CA1233481A - Preparation of alkali metal and alkaline earth metal salts of acyloxybenzenesulfonic acids - Google Patents
Preparation of alkali metal and alkaline earth metal salts of acyloxybenzenesulfonic acidsInfo
- Publication number
- CA1233481A CA1233481A CA000465665A CA465665A CA1233481A CA 1233481 A CA1233481 A CA 1233481A CA 000465665 A CA000465665 A CA 000465665A CA 465665 A CA465665 A CA 465665A CA 1233481 A CA1233481 A CA 1233481A
- Authority
- CA
- Canada
- Prior art keywords
- acid
- alkaline earth
- alkali metal
- earth metal
- neutralization
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000002253 acid Substances 0.000 title claims abstract description 30
- 150000003839 salts Chemical class 0.000 title claims abstract description 16
- 150000001340 alkali metals Chemical class 0.000 title claims abstract description 11
- 229910052783 alkali metal Inorganic materials 0.000 title claims abstract description 8
- 229910052784 alkaline earth metal Chemical class 0.000 title claims abstract description 8
- 238000002360 preparation method Methods 0.000 title claims description 6
- 150000007513 acids Chemical class 0.000 title abstract description 13
- 150000001342 alkaline earth metals Chemical class 0.000 title 1
- 238000000034 method Methods 0.000 claims abstract description 20
- -1 alkaline earth metal salts Chemical class 0.000 claims abstract description 16
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims abstract description 16
- 239000007864 aqueous solution Substances 0.000 claims abstract description 12
- 238000006386 neutralization reaction Methods 0.000 claims abstract description 12
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 6
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 claims abstract description 5
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 claims abstract description 4
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 claims abstract description 4
- 238000002156 mixing Methods 0.000 claims abstract description 4
- 229920006395 saturated elastomer Polymers 0.000 claims abstract description 4
- 229910000272 alkali metal oxide Inorganic materials 0.000 claims abstract description 3
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 3
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 3
- 150000002367 halogens Chemical class 0.000 claims abstract description 3
- 239000007788 liquid Substances 0.000 claims abstract description 3
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims abstract description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims abstract description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 3
- 235000013350 formula milk Nutrition 0.000 claims description 7
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 claims description 4
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 claims description 4
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 claims description 3
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 claims description 3
- 239000011976 maleic acid Substances 0.000 claims description 3
- OJMIONKXNSYLSR-UHFFFAOYSA-N phosphorous acid Chemical compound OP(O)O OJMIONKXNSYLSR-UHFFFAOYSA-N 0.000 claims description 3
- 229940095064 tartrate Drugs 0.000 claims description 3
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 claims description 3
- 229910019142 PO4 Inorganic materials 0.000 claims description 2
- 239000008139 complexing agent Substances 0.000 claims description 2
- 229910001385 heavy metal Inorganic materials 0.000 claims description 2
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 claims description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 claims description 2
- 239000010452 phosphate Substances 0.000 claims description 2
- 229920000642 polymer Polymers 0.000 claims description 2
- 229940092714 benzenesulfonic acid Drugs 0.000 abstract 1
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 15
- 239000000243 solution Substances 0.000 description 15
- 159000000000 sodium salts Chemical class 0.000 description 8
- 238000001694 spray drying Methods 0.000 description 6
- 239000003795 chemical substances by application Substances 0.000 description 5
- 230000007062 hydrolysis Effects 0.000 description 5
- 238000006460 hydrolysis reaction Methods 0.000 description 5
- 229910000403 monosodium phosphate Inorganic materials 0.000 description 5
- 235000019799 monosodium phosphate Nutrition 0.000 description 5
- AJPJDKMHJJGVTQ-UHFFFAOYSA-M sodium dihydrogen phosphate Chemical compound [Na+].OP(O)([O-])=O AJPJDKMHJJGVTQ-UHFFFAOYSA-M 0.000 description 5
- 229940083608 sodium hydroxide Drugs 0.000 description 5
- 235000011121 sodium hydroxide Nutrition 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- 239000012736 aqueous medium Substances 0.000 description 3
- 230000000052 comparative effect Effects 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- TWDUKWCXYKWSKZ-UHFFFAOYSA-N 2-(7-methyloctanoyloxy)benzenesulfonic acid Chemical compound CC(C)CCCCCC(=O)OC1=CC=CC=C1S(O)(=O)=O TWDUKWCXYKWSKZ-UHFFFAOYSA-N 0.000 description 2
- URDCARMUOSMFFI-UHFFFAOYSA-N 2-[2-[bis(carboxymethyl)amino]ethyl-(2-hydroxyethyl)amino]acetic acid Chemical compound OCCN(CC(O)=O)CCN(CC(O)=O)CC(O)=O URDCARMUOSMFFI-UHFFFAOYSA-N 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- 229940077388 benzenesulfonate Drugs 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 239000000306 component Substances 0.000 description 2
- 239000003599 detergent Substances 0.000 description 2
- 235000019524 disodium tartrate Nutrition 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- 239000011630 iodine Substances 0.000 description 2
- 229940098895 maleic acid Drugs 0.000 description 2
- 229940044652 phenolsulfonate Drugs 0.000 description 2
- ACVYVLVWPXVTIT-UHFFFAOYSA-N phosphinic acid Chemical compound O[PH2]=O ACVYVLVWPXVTIT-UHFFFAOYSA-N 0.000 description 2
- HELHAJAZNSDZJO-OLXYHTOASA-L sodium L-tartrate Chemical compound [Na+].[Na+].[O-]C(=O)[C@H](O)[C@@H](O)C([O-])=O HELHAJAZNSDZJO-OLXYHTOASA-L 0.000 description 2
- 239000001433 sodium tartrate Substances 0.000 description 2
- WHOZNOZYMBRCBL-OUKQBFOZSA-N (2E)-2-Tetradecenal Chemical compound CCCCCCCCCCC\C=C\C=O WHOZNOZYMBRCBL-OUKQBFOZSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- PCWITQSPDHVTKN-UHFFFAOYSA-N 4-acetyloxybenzenesulfonic acid Chemical class CC(=O)OC1=CC=C(S(O)(=O)=O)C=C1 PCWITQSPDHVTKN-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical class S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 1
- 241000282326 Felis catus Species 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 229920000388 Polyphosphate Polymers 0.000 description 1
- YDONNITUKPKTIG-UHFFFAOYSA-N [Nitrilotris(methylene)]trisphosphonic acid Chemical compound OP(O)(=O)CN(CP(O)(O)=O)CP(O)(O)=O YDONNITUKPKTIG-UHFFFAOYSA-N 0.000 description 1
- MOOSBPSAZDOBSN-UHFFFAOYSA-N acetic acid;azane Chemical compound N.CC(O)=O.CC(O)=O.CC(O)=O.CC(O)=O.CC(O)=O MOOSBPSAZDOBSN-UHFFFAOYSA-N 0.000 description 1
- 229940022682 acetone Drugs 0.000 description 1
- 239000012190 activator Substances 0.000 description 1
- 150000003855 acyl compounds Chemical class 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000007844 bleaching agent Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- MCWXGJITAZMZEV-UHFFFAOYSA-N dimethoate Chemical compound CNC(=O)CSP(=S)(OC)OC MCWXGJITAZMZEV-UHFFFAOYSA-N 0.000 description 1
- 238000002845 discoloration Methods 0.000 description 1
- 238000002036 drum drying Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000004108 freeze drying Methods 0.000 description 1
- 238000007429 general method Methods 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 125000003136 n-heptyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- MGFYIUFZLHCRTH-UHFFFAOYSA-N nitrilotriacetic acid Chemical compound OC(=O)CN(CC(O)=O)CC(O)=O MGFYIUFZLHCRTH-UHFFFAOYSA-N 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 229940044654 phenolsulfonic acid Drugs 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 239000001205 polyphosphate Substances 0.000 description 1
- 235000011176 polyphosphates Nutrition 0.000 description 1
- 239000003586 protic polar solvent Substances 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- 235000015424 sodium Nutrition 0.000 description 1
- 229940087596 sodium phenolsulfonate Drugs 0.000 description 1
- NKAAEMMYHLFEFN-ZVGUSBNCSA-M sodium;(2r,3r)-2,3,4-trihydroxy-4-oxobutanoate Chemical compound [Na+].OC(=O)[C@H](O)[C@@H](O)C([O-])=O NKAAEMMYHLFEFN-ZVGUSBNCSA-M 0.000 description 1
- BLXAGSNYHSQSRC-UHFFFAOYSA-M sodium;2-hydroxybenzenesulfonate Chemical compound [Na+].OC1=CC=CC=C1S([O-])(=O)=O BLXAGSNYHSQSRC-UHFFFAOYSA-M 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 230000003068 static effect Effects 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 150000003871 sulfonates Chemical class 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 238000004448 titration Methods 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 238000005809 transesterification reaction Methods 0.000 description 1
- SOBHUZYZLFQYFK-UHFFFAOYSA-K trisodium;hydroxy-[[phosphonatomethyl(phosphonomethyl)amino]methyl]phosphinate Chemical compound [Na+].[Na+].[Na+].OP(O)(=O)CN(CP(O)([O-])=O)CP([O-])([O-])=O SOBHUZYZLFQYFK-UHFFFAOYSA-K 0.000 description 1
- 125000002948 undecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C309/00—Sulfonic acids; Halides, esters, or anhydrides thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Detergent Compositions (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEP3337921.1 | 1983-10-19 | ||
| DE19833337921 DE3337921A1 (de) | 1983-10-19 | 1983-10-19 | Verfahren zur herstellung von alkali- und erdalkalisalzen von acyloxibenzolfulfonsaeuren |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1233481A true CA1233481A (en) | 1988-03-01 |
Family
ID=6212171
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000465665A Expired CA1233481A (en) | 1983-10-19 | 1984-10-17 | Preparation of alkali metal and alkaline earth metal salts of acyloxybenzenesulfonic acids |
Country Status (7)
| Country | Link |
|---|---|
| US (2) | US4588531A (enExample) |
| EP (1) | EP0140251B2 (enExample) |
| JP (1) | JPS60104056A (enExample) |
| AT (1) | ATE20344T1 (enExample) |
| CA (1) | CA1233481A (enExample) |
| DE (2) | DE3337921A1 (enExample) |
| ES (1) | ES8506268A1 (enExample) |
Families Citing this family (38)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4692279A (en) * | 1985-04-15 | 1987-09-08 | Stepan Company | Preparation of acyloxy benzene sulfonate |
| DE3524052A1 (de) * | 1985-07-05 | 1987-01-08 | Hoechst Ag | Verfahren zur herstellung von acyloxybenzolsulfonsaeuren und deren salzen |
| GB8523962D0 (en) * | 1985-09-28 | 1985-10-30 | Interox Chemicals Ltd | Preparation of sulphophenyl esters |
| DE3538143A1 (de) * | 1985-10-26 | 1987-04-30 | Hoechst Ag | Verfahren zur herstellung von acyloxibenzolsulfonsaeuren und deren salzen |
| GB8531392D0 (en) * | 1985-12-20 | 1986-02-05 | Unilever Plc | Sulphonated aromated esters |
| US4735740A (en) * | 1986-10-03 | 1988-04-05 | The Clorox Company | Diperoxyacid precursors and method |
| US5050330A (en) * | 1990-05-17 | 1991-09-24 | Pilgrim Archery Products, Inc. | Gun rest |
| US5153341A (en) * | 1991-03-25 | 1992-10-06 | E. I. Du Pont De Nemours And Company | Process for preparing benzenesulfonate salts |
| SK278834B6 (sk) * | 1992-01-17 | 1998-03-04 | Unilever Nv | Časticová bieliaca detergentná zmes |
| SK278833B6 (sk) * | 1992-01-17 | 1998-03-04 | Unilever Nv | Časticová bieliaca detergentná zmes |
| US5850086A (en) * | 1996-06-21 | 1998-12-15 | Regents Of The University Of Minnesota | Iron complexes for bleach activation and stereospecific oxidation |
| DE19956862A1 (de) * | 1999-11-25 | 2001-06-21 | Axiva Gmbh | Verfahren zur Gewinnung und Reinigung substituierter Benzolsulfonate |
| GB0011527D0 (en) | 2000-05-12 | 2000-06-28 | Unilever Plc | Bleach catalyst and composition and method for bleaching a substrate |
| CA2439524A1 (en) | 2001-03-14 | 2002-09-19 | Unilever Plc | Bleaching catalysts with unsaturated surfactant and antioxidants |
| GB0106285D0 (en) | 2001-03-14 | 2001-05-02 | Unilever Plc | Air bleaching catalysts with moderating agent |
| GB0205276D0 (en) * | 2002-03-06 | 2002-04-17 | Unilever Plc | Bleaching composition |
| US6790981B2 (en) | 2002-12-13 | 2004-09-14 | Clariant Finance (Bvi) Limited | Process for the preparation of acyloxybenzenesulfonates |
| DE102007026216A1 (de) * | 2007-06-05 | 2008-12-11 | Clariant International Ltd. | Feste Partikel von hydrophoben Bleichaktivatoren |
| DE102008013606A1 (de) * | 2008-03-11 | 2009-09-17 | Clariant International Ltd. | Verfahren zur Herstellung fester Erdalkalimetallsalze sekundärer Paraffinsulfonsäuren |
| KR101591543B1 (ko) | 2008-04-09 | 2016-02-03 | 바스프 에스이 | 금속 히드라지드 착체 화합물의 산화 촉매로서의 용도 |
| BR112012032820A2 (pt) | 2010-06-28 | 2016-11-08 | Basf Se | uso de uma composição, composição, processo para o alvejamento de manchas ou de sujeira sobre materiais têxteis ou pratos, composição detergentes, de limpeza ou de alvejamento, grânulo, e,composto da fórmula |
| WO2012080088A1 (en) | 2010-12-13 | 2012-06-21 | Basf Se | Bleach catalysts |
| WO2017076771A1 (en) | 2015-11-03 | 2017-05-11 | Basf Se | Bleach catalysts |
| EP3176157A1 (en) | 2015-12-01 | 2017-06-07 | Basf Se | Bleach catalysts |
| WO2017182295A1 (en) | 2016-04-18 | 2017-10-26 | Basf Se | Liquid cleaning compositions |
| WO2017186480A1 (en) | 2016-04-26 | 2017-11-02 | Basf Se | Metal free bleaching composition |
| EP3372663A1 (en) | 2017-03-10 | 2018-09-12 | Basf Se | Bleach catalysts |
| WO2024175409A1 (en) | 2023-02-21 | 2024-08-29 | Basf Se | Modified hyperbranched alkoxylated polyalkylene imines |
| WO2024175407A1 (en) | 2023-02-21 | 2024-08-29 | Basf Se | Modified alkoxylated polyalkylene imines or modified alkoxylated polyamines |
| JP2026506171A (ja) | 2023-02-21 | 2026-02-20 | ビーエーエスエフ ソシエタス・ヨーロピア | 変性アルコキシル化ポリアルキレンイミン又は変性アルコキシル化ポリアミン |
| EP4680658A1 (en) | 2023-03-13 | 2026-01-21 | Basf Se | Alkoxylated nitrogen containing polymers and their use |
| WO2024231110A1 (en) | 2023-05-05 | 2024-11-14 | Basf Se | Biodegradable polyol propoxylates, their preparation, uses, and compositions comprising them |
| MX2025014975A (es) | 2023-06-13 | 2026-02-03 | Basf Se | Composiciones de limpieza estabilizadas que comprenden edds y enzimas y su uso |
| WO2025125117A1 (en) | 2023-12-15 | 2025-06-19 | Basf Se | Biodegradable propoxylated ethylenediamines, their preparation, uses, and compositions comprising them |
| WO2025131888A1 (en) | 2023-12-19 | 2025-06-26 | Basf Se | Modified alkoxylated polyalkylene imines or modified alkoxylated polyamines |
| WO2025180874A1 (en) | 2024-02-27 | 2025-09-04 | Basf Se | Substituted 1,3-dioxolane sulfates and their use |
| WO2025195856A1 (en) | 2024-03-19 | 2025-09-25 | Basf Se | Compositions of guerbet alkyl sulfates and their use |
| WO2025202032A1 (en) | 2024-03-26 | 2025-10-02 | Basf Se | Biodegradable alkoxylated polyols, their preparation, uses, and compositions comprising them |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE859451C (de) * | 1943-09-21 | 1952-12-15 | Boehme Fettchemie G M B H | Verfahren zur Neutralisation von Sulfonierungsprodukten |
| US2716126A (en) * | 1950-05-27 | 1955-08-23 | Petrolite Corp | Certain ester acids and certain ester salts of sulfoaromatic fatty acids, and method of making same |
| GB864798A (en) * | 1958-03-20 | 1961-04-06 | Unilever Ltd | Bleaching processes and compositions |
| US3394155A (en) * | 1964-05-22 | 1968-07-23 | Lever Brothers Ltd | Preparation of surface-active agents |
| US3503888A (en) * | 1965-02-16 | 1970-03-31 | Dow Chemical Co | Synthetic detergent bar |
| US3636016A (en) * | 1969-05-28 | 1972-01-18 | Continental Oil Co | Surface active agents |
| US3775445A (en) * | 1972-01-14 | 1973-11-27 | Continental Oil Co | Surface active agents |
| GB1519351A (en) * | 1975-01-29 | 1978-07-26 | Unilever Ltd | Preparation of acetoxy arylene sulphonates |
| ATE5896T1 (de) * | 1979-11-03 | 1984-02-15 | The Procter & Gamble Company | Granulare waschmittelzusammensetzungen. |
-
1983
- 1983-10-19 DE DE19833337921 patent/DE3337921A1/de not_active Withdrawn
-
1984
- 1984-10-12 AT AT84112279T patent/ATE20344T1/de not_active IP Right Cessation
- 1984-10-12 EP EP84112279A patent/EP0140251B2/de not_active Expired
- 1984-10-12 DE DE8484112279T patent/DE3460224D1/de not_active Expired
- 1984-10-17 CA CA000465665A patent/CA1233481A/en not_active Expired
- 1984-10-18 US US06/662,048 patent/US4588531A/en not_active Expired - Fee Related
- 1984-10-18 ES ES536867A patent/ES8506268A1/es not_active Expired
- 1984-10-19 JP JP59218794A patent/JPS60104056A/ja active Granted
-
1986
- 1986-04-02 US US06/847,196 patent/US4693848A/en not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| US4588531A (en) | 1986-05-13 |
| EP0140251B1 (de) | 1986-06-11 |
| JPS60104056A (ja) | 1985-06-08 |
| ES536867A0 (es) | 1985-07-01 |
| EP0140251B2 (de) | 1989-09-06 |
| US4693848A (en) | 1987-09-15 |
| EP0140251A3 (enExample) | 1985-07-03 |
| EP0140251A2 (de) | 1985-05-08 |
| DE3337921A1 (de) | 1985-05-02 |
| JPH0437827B2 (enExample) | 1992-06-22 |
| ES8506268A1 (es) | 1985-07-01 |
| DE3460224D1 (en) | 1986-07-17 |
| ATE20344T1 (de) | 1986-06-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1233481A (en) | Preparation of alkali metal and alkaline earth metal salts of acyloxybenzenesulfonic acids | |
| US5523434A (en) | Synthesis of bleach activators | |
| CA1313673C (en) | Preparation of serine-n,n-diacetic acid and derivatives as complexing agents and detergents containing same | |
| US4827014A (en) | 2-Hydroxy-3-aminopropionic-n,n-diacetic acid and derivatives thereof, preparation thereof, and detergents containing same | |
| US4307038A (en) | N-Carboxy alkyl amino alkane polyphosphonic acids | |
| CA1273353A (en) | Preparation of acyloxy benzene sulfonate | |
| CA1253171A (en) | Preparation of acyloxybenzenesulfonic acids and their alkali metal and alkaline earth metal salts | |
| US2664437A (en) | O-(2-chloro-4-nitrophenyl) o,o dimethyl thiophosphate | |
| US5112530A (en) | Use of 2-hydroxy-3-aminopropionic acid derivatives as complexing agents, bleach stabilizers and builders in detergent compositions | |
| US4705649A (en) | Preparation of acyloxybenzenesulfonic acids and their alkali metal and alkaline earth metal salts | |
| US3031501A (en) | Preparation of 2, 5-diarylamino-tereph-thalic acid and salts thereof | |
| US5100588A (en) | Process for the preparation of acyloxybenzenesulfonic acids and their salts | |
| KR100920319B1 (ko) | 라디칼 중합성 화합물의 금속염의 제조방법 | |
| US5030381A (en) | Process for the preparation of stabilized aliphatic diperoxydicarboxylic acids | |
| CA1106843A (en) | N-carboxy-alkane-aminoalkane-diphosphonic acids, n- carboxy-alkane-azacycloalkane-diphosphonic acids and n-carboxy-alkane-aminoaryl-alkane-diphosphonic acids and process for theirproduction | |
| SU638253A3 (ru) | Способ получени диамидов дикарбоновых кислот | |
| KR880002623B1 (ko) | 하이드록시-아미노-아릴설폰산의 선택적 아실화 방법 | |
| JPS63166852A (ja) | エステル基を含有するn−置換アクリルアミド | |
| US5091562A (en) | Process for eliminating 1-carboxy-1-phosphonocyclopentan-3-one from, or reducing its content in, technical 2-phosphonobutane-1,2,4-tricarboxylic acid using bleaching liquor | |
| RU2149157C1 (ru) | Способ получения очищенной 2,4-дихлорфеноксиуксусной кислоты | |
| JPS6168462A (ja) | 3‐(アシル)アミノ‐4‐アルコキシフエニル‐β‐ヒドロキシエチルスルホン(‐硫酸エステル)の製法 | |
| RU1825783C (ru) | Способ получени @ -цианкоричной кислоты | |
| SU1293178A1 (ru) | Способ получени 2-хлор-5- @ -(2,4-ди-трет-амилфенокси)-бутироиламино @ -анилида @ -(1-бензилгидантоинил-3)-пивалоилуксусной кислоты | |
| CA2099096A1 (en) | Process for preparing granular esters | |
| SU1120671A1 (ru) | Амино-3-(5-дезокси-5-аденозил)тиопропилфосфониста кислота дл ингибировани процесса биометилировани |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |