CA1178291A - Process for the continuous thermal cleavage of carbamic acid esters and preparation of isocyanates from the products thereof - Google Patents
Process for the continuous thermal cleavage of carbamic acid esters and preparation of isocyanates from the products thereofInfo
- Publication number
- CA1178291A CA1178291A CA000391376A CA391376A CA1178291A CA 1178291 A CA1178291 A CA 1178291A CA 000391376 A CA000391376 A CA 000391376A CA 391376 A CA391376 A CA 391376A CA 1178291 A CA1178291 A CA 1178291A
- Authority
- CA
- Canada
- Prior art keywords
- carbamic acid
- acid ester
- isocyanate
- reaction
- ester
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000012948 isocyanate Substances 0.000 title claims abstract description 136
- JOYRKODLDBILNP-UHFFFAOYSA-N urethane group Chemical group NC(=O)OCC JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 title claims abstract description 129
- 150000002513 isocyanates Chemical class 0.000 title claims abstract description 127
- 238000000034 method Methods 0.000 title claims abstract description 114
- 230000008569 process Effects 0.000 title claims abstract description 101
- 238000003776 cleavage reaction Methods 0.000 title claims abstract description 75
- 230000007017 scission Effects 0.000 title claims abstract description 72
- 229940112021 centrally acting muscle relaxants carbamic acid ester Drugs 0.000 title description 36
- 238000002360 preparation method Methods 0.000 title description 11
- 238000006243 chemical reaction Methods 0.000 claims abstract description 218
- 238000005194 fractionation Methods 0.000 claims abstract description 98
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims abstract description 70
- 238000009835 boiling Methods 0.000 claims abstract description 68
- IQPQWNKOIGAROB-UHFFFAOYSA-N isocyanate Chemical compound [N-]=C=O IQPQWNKOIGAROB-UHFFFAOYSA-N 0.000 claims abstract description 8
- 239000000047 product Substances 0.000 claims description 74
- 238000004821 distillation Methods 0.000 claims description 69
- 239000000203 mixture Substances 0.000 claims description 63
- 239000003054 catalyst Substances 0.000 claims description 54
- 239000003381 stabilizer Substances 0.000 claims description 29
- 239000011541 reaction mixture Substances 0.000 claims description 21
- 125000004432 carbon atom Chemical group C* 0.000 claims description 17
- 125000001424 substituent group Chemical group 0.000 claims description 14
- 230000000875 corresponding effect Effects 0.000 claims description 13
- -1 carboxylic acid chlorides Chemical class 0.000 claims description 12
- 238000000926 separation method Methods 0.000 claims description 12
- 230000036647 reaction Effects 0.000 claims description 11
- 239000008246 gaseous mixture Substances 0.000 claims description 10
- 125000001183 hydrocarbyl group Chemical group 0.000 claims description 7
- 239000002841 Lewis acid Substances 0.000 claims description 6
- 150000007517 lewis acids Chemical class 0.000 claims description 6
- 239000012263 liquid product Substances 0.000 claims description 6
- 125000001931 aliphatic group Chemical group 0.000 claims description 5
- 150000001875 compounds Chemical class 0.000 claims description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 5
- 238000004519 manufacturing process Methods 0.000 claims description 5
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 claims description 4
- 125000002029 aromatic hydrocarbon group Chemical group 0.000 claims description 3
- 239000004327 boric acid Substances 0.000 claims description 3
- 230000002152 alkylating effect Effects 0.000 claims description 2
- 238000010924 continuous production Methods 0.000 claims description 2
- 150000003459 sulfonic acid esters Chemical class 0.000 claims description 2
- 230000000694 effects Effects 0.000 claims 1
- 239000011968 lewis acid catalyst Substances 0.000 claims 1
- 239000007858 starting material Substances 0.000 abstract description 6
- 235000019441 ethanol Nutrition 0.000 description 58
- 239000007788 liquid Substances 0.000 description 22
- 239000002904 solvent Substances 0.000 description 16
- 150000002148 esters Chemical class 0.000 description 15
- LBKPGNUOUPTQKA-UHFFFAOYSA-N ethyl n-phenylcarbamate Chemical compound CCOC(=O)NC1=CC=CC=C1 LBKPGNUOUPTQKA-UHFFFAOYSA-N 0.000 description 11
- 239000006227 byproduct Substances 0.000 description 10
- 230000015572 biosynthetic process Effects 0.000 description 9
- 239000007789 gas Substances 0.000 description 9
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 8
- 238000001816 cooling Methods 0.000 description 8
- 229960004756 ethanol Drugs 0.000 description 8
- DGTNSSLYPYDJGL-UHFFFAOYSA-N phenyl isocyanate Chemical compound O=C=NC1=CC=CC=C1 DGTNSSLYPYDJGL-UHFFFAOYSA-N 0.000 description 8
- 239000002253 acid Substances 0.000 description 7
- 239000000306 component Substances 0.000 description 7
- 238000000354 decomposition reaction Methods 0.000 description 7
- 150000001298 alcohols Chemical class 0.000 description 6
- KXDHJXZQYSOELW-UHFFFAOYSA-N carbonic acid monoamide Natural products NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 description 6
- KJAMZCVTJDTESW-UHFFFAOYSA-N tiracizine Chemical compound C1CC2=CC=CC=C2N(C(=O)CN(C)C)C2=CC(NC(=O)OCC)=CC=C21 KJAMZCVTJDTESW-UHFFFAOYSA-N 0.000 description 6
- AJSTXXYNEIHPMD-UHFFFAOYSA-N triethyl borate Chemical compound CCOB(OCC)OCC AJSTXXYNEIHPMD-UHFFFAOYSA-N 0.000 description 6
- 238000007654 immersion Methods 0.000 description 5
- HAMGRBXTJNITHG-UHFFFAOYSA-N methyl isocyanate Chemical compound CN=C=O HAMGRBXTJNITHG-UHFFFAOYSA-N 0.000 description 5
- 230000036961 partial effect Effects 0.000 description 5
- 239000012809 cooling fluid Substances 0.000 description 4
- 239000005056 polyisocyanate Substances 0.000 description 4
- 238000001149 thermolysis Methods 0.000 description 4
- GRYSXUXXBDSYRT-WOUKDFQISA-N (2r,3r,4r,5r)-2-(hydroxymethyl)-4-methoxy-5-[6-(methylamino)purin-9-yl]oxolan-3-ol Chemical compound C1=NC=2C(NC)=NC=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1OC GRYSXUXXBDSYRT-WOUKDFQISA-N 0.000 description 3
- UAJRSHJHFRVGMG-UHFFFAOYSA-N 1-ethenyl-4-methoxybenzene Chemical compound COC1=CC=C(C=C)C=C1 UAJRSHJHFRVGMG-UHFFFAOYSA-N 0.000 description 3
- 208000036366 Sensation of pressure Diseases 0.000 description 3
- 235000013877 carbamide Nutrition 0.000 description 3
- KQWGXHWJMSMDJJ-UHFFFAOYSA-N cyclohexyl isocyanate Chemical compound O=C=NC1CCCCC1 KQWGXHWJMSMDJJ-UHFFFAOYSA-N 0.000 description 3
- WSKXXIMERYQVGJ-UHFFFAOYSA-N ethyl n-(4-chlorophenyl)carbamate Chemical compound CCOC(=O)NC1=CC=C(Cl)C=C1 WSKXXIMERYQVGJ-UHFFFAOYSA-N 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 150000002500 ions Chemical class 0.000 description 3
- 230000002427 irreversible effect Effects 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- SURZCVYFPAXNGN-UHFFFAOYSA-N methyl-carbamic acid ethyl ester Chemical compound CCOC(=O)NC SURZCVYFPAXNGN-UHFFFAOYSA-N 0.000 description 3
- 150000003672 ureas Chemical class 0.000 description 3
- UEQWUCNIFRFGSB-UHFFFAOYSA-N 2-ethylhexyl n-propan-2-ylcarbamate Chemical compound CCCCC(CC)COC(=O)NC(C)C UEQWUCNIFRFGSB-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 2
- FYXKZNLBZKRYSS-UHFFFAOYSA-N benzene-1,2-dicarbonyl chloride Chemical compound ClC(=O)C1=CC=CC=C1C(Cl)=O FYXKZNLBZKRYSS-UHFFFAOYSA-N 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 230000001419 dependent effect Effects 0.000 description 2
- JGFBRKRYDCGYKD-UHFFFAOYSA-N dibutyl(oxo)tin Chemical compound CCCC[Sn](=O)CCCC JGFBRKRYDCGYKD-UHFFFAOYSA-N 0.000 description 2
- 238000007700 distillative separation Methods 0.000 description 2
- 125000004494 ethyl ester group Chemical group 0.000 description 2
- XYSNXNHHBUFLLV-UHFFFAOYSA-N ethyl n-(3-methylphenyl)carbamate Chemical compound CCOC(=O)NC1=CC=CC(C)=C1 XYSNXNHHBUFLLV-UHFFFAOYSA-N 0.000 description 2
- ZAVUHLXZFYNAMG-UHFFFAOYSA-N ethyl n-cyclohexylcarbamate Chemical compound CCOC(=O)NC1CCCCC1 ZAVUHLXZFYNAMG-UHFFFAOYSA-N 0.000 description 2
- 238000011010 flushing procedure Methods 0.000 description 2
- 239000007792 gaseous phase Substances 0.000 description 2
- 239000003701 inert diluent Substances 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 239000007791 liquid phase Substances 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- 229920001228 polyisocyanate Polymers 0.000 description 2
- DFBONKKNEQNADO-UHFFFAOYSA-N propan-2-yl n-(3-methylphenyl)carbamate Chemical compound CC(C)OC(=O)NC1=CC=CC(C)=C1 DFBONKKNEQNADO-UHFFFAOYSA-N 0.000 description 2
- VXPLXMJHHKHSOA-UHFFFAOYSA-N propham Chemical compound CC(C)OC(=O)NC1=CC=CC=C1 VXPLXMJHHKHSOA-UHFFFAOYSA-N 0.000 description 2
- 238000007086 side reaction Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- CHJMFFKHPHCQIJ-UHFFFAOYSA-L zinc;octanoate Chemical compound [Zn+2].CCCCCCCC([O-])=O.CCCCCCCC([O-])=O CHJMFFKHPHCQIJ-UHFFFAOYSA-L 0.000 description 2
- VMKOFRJSULQZRM-UHFFFAOYSA-N 1-bromooctane Chemical compound CCCCCCCCBr VMKOFRJSULQZRM-UHFFFAOYSA-N 0.000 description 1
- MLRVZFYXUZQSRU-UHFFFAOYSA-N 1-chlorohexane Chemical compound CCCCCCCl MLRVZFYXUZQSRU-UHFFFAOYSA-N 0.000 description 1
- ANOOTOPTCJRUPK-UHFFFAOYSA-N 1-iodohexane Chemical compound CCCCCCI ANOOTOPTCJRUPK-UHFFFAOYSA-N 0.000 description 1
- MMEDJBFVJUFIDD-UHFFFAOYSA-N 2-[2-(carboxymethyl)phenyl]acetic acid Chemical compound OC(=O)CC1=CC=CC=C1CC(O)=O MMEDJBFVJUFIDD-UHFFFAOYSA-N 0.000 description 1
- FXPSNOVRPHPNFC-UHFFFAOYSA-N 2-methyl-5-(4-methyl-3-nitrophenyl)-1,3,4-oxadiazole Chemical compound O1C(C)=NN=C1C1=CC=C(C)C([N+]([O-])=O)=C1 FXPSNOVRPHPNFC-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- HFGHRUCCKVYFKL-UHFFFAOYSA-N 4-ethoxy-2-piperazin-1-yl-7-pyridin-4-yl-5h-pyrimido[5,4-b]indole Chemical compound C1=C2NC=3C(OCC)=NC(N4CCNCC4)=NC=3C2=CC=C1C1=CC=NC=C1 HFGHRUCCKVYFKL-UHFFFAOYSA-N 0.000 description 1
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 1
- 101001121591 Aplysia californica L-amino-acid oxidase Proteins 0.000 description 1
- 241001527902 Aratus Species 0.000 description 1
- 229910015437 B(OC4H9)3 Inorganic materials 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 241000861718 Chloris <Aves> Species 0.000 description 1
- 229910021591 Copper(I) chloride Inorganic materials 0.000 description 1
- 101100456896 Drosophila melanogaster metl gene Proteins 0.000 description 1
- 229910015400 FeC13 Inorganic materials 0.000 description 1
- AFCARXCZXQIEQB-UHFFFAOYSA-N N-[3-oxo-3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)propyl]-2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carboxamide Chemical compound O=C(CCNC(=O)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F)N1CC2=C(CC1)NN=N2 AFCARXCZXQIEQB-UHFFFAOYSA-N 0.000 description 1
- 206010037660 Pyrexia Diseases 0.000 description 1
- 229910008046 SnC14 Inorganic materials 0.000 description 1
- 229910010066 TiC14 Inorganic materials 0.000 description 1
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- PWAXUOGZOSVGBO-UHFFFAOYSA-N adipoyl chloride Chemical compound ClC(=O)CCCCC(Cl)=O PWAXUOGZOSVGBO-UHFFFAOYSA-N 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- PQLAYKMGZDUDLQ-UHFFFAOYSA-K aluminium bromide Chemical compound Br[Al](Br)Br PQLAYKMGZDUDLQ-UHFFFAOYSA-K 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 239000012752 auxiliary agent Substances 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- 125000006267 biphenyl group Chemical group 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- 210000001217 buttock Anatomy 0.000 description 1
- LFLBHTZRLVHUQC-UHFFFAOYSA-N butyl methanesulfonate Chemical compound CCCCOS(C)(=O)=O LFLBHTZRLVHUQC-UHFFFAOYSA-N 0.000 description 1
- IPBXEDNAFAYYQO-UHFFFAOYSA-N butyl n-pentylcarbamate Chemical compound CCCCCNC(=O)OCCCC IPBXEDNAFAYYQO-UHFFFAOYSA-N 0.000 description 1
- JMEJUPWADBAAIM-UHFFFAOYSA-N butyl n-propan-2-ylcarbamate Chemical compound CCCCOC(=O)NC(C)C JMEJUPWADBAAIM-UHFFFAOYSA-N 0.000 description 1
- ZZHGIUCYKGFIPV-UHFFFAOYSA-N butylcarbamic acid Chemical compound CCCCNC(O)=O ZZHGIUCYKGFIPV-UHFFFAOYSA-N 0.000 description 1
- DVECBJCOGJRVPX-UHFFFAOYSA-N butyryl chloride Chemical compound CCCC(Cl)=O DVECBJCOGJRVPX-UHFFFAOYSA-N 0.000 description 1
- 150000001718 carbodiimides Chemical class 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 230000006315 carbonylation Effects 0.000 description 1
- 238000005810 carbonylation reaction Methods 0.000 description 1
- 239000012159 carrier gas Substances 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 238000010960 commercial process Methods 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- OXBLHERUFWYNTN-UHFFFAOYSA-M copper(I) chloride Chemical compound [Cu]Cl OXBLHERUFWYNTN-UHFFFAOYSA-M 0.000 description 1
- BJZJDEOGMBZSLE-UHFFFAOYSA-N cyclohexane;hydrate Chemical compound O.C1CCCCC1 BJZJDEOGMBZSLE-UHFFFAOYSA-N 0.000 description 1
- PYRZPBDTPRQYKG-UHFFFAOYSA-N cyclopentene-1-carboxylic acid Chemical class OC(=O)C1=CCCC1 PYRZPBDTPRQYKG-UHFFFAOYSA-N 0.000 description 1
- 150000001987 diarylethers Chemical class 0.000 description 1
- RJGHQTVXGKYATR-UHFFFAOYSA-L dibutyl(dichloro)stannane Chemical compound CCCC[Sn](Cl)(Cl)CCCC RJGHQTVXGKYATR-UHFFFAOYSA-L 0.000 description 1
- DENRZWYUOJLTMF-UHFFFAOYSA-N diethyl sulfate Chemical compound CCOS(=O)(=O)OCC DENRZWYUOJLTMF-UHFFFAOYSA-N 0.000 description 1
- 229940008406 diethyl sulfate Drugs 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- 238000007599 discharging Methods 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- WWJWYSLUTFZDIO-UHFFFAOYSA-N ethyl 4-ethoxysulfonylbenzoate Chemical compound CCOC(=O)C1=CC=C(S(=O)(=O)OCC)C=C1 WWJWYSLUTFZDIO-UHFFFAOYSA-N 0.000 description 1
- VRZVPALEJCLXPR-UHFFFAOYSA-N ethyl 4-methylbenzenesulfonate Chemical compound CCOS(=O)(=O)C1=CC=C(C)C=C1 VRZVPALEJCLXPR-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- DLSULVSCVOXBBE-UHFFFAOYSA-N ethyl n-(1-cyclohexylcyclohexyl)carbamate Chemical compound C1CCCCC1C1(NC(=O)OCC)CCCCC1 DLSULVSCVOXBBE-UHFFFAOYSA-N 0.000 description 1
- WXDDBYFBIIAYSM-UHFFFAOYSA-N ethyl n-(2-phenylethyl)carbamate Chemical compound CCOC(=O)NCCC1=CC=CC=C1 WXDDBYFBIIAYSM-UHFFFAOYSA-N 0.000 description 1
- AOVLXBXJFYNQAZ-UHFFFAOYSA-N ethyl n-(3,4-dichlorophenyl)carbamate Chemical compound CCOC(=O)NC1=CC=C(Cl)C(Cl)=C1 AOVLXBXJFYNQAZ-UHFFFAOYSA-N 0.000 description 1
- KJEXITNRKHKKBH-UHFFFAOYSA-N ethyl n-(3-chloro-4-methylphenyl)carbamate Chemical compound CCOC(=O)NC1=CC=C(C)C(Cl)=C1 KJEXITNRKHKKBH-UHFFFAOYSA-N 0.000 description 1
- VIOOLKBPDAHMDY-UHFFFAOYSA-N ethyl n-(4-benzylphenyl)carbamate Chemical compound C1=CC(NC(=O)OCC)=CC=C1CC1=CC=CC=C1 VIOOLKBPDAHMDY-UHFFFAOYSA-N 0.000 description 1
- BQBKYSPXQYHTIP-UHFFFAOYSA-N ethyl n-butylcarbamate Chemical compound CCCCNC(=O)OCC BQBKYSPXQYHTIP-UHFFFAOYSA-N 0.000 description 1
- GZXSDYYWLZERLF-UHFFFAOYSA-N ethyl n-ethylcarbamate Chemical compound CCNC(=O)OCC GZXSDYYWLZERLF-UHFFFAOYSA-N 0.000 description 1
- GTOKAWYXANYGFG-UHFFFAOYSA-N ethyl n-propylcarbamate Chemical compound CCCNC(=O)OCC GTOKAWYXANYGFG-UHFFFAOYSA-N 0.000 description 1
- KWBIXTIBYFUAGV-UHFFFAOYSA-N ethylcarbamic acid Chemical compound CCNC(O)=O KWBIXTIBYFUAGV-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- PZKPFYPWJUJRHQ-UHFFFAOYSA-N heptyl n-propylcarbamate Chemical compound CCCCCCCOC(=O)NCCC PZKPFYPWJUJRHQ-UHFFFAOYSA-N 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- QCFNXNHCNMNWCJ-UHFFFAOYSA-N hexyl n-propan-2-ylcarbamate Chemical compound CCCCCCOC(=O)NC(C)C QCFNXNHCNMNWCJ-UHFFFAOYSA-N 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- AFCCDDWKHLHPDF-UHFFFAOYSA-M metam-sodium Chemical compound [Na+].CNC([S-])=S AFCCDDWKHLHPDF-UHFFFAOYSA-M 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- YTWXTBHOMOSBCB-UHFFFAOYSA-N methyl N-(2-methylhex-1-enyl)carbamate Chemical compound CCCCC(C)=CNC(=O)OC YTWXTBHOMOSBCB-UHFFFAOYSA-N 0.000 description 1
- CZXGXYBOQYQXQD-UHFFFAOYSA-N methyl benzenesulfonate Chemical compound COS(=O)(=O)C1=CC=CC=C1 CZXGXYBOQYQXQD-UHFFFAOYSA-N 0.000 description 1
- IOOKFKBCLRZKNK-UHFFFAOYSA-N methyl n-(2,2-dimethylpropyl)carbamate Chemical compound COC(=O)NCC(C)(C)C IOOKFKBCLRZKNK-UHFFFAOYSA-N 0.000 description 1
- NVNYDGHHYOIGAS-UHFFFAOYSA-N methyl n-(3-cyanophenyl)carbamate Chemical compound COC(=O)NC1=CC=CC(C#N)=C1 NVNYDGHHYOIGAS-UHFFFAOYSA-N 0.000 description 1
- YYKXNDIQHDVJKF-UHFFFAOYSA-N methyl n-(3-methylphenyl)carbamate Chemical compound COC(=O)NC1=CC=CC(C)=C1 YYKXNDIQHDVJKF-UHFFFAOYSA-N 0.000 description 1
- NRXWBPKDKRPCTE-UHFFFAOYSA-N methyl n-[3-(trifluoromethyl)phenyl]carbamate Chemical compound COC(=O)NC1=CC=CC(C(F)(F)F)=C1 NRXWBPKDKRPCTE-UHFFFAOYSA-N 0.000 description 1
- ZWZIHLRSOOMEKT-UHFFFAOYSA-N methyl n-benzylcarbamate Chemical compound COC(=O)NCC1=CC=CC=C1 ZWZIHLRSOOMEKT-UHFFFAOYSA-N 0.000 description 1
- ZNNMCHFBYPSIFG-UHFFFAOYSA-N methyl n-cyclobutylcarbamate Chemical compound COC(=O)NC1CCC1 ZNNMCHFBYPSIFG-UHFFFAOYSA-N 0.000 description 1
- BUIPKGZDEMXJLW-UHFFFAOYSA-N methyl n-cyclohexylcarbamate Chemical compound COC(=O)NC1CCCCC1 BUIPKGZDEMXJLW-UHFFFAOYSA-N 0.000 description 1
- KBCHWPYDGVRMBB-UHFFFAOYSA-N methyl n-cyclopentylcarbamate Chemical compound COC(=O)NC1CCCC1 KBCHWPYDGVRMBB-UHFFFAOYSA-N 0.000 description 1
- OXNAJPQXTZANJL-UHFFFAOYSA-N methyl n-hexylcarbamate Chemical compound CCCCCCNC(=O)OC OXNAJPQXTZANJL-UHFFFAOYSA-N 0.000 description 1
- QXOUFQKDZIMOMU-UHFFFAOYSA-N methyl n-octylcarbamate Chemical compound CCCCCCCCNC(=O)OC QXOUFQKDZIMOMU-UHFFFAOYSA-N 0.000 description 1
- VBJIQWCGMYVMKK-UHFFFAOYSA-N methyl n-pentylcarbamate Chemical compound CCCCCNC(=O)OC VBJIQWCGMYVMKK-UHFFFAOYSA-N 0.000 description 1
- PWFYXEJZPCACLT-UHFFFAOYSA-N methyl n-propan-2-ylcarbamate Chemical compound COC(=O)NC(C)C PWFYXEJZPCACLT-UHFFFAOYSA-N 0.000 description 1
- 150000002828 nitro derivatives Chemical class 0.000 description 1
- WTBAHSZERDXKKZ-UHFFFAOYSA-N octadecanoyl chloride Chemical compound CCCCCCCCCCCCCCCCCC(Cl)=O WTBAHSZERDXKKZ-UHFFFAOYSA-N 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- WYAUONKECLXJCB-UHFFFAOYSA-N octyl n-(2-methoxyethyl)carbamate Chemical compound CCCCCCCCOC(=O)NCCOC WYAUONKECLXJCB-UHFFFAOYSA-N 0.000 description 1
- 239000004814 polyurethane Substances 0.000 description 1
- 229920002635 polyurethane Polymers 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 239000003223 protective agent Substances 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000004064 recycling Methods 0.000 description 1
- 230000002829 reductive effect Effects 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 230000002441 reversible effect Effects 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 235000011150 stannous chloride Nutrition 0.000 description 1
- 238000005979 thermal decomposition reaction Methods 0.000 description 1
- AXZWODMDQAVCJE-UHFFFAOYSA-L tin(II) chloride (anhydrous) Chemical compound [Cl-].[Cl-].[Sn+2] AXZWODMDQAVCJE-UHFFFAOYSA-L 0.000 description 1
- UBZYKBZMAMTNKW-UHFFFAOYSA-J titanium tetrabromide Chemical compound Br[Ti](Br)(Br)Br UBZYKBZMAMTNKW-UHFFFAOYSA-J 0.000 description 1
- DVKJHBMWWAPEIU-UHFFFAOYSA-N toluene 2,4-diisocyanate Chemical compound CC1=CC=C(N=C=O)C=C1N=C=O DVKJHBMWWAPEIU-UHFFFAOYSA-N 0.000 description 1
- LGQXXHMEBUOXRP-UHFFFAOYSA-N tributyl borate Chemical compound CCCCOB(OCCCC)OCCCC LGQXXHMEBUOXRP-UHFFFAOYSA-N 0.000 description 1
- AVWRKZWQTYIKIY-UHFFFAOYSA-N urea-1-carboxylic acid Chemical compound NC(=O)NC(O)=O AVWRKZWQTYIKIY-UHFFFAOYSA-N 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011787 zinc oxide Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C263/00—Preparation of derivatives of isocyanic acid
- C07C263/04—Preparation of derivatives of isocyanic acid from or via carbamates or carbamoyl halides
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/12—Systems containing only non-condensed rings with a six-membered ring
- C07C2601/14—The ring being saturated
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y02—TECHNOLOGIES OR APPLICATIONS FOR MITIGATION OR ADAPTATION AGAINST CLIMATE CHANGE
- Y02P—CLIMATE CHANGE MITIGATION TECHNOLOGIES IN THE PRODUCTION OR PROCESSING OF GOODS
- Y02P20/00—Technologies relating to chemical industry
- Y02P20/50—Improvements relating to the production of bulk chemicals
- Y02P20/582—Recycling of unreacted starting or intermediate materials
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19803047898 DE3047898A1 (de) | 1980-12-19 | 1980-12-19 | Verfahren zur kontinuierlichen thermischen spaltung von carbamidsaeureestern und die verwendung von hierbei anfallenden isocyanate und carbamidsaeureester aufweisenden gemischen zur herstellung von isocyanaten |
| DEP3047898.9 | 1980-12-19 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1178291A true CA1178291A (en) | 1984-11-20 |
Family
ID=6119595
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000391376A Expired CA1178291A (en) | 1980-12-19 | 1981-12-02 | Process for the continuous thermal cleavage of carbamic acid esters and preparation of isocyanates from the products thereof |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US4386033A (cg-RX-API-DMAC10.html) |
| EP (1) | EP0054817B1 (cg-RX-API-DMAC10.html) |
| JP (2) | JPS57123159A (cg-RX-API-DMAC10.html) |
| AU (1) | AU541537B2 (cg-RX-API-DMAC10.html) |
| BR (1) | BR8108272A (cg-RX-API-DMAC10.html) |
| CA (1) | CA1178291A (cg-RX-API-DMAC10.html) |
| DE (2) | DE3047898A1 (cg-RX-API-DMAC10.html) |
Families Citing this family (37)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3215591A1 (de) * | 1982-04-27 | 1983-10-27 | Bayer Ag, 5090 Leverkusen | Verfahren zur kontinuierlichen thermischen spaltung von carbamidsaeureestern |
| US4587056A (en) * | 1984-04-26 | 1986-05-06 | Asahi Kasei Kogyo Kabushiki Kaisha | Process for producing an aliphatic isocyanate |
| JPS60231640A (ja) * | 1984-05-02 | 1985-11-18 | Asahi Chem Ind Co Ltd | イソシアナ−トの連続的製法 |
| US4572804A (en) * | 1984-12-17 | 1986-02-25 | The Dow Chemical Company | Preparation of unsaturated isocyanates |
| DE3828033A1 (de) * | 1988-08-18 | 1990-03-08 | Huels Chemische Werke Ag | Kreislaufverfahren zur herstellung von (cyclo)aliphatischen diisocyanaten |
| US5194660A (en) * | 1990-12-21 | 1993-03-16 | Union Carbide Chemicals & Plastics Technology Corporation | Processes for producing carbamates and isocyanates |
| DE4124671A1 (de) * | 1991-07-25 | 1993-01-28 | Basf Ag | Reaktor und verfahren zur thermischen spaltung von carbamidsaeureestern |
| DE4213099A1 (de) * | 1992-04-21 | 1993-10-28 | Basf Ag | Mehrstufiges Verfahren zur kontinuierlichen Herstellung von organischen Polyisocyanaten |
| DE4231417A1 (de) * | 1992-05-05 | 1993-11-11 | Huels Chemische Werke Ag | Kontinuierliches mehrstufiges Verfahren zur Herstellung von (cyclo)aliphatischen Diisocyanaten |
| EP0680994A1 (en) * | 1994-05-02 | 1995-11-08 | Nippon Paint Co., Ltd. | Re-Crosslinkable composition and method for recycling using the same |
| EP0795544B1 (de) * | 1996-03-15 | 2001-10-31 | Bayer Ag | Verfahren zur thermischen Spaltung von Carbamidsäureestern |
| DE19857532A1 (de) * | 1998-12-14 | 2000-06-15 | Degussa | Verfahren zur Herstellung von Carbamatoorganosilanen und Isocyanatoorganosilanen |
| DE19922572A1 (de) * | 1999-05-17 | 2000-11-23 | Bayer Ag | Verfahren zur Reinigung von organischen Isocyanaten, die so gereinigten organischen Isocyanate und ihre Verwendung |
| EP1325051B1 (fr) * | 2000-10-13 | 2008-08-20 | Rhodia Chimie | Utilisation comme catalyseur pour la formation d'urethanes, de sels d'acide fluores et de metal trivalent, composition en contenant et procede |
| FR2815348B1 (fr) * | 2000-10-13 | 2002-12-20 | Rhodia Chimie Sa | Utilisation comme catalyseur pour la formation d'urethanes, de sels d'acide fluores et de metal trivalent, composition en contenant et procede les utilisant |
| DE10338511A1 (de) * | 2003-08-22 | 2005-03-17 | Degussa Ag | Mehrstufiges Verfahren zur kontinuierlichen Herstellung von cycloaliphatischen Diisocyanaten |
| DE10338508A1 (de) * | 2003-08-22 | 2005-03-17 | Degussa Ag | Mehrstufiges Verfahren zur kontinuierlichen Herstellung von cycloaliphatischen Diisocyanaten |
| DE10338509A1 (de) | 2003-08-22 | 2005-03-17 | Degussa Ag | Mehrstufiges Verfahren zur kontinuierlichen Herstellung von cycloaliphatischen Diisocyanaten |
| DE102004022626A1 (de) | 2004-05-07 | 2005-12-15 | Degussa Ag | Mehrstufiges Verfahren zur kontinuierlichen Herstellung von cycloaliphatischen Diisocyanaten |
| DE102004026451A1 (de) * | 2004-05-29 | 2005-12-15 | Degussa Ag | Mehrstufiges Verfahren zur kontinuierlichen Herstellung von cycloaliphatischen Diisocyanaten |
| DE102004036499A1 (de) * | 2004-07-28 | 2006-03-23 | Degussa Ag | Mehrstufiges Verfahren zur kontinuierlichen Herstellung von cycloaliphatischen Diisocyanaten |
| US7060849B1 (en) * | 2005-09-15 | 2006-06-13 | General Electric Company | Method for production of isocyanatosilanes |
| DE602007011969D1 (de) * | 2006-11-17 | 2011-02-24 | Asahi Kasei Chemicals Corp | Verfahren zur herstellung von isocyanaten |
| TW200844080A (en) | 2007-01-11 | 2008-11-16 | Asahi Kasei Chemicals Corp | Process for producing isocyanate |
| EP2147909B1 (en) * | 2007-03-30 | 2016-12-14 | Asahi Kasei Kabushiki Kaisha | Method for production of isocyanate using composition comprising carbamic acid ester and aromatic hydroxy compound, and composition for transport or storage of carbamic acid ester |
| CA2705874C (en) | 2007-11-19 | 2013-10-29 | Masaaki Shinohata | Process for producing isocyanates and aromatic hydroxy compounds from aromatic polycarbonate resins |
| ES2710177T3 (es) * | 2008-05-15 | 2019-04-23 | Asahi Chemical Ind | Proceso para la producción de isocianato |
| RU2523201C2 (ru) * | 2008-05-15 | 2014-07-20 | Асахи Касеи Кемикалз Корпорейшн | Способ получения изоцианатов с использованием диарилкарбоната |
| DE102008002002A1 (de) | 2008-05-27 | 2009-12-03 | Evonik Degussa Gmbh | Chlor armes mehrstufiges Verfahren zur Herstellung von cycloaliphatischen Diisocyanaten |
| DE102009054749A1 (de) * | 2009-12-16 | 2011-06-22 | Evonik Degussa GmbH, 45128 | Zusammensetzung aus (cyclo)aliphatischen Diisocyanaten und aromatischen Säurehalogeniden |
| EP2626345B1 (en) | 2010-10-04 | 2019-01-16 | Asahi Kasei Kabushiki Kaisha | Separation method and method for producing isocyanate |
| KR101348229B1 (ko) | 2011-12-14 | 2014-01-08 | 경희대학교 산학협력단 | 지방족 디이소시아네이트의 제조방법 |
| CN102659631B (zh) * | 2011-12-24 | 2014-05-07 | 德州绿邦化工有限公司 | 一步合成乙基异氰酸酯的方法 |
| CN109503648B (zh) * | 2017-09-15 | 2024-05-28 | 张家港市国泰华荣化工新材料有限公司 | 制备3-异氰酸酯基丙基三甲氧基硅烷的装置 |
| KR102289569B1 (ko) | 2019-10-24 | 2021-08-17 | 애경유화주식회사 | 펜타메틸렌 디이소시아네이트의 제조방법 |
| US20240425448A1 (en) | 2021-11-08 | 2024-12-26 | Asahi Kasei Kabushiki Kaisha | Method for producing isocyanate compound, method for producing carbamate compound, method for recovering amine compound, and isocyanate composition |
| CN116271907B (zh) * | 2023-03-20 | 2025-12-30 | 中国天辰工程有限公司 | 一种六亚甲基二异氰酸酯绿色制备的方法和系统 |
Family Cites Families (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2713591A (en) * | 1955-07-19 | boc boctanaib | ||
| US2409712A (en) * | 1944-02-03 | 1946-10-22 | Du Pont | Chemical process and products |
| DE1016699B (de) * | 1952-09-25 | 1957-10-03 | Rohm & Haas | Verfahren zur Herstellung von organischen Isocyanaten |
| US2692275A (en) * | 1953-01-23 | 1954-10-19 | Rohm & Haas | Preparation of 1, 8-diisocyanato-p-menthane |
| GB763635A (cg-RX-API-DMAC10.html) * | 1953-04-10 | |||
| US3734941A (en) * | 1968-09-06 | 1973-05-22 | American Cyanamid Co | Process for converting urethanes to isocyanates |
| US3870739A (en) * | 1973-03-05 | 1975-03-11 | Air Prod & Chem | Isocyanates from urethanes |
| US3962302A (en) * | 1974-03-08 | 1976-06-08 | Atlantic Richfield Company | Production of isocyanates from esters of carbamic acids (urethanes) |
| US3919278A (en) * | 1974-06-13 | 1975-11-11 | Atlantic Richfield Co | Production of isocyanates from lower alkyl esters of mononuclear aromatic carbamic acids |
| US3919279A (en) * | 1974-06-26 | 1975-11-11 | Atlantic Richfield Co | Catalytic production of isocyanates from esters of carbamic acids |
| US3919280A (en) * | 1974-07-05 | 1975-11-11 | Atlantic Richfield Co | Recovery of solvents employed in the production of isocyanates from esters of carbamic acids |
| JPS5219624A (en) * | 1975-08-07 | 1977-02-15 | Mitsui Toatsu Chem Inc | Process for preparation of isocyanates |
| DE2756928A1 (de) * | 1977-12-21 | 1979-07-05 | Bayer Ag | Verfahren zur kontinuierlichen herstellung von monoisocyanaten |
-
1980
- 1980-12-19 DE DE19803047898 patent/DE3047898A1/de not_active Withdrawn
-
1981
- 1981-12-02 CA CA000391376A patent/CA1178291A/en not_active Expired
- 1981-12-07 DE DE8181110204T patent/DE3162326D1/de not_active Expired
- 1981-12-07 EP EP81110204A patent/EP0054817B1/de not_active Expired
- 1981-12-16 US US06/331,412 patent/US4386033A/en not_active Expired - Lifetime
- 1981-12-16 AU AU78546/81A patent/AU541537B2/en not_active Ceased
- 1981-12-17 JP JP56202617A patent/JPS57123159A/ja active Granted
- 1981-12-18 BR BR8108272A patent/BR8108272A/pt unknown
-
1990
- 1990-09-04 JP JP2232633A patent/JPH03115258A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| DE3047898A1 (de) | 1982-07-15 |
| EP0054817A3 (en) | 1982-08-18 |
| JPS57123159A (en) | 1982-07-31 |
| BR8108272A (pt) | 1982-10-05 |
| EP0054817A2 (de) | 1982-06-30 |
| JPH0360816B2 (cg-RX-API-DMAC10.html) | 1991-09-17 |
| EP0054817B1 (de) | 1984-02-15 |
| US4386033A (en) | 1983-05-31 |
| JPH0328415B2 (cg-RX-API-DMAC10.html) | 1991-04-19 |
| AU7854681A (en) | 1982-06-24 |
| DE3162326D1 (en) | 1984-03-22 |
| AU541537B2 (en) | 1985-01-10 |
| JPH03115258A (ja) | 1991-05-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1178291A (en) | Process for the continuous thermal cleavage of carbamic acid esters and preparation of isocyanates from the products thereof | |
| US5087739A (en) | Circulation process for the production of aliphatic and cycloaliphatic diisocyanates | |
| EP0126299B1 (de) | Mehrstufenverfahren zur Herstellung von Hexamethylen-diisocyanat-1,6 und/oder isomeren aliphatischen Diisocyanaten mit 6 Kohlenstoffatomen im Alkylenrest | |
| EP0566925B1 (de) | Mehrstufiges Verfahren zur kontinuierlichen Herstellung von organischen Polyisocyanaten | |
| EP0126300B1 (de) | Mehrstufenverfahren zur Herstellung von 3-Isocyanatomethyl-3,5,5-trimethyl-cyclohexylisocyanat | |
| US4692550A (en) | Continuous process for thermal splitting of carbamic acid esters | |
| CA1178968A (en) | Process for the preparation of polyisocyanates | |
| EP0568782A2 (de) | Kontinuierliches mehrstufiges Verfahren zur Herstellung von (cyclo)-aliphatischen Diisocyanaten | |
| EP1593669B1 (de) | Mehrstufiges Verfahren zur kontinuierlichen Herstellung von cycloaliphatischen Diisocyanaten | |
| US4195031A (en) | Process for the continuous production of monoisocyanates | |
| US7179935B2 (en) | Method for producing isocyanates | |
| US4178448A (en) | Process for preparing herbicidal triazines | |
| US5646328A (en) | Process for removing by-products from diurethanes | |
| US3076007A (en) | Organic isocyanate preparation | |
| JP3674642B2 (ja) | イソシアネート類の製造法 | |
| EP0125726A1 (en) | Improved process for preparing alkyl isocyanates | |
| JPH11343276A (ja) | 新規なウレタン化合物及び多環式脂肪族ジイソシアネ―トの製造方法 | |
| EP0261604B1 (de) | Neue 2-(Alkoximethyl)-pentan-1,5-diisocyanate, - diurethane und dicarbamidsäurechloride, Verfahren zu ihrer Herstellung und deren Verwendung | |
| WO2007031444A1 (de) | Verfahren zur herstellung von isocyanaten | |
| DE69105707T2 (de) | Kontinuierliches Verfahren zur Herstellung von Isocyanaten. | |
| US4594441A (en) | Process for the preparation of urethanes | |
| US4231952A (en) | Process for the production of monoisocyanate | |
| DE10209305A1 (de) | Thermische Spaltung von Allophanaten | |
| DE1593220A1 (de) | Verfahren zur Herstellung von polychlorierten Phenyldiisocyanaten,Diphenylendiisocyanaten oder Naphthalindiisocyanaten | |
| EP0230224A2 (de) | Verfahren zur Herstellung von Alkoxycarbonylisocyanaten |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEC | Expiry (correction) | ||
| MKEX | Expiry |