CA1216998A - Compositions pour photopolymerisation renfermant des photosensibilisateurs amines et des composes n- heterocycliques n-oxy - Google Patents
Compositions pour photopolymerisation renfermant des photosensibilisateurs amines et des composes n- heterocycliques n-oxyInfo
- Publication number
- CA1216998A CA1216998A CA000376470A CA376470A CA1216998A CA 1216998 A CA1216998 A CA 1216998A CA 000376470 A CA000376470 A CA 000376470A CA 376470 A CA376470 A CA 376470A CA 1216998 A CA1216998 A CA 1216998A
- Authority
- CA
- Canada
- Prior art keywords
- coumarin
- composition
- photosensitizer
- heterocyclic
- diethylamino
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000203 mixture Substances 0.000 title claims abstract description 67
- 239000003504 photosensitizing agent Substances 0.000 title claims abstract description 56
- 150000001875 compounds Chemical class 0.000 claims abstract description 35
- 150000001412 amines Chemical class 0.000 claims abstract description 29
- 239000003999 initiator Substances 0.000 claims abstract description 28
- 150000003254 radicals Chemical class 0.000 claims abstract description 10
- 238000000034 method Methods 0.000 claims abstract description 8
- -1 N-pyrrolidinyl Chemical group 0.000 claims description 45
- ZYGHJZDHTFUPRJ-UHFFFAOYSA-N coumarin Chemical compound C1=CC=C2OC(=O)C=CC2=C1 ZYGHJZDHTFUPRJ-UHFFFAOYSA-N 0.000 claims description 26
- 239000012190 activator Substances 0.000 claims description 23
- VVBLNCFGVYUYGU-UHFFFAOYSA-N 4,4'-Bis(dimethylamino)benzophenone Chemical compound C1=CC(N(C)C)=CC=C1C(=O)C1=CC=C(N(C)C)C=C1 VVBLNCFGVYUYGU-UHFFFAOYSA-N 0.000 claims description 20
- 125000004429 atom Chemical group 0.000 claims description 18
- 239000012965 benzophenone Substances 0.000 claims description 16
- 229960000956 coumarin Drugs 0.000 claims description 15
- 125000000623 heterocyclic group Chemical group 0.000 claims description 15
- 125000000217 alkyl group Chemical group 0.000 claims description 14
- RWCCWEUUXYIKHB-UHFFFAOYSA-N benzophenone Chemical compound C=1C=CC=CC=1C(=O)C1=CC=CC=C1 RWCCWEUUXYIKHB-UHFFFAOYSA-N 0.000 claims description 14
- 125000004432 carbon atom Chemical group C* 0.000 claims description 13
- 235000001671 coumarin Nutrition 0.000 claims description 13
- 125000001424 substituent group Chemical group 0.000 claims description 11
- CDSULTPOCMWJCM-UHFFFAOYSA-N 4h-chromene-2,3-dione Chemical compound C1=CC=C2OC(=O)C(=O)CC2=C1 CDSULTPOCMWJCM-UHFFFAOYSA-N 0.000 claims description 10
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 8
- 125000003647 acryloyl group Chemical group O=C([*])C([H])=C([H])[H] 0.000 claims description 8
- 229910052799 carbon Inorganic materials 0.000 claims description 8
- 125000002837 carbocyclic group Chemical group 0.000 claims description 7
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 claims description 7
- 229910052753 mercury Inorganic materials 0.000 claims description 7
- 230000005855 radiation Effects 0.000 claims description 7
- 125000003342 alkenyl group Chemical group 0.000 claims description 6
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 6
- 125000003386 piperidinyl group Chemical group 0.000 claims description 6
- 125000000332 coumarinyl group Chemical group O1C(=O)C(=CC2=CC=CC=C12)* 0.000 claims description 5
- 125000005842 heteroatom Chemical group 0.000 claims description 5
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 claims description 5
- CPVJWBWVJUAOMV-UHFFFAOYSA-N 3-benzoyl-7-(diethylamino)chromen-2-one Chemical compound O=C1OC2=CC(N(CC)CC)=CC=C2C=C1C(=O)C1=CC=CC=C1 CPVJWBWVJUAOMV-UHFFFAOYSA-N 0.000 claims description 3
- BZGXVSAGPUNNHF-UHFFFAOYSA-N 7-(diethylamino)-3-(2-methoxybenzoyl)chromen-2-one Chemical compound O=C1OC2=CC(N(CC)CC)=CC=C2C=C1C(=O)C1=CC=CC=C1OC BZGXVSAGPUNNHF-UHFFFAOYSA-N 0.000 claims description 3
- ZZFQJJZCMZPXMI-UHFFFAOYSA-N 7-(diethylamino)-3-(furan-2-carbonyl)chromen-2-one Chemical compound O=C1OC2=CC(N(CC)CC)=CC=C2C=C1C(=O)C1=CC=CO1 ZZFQJJZCMZPXMI-UHFFFAOYSA-N 0.000 claims description 3
- 230000003213 activating effect Effects 0.000 claims description 3
- PSXVVEFTUBMHJR-UHFFFAOYSA-N (1,3-dioxoisoindol-2-yl) benzoate Chemical compound O=C1C2=CC=CC=C2C(=O)N1OC(=O)C1=CC=CC=C1 PSXVVEFTUBMHJR-UHFFFAOYSA-N 0.000 claims description 2
- SYXGMWCLRWOVJB-MDWZMJQESA-N (e)-1-[4-(dimethylamino)phenyl]-3-phenylprop-2-en-1-one Chemical compound C1=CC(N(C)C)=CC=C1C(=O)\C=C\C1=CC=CC=C1 SYXGMWCLRWOVJB-MDWZMJQESA-N 0.000 claims description 2
- GQYDZBRCPSLDOG-UHFFFAOYSA-N 2-(1-ethylbenzo[e][1,3]benzothiazol-2-ylidene)-1-phenylethanone Chemical compound S1C2=CC=C3C=CC=CC3=C2N(CC)C1=CC(=O)C1=CC=CC=C1 GQYDZBRCPSLDOG-UHFFFAOYSA-N 0.000 claims description 2
- RJKAFJZQRITXSK-UHFFFAOYSA-N 2-[(4-pyrrolidin-1-ylphenyl)methylidene]indene-1,3-dione Chemical compound O=C1C2=CC=CC=C2C(=O)C1=CC(C=C1)=CC=C1N1CCCC1 RJKAFJZQRITXSK-UHFFFAOYSA-N 0.000 claims description 2
- MIDWMFRRBVCKKT-UHFFFAOYSA-N 3-(1-benzofuran-2-carbonyl)-7-pyrrolidin-1-ylchromen-2-one Chemical compound C=1C2=CC=CC=C2OC=1C(=O)C(C(OC1=C2)=O)=CC1=CC=C2N1CCCC1 MIDWMFRRBVCKKT-UHFFFAOYSA-N 0.000 claims description 2
- RLFFAENULRCVMI-UHFFFAOYSA-N 3-[7-(diethylamino)-2-oxochromene-3-carbonyl]benzenesulfonyl fluoride Chemical compound O=C1OC2=CC(N(CC)CC)=CC=C2C=C1C(=O)C1=CC=CC(S(F)(=O)=O)=C1 RLFFAENULRCVMI-UHFFFAOYSA-N 0.000 claims description 2
- DWDONSBFIIUPQS-UHFFFAOYSA-N 3-benzoyl-7-(dimethylamino)chromen-2-one Chemical compound O=C1OC2=CC(N(C)C)=CC=C2C=C1C(=O)C1=CC=CC=C1 DWDONSBFIIUPQS-UHFFFAOYSA-N 0.000 claims description 2
- ASIDOSYHBCQXRT-UHFFFAOYSA-N 3-benzoyl-7-pyrrolidin-1-ylchromen-2-one Chemical compound C=1C2=CC=C(N3CCCC3)C=C2OC(=O)C=1C(=O)C1=CC=CC=C1 ASIDOSYHBCQXRT-UHFFFAOYSA-N 0.000 claims description 2
- NQZHMKXMCNEZGO-UHFFFAOYSA-N 4-[7-(diethylamino)-2-oxochromene-3-carbonyl]benzonitrile Chemical compound O=C1OC2=CC(N(CC)CC)=CC=C2C=C1C(=O)C1=CC=C(C#N)C=C1 NQZHMKXMCNEZGO-UHFFFAOYSA-N 0.000 claims description 2
- SFERXSVIUQILJJ-UHFFFAOYSA-N 7-(diethylamino)-3-(3-thiophen-2-ylprop-2-enoyl)chromen-2-one Chemical compound O=C1OC2=CC(N(CC)CC)=CC=C2C=C1C(=O)C=CC1=CC=CS1 SFERXSVIUQILJJ-UHFFFAOYSA-N 0.000 claims description 2
- NDPLUJZAURLYAE-UHFFFAOYSA-N 7-(diethylamino)-3-(4-iodobenzoyl)chromen-2-one Chemical compound O=C1OC2=CC(N(CC)CC)=CC=C2C=C1C(=O)C1=CC=C(I)C=C1 NDPLUJZAURLYAE-UHFFFAOYSA-N 0.000 claims description 2
- YCHOUXDNWWZEFY-JLHYYAGUSA-N 7-(diethylamino)-3-[(e)-3-phenylprop-2-enoyl]chromen-2-one Chemical compound O=C1OC2=CC(N(CC)CC)=CC=C2C=C1C(=O)\C=C\C1=CC=CC=C1 YCHOUXDNWWZEFY-JLHYYAGUSA-N 0.000 claims description 2
- KVMNZYVVZAVBNW-UHFFFAOYSA-N 7-(diethylamino)-3-[3-(4-ethoxyphenyl)prop-2-enoyl]chromen-2-one Chemical compound C1=CC(OCC)=CC=C1C=CC(=O)C1=CC2=CC=C(N(CC)CC)C=C2OC1=O KVMNZYVVZAVBNW-UHFFFAOYSA-N 0.000 claims description 2
- UMPGSTJFSOVGTI-UHFFFAOYSA-N 7-(diethylamino)-3-[3-[4-(diethylamino)phenyl]prop-2-enoyl]chromen-2-one Chemical compound C1=CC(N(CC)CC)=CC=C1C=CC(=O)C1=CC2=CC=C(N(CC)CC)C=C2OC1=O UMPGSTJFSOVGTI-UHFFFAOYSA-N 0.000 claims description 2
- VPZOKYTXVDEFMM-UHFFFAOYSA-N 7-(diethylamino)-3-[4-(dimethylamino)benzoyl]chromen-2-one Chemical compound O=C1OC2=CC(N(CC)CC)=CC=C2C=C1C(=O)C1=CC=C(N(C)C)C=C1 VPZOKYTXVDEFMM-UHFFFAOYSA-N 0.000 claims description 2
- SANIRTQDABNCHF-UHFFFAOYSA-N 7-(diethylamino)-3-[7-(diethylamino)-2-oxochromene-3-carbonyl]chromen-2-one Chemical compound C1=C(N(CC)CC)C=C2OC(=O)C(C(=O)C3=CC4=CC=C(C=C4OC3=O)N(CC)CC)=CC2=C1 SANIRTQDABNCHF-UHFFFAOYSA-N 0.000 claims description 2
- RHROYFNIWOPJAZ-UHFFFAOYSA-N 7-(dimethylamino)-3-(4-iodobenzoyl)chromen-2-one Chemical compound O=C1OC2=CC(N(C)C)=CC=C2C=C1C(=O)C1=CC=C(I)C=C1 RHROYFNIWOPJAZ-UHFFFAOYSA-N 0.000 claims description 2
- WAWCXEOGKCDMKT-UHFFFAOYSA-N 7-(dimethylamino)-3-(thiophene-3-carbonyl)chromen-2-one Chemical compound O=C1OC2=CC(N(C)C)=CC=C2C=C1C(=O)C=1C=CSC=1 WAWCXEOGKCDMKT-UHFFFAOYSA-N 0.000 claims description 2
- JBCSVEGQORLINP-UHFFFAOYSA-N 7-(dimethylamino)-3-[4-(dimethylamino)benzoyl]chromen-2-one Chemical compound C1=CC(N(C)C)=CC=C1C(=O)C1=CC2=CC=C(N(C)C)C=C2OC1=O JBCSVEGQORLINP-UHFFFAOYSA-N 0.000 claims description 2
- DCERUEXFPSYWCT-UHFFFAOYSA-N 7-pyrrolidin-1-yl-3-(thiophene-2-carbonyl)chromen-2-one Chemical compound C=1C2=CC=C(N3CCCC3)C=C2OC(=O)C=1C(=O)C1=CC=CS1 DCERUEXFPSYWCT-UHFFFAOYSA-N 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims 4
- 239000001257 hydrogen Substances 0.000 claims 4
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims 4
- HGHFTRHRINMDGI-UHFFFAOYSA-N 7-(diethylamino)-3-[3-(4-morpholin-4-ylphenyl)prop-2-enoyl]chromen-2-one Chemical compound O=C1OC2=CC(N(CC)CC)=CC=C2C=C1C(=O)C=CC(C=C1)=CC=C1N1CCOCC1 HGHFTRHRINMDGI-UHFFFAOYSA-N 0.000 claims 2
- SGMODQNVAQABMZ-UHFFFAOYSA-N 1,3-bis(furan-2-yl)-2-(1-methylbenzo[e][1,3]benzothiazol-2-ylidene)propane-1,3-dione Chemical compound S1C2=CC=C3C=CC=CC3=C2N(C)C1=C(C(=O)C=1OC=CC=1)C(=O)C1=CC=CO1 SGMODQNVAQABMZ-UHFFFAOYSA-N 0.000 claims 1
- KKLBPVXKMBLCQX-UHFFFAOYSA-N 2,5-bis[[4-(diethylamino)phenyl]methylidene]cyclopentan-1-one Chemical compound C1=CC(N(CC)CC)=CC=C1C=C(CC1)C(=O)C1=CC1=CC=C(N(CC)CC)C=C1 KKLBPVXKMBLCQX-UHFFFAOYSA-N 0.000 claims 1
- IZCYTEDHJCNZFO-UHFFFAOYSA-N 2-(1-methylbenzo[e][1,3]benzothiazol-2-ylidene)-1-thiophen-2-ylethanone Chemical compound S1C2=CC=C3C=CC=CC3=C2N(C)C1=CC(=O)C1=CC=CS1 IZCYTEDHJCNZFO-UHFFFAOYSA-N 0.000 claims 1
- XJIABBOWKJCQMK-UHFFFAOYSA-N 3-[3-(4-bromophenyl)prop-2-enoyl]-7-(diethylamino)chromen-2-one Chemical compound O=C1OC2=CC(N(CC)CC)=CC=C2C=C1C(=O)C=CC1=CC=C(Br)C=C1 XJIABBOWKJCQMK-UHFFFAOYSA-N 0.000 claims 1
- NRDDRFGZRQOCCM-UHFFFAOYSA-N 7-(diethylamino)-3-(4-nitrobenzoyl)chromen-2-one Chemical compound O=C1OC2=CC(N(CC)CC)=CC=C2C=C1C(=O)C1=CC=C([N+]([O-])=O)C=C1 NRDDRFGZRQOCCM-UHFFFAOYSA-N 0.000 claims 1
- DBPZPCHITDGJRR-UHFFFAOYSA-N 7-(diethylamino)-3-(5-phenylpenta-2,4-dienoyl)chromen-2-one Chemical compound O=C1OC2=CC(N(CC)CC)=CC=C2C=C1C(=O)C=CC=CC1=CC=CC=C1 DBPZPCHITDGJRR-UHFFFAOYSA-N 0.000 claims 1
- HSYRYXPRQYPBBQ-UHFFFAOYSA-N 7-(diethylamino)-3-(thiophene-2-carbonyl)chromen-2-one Chemical compound O=C1OC2=CC(N(CC)CC)=CC=C2C=C1C(=O)C1=CC=CS1 HSYRYXPRQYPBBQ-UHFFFAOYSA-N 0.000 claims 1
- BWOFOTIXJCCNQY-UHFFFAOYSA-N 7-(diethylamino)-3-[3-(4-methoxynaphthalen-1-yl)prop-2-enoyl]chromen-2-one Chemical compound C1=CC=C2C(C=CC(=O)C3=CC4=CC=C(C=C4OC3=O)N(CC)CC)=CC=C(OC)C2=C1 BWOFOTIXJCCNQY-UHFFFAOYSA-N 0.000 claims 1
- KKPYYVCCNAIGGA-UHFFFAOYSA-N 7-(diethylamino)-3-[5-[4-(dimethylamino)phenyl]penta-2,4-dienoyl]chromen-2-one Chemical compound O=C1OC2=CC(N(CC)CC)=CC=C2C=C1C(=O)C=CC=CC1=CC=C(N(C)C)C=C1 KKPYYVCCNAIGGA-UHFFFAOYSA-N 0.000 claims 1
- SHHGHGAWZFTFGS-UHFFFAOYSA-N 7-(dimethylamino)-3-(3-thiophen-2-ylprop-2-enoyl)chromen-2-one Chemical compound O=C1OC2=CC(N(C)C)=CC=C2C=C1C(=O)C=CC1=CC=CS1 SHHGHGAWZFTFGS-UHFFFAOYSA-N 0.000 claims 1
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 claims 1
- 125000005462 imide group Chemical group 0.000 claims 1
- 239000002798 polar solvent Substances 0.000 claims 1
- 229940024874 benzophenone Drugs 0.000 description 11
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- 229920000642 polymer Polymers 0.000 description 9
- 239000011230 binding agent Substances 0.000 description 8
- 150000002500 ions Chemical class 0.000 description 8
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 8
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 7
- 150000002576 ketones Chemical class 0.000 description 7
- 239000011248 coating agent Substances 0.000 description 5
- 238000000576 coating method Methods 0.000 description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 5
- 125000003118 aryl group Chemical group 0.000 description 4
- 229920001577 copolymer Polymers 0.000 description 4
- BGTOWKSIORTVQH-UHFFFAOYSA-N cyclopentanone Chemical compound O=C1CCCC1 BGTOWKSIORTVQH-UHFFFAOYSA-N 0.000 description 4
- 239000011888 foil Substances 0.000 description 4
- XKJCHHZQLQNZHY-UHFFFAOYSA-N phthalimide Chemical compound C1=CC=C2C(=O)NC(=O)C2=C1 XKJCHHZQLQNZHY-UHFFFAOYSA-N 0.000 description 4
- 238000006116 polymerization reaction Methods 0.000 description 4
- SMBSZJBWYCGCJP-UHFFFAOYSA-N 3-(diethylamino)chromen-2-one Chemical compound C1=CC=C2OC(=O)C(N(CC)CC)=CC2=C1 SMBSZJBWYCGCJP-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- NPKSPKHJBVJUKB-UHFFFAOYSA-N N-phenylglycine Chemical compound OC(=O)CNC1=CC=CC=C1 NPKSPKHJBVJUKB-UHFFFAOYSA-N 0.000 description 3
- 239000004743 Polypropylene Substances 0.000 description 3
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 3
- 150000001252 acrylic acid derivatives Chemical class 0.000 description 3
- 125000003545 alkoxy group Chemical group 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- JLKXXDAJGKKSNK-UHFFFAOYSA-N perchloric acid;pyridine Chemical compound OCl(=O)(=O)=O.C1=CC=NC=C1 JLKXXDAJGKKSNK-UHFFFAOYSA-N 0.000 description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 3
- 229920001155 polypropylene Polymers 0.000 description 3
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 238000012360 testing method Methods 0.000 description 3
- CBDKQYKMCICBOF-UHFFFAOYSA-N thiazoline Chemical compound C1CN=CS1 CBDKQYKMCICBOF-UHFFFAOYSA-N 0.000 description 3
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 3
- 229920002554 vinyl polymer Polymers 0.000 description 3
- HCLJOFJIQIJXHS-UHFFFAOYSA-N 2-[2-[2-(2-prop-2-enoyloxyethoxy)ethoxy]ethoxy]ethyl prop-2-enoate Chemical compound C=CC(=O)OCCOCCOCCOCCOC(=O)C=C HCLJOFJIQIJXHS-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 2
- 239000005977 Ethylene Substances 0.000 description 2
- BAPJBEWLBFYGME-UHFFFAOYSA-N Methyl acrylate Chemical compound COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 description 2
- 239000004952 Polyamide Substances 0.000 description 2
- 239000004698 Polyethylene Substances 0.000 description 2
- YRKCREAYFQTBPV-UHFFFAOYSA-N acetylacetone Chemical compound CC(=O)CC(C)=O YRKCREAYFQTBPV-UHFFFAOYSA-N 0.000 description 2
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- 229910052802 copper Inorganic materials 0.000 description 2
- 239000010949 copper Substances 0.000 description 2
- 238000004132 cross linking Methods 0.000 description 2
- DOIRQSBPFJWKBE-UHFFFAOYSA-N dibutyl phthalate Chemical compound CCCCOC(=O)C1=CC=CC=C1C(=O)OCCCC DOIRQSBPFJWKBE-UHFFFAOYSA-N 0.000 description 2
- 125000000219 ethylidene group Chemical group [H]C(=[*])C([H])([H])[H] 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 150000002391 heterocyclic compounds Chemical class 0.000 description 2
- 230000003993 interaction Effects 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 150000002734 metacrylic acid derivatives Chemical class 0.000 description 2
- 239000000178 monomer Substances 0.000 description 2
- 125000001624 naphthyl group Chemical group 0.000 description 2
- WXZMFSXDPGVJKK-UHFFFAOYSA-N pentaerythritol Chemical compound OCC(CO)(CO)CO WXZMFSXDPGVJKK-UHFFFAOYSA-N 0.000 description 2
- 239000004014 plasticizer Substances 0.000 description 2
- 229920002647 polyamide Polymers 0.000 description 2
- 229920000728 polyester Polymers 0.000 description 2
- 150000003839 salts Chemical group 0.000 description 2
- 230000003595 spectral effect Effects 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- VNQXSTWCDUXYEZ-LDWIPMOCSA-N (+/-)-Camphorquinone Chemical compound C1C[C@@]2(C)C(=O)C(=O)[C@@H]1C2(C)C VNQXSTWCDUXYEZ-LDWIPMOCSA-N 0.000 description 1
- PRDAOFFSXSFTPA-UHFFFAOYSA-N (1,3-dioxoisoindol-2-yl) 2-cyanobenzoate Chemical compound C(#N)C1=C(C(=O)ON2C(C=3C(C2=O)=CC=CC3)=O)C=CC=C1 PRDAOFFSXSFTPA-UHFFFAOYSA-N 0.000 description 1
- BFCNIOLRCHODJL-UHFFFAOYSA-N (1,3-dioxoisoindol-2-yl) benzenesulfonate Chemical compound O=C1C2=CC=CC=C2C(=O)N1OS(=O)(=O)C1=CC=CC=C1 BFCNIOLRCHODJL-UHFFFAOYSA-N 0.000 description 1
- UOCLXMDMGBRAIB-UHFFFAOYSA-N 1,1,1-trichloroethane Chemical compound CC(Cl)(Cl)Cl UOCLXMDMGBRAIB-UHFFFAOYSA-N 0.000 description 1
- FEBPYUHMNSECIE-UHFFFAOYSA-M 1-ethoxy-2-methylpyridin-1-ium;iodide Chemical compound [I-].CCO[N+]1=CC=CC=C1C FEBPYUHMNSECIE-UHFFFAOYSA-M 0.000 description 1
- ABFDKXBSQCTIKH-UHFFFAOYSA-M 1-ethylpyridin-1-ium;bromide Chemical compound [Br-].CC[N+]1=CC=CC=C1 ABFDKXBSQCTIKH-UHFFFAOYSA-M 0.000 description 1
- LBBKMDNGHBSIEV-UHFFFAOYSA-N 1-methoxy-2-methylpyridin-1-ium Chemical compound CO[N+]1=CC=CC=C1C LBBKMDNGHBSIEV-UHFFFAOYSA-N 0.000 description 1
- VVVGYLBJHAFVPQ-UHFFFAOYSA-M 1-methoxy-2-methylpyridin-1-ium;4-methylbenzenesulfonate Chemical compound CO[N+]1=CC=CC=C1C.CC1=CC=C(S([O-])(=O)=O)C=C1 VVVGYLBJHAFVPQ-UHFFFAOYSA-M 0.000 description 1
- VOBUAPTXJKMNCT-UHFFFAOYSA-N 1-prop-2-enoyloxyhexyl prop-2-enoate Chemical class CCCCCC(OC(=O)C=C)OC(=O)C=C VOBUAPTXJKMNCT-UHFFFAOYSA-N 0.000 description 1
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 1
- HWSSEYVMGDIFMH-UHFFFAOYSA-N 2-[2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethoxy]ethyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCCOCCOCCOC(=O)C(C)=C HWSSEYVMGDIFMH-UHFFFAOYSA-N 0.000 description 1
- IAOCAMCUNSVVNE-UHFFFAOYSA-L 2-methyl-1-[4-(2-methylpyridin-1-ium-1-yl)oxybutoxy]pyridin-1-ium;dibromide Chemical compound [Br-].[Br-].CC1=CC=CC=[N+]1OCCCCO[N+]1=CC=CC=C1C IAOCAMCUNSVVNE-UHFFFAOYSA-L 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- POTFCSBOXWLDJQ-UHFFFAOYSA-N 3-(2-oxo-5,7-dipropoxychromene-3-carbonyl)-5,7-dipropoxychromen-2-one Chemical compound C1=C(OCCC)C=C2OC(=O)C(C(=O)C3=CC4=C(OCCC)C=C(C=C4OC3=O)OCCC)=CC2=C1OCCC POTFCSBOXWLDJQ-UHFFFAOYSA-N 0.000 description 1
- MVVFUAACPKXXKJ-UHFFFAOYSA-N 4,5-dihydro-1,3-selenazole Chemical compound C1CN=C[Se]1 MVVFUAACPKXXKJ-UHFFFAOYSA-N 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- SJVGFKBLUYAEOK-SFHVURJKSA-N 6-[4-[(3S)-3-(3,5-difluorophenyl)-3,4-dihydropyrazole-2-carbonyl]piperidin-1-yl]pyrimidine-4-carbonitrile Chemical compound FC=1C=C(C=C(C=1)F)[C@@H]1CC=NN1C(=O)C1CCN(CC1)C1=CC(=NC=N1)C#N SJVGFKBLUYAEOK-SFHVURJKSA-N 0.000 description 1
- QXAMGWKESXGGNV-UHFFFAOYSA-N 7-(diethylamino)-1-benzopyran-2-one Chemical compound C1=CC(=O)OC2=CC(N(CC)CC)=CC=C21 QXAMGWKESXGGNV-UHFFFAOYSA-N 0.000 description 1
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 1
- 241001024304 Mino Species 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- 206010034960 Photophobia Diseases 0.000 description 1
- 239000004721 Polyphenylene oxide Substances 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- 102000003800 Selectins Human genes 0.000 description 1
- 108090000184 Selectins Proteins 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- QYKIQEUNHZKYBP-UHFFFAOYSA-N Vinyl ether Chemical class C=COC=C QYKIQEUNHZKYBP-UHFFFAOYSA-N 0.000 description 1
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000003926 acrylamides Chemical class 0.000 description 1
- 238000012644 addition polymerization Methods 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 125000005250 alkyl acrylate group Chemical group 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 150000004056 anthraquinones Chemical class 0.000 description 1
- RJGDLRCDCYRQOQ-UHFFFAOYSA-N anthrone Chemical compound C1=CC=C2C(=O)C3=CC=CC=C3CC2=C1 RJGDLRCDCYRQOQ-UHFFFAOYSA-N 0.000 description 1
- HNYOPLTXPVRDBG-UHFFFAOYSA-N barbituric acid Chemical compound O=C1CC(=O)NC(=O)N1 HNYOPLTXPVRDBG-UHFFFAOYSA-N 0.000 description 1
- QVQLCTNNEUAWMS-UHFFFAOYSA-N barium oxide Chemical compound [Ba]=O QVQLCTNNEUAWMS-UHFFFAOYSA-N 0.000 description 1
- 229910001864 baryta Inorganic materials 0.000 description 1
- XJHABGPPCLHLLV-UHFFFAOYSA-N benzo[de]isoquinoline-1,3-dione Chemical compound C1=CC(C(=O)NC2=O)=C3C2=CC=CC3=C1 XJHABGPPCLHLLV-UHFFFAOYSA-N 0.000 description 1
- 125000004618 benzofuryl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 125000001231 benzoyloxy group Chemical group C(C1=CC=CC=C1)(=O)O* 0.000 description 1
- 125000000649 benzylidene group Chemical group [H]C(=[*])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 230000008033 biological extinction Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 125000004106 butoxy group Chemical group [*]OC([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000000919 ceramic Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 229940000425 combination drug Drugs 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 238000007766 curtain coating Methods 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 150000003997 cyclic ketones Chemical class 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 125000004386 diacrylate group Chemical group 0.000 description 1
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 1
- 238000000295 emission spectrum Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- SUPCQIBBMFXVTL-UHFFFAOYSA-N ethyl 2-methylprop-2-enoate Chemical compound CCOC(=O)C(C)=C SUPCQIBBMFXVTL-UHFFFAOYSA-N 0.000 description 1
- LYCAIKOWRPUZTN-UHFFFAOYSA-N ethylene glycol Natural products OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 1
- 150000008376 fluorenones Chemical class 0.000 description 1
- UQSQSQZYBQSBJZ-UHFFFAOYSA-M fluorosulfonate Chemical compound [O-]S(F)(=O)=O UQSQSQZYBQSBJZ-UHFFFAOYSA-M 0.000 description 1
- 238000005755 formation reaction Methods 0.000 description 1
- 238000012682 free radical photopolymerization Methods 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 229920001519 homopolymer Polymers 0.000 description 1
- 125000001145 hydrido group Chemical group *[H] 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 150000004693 imidazolium salts Chemical class 0.000 description 1
- 150000003949 imides Chemical group 0.000 description 1
- 125000000468 ketone group Chemical group 0.000 description 1
- 208000013469 light sensitivity Diseases 0.000 description 1
- CDOSHBSSFJOMGT-UHFFFAOYSA-N linalool Chemical compound CC(C)=CCCC(C)(O)C=C CDOSHBSSFJOMGT-UHFFFAOYSA-N 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- FQPSGWSUVKBHSU-UHFFFAOYSA-N methacrylamide Chemical class CC(=C)C(N)=O FQPSGWSUVKBHSU-UHFFFAOYSA-N 0.000 description 1
- 238000004377 microelectronic Methods 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- RLZZZVKAURTHCP-UHFFFAOYSA-N phenanthrene-3,4-diol Chemical compound C1=CC=C2C3=C(O)C(O)=CC=C3C=CC2=C1 RLZZZVKAURTHCP-UHFFFAOYSA-N 0.000 description 1
- 150000003003 phosphines Chemical class 0.000 description 1
- AQSJGOWTSHOLKH-UHFFFAOYSA-N phosphite(3-) Chemical class [O-]P([O-])[O-] AQSJGOWTSHOLKH-UHFFFAOYSA-N 0.000 description 1
- 229920002120 photoresistant polymer Polymers 0.000 description 1
- 229920000570 polyether Polymers 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920005862 polyol Polymers 0.000 description 1
- 229920000098 polyolefin Polymers 0.000 description 1
- 150000003077 polyols Chemical class 0.000 description 1
- 229920000136 polysorbate Polymers 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- AAEVYOVXGOFMJO-UHFFFAOYSA-N prometryn Chemical compound CSC1=NC(NC(C)C)=NC(NC(C)C)=N1 AAEVYOVXGOFMJO-UHFFFAOYSA-N 0.000 description 1
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- OENLEHTYJXMVBG-UHFFFAOYSA-N pyridine;hydrate Chemical compound [OH-].C1=CC=[NH+]C=C1 OENLEHTYJXMVBG-UHFFFAOYSA-N 0.000 description 1
- JUJWROOIHBZHMG-UHFFFAOYSA-O pyridinium Chemical compound C1=CC=[NH+]C=C1 JUJWROOIHBZHMG-UHFFFAOYSA-O 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 125000006850 spacer group Chemical group 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 150000003440 styrenes Chemical class 0.000 description 1
- 125000005504 styryl group Chemical group 0.000 description 1
- 150000003453 sulfinic acid esters Chemical class 0.000 description 1
- 125000004964 sulfoalkyl group Chemical group 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 150000003871 sulfonates Chemical class 0.000 description 1
- 229920001897 terpolymer Polymers 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-M toluene-4-sulfonate Chemical compound CC1=CC=C(S([O-])(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-M 0.000 description 1
- ILJSQTXMGCGYMG-UHFFFAOYSA-N triacetic acid Chemical compound CC(=O)CC(=O)CC(O)=O ILJSQTXMGCGYMG-UHFFFAOYSA-N 0.000 description 1
- 229920001567 vinyl ester resin Polymers 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
- 229910052724 xenon Inorganic materials 0.000 description 1
- FHNFHKCVQCLJFQ-UHFFFAOYSA-N xenon atom Chemical compound [Xe] FHNFHKCVQCLJFQ-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F2/00—Processes of polymerisation
- C08F2/46—Polymerisation initiated by wave energy or particle radiation
- C08F2/48—Polymerisation initiated by wave energy or particle radiation by ultraviolet or visible light
- C08F2/50—Polymerisation initiated by wave energy or particle radiation by ultraviolet or visible light with sensitising agents
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polymerisation Methods In General (AREA)
Applications Claiming Priority (2)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
US18585480A | 1980-09-10 | 1980-09-10 | |
US185,854 | 1980-09-10 |
Publications (1)
Publication Number | Publication Date |
---|---|
CA1216998A true CA1216998A (fr) | 1987-01-20 |
Family
ID=22682702
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
CA000376470A Expired CA1216998A (fr) | 1980-09-10 | 1981-04-29 | Compositions pour photopolymerisation renfermant des photosensibilisateurs amines et des composes n- heterocycliques n-oxy |
Country Status (5)
Country | Link |
---|---|
JP (1) | JPS5783501A (fr) |
CA (1) | CA1216998A (fr) |
DE (1) | DE3135399A1 (fr) |
FR (1) | FR2489982B1 (fr) |
GB (1) | GB2083832B (fr) |
Families Citing this family (31)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
JPS62123450A (ja) * | 1985-07-09 | 1987-06-04 | Hitachi Chem Co Ltd | 光重合性組成物 |
DE3606155A1 (de) * | 1986-02-26 | 1987-08-27 | Basf Ag | Photopolymerisierbares gemisch, dieses enthaltendes lichtempfindliches aufzeichnungselement sowie verfahren zur herstellung einer flachdruckform mittels dieses lichtempfindlichen aufzeichnungselements |
US4743529A (en) * | 1986-11-21 | 1988-05-10 | Eastman Kodak Company | Negative working photoresists responsive to shorter visible wavelengths and novel coated articles |
US4743530A (en) * | 1986-11-21 | 1988-05-10 | Eastman Kodak Company | Negative working photoresists responsive to longer wavelengths and novel coated articles |
US4743531A (en) * | 1986-11-21 | 1988-05-10 | Eastman Kodak Company | Dye sensitized photographic imaging system |
US4743528A (en) * | 1986-11-21 | 1988-05-10 | Eastman Kodak Company | Enhanced imaging composition containing an azinium activator |
EP0269397A3 (fr) * | 1986-11-21 | 1988-12-07 | EASTMAN KODAK COMPANY (a New Jersey corporation) | Système photographique pour l'enregistrement de l'image, sensibilisé par des colorants |
DE3717037A1 (de) * | 1987-05-21 | 1988-12-08 | Basf Ag | Photopolymerisierbare aufzeichnungsmaterialien sowie photoresistschichten und flachdruckplatten auf basis dieser aufzeichnungsmaterialien |
US4855213A (en) * | 1987-06-30 | 1989-08-08 | Eastman Kodak Company | Novel polymethine dyes and imaging compositions |
US4839274A (en) * | 1987-06-30 | 1989-06-13 | Eastman Kodak Company | Novel polymethine dyes and UV absorbers containing a triarylborylisocyano group and imaging compositions containing these dyes |
US4839260A (en) * | 1987-06-30 | 1989-06-13 | Eastman Kodak Company | Novel polymethine dyes and UV absorbers and imaging materials for their use |
US4859572A (en) * | 1988-05-02 | 1989-08-22 | Eastman Kodak Company | Dye sensitized photographic imaging system |
US4973694A (en) * | 1988-05-09 | 1990-11-27 | Eastman Kodak Company | Benzofuran dyes containing a coumarin nucleus |
EP0441232A3 (en) * | 1990-02-09 | 1992-10-14 | Basf Aktiengesellschaft | Cationic photopolymerisation process |
DE4102173A1 (de) * | 1991-01-25 | 1992-07-30 | Basf Ag | Lagerstabile loesung eines carboxylgruppenhaltigen copolymerisats sowie verfahren zur herstellung von photoempfindlichen lacken und offsetdruckplatten |
GB9609439D0 (en) * | 1996-05-04 | 1996-07-10 | Zeneca Ltd | Polymerisable composition |
TW455616B (en) * | 1997-11-03 | 2001-09-21 | Ciba Sc Holding Ag | New quinolinium dyes and borates, combinations thereof as photoinitiator compositions and photopolymerizable compositions comprising these photoinitiators |
US6376163B1 (en) * | 2000-02-22 | 2002-04-23 | Eastman Kodak Company | Photobleachable composition, photographic element containing the composition and photobleachable method |
EP2236488A1 (fr) | 2001-03-30 | 2010-10-06 | The Arizona Board of Regents on behalf of the University of Arizona | Matériaux, procédés et utilisations pour la génération photochimique d'acides et/ou d'espèces radicales |
US20040091811A1 (en) | 2002-10-30 | 2004-05-13 | Munnelly Heidi M. | Hetero-substituted aryl acetic acid co-initiators for IR-sensitive compositions |
US7056639B2 (en) | 2001-08-21 | 2006-06-06 | Eastman Kodak Company | Imageable composition containing an infrared absorber with counter anion derived from a non-volatile acid |
US7365104B2 (en) | 2005-03-31 | 2008-04-29 | Eastman Kodak Company | Light curable articles containing azinium salts |
US8399533B2 (en) | 2010-11-15 | 2013-03-19 | Eastman Kodak Company | Photocurable compositions containing N-oxyazinium salt photoinitiators |
US20120122664A1 (en) | 2010-11-15 | 2012-05-17 | Deepak Shukla | Photoinitiator compositions |
US9365658B2 (en) | 2010-11-15 | 2016-06-14 | Eastman Kodak Company | Method of photocuring acrylate compositions |
US8816211B2 (en) | 2011-02-14 | 2014-08-26 | Eastman Kodak Company | Articles with photocurable and photocured compositions |
US20120208914A1 (en) | 2011-02-14 | 2012-08-16 | Deepak Shukla | Photoinitiator compositions and uses |
US20120207935A1 (en) | 2011-02-14 | 2012-08-16 | Deepak Shukla | Photocurable inks and methods of use |
US9475889B2 (en) | 2011-05-16 | 2016-10-25 | Eastman Kodak Company | Photoinitiator and photocurable compositions and uses |
WO2016106062A1 (fr) | 2014-12-23 | 2016-06-30 | Bridgestone Americas Tire Operations, Llc | Mélanges polymères durcissables par un rayonnement actinique, mélanges polymères durcis, et procédés connexes |
JP7131499B2 (ja) * | 2018-08-09 | 2022-09-06 | 信越化学工業株式会社 | レジスト材料及びパターン形成方法 |
Family Cites Families (5)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US3359109A (en) * | 1964-04-29 | 1967-12-19 | Du Pont | Leuco dye-n, n. o-triacylhydroxylamine light-sensitive dye former compositions |
US3574622A (en) * | 1968-10-09 | 1971-04-13 | Eastman Kodak Co | Photopolymerization using n-alkoxy heterocyclic initiators |
US4147552A (en) * | 1976-05-21 | 1979-04-03 | Eastman Kodak Company | Light-sensitive compositions with 3-substituted coumarin compounds as spectral sensitizers |
GB2029423A (en) * | 1978-08-25 | 1980-03-19 | Agfa Gevaert Nv | Photo-polymerisable materials and recording method |
JPS55118030A (en) * | 1979-03-06 | 1980-09-10 | Fuji Photo Film Co Ltd | Photopolymerizable composition |
-
1981
- 1981-04-29 CA CA000376470A patent/CA1216998A/fr not_active Expired
- 1981-09-07 DE DE19813135399 patent/DE3135399A1/de not_active Withdrawn
- 1981-09-09 FR FR8117068A patent/FR2489982B1/fr not_active Expired
- 1981-09-10 JP JP14314881A patent/JPS5783501A/ja active Pending
- 1981-09-10 GB GB8127386A patent/GB2083832B/en not_active Expired
Also Published As
Publication number | Publication date |
---|---|
GB2083832B (en) | 1984-07-25 |
DE3135399A1 (de) | 1982-07-22 |
GB2083832A (en) | 1982-03-31 |
FR2489982B1 (fr) | 1986-02-21 |
JPS5783501A (en) | 1982-05-25 |
FR2489982A1 (fr) | 1982-03-12 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
CA1216998A (fr) | Compositions pour photopolymerisation renfermant des photosensibilisateurs amines et des composes n- heterocycliques n-oxy | |
US4366228A (en) | Photopolymerizable compositions featuring novel co-initiators | |
US4278751A (en) | Photopolymerization co-initiator compositions comprising amine-substituted ketocoumarins and certain acetic acid derivative activators | |
DE3822909C2 (de) | Photopolymerisierbares Gemisch | |
US4258121A (en) | Photopolymerizable compositions | |
CA1338095C (fr) | Composition photopolymerisable | |
AT406777B (de) | Borat photoinitiatoren aus monoboranen | |
US4062686A (en) | Sensitizers for photocrosslinkable polymers | |
DE3907666A1 (de) | Photopolymerisierbare zusammensetzung | |
JPS6341484A (ja) | チタノセン、それらの製造法およびそれらを含有する組成物 | |
JPH06175553A (ja) | ホログラム記録媒体及びそれを用いた体積位相型ホログラムの製造方法 | |
JPS5942684B2 (ja) | 感光性組成物 | |
JP2677457B2 (ja) | 光重合性組成物 | |
JPH07505911A (ja) | 光重合可能な組成物のための可視の光増感剤 | |
CA1137695A (fr) | Compositions photopolymerisables avec de nouveaux co-initiateurs | |
AU603235B2 (en) | Photopolymerizable composition | |
US5100755A (en) | Dye-benzyltriaryl borate photoinitiators and photohardenable composition containing these photoinitiators | |
EP0022188B1 (fr) | Compositions de co-initiateurs pour photopolymérisation avec des 3-acyl-coumarines, composition photopolymérisable et élément photographique | |
US5230986A (en) | Photosensitive compositions containing benzospiropyrans and uses thereof | |
US4774163A (en) | Photopolymerizable composition including an unsaturated monomer, a photopolymerization initator and a carbozole compound | |
EP0242330B1 (fr) | Mélange de photo-initiateurs liquides | |
AU606231B2 (en) | Photopolymerizable composition | |
USRE27922E (en) | Image-forming elements containing cross- linkable polymer compositions and processes for their use | |
Tanabe et al. | Visible light photopolymerization: Synthesis of new fluorone dyes and photopolymerization of acrylic monomers using them | |
JP3385421B2 (ja) | 光重合可能な組成物 |
Legal Events
Date | Code | Title | Description |
---|---|---|---|
MKEX | Expiry |