAK-UHFFFAOYSA-M potassium thiocyanate Chemical compound [K+].[S-]C#N ZNNZYHKDIALBAK-UHFFFAOYSA-M 0.000 description 3
- 229940116357 potassium thiocyanate Drugs 0.000 description 3
- 125000006239 protecting group Chemical group 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- 230000009467 reduction Effects 0.000 description 3
- 235000012239 silicon dioxide Nutrition 0.000 description 3
- 235000010288 sodium nitrite Nutrition 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 229910052682 stishovite Inorganic materials 0.000 description 3
- 125000001424 substituent group Chemical group 0.000 description 3
- 229910052717 sulfur Inorganic materials 0.000 description 3
- FKKJJPMGAWGYPN-UHFFFAOYSA-N thiophen-2-ylmethanamine Chemical compound NCC1=CC=CS1 FKKJJPMGAWGYPN-UHFFFAOYSA-N 0.000 description 3
- 150000003585 thioureas Chemical class 0.000 description 3
- 229910052905 tridymite Inorganic materials 0.000 description 3
- 210000002700 urine Anatomy 0.000 description 3
- YKBGVTZYEHREMT-KVQBGUIXSA-N 2'-deoxyguanosine Chemical compound C1=NC=2C(=O)NC(N)=NC=2N1[C@H]1C[C@H](O)[C@@H](CO)O1 YKBGVTZYEHREMT-KVQBGUIXSA-N 0.000 description 2
- YKBGVTZYEHREMT-UHFFFAOYSA-N 2'-deoxyguanosine Natural products C1=2NC(N)=NC(=O)C=2N=CN1C1CC(O)C(CO)O1 YKBGVTZYEHREMT-UHFFFAOYSA-N 0.000 description 2
- YIESXWHNAVYZRL-UHFFFAOYSA-N 2-amino-9-(furan-2-ylmethyl)-3h-purin-6-one Chemical compound C1=2NC(N)=NC(=O)C=2N=CN1CC1=CC=CO1 YIESXWHNAVYZRL-UHFFFAOYSA-N 0.000 description 2
- UQOKRDJILZMZKU-UHFFFAOYSA-N 2-nitropyrimidine Chemical compound [O-][N+](=O)C1=NC=CC=N1 UQOKRDJILZMZKU-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical group C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- 101100134925 Gallus gallus COR6 gene Proteins 0.000 description 2
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- 206010028980 Neoplasm Diseases 0.000 description 2
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 2
- 210000001744 T-lymphocyte Anatomy 0.000 description 2
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 2
- 206010067584 Type 1 diabetes mellitus Diseases 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 201000011510 cancer Diseases 0.000 description 2
- 230000008859 change Effects 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 125000000753 cycloalkyl group Chemical group 0.000 description 2
- 230000001472 cytotoxic effect Effects 0.000 description 2
- VGONTNSXDCQUGY-UHFFFAOYSA-N desoxyinosine Natural products C1C(O)C(CO)OC1N1C(NC=NC2=O)=C2N=C1 VGONTNSXDCQUGY-UHFFFAOYSA-N 0.000 description 2
- 238000005755 formation reaction Methods 0.000 description 2
- DDRPCXLAQZKBJP-UHFFFAOYSA-N furfurylamine Chemical compound NCC1=CC=CO1 DDRPCXLAQZKBJP-UHFFFAOYSA-N 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 125000005842 heteroatom Chemical group 0.000 description 2
- 238000004128 high performance liquid chromatography Methods 0.000 description 2
- 230000028993 immune response Effects 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- 229910017053 inorganic salt Inorganic materials 0.000 description 2
- 229960004592 isopropanol Drugs 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- WCYWZMWISLQXQU-UHFFFAOYSA-N methyl Chemical class [CH3] WCYWZMWISLQXQU-UHFFFAOYSA-N 0.000 description 2
- LBFAAYMITJMZOC-UHFFFAOYSA-N methyl n-(sulfanylidenemethylidene)carbamate Chemical compound COC(=O)N=C=S LBFAAYMITJMZOC-UHFFFAOYSA-N 0.000 description 2
- 201000006417 multiple sclerosis Diseases 0.000 description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 2
- 150000002832 nitroso derivatives Chemical class 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 125000000246 pyrimidin-2-yl group Chemical group [H]C1=NC(*)=NC([H])=C1[H] 0.000 description 2
- 239000000523 sample Substances 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 239000011877 solvent mixture Substances 0.000 description 2
- ILMRJRBKQSSXGY-UHFFFAOYSA-N tert-butyl(dimethyl)silicon Chemical group C[Si](C)C(C)(C)C ILMRJRBKQSSXGY-UHFFFAOYSA-N 0.000 description 2
- FPGGTKZVZWFYPV-UHFFFAOYSA-M tetrabutylammonium fluoride Chemical compound [F-].CCCC[N+](CCCC)(CCCC)CCCC FPGGTKZVZWFYPV-UHFFFAOYSA-M 0.000 description 2
- 229930192474 thiophene Natural products 0.000 description 2
- 238000002054 transplantation Methods 0.000 description 2
- DGVVWUTYPXICAM-UHFFFAOYSA-N β‐Mercaptoethanol Chemical compound OCCS DGVVWUTYPXICAM-UHFFFAOYSA-N 0.000 description 2
- UVCDLICHQNGTDQ-UHFFFAOYSA-N (2-methylthiophen-3-yl)methanamine Chemical compound CC=1SC=CC=1CN UVCDLICHQNGTDQ-UHFFFAOYSA-N 0.000 description 1
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 1
- FZENGILVLUJGJX-NSCUHMNNSA-N (E)-acetaldehyde oxime Chemical compound C\C=N\O FZENGILVLUJGJX-NSCUHMNNSA-N 0.000 description 1
- NSMXQKNUPPXBRG-SECBINFHSA-N (R)-lisofylline Chemical group O=C1N(CCCC[C@H](O)C)C(=O)N(C)C2=C1N(C)C=N2 NSMXQKNUPPXBRG-SECBINFHSA-N 0.000 description 1
- QPLJYAKLSCXZSF-UHFFFAOYSA-N 2,2,2-trichloroethyl carbamate Chemical compound NC(=O)OCC(Cl)(Cl)Cl QPLJYAKLSCXZSF-UHFFFAOYSA-N 0.000 description 1
- DPDYTYOWSIRPMB-UHFFFAOYSA-N 2,8-diamino-9-benzyl-3h-purin-6-one Chemical compound NC1=NC(C(N=C(N)N2)=O)=C2N1CC1=CC=CC=C1 DPDYTYOWSIRPMB-UHFFFAOYSA-N 0.000 description 1
- GANBJDIOIDQSGI-UHFFFAOYSA-N 2-(chloromethyl)furan Chemical compound ClCC1=CC=CO1 GANBJDIOIDQSGI-UHFFFAOYSA-N 0.000 description 1
- IZBLFZXCXYDKRW-UHFFFAOYSA-N 2-amino-3,7-dihydropurin-6-one;7h-purine Chemical compound C1=NC=C2NC=NC2=N1.N1C(N)=NC(=O)C2=C1N=CN2 IZBLFZXCXYDKRW-UHFFFAOYSA-N 0.000 description 1
- IQHSSYROJYPFDV-UHFFFAOYSA-N 2-bromo-1,3-dichloro-5-(trifluoromethyl)benzene Chemical group FC(F)(F)C1=CC(Cl)=C(Br)C(Cl)=C1 IQHSSYROJYPFDV-UHFFFAOYSA-N 0.000 description 1
- JBMBVWROWJGFMG-UHFFFAOYSA-N 2-chloro-7h-purine Chemical class ClC1=NC=C2NC=NC2=N1 JBMBVWROWJGFMG-UHFFFAOYSA-N 0.000 description 1
- OANLWIQYRRVBPY-UHFFFAOYSA-N 2-thiophen-3-ylethanamine Chemical compound NCCC=1C=CSC=1 OANLWIQYRRVBPY-UHFFFAOYSA-N 0.000 description 1
- KTESLEPUDPKBQS-UHFFFAOYSA-N 3-(chloromethyl)-2,5-dimethylthiophene Chemical compound CC1=CC(CCl)=C(C)S1 KTESLEPUDPKBQS-UHFFFAOYSA-N 0.000 description 1
- YZFUAIWTNMWSEP-UHFFFAOYSA-N 5-nitrosopyrimidine Chemical compound O=NC1=CN=CN=C1 YZFUAIWTNMWSEP-UHFFFAOYSA-N 0.000 description 1
- RYYIULNRIVUMTQ-UHFFFAOYSA-N 6-chloroguanine Chemical compound NC1=NC(Cl)=C2N=CNC2=N1 RYYIULNRIVUMTQ-UHFFFAOYSA-N 0.000 description 1
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 241000972773 Aulopiformes Species 0.000 description 1
- 241000566113 Branta sandvicensis Species 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 102100040999 Catechol O-methyltransferase Human genes 0.000 description 1
- 108020002739 Catechol O-methyltransferase Proteins 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- 241000982822 Ficus obtusifolia Species 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 238000005642 Gabriel synthesis reaction Methods 0.000 description 1
- 229910004373 HOAc Inorganic materials 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 208000022559 Inflammatory bowel disease Diseases 0.000 description 1
- 229930010555 Inosine Natural products 0.000 description 1
- UGQMRVRMYYASKQ-KQYNXXCUSA-N Inosine Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C2=NC=NC(O)=C2N=C1 UGQMRVRMYYASKQ-KQYNXXCUSA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- KDXKERNSBIXSRK-UHFFFAOYSA-N Lysine Natural products NCCCCC(N)C(O)=O KDXKERNSBIXSRK-UHFFFAOYSA-N 0.000 description 1
- 239000004472 Lysine Substances 0.000 description 1
- MBBZMMPHUWSWHV-BDVNFPICSA-N N-methylglucamine Chemical compound CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO MBBZMMPHUWSWHV-BDVNFPICSA-N 0.000 description 1
- 229910017974 NH40H Inorganic materials 0.000 description 1
- 241001602876 Nata Species 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-N Nitrous acid Chemical compound ON=O IOVCWXUNBOPUCH-UHFFFAOYSA-N 0.000 description 1
- 241000669618 Nothes Species 0.000 description 1
- 235000019483 Peanut oil Nutrition 0.000 description 1
- YNPNZTXNASCQKK-UHFFFAOYSA-N Phenanthrene Natural products C1=CC=C2C3=CC=CC=C3C=CC2=C1 YNPNZTXNASCQKK-UHFFFAOYSA-N 0.000 description 1
- 101710101148 Probable 6-oxopurine nucleoside phosphorylase Proteins 0.000 description 1
- 102000030764 Purine-nucleoside phosphorylase Human genes 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 208000036142 Viral infection Diseases 0.000 description 1
- DGEZNRSVGBDHLK-UHFFFAOYSA-N [1,10]phenanthroline Chemical compound C1=CN=C2C3=NC=CC=C3C=CC2=C1 DGEZNRSVGBDHLK-UHFFFAOYSA-N 0.000 description 1
- KPCZJLGGXRGYIE-UHFFFAOYSA-N [C]1=CC=CN=C1 Chemical group [C]1=CC=CN=C1 KPCZJLGGXRGYIE-UHFFFAOYSA-N 0.000 description 1
- 230000002159 abnormal effect Effects 0.000 description 1
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 1
- MDFFNEOEWAXZRQ-UHFFFAOYSA-N aminyl Chemical group [NH2] MDFFNEOEWAXZRQ-UHFFFAOYSA-N 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 239000011260 aqueous acid Substances 0.000 description 1
- 150000003975 aryl alkyl amines Chemical class 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 210000003719 b-lymphocyte Anatomy 0.000 description 1
- 125000005605 benzo group Chemical group 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 125000006367 bivalent amino carbonyl group Chemical group [H]N([*:1])C([*:2])=O 0.000 description 1
- 102200084471 c.4C>T Human genes 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000005587 carbonate group Chemical group 0.000 description 1
- FULSCKQLKRBVJV-UHFFFAOYSA-N carbonyl diisothiocyanate Chemical compound S=C=NC(=O)N=C=S FULSCKQLKRBVJV-UHFFFAOYSA-N 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 238000012512 characterization method Methods 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- DOBRDRYODQBAMW-UHFFFAOYSA-N copper(i) cyanide Chemical compound [Cu+].N#[C-] DOBRDRYODQBAMW-UHFFFAOYSA-N 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 231100000433 cytotoxic Toxicity 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 238000001952 enzyme assay Methods 0.000 description 1
- 210000003743 erythrocyte Anatomy 0.000 description 1
- DFYIGRMVKIBMAE-UHFFFAOYSA-N ethenoxycarbamic acid Chemical compound OC(=O)NOC=C DFYIGRMVKIBMAE-UHFFFAOYSA-N 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 125000005448 ethoxyethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- NKKLCOFTJVNYAQ-UHFFFAOYSA-N formamidopyrimidine Chemical compound O=CNC1=CN=CN=C1 NKKLCOFTJVNYAQ-UHFFFAOYSA-N 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 125000004446 heteroarylalkyl group Chemical group 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 1
- 125000001145 hydrido group Chemical group *[H] 0.000 description 1
- 125000001183 hydrocarbyl group Chemical group 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 230000007365 immunoregulation Effects 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 229910052738 indium Inorganic materials 0.000 description 1
- 230000002757 inflammatory effect Effects 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 229960003786 inosine Drugs 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 150000002540 isothiocyanates Chemical class 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 206010025135 lupus erythematosus Diseases 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- NIQQIJXGUZVEBB-UHFFFAOYSA-N methanol;propan-2-one Chemical compound OC.CC(C)=O NIQQIJXGUZVEBB-UHFFFAOYSA-N 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 150000003956 methylamines Chemical class 0.000 description 1
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000000312 peanut oil Substances 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 235000015320 potassium carbonate Nutrition 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 235000013772 propylene glycol Nutrition 0.000 description 1
- HDOUGSFASVGDCS-UHFFFAOYSA-N pyridin-3-ylmethanamine Chemical compound NCC1=CC=CN=C1 HDOUGSFASVGDCS-UHFFFAOYSA-N 0.000 description 1
- TXQWFIVRZNOPCK-UHFFFAOYSA-N pyridin-4-ylmethanamine Chemical class NCC1=CC=NC=C1 TXQWFIVRZNOPCK-UHFFFAOYSA-N 0.000 description 1
- 150000003230 pyrimidines Chemical class 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 230000008707 rearrangement Effects 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 206010039073 rheumatoid arthritis Diseases 0.000 description 1
- 238000006798 ring closing metathesis reaction Methods 0.000 description 1
- 238000007142 ring opening reaction Methods 0.000 description 1
- 235000019515 salmon Nutrition 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000008159 sesame oil Substances 0.000 description 1
- 235000011803 sesame oil Nutrition 0.000 description 1
- 235000020374 simple syrup Nutrition 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- PXQLVRUNWNTZOS-UHFFFAOYSA-N sulfanyl Chemical group [SH] PXQLVRUNWNTZOS-UHFFFAOYSA-N 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 201000000596 systemic lupus erythematosus Diseases 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- HJXJNSKEOFNHCU-UHFFFAOYSA-N thiohypobromous acid Chemical group BrS HJXJNSKEOFNHCU-UHFFFAOYSA-N 0.000 description 1
- DUDAKCCDHRNMDJ-UHFFFAOYSA-N thiophen-3-ylmethanamine Chemical compound NCC=1C=CSC=1 DUDAKCCDHRNMDJ-UHFFFAOYSA-N 0.000 description 1
- 150000003577 thiophenes Chemical class 0.000 description 1
- 125000000464 thioxo group Chemical group S=* 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 125000004665 trialkylsilyl group Chemical group 0.000 description 1
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 125000005289 uranyl group Chemical group 0.000 description 1
- 239000003981 vehicle Substances 0.000 description 1
- 230000009385 viral infection Effects 0.000 description 1
- 230000003612 virological effect Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D473/00—Heterocyclic compounds containing purine ring systems
- C07D473/02—Heterocyclic compounds containing purine ring systems with oxygen, sulphur, or nitrogen atoms directly attached in positions 2 and 6
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D473/00—Heterocyclic compounds containing purine ring systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/12—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings
- C07D409/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings linked by a chain containing hetero atoms as chain links
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CA000552544A CA1289138C (en) | 1984-10-12 | 1987-11-23 | Intermediates for purine derivatives |
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US66015284A | 1984-10-12 | 1984-10-12 | |
| US660,152 | 1984-10-12 | ||
| US767,202 | 1985-08-22 | ||
| US06/767,202 US4772606A (en) | 1985-08-22 | 1985-08-22 | Purine derivatives |
Related Child Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000552544A Division CA1289138C (en) | 1984-10-12 | 1987-11-23 | Intermediates for purine derivatives |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1260934A true CA1260934A (en) | 1989-09-26 |
Family
ID=27097992
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000492727A Expired CA1260934A (en) | 1984-10-12 | 1985-10-10 | Purine derivatives |
Country Status (15)
| Country | Link |
|---|---|
| EP (1) | EP0178178A3 (enExample) |
| KR (1) | KR860003255A (enExample) |
| AU (1) | AU584126B2 (enExample) |
| CA (1) | CA1260934A (enExample) |
| DK (1) | DK458485A (enExample) |
| ES (2) | ES8609328A1 (enExample) |
| FI (1) | FI853891L (enExample) |
| GR (1) | GR852468B (enExample) |
| HU (1) | HU197747B (enExample) |
| IL (1) | IL76546A (enExample) |
| NO (1) | NO854050L (enExample) |
| NZ (1) | NZ213798A (enExample) |
| OA (1) | OA08120A (enExample) |
| PH (1) | PH22811A (enExample) |
| PT (1) | PT81293B (enExample) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NZ228645A (en) * | 1988-04-11 | 1991-09-25 | Iaf Biochem Int | 1,3-dioxolane derivatives substituted in the 5th position by a purine or pyrimidine radical; treatment of viral infections |
| JP2760364B2 (ja) * | 1989-02-27 | 1998-05-28 | バイオクライシス・ファーマシューティカルズ、インコーポレイテッド | 9―置換―8―非置換―9―デアザグアニン類 |
| US4939252A (en) * | 1989-04-20 | 1990-07-03 | Hoffmann-La Roche Inc. | Novel intermediates for the preparation of Carbovir |
| IL94390A (en) * | 1989-05-30 | 1996-03-31 | Merck & Co Inc | The 6-membered trans-nitrogen-containing heterocycles are compressed with imidazo and pharmaceutical preparations containing them |
| US5272169A (en) * | 1992-03-27 | 1993-12-21 | The Dupont Merck Pharmaceutical Company | (N-benzyl) acetaldehyde bicyclic heterocycles useful as topical antiinflammatories |
| US5217983A (en) * | 1992-03-27 | 1993-06-08 | Du Pont Merck Pharmaceutical Company | (N-benzyl) acetaldehyde bicyclic heterocycles useful as topical antiinflammatories |
| HUT77436A (hu) * | 1994-10-05 | 1998-04-28 | Darwin Discovery Limited | Purin- és guaninszármazékok, eljárás előállításukra, ezeket tartalmazó gyógyszerkészítmények és alkalmazásuk gyógyszerkészítmények előállítására |
| DE19501482A1 (de) * | 1995-01-19 | 1996-07-25 | Bayer Ag | 2,9-disubstituierte Purin-6-one |
| GB9520364D0 (en) * | 1995-10-05 | 1995-12-06 | Chiroscience Ltd | Compouundds |
| GB9520363D0 (en) * | 1995-10-05 | 1995-12-06 | Chiroscience Ltd | Compounds |
| DE19541264A1 (de) * | 1995-11-06 | 1997-05-07 | Bayer Ag | Purin-6-on-derivate |
| EP2336133A1 (en) | 2001-10-30 | 2011-06-22 | Conforma Therapeutics Corporation | Purine analogs having HSP90-inhibiting activity |
| EP2145888A1 (en) | 2003-09-18 | 2010-01-20 | Conforma Therapeutics Corporation | Deazapurine derivatives as HSP90-Inhibitors |
| BRPI0609509A2 (pt) * | 2005-03-30 | 2010-04-13 | Conforma Therapeutics Corp | composto ou um polimorfo, solvato, tautÈmero, enanciÈmero, pró-droga ou sal farmaceuticamente aceitável do mesmo, composição farmacêutica, e, uso do composto, polimorfo, solvato, tautÈmero, enanciÈmero, pró-droga ou sal farmaceuticamente aceitável |
| WO2013066729A1 (en) * | 2011-10-31 | 2013-05-10 | Merck Sharp & Dohme Corp. | Aminopyrimidinones as interleukin receptor-associated kinase inhibitors |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2844578A (en) * | 1955-09-14 | 1958-07-22 | Du Pont | Pyrimidine derivatives |
-
1985
- 1985-10-02 IL IL76546A patent/IL76546A/xx unknown
- 1985-10-04 AU AU48292/85A patent/AU584126B2/en not_active Ceased
- 1985-10-07 FI FI853891A patent/FI853891L/fi not_active Application Discontinuation
- 1985-10-08 DK DK458485A patent/DK458485A/da not_active Application Discontinuation
- 1985-10-10 PH PH32916A patent/PH22811A/en unknown
- 1985-10-10 CA CA000492727A patent/CA1260934A/en not_active Expired
- 1985-10-11 NO NO854050A patent/NO854050L/no unknown
- 1985-10-11 ES ES547805A patent/ES8609328A1/es not_active Expired
- 1985-10-11 GR GR852468A patent/GR852468B/el unknown
- 1985-10-11 HU HU853956A patent/HU197747B/hu not_active IP Right Cessation
- 1985-10-11 NZ NZ213798A patent/NZ213798A/xx unknown
- 1985-10-11 OA OA58702A patent/OA08120A/xx unknown
- 1985-10-11 PT PT81293A patent/PT81293B/pt not_active IP Right Cessation
- 1985-10-11 EP EP85307283A patent/EP0178178A3/en not_active Withdrawn
- 1985-10-12 KR KR1019850007507A patent/KR860003255A/ko not_active Abandoned
-
1986
- 1986-04-01 ES ES553606A patent/ES8801273A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| ES547805A0 (es) | 1986-09-01 |
| IL76546A0 (en) | 1986-02-28 |
| KR860003255A (ko) | 1986-05-21 |
| FI853891A0 (fi) | 1985-10-07 |
| PT81293B (pt) | 1988-02-17 |
| IL76546A (en) | 1988-12-30 |
| OA08120A (fr) | 1987-03-31 |
| ES8801273A1 (es) | 1987-12-16 |
| GR852468B (enExample) | 1986-02-12 |
| HU197747B (en) | 1989-05-29 |
| FI853891A7 (fi) | 1986-04-13 |
| EP0178178A3 (en) | 1987-08-12 |
| AU4829285A (en) | 1986-04-17 |
| AU584126B2 (en) | 1989-05-18 |
| ES8609328A1 (es) | 1986-09-01 |
| FI853891L (fi) | 1986-04-13 |
| NZ213798A (en) | 1989-01-06 |
| EP0178178A2 (en) | 1986-04-16 |
| DK458485D0 (da) | 1985-10-08 |
| DK458485A (da) | 1986-04-13 |
| ES553606A0 (es) | 1987-12-16 |
| NO854050L (no) | 1986-04-14 |
| HUT40131A (en) | 1986-11-28 |
| PT81293A (en) | 1985-11-01 |
| PH22811A (en) | 1988-12-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4772606A (en) | Purine derivatives | |
| CA1260934A (en) | Purine derivatives | |
| US4923872A (en) | Analogues of pyrrolo[3,2d]pyrimidin-4-ones | |
| DE60101158T2 (de) | 8-chinolinxanthin and 8-isochinolinxanthin derivate als pde 5 inhibitoren | |
| CA1062257A (en) | Purine compounds and salts thereof | |
| CA2752269C (en) | Novel triazine derivative and pharmaceutical composition comprising the same | |
| FI88163C (fi) | Foerfarande foer framstaellning av farmaceutiskt anvaendbara pyrazolo/3,4-d/pyrimidiner | |
| US20040254183A1 (en) | Pyrazolo[3,4-d]pyrimidines inhibiting h. pylori infections | |
| JP2010511727A5 (enExample) | ||
| JP2010511727A (ja) | アデノシン受容体アンタゴニストとしての置換ピリミジン | |
| CA1320203C (en) | Intermediates for 9-deazaguanines | |
| KR100745307B1 (ko) | 아미노퀴놀린 유도체 및 아데노신 a3 리간드로서의 이의 용도 | |
| US4952693A (en) | Oxazolo-pyrimidine derivatives | |
| HU217870B (hu) | 9-Szubsztituált-9-dezaza-guanin-származékok, ezeket tartalmazó gyógyászati készítmények, és eljárás ezek előállítására | |
| US4921858A (en) | 7-deazaguanines as immunomodulators | |
| US5002950A (en) | 7-deazaguanines as immunomodulators | |
| CA1294960C (en) | 7-deazaguanines as immunomodulators | |
| US4988702A (en) | Novel 9-deazaguanines | |
| EP1515972A1 (en) | Amide substituted xanthine derivatives with gluconeogenesis modulating activity | |
| Hirota et al. | Synthesis and biological evaluation of 2, 8-disubstituted 9-benzyladenines: discovery of 8-mercaptoadenines as potent interferon-inducers | |
| US5281708A (en) | 9-Substituted-8-halo or -8-hydroxy-9-deazaguanines as inhibitors of PNP | |
| CA1289138C (en) | Intermediates for purine derivatives | |
| JPS61137886A (ja) | プリン誘導体 | |
| US5061707A (en) | 9-deazaguanines to treat psoriasis | |
| US5051429A (en) | "Pyrimidine derivatives" |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |