CA1219583A - Stabilizing agents for polymer materials - Google Patents
Stabilizing agents for polymer materialsInfo
- Publication number
- CA1219583A CA1219583A CA000425612A CA425612A CA1219583A CA 1219583 A CA1219583 A CA 1219583A CA 000425612 A CA000425612 A CA 000425612A CA 425612 A CA425612 A CA 425612A CA 1219583 A CA1219583 A CA 1219583A
- Authority
- CA
- Canada
- Prior art keywords
- formula
- carbon atoms
- meaning
- radical
- compounds according
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000002861 polymer material Substances 0.000 title claims abstract description 8
- 239000003381 stabilizer Substances 0.000 title claims description 13
- 150000001875 compounds Chemical class 0.000 claims abstract description 50
- 238000000034 method Methods 0.000 claims abstract description 8
- -1 alkyl radical Chemical class 0.000 claims description 56
- 125000004432 carbon atom Chemical group C* 0.000 claims description 38
- 239000001257 hydrogen Substances 0.000 claims description 17
- 229910052739 hydrogen Inorganic materials 0.000 claims description 17
- 150000002431 hydrogen Chemical class 0.000 claims description 13
- 229920000642 polymer Polymers 0.000 claims description 13
- 238000006243 chemical reaction Methods 0.000 claims description 7
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 7
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- 150000005840 aryl radicals Chemical class 0.000 claims description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 4
- 239000001301 oxygen Substances 0.000 claims description 4
- 229910052760 oxygen Inorganic materials 0.000 claims description 4
- 239000004698 Polyethylene Substances 0.000 claims description 3
- 239000004743 Polypropylene Substances 0.000 claims description 3
- 229910052740 iodine Inorganic materials 0.000 claims description 3
- 238000002156 mixing Methods 0.000 claims description 3
- 125000003386 piperidinyl group Chemical group 0.000 claims description 3
- 229920001155 polypropylene Polymers 0.000 claims description 3
- 230000000087 stabilizing effect Effects 0.000 claims description 3
- 239000008096 xylene Substances 0.000 claims description 3
- 150000001412 amines Chemical class 0.000 claims description 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 2
- 150000004985 diamines Chemical class 0.000 claims description 2
- 229910052757 nitrogen Inorganic materials 0.000 claims description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 2
- 229920000573 polyethylene Polymers 0.000 claims description 2
- 150000003254 radicals Chemical class 0.000 claims description 2
- 125000003710 aryl alkyl group Chemical group 0.000 claims 1
- 239000000543 intermediate Substances 0.000 claims 1
- 150000003918 triazines Chemical class 0.000 claims 1
- 230000015556 catabolic process Effects 0.000 abstract description 4
- 238000006731 degradation reaction Methods 0.000 abstract description 4
- 230000003647 oxidation Effects 0.000 abstract description 2
- 238000007254 oxidation reaction Methods 0.000 abstract description 2
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 31
- 238000003756 stirring Methods 0.000 description 17
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 16
- 239000000243 solution Substances 0.000 description 13
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 13
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 11
- 239000011541 reaction mixture Substances 0.000 description 11
- 239000002904 solvent Substances 0.000 description 11
- 239000000203 mixture Substances 0.000 description 9
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 8
- 229910000027 potassium carbonate Inorganic materials 0.000 description 8
- 229940093956 potassium carbonate Drugs 0.000 description 8
- 235000011181 potassium carbonates Nutrition 0.000 description 8
- 229920005989 resin Polymers 0.000 description 8
- 239000011347 resin Substances 0.000 description 8
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 8
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 5
- 239000000460 chlorine Substances 0.000 description 5
- 239000012153 distilled water Substances 0.000 description 5
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 4
- 239000012071 phase Substances 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- 229960001124 trientine Drugs 0.000 description 4
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 239000007832 Na2SO4 Substances 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 3
- 125000006309 butyl amino group Chemical group 0.000 description 3
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 229920001577 copolymer Polymers 0.000 description 3
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 3
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 3
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 238000011403 purification operation Methods 0.000 description 3
- 230000005855 radiation Effects 0.000 description 3
- 229910052938 sodium sulfate Inorganic materials 0.000 description 3
- 235000011152 sodium sulphate Nutrition 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 239000012965 benzophenone Substances 0.000 description 2
- 150000008366 benzophenones Chemical class 0.000 description 2
- 150000001565 benzotriazoles Chemical class 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 125000004369 butenyl group Chemical group C(=CCC)* 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- RRAMGCGOFNQTLD-UHFFFAOYSA-N hexamethylene diisocyanate Chemical compound O=C=NCCCCCCN=C=O RRAMGCGOFNQTLD-UHFFFAOYSA-N 0.000 description 2
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 229920000098 polyolefin Polymers 0.000 description 2
- 230000001376 precipitating effect Effects 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 235000015424 sodium Nutrition 0.000 description 2
- 235000011121 sodium hydroxide Nutrition 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- ZZHIDJWUJRKHGX-UHFFFAOYSA-N 1,4-bis(chloromethyl)benzene Chemical compound ClCC1=CC=C(CCl)C=C1 ZZHIDJWUJRKHGX-UHFFFAOYSA-N 0.000 description 1
- KFAKZJUYBOYVKA-UHFFFAOYSA-N 1,4-dichloro-2-methylbenzene Chemical compound CC1=CC(Cl)=CC=C1Cl KFAKZJUYBOYVKA-UHFFFAOYSA-N 0.000 description 1
- VILCJCGEZXAXTO-UHFFFAOYSA-N 2,2,2-tetramine Chemical compound NCCNCCNCCN VILCJCGEZXAXTO-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 229920001651 Cyanoacrylate Polymers 0.000 description 1
- RPNUMPOLZDHAAY-UHFFFAOYSA-N Diethylenetriamine Chemical compound NCCNCCN RPNUMPOLZDHAAY-UHFFFAOYSA-N 0.000 description 1
- 239000005057 Hexamethylene diisocyanate Substances 0.000 description 1
- 101100448208 Human herpesvirus 6B (strain Z29) U69 gene Proteins 0.000 description 1
- 102000006835 Lamins Human genes 0.000 description 1
- 108010047294 Lamins Proteins 0.000 description 1
- 229920002292 Nylon 6 Polymers 0.000 description 1
- 229920002302 Nylon 6,6 Polymers 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 1
- 241000394605 Viola striata Species 0.000 description 1
- RSWGJHLUYNHPMX-ONCXSQPRSA-N abietic acid Chemical compound C([C@@H]12)CC(C(C)C)=CC1=CC[C@@H]1[C@]2(C)CCC[C@@]1(C)C(O)=O RSWGJHLUYNHPMX-ONCXSQPRSA-N 0.000 description 1
- 239000006096 absorbing agent Substances 0.000 description 1
- 239000000370 acceptor Substances 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- PWAXUOGZOSVGBO-UHFFFAOYSA-N adipoyl chloride Chemical compound ClC(=O)CCCCC(Cl)=O PWAXUOGZOSVGBO-UHFFFAOYSA-N 0.000 description 1
- IMHBYKMAHXWHRP-UHFFFAOYSA-N anilazine Chemical compound ClC1=CC=CC=C1NC1=NC(Cl)=NC(Cl)=N1 IMHBYKMAHXWHRP-UHFFFAOYSA-N 0.000 description 1
- 239000002216 antistatic agent Substances 0.000 description 1
- 239000000010 aprotic solvent Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- ZSIQJIWKELUFRJ-UHFFFAOYSA-N azepane Chemical compound C1CCCNCC1 ZSIQJIWKELUFRJ-UHFFFAOYSA-N 0.000 description 1
- 230000008033 biological extinction Effects 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- CJZGTCYPCWQAJB-UHFFFAOYSA-L calcium stearate Chemical compound [Ca+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CJZGTCYPCWQAJB-UHFFFAOYSA-L 0.000 description 1
- 239000008116 calcium stearate Substances 0.000 description 1
- 235000013539 calcium stearate Nutrition 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 238000002845 discoloration Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- XXMIOPMDWAUFGU-UHFFFAOYSA-N hexane-1,6-diol Chemical compound OCCCCCCO XXMIOPMDWAUFGU-UHFFFAOYSA-N 0.000 description 1
- 229920001903 high density polyethylene Polymers 0.000 description 1
- 239000004700 high-density polyethylene Substances 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 210000005053 lamin Anatomy 0.000 description 1
- 239000004611 light stabiliser Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 125000006178 methyl benzyl group Chemical group 0.000 description 1
- 235000014571 nuts Nutrition 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- AQSJGOWTSHOLKH-UHFFFAOYSA-N phosphite(3-) Chemical class [O-]P([O-])[O-] AQSJGOWTSHOLKH-UHFFFAOYSA-N 0.000 description 1
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 229920002857 polybutadiene Polymers 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229940068921 polyethylenes Drugs 0.000 description 1
- 239000004814 polyurethane Substances 0.000 description 1
- 229920002635 polyurethane Polymers 0.000 description 1
- 229920002689 polyvinyl acetate Polymers 0.000 description 1
- 239000011118 polyvinyl acetate Substances 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- 235000011118 potassium hydroxide Nutrition 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- MZWKCFGWAWRHDY-UHFFFAOYSA-N s-[2-(diethylamino)ethyl] 2,2-diphenylethanethioate;hydrochloride Chemical compound Cl.C=1C=CC=CC=1C(C(=O)SCCN(CC)CC)C1=CC=CC=C1 MZWKCFGWAWRHDY-UHFFFAOYSA-N 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- 229920001059 synthetic polymer Polymers 0.000 description 1
- 125000004862 thiobutyl group Chemical group 0.000 description 1
- 125000004014 thioethyl group Chemical group [H]SC([H])([H])C([H])([H])* 0.000 description 1
- 125000004055 thiomethyl group Chemical group [H]SC([H])([H])* 0.000 description 1
- 125000004035 thiopropyl group Chemical group [H]SC([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- OGIDPMRJRNCKJF-UHFFFAOYSA-N titanium oxide Inorganic materials [Ti]=O OGIDPMRJRNCKJF-UHFFFAOYSA-N 0.000 description 1
- 125000005065 undecenyl group Chemical group C(=CCCCCCCCCC)* 0.000 description 1
- 125000006839 xylylene group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/14—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D251/00—Heterocyclic compounds containing 1,3,5-triazine rings
- C07D251/02—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings
- C07D251/12—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D251/26—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with only hetero atoms directly attached to ring carbon atoms
- C07D251/40—Nitrogen atoms
- C07D251/42—One nitrogen atom
- C07D251/46—One nitrogen atom with oxygen or sulfur atoms attached to the two other ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D251/00—Heterocyclic compounds containing 1,3,5-triazine rings
- C07D251/02—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings
- C07D251/12—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D251/26—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with only hetero atoms directly attached to ring carbon atoms
- C07D251/40—Nitrogen atoms
- C07D251/48—Two nitrogen atoms
- C07D251/52—Two nitrogen atoms with an oxygen or sulfur atom attached to the third ring carbon atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D251/00—Heterocyclic compounds containing 1,3,5-triazine rings
- C07D251/02—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings
- C07D251/12—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D251/26—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with only hetero atoms directly attached to ring carbon atoms
- C07D251/40—Nitrogen atoms
- C07D251/54—Three nitrogen atoms
- C07D251/70—Other substituted melamines
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Plural Heterocyclic Compounds (AREA)
- Hydrogenated Pyridines (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT21346/82A IT1152192B (it) | 1982-05-19 | 1982-05-19 | Composti per stabilizzare i polimeri |
| IT21346A/82 | 1982-05-19 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1219583A true CA1219583A (en) | 1987-03-24 |
Family
ID=11180440
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000425612A Expired CA1219583A (en) | 1982-05-19 | 1983-04-11 | Stabilizing agents for polymer materials |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US4477615A (enExample) |
| BE (1) | BE896691A (enExample) |
| CA (1) | CA1219583A (enExample) |
| DE (1) | DE3315115A1 (enExample) |
| FR (1) | FR2527215B1 (enExample) |
| GB (1) | GB2120248B (enExample) |
| IT (1) | IT1152192B (enExample) |
| NL (1) | NL190813C (enExample) |
Families Citing this family (48)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4639479A (en) * | 1982-02-19 | 1987-01-27 | The Bfgoodrich Company | Polyalkylenepolyamine having pendant substituted oxo-piperazinyltriazines and UV light stabilized compositions |
| EP0107615B1 (de) * | 1982-09-30 | 1992-10-28 | Ciba-Geigy Ag | Mit Bis- oder Tris-(polyalkylpiperidinyl-amino)-1,3,5-triazine stabilisierte Polyolefine |
| US5260362A (en) * | 1982-09-30 | 1993-11-09 | Ciba-Geigy Corporation | Polyolefines which have been stabilized with bis-(polyalkypiperidiny(amino)-1,3,5-triazines or tris-(polyalkylpiperidinyl(amino)-1,3,5-triazines |
| IT1197466B (it) * | 1986-08-25 | 1988-11-30 | Ciba Geigy Spa | Metodo per la stabilizzazione di polimeri oleofinici mediante composti triazinici |
| IT1223405B (it) * | 1987-12-04 | 1990-09-19 | Ciba Geigy Spa | Procedimento per la metilazione di composti triazinici contenenti gruppi 2,2,6,6 tetrametilpiperidinici |
| IT1217742B (it) * | 1988-05-31 | 1990-03-30 | Ciba Geigy Spa | Poliammine parzialmente sostituite con piperidin triazine |
| IT1219701B (it) * | 1988-05-31 | 1990-05-24 | Ciba Geigy Spa | Poliammine parzialmente sostituite con 4,6 bis (n,n bis(2,2,6,6 tetrametil 4 piperdil) ammino) 1,3,5-triazin-2-il |
| EP0461206B1 (en) * | 1989-09-09 | 1994-03-02 | Sandoz-Patent-Gmbh | Synthetic polyamides and their salts |
| DE3932912A1 (de) * | 1989-10-03 | 1991-04-11 | Sandoz Ag | Sterisch gehinderte aminogruppen enthaltende synthetische polyamide |
| IT1237129B (it) * | 1989-11-10 | 1993-05-18 | Valerio Borzatta | Composti piperidin-triazinici atti all'impiego come stabilizzanti per materiali organici. |
| IT1237541B (it) * | 1989-12-28 | 1993-06-08 | Ciba Geigy | Composti piperidin-triazinici atti all'impiego come stabilizzanti per materiali organici |
| IT1246170B (it) * | 1990-07-24 | 1994-11-16 | Ciba Geigy Spa | Composizione stabilizzante per polipropilene comprendente composti triazinici contenenti gruppi piperidinici e composti metallici |
| IT1243374B (it) * | 1990-07-27 | 1994-06-10 | Ciba Geigy Spa | Composti piperidin-triazinici contenenti gruppi tetraidrofuranici o tetraidropiranici atti all'impiego come stabilizzanti per materiali organici |
| US5256787A (en) * | 1990-09-03 | 1993-10-26 | Ciba-Geigy Corporation | Tri-piperdine compounds as stabilizers for organic materials |
| IT1243433B (it) * | 1990-10-03 | 1994-06-10 | Ciba Geigy Spa | Composti piperidin-triazinici atti all'impiego come stabilizzanti per materiali organici |
| TW237471B (enExample) * | 1992-09-03 | 1995-01-01 | Ciba Geigy | |
| IT1263892B (it) * | 1993-02-11 | 1996-09-05 | Graziano Vignali | Composti piperidin-triazinici atti all'impiego come stabilizzanti per materiali organici |
| IT1269828B (it) * | 1994-05-24 | 1997-04-15 | 3V Sigma Spa | Composizioni per la stabilizzazione di polimeri sintetici |
| EP0709426B2 (de) | 1994-10-28 | 2005-01-05 | Ciba SC Holding AG | Synergistisches Stabilisatorgemisch |
| ES2148464T5 (es) * | 1994-10-28 | 2005-06-16 | Ciba Specialty Chemicals Holding Inc. | Mezcla de estabilizadores sinergicos. |
| IT1271711B (it) * | 1994-11-09 | 1997-06-04 | Ciba Geigy Spa | Derivati della 2,2,6,6-tetrametilpiperidina utili come stabilizzanti alla luce, al calore e all'ossidazione per materiali organici |
| TW357174B (en) * | 1995-01-23 | 1999-05-01 | Ciba Sc Holding Ag | Synergistic stabilizer mixture |
| TW401437B (en) * | 1995-02-10 | 2000-08-11 | Ciba Sc Holding Ag | Synergistic stabilizer mixture |
| TW358820B (en) * | 1995-04-11 | 1999-05-21 | Ciba Sc Holding Ag | Synergistic stabilizer mixture |
| TW360678B (en) * | 1995-05-03 | 1999-06-11 | Ciba Sc Holding Ag | Synergistic stabilizer mixture for polyolefins |
| TW390897B (en) * | 1995-07-21 | 2000-05-21 | Ciba Sc Holding Ag | Synergistic stabilizer mixture |
| IT1275584B1 (it) * | 1995-07-21 | 1997-08-06 | 3V Sigma Spa | Composizioni per la stabilizzazione di polimeri sintetici |
| TW357175B (en) | 1996-07-12 | 1999-05-01 | Ciba Sc Holding Ag | Stabilizer mixtures |
| DE19820157B4 (de) | 1997-05-13 | 2010-04-08 | Clariant Produkte (Deutschland) Gmbh | Neue Verbindungen auf Basis von Polyalkyl-1-oxa-diazaspirodecan-Verbindungen |
| US20030191239A1 (en) * | 2000-05-31 | 2003-10-09 | Francois Gugumus | Stabilizer mixtures |
| ITMI20012085A1 (it) | 2000-10-17 | 2003-04-09 | Ciba Sc Holding Ag | Polpropilene metallocene stabilizzato |
| US20030225191A1 (en) | 2002-04-12 | 2003-12-04 | Francois Gugumus | Stabilizer mixtures |
| NZ536384A (en) * | 2002-05-30 | 2007-05-31 | Ciba Sc Holding Ag | Degradable stabilized articles of organic polymers |
| US20030236325A1 (en) * | 2002-05-30 | 2003-12-25 | Michela Bonora | Agricultural articles |
| ITMI20052067A1 (it) * | 2005-10-28 | 2007-04-29 | 3V Sigma Spa | Composizione per la stabilizzazione di polimeri sintetici |
| UA93147C2 (uk) * | 2007-03-16 | 2011-01-10 | Сурро Хесус Іскара | Діелектричне плинне середовище, здатне до біорозкладання, і його застосування як ізолятора та охолоджувача в електроустаткуванні |
| ITMI20080739A1 (it) * | 2008-04-23 | 2009-10-24 | 3V Sigma Spa | Ammine stericamente impedite oligomeriche e loro uso come stabilizzanti per polimeri |
| ITMI20080747A1 (it) * | 2008-04-24 | 2009-10-25 | 3V Sigma Spa | Miscele di ammine stericamente impedite per la stabilizzazione di polimeri |
| IT1393333B1 (it) | 2009-02-09 | 2012-04-20 | 3V Sigma Spa | Nuove ammine stericamente impedite e loro uso come stabilizzanti per polimeri |
| EP2467878A1 (en) | 2009-08-18 | 2012-06-27 | Basf Se | An uv-stabilized photovoltaic module |
| IT1399477B1 (it) * | 2010-03-15 | 2013-04-19 | 3V Sigma Spa | Miscele di ammine stericamente impedite per la stabilizzazione di polimeri |
| IT1403086B1 (it) * | 2010-10-28 | 2013-10-04 | 3V Sigma Spa | Nuove ammine stericamente impedite polimeriche e loro uso come stabilizzanti per polimeri |
| ITMI20110802A1 (it) | 2011-05-10 | 2012-11-11 | 3V Sigma Spa | Miscele di ammine stericamente impedite per la stabilizzazione di polimeri |
| SA116370295B1 (ar) | 2015-02-20 | 2016-12-06 | باسف اس اى | رقائق، وأشرطة وفتائل أحادية من البولي أوليفين مثبتة للضوء |
| AU2016299258B2 (en) | 2015-07-27 | 2021-02-18 | Basf Se | An additive mixture |
| IT201700073726A1 (it) | 2017-06-30 | 2018-12-30 | 3V Sigma Spa | Ammine impedite polimeriche |
| IT201700078234A1 (it) | 2017-07-11 | 2019-01-11 | 3V Sigma Spa | Ammine impedite |
| WO2019210178A1 (en) * | 2018-04-27 | 2019-10-31 | Dow Global Technologies Llc | Polymeric composition containing a light stabilizer |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1393551A (en) * | 1972-04-21 | 1975-05-07 | Ciba Geigy Ag | Piperidine derivatives |
| NO146433C (no) * | 1975-03-21 | 1982-09-29 | Montefibre Spa | Stabilisert polyolefinmateriale inneholdende et polyamin som stabilisator |
| CH625814A5 (en) * | 1975-12-04 | 1981-10-15 | Chimosa Chimica Organica Spa | Process for the preparation of polytriazine compounds |
| IT1052501B (it) * | 1975-12-04 | 1981-07-20 | Chimosa Chimica Organica Spa | Composti politriazinici utilizzabili per la stabilizzazione di polimeri sintetici e procedimento per la loro preparazione |
| IT1123083B (it) * | 1976-11-26 | 1986-04-30 | Chimosa Chimica Organica Spa | Derivati piperidinici della 1,3,5 triazina quali stabilizzanti per polimeri sintetici che li comprendono e procedimento per la loro preparazione |
| US4315859A (en) * | 1979-01-15 | 1982-02-16 | Ciba-Geigy Corporation | 1,3,5-Triazines containing at least one piperidine radical |
| DE2944729A1 (de) * | 1979-11-06 | 1981-05-14 | Hoechst Ag, 6000 Frankfurt | Neue triazinstabilisatoren |
| DE3022896A1 (de) * | 1980-06-19 | 1981-12-24 | Hoechst Ag, 6000 Frankfurt | Polytriazinylamine, verfahren zu ihrer herstellung und ihre verwendung als stabilisatoren fuer synthetische polymere |
-
1982
- 1982-05-19 IT IT21346/82A patent/IT1152192B/it active
-
1983
- 1983-04-08 US US06/483,092 patent/US4477615A/en not_active Expired - Lifetime
- 1983-04-11 CA CA000425612A patent/CA1219583A/en not_active Expired
- 1983-04-25 NL NL8301457A patent/NL190813C/xx not_active IP Right Cessation
- 1983-04-27 DE DE19833315115 patent/DE3315115A1/de active Granted
- 1983-05-09 BE BE2/60091A patent/BE896691A/nl not_active IP Right Cessation
- 1983-05-10 GB GB08312768A patent/GB2120248B/en not_active Expired
- 1983-05-11 FR FR8307888A patent/FR2527215B1/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FR2527215B1 (fr) | 1986-05-09 |
| DE3315115A1 (de) | 1983-11-24 |
| IT8221346A0 (it) | 1982-05-19 |
| GB8312768D0 (en) | 1983-06-15 |
| FR2527215A1 (fr) | 1983-11-25 |
| NL190813B (nl) | 1994-04-05 |
| DE3315115C2 (enExample) | 1988-12-01 |
| US4477615A (en) | 1984-10-16 |
| NL8301457A (nl) | 1983-12-16 |
| GB2120248A (en) | 1983-11-30 |
| GB2120248B (en) | 1986-03-12 |
| NL190813C (nl) | 1994-09-01 |
| BE896691A (nl) | 1983-09-01 |
| IT1152192B (it) | 1986-12-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1219583A (en) | Stabilizing agents for polymer materials | |
| DK167017B1 (da) | 2,2,6,6-tetramethylpiperidylgruppeholdige 1,3,5-triazinylforbindelser, fremgangsmaade til fremstilling deraf samt middel til stabilisering af polymerer | |
| US4086204A (en) | Novel polytriazine compounds | |
| US3925376A (en) | Piperidine derivatives | |
| KR100449430B1 (ko) | 유기물질용안정화제로서2,2,6,6-테트라메틸-4-피페리딜기를함유하는블록올리고머 | |
| AU573170B2 (en) | Alkylated polyalkylenepolyamines substituted oxo-piperazinyl-triazines and uv light stabilized compositions | |
| US4161592A (en) | Piperidinyl-s-triazines | |
| EP2130854B1 (en) | Polytriazinyl compounds as flame retardants and light stabilizers | |
| US8809533B2 (en) | Bi- or tricyclic sterically hindered alkoxyamines and process for their preparation | |
| JPS649995B2 (enExample) | ||
| JP2704633B2 (ja) | ピペリジン−トリアジン化合物および該化合物の安定剤としての用途 | |
| JPH0288571A (ja) | 有機物質用安定剤として使用するピペリジン―トリアジン化合物 | |
| US20130203904A1 (en) | Sterically hindered polymeric amines and their use as polymer stabilizers | |
| JP2799588B2 (ja) | ビス―ピペリジル―トリアジン環によって部分的に置換されたポリアミン類 | |
| KR960012369B1 (ko) | 2,2,6,6-테트라메틸피페리딘으로부터 유도되는 트리아진 화합물 | |
| JP2782449B2 (ja) | テトラメチルピペリジノ―s―トリアジン | |
| TW589341B (en) | Block oligomers containing 1-hydrocarbyloxy-2,2,6,6-tetramethyl-4-piperidyl groups as stabilizers for organic materials | |
| KR970001483B1 (ko) | 트리아진게 화합물 | |
| US3167565A (en) | 5-cyano-2-(p-aminophenyl) naphth [1,2-d]-oxazole | |
| US6316619B1 (en) | Polyaminotriazine and its production and use | |
| US4238388A (en) | Derivatives of 1,3,5-triazacycloheptane-2,4-dione and their use as polymer stabilizers | |
| JPS62129284A (ja) | 置換ジアザオキサスピロデカン、それらの製造方法および重合体用の安定剤としてのそれらの用途 | |
| CA2005235C (en) | Tetramethyl piperidyl terminated triazine oligomeric esters and amides | |
| KR19980064505A (ko) | 유기 물질용 안정화제로서 2,2,6,6-테트라메틸-4-피페리딜기를함유하는 트리아진 화합물 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |