CA1154898A - Chlorinated thermoplastics stabilised with aminothiouracils - Google Patents
Chlorinated thermoplastics stabilised with aminothiouracilsInfo
- Publication number
- CA1154898A CA1154898A CA000378595A CA378595A CA1154898A CA 1154898 A CA1154898 A CA 1154898A CA 000378595 A CA000378595 A CA 000378595A CA 378595 A CA378595 A CA 378595A CA 1154898 A CA1154898 A CA 1154898A
- Authority
- CA
- Canada
- Prior art keywords
- carbon atoms
- stabilised
- moulding composition
- composition according
- aminouracil
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229920001169 thermoplastic Polymers 0.000 title claims abstract description 9
- 239000004416 thermosoftening plastic Substances 0.000 title abstract description 8
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 11
- 239000004215 Carbon black (E152) Substances 0.000 claims abstract description 7
- 229930195733 hydrocarbon Natural products 0.000 claims abstract description 7
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 7
- 239000001257 hydrogen Substances 0.000 claims abstract description 7
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 7
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 claims abstract description 5
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 5
- 150000002367 halogens Chemical class 0.000 claims abstract description 5
- 101100294115 Caenorhabditis elegans nhr-4 gene Proteins 0.000 claims abstract description 4
- 125000002252 acyl group Chemical group 0.000 claims abstract description 4
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims abstract description 4
- YFYYRKDBDBILSD-UHFFFAOYSA-N 6-amino-2-sulfanylidene-1h-pyrimidin-4-one Chemical compound NC1=CC(=O)NC(=S)N1 YFYYRKDBDBILSD-UHFFFAOYSA-N 0.000 claims abstract description 3
- 239000004415 thermoplastic moulding composition Substances 0.000 claims abstract 2
- -1 zinc carboxy-late Chemical class 0.000 claims description 24
- 239000003381 stabilizer Substances 0.000 claims description 15
- 239000000203 mixture Substances 0.000 claims description 12
- 238000000034 method Methods 0.000 claims description 4
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical group [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims description 3
- 229910052791 calcium Inorganic materials 0.000 claims description 3
- 239000011575 calcium Substances 0.000 claims description 3
- 229910052725 zinc Inorganic materials 0.000 claims description 2
- 239000011701 zinc Substances 0.000 claims description 2
- 238000000465 moulding Methods 0.000 claims 5
- ISAKRJDGNUQOIC-UHFFFAOYSA-N Uracil Chemical compound O=C1C=CNC(=O)N1 ISAKRJDGNUQOIC-UHFFFAOYSA-N 0.000 claims 2
- 230000003019 stabilising effect Effects 0.000 claims 1
- 229940035893 uracil Drugs 0.000 claims 1
- 229920000642 polymer Polymers 0.000 abstract description 4
- 239000004800 polyvinyl chloride Substances 0.000 description 6
- 229920000915 polyvinyl chloride Polymers 0.000 description 6
- 239000000654 additive Substances 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- 125000000217 alkyl group Chemical group 0.000 description 3
- HJIAMFHSAAEUKR-UHFFFAOYSA-N (2-hydroxyphenyl)-phenylmethanone Chemical class OC1=CC=CC=C1C(=O)C1=CC=CC=C1 HJIAMFHSAAEUKR-UHFFFAOYSA-N 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N Propionic acid Substances CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 235000012424 soybean oil Nutrition 0.000 description 2
- 239000003549 soybean oil Substances 0.000 description 2
- 239000000758 substrate Substances 0.000 description 2
- 125000006710 (C2-C12) alkenyl group Chemical group 0.000 description 1
- JIHQDMXYYFUGFV-UHFFFAOYSA-N 1,3,5-triazine Chemical class C1=NC=NC=N1 JIHQDMXYYFUGFV-UHFFFAOYSA-N 0.000 description 1
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 1
- JAHNSTQSQJOJLO-UHFFFAOYSA-N 2-(3-fluorophenyl)-1h-imidazole Chemical compound FC1=CC=CC(C=2NC=CN=2)=C1 JAHNSTQSQJOJLO-UHFFFAOYSA-N 0.000 description 1
- OEPOKWHJYJXUGD-UHFFFAOYSA-N 2-(3-phenylmethoxyphenyl)-1,3-thiazole-4-carbaldehyde Chemical compound O=CC1=CSC(C=2C=C(OCC=3C=CC=CC=3)C=CC=2)=N1 OEPOKWHJYJXUGD-UHFFFAOYSA-N 0.000 description 1
- KZDCMKVLEYCGQX-UDPGNSCCSA-N 2-(diethylamino)ethyl 4-aminobenzoate;(2s,5r,6r)-3,3-dimethyl-7-oxo-6-[(2-phenylacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid;hydrate Chemical compound O.CCN(CC)CCOC(=O)C1=CC=C(N)C=C1.N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 KZDCMKVLEYCGQX-UDPGNSCCSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- 125000001340 2-chloroethyl group Chemical group [H]C([H])(Cl)C([H])([H])* 0.000 description 1
- KKZUMAMOMRDVKA-UHFFFAOYSA-N 2-chloropropane Chemical group [CH2]C(C)Cl KKZUMAMOMRDVKA-UHFFFAOYSA-N 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- 125000006181 4-methyl benzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])C([H])([H])* 0.000 description 1
- VFGRNTYELNYSKJ-UHFFFAOYSA-N 6-amino-1,3-dimethylpyrimidine-2,4-dione Chemical compound CN1C(N)=CC(=O)N(C)C1=O VFGRNTYELNYSKJ-UHFFFAOYSA-N 0.000 description 1
- QDQFFMDHSLMPPN-UHFFFAOYSA-N 6-methyl-3-phenyl-2-sulfanylidene-1h-pyrimidin-4-one Chemical compound S=C1NC(C)=CC(=O)N1C1=CC=CC=C1 QDQFFMDHSLMPPN-UHFFFAOYSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 229930185605 Bisphenol Natural products 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- MQIUGAXCHLFZKX-UHFFFAOYSA-N Di-n-octyl phthalate Natural products CCCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCCC MQIUGAXCHLFZKX-UHFFFAOYSA-N 0.000 description 1
- 239000004908 Emulsion polymer Substances 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 1
- YIKSCQDJHCMVMK-UHFFFAOYSA-N Oxamide Chemical class NC(=O)C(N)=O YIKSCQDJHCMVMK-UHFFFAOYSA-N 0.000 description 1
- 229920001944 Plastisol Polymers 0.000 description 1
- 240000001987 Pyrus communis Species 0.000 description 1
- 239000006096 absorbing agent Substances 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-N acetic acid Substances CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 1
- 125000002339 acetoacetyl group Chemical group O=C([*])C([H])([H])C(=O)C([H])([H])[H] 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000001252 acrylic acid derivatives Chemical class 0.000 description 1
- 230000032683 aging Effects 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 239000002216 antistatic agent Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000010425 asbestos Substances 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 150000001559 benzoic acids Chemical class 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- BJQHLKABXJIVAM-UHFFFAOYSA-N bis(2-ethylhexyl) phthalate Chemical compound CCCCC(CC)COC(=O)C1=CC=CC=C1C(=O)OCC(CC)CCCC BJQHLKABXJIVAM-UHFFFAOYSA-N 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000003490 calendering Methods 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000006229 carbon black Substances 0.000 description 1
- 125000005708 carbonyloxy group Chemical group [*:2]OC([*:1])=O 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 125000000068 chlorophenyl group Chemical group 0.000 description 1
- 229940125904 compound 1 Drugs 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000006260 ethylaminocarbonyl group Chemical group [H]N(C(*)=O)C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000003063 flame retardant Substances 0.000 description 1
- 239000006081 fluorescent whitening agent Substances 0.000 description 1
- 239000003365 glass fiber Substances 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 125000006289 hydroxybenzyl group Chemical group 0.000 description 1
- 238000001746 injection moulding Methods 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 239000004611 light stabiliser Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 150000002690 malonic acid derivatives Chemical class 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000006078 metal deactivator Substances 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 125000004458 methylaminocarbonyl group Chemical group [H]N(C(*)=O)C([H])([H])[H] 0.000 description 1
- LVHBHZANLOWSRM-UHFFFAOYSA-N methylenebutanedioic acid Natural products OC(=O)CC(=C)C(O)=O LVHBHZANLOWSRM-UHFFFAOYSA-N 0.000 description 1
- 238000010137 moulding (plastic) Methods 0.000 description 1
- 239000000206 moulding compound Substances 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000002816 nickel compounds Chemical class 0.000 description 1
- AICOOMRHRUFYCM-ZRRPKQBOSA-N oxazine, 1 Chemical compound C([C@@H]1[C@H](C(C[C@]2(C)[C@@H]([C@H](C)N(C)C)[C@H](O)C[C@]21C)=O)CC1=CC2)C[C@H]1[C@@]1(C)[C@H]2N=C(C(C)C)OC1 AICOOMRHRUFYCM-ZRRPKQBOSA-N 0.000 description 1
- AQSJGOWTSHOLKH-UHFFFAOYSA-N phosphite(3-) Chemical class [O-]P([O-])[O-] AQSJGOWTSHOLKH-UHFFFAOYSA-N 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 239000004999 plastisol Substances 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000003230 pyrimidines Chemical class 0.000 description 1
- 229910052895 riebeckite Inorganic materials 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- ZEMGGZBWXRYJHK-UHFFFAOYSA-N thiouracil Chemical compound O=C1C=CNC(=S)N1 ZEMGGZBWXRYJHK-UHFFFAOYSA-N 0.000 description 1
- 229950000329 thiouracil Drugs 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- MGMXGCZJYUCMGY-UHFFFAOYSA-N tris(4-nonylphenyl) phosphite Chemical compound C1=CC(CCCCCCCCC)=CC=C1OP(OC=1C=CC(CCCCCCCCC)=CC=1)OC1=CC=C(CCCCCCCCC)C=C1 MGMXGCZJYUCMGY-UHFFFAOYSA-N 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- XOOUIPVCVHRTMJ-UHFFFAOYSA-L zinc stearate Chemical compound [Zn+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O XOOUIPVCVHRTMJ-UHFFFAOYSA-L 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/16—Nitrogen-containing compounds
- C08K5/34—Heterocyclic compounds having nitrogen in the ring
- C08K5/3442—Heterocyclic compounds having nitrogen in the ring having two nitrogen atoms in the ring
- C08K5/3462—Six-membered rings
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/36—Sulfur-, selenium-, or tellurium-containing compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH4261/80-9 | 1980-06-02 | ||
| CH426180 | 1980-06-02 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1154898A true CA1154898A (en) | 1983-10-04 |
Family
ID=4272837
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000378595A Expired CA1154898A (en) | 1980-06-02 | 1981-05-29 | Chlorinated thermoplastics stabilised with aminothiouracils |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US4352903A (show.php) |
| EP (1) | EP0041479B1 (show.php) |
| JP (1) | JPS5723647A (show.php) |
| CA (1) | CA1154898A (show.php) |
| DE (1) | DE3162945D1 (show.php) |
Families Citing this family (25)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4656209A (en) * | 1982-05-26 | 1987-04-07 | Ciba-Geigy Corporation | Chlorinated thermoplastics stabilized with aminouracils |
| JPS6345138A (ja) * | 1986-08-08 | 1988-02-26 | Asahi Glass Co Ltd | ガラス板の曲げ加工方法 |
| JPS63192402A (ja) * | 1987-02-03 | 1988-08-09 | ワイケイケイ株式会社 | スライドフアスナ−用錠装置 |
| JPS6414121A (en) * | 1987-07-07 | 1989-01-18 | Asahi Glass Co Ltd | Bend forming device for plate glass |
| EP0421933B1 (de) | 1989-10-06 | 1996-06-12 | Ciba-Geigy Ag | Stabilisierte chlorhaltige Polymerzusammensetzungen |
| US5177135A (en) | 1989-12-11 | 1993-01-05 | Ciba-Geigy Corporation | β-keto esters as stabilizers for chlorinated polymers |
| US5196463A (en) * | 1991-02-07 | 1993-03-23 | Enichem Elastomeri S.R.L. | Non-postcure vulcanizing composition and elastomers made therefrom |
| AU735549B2 (en) * | 1995-10-13 | 2001-07-12 | Chemtura Vinyl Additives Gmbh | Stabiliser combinations for chlorine-containing polymers |
| AU2003203242B2 (en) * | 1995-10-13 | 2004-11-25 | Chemtura Vinyl Additives Gmbh | Stabiliser combinations for chlorine-containing polymers |
| AU714489B2 (en) * | 1995-10-13 | 2000-01-06 | Chemtura Vinyl Additives Gmbh | Stabiliser combinations for chlorine-containing polymers |
| MY114466A (en) * | 1996-09-25 | 2002-10-31 | Crompton Vinyl Additives Gmbh | Rigid pvc stabilised with n, n-dimethyl-6-aminouracils |
| DK0930332T3 (da) * | 1998-01-16 | 2003-07-21 | Crompton Vinyl Additives Gmbh | Stabilisatorsystem til chlorholdige polymerer |
| ES2199496T3 (es) | 1998-06-02 | 2004-02-16 | Crompton Vinyl Additives Gmbh | Cianacetilureas para la estabilizacion de polimeros con un contenido en halogeno. |
| ATE222242T1 (de) * | 1998-06-26 | 2002-08-15 | Crompton Vinyl Additives Gmbh | In 5-stellung substituierte 6-aminouracile als stabilisatoren für halogen-haltige polymere |
| EP1510545A3 (de) * | 1998-06-26 | 2005-06-15 | Wolfgang Dr. Wehner | Oxaalkyl-6-Aminouracile zum Stabilisieren von halogenhaltigen Polymeren |
| ATE230733T1 (de) | 1998-06-26 | 2003-01-15 | Crompton Vinyl Additives Gmbh | Neue nh2-modifizierte 6-aminouracile als stabilisatoren für halogenhaltige polymere |
| DE19915388A1 (de) * | 1999-04-06 | 2000-10-12 | Witco Vinyl Additives Gmbh | 4-Aminopyrimidinone und Oxazolidino-4-amino-pyrimidinone, Verfahren zu deren Herstellung und ihre Verwendung zum Stabilisieren von halogenhaltigen Polymeren |
| DE10132836A1 (de) * | 2001-07-06 | 2003-01-16 | Cognis Deutschland Gmbh | Verwendung von Aminouracilen zur Stabilisierung von antistatisch ausgerüsteten halogenhaltigen organischen Kunststoffen |
| ITVA20020058A1 (it) * | 2002-11-15 | 2004-05-16 | Lamberti Spa | Composizioni di pvc stabili al calore. |
| EP1426406A1 (de) * | 2002-12-02 | 2004-06-09 | Crompton Vinyl Additives GmbH | Monosubstituierte 6-Aminouracile zum Stabilisieren von halogenhaltigen Polymeren |
| EP1496083A1 (en) * | 2003-07-10 | 2005-01-12 | Arkema | Stabilizing composition for chlorine-containing polymers |
| EP2123659A1 (en) * | 2008-05-15 | 2009-11-25 | Arkema France | High purity monoalkyltin compounds and uses thereof |
| FR2986003B1 (fr) | 2012-01-24 | 2015-01-16 | Arkema France | Procede de preparation de polymeres halogenes |
| CN104877179B (zh) * | 2015-03-31 | 2018-02-23 | 杭州鸿雁管道系统科技有限公司 | 一种有机复合热稳定剂及其制备方法 |
| CN106189281A (zh) * | 2016-08-09 | 2016-12-07 | 昌吉市新铭泰新型材料科技有限公司 | 一种微细钙锌复合热稳定剂的生产工艺 |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE888167C (de) * | 1944-02-23 | 1953-08-31 | Cassella Farbwerke Mainkur Ag | Stabilisierungsmittel fuer halogenhaltige Verbindungen |
| US2615020A (en) * | 1950-02-01 | 1952-10-21 | Searle & Co | Derivatives of 2-thio-6-amino-1,2,3,4-tetrahydro-2,4-pyrimidinedione |
| DE1694873C3 (de) * | 1966-02-12 | 1973-11-08 | Ciba-Geigy Marienberg Gmbh, 6140 Marienberg | Stabilisierung von Vinylchlorid polymerisaten |
| US4105627A (en) * | 1976-09-20 | 1978-08-08 | Argus Chemical Corporation | Mercaptoheterocyclic resin stabilizers |
-
1981
- 1981-05-26 DE DE8181810200T patent/DE3162945D1/de not_active Expired
- 1981-05-26 EP EP81810200A patent/EP0041479B1/de not_active Expired
- 1981-05-29 CA CA000378595A patent/CA1154898A/en not_active Expired
- 1981-06-01 JP JP8425781A patent/JPS5723647A/ja active Granted
- 1981-06-01 US US06/268,558 patent/US4352903A/en not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| DE3162945D1 (en) | 1984-05-10 |
| US4352903A (en) | 1982-10-05 |
| EP0041479B1 (de) | 1984-04-04 |
| JPS6411066B2 (show.php) | 1989-02-23 |
| EP0041479A1 (de) | 1981-12-09 |
| JPS5723647A (en) | 1982-02-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1154898A (en) | Chlorinated thermoplastics stabilised with aminothiouracils | |
| BE1011371A3 (fr) | Utilisation d'amino-uraciles substitues procede pour stabiliser du pvc rigide, composition ainsi obtenue et son utilisation. | |
| EP1327660B1 (de) | Stabilisatorkombinationen für chlorhaltige Polymere | |
| US4656209A (en) | Chlorinated thermoplastics stabilized with aminouracils | |
| US4339383A (en) | Imide containing stabilizers for chlorinated thermoplastics | |
| CA1180476A (en) | Chlorinated thermoplastics stabilised with aminouracils | |
| US20090170988A1 (en) | Stabilizing system for halogenous polymers | |
| NO320683B1 (no) | Cyanoacetylurea-stabilisert klorholdig polymermateriale og anvendelse derav | |
| US4698368A (en) | Mixtures of organo-tin compounds | |
| US6232375B1 (en) | 4-aminopyrimidinones and oxazolidino-4-aminopyrimidinones, process for their preparation and their use for stabilizing halogen-containing polymers | |
| US20060235124A1 (en) | Stabilizer system for the stabilisation of halogenated polymers | |
| US4290942A (en) | Heat-stabilized chlorine-containing thermoplastic | |
| KR100896259B1 (ko) | 할로겐-함유 중합체의 예비중합화 | |
| US4285856A (en) | Organo-tin compounds, process for their preparation and their use | |
| US4327000A (en) | Stabilizer mixtures for stabilizing chlorinated thermoplastics | |
| US4097452A (en) | 14-Substituted 7,15-diazadispiro- 5.1.5.3!-hexadecanes as UV stabilizers | |
| US4196110A (en) | Stabilized moulding material | |
| US4385147A (en) | Stabilization of chlorine-containing thermoplastics with m-aminophenol derivatives | |
| US4374945A (en) | Thioglycolate and thiopropionate secondary stabilizers | |
| FR2717821A1 (fr) | Compositions de polymères chlorés stabilisées. | |
| EP1560878B1 (en) | Thermally stabilised pvc compositions | |
| WO1982002169A1 (en) | Hindered phenolic antioxidants and diazacycloalkane uv stabilizers in polymeric films | |
| GB2076409A (en) | Novel stabiliser mixture | |
| US3626006A (en) | Thiolanhydride of 3-aminocrotonic acid |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |