CA1225182A - Flame retardant thermoplastic multi-block copolyester elastomers - Google Patents
Flame retardant thermoplastic multi-block copolyester elastomersInfo
- Publication number
- CA1225182A CA1225182A CA000480103A CA480103A CA1225182A CA 1225182 A CA1225182 A CA 1225182A CA 000480103 A CA000480103 A CA 000480103A CA 480103 A CA480103 A CA 480103A CA 1225182 A CA1225182 A CA 1225182A
- Authority
- CA
- Canada
- Prior art keywords
- melting point
- molecular weight
- weight
- glycol
- composition
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000003063 flame retardant Substances 0.000 title claims abstract description 38
- 229920006236 copolyester elastomer Polymers 0.000 title claims abstract description 34
- RNFJDJUURJAICM-UHFFFAOYSA-N 2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene Chemical compound N=1P(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP=1(OC=1C=CC=CC=1)OC1=CC=CC=C1 RNFJDJUURJAICM-UHFFFAOYSA-N 0.000 title claims abstract description 31
- 229920001169 thermoplastic Polymers 0.000 title abstract description 8
- 239000004416 thermosoftening plastic Substances 0.000 title abstract description 7
- 239000000203 mixture Substances 0.000 claims abstract description 57
- 239000004927 clay Substances 0.000 claims abstract description 26
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims abstract description 12
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims abstract description 12
- 229910052794 bromium Inorganic materials 0.000 claims abstract description 12
- 150000003242 quaternary ammonium salts Chemical class 0.000 claims abstract description 9
- 239000007795 chemical reaction product Substances 0.000 claims abstract description 8
- 229910021647 smectite Inorganic materials 0.000 claims abstract description 4
- ADCOVFLJGNWWNZ-UHFFFAOYSA-N antimony trioxide Chemical compound O=[Sb]O[Sb]=O ADCOVFLJGNWWNZ-UHFFFAOYSA-N 0.000 claims abstract 6
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 claims description 56
- 238000002844 melting Methods 0.000 claims description 56
- 230000008018 melting Effects 0.000 claims description 56
- 229920000642 polymer Polymers 0.000 claims description 25
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 claims description 24
- 150000002148 esters Chemical group 0.000 claims description 22
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 claims description 22
- -1 poly(tetramethylene oxide) Polymers 0.000 claims description 20
- 150000002334 glycols Chemical class 0.000 claims description 17
- WERYXYBDKMZEQL-UHFFFAOYSA-N butane-1,4-diol Chemical compound OCCCCO WERYXYBDKMZEQL-UHFFFAOYSA-N 0.000 claims description 16
- 229920000728 polyester Polymers 0.000 claims description 14
- 239000003760 tallow Substances 0.000 claims description 14
- 235000019270 ammonium chloride Nutrition 0.000 claims description 12
- 125000004432 carbon atom Chemical group C* 0.000 claims description 12
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 9
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 claims description 7
- 150000001875 compounds Chemical class 0.000 claims description 7
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 claims description 7
- 229920000233 poly(alkylene oxides) Polymers 0.000 claims description 7
- DYIZJUDNMOIZQO-UHFFFAOYSA-N 4,5,6,7-tetrabromo-2-[2-(4,5,6,7-tetrabromo-1,3-dioxoisoindol-2-yl)ethyl]isoindole-1,3-dione Chemical group O=C1C(C(=C(Br)C(Br)=C2Br)Br)=C2C(=O)N1CCN1C(=O)C2=C(Br)C(Br)=C(Br)C(Br)=C2C1=O DYIZJUDNMOIZQO-UHFFFAOYSA-N 0.000 claims description 6
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 claims description 6
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 claims description 6
- 239000000440 bentonite Substances 0.000 claims description 6
- 229910000278 bentonite Inorganic materials 0.000 claims description 6
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 claims description 6
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 6
- 238000010438 heat treatment Methods 0.000 claims description 6
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 claims description 6
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 claims description 5
- 238000005342 ion exchange Methods 0.000 claims description 5
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 claims description 5
- 229920001610 polycaprolactone Polymers 0.000 claims description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims description 4
- 239000004632 polycaprolactone Substances 0.000 claims description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 claims description 3
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 claims description 3
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 3
- 125000006182 dimethyl benzyl group Chemical group 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 3
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 claims description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 claims description 3
- JZMJDSHXVKJFKW-UHFFFAOYSA-M methyl sulfate(1-) Chemical compound COS([O-])(=O)=O JZMJDSHXVKJFKW-UHFFFAOYSA-M 0.000 claims description 3
- 239000001301 oxygen Substances 0.000 claims description 3
- 229910052760 oxygen Inorganic materials 0.000 claims description 3
- 229920001451 polypropylene glycol Polymers 0.000 claims description 3
- 230000004580 weight loss Effects 0.000 claims description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- 239000011248 coating agent Substances 0.000 claims description 2
- 238000000576 coating method Methods 0.000 claims description 2
- 238000002411 thermogravimetry Methods 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims 1
- 125000003118 aryl group Chemical group 0.000 claims 1
- 229910052799 carbon Inorganic materials 0.000 claims 1
- 150000002009 diols Chemical class 0.000 claims 1
- 238000000034 method Methods 0.000 description 19
- 229920001634 Copolyester Polymers 0.000 description 17
- 229920001971 elastomer Polymers 0.000 description 16
- 239000000806 elastomer Substances 0.000 description 16
- 241000125205 Anethum Species 0.000 description 14
- 229910052787 antimony Inorganic materials 0.000 description 12
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 description 12
- 239000004615 ingredient Substances 0.000 description 12
- 238000012360 testing method Methods 0.000 description 12
- 238000006243 chemical reaction Methods 0.000 description 10
- 229920000180 alkyd Polymers 0.000 description 8
- 239000003054 catalyst Substances 0.000 description 8
- 239000000463 material Substances 0.000 description 7
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- JBKVHLHDHHXQEQ-UHFFFAOYSA-N epsilon-caprolactam Chemical compound O=C1CCCCCN1 JBKVHLHDHHXQEQ-UHFFFAOYSA-N 0.000 description 6
- 239000004215 Carbon black (E152) Substances 0.000 description 5
- 239000005977 Ethylene Substances 0.000 description 5
- 239000002253 acid Substances 0.000 description 5
- 150000001991 dicarboxylic acids Chemical class 0.000 description 5
- 229930195733 hydrocarbon Natural products 0.000 description 5
- 239000008188 pellet Substances 0.000 description 5
- 238000006068 polycondensation reaction Methods 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 4
- YHWCPXVTRSHPNY-UHFFFAOYSA-N butan-1-olate;titanium(4+) Chemical compound [Ti+4].CCCC[O-].CCCC[O-].CCCC[O-].CCCC[O-] YHWCPXVTRSHPNY-UHFFFAOYSA-N 0.000 description 4
- 238000010168 coupling process Methods 0.000 description 4
- WOZVHXUHUFLZGK-UHFFFAOYSA-N dimethyl terephthalate Chemical compound COC(=O)C1=CC=C(C(=O)OC)C=C1 WOZVHXUHUFLZGK-UHFFFAOYSA-N 0.000 description 4
- 238000002156 mixing Methods 0.000 description 4
- 230000000704 physical effect Effects 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 3
- 238000000748 compression moulding Methods 0.000 description 3
- 230000008878 coupling Effects 0.000 description 3
- 238000005859 coupling reaction Methods 0.000 description 3
- 150000002430 hydrocarbons Chemical class 0.000 description 3
- 238000001746 injection moulding Methods 0.000 description 3
- 239000000155 melt Substances 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 239000000049 pigment Substances 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- PAPBSGBWRJIAAV-UHFFFAOYSA-N ε-Caprolactone Chemical class O=C1CCCCCO1 PAPBSGBWRJIAAV-UHFFFAOYSA-N 0.000 description 3
- YEJRWHAVMIAJKC-UHFFFAOYSA-N 4-Butyrolactone Chemical class O=C1CCCO1 YEJRWHAVMIAJKC-UHFFFAOYSA-N 0.000 description 2
- 239000004594 Masterbatch (MB) Substances 0.000 description 2
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 125000002947 alkylene group Chemical group 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 229920001400 block copolymer Polymers 0.000 description 2
- 230000003750 conditioning effect Effects 0.000 description 2
- 125000005442 diisocyanate group Chemical group 0.000 description 2
- VNGOYPQMJFJDLV-UHFFFAOYSA-N dimethyl benzene-1,3-dicarboxylate Chemical compound COC(=O)C1=CC=CC(C(=O)OC)=C1 VNGOYPQMJFJDLV-UHFFFAOYSA-N 0.000 description 2
- DMBHHRLKUKUOEG-UHFFFAOYSA-N diphenylamine Chemical compound C=1C=CC=CC=1NC1=CC=CC=C1 DMBHHRLKUKUOEG-UHFFFAOYSA-N 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- KWLMIXQRALPRBC-UHFFFAOYSA-L hectorite Chemical compound [Li+].[OH-].[OH-].[Na+].[Mg+2].O1[Si]2([O-])O[Si]1([O-])O[Si]([O-])(O1)O[Si]1([O-])O2 KWLMIXQRALPRBC-UHFFFAOYSA-L 0.000 description 2
- 229910000271 hectorite Inorganic materials 0.000 description 2
- WLJVNTCWHIRURA-UHFFFAOYSA-N pimelic acid Chemical compound OC(=O)CCCCCC(O)=O WLJVNTCWHIRURA-UHFFFAOYSA-N 0.000 description 2
- 229920005604 random copolymer Polymers 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- DNIAPMSPPWPWGF-VKHMYHEASA-N (+)-propylene glycol Chemical compound C[C@H](O)CO DNIAPMSPPWPWGF-VKHMYHEASA-N 0.000 description 1
- YHMOQCYOOUHZSF-UHFFFAOYSA-N 1,2,3,4,5-pentabromo-6-[1-(2,3,4,5,6-pentabromophenoxy)ethoxy]benzene Chemical compound BrC=1C(Br)=C(Br)C(Br)=C(Br)C=1OC(C)OC1=C(Br)C(Br)=C(Br)C(Br)=C1Br YHMOQCYOOUHZSF-UHFFFAOYSA-N 0.000 description 1
- ORYGKUIDIMIRNN-UHFFFAOYSA-N 1,2,3,4-tetrabromo-5-(2,3,4,5-tetrabromophenoxy)benzene Chemical compound BrC1=C(Br)C(Br)=CC(OC=2C(=C(Br)C(Br)=C(Br)C=2)Br)=C1Br ORYGKUIDIMIRNN-UHFFFAOYSA-N 0.000 description 1
- DEIGXXQKDWULML-UHFFFAOYSA-N 1,2,5,6,9,10-hexabromocyclododecane Chemical compound BrC1CCC(Br)C(Br)CCC(Br)C(Br)CCC1Br DEIGXXQKDWULML-UHFFFAOYSA-N 0.000 description 1
- YATIGPZCMOYEGE-UHFFFAOYSA-N 1,3,5-tribromo-2-[2-(2,4,6-tribromophenoxy)ethoxy]benzene Chemical compound BrC1=CC(Br)=CC(Br)=C1OCCOC1=C(Br)C=C(Br)C=C1Br YATIGPZCMOYEGE-UHFFFAOYSA-N 0.000 description 1
- YPFDHNVEDLHUCE-UHFFFAOYSA-N 1,3-propanediol Substances OCCCO YPFDHNVEDLHUCE-UHFFFAOYSA-N 0.000 description 1
- AXKZIDYFAMKWSA-UHFFFAOYSA-N 1,6-dioxacyclododecane-7,12-dione Chemical compound O=C1CCCCC(=O)OCCCCO1 AXKZIDYFAMKWSA-UHFFFAOYSA-N 0.000 description 1
- KMBSSXSNDSJXCG-UHFFFAOYSA-N 1-[2-(2-hydroxyundecylamino)ethylamino]undecan-2-ol Chemical compound CCCCCCCCCC(O)CNCCNCC(O)CCCCCCCCC KMBSSXSNDSJXCG-UHFFFAOYSA-N 0.000 description 1
- RTBFRGCFXZNCOE-UHFFFAOYSA-N 1-methylsulfonylpiperidin-4-one Chemical compound CS(=O)(=O)N1CCC(=O)CC1 RTBFRGCFXZNCOE-UHFFFAOYSA-N 0.000 description 1
- SEFYJVFBMNOLBK-UHFFFAOYSA-N 2-[2-[2-(oxiran-2-ylmethoxy)ethoxy]ethoxymethyl]oxirane Chemical compound C1OC1COCCOCCOCC1CO1 SEFYJVFBMNOLBK-UHFFFAOYSA-N 0.000 description 1
- ODJQKYXPKWQWNK-UHFFFAOYSA-N 3,3'-Thiobispropanoic acid Chemical compound OC(=O)CCSCCC(O)=O ODJQKYXPKWQWNK-UHFFFAOYSA-N 0.000 description 1
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 1
- BHELIUBJHYAEDK-OAIUPTLZSA-N Aspoxicillin Chemical compound C1([C@H](C(=O)N[C@@H]2C(N3[C@H](C(C)(C)S[C@@H]32)C(O)=O)=O)NC(=O)[C@H](N)CC(=O)NC)=CC=C(O)C=C1 BHELIUBJHYAEDK-OAIUPTLZSA-N 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- 241001315286 Damon Species 0.000 description 1
- 240000008669 Hedera helix Species 0.000 description 1
- OKOBUGCCXMIKDM-UHFFFAOYSA-N Irganox 1098 Chemical compound CC(C)(C)C1=C(O)C(C(C)(C)C)=CC(CCC(=O)NCCCCCCNC(=O)CCC=2C=C(C(O)=C(C=2)C(C)(C)C)C(C)(C)C)=C1 OKOBUGCCXMIKDM-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 235000006679 Mentha X verticillata Nutrition 0.000 description 1
- 235000002899 Mentha suaveolens Nutrition 0.000 description 1
- 235000001636 Mentha x rotundifolia Nutrition 0.000 description 1
- 241000282320 Panthera leo Species 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 239000005062 Polybutadiene Substances 0.000 description 1
- 229920002367 Polyisobutene Polymers 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- 241001415849 Strigiformes Species 0.000 description 1
- 239000003490 Thiodipropionic acid Substances 0.000 description 1
- 239000006096 absorbing agent Substances 0.000 description 1
- WNLRTRBMVRJNCN-UHFFFAOYSA-L adipate(2-) Chemical compound [O-]C(=O)CCCCC([O-])=O WNLRTRBMVRJNCN-UHFFFAOYSA-L 0.000 description 1
- 235000011037 adipic acid Nutrition 0.000 description 1
- 239000001361 adipic acid Substances 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- JFCQEDHGNNZCLN-UHFFFAOYSA-N anhydrous glutaric acid Natural products OC(=O)CCCC(O)=O JFCQEDHGNNZCLN-UHFFFAOYSA-N 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 230000003078 antioxidant effect Effects 0.000 description 1
- 230000005540 biological transmission Effects 0.000 description 1
- 229930188620 butyrolactone Chemical class 0.000 description 1
- VSGNNIFQASZAOI-UHFFFAOYSA-L calcium acetate Chemical class [Ca+2].CC([O-])=O.CC([O-])=O VSGNNIFQASZAOI-UHFFFAOYSA-L 0.000 description 1
- 235000011092 calcium acetate Nutrition 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- 239000006229 carbon black Substances 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000005253 cladding Methods 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 238000013329 compounding Methods 0.000 description 1
- 230000006835 compression Effects 0.000 description 1
- 238000007906 compression Methods 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 238000011437 continuous method Methods 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- PDXRQENMIVHKPI-UHFFFAOYSA-N cyclohexane-1,1-diol Chemical compound OC1(O)CCCCC1 PDXRQENMIVHKPI-UHFFFAOYSA-N 0.000 description 1
- VEIOBOXBGYWJIT-UHFFFAOYSA-N cyclohexane;methanol Chemical compound OC.OC.C1CCCCC1 VEIOBOXBGYWJIT-UHFFFAOYSA-N 0.000 description 1
- WHHGLZMJPXIBIX-UHFFFAOYSA-N decabromodiphenyl ether Chemical compound BrC1=C(Br)C(Br)=C(Br)C(Br)=C1OC1=C(Br)C(Br)=C(Br)C(Br)=C1Br WHHGLZMJPXIBIX-UHFFFAOYSA-N 0.000 description 1
- FOTKYAAJKYLFFN-UHFFFAOYSA-N decane-1,10-diol Chemical class OCCCCCCCCCCO FOTKYAAJKYLFFN-UHFFFAOYSA-N 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- GUJOJGAPFQRJSV-UHFFFAOYSA-N dialuminum;dioxosilane;oxygen(2-);hydrate Chemical compound O.[O-2].[O-2].[O-2].[Al+3].[Al+3].O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O GUJOJGAPFQRJSV-UHFFFAOYSA-N 0.000 description 1
- AYOHIQLKSOJJQH-UHFFFAOYSA-N dibutyltin Chemical compound CCCC[Sn]CCCC AYOHIQLKSOJJQH-UHFFFAOYSA-N 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000000446 fuel Substances 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 238000004442 gravimetric analysis Methods 0.000 description 1
- ACCCMOQWYVYDOT-UHFFFAOYSA-N hexane-1,1-diol Chemical compound CCCCCC(O)O ACCCMOQWYVYDOT-UHFFFAOYSA-N 0.000 description 1
- 229920006158 high molecular weight polymer Polymers 0.000 description 1
- 229920001519 homopolymer Polymers 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 239000003999 initiator Substances 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 150000002531 isophthalic acids Chemical class 0.000 description 1
- 238000005304 joining Methods 0.000 description 1
- 239000006210 lotion Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 235000011285 magnesium acetate Nutrition 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 238000005065 mining Methods 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- 229910052901 montmorillonite Inorganic materials 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 150000002896 organic halogen compounds Chemical class 0.000 description 1
- AHHWIHXENZJRFG-UHFFFAOYSA-N oxetane Chemical compound C1COC1 AHHWIHXENZJRFG-UHFFFAOYSA-N 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- UWJJYHHHVWZFEP-UHFFFAOYSA-N pentane-1,1-diol Chemical compound CCCCC(O)O UWJJYHHHVWZFEP-UHFFFAOYSA-N 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 150000003014 phosphoric acid esters Chemical class 0.000 description 1
- 150000003022 phthalic acids Chemical class 0.000 description 1
- 229920002857 polybutadiene Polymers 0.000 description 1
- 238000012643 polycondensation polymerization Methods 0.000 description 1
- 229920001195 polyisoprene Polymers 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 229920000166 polytrimethylene carbonate Polymers 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 239000007790 solid phase Substances 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 125000004079 stearyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- KKEYFWRCBNTPAC-UHFFFAOYSA-L terephthalate(2-) Chemical compound [O-]C(=O)C1=CC=C(C([O-])=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-L 0.000 description 1
- 150000003504 terephthalic acids Chemical class 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 229920006344 thermoplastic copolyester Polymers 0.000 description 1
- 235000019303 thiodipropionic acid Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L67/00—Compositions of polyesters obtained by reactions forming a carboxylic ester link in the main chain; Compositions of derivatives of such polymers
- C08L67/02—Polyesters derived from dicarboxylic acids and dihydroxy compounds
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K9/00—Use of pretreated ingredients
- C08K9/04—Ingredients treated with organic substances
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K13/00—Use of mixtures of ingredients not covered by one single of the preceding main groups, each of these compounds being essential
- C08K13/06—Pretreated ingredients and ingredients covered by the main groups C08K3/00 - C08K7/00
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K3/00—Use of inorganic substances as compounding ingredients
- C08K3/34—Silicon-containing compounds
- C08K3/346—Clay
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Dispersion Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Polyesters Or Polycarbonates (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/605,550 US4582866A (en) | 1984-04-30 | 1984-04-30 | Flame retardant thermoplastic multi-block copolyester elastomers |
| US605,550 | 1984-04-30 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1225182A true CA1225182A (en) | 1987-08-04 |
Family
ID=24424132
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000480103A Expired CA1225182A (en) | 1984-04-30 | 1985-04-25 | Flame retardant thermoplastic multi-block copolyester elastomers |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US4582866A (enExample) |
| EP (1) | EP0163427B1 (enExample) |
| JP (1) | JPS60235858A (enExample) |
| KR (1) | KR850007452A (enExample) |
| AU (1) | AU4173685A (enExample) |
| BR (1) | BR8501998A (enExample) |
| CA (1) | CA1225182A (enExample) |
| DE (1) | DE3565272D1 (enExample) |
| ES (1) | ES8609413A1 (enExample) |
Families Citing this family (43)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4639486A (en) * | 1985-10-08 | 1987-01-27 | General Electric Company | Flame retardant elastomeric compositions |
| US4708975A (en) * | 1986-04-02 | 1987-11-24 | E. I. Du Pont De Nemours And Company | Low smoke generating, high char forming, flame retardant thermoplastic multi-block copolyesters |
| US4826899A (en) * | 1987-06-15 | 1989-05-02 | E. I. Du Pont De Nemours And Company | Low smoke generating, high char forming, flame resistant thermoplastic multi-block copolyesters |
| US4908260A (en) * | 1988-09-07 | 1990-03-13 | E. I. Du Pont De Nemours And Company | Flame-retardant, vapor-permeable waterproof structure |
| JPH02112178A (ja) * | 1988-10-20 | 1990-04-24 | Sumitomo Wiring Syst Ltd | コネクター |
| DE19642491A1 (de) * | 1996-10-15 | 1998-04-16 | Basf Ag | Flammwidrige thermoplastische Formmassen auf Basis von Polyphenylenethern und vinylaromatischen Polymeren |
| JP2001507746A (ja) * | 1997-01-03 | 2001-06-12 | エー アクアルロ,ローレンス | 難燃性ナイロンエラストマー |
| US5773502A (en) * | 1997-10-14 | 1998-06-30 | General Electric Company | Fire retardant blends |
| GB9807180D0 (en) | 1998-04-04 | 1998-06-03 | Ecc Int Ltd | Pigment products |
| US6541557B1 (en) | 1999-03-23 | 2003-04-01 | Kabushiki Kaisha Toyota Chuo Kenkyusho | Resin composite material |
| CA2368750C (en) | 1999-04-01 | 2010-09-28 | Imerys Pigments, Inc. | Kaolin clay pigments, their preparation and use |
| AU759343B2 (en) | 1999-04-01 | 2003-04-10 | Imerys Pigments, Inc. | Kaolin pigments, their preparation and use |
| US6350804B2 (en) | 1999-04-14 | 2002-02-26 | General Electric Co. | Compositions with enhanced ductility |
| PT1177252E (pt) | 1999-04-30 | 2005-08-31 | Sued Chemie Ag | Composicoes retardadoras das chamas |
| US6554892B1 (en) | 1999-07-02 | 2003-04-29 | Imerys Kaolin, Inc. | Compositions and methods for making a coarse platey, high brightness kaolin product |
| US6610770B1 (en) * | 1999-10-04 | 2003-08-26 | Elementis Specialties, Inc. | Organoclay/polymer compositions with flame retardant properties |
| US6579926B2 (en) * | 1999-11-15 | 2003-06-17 | General Electric Company | Fire retardant polyphenylene ether-organoclay composition and method of making same |
| US6414070B1 (en) | 2000-03-08 | 2002-07-02 | Omnova Solutions Inc. | Flame resistant polyolefin compositions containing organically modified clay |
| FR2809499B1 (fr) * | 2000-05-29 | 2003-10-03 | Cit Alcatel | Peau de protection pour fibres optiques |
| GB0020179D0 (en) * | 2000-08-17 | 2000-10-04 | Imerys Minerals Ltd | Kaolin products and their use |
| GB0020180D0 (en) | 2000-08-17 | 2000-10-04 | Imerys Minerals Ltd | Kaolin products and their production |
| GB0020182D0 (en) | 2000-08-17 | 2000-10-04 | Imerys Minerals Ltd | Particulate kaolin |
| US20030085012A1 (en) * | 2001-09-07 | 2003-05-08 | Jones J Philip E | Hyperplaty clays and their use in paper coating and filling, methods for making same, and paper products having improved brightness |
| US6808559B2 (en) | 2002-02-26 | 2004-10-26 | Imerys Pigments, Inc. | Kaolin clay pigments suited to rotogravure printing applications and method for preparing the same |
| JP2005521767A (ja) * | 2002-03-28 | 2005-07-21 | イメリーズ ミネラルズ リミテッド | 粒状粘土鉱物を含む難燃性ポリマー組成物 |
| US20040074847A1 (en) * | 2002-10-16 | 2004-04-22 | Jaquess Percy A. | Stable N-bromo-2-pyrrolidone and methods to make the same |
| KR20050097502A (ko) * | 2003-01-08 | 2005-10-07 | 쉬드-케미아크티엔게젤샤프트 | 미리-박리된 나노클레이 기초 조성물 및 이들의 용도 |
| US7867614B2 (en) | 2003-06-12 | 2011-01-11 | Rockwood Clay Additives, Gmbh | Method for producing nanocomposite additives with improved delamination in polymers |
| GB0315409D0 (en) * | 2003-07-01 | 2003-08-06 | Imerys Minerals Ltd | Particulate clay materials and polymer compositions incorporating the same |
| US7148282B2 (en) * | 2003-12-19 | 2006-12-12 | Cornell Research Foundations, Inc. | Composite of high melting polymer and nanoclay with enhanced properties |
| DE102004039451A1 (de) * | 2004-08-13 | 2006-03-02 | Süd-Chemie AG | Polymerblend aus nicht verträglichen Polymeren |
| CN101072837A (zh) * | 2004-10-06 | 2007-11-14 | 英默里斯高岭土公司 | 用在硅橡胶基配方中的有机中和的煅烧高岭土 |
| KR101108242B1 (ko) | 2005-02-15 | 2012-01-31 | 에스케이케미칼주식회사 | 난연성 폴리에스테르 엘라스토머 조성물 |
| US20060202177A1 (en) * | 2005-03-11 | 2006-09-14 | Taiwan Textile Research Institute | Flame retardant composition |
| US7888419B2 (en) * | 2005-09-02 | 2011-02-15 | Naturalnano, Inc. | Polymeric composite including nanoparticle filler |
| US8124678B2 (en) * | 2006-11-27 | 2012-02-28 | Naturalnano, Inc. | Nanocomposite master batch composition and method of manufacture |
| US8648132B2 (en) * | 2007-02-07 | 2014-02-11 | Naturalnano, Inc. | Nanocomposite method of manufacture |
| WO2009029310A1 (en) * | 2007-05-23 | 2009-03-05 | Naturalnano Research, Inc. | Fire and flame retardant polymer composites |
| TWI379860B (en) | 2008-06-24 | 2012-12-21 | Univ Chung Yuan Christian | Modified clay and clay-polymer composite |
| US20110180300A1 (en) * | 2008-09-30 | 2011-07-28 | Polyone Corporation | Flame retardant thermoplastic elastomers |
| JP5854095B1 (ja) * | 2014-07-25 | 2016-02-09 | 横浜ゴム株式会社 | 耐熱コンベヤベルト用ゴム組成物および耐熱コンベヤベルト |
| US20190211203A1 (en) * | 2018-01-11 | 2019-07-11 | Celanese International Corporation | Copolyester Polymer Composition With Enhanced Elastic Properties |
| US20210277160A1 (en) * | 2020-01-08 | 2021-09-09 | Northrop Grumman Systems Corporation | Precursor compositions for an insulation, insulated rocket motors, and related methods |
Family Cites Families (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2531396A (en) * | 1947-03-29 | 1950-11-28 | Nat Lead Co | Elastomer reinforced with a modified clay |
| US3023192A (en) * | 1958-05-29 | 1962-02-27 | Du Pont | Segmented copolyetherester elastomers |
| GB1114174A (en) * | 1964-12-18 | 1968-05-15 | Berk Ltd | Synthetic thermoplastic polymer composition |
| US4374220A (en) * | 1968-09-18 | 1983-02-15 | Raychem Corporation | Imide flame retardants and compositions containing them |
| US3624024A (en) * | 1970-02-24 | 1971-11-30 | Eastman Kodak Co | Flame retardant poly(tetramethylene terephthalate) molding compositions |
| US3833535A (en) * | 1971-08-30 | 1974-09-03 | Gen Electric | Non-dripping flame retardant glass reinforced polyester resins |
| JPS5645942B2 (enExample) * | 1973-01-18 | 1981-10-29 | ||
| US4031165A (en) * | 1974-09-30 | 1977-06-21 | Teijin Limited | Process for preparing polyester elastomers |
| FR2322900A1 (fr) * | 1975-09-04 | 1977-04-01 | Rhone Poulenc Ind | Compositions ignifugees de polyesters |
| GB1592271A (en) * | 1977-03-23 | 1981-07-01 | Exxon Research Engineering Co | Overtreated higher dialkyl dimethyl ammonium clay gellants and their use in greases |
| US4216135A (en) * | 1978-03-27 | 1980-08-05 | Nl Industries, Inc. | Organophilic clays and thixotropic polyester compositions containing the same |
| US4467057A (en) * | 1978-12-06 | 1984-08-21 | General Electric Company | Modified polyester composition |
| GB2042560A (en) * | 1979-01-12 | 1980-09-24 | Gen Electric | Non-blooming flame retardant thermoplastic compositions |
| DE3066633D1 (en) * | 1979-11-19 | 1984-03-22 | Bayer Ag | Use of polyethylene terephthalate moulding masses containing an organic imide in the preparation of crystalline mouldings by injection moulding at low mould temperatures |
| EP0089314B1 (de) * | 1982-03-16 | 1986-02-19 | Ciba-Geigy Ag | Flammwidrige verstärkte thermoplastische Polyesterformmasse und deren Verwendung |
| US4521557A (en) * | 1983-06-23 | 1985-06-04 | E. I. Du Pont De Nemours And Company | Flame retardant copolyetheresters |
| CA1225653A (en) * | 1983-07-07 | 1987-08-18 | Thomas D. Thompson, Iii | Organoclay-antiozonant complex |
-
1984
- 1984-04-30 US US06/605,550 patent/US4582866A/en not_active Expired - Fee Related
-
1985
- 1985-04-25 CA CA000480103A patent/CA1225182A/en not_active Expired
- 1985-04-26 AU AU41736/85A patent/AU4173685A/en not_active Abandoned
- 1985-04-26 BR BR8501998A patent/BR8501998A/pt unknown
- 1985-04-26 JP JP60089141A patent/JPS60235858A/ja active Granted
- 1985-04-29 EP EP85303024A patent/EP0163427B1/en not_active Expired
- 1985-04-29 ES ES542686A patent/ES8609413A1/es not_active Expired
- 1985-04-29 KR KR1019850002882A patent/KR850007452A/ko not_active Withdrawn
- 1985-04-29 DE DE8585303024T patent/DE3565272D1/de not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| ES8609413A1 (es) | 1986-07-16 |
| KR850007452A (ko) | 1985-12-04 |
| BR8501998A (pt) | 1985-12-31 |
| ES542686A0 (es) | 1986-07-16 |
| EP0163427A1 (en) | 1985-12-04 |
| US4582866A (en) | 1986-04-15 |
| EP0163427B1 (en) | 1988-09-28 |
| DE3565272D1 (en) | 1988-11-03 |
| AU4173685A (en) | 1985-11-07 |
| JPH0133500B2 (enExample) | 1989-07-13 |
| JPS60235858A (ja) | 1985-11-22 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1225182A (en) | Flame retardant thermoplastic multi-block copolyester elastomers | |
| CA1271862A (en) | Low smoke generating, high char forming, flame retardant thermoplastic multi-block copolyesters | |
| US4826899A (en) | Low smoke generating, high char forming, flame resistant thermoplastic multi-block copolyesters | |
| US4414352A (en) | Thermoplastic molding compositions and process | |
| JPH11513722A (ja) | 難燃性ポリケトンポリマーブレンド | |
| IT8922878A1 (it) | Copolieteri-esteri elastomerici termoplastici a migliorata resistenza alla termo-ossidazione | |
| US4520149A (en) | Elastomer compositions | |
| EP0188634B1 (en) | Flame retardant copolyetheresters | |
| US4520150A (en) | Stabilized elastomer compositions | |
| US4520148A (en) | Thermoplastic elastomer compositions | |
| DE2756465A1 (de) | Feuerhemmende massen enthaltend blockcopolymere von polybutylenterephthalat | |
| US5298544A (en) | Non-halogen flame retardant thermoplastic composition | |
| EP0027464A1 (en) | Thermoplastic molding composition and process | |
| US4126592A (en) | Process for the preparation of polyesters having stabilized melt viscosity in the presence of aromatic poly(carbonates) | |
| US4778839A (en) | Stabilized thermoplastic elastomer compositions | |
| US4797437A (en) | Thermoplastic elastomer | |
| EP0144174B1 (en) | Thermoplastic elastomer compositions | |
| EP0144175B1 (en) | Stabilized thermoplastic elastomer compositions | |
| JPS5928346B2 (ja) | 難燃性ポリエステル組成物 | |
| JPS636093B2 (enExample) | ||
| CA1254332A (en) | Flame retardant copolyetheresters | |
| EP0411339A1 (en) | Elastomeric thermoplastic copolyester compositions | |
| US4169081A (en) | Process for the preparation of polyesters having stabilized melt viscosity in the presence of aromatic (poly-)carbonates | |
| US4766164A (en) | Stabilized thermoplastic elastomer | |
| JPS61174251A (ja) | 難燃性コポリエーテルエステル弾性体組成物 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |