CA1154765A - 4-amino-6, 7-dimethoxy-2-piperazinylquinazoline derivatives, their preparation and use - Google Patents
4-amino-6, 7-dimethoxy-2-piperazinylquinazoline derivatives, their preparation and useInfo
- Publication number
- CA1154765A CA1154765A CA000370761A CA370761A CA1154765A CA 1154765 A CA1154765 A CA 1154765A CA 000370761 A CA000370761 A CA 000370761A CA 370761 A CA370761 A CA 370761A CA 1154765 A CA1154765 A CA 1154765A
- Authority
- CA
- Canada
- Prior art keywords
- group
- amino
- formula
- piperazinyl
- compound
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- APKHJGDGWQDBGM-UHFFFAOYSA-N 6,7-dimethoxy-2-piperazin-1-ylquinazolin-4-amine Chemical class N=1C(N)=C2C=C(OC)C(OC)=CC2=NC=1N1CCNCC1 APKHJGDGWQDBGM-UHFFFAOYSA-N 0.000 title claims description 8
- 238000002360 preparation method Methods 0.000 title description 5
- 150000001875 compounds Chemical class 0.000 claims abstract description 187
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 claims abstract description 42
- 125000005843 halogen group Chemical group 0.000 claims abstract description 38
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 36
- 239000002253 acid Substances 0.000 claims abstract description 32
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 31
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 26
- 150000003839 salts Chemical class 0.000 claims abstract description 24
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims abstract description 15
- 125000003342 alkenyl group Chemical group 0.000 claims abstract description 9
- 125000000304 alkynyl group Chemical group 0.000 claims abstract description 7
- 125000003277 amino group Chemical group 0.000 claims abstract description 6
- 125000004430 oxygen atom Chemical group O* 0.000 claims abstract description 6
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims abstract description 5
- 125000001931 aliphatic group Chemical group 0.000 claims abstract description 5
- 150000004050 homopiperazines Chemical class 0.000 claims abstract description 3
- 238000000034 method Methods 0.000 claims description 95
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 82
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 claims description 81
- -1 homopiperazin-1-yl group Chemical group 0.000 claims description 70
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 claims description 56
- JWVCLYRUEFBMGU-UHFFFAOYSA-N quinazoline Chemical compound N1=CN=CC2=CC=CC=C21 JWVCLYRUEFBMGU-UHFFFAOYSA-N 0.000 claims description 52
- PHTQWCKDNZKARW-UHFFFAOYSA-N isoamylol Chemical compound CC(C)CCO PHTQWCKDNZKARW-UHFFFAOYSA-N 0.000 claims description 31
- 238000010992 reflux Methods 0.000 claims description 29
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 claims description 28
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 claims description 28
- HWIIAAVGRHKSOJ-UHFFFAOYSA-N 2-chloro-6,7-dimethoxyquinazolin-4-amine Chemical compound ClC1=NC(N)=C2C=C(OC)C(OC)=CC2=N1 HWIIAAVGRHKSOJ-UHFFFAOYSA-N 0.000 claims description 21
- 125000006274 (C1-C3)alkoxy group Chemical group 0.000 claims description 18
- 239000012458 free base Substances 0.000 claims description 10
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 7
- 150000003246 quinazolines Chemical class 0.000 claims description 7
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 claims description 4
- 150000008065 acid anhydrides Chemical class 0.000 claims description 4
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 claims description 4
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 claims description 4
- 229920006395 saturated elastomer Polymers 0.000 claims description 4
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 claims description 3
- DFFBWJWKKVFBTC-UHFFFAOYSA-N (4-phenylmethoxyphenyl)-piperazin-1-ylmethanone Chemical compound C=1C=C(OCC=2C=CC=CC=2)C=CC=1C(=O)N1CCNCC1 DFFBWJWKKVFBTC-UHFFFAOYSA-N 0.000 claims description 2
- OTTYFDRFBJPGRW-ONEGZZNKSA-N (e)-pent-2-enoyl chloride Chemical compound CC\C=C\C(Cl)=O OTTYFDRFBJPGRW-ONEGZZNKSA-N 0.000 claims description 2
- UZVCOVYLNPOXMM-UHFFFAOYSA-N 1-[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]pent-4-en-1-one Chemical compound N=1C(N)=C2C=C(OC)C(OC)=CC2=NC=1N1CCN(C(=O)CCC=C)CC1 UZVCOVYLNPOXMM-UHFFFAOYSA-N 0.000 claims description 2
- POFHGVAOSUKEPE-UHFFFAOYSA-N 2-cyclohexylideneacetyl chloride Chemical compound ClC(=O)C=C1CCCCC1 POFHGVAOSUKEPE-UHFFFAOYSA-N 0.000 claims description 2
- YOYSRTQXTLLFCB-UHFFFAOYSA-N 2-cyclopentylideneacetyl chloride Chemical compound ClC(=O)C=C1CCCC1 YOYSRTQXTLLFCB-UHFFFAOYSA-N 0.000 claims description 2
- PKUPAJQAJXVUEK-UHFFFAOYSA-N 2-phenoxyacetyl chloride Chemical compound ClC(=O)COC1=CC=CC=C1 PKUPAJQAJXVUEK-UHFFFAOYSA-N 0.000 claims description 2
- BDSSZTXPZHIYHM-UHFFFAOYSA-N 2-phenoxypropanoyl chloride Chemical compound ClC(=O)C(C)OC1=CC=CC=C1 BDSSZTXPZHIYHM-UHFFFAOYSA-N 0.000 claims description 2
- VMZCDNSFRSVYKQ-UHFFFAOYSA-N 2-phenylacetyl chloride Chemical compound ClC(=O)CC1=CC=CC=C1 VMZCDNSFRSVYKQ-UHFFFAOYSA-N 0.000 claims description 2
- MFEILWXBDBCWKF-UHFFFAOYSA-N 3-phenylpropanoyl chloride Chemical compound ClC(=O)CCC1=CC=CC=C1 MFEILWXBDBCWKF-UHFFFAOYSA-N 0.000 claims description 2
- 150000004820 halides Chemical class 0.000 claims description 2
- JDKQTIKEGOOXTJ-UHFFFAOYSA-N pent-4-enoyl chloride Chemical compound ClC(=O)CCC=C JDKQTIKEGOOXTJ-UHFFFAOYSA-N 0.000 claims description 2
- 239000000126 substance Substances 0.000 claims 29
- 125000004194 piperazin-1-yl group Chemical group [H]N1C([H])([H])C([H])([H])N(*)C([H])([H])C1([H])[H] 0.000 claims 3
- 150000001728 carbonyl compounds Chemical class 0.000 claims 2
- 229960005141 piperazine Drugs 0.000 claims 2
- WWOZMOHTPWJWDV-UHFFFAOYSA-N (1-phenylcyclopropyl)-piperazin-1-ylmethanone Chemical compound C1CC1(C=1C=CC=CC=1)C(=O)N1CCNCC1 WWOZMOHTPWJWDV-UHFFFAOYSA-N 0.000 claims 1
- HBUVWDNPZLRVAD-UHFFFAOYSA-N (3-methoxy-4-phenylmethoxyphenyl)-piperazin-1-ylmethanone Chemical compound COC1=CC(C(=O)N2CCNCC2)=CC=C1OCC1=CC=CC=C1 HBUVWDNPZLRVAD-UHFFFAOYSA-N 0.000 claims 1
- UABQBJWRKVJQGV-SNAWJCMRSA-N (e)-1-[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]but-2-en-1-one Chemical compound N=1C(N)=C2C=C(OC)C(OC)=CC2=NC=1N1CCN(C(=O)\C=C\C)CC1 UABQBJWRKVJQGV-SNAWJCMRSA-N 0.000 claims 1
- GIBJEDDGVTYTNP-NSCUHMNNSA-N (e)-1-piperazin-1-ylbut-2-en-1-one Chemical compound C\C=C\C(=O)N1CCNCC1 GIBJEDDGVTYTNP-NSCUHMNNSA-N 0.000 claims 1
- CKYPVYOGSAOFFL-UHFFFAOYSA-N 1-[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-2-cyclohexylideneethanone Chemical compound N=1C(N)=C2C=C(OC)C(OC)=CC2=NC=1N(CC1)CCN1C(=O)C=C1CCCCC1 CKYPVYOGSAOFFL-UHFFFAOYSA-N 0.000 claims 1
- DPRWRLGDIOBLSH-UHFFFAOYSA-N 1-[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-2-cyclopentylideneethanone Chemical compound N=1C(N)=C2C=C(OC)C(OC)=CC2=NC=1N(CC1)CCN1C(=O)C=C1CCCC1 DPRWRLGDIOBLSH-UHFFFAOYSA-N 0.000 claims 1
- SCPZJEYEUXEBTQ-UHFFFAOYSA-N 1-[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-2-phenoxypropan-1-one Chemical compound N=1C(N)=C2C=C(OC)C(OC)=CC2=NC=1N(CC1)CCN1C(=O)C(C)OC1=CC=CC=C1 SCPZJEYEUXEBTQ-UHFFFAOYSA-N 0.000 claims 1
- LTARAMBSPXICFP-UHFFFAOYSA-N 1-[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-2-phenylethanethione Chemical compound N=1C(N)=C2C=C(OC)C(OC)=CC2=NC=1N(CC1)CCN1C(=S)CC1=CC=CC=C1 LTARAMBSPXICFP-UHFFFAOYSA-N 0.000 claims 1
- DCOWFYLEXDOVAM-UHFFFAOYSA-N 1-[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-3-phenylpropan-1-one Chemical compound N=1C(N)=C2C=C(OC)C(OC)=CC2=NC=1N(CC1)CCN1C(=O)CCC1=CC=CC=C1 DCOWFYLEXDOVAM-UHFFFAOYSA-N 0.000 claims 1
- QXYVSQHXWANCJH-UHFFFAOYSA-N 2-phenyl-1-piperazin-1-ylethanethione Chemical compound C1CNCCN1C(=S)CC1=CC=CC=C1 QXYVSQHXWANCJH-UHFFFAOYSA-N 0.000 claims 1
- QIRURGMDBKVCNR-UHFFFAOYSA-N 4-(1-phenylethoxy)benzoyl chloride Chemical compound C=1C=CC=CC=1C(C)OC1=CC=C(C(Cl)=O)C=C1 QIRURGMDBKVCNR-UHFFFAOYSA-N 0.000 claims 1
- WHBRACGDXAWFBY-QWHCGFSZSA-N [(1r,2r)-2-phenylcyclopropyl]-piperazin-1-ylmethanone Chemical compound C1([C@@H]2C[C@H]2C(=O)N2CCNCC2)=CC=CC=C1 WHBRACGDXAWFBY-QWHCGFSZSA-N 0.000 claims 1
- HBICVUIEPZZPSC-UHFFFAOYSA-N [4-(1-phenylethoxy)phenyl]-piperazin-1-ylmethanone Chemical compound C=1C=CC=CC=1C(C)OC(C=C1)=CC=C1C(=O)N1CCNCC1 HBICVUIEPZZPSC-UHFFFAOYSA-N 0.000 claims 1
- OYVXUTNQWGCCJJ-UHFFFAOYSA-N [4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-(1-phenylcyclopropyl)methanone Chemical compound N=1C(N)=C2C=C(OC)C(OC)=CC2=NC=1N(CC1)CCN1C(=O)C1(C=2C=CC=CC=2)CC1 OYVXUTNQWGCCJJ-UHFFFAOYSA-N 0.000 claims 1
- JOPBDECWMYYFDE-UHFFFAOYSA-N [4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-(3,5-dimethoxy-4-phenylmethoxyphenyl)methanone Chemical compound N=1C(N)=C2C=C(OC)C(OC)=CC2=NC=1N(CC1)CCN1C(=O)C(C=C1OC)=CC(OC)=C1OCC1=CC=CC=C1 JOPBDECWMYYFDE-UHFFFAOYSA-N 0.000 claims 1
- BEYPUJPRORHEMK-UHFFFAOYSA-N [4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-(3-methoxy-4-phenylmethoxyphenyl)methanone Chemical compound COC1=CC(C(=O)N2CCN(CC2)C=2N=C3C=C(OC)C(OC)=CC3=C(N)N=2)=CC=C1OCC1=CC=CC=C1 BEYPUJPRORHEMK-UHFFFAOYSA-N 0.000 claims 1
- HLOZOURBTWCFBF-UHFFFAOYSA-N [4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-(4-phenylmethoxyphenyl)methanone Chemical compound N=1C(N)=C2C=C(OC)C(OC)=CC2=NC=1N(CC1)CCN1C(=O)C(C=C1)=CC=C1OCC1=CC=CC=C1 HLOZOURBTWCFBF-UHFFFAOYSA-N 0.000 claims 1
- QSRCXSDOJVDQBI-DLBZAZTESA-N [4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-[(1r,2r)-2-phenylcyclopropyl]methanone Chemical compound C1([C@@H]2C[C@H]2C(=O)N2CCN(CC2)C=2N=C3C=C(C(=CC3=C(N)N=2)OC)OC)=CC=CC=C1 QSRCXSDOJVDQBI-DLBZAZTESA-N 0.000 claims 1
- 238000004519 manufacturing process Methods 0.000 claims 1
- 125000003545 alkoxy group Chemical group 0.000 abstract description 20
- 239000002220 antihypertensive agent Substances 0.000 abstract description 3
- 229940030600 antihypertensive agent Drugs 0.000 abstract 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 147
- 239000013078 crystal Substances 0.000 description 71
- 239000000203 mixture Substances 0.000 description 71
- 239000000460 chlorine Substances 0.000 description 50
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 46
- 238000001914 filtration Methods 0.000 description 39
- 238000000921 elemental analysis Methods 0.000 description 37
- 238000002844 melting Methods 0.000 description 37
- 230000008018 melting Effects 0.000 description 37
- 239000000243 solution Substances 0.000 description 31
- DKAGJZJALZXOOV-UHFFFAOYSA-N hydrate;hydrochloride Chemical compound O.Cl DKAGJZJALZXOOV-UHFFFAOYSA-N 0.000 description 29
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 27
- 238000000354 decomposition reaction Methods 0.000 description 25
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 24
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 24
- 238000006243 chemical reaction Methods 0.000 description 18
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 17
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 15
- 239000011541 reaction mixture Substances 0.000 description 15
- 230000003276 anti-hypertensive effect Effects 0.000 description 13
- 238000001704 evaporation Methods 0.000 description 13
- 230000008020 evaporation Effects 0.000 description 13
- VBUBADWLHFZFDK-UHFFFAOYSA-N quinazoline;hydrochloride Chemical compound Cl.N1=CN=CC2=CC=CC=C21 VBUBADWLHFZFDK-UHFFFAOYSA-N 0.000 description 12
- 125000004193 piperazinyl group Chemical group 0.000 description 10
- 239000002904 solvent Substances 0.000 description 10
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- 239000007864 aqueous solution Substances 0.000 description 9
- 229910052801 chlorine Inorganic materials 0.000 description 9
- QMEZUZOCLYUADC-UHFFFAOYSA-N hydrate;dihydrochloride Chemical compound O.Cl.Cl QMEZUZOCLYUADC-UHFFFAOYSA-N 0.000 description 9
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 9
- 125000004432 carbon atom Chemical group C* 0.000 description 8
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 8
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 8
- IENZQIKPVFGBNW-UHFFFAOYSA-N prazosin Chemical compound N=1C(N)=C2C=C(OC)C(OC)=CC2=NC=1N(CC1)CCN1C(=O)C1=CC=CO1 IENZQIKPVFGBNW-UHFFFAOYSA-N 0.000 description 8
- 229960001289 prazosin Drugs 0.000 description 8
- 238000001816 cooling Methods 0.000 description 7
- NSNHWTBQMQIDCF-UHFFFAOYSA-N dihydrate;hydrochloride Chemical compound O.O.Cl NSNHWTBQMQIDCF-UHFFFAOYSA-N 0.000 description 7
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 7
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- 206010020772 Hypertension Diseases 0.000 description 6
- 241001465754 Metazoa Species 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 6
- 230000000694 effects Effects 0.000 description 6
- RVZMPNMUBCAPQO-UHFFFAOYSA-N 2,4-dimethoxyquinazoline Chemical compound C1=CC=CC2=NC(OC)=NC(OC)=C21 RVZMPNMUBCAPQO-UHFFFAOYSA-N 0.000 description 5
- 239000011737 fluorine Substances 0.000 description 5
- 229910052731 fluorine Inorganic materials 0.000 description 5
- 125000003253 isopropoxy group Chemical group [H]C([H])([H])C([H])(O*)C([H])([H])[H] 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 238000010898 silica gel chromatography Methods 0.000 description 5
- FYMQPWWNOCENRN-UHFFFAOYSA-N 6,7-dimethoxyquinazoline Chemical compound N1=CN=C2C=C(OC)C(OC)=CC2=C1 FYMQPWWNOCENRN-UHFFFAOYSA-N 0.000 description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 4
- 230000036772 blood pressure Effects 0.000 description 4
- 229910052799 carbon Inorganic materials 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- GHPYJLCQYMAXGG-WCCKRBBISA-N (2R)-2-amino-3-(2-boronoethylsulfanyl)propanoic acid hydrochloride Chemical compound Cl.N[C@@H](CSCCB(O)O)C(O)=O GHPYJLCQYMAXGG-WCCKRBBISA-N 0.000 description 3
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 3
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 125000001246 bromo group Chemical group Br* 0.000 description 3
- 238000004587 chromatography analysis Methods 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 229910052736 halogen Chemical group 0.000 description 3
- 150000003840 hydrochlorides Chemical class 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 125000001424 substituent group Chemical group 0.000 description 3
- DBODNPMIIRVQGW-UHFFFAOYSA-N trihydrate;dihydrochloride Chemical compound O.O.O.Cl.Cl DBODNPMIIRVQGW-UHFFFAOYSA-N 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- 125000004973 1-butenyl group Chemical group C(=CCC)* 0.000 description 2
- QIPSSVPXEDZUJA-UHFFFAOYSA-N 2-(1,4-diazepan-1-yl)quinazoline Chemical class C1CCNCCN1C1=NC=C(C=CC=C2)C2=N1 QIPSSVPXEDZUJA-UHFFFAOYSA-N 0.000 description 2
- NRQJIAVOKMKUOR-UHFFFAOYSA-N 2-piperazin-1-ylquinazoline Chemical compound C1CNCCN1C1=NC=C(C=CC=C2)C2=N1 NRQJIAVOKMKUOR-UHFFFAOYSA-N 0.000 description 2
- 125000004975 3-butenyl group Chemical group C(CC=C)* 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- 208000001953 Hypotension Diseases 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 241000700159 Rattus Species 0.000 description 2
- 125000002252 acyl group Chemical group 0.000 description 2
- 230000002411 adverse Effects 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 2
- 150000008041 alkali metal carbonates Chemical class 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 125000000753 cycloalkyl group Chemical group 0.000 description 2
- 235000014113 dietary fatty acids Nutrition 0.000 description 2
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- 239000000194 fatty acid Substances 0.000 description 2
- 229930195729 fatty acid Natural products 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 125000001153 fluoro group Chemical group F* 0.000 description 2
- 150000002367 halogens Chemical group 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 150000007529 inorganic bases Chemical class 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 150000007530 organic bases Chemical class 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- ZIDNDHOWBISBIO-UHFFFAOYSA-N quinazoline;hydrate;hydrochloride Chemical compound O.Cl.N1=CN=CC2=CC=CC=C21 ZIDNDHOWBISBIO-UHFFFAOYSA-N 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- RJUIDDKTATZJFE-NSCUHMNNSA-N (e)-but-2-enoyl chloride Chemical compound C\C=C\C(Cl)=O RJUIDDKTATZJFE-NSCUHMNNSA-N 0.000 description 1
- QWJAOMBLOLSAIB-UHFFFAOYSA-N 1,4-diazepan-1-yl-(4-phenylmethoxyphenyl)methanone Chemical compound C=1C=C(OCC=2C=CC=CC=2)C=CC=1C(=O)N1CCCNCC1 QWJAOMBLOLSAIB-UHFFFAOYSA-N 0.000 description 1
- JTUBLGGTVJUEGT-UHFFFAOYSA-N 1-[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-2-cyclohexyl-2-(4-methylphenyl)ethanone Chemical compound N=1C(N)=C2C=C(OC)C(OC)=CC2=NC=1N(CC1)CCN1C(=O)C(C=1C=CC(C)=CC=1)C1CCCCC1 JTUBLGGTVJUEGT-UHFFFAOYSA-N 0.000 description 1
- ZZHPUBNNJGIKLC-UHFFFAOYSA-N 1-[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-2-cyclopropyl-2-phenylethanone Chemical compound N=1C(N)=C2C=C(OC)C(OC)=CC2=NC=1N(CC1)CCN1C(=O)C(C=1C=CC=CC=1)C1CC1 ZZHPUBNNJGIKLC-UHFFFAOYSA-N 0.000 description 1
- VWDWUKICKBQSOD-UHFFFAOYSA-N 1-[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]hex-2-en-1-one Chemical compound C1CN(C(=O)C=CCCC)CCN1C1=NC(N)=C(C=C(OC)C(OC)=C2)C2=N1 VWDWUKICKBQSOD-UHFFFAOYSA-N 0.000 description 1
- HVRIJIIWXFMRPH-UHFFFAOYSA-N 1-[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]hex-3-en-1-one Chemical compound C1CN(C(=O)CC=CCC)CCN1C1=NC(N)=C(C=C(OC)C(OC)=C2)C2=N1 HVRIJIIWXFMRPH-UHFFFAOYSA-N 0.000 description 1
- YOTSPHBUHZXZJV-UHFFFAOYSA-N 1-[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]pent-2-en-1-one Chemical compound C1CN(C(=O)C=CCC)CCN1C1=NC(N)=C(C=C(OC)C(OC)=C2)C2=N1 YOTSPHBUHZXZJV-UHFFFAOYSA-N 0.000 description 1
- 125000006039 1-hexenyl group Chemical group 0.000 description 1
- 125000006025 1-methyl-1-butenyl group Chemical group 0.000 description 1
- 125000006044 1-methyl-1-pentenyl group Chemical group 0.000 description 1
- 125000006030 1-methyl-3-butenyl group Chemical group 0.000 description 1
- 125000006023 1-pentenyl group Chemical group 0.000 description 1
- 125000006017 1-propenyl group Chemical group 0.000 description 1
- 125000000530 1-propynyl group Chemical group [H]C([H])([H])C#C* 0.000 description 1
- BBUMHNGYUDGBRV-UHFFFAOYSA-N 2,4-dimethoxyquinazoline hydrate hydrochloride Chemical compound O.Cl.COC1=NC(=NC2=CC=CC=C12)OC BBUMHNGYUDGBRV-UHFFFAOYSA-N 0.000 description 1
- ZJAAJOAWNRODNB-UHFFFAOYSA-N 2-(1,4-diazepan-1-yl)-6,7-dimethoxyquinazoline Chemical class N1=C2C=C(OC)C(OC)=CC2=CN=C1N1CCCNCC1 ZJAAJOAWNRODNB-UHFFFAOYSA-N 0.000 description 1
- KIAYGSLXVNBIFE-UHFFFAOYSA-N 2-chloro-6,7-dimethoxyquinazoline Chemical compound N1=C(Cl)N=C2C=C(OC)C(OC)=CC2=C1 KIAYGSLXVNBIFE-UHFFFAOYSA-N 0.000 description 1
- 125000006040 2-hexenyl group Chemical group 0.000 description 1
- BWYJJZBRYSADRP-UHFFFAOYSA-N 2-methoxyquinazoline Chemical compound C1=CC=CC2=NC(OC)=NC=C21 BWYJJZBRYSADRP-UHFFFAOYSA-N 0.000 description 1
- 125000006026 2-methyl-1-butenyl group Chemical group 0.000 description 1
- 125000006020 2-methyl-1-propenyl group Chemical group 0.000 description 1
- TUNLYEHIVPWOHK-UHFFFAOYSA-N 2-methylbut-2-enoyl chloride Chemical compound CC=C(C)C(Cl)=O TUNLYEHIVPWOHK-UHFFFAOYSA-N 0.000 description 1
- 125000006024 2-pentenyl group Chemical group 0.000 description 1
- BMGKQFRMINVVPP-UHFFFAOYSA-N 2-phenoxybenzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1OC1=CC=CC=C1 BMGKQFRMINVVPP-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000000474 3-butynyl group Chemical group [H]C#CC([H])([H])C([H])([H])* 0.000 description 1
- 125000006041 3-hexenyl group Chemical group 0.000 description 1
- BDUBTLFQHNYXPC-UHFFFAOYSA-N 3-methylbut-2-enoyl chloride Chemical compound CC(C)=CC(Cl)=O BDUBTLFQHNYXPC-UHFFFAOYSA-N 0.000 description 1
- 125000006042 4-hexenyl group Chemical group 0.000 description 1
- 125000006043 5-hexenyl group Chemical group 0.000 description 1
- VDBJCDWTNCKRTF-UHFFFAOYSA-N 6'-hydroxyspiro[2-benzofuran-3,9'-9ah-xanthene]-1,3'-dione Chemical compound O1C(=O)C2=CC=CC=C2C21C1C=CC(=O)C=C1OC1=CC(O)=CC=C21 VDBJCDWTNCKRTF-UHFFFAOYSA-N 0.000 description 1
- 101710125089 Bindin Proteins 0.000 description 1
- 206010005746 Blood pressure fluctuation Diseases 0.000 description 1
- 101150099461 CTL2 gene Proteins 0.000 description 1
- 101100087530 Caenorhabditis elegans rom-1 gene Proteins 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 208000007530 Essential hypertension Diseases 0.000 description 1
- 241000243251 Hydra Species 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical group [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 125000000174 L-prolyl group Chemical group [H]N1C([H])([H])C([H])([H])C([H])([H])[C@@]1([H])C(*)=O 0.000 description 1
- 101100118976 Mus musculus Clint1 gene Proteins 0.000 description 1
- 101100305983 Mus musculus Rom1 gene Proteins 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- HBHMZPIFYVBMBY-UHFFFAOYSA-N O.O.Cl.N1=CN=CC2=CC=CC=C12 Chemical compound O.O.Cl.N1=CN=CC2=CC=CC=C12 HBHMZPIFYVBMBY-UHFFFAOYSA-N 0.000 description 1
- 241001387976 Pera Species 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 101150116431 Slc44a2 gene Proteins 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 239000005864 Sulphur Chemical group 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 241000009298 Trigla lyra Species 0.000 description 1
- VLNYLRHDXZVXJB-UHFFFAOYSA-N [4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-(2-phenylmethoxyphenyl)methanone;hydrochloride Chemical compound Cl.N=1C(N)=C2C=C(OC)C(OC)=CC2=NC=1N(CC1)CCN1C(=O)C1=CC=CC=C1OCC1=CC=CC=C1 VLNYLRHDXZVXJB-UHFFFAOYSA-N 0.000 description 1
- XOZFPSHPZLVYNP-UHFFFAOYSA-N [4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl]-[2-(2-phenylethoxy)phenyl]methanone Chemical compound N=1C(N)=C2C=C(OC)C(OC)=CC2=NC=1N(CC1)CCN1C(=O)C1=CC=CC=C1OCCC1=CC=CC=C1 XOZFPSHPZLVYNP-UHFFFAOYSA-N 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 230000001919 adrenal effect Effects 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 210000000702 aorta abdominal Anatomy 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 229960005070 ascorbic acid Drugs 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 239000011203 carbon fibre reinforced carbon Chemical group 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- UXTMROKLAAOEQO-UHFFFAOYSA-N chloroform;ethanol Chemical compound CCO.ClC(Cl)Cl UXTMROKLAAOEQO-UHFFFAOYSA-N 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- 238000006482 condensation reaction Methods 0.000 description 1
- 125000000392 cycloalkenyl group Chemical group 0.000 description 1
- 125000006255 cyclopropyl carbonyl group Chemical group [H]C1([H])C([H])([H])C1([H])C(*)=O 0.000 description 1
- 238000006704 dehydrohalogenation reaction Methods 0.000 description 1
- 150000004683 dihydrates Chemical class 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000002934 diuretic Substances 0.000 description 1
- 229940030606 diuretics Drugs 0.000 description 1
- 208000002173 dizziness Diseases 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 230000002526 effect on cardiovascular system Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 125000002425 furfuryl group Chemical group C(C1=CC=CO1)* 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 238000005227 gel permeation chromatography Methods 0.000 description 1
- 230000014509 gene expression Effects 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- BSUODTDYSTUDAV-UHFFFAOYSA-N hex-3-enoyl chloride Chemical compound CCC=CCC(Cl)=O BSUODTDYSTUDAV-UHFFFAOYSA-N 0.000 description 1
- GRTWTVFDPBKQNU-UHFFFAOYSA-N hexa-2,4-dienoyl chloride Chemical compound CC=CC=CC(Cl)=O GRTWTVFDPBKQNU-UHFFFAOYSA-N 0.000 description 1
- VKYKSIONXSXAKP-UHFFFAOYSA-N hexamethylenetetramine Chemical compound C1N(C2)CN3CN1CN2C3 VKYKSIONXSXAKP-UHFFFAOYSA-N 0.000 description 1
- 125000000717 hydrazino group Chemical group [H]N([*])N([H])[H] 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 1
- 230000001631 hypertensive effect Effects 0.000 description 1
- 208000021822 hypotensive Diseases 0.000 description 1
- 230000001077 hypotensive effect Effects 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 238000007912 intraperitoneal administration Methods 0.000 description 1
- 230000009545 invasion Effects 0.000 description 1
- QRXWMOHMRWLFEY-UHFFFAOYSA-N isoniazide Chemical compound NNC(=O)C1=CC=NC=C1 QRXWMOHMRWLFEY-UHFFFAOYSA-N 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 125000005394 methallyl group Chemical group 0.000 description 1
- GRVDJDISBSALJP-UHFFFAOYSA-N methyloxidanyl Chemical compound [O]C GRVDJDISBSALJP-UHFFFAOYSA-N 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 229960001412 pentobarbital Drugs 0.000 description 1
- WEXRUCMBJFQVBZ-UHFFFAOYSA-N pentobarbital Chemical compound CCCC(C)C1(CC)C(=O)NC(=O)NC1=O WEXRUCMBJFQVBZ-UHFFFAOYSA-N 0.000 description 1
- 239000008194 pharmaceutical composition Substances 0.000 description 1
- 125000000109 phenylethoxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])O* 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 230000002980 postoperative effect Effects 0.000 description 1
- 125000001844 prenyl group Chemical group [H]C([*])([H])C([H])=C(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 239000003087 receptor blocking agent Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 206010038464 renal hypertension Diseases 0.000 description 1
- 229910052701 rubidium Inorganic materials 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- JLSMWAKFKRCDDC-UHFFFAOYSA-M sodium;but-2-ynoate Chemical compound [Na+].CC#CC([O-])=O JLSMWAKFKRCDDC-UHFFFAOYSA-M 0.000 description 1
- 230000003068 static effect Effects 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000001117 sulphuric acid Substances 0.000 description 1
- 235000011149 sulphuric acid Nutrition 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/70—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings condensed with carbocyclic rings or ring systems
- C07D239/72—Quinazolines; Hydrogenated quinazolines
- C07D239/95—Quinazolines; Hydrogenated quinazolines with hetero atoms directly attached in positions 2 and 4
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (8)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP1677580A JPS56113770A (en) | 1980-02-13 | 1980-02-13 | Novel quinazoline derivative and its preparation |
| JP55-16775 | 1980-02-13 | ||
| JP5275480A JPS56150072A (en) | 1980-04-21 | 1980-04-21 | Novel quinazoline derivative and its preparation |
| JP55-52754 | 1980-04-21 | ||
| JP55-96106 | 1980-07-14 | ||
| JP9610780A JPS5721385A (en) | 1980-07-14 | 1980-07-14 | Novel aminoquinazoline derivative and its preparation |
| JP55-96107 | 1980-07-14 | ||
| JP9610680A JPS5721384A (en) | 1980-07-14 | 1980-07-14 | Novel aminoquinazoline derivative and its preparation |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1154765A true CA1154765A (en) | 1983-10-04 |
Family
ID=27456647
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000370761A Expired CA1154765A (en) | 1980-02-13 | 1981-02-12 | 4-amino-6, 7-dimethoxy-2-piperazinylquinazoline derivatives, their preparation and use |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US4426382A (enFirst) |
| CA (1) | CA1154765A (enFirst) |
| CH (1) | CH644857A5 (enFirst) |
| DE (1) | DE3105330A1 (enFirst) |
| ES (1) | ES499377A0 (enFirst) |
| FR (1) | FR2475548A1 (enFirst) |
| GB (1) | GB2068961B (enFirst) |
| IT (1) | IT1172225B (enFirst) |
| NL (1) | NL191208C (enFirst) |
Families Citing this family (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CS236097B1 (en) * | 1983-06-01 | 1985-05-15 | Jan Koenig | Acylderivatives of 2-piperazinochinazoline and method of their preparation |
| DE3346675A1 (de) * | 1983-12-23 | 1985-07-04 | Beiersdorf Ag, 2000 Hamburg | Substituierte 1-(4-amino-6,7-dialkoxy-chinazolinyl)-4- cyclohexenyl-derivate des piperazins und homopiperazins, verfahren zu ihrer herstellung und ihre verwendung sowie diese verbindungen enthaltende zubereitungen und zwischenprodukte |
| JPH0647540B2 (ja) * | 1985-07-16 | 1994-06-22 | エーザイ株式会社 | 虚血性心疾患・不整脈治療・予防剤 |
| IT1270993B (it) * | 1994-03-18 | 1997-05-26 | Recordati Chem Pharm | Derivati chinzolilamminici attivi come alfa-antagonisti |
| TWI350168B (en) | 2004-05-07 | 2011-10-11 | Incyte Corp | Amido compounds and their use as pharmaceuticals |
| WO2007126935A2 (en) * | 2006-03-29 | 2007-11-08 | Merck & Co., Inc. | Diazepan orexin receptor antagonists |
| PE20081229A1 (es) * | 2006-12-01 | 2008-08-28 | Merck & Co Inc | Antagonistas de receptor de orexina de diazepam sustituido |
| CA2687931C (en) | 2007-05-31 | 2016-05-24 | Boehringer Ingelheim International Gmbh | Ccr2 receptor antagonists and uses thereof |
| US20090325964A1 (en) * | 2008-05-23 | 2009-12-31 | Wyeth | Piperazine Metabotropic Glutamate Receptor 5 (MGLUR5) Negative Allosteric Modulators For Anxiety/Depression |
| CN102256963B (zh) | 2008-12-19 | 2014-06-11 | 贝林格尔.英格海姆国际有限公司 | 作为ccr2受体拮抗剂用于治疗炎症、哮喘和copd的环状嘧啶-4-甲酰胺 |
| MX346393B (es) | 2009-12-17 | 2017-03-17 | Centrexion Therapeutics Corp | Nuevos antagonistas del receptor ccr2 y usos de los mismo. |
| JP2013526507A (ja) | 2010-05-12 | 2013-06-24 | ベーリンガー インゲルハイム インターナショナル ゲゼルシャフト ミット ベシュレンクテル ハフツング | 新規ccr2受容体アンタゴニスト、その製造方法及び薬物としてのその使用 |
| WO2011141477A1 (en) | 2010-05-12 | 2011-11-17 | Boehringer Ingelheim International Gmbh | New ccr2 receptor antagonists, method for producing the same, and use thereof as medicaments |
| WO2011144501A1 (en) | 2010-05-17 | 2011-11-24 | Boehringer Ingelheim International Gmbh | Ccr2 antagonists and uses thereof |
| WO2011147772A1 (en) | 2010-05-25 | 2011-12-01 | Boehringer Ingelheim International Gmbh | Ccr2 receptor antagonists |
| US8962656B2 (en) | 2010-06-01 | 2015-02-24 | Boehringer Ingelheim International Gmbh | CCR2 antagonists |
| WO2013010839A1 (en) | 2011-07-15 | 2013-01-24 | Boehringer Ingelheim International Gmbh | Novel and selective ccr2 antagonists |
| US9260441B2 (en) * | 2012-03-28 | 2016-02-16 | Intervet Inc. | Heteroaryl compounds with cyclic bridging unit |
| EA201590053A1 (ru) | 2012-06-20 | 2015-08-31 | Новартис Аг | Модуляторы пути системы комплемента и их применение |
| WO2015095111A1 (en) | 2013-12-18 | 2015-06-25 | Merck Sharp & Dohme Corp. | Diazepane orexin receptor antagonists |
| AU2016287584B2 (en) | 2015-07-02 | 2020-03-26 | Centrexion Therapeutics Corporation | (4-((3R,4R)-3-methoxytetrahydro-pyran-4-ylamino)piperidin-1-yl)(5-methyl-6-(((2R,6S)-6-(p-tolyl)tetrahydro-2H-pyran-2-yl)methylamino)pyrimidin-4yl)methanone citrate |
| US11944624B2 (en) * | 2017-07-06 | 2024-04-02 | Case Western Reserve University | Peptide and small molecule agonists of EphA and their uses |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3511836A (en) * | 1967-12-13 | 1970-05-12 | Pfizer & Co C | 2,4,6,7-tetra substituted quinazolines |
| US3635979A (en) | 1969-09-29 | 1972-01-18 | Pfizer | Certain 6- and/or 7-alkoxy-substituted-2 4-bis(disubstituted amino) quinazolines |
| JPS536156B2 (enFirst) * | 1972-10-30 | 1978-03-04 | ||
| US3935213A (en) | 1973-12-05 | 1976-01-27 | Pfizer Inc. | Process for hypotensive 4-amino-2-(piperazin-1-yl) quinazoline derivatives |
| US4060615A (en) * | 1976-02-18 | 1977-11-29 | Mead Johnson & Company | 2-Piperazinyl-6,7-dimethoxyquinazolines |
| US4001237A (en) * | 1976-02-18 | 1977-01-04 | Bristol-Myers Company | Oxazole, isoxazole, thiazole and isothiazole amides |
| US4189484A (en) * | 1977-11-08 | 1980-02-19 | Mitsubishi Yuka Pharmaceutical Co., Ltd. | Antihypertensive quinazoline derivatives |
| US4287341A (en) | 1979-11-01 | 1981-09-01 | Pfizer Inc. | Alkoxy-substituted-6-chloro-quinazoline-2,4-diones |
| JPS5728576A (en) * | 1980-07-24 | 1982-02-16 | Toshiba Corp | Inverter device |
-
1981
- 1981-02-11 US US06/233,679 patent/US4426382A/en not_active Expired - Fee Related
- 1981-02-11 GB GB8104185A patent/GB2068961B/en not_active Expired
- 1981-02-12 CA CA000370761A patent/CA1154765A/en not_active Expired
- 1981-02-12 CH CH94481A patent/CH644857A5/de not_active IP Right Cessation
- 1981-02-12 ES ES499377A patent/ES499377A0/es active Granted
- 1981-02-13 IT IT67213/81A patent/IT1172225B/it active
- 1981-02-13 NL NL8100726A patent/NL191208C/xx not_active IP Right Cessation
- 1981-02-13 FR FR8102821A patent/FR2475548A1/fr active Granted
- 1981-02-13 DE DE19813105330 patent/DE3105330A1/de active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| GB2068961B (en) | 1983-11-30 |
| ES8207169A1 (es) | 1982-09-01 |
| GB2068961A (en) | 1981-08-19 |
| NL191208B (nl) | 1994-10-17 |
| ES499377A0 (es) | 1982-09-01 |
| US4426382A (en) | 1984-01-17 |
| CH644857A5 (de) | 1984-08-31 |
| FR2475548A1 (fr) | 1981-08-14 |
| NL191208C (nl) | 1995-03-16 |
| IT8167213A0 (it) | 1981-02-13 |
| NL8100726A (nl) | 1981-09-16 |
| IT1172225B (it) | 1987-06-18 |
| FR2475548B1 (enFirst) | 1983-06-24 |
| DE3105330C2 (enFirst) | 1991-07-25 |
| DE3105330A1 (de) | 1981-12-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1154765A (en) | 4-amino-6, 7-dimethoxy-2-piperazinylquinazoline derivatives, their preparation and use | |
| US3812127A (en) | 4-(quinolin-4-yl)piperazine-1-carboxylic acid esters | |
| US3594480A (en) | Nitrogen heterocycles for therapeutic administration | |
| CA1090803A (en) | 2-piperazinyl-6,7-dimethoxyquinazolines | |
| FI94343C (fi) | Menetelmä valmistaa terapeuttisesti aktiivisia syklisiä amiinijohdannaisia | |
| AU606184B2 (en) | New benzopyran derivatives, their preparation and pharmaceutical compositions containing them | |
| SK14282002A3 (sk) | Deriváty 8-chinolínxantínu a 8-izochinolínxantínu, farmaceutická kompozícia, ktorá ich obsahuje, ich použitie a spôsob ich prípravy | |
| PL175556B1 (pl) | Pochodne benzopiranu, benzotiopiranu i benzofuranu oraz sposób ich wytwarzania | |
| WO2002072578A2 (en) | (homo) piperazine substituted quinolines for inhibiting the phosphorylation of kinases | |
| JPH0616648A (ja) | ベンゾイミダゾリル誘導体、これらの化合物を含む医薬組成物及びそれらの調製法 | |
| EP0343574B1 (en) | 4(1H)-quinolone derivatives | |
| CA1266266A (en) | Process for preparing 2-phenylalkyl-3-aminoalkyl-4 (3h)-quinazolinone compound | |
| AU598149B2 (en) | 2-((4-piperidyl)methyl)-1,2,3,4-tetrahydroisoquinoline derivatives, their preparation and their application in therapy | |
| US4216216A (en) | Aromatic piperazinyl substituted dihydrouracils | |
| NO178968B (no) | Analogifremgangsmåte for fremstilling av terapeutisk aktive aminopyrimidin-karboksamidderivater | |
| AU644295B2 (en) | 2-aminopyrimidine-4-carboxamide derivatives, their preparation and their use in therapeutics | |
| EP1330444B1 (en) | Nitrogenous heterocyclic compounds and process for making them | |
| CA1056831A (en) | Quinazoline derivatives | |
| US4841051A (en) | Phenylpiperazine derivatives | |
| US4461895A (en) | Dibenzo(de,g)quinolines | |
| CA1237428A (en) | ¬1| benzepino¬3,4-b|pyridine derivative | |
| US7220777B2 (en) | Lactam derivatives as antagonists for human 11cby receptors | |
| FI66853C (fi) | Mellanprodukt foer anvaendning vid framstaellning av hypotensivt 2-(4-(2-furoyl)piperazin-1-yl)-6,7-dimetoxikinazolin | |
| US4537895A (en) | Isoquinoline derivatives | |
| CA1141382A (en) | 2-(1-piperazinyl)-cycloheptimidazole derivatives |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |