CA1182804A - Process for polymerising conjugate diolefins, and means suitable for this purpose - Google Patents
Process for polymerising conjugate diolefins, and means suitable for this purposeInfo
- Publication number
- CA1182804A CA1182804A CA000412148A CA412148A CA1182804A CA 1182804 A CA1182804 A CA 1182804A CA 000412148 A CA000412148 A CA 000412148A CA 412148 A CA412148 A CA 412148A CA 1182804 A CA1182804 A CA 1182804A
- Authority
- CA
- Canada
- Prior art keywords
- catalytic system
- alkyl
- reaction
- aryl
- carried out
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims abstract description 12
- 150000001993 dienes Chemical class 0.000 title claims abstract description 9
- 230000003197 catalytic effect Effects 0.000 claims abstract description 19
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 10
- 150000002367 halogens Chemical class 0.000 claims abstract description 9
- 150000001875 compounds Chemical class 0.000 claims abstract description 8
- 229910052751 metal Inorganic materials 0.000 claims abstract description 8
- 239000002184 metal Substances 0.000 claims abstract description 8
- 230000000737 periodic effect Effects 0.000 claims abstract description 4
- 238000006243 chemical reaction Methods 0.000 claims description 10
- 125000000217 alkyl group Chemical group 0.000 claims description 8
- 125000003118 aryl group Chemical group 0.000 claims description 8
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 7
- 229930195733 hydrocarbon Natural products 0.000 claims description 7
- 150000002430 hydrocarbons Chemical class 0.000 claims description 7
- 150000002736 metal compounds Chemical class 0.000 claims description 7
- 239000000203 mixture Substances 0.000 claims description 6
- 239000004215 Carbon black (E152) Substances 0.000 claims description 5
- 229910052794 bromium Inorganic materials 0.000 claims description 5
- 229910052801 chlorine Inorganic materials 0.000 claims description 5
- 229920006395 saturated elastomer Polymers 0.000 claims description 5
- 239000002904 solvent Substances 0.000 claims description 5
- 239000003085 diluting agent Substances 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- -1 organometallic aluminium compounds Chemical class 0.000 claims description 4
- 125000001931 aliphatic group Chemical group 0.000 claims description 3
- 150000001399 aluminium compounds Chemical class 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 239000004593 Epoxy Substances 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000002877 alkyl aryl group Chemical group 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 2
- 229920002554 vinyl polymer Polymers 0.000 claims description 2
- 229940077746 antacid containing aluminium compound Drugs 0.000 claims 1
- 150000002798 neodymium compounds Chemical class 0.000 claims 1
- 230000000379 polymerizing effect Effects 0.000 claims 1
- 150000003114 praseodymium compounds Chemical class 0.000 claims 1
- 229930195734 saturated hydrocarbon Natural products 0.000 claims 1
- 229920000642 polymer Polymers 0.000 abstract description 21
- 239000004411 aluminium Substances 0.000 abstract description 4
- 229910052782 aluminium Inorganic materials 0.000 abstract description 4
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 abstract description 4
- 229920001577 copolymer Polymers 0.000 abstract description 4
- 229910052779 Neodymium Inorganic materials 0.000 abstract 1
- QEFYFXOXNSNQGX-UHFFFAOYSA-N neodymium atom Chemical compound [Nd] QEFYFXOXNSNQGX-UHFFFAOYSA-N 0.000 abstract 1
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 36
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 24
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 11
- 239000000178 monomer Substances 0.000 description 8
- 239000000243 solution Substances 0.000 description 8
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 description 7
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 239000000306 component Substances 0.000 description 6
- 239000003054 catalyst Substances 0.000 description 5
- 239000005062 Polybutadiene Substances 0.000 description 4
- 235000019441 ethanol Nutrition 0.000 description 4
- 229920002857 polybutadiene Polymers 0.000 description 4
- 238000004458 analytical method Methods 0.000 description 3
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- NBRKLOOSMBRFMH-UHFFFAOYSA-N tert-butyl chloride Chemical compound CC(C)(C)Cl NBRKLOOSMBRFMH-UHFFFAOYSA-N 0.000 description 3
- PMJHHCWVYXUKFD-SNAWJCMRSA-N (E)-1,3-pentadiene Chemical compound C\C=C\C=C PMJHHCWVYXUKFD-SNAWJCMRSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 229910000831 Steel Inorganic materials 0.000 description 2
- ZDVDCDLBOLSVGM-UHFFFAOYSA-N [chloro(phenyl)methyl]benzene Chemical compound C=1C=CC=CC=1C(Cl)C1=CC=CC=C1 ZDVDCDLBOLSVGM-UHFFFAOYSA-N 0.000 description 2
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 2
- 229940073608 benzyl chloride Drugs 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 238000009826 distribution Methods 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 239000003701 inert diluent Substances 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- XMJHPCRAQCTCFT-UHFFFAOYSA-N methyl chloroformate Chemical compound COC(Cl)=O XMJHPCRAQCTCFT-UHFFFAOYSA-N 0.000 description 2
- PMJHHCWVYXUKFD-UHFFFAOYSA-N piperylene Natural products CC=CC=C PMJHHCWVYXUKFD-UHFFFAOYSA-N 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 239000010959 steel Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- JBWKIWSBJXDJDT-UHFFFAOYSA-N triphenylmethyl chloride Chemical compound C=1C=CC=CC=1C(C=1C=CC=CC=1)(Cl)C1=CC=CC=C1 JBWKIWSBJXDJDT-UHFFFAOYSA-N 0.000 description 2
- 238000013022 venting Methods 0.000 description 2
- JEQDSBVHLKBEIZ-REOHCLBHSA-N (2s)-2-chloropropanoyl chloride Chemical compound C[C@H](Cl)C(Cl)=O JEQDSBVHLKBEIZ-REOHCLBHSA-N 0.000 description 1
- XEMRAKSQROQPBR-UHFFFAOYSA-N (trichloromethyl)benzene Chemical compound ClC(Cl)(Cl)C1=CC=CC=C1 XEMRAKSQROQPBR-UHFFFAOYSA-N 0.000 description 1
- VFWCMGCRMGJXDK-UHFFFAOYSA-N 1-chlorobutane Chemical group CCCCCl VFWCMGCRMGJXDK-UHFFFAOYSA-N 0.000 description 1
- OSDWBNJEKMUWAV-UHFFFAOYSA-N Allyl chloride Chemical compound ClCC=C OSDWBNJEKMUWAV-UHFFFAOYSA-N 0.000 description 1
- CAHQGWAXKLQREW-UHFFFAOYSA-N Benzal chloride Chemical compound ClC(Cl)C1=CC=CC=C1 CAHQGWAXKLQREW-UHFFFAOYSA-N 0.000 description 1
- 101710180448 CD-NTase-associated protein 7 Proteins 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- 238000005481 NMR spectroscopy Methods 0.000 description 1
- 150000001206 Neodymium Chemical class 0.000 description 1
- 229910052777 Praseodymium Inorganic materials 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 230000004075 alteration Effects 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 125000000649 benzylidene group Chemical group [H]C(=[*])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 150000001649 bromium compounds Chemical group 0.000 description 1
- ZYSAVXVGWOCMMF-UHFFFAOYSA-N bromo formate Chemical compound BrOC=O ZYSAVXVGWOCMMF-UHFFFAOYSA-N 0.000 description 1
- 239000013522 chelant Substances 0.000 description 1
- 230000015271 coagulation Effects 0.000 description 1
- 238000005345 coagulation Methods 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 229910052747 lanthanoid Inorganic materials 0.000 description 1
- 150000002602 lanthanoids Chemical class 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- 229910001507 metal halide Inorganic materials 0.000 description 1
- 150000005309 metal halides Chemical class 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 150000004682 monohydrates Chemical class 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 125000002524 organometallic group Chemical group 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- PUDIUYLPXJFUGB-UHFFFAOYSA-N praseodymium atom Chemical compound [Pr] PUDIUYLPXJFUGB-UHFFFAOYSA-N 0.000 description 1
- RZWZRACFZGVKFM-UHFFFAOYSA-N propanoyl chloride Chemical compound CCC(Cl)=O RZWZRACFZGVKFM-UHFFFAOYSA-N 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 150000002909 rare earth metal compounds Chemical class 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 239000005060 rubber Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F36/00—Homopolymers and copolymers of compounds having one or more unsaturated aliphatic radicals, at least one having two or more carbon-to-carbon double bonds
- C08F36/02—Homopolymers and copolymers of compounds having one or more unsaturated aliphatic radicals, at least one having two or more carbon-to-carbon double bonds the radical having only two carbon-to-carbon double bonds
- C08F36/04—Homopolymers and copolymers of compounds having one or more unsaturated aliphatic radicals, at least one having two or more carbon-to-carbon double bonds the radical having only two carbon-to-carbon double bonds conjugated
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Transition And Organic Metals Composition Catalysts For Addition Polymerization (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Polymerization Catalysts (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT24160/81A IT1140452B (it) | 1981-09-25 | 1981-09-25 | Procedimento per la polimerizzazione di diolefine coniugate e mezzi adatti allo scopo |
| IT24160A/81 | 1981-09-25 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1182804A true CA1182804A (en) | 1985-02-19 |
Family
ID=11212298
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000412148A Expired CA1182804A (en) | 1981-09-25 | 1982-09-24 | Process for polymerising conjugate diolefins, and means suitable for this purpose |
Country Status (21)
| Country | Link |
|---|---|
| US (1) | US4444903A (enFirst) |
| EP (1) | EP0076535B1 (enFirst) |
| JP (1) | JPS5867705A (enFirst) |
| AR (1) | AR245943A1 (enFirst) |
| AU (1) | AU564970B2 (enFirst) |
| BR (1) | BR8205374A (enFirst) |
| CA (1) | CA1182804A (enFirst) |
| CS (1) | CS249511B2 (enFirst) |
| DD (2) | DD214617A5 (enFirst) |
| DE (1) | DE3276436D1 (enFirst) |
| EG (1) | EG17884A (enFirst) |
| ES (2) | ES516703A0 (enFirst) |
| IE (1) | IE53557B1 (enFirst) |
| IN (1) | IN157598B (enFirst) |
| IT (1) | IT1140452B (enFirst) |
| MX (1) | MX162400A (enFirst) |
| PL (1) | PL140371B1 (enFirst) |
| PT (1) | PT75607B (enFirst) |
| TR (1) | TR21230A (enFirst) |
| YU (2) | YU43644B (enFirst) |
| ZA (1) | ZA826371B (enFirst) |
Families Citing this family (46)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IT1164238B (it) * | 1983-05-25 | 1987-04-08 | Anic Spa | Procedimento per la polimerizzazione del butadiene |
| US4695669A (en) * | 1986-09-02 | 1987-09-22 | The Dow Chemical Company | Process for propylene dimerization |
| US4855523A (en) * | 1987-08-27 | 1989-08-08 | The Dow Chemical Company | Catalyst and process for the selective dimerization of propylene to 4-methyl-1-pentene |
| GB8830007D0 (en) * | 1988-12-22 | 1989-02-15 | Enichem Elastomers | Polymerization of butadiene |
| IT1265048B1 (it) * | 1993-08-06 | 1996-10-28 | Eniricerche Spa | Complessi metallorganici dei lantanidi e loro uso nella polimerizzazione di monomeri insaturi |
| IT1265049B1 (it) * | 1993-08-06 | 1996-10-28 | Eniricerche Spa | Complessi alogenati dei lantanidi e loro uso nella polimerizzazione di monomeri insaturi |
| DE4334045A1 (de) * | 1993-10-06 | 1995-04-13 | Bayer Ag | Katalysator, dessen Herstellung und Verwendung zur Gasphasenpolymerisation von konjugierten Dienen |
| US5428119A (en) * | 1993-11-09 | 1995-06-27 | Polysar Rubber Corporation | Process for polybutadiene production using catalyst with high activity |
| IT1273753B (it) * | 1994-02-11 | 1997-07-10 | Eniriceche Spa | Sistema catalitico e processo per la produzione di polidiolefine |
| US5914377A (en) * | 1995-04-04 | 1999-06-22 | Bayer Ag | Method for the production of diene rubbers in the gas phase |
| DE19746266A1 (de) | 1997-10-20 | 1999-04-22 | Bayer Ag | Katalysator auf Basis von Verbindungen der seltenen Erdmetalle für die Polymerisation von ungesättigten organischen Verbindungen |
| KR100308781B1 (ko) * | 1999-08-09 | 2001-09-26 | 박찬구 | 폴리부타디엔의 분자량 조절 방법 |
| DE10115106A1 (de) | 2001-03-27 | 2002-10-10 | Bayer Ag | Blockcopolymerisat auf Basis von konjugierten Diolefinen und polaren Monomeren |
| RU2205192C1 (ru) * | 2001-09-04 | 2003-05-27 | Федеральное государственное унитарное предприятие "Научно-исследовательский институт синтетического каучука им. акад. С.В. Лебедева" | Способ получения катализатора сополимеризации сопряженных диенов |
| RU2206577C2 (ru) * | 2001-09-04 | 2003-06-20 | Федеральное государственное унитарное предприятие "Научно-исследовательский институт синтетического каучука им. акад. С.В. Лебедева" | Способ получения катализатора полимеризации бутадиена |
| RU2206578C2 (ru) * | 2001-09-04 | 2003-06-20 | Федеральное государственное унитарное предприятие "Научно-исследовательский институт синтетического каучука им. акад. С.В. Лебедева" | Способ получения катализатора полимеризации изопрена |
| US9226876B2 (en) * | 2001-10-19 | 2016-01-05 | The Goodyear Tire & Rubber Company | Rubber for baby bottle nipples, pacifiers, and syringe plungers |
| US6871751B2 (en) * | 2001-10-19 | 2005-03-29 | The Goodyear Tire & Rubber Company | Rubber for baby bottle nipples, pacifiers, & syringe plungers |
| US6780948B2 (en) | 2002-03-28 | 2004-08-24 | The Goodyear Tire & Rubber Company | Synthesis of polyisoprene with neodymium catalyst |
| KR100553249B1 (ko) * | 2003-05-15 | 2006-02-20 | 금호석유화학 주식회사 | 고 1,4-시스 폴리부타디엔-폴리우레탄 공중합체 및 그 제조방법 |
| CN1528794A (zh) * | 2003-09-25 | 2004-09-15 | 中国科学院长春应用化学研究所 | 稀土顺丁橡胶分子质量分布的调节方法 |
| US7094849B2 (en) * | 2003-12-15 | 2006-08-22 | Bridgestone Corporation | Bulk polymerization process for producing polydienes |
| US7091150B2 (en) * | 2003-12-19 | 2006-08-15 | The Goodyear Tire & Rubber Company | Synthetic polyisoprene rubber |
| RU2267355C2 (ru) * | 2003-12-22 | 2006-01-10 | Открытое акционерное общество "Нижнекамскнефтехим" | Способ получения катализатора полимеризации бутадиена и сополимеризации бутадиена с сопряженными диенами |
| US7351776B2 (en) | 2004-03-02 | 2008-04-01 | Bridgestone Corporation | Bulk polymerization process |
| DE102004022676A1 (de) * | 2004-05-07 | 2005-12-15 | Bayer Ag | Hydrierte Copolymerisate aus nicht substituierten und substituierten konjugierten Dienen |
| RU2268894C1 (ru) * | 2004-11-15 | 2006-01-27 | Открытое акционерное общество "Нижнекамскнефтехим" | Способ получения катализатора полимеризации и сополимеризации сопряженных диеновых углеродов |
| CN101153069B (zh) * | 2006-09-25 | 2010-05-12 | 北京化工大学 | 一种高顺式丁苯嵌段共聚物的制备方法 |
| RU2345092C1 (ru) * | 2007-05-23 | 2009-01-27 | Федеральное государственное унитарное предприятие "Ордена Ленина и ордена Трудового Красного Знамени научно-исследовательский институт синтетического каучука имени академика С.В. Лебедева" | Способ получения катализатора полимеризации бутадиена и сополимеризации бутадиена с изопреном |
| US7807763B2 (en) | 2008-04-07 | 2010-10-05 | Bridgestone Corporation | Method for bulk polymerization |
| WO2011047021A1 (en) | 2009-10-14 | 2011-04-21 | Bridgestone Corporation | Processes for preparation of cyclic acyclic diene copolymer and rubber composition |
| EP2311889A1 (de) | 2009-10-16 | 2011-04-20 | LANXESS Deutschland GmbH | Neodym-katalysierte Polybutadiene |
| RU2437895C1 (ru) * | 2010-06-21 | 2011-12-27 | Открытое акционерное общество "Воронежский синтетический каучук" | Способ получения модифицированного 1,4-цис полибутадиена |
| ITMI20111652A1 (it) | 2011-09-14 | 2013-03-15 | Polimeri Europa Spa | Complesso oss-azotato di lantanidi, sistema catalitico comprendente detto complesso osso-azotato e procedimento per la (co)polimerizzazione di dieni coniugati |
| ITMI20111650A1 (it) | 2011-09-14 | 2013-03-15 | Polimeri Europa Spa | Complesso bis-imminico di lantanidi, sistema catalitico comprendente detto complesso bis-imminico e procedimento per la (co)polimerizzazione di dieni coniugati |
| ITMI20111651A1 (it) | 2011-09-14 | 2013-03-15 | Polimeri Europa Spa | Complesso bis-immino piridinico di lantanidi, sistema catalitico comprendente detto complesso bis-immino piridinico e procedimento per la (co)polimerizzazione di dieni coniugati |
| RU2621683C2 (ru) | 2012-01-31 | 2017-06-07 | Асахи Касеи Кемикалз Корпорейшн | Каталитическая композиция для полимеризации сопряженного диенового мономера |
| US8695665B2 (en) | 2012-06-21 | 2014-04-15 | The Goodyear Tire & Rubber Company | Tire with composite of chafer and outer sidewall rubber layer components |
| EP3237526B1 (en) | 2014-12-23 | 2022-05-18 | Bridgestone Americas Tire Operations, LLC | Tire comprising an oil-containing rubber composition |
| CN113105573A (zh) | 2015-01-28 | 2021-07-13 | 株式会社普利司通 | 具有改善的耐冷流性的顺式-1,4-聚二烯 |
| JP6717840B2 (ja) | 2015-01-28 | 2020-07-08 | 株式会社ブリヂストン | 熟成ランタニド系触媒系及びシス−1,4−ポリジエンの調製における同触媒系の使用 |
| EP3622843B1 (en) | 2018-09-13 | 2023-01-25 | The Goodyear Tire & Rubber Company | Resin modified oil extended rubber |
| US11220595B2 (en) | 2019-03-04 | 2022-01-11 | The Goodyear Tire & Rubber Company | Reinforced rubber containing silylated triglyceride oil |
| US11767388B1 (en) | 2019-09-18 | 2023-09-26 | The Goodyear Tire & Rubber Company | Silicon-functionalized rubber |
| US11560462B1 (en) | 2019-09-20 | 2023-01-24 | The Goodyear Tire & Rubber Company | Functionalized high cis-1,4-polybutadiene |
| EP3838932B1 (en) | 2019-12-20 | 2022-08-10 | The Goodyear Tire & Rubber Company | Synthesis of isoprene-butadiene copolymer rubbers |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3803053A (en) * | 1968-05-08 | 1974-04-09 | Atlantic Richfield Co | Lanthanide oligomerization catalyst |
| US3655811A (en) * | 1968-07-15 | 1972-04-11 | Atlantic Richfield Co | Olefin polymerization process |
| US3676411A (en) * | 1970-12-17 | 1972-07-11 | Goodyear Tire & Rubber | Ternary catalyst systems for the polymerization of conjugated diolefins |
| US4093815A (en) * | 1976-08-12 | 1978-06-06 | Phillips Petroleum Company | Method for the oxidation of a conjugated diolefin |
| IT1078032B (it) * | 1977-04-07 | 1985-05-08 | Snam Progetti | Processo per la preparazione di oligomeri del butadiene |
| IT1085663B (it) * | 1977-08-01 | 1985-05-28 | Snam Progetti | Procedimento per la polimerizzazione e copolimerizzazione di diolefine e mezzi adatti allo scopo |
| DE2830080A1 (de) * | 1978-07-08 | 1980-01-17 | Bayer Ag | Katalysator, dessen herstellung und verwendung zur loesungspolymerisation von butadien |
| DE2848964A1 (de) * | 1978-11-11 | 1980-05-22 | Bayer Ag | Katalysator, dessen herstellung und verwendung zur loesungspolymerisation von butadien |
-
1981
- 1981-09-25 IT IT24160/81A patent/IT1140452B/it active
-
1982
- 1982-08-31 ZA ZA826371A patent/ZA826371B/xx unknown
- 1982-09-02 US US06/413,982 patent/US4444903A/en not_active Expired - Lifetime
- 1982-09-07 IN IN1035/CAL/82A patent/IN157598B/en unknown
- 1982-09-10 AU AU88190/82A patent/AU564970B2/en not_active Expired
- 1982-09-13 MX MX194388A patent/MX162400A/es unknown
- 1982-09-13 BR BR8205374A patent/BR8205374A/pt not_active IP Right Cessation
- 1982-09-15 EP EP82201142A patent/EP0076535B1/en not_active Expired
- 1982-09-15 DE DE8282201142T patent/DE3276436D1/de not_active Expired
- 1982-09-22 EG EG578/82A patent/EG17884A/xx active
- 1982-09-22 YU YU2105/82A patent/YU43644B/xx unknown
- 1982-09-22 CS CS826785A patent/CS249511B2/cs unknown
- 1982-09-23 PL PL1982238331A patent/PL140371B1/pl unknown
- 1982-09-23 PT PT75607A patent/PT75607B/pt unknown
- 1982-09-23 ES ES516703A patent/ES516703A0/es active Granted
- 1982-09-23 TR TR21230A patent/TR21230A/xx unknown
- 1982-09-24 CA CA000412148A patent/CA1182804A/en not_active Expired
- 1982-09-24 AR AR82290766A patent/AR245943A1/es active
- 1982-09-24 IE IE2317/82A patent/IE53557B1/en not_active IP Right Cessation
- 1982-09-24 JP JP57165175A patent/JPS5867705A/ja active Granted
- 1982-09-27 DD DD82254445A patent/DD214617A5/de not_active IP Right Cessation
- 1982-09-27 DD DD82243530A patent/DD203727A5/de not_active IP Right Cessation
-
1983
- 1983-10-28 ES ES527174A patent/ES8504850A1/es not_active Expired
-
1985
- 1985-04-29 YU YU724/85A patent/YU45254B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| MX162400A (es) | 1991-05-06 |
| EP0076535A1 (en) | 1983-04-13 |
| YU43644B (en) | 1989-10-31 |
| ES527174A0 (es) | 1985-04-16 |
| AR245943A1 (es) | 1994-03-30 |
| EP0076535B1 (en) | 1987-05-27 |
| US4444903A (en) | 1984-04-24 |
| DD214617A5 (de) | 1984-10-17 |
| YU72485A (en) | 1987-06-30 |
| CS249511B2 (en) | 1987-03-12 |
| YU210582A (en) | 1985-08-31 |
| BR8205374A (pt) | 1983-08-23 |
| PT75607A (en) | 1982-10-01 |
| EG17884A (en) | 1991-03-30 |
| DD203727A5 (de) | 1983-11-02 |
| IE53557B1 (en) | 1988-12-07 |
| ZA826371B (en) | 1983-07-27 |
| PL238331A1 (en) | 1984-05-21 |
| YU45254B (en) | 1992-05-28 |
| PT75607B (en) | 1985-12-09 |
| IT1140452B (it) | 1986-09-24 |
| JPH042601B2 (enFirst) | 1992-01-20 |
| JPS5867705A (ja) | 1983-04-22 |
| ES8402732A1 (es) | 1984-03-01 |
| IT8124160A0 (it) | 1981-09-25 |
| ES516703A0 (es) | 1984-03-01 |
| AU8819082A (en) | 1983-03-31 |
| DE3276436D1 (en) | 1987-07-02 |
| AU564970B2 (en) | 1987-09-03 |
| PL140371B1 (en) | 1987-04-30 |
| TR21230A (tr) | 1984-02-06 |
| ES8504850A1 (es) | 1985-04-16 |
| IE822317L (en) | 1983-03-25 |
| IN157598B (enFirst) | 1986-05-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1182804A (en) | Process for polymerising conjugate diolefins, and means suitable for this purpose | |
| CA2058562C (en) | Tin containing elastomers and products having reduced hysteresis properties | |
| US4429089A (en) | Polymerizing and copolymerizing diolefines, and means therefor | |
| CA1143711A (en) | Catalyst, its preparation and its use for the polymerisation of conjugated dienes in solution | |
| US3326881A (en) | Polymerization of vinylidene-containing monomers with an initiator consisting of an alkali metal derivative of a functional halogen-substituted aromatic compound | |
| US3992561A (en) | Preparation of solution polymers | |
| US4753991A (en) | Polymers containing amino groups, and their preparation | |
| GB2118199A (en) | Polymerisation of conjugated dienes | |
| EP0331400B1 (en) | Catalyst composition for polymerization of conjugated diene and process for producing conjugated diene polymer | |
| EP0316857B1 (en) | Amine containing initiator system for anionic polymerization | |
| US4960842A (en) | Amine containing initiator system for anionic polymerization | |
| US4048427A (en) | Preparation of solution polymers | |
| EP0092270B1 (en) | Process for polymerizing conjugate diolefins, and means suitable for this purpose | |
| US4537870A (en) | Polyolefin polymerization process and catalyst | |
| FI110100B (fi) | Diolefiinien polymerisaatiokatalysaattori, menetelmä sen valmistamiseksi ja sen käyttö polymeerien valmistuksessa | |
| US4189555A (en) | Continuous solution polymerization process | |
| US6787661B2 (en) | Tin-containing organolithium compounds and preparation thereof | |
| US3687925A (en) | Process for the preparation of improved cis-1,4-polyisoprene | |
| US3935175A (en) | Process for the polymerization of unsaturated compounds | |
| US3848008A (en) | Dilithium initiators from certain conjugated dienes yielding delocaliized chain ends | |
| US20230047483A1 (en) | Diorganomagnesium compound | |
| US3836513A (en) | Polymerization of conjugated diolefins with alfin catalyst and molecular weight controller | |
| CA1121100A (en) | Method for the polymerization of compounds having a system of conjugated double bonds | |
| US3919184A (en) | Novel acetylene-conjugated diene compound linear random copolymers and a method of production thereof | |
| US3846388A (en) | Copolymer of a conjugated diolefin and vinyl chloride and manufacturing process therefor |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEC | Expiry (correction) | ||
| MKEX | Expiry |