CA1140915A - Process for the preparation of (substituted)-2-carbamoyloxymethylpenam and (substituted)-3-carbamolyoxycepham - Google Patents
Process for the preparation of (substituted)-2-carbamoyloxymethylpenam and (substituted)-3-carbamolyoxycephamInfo
- Publication number
- CA1140915A CA1140915A CA000322307A CA322307A CA1140915A CA 1140915 A CA1140915 A CA 1140915A CA 000322307 A CA000322307 A CA 000322307A CA 322307 A CA322307 A CA 322307A CA 1140915 A CA1140915 A CA 1140915A
- Authority
- CA
- Canada
- Prior art keywords
- isocyanate
- nco
- group
- methyl
- alkyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- -1 (substituted)-2-carbamoyloxymethylpenam Chemical class 0.000 title claims abstract description 393
- 238000000034 method Methods 0.000 title claims description 99
- 238000002360 preparation method Methods 0.000 title claims description 10
- 239000012948 isocyanate Substances 0.000 claims abstract description 96
- 150000001875 compounds Chemical class 0.000 claims abstract description 40
- IQPQWNKOIGAROB-UHFFFAOYSA-N isocyanate Chemical compound [N-]=C=O IQPQWNKOIGAROB-UHFFFAOYSA-N 0.000 claims abstract description 29
- 150000002513 isocyanates Chemical class 0.000 claims description 76
- 125000000217 alkyl group Chemical group 0.000 claims description 64
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 62
- 125000003118 aryl group Chemical group 0.000 claims description 56
- 125000003545 alkoxy group Chemical group 0.000 claims description 50
- 238000006243 chemical reaction Methods 0.000 claims description 50
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 43
- 125000004414 alkyl thio group Chemical group 0.000 claims description 42
- 229910052739 hydrogen Inorganic materials 0.000 claims description 42
- 239000001257 hydrogen Substances 0.000 claims description 41
- 125000002252 acyl group Chemical group 0.000 claims description 31
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 30
- 229910052757 nitrogen Inorganic materials 0.000 claims description 26
- 125000004104 aryloxy group Chemical group 0.000 claims description 24
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 22
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 claims description 21
- BUXTXUBQAKIQKS-UHFFFAOYSA-N sulfuryl diisocyanate Chemical compound O=C=NS(=O)(=O)N=C=O BUXTXUBQAKIQKS-UHFFFAOYSA-N 0.000 claims description 21
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 19
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 17
- 229910052751 metal Inorganic materials 0.000 claims description 16
- 239000002184 metal Substances 0.000 claims description 16
- 229910052755 nonmetal Inorganic materials 0.000 claims description 16
- OCKPROYBCPQWJO-UHFFFAOYSA-N acetyl isocyanate Chemical group CC(=O)N=C=O OCKPROYBCPQWJO-UHFFFAOYSA-N 0.000 claims description 15
- 125000000623 heterocyclic group Chemical group 0.000 claims description 14
- 150000002843 nonmetals Chemical group 0.000 claims description 14
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 13
- 125000004122 cyclic group Chemical group 0.000 claims description 13
- GRNOZCCBOFGDCL-UHFFFAOYSA-N 2,2,2-trichloroacetyl isocyanate Chemical compound ClC(Cl)(Cl)C(=O)N=C=O GRNOZCCBOFGDCL-UHFFFAOYSA-N 0.000 claims description 12
- 239000003960 organic solvent Substances 0.000 claims description 12
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 11
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 11
- 150000002431 hydrogen Chemical group 0.000 claims description 11
- 229910052717 sulfur Inorganic materials 0.000 claims description 10
- 239000011593 sulfur Substances 0.000 claims description 10
- 125000003831 tetrazolyl group Chemical group 0.000 claims description 10
- YNKDRTCJDFVUTJ-UHFFFAOYSA-N carbonyl diisocyanate Chemical compound O=C=NC(=O)N=C=O YNKDRTCJDFVUTJ-UHFFFAOYSA-N 0.000 claims description 9
- 125000004415 heterocyclylalkyl group Chemical group 0.000 claims description 9
- OUPLTJDZPQZRBW-UHFFFAOYSA-N n-(oxomethylidene)methanesulfonamide Chemical group CS(=O)(=O)N=C=O OUPLTJDZPQZRBW-UHFFFAOYSA-N 0.000 claims description 9
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 8
- 229910052760 oxygen Inorganic materials 0.000 claims description 8
- 239000001301 oxygen Substances 0.000 claims description 8
- UBCNWGMGMVGVIJ-UHFFFAOYSA-N 1-chloro-n-(oxomethylidene)methanesulfonamide Chemical compound ClCS(=O)(=O)N=C=O UBCNWGMGMVGVIJ-UHFFFAOYSA-N 0.000 claims description 7
- BIGWKPQWUGNMSE-UHFFFAOYSA-N 2,4-dinitro-n-(oxomethylidene)benzenesulfonamide Chemical compound [O-][N+](=O)C1=CC=C(S(=O)(=O)N=C=O)C([N+]([O-])=O)=C1 BIGWKPQWUGNMSE-UHFFFAOYSA-N 0.000 claims description 7
- PRMQJMFYVGKRGH-UHFFFAOYSA-N 2-cyanoacetyl isocyanate Chemical compound O=C=NC(=O)CC#N PRMQJMFYVGKRGH-UHFFFAOYSA-N 0.000 claims description 7
- HEBTZZBBPUFAFE-UHFFFAOYSA-N 2-methyl-n-(oxomethylidene)benzenesulfonamide Chemical compound CC1=CC=CC=C1S(=O)(=O)N=C=O HEBTZZBBPUFAFE-UHFFFAOYSA-N 0.000 claims description 7
- SMTUNIMBRXGDKX-UHFFFAOYSA-N 2-phenylacetyl isocyanate Chemical compound O=C=NC(=O)CC1=CC=CC=C1 SMTUNIMBRXGDKX-UHFFFAOYSA-N 0.000 claims description 7
- BXLRBPNDOBBLHO-UHFFFAOYSA-N 4-nitro-n-(oxomethylidene)benzenesulfonamide Chemical compound [O-][N+](=O)C1=CC=C(S(=O)(=O)N=C=O)C=C1 BXLRBPNDOBBLHO-UHFFFAOYSA-N 0.000 claims description 7
- DRCVWVLUBDJADC-UHFFFAOYSA-N 4-nitrobenzoyl isocyanate Chemical compound [O-][N+](=O)C1=CC=C(C(=O)N=C=O)C=C1 DRCVWVLUBDJADC-UHFFFAOYSA-N 0.000 claims description 7
- LURYMYITPCOQAU-UHFFFAOYSA-N benzoyl isocyanate Chemical compound O=C=NC(=O)C1=CC=CC=C1 LURYMYITPCOQAU-UHFFFAOYSA-N 0.000 claims description 7
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 7
- DPLPYEOVMXECQX-UHFFFAOYSA-N benzyl n-(oxomethylidene)carbamate Chemical compound O=C=NC(=O)OCC1=CC=CC=C1 DPLPYEOVMXECQX-UHFFFAOYSA-N 0.000 claims description 7
- VKYUIYJITRRKMZ-UHFFFAOYSA-N benzyl n-(oxomethylidene)sulfamate Chemical compound O=C=NS(=O)(=O)OCC1=CC=CC=C1 VKYUIYJITRRKMZ-UHFFFAOYSA-N 0.000 claims description 7
- OBMGCMDXJDMDQU-UHFFFAOYSA-N butanoyl isocyanate Chemical class CCCC(=O)N=C=O OBMGCMDXJDMDQU-UHFFFAOYSA-N 0.000 claims description 7
- XEMICALTAFYFKQ-UHFFFAOYSA-N chloromethyl n-(oxomethylidene)carbamate Chemical compound ClCOC(=O)N=C=O XEMICALTAFYFKQ-UHFFFAOYSA-N 0.000 claims description 7
- HNMKOFNBCMOOQW-UHFFFAOYSA-N cyanoformyl isocyanate Chemical compound O=C=NC(=O)C#N HNMKOFNBCMOOQW-UHFFFAOYSA-N 0.000 claims description 7
- JNFUJVWWFWBAFI-UHFFFAOYSA-N isocyanato(triphenyl)silane Chemical compound C=1C=CC=CC=1[Si](C=1C=CC=CC=1)(N=C=O)C1=CC=CC=C1 JNFUJVWWFWBAFI-UHFFFAOYSA-N 0.000 claims description 7
- YOVQDZPAVARTTR-UHFFFAOYSA-N methyl n-(oxomethylidene)carbamate Chemical compound COC(=O)N=C=O YOVQDZPAVARTTR-UHFFFAOYSA-N 0.000 claims description 7
- UJYAZVSPFMJCLW-UHFFFAOYSA-N n-(oxomethylidene)benzenesulfonamide Chemical compound O=C=NS(=O)(=O)C1=CC=CC=C1 UJYAZVSPFMJCLW-UHFFFAOYSA-N 0.000 claims description 7
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 7
- 125000006503 p-nitrobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1[N+]([O-])=O)C([H])([H])* 0.000 claims description 7
- BFKZWJPWBGAKLZ-UHFFFAOYSA-N phenyl n-(oxomethylidene)sulfamate Chemical compound O=C=NS(=O)(=O)OC1=CC=CC=C1 BFKZWJPWBGAKLZ-UHFFFAOYSA-N 0.000 claims description 7
- LLROOTQECVJATI-UHFFFAOYSA-N triethoxy(isocyanato)silane Chemical compound CCO[Si](OCC)(OCC)N=C=O LLROOTQECVJATI-UHFFFAOYSA-N 0.000 claims description 7
- VIGRJDWPNTXJSQ-UHFFFAOYSA-N triethyl(isocyanato)silane Chemical compound CC[Si](CC)(CC)N=C=O VIGRJDWPNTXJSQ-UHFFFAOYSA-N 0.000 claims description 7
- RRXCOMRSZAQORJ-UHFFFAOYSA-N 2,4-dinitrobenzoyl isocyanate Chemical compound [O-][N+](=O)C1=CC=C(C(=O)N=C=O)C([N+]([O-])=O)=C1 RRXCOMRSZAQORJ-UHFFFAOYSA-N 0.000 claims description 6
- NZSKYCDUTFNRAA-UHFFFAOYSA-N ethyl n-(oxomethylidene)sulfamate Chemical compound CCOS(=O)(=O)N=C=O NZSKYCDUTFNRAA-UHFFFAOYSA-N 0.000 claims description 6
- 229910052736 halogen Inorganic materials 0.000 claims description 6
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 6
- NIZHERJWXFHGGU-UHFFFAOYSA-N isocyanato(trimethyl)silane Chemical group C[Si](C)(C)N=C=O NIZHERJWXFHGGU-UHFFFAOYSA-N 0.000 claims description 6
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 6
- 125000004423 acyloxy group Chemical group 0.000 claims description 5
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 5
- 125000002541 furyl group Chemical group 0.000 claims description 5
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 5
- 125000000018 nitroso group Chemical group N(=O)* 0.000 claims description 5
- 125000001476 phosphono group Chemical group [H]OP(*)(=O)O[H] 0.000 claims description 5
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 5
- 125000001113 thiadiazolyl group Chemical group 0.000 claims description 5
- 125000000335 thiazolyl group Chemical group 0.000 claims description 5
- 125000001544 thienyl group Chemical group 0.000 claims description 5
- 125000006283 4-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Cl)C([H])([H])* 0.000 claims description 4
- 125000003143 4-hydroxybenzyl group Chemical group [H]C([*])([H])C1=C([H])C([H])=C(O[H])C([H])=C1[H] 0.000 claims description 4
- 102220465933 Beta-1,3-glucuronyltransferase LARGE2_R15A_mutation Human genes 0.000 claims description 4
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 4
- PXBRQCKWGAHEHS-UHFFFAOYSA-N dichlorodifluoromethane Chemical compound FC(F)(Cl)Cl PXBRQCKWGAHEHS-UHFFFAOYSA-N 0.000 claims description 4
- 150000002367 halogens Chemical group 0.000 claims description 4
- 125000005808 2,4,6-trimethoxyphenyl group Chemical group [H][#6]-1=[#6](-[#8]C([H])([H])[H])-[#6](-*)=[#6](-[#8]C([H])([H])[H])-[#6]([H])=[#6]-1-[#8]C([H])([H])[H] 0.000 claims description 3
- KLIDCXVFHGNTTM-UHFFFAOYSA-N 2,6-dimethoxyphenol Chemical group COC1=CC=CC(OC)=C1O KLIDCXVFHGNTTM-UHFFFAOYSA-N 0.000 claims description 3
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 claims description 3
- 125000004204 2-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C(OC([H])([H])[H])C([H])=C1[H] 0.000 claims description 3
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 claims description 3
- 125000006279 3-bromobenzyl group Chemical group [H]C1=C([H])C(=C([H])C(Br)=C1[H])C([H])([H])* 0.000 claims description 3
- 125000006284 3-fluorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C(F)=C1[H])C([H])([H])* 0.000 claims description 3
- DGYIJVNZSDYBOE-UHFFFAOYSA-N [CH2]C1=CC=NC=C1 Chemical group [CH2]C1=CC=NC=C1 DGYIJVNZSDYBOE-UHFFFAOYSA-N 0.000 claims description 3
- 125000000852 azido group Chemical group *N=[N+]=[N-] 0.000 claims description 3
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims description 3
- 125000004772 dichloromethyl group Chemical group [H]C(Cl)(Cl)* 0.000 claims description 3
- 125000001028 difluoromethyl group Chemical group [H]C(F)(F)* 0.000 claims description 3
- HRDXJKGNWSUIBT-UHFFFAOYSA-N methoxybenzene Chemical group [CH2]OC1=CC=CC=C1 HRDXJKGNWSUIBT-UHFFFAOYSA-N 0.000 claims description 3
- 125000003136 n-heptyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 3
- 125000005544 phthalimido group Chemical group 0.000 claims description 3
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 claims description 3
- 125000005842 heteroatom Chemical group 0.000 claims description 2
- 125000004646 sulfenyl group Chemical group S(*)* 0.000 claims description 2
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 claims description 2
- 125000003441 thioacyl group Chemical group 0.000 claims description 2
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 2
- BUZRAOJSFRKWPD-UHFFFAOYSA-N isocyanatosilane Chemical compound [SiH3]N=C=O BUZRAOJSFRKWPD-UHFFFAOYSA-N 0.000 claims 12
- CMNXBYHSNBLXDN-UHFFFAOYSA-N (4-nitrophenyl)methyl n-(oxomethylidene)carbamate Chemical compound [O-][N+](=O)C1=CC=C(COC(=O)N=C=O)C=C1 CMNXBYHSNBLXDN-UHFFFAOYSA-N 0.000 claims 6
- 229910007166 Si(NCO)4 Inorganic materials 0.000 claims 6
- 229910011003 Ti(NCO)4 Inorganic materials 0.000 claims 6
- FADNAWIZFDFJSH-UHFFFAOYSA-N n-(oxomethylidene)ethanesulfonothioamide Chemical compound CCS(=O)(=S)N=C=O FADNAWIZFDFJSH-UHFFFAOYSA-N 0.000 claims 6
- 125000004442 acylamino group Chemical group 0.000 claims 4
- SYGWYBOJXOGMRU-UHFFFAOYSA-N chembl233051 Chemical compound C1=CC=C2C3=CC(C(N(CCN(C)C)C4=O)=O)=C5C4=CC=CC5=C3SC2=C1 SYGWYBOJXOGMRU-UHFFFAOYSA-N 0.000 claims 4
- 125000001931 aliphatic group Chemical group 0.000 claims 2
- 239000002253 acid Substances 0.000 abstract description 25
- 150000001781 cephams Chemical class 0.000 abstract description 14
- FCZNNHHXCFARDY-WQRUCBPWSA-N (2s,5r,6r)-3,3-dimethyl-4,7-dioxo-6-[(2-phenylacetyl)amino]-4$l^{4}-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid Chemical class N([C@H]1[C@@H]2N(C1=O)[C@H](C(S2=O)(C)C)C(O)=O)C(=O)CC1=CC=CC=C1 FCZNNHHXCFARDY-WQRUCBPWSA-N 0.000 abstract description 10
- 150000002959 penams Chemical class 0.000 abstract description 10
- 125000001424 substituent group Chemical group 0.000 abstract description 10
- 241001465754 Metazoa Species 0.000 abstract description 2
- 239000003242 anti bacterial agent Substances 0.000 abstract description 2
- HHOUIMZXVJMFGE-NQPNHJOESA-N (6r)-3-methyl-5-thia-1-azabicyclo[4.2.0]octan-8-one Chemical compound C1C(C)CS[C@@H]2CC(=O)N21 HHOUIMZXVJMFGE-NQPNHJOESA-N 0.000 abstract 1
- 201000010099 disease Diseases 0.000 abstract 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 abstract 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 108
- WSHJJCPTKWSMRR-RXMQYKEDSA-N penam Chemical compound S1CCN2C(=O)C[C@H]21 WSHJJCPTKWSMRR-RXMQYKEDSA-N 0.000 description 50
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 48
- QHTOIDKCEPKVCM-ZCFIWIBFSA-N cepham Chemical compound S1CCCN2C(=O)C[C@H]21 QHTOIDKCEPKVCM-ZCFIWIBFSA-N 0.000 description 44
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 42
- 239000000047 product Substances 0.000 description 39
- 239000000243 solution Substances 0.000 description 35
- 229910001868 water Inorganic materials 0.000 description 34
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 31
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 29
- 150000001782 cephems Chemical class 0.000 description 28
- 239000006260 foam Substances 0.000 description 23
- JUJWROOIHBZHMG-UHFFFAOYSA-N pyridine Substances C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 23
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 22
- 239000002585 base Substances 0.000 description 20
- 239000000203 mixture Substances 0.000 description 20
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 17
- 125000006239 protecting group Chemical group 0.000 description 17
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 16
- 150000002148 esters Chemical class 0.000 description 16
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 16
- 239000007787 solid Substances 0.000 description 16
- 239000003921 oil Substances 0.000 description 15
- 235000019198 oils Nutrition 0.000 description 15
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 14
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 13
- 239000003795 chemical substances by application Substances 0.000 description 13
- 239000000284 extract Substances 0.000 description 13
- 239000010410 layer Substances 0.000 description 13
- 239000000741 silica gel Substances 0.000 description 13
- 229910002027 silica gel Inorganic materials 0.000 description 13
- 239000002904 solvent Substances 0.000 description 12
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 11
- 229930182555 Penicillin Natural products 0.000 description 11
- 238000003776 cleavage reaction Methods 0.000 description 11
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 11
- 230000007017 scission Effects 0.000 description 11
- 230000000875 corresponding effect Effects 0.000 description 10
- 235000019439 ethyl acetate Nutrition 0.000 description 10
- 239000000725 suspension Substances 0.000 description 10
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- 229940049954 penicillin Drugs 0.000 description 9
- 150000003462 sulfoxides Chemical group 0.000 description 9
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 8
- 125000006519 CCH3 Chemical group 0.000 description 8
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 8
- 150000001408 amides Chemical class 0.000 description 8
- 238000010992 reflux Methods 0.000 description 8
- 238000006049 ring expansion reaction Methods 0.000 description 8
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 7
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 7
- FXXACINHVKSMDR-UHFFFAOYSA-N acetyl bromide Chemical compound CC(Br)=O FXXACINHVKSMDR-UHFFFAOYSA-N 0.000 description 7
- 238000005917 acylation reaction Methods 0.000 description 7
- 239000006227 byproduct Substances 0.000 description 7
- 239000000706 filtrate Substances 0.000 description 7
- 230000002140 halogenating effect Effects 0.000 description 7
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 7
- 239000011541 reaction mixture Substances 0.000 description 7
- 239000007858 starting material Substances 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical class C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 239000000499 gel Substances 0.000 description 6
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 6
- 239000002808 molecular sieve Substances 0.000 description 6
- 239000012074 organic phase Substances 0.000 description 6
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 6
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 5
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 description 5
- 230000010933 acylation Effects 0.000 description 5
- MDFFNEOEWAXZRQ-UHFFFAOYSA-N aminyl Chemical compound [NH2] MDFFNEOEWAXZRQ-UHFFFAOYSA-N 0.000 description 5
- 239000008346 aqueous phase Substances 0.000 description 5
- 239000011230 binding agent Substances 0.000 description 5
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 5
- 239000003153 chemical reaction reagent Substances 0.000 description 5
- 238000004587 chromatography analysis Methods 0.000 description 5
- 238000001914 filtration Methods 0.000 description 5
- 239000012535 impurity Substances 0.000 description 5
- 239000012071 phase Substances 0.000 description 5
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 5
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 5
- 239000002002 slurry Substances 0.000 description 5
- FZEVMBJWXHDLDB-ZCFIWIBFSA-N (6r)-5-thia-1-azabicyclo[4.2.0]oct-2-en-8-one Chemical compound S1CC=CN2C(=O)C[C@H]21 FZEVMBJWXHDLDB-ZCFIWIBFSA-N 0.000 description 4
- OISVCGZHLKNMSJ-UHFFFAOYSA-N 2,6-dimethylpyridine Chemical compound CC1=CC=CC(C)=N1 OISVCGZHLKNMSJ-UHFFFAOYSA-N 0.000 description 4
- 229930186147 Cephalosporin Natural products 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- 102000004190 Enzymes Human genes 0.000 description 4
- 108090000790 Enzymes Proteins 0.000 description 4
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 4
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 4
- 229910021529 ammonia Inorganic materials 0.000 description 4
- AUNFRQANODILJJ-ITCMONMYSA-N benzhydryl (6r)-3-methyl-8-oxo-7-[(2-phenoxyacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound C1([C@@H]2N(C1=O)C(=C(CS2)C)C(=O)OC(C=1C=CC=CC=1)C=1C=CC=CC=1)NC(=O)COC1=CC=CC=C1 AUNFRQANODILJJ-ITCMONMYSA-N 0.000 description 4
- 239000000872 buffer Substances 0.000 description 4
- 235000013877 carbamide Nutrition 0.000 description 4
- 229940124587 cephalosporin Drugs 0.000 description 4
- 150000001780 cephalosporins Chemical class 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- 238000010979 pH adjustment Methods 0.000 description 4
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 4
- 230000035484 reaction time Effects 0.000 description 4
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- UVVUGWBBCDFNSD-UHFFFAOYSA-N tetraisocyanatosilane Chemical compound O=C=N[Si](N=C=O)(N=C=O)N=C=O UVVUGWBBCDFNSD-UHFFFAOYSA-N 0.000 description 4
- UTQNKKSJPHTPBS-UHFFFAOYSA-N 2,2,2-trichloroethanone Chemical group ClC(Cl)(Cl)[C]=O UTQNKKSJPHTPBS-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- FISLQCMREBWILK-QTTRRQMYSA-N [N+](=O)([O-])C1=CC=C(COC(=O)[C@H]2C([S@@]([C@H]3N2C([C@H]3OC3=CC=CC=C3)=O)=O)NC(C(C)C)=O)C=C1 Chemical compound [N+](=O)([O-])C1=CC=C(COC(=O)[C@H]2C([S@@]([C@H]3N2C([C@H]3OC3=CC=CC=C3)=O)=O)NC(C(C)C)=O)C=C1 FISLQCMREBWILK-QTTRRQMYSA-N 0.000 description 3
- 125000003277 amino group Chemical group 0.000 description 3
- 239000000538 analytical sample Substances 0.000 description 3
- 230000000844 anti-bacterial effect Effects 0.000 description 3
- 239000004202 carbamide Substances 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 230000003197 catalytic effect Effects 0.000 description 3
- 239000012141 concentrate Substances 0.000 description 3
- 125000005442 diisocyanate group Chemical group 0.000 description 3
- 125000005982 diphenylmethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 3
- 239000002552 dosage form Substances 0.000 description 3
- 238000010828 elution Methods 0.000 description 3
- 125000004185 ester group Chemical group 0.000 description 3
- XLYOFNOQVPJJNP-ZSJDYOACSA-N heavy water Substances [2H]O[2H] XLYOFNOQVPJJNP-ZSJDYOACSA-N 0.000 description 3
- 238000007327 hydrogenolysis reaction Methods 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- ODUCDPQEXGNKDN-UHFFFAOYSA-N nitroxyl Chemical compound O=N ODUCDPQEXGNKDN-UHFFFAOYSA-N 0.000 description 3
- 239000012044 organic layer Substances 0.000 description 3
- 235000015497 potassium bicarbonate Nutrition 0.000 description 3
- 239000011736 potassium bicarbonate Substances 0.000 description 3
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 3
- 239000000376 reactant Substances 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- 238000001228 spectrum Methods 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Chemical class C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- 125000003396 thiol group Chemical group [H]S* 0.000 description 3
- DNPOVSLJNLLGMA-SJUANORRSA-N (2s,5r,6r)-3,3-dimethyl-4,7-dioxo-6-[(2-phenoxyacetyl)amino]-4$l^{4}-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid Chemical compound N([C@H]1[C@@H]2N(C1=O)[C@H](C(S2=O)(C)C)C(O)=O)C(=O)COC1=CC=CC=C1 DNPOVSLJNLLGMA-SJUANORRSA-N 0.000 description 2
- SVKHLWRBLIGSRS-OSDKZWGASA-N (4-nitrophenyl)methyl (2s,3r,5r,6r)-3-(acetylcarbamoyloxymethyl)-6-amino-3-methyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate Chemical compound O=C([C@@H]1N2C(=O)[C@@H](N)[C@H]2S[C@@]1(C)COC(=O)NC(=O)C)OCC1=CC=C([N+]([O-])=O)C=C1 SVKHLWRBLIGSRS-OSDKZWGASA-N 0.000 description 2
- LFMBIMXJWIQULB-SSDOTTSWSA-N (6r)-3-methyl-5-thia-1-azabicyclo[4.2.0]oct-2-en-8-one Chemical compound S1CC(C)=CN2C(=O)C[C@H]21 LFMBIMXJWIQULB-SSDOTTSWSA-N 0.000 description 2
- CFGDUGSIBUXRMR-UHFFFAOYSA-N 1,2-dihydropyrrol-2-ide Chemical compound C=1C=[C-]NC=1 CFGDUGSIBUXRMR-UHFFFAOYSA-N 0.000 description 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 2
- MOVMEFHWBOWMFU-UHFFFAOYSA-N 2-chloroacetyl isocyanate Chemical compound ClCC(=O)N=C=O MOVMEFHWBOWMFU-UHFFFAOYSA-N 0.000 description 2
- WRMNZCZEMHIOCP-UHFFFAOYSA-N 2-phenylethanol Chemical compound OCCC1=CC=CC=C1 WRMNZCZEMHIOCP-UHFFFAOYSA-N 0.000 description 2
- GRFNBEZIAWKNCO-UHFFFAOYSA-N 3-pyridinol Chemical compound OC1=CC=CN=C1 GRFNBEZIAWKNCO-UHFFFAOYSA-N 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 2
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 2
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- 239000002841 Lewis acid Substances 0.000 description 2
- RGNKURGEJYENNJ-MIWTYKNXSA-N O.C1(=CC=CC=C1)C(C1=CC=CC=C1)OC(=O)[C@H]1C([S@@]([C@H]2N1C([C@H]2OC2=CC=CC=C2)=O)=O)NC(C(C)C)=O Chemical compound O.C1(=CC=CC=C1)C(C1=CC=CC=C1)OC(=O)[C@H]1C([S@@]([C@H]2N1C([C@H]2OC2=CC=CC=C2)=O)=O)NC(C(C)C)=O RGNKURGEJYENNJ-MIWTYKNXSA-N 0.000 description 2
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 238000013019 agitation Methods 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 2
- 239000003125 aqueous solvent Substances 0.000 description 2
- TZCXTZWJZNENPQ-UHFFFAOYSA-L barium sulfate Chemical compound [Ba+2].[O-]S([O-])(=O)=O TZCXTZWJZNENPQ-UHFFFAOYSA-L 0.000 description 2
- LCRVLXSXMGVJHV-RKAVALGPSA-N benzhydryl (5r)-3,3-dimethyl-4,7-dioxo-6-[(2-phenoxyacetyl)amino]-4$l^{4}-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate Chemical compound C1([C@@H]2N(C1=O)C(C(S2=O)(C)C)C(=O)OC(C=1C=CC=CC=1)C=1C=CC=CC=1)NC(=O)COC1=CC=CC=C1 LCRVLXSXMGVJHV-RKAVALGPSA-N 0.000 description 2
- QRUDEWIWKLJBPS-UHFFFAOYSA-N benzotriazole Chemical compound C1=CC=C2N[N][N]C2=C1 QRUDEWIWKLJBPS-UHFFFAOYSA-N 0.000 description 2
- 239000012964 benzotriazole Substances 0.000 description 2
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 125000005242 carbamoyl alkyl group Chemical group 0.000 description 2
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 2
- 125000002668 chloroacetyl group Chemical group ClCC(=O)* 0.000 description 2
- 230000001419 dependent effect Effects 0.000 description 2
- HRKQOINLCJTGBK-UHFFFAOYSA-N dihydroxidosulfur Chemical compound OSO HRKQOINLCJTGBK-UHFFFAOYSA-N 0.000 description 2
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 2
- HPYNZHMRTTWQTB-UHFFFAOYSA-N dimethylpyridine Natural products CC1=CC=CN=C1C HPYNZHMRTTWQTB-UHFFFAOYSA-N 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- 125000000524 functional group Chemical group 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 238000007689 inspection Methods 0.000 description 2
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 description 2
- 125000005928 isopropyloxycarbonyl group Chemical group [H]C([H])([H])C([H])(OC(*)=O)C([H])([H])[H] 0.000 description 2
- AWJUIBRHMBBTKR-UHFFFAOYSA-N isoquinoline Chemical compound C1=NC=CC2=CC=CC=C21 AWJUIBRHMBBTKR-UHFFFAOYSA-N 0.000 description 2
- 150000007517 lewis acids Chemical class 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 2
- 125000004092 methylthiomethyl group Chemical group [H]C([H])([H])SC([H])([H])* 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 239000012038 nucleophile Substances 0.000 description 2
- 125000001181 organosilyl group Chemical group [SiH3]* 0.000 description 2
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 2
- 150000002960 penicillins Chemical class 0.000 description 2
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 2
- 239000008363 phosphate buffer Substances 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- KWYUFKZDYYNOTN-UHFFFAOYSA-M potassium hydroxide Inorganic materials [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 238000011084 recovery Methods 0.000 description 2
- 239000011669 selenium Substances 0.000 description 2
- JQWHASGSAFIOCM-UHFFFAOYSA-M sodium periodate Chemical compound [Na+].[O-]I(=O)(=O)=O JQWHASGSAFIOCM-UHFFFAOYSA-M 0.000 description 2
- 238000010561 standard procedure Methods 0.000 description 2
- 239000000829 suppository Substances 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 150000003512 tertiary amines Chemical class 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 2
- 125000004044 trifluoroacetyl group Chemical group FC(C(=O)*)(F)F 0.000 description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 2
- 229920002554 vinyl polymer Polymers 0.000 description 2
- 238000010626 work up procedure Methods 0.000 description 2
- 239000011701 zinc Substances 0.000 description 2
- 229910052725 zinc Inorganic materials 0.000 description 2
- VNDYJBBGRKZCSX-UHFFFAOYSA-L zinc bromide Chemical compound Br[Zn]Br VNDYJBBGRKZCSX-UHFFFAOYSA-L 0.000 description 2
- FNHPXOZSWXLMGI-UHFFFAOYSA-N (1-oxidopyridin-1-ium-2-yl)methanol Chemical compound OCC1=CC=CC=[N+]1[O-] FNHPXOZSWXLMGI-UHFFFAOYSA-N 0.000 description 1
- ANYMYIVRWMKBEJ-UHFFFAOYSA-N (1-oxidoquinolin-1-ium-2-yl)methanol Chemical compound C1=CC=CC2=[N+]([O-])C(CO)=CC=C21 ANYMYIVRWMKBEJ-UHFFFAOYSA-N 0.000 description 1
- BTANRVKWQNVYAZ-SCSAIBSYSA-N (2R)-butan-2-ol Chemical compound CC[C@@H](C)O BTANRVKWQNVYAZ-SCSAIBSYSA-N 0.000 description 1
- HPAOPTDNRPMCDE-HRKISDNUSA-N (4-nitrophenyl)methyl (2s,3r,5r,6r)-3-(acetylcarbamoyloxymethyl)-3-methyl-7-oxo-6-[(2-phenoxyacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate Chemical compound N([C@H]1[C@H]2S[C@@]([C@@H](N2C1=O)C(=O)OCC=1C=CC(=CC=1)[N+]([O-])=O)(C)COC(=O)NC(=O)C)C(=O)COC1=CC=CC=C1 HPAOPTDNRPMCDE-HRKISDNUSA-N 0.000 description 1
- NWFHALAGKAXVOP-NMNFXAFOSA-N (4-nitrophenyl)methyl (2s,3r,5r,6r)-3-(carbamoyloxymethyl)-3-methyl-7-oxo-6-[(2-phenoxyacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate Chemical compound N([C@H]1[C@H]2S[C@]([C@@H](N2C1=O)C(=O)OCC=1C=CC(=CC=1)[N+]([O-])=O)(COC(N)=O)C)C(=O)COC1=CC=CC=C1 NWFHALAGKAXVOP-NMNFXAFOSA-N 0.000 description 1
- IFFDQLCFFLZWNI-WNCDQNTKSA-N (4-nitrophenyl)methyl (2s,3r,5r,6r)-6-amino-3-(carbamoyloxymethyl)-3-methyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate Chemical compound O=C([C@@H]1N2C(=O)[C@@H](N)[C@H]2S[C@]1(COC(N)=O)C)OCC1=CC=C([N+]([O-])=O)C=C1 IFFDQLCFFLZWNI-WNCDQNTKSA-N 0.000 description 1
- UOCLXMDMGBRAIB-UHFFFAOYSA-N 1,1,1-trichloroethane Chemical compound CC(Cl)(Cl)Cl UOCLXMDMGBRAIB-UHFFFAOYSA-N 0.000 description 1
- KYVBNYUBXIEUFW-UHFFFAOYSA-N 1,1,3,3-tetramethylguanidine Chemical compound CN(C)C(=N)N(C)C KYVBNYUBXIEUFW-UHFFFAOYSA-N 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- BDNKZNFMNDZQMI-UHFFFAOYSA-N 1,3-diisopropylcarbodiimide Chemical compound CC(C)N=C=NC(C)C BDNKZNFMNDZQMI-UHFFFAOYSA-N 0.000 description 1
- WZFITHHTQZPNAA-UHFFFAOYSA-N 1-isocyanatosulfanyl-2,4-dinitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(SN=C=O)C([N+]([O-])=O)=C1 WZFITHHTQZPNAA-UHFFFAOYSA-N 0.000 description 1
- HYZJCKYKOHLVJF-UHFFFAOYSA-N 1H-benzimidazole Chemical compound C1=CC=C2NC=NC2=C1 HYZJCKYKOHLVJF-UHFFFAOYSA-N 0.000 description 1
- TZGPACAKMCUCKX-UHFFFAOYSA-N 2-hydroxyacetamide Chemical compound NC(=O)CO TZGPACAKMCUCKX-UHFFFAOYSA-N 0.000 description 1
- CFMZSMGAMPBRBE-UHFFFAOYSA-N 2-hydroxyisoindole-1,3-dione Chemical class C1=CC=C2C(=O)N(O)C(=O)C2=C1 CFMZSMGAMPBRBE-UHFFFAOYSA-N 0.000 description 1
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical compound CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- NSHAOELVDPKZIC-UHFFFAOYSA-N 3-(2-ethyl-1,2-oxazol-2-ium-5-yl)benzenesulfonic acid;hydroxide Chemical compound [OH-].O1[N+](CC)=CC=C1C1=CC=CC(S(O)(=O)=O)=C1 NSHAOELVDPKZIC-UHFFFAOYSA-N 0.000 description 1
- 125000004975 3-butenyl group Chemical group C(CC=C)* 0.000 description 1
- 125000004080 3-carboxypropanoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C(O[H])=O 0.000 description 1
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 1
- 125000006032 3-methyl-3-butenyl group Chemical group 0.000 description 1
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 description 1
- VLJQDHDVZJXNQL-UHFFFAOYSA-N 4-methyl-n-(oxomethylidene)benzenesulfonamide Chemical compound CC1=CC=C(S(=O)(=O)N=C=O)C=C1 VLJQDHDVZJXNQL-UHFFFAOYSA-N 0.000 description 1
- KDDQRKBRJSGMQE-UHFFFAOYSA-N 4-thiazolyl Chemical group [C]1=CSC=N1 KDDQRKBRJSGMQE-UHFFFAOYSA-N 0.000 description 1
- NGHVIOIJCVXTGV-ALEPSDHESA-N 6-aminopenicillanic acid Chemical compound [O-]C(=O)[C@H]1C(C)(C)S[C@@H]2[C@H]([NH3+])C(=O)N21 NGHVIOIJCVXTGV-ALEPSDHESA-N 0.000 description 1
- NGHVIOIJCVXTGV-UHFFFAOYSA-N 6beta-amino-penicillanic acid Natural products OC(=O)C1C(C)(C)SC2C(N)C(=O)N21 NGHVIOIJCVXTGV-UHFFFAOYSA-N 0.000 description 1
- 239000005725 8-Hydroxyquinoline Substances 0.000 description 1
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- RILYCEMQTBWUHF-PHRYCVSLSA-N C(N)(=O)OCC1(S[C@H]2N(C1C(=O)O)C(C2N)=O)C Chemical compound C(N)(=O)OCC1(S[C@H]2N(C1C(=O)O)C(C2N)=O)C RILYCEMQTBWUHF-PHRYCVSLSA-N 0.000 description 1
- 102100022210 COX assembly mitochondrial protein 2 homolog Human genes 0.000 description 1
- 101100496114 Caenorhabditis elegans clc-2 gene Proteins 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 241000725101 Clea Species 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical class S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- GKQLYSROISKDLL-UHFFFAOYSA-N EEDQ Chemical compound C1=CC=C2N(C(=O)OCC)C(OCC)C=CC2=C1 GKQLYSROISKDLL-UHFFFAOYSA-N 0.000 description 1
- XHVAVDCFFNPVFE-UHFFFAOYSA-N F[Se](C)(F)(F)N=C=O Chemical compound F[Se](C)(F)(F)N=C=O XHVAVDCFFNPVFE-UHFFFAOYSA-N 0.000 description 1
- GVGLGOZIDCSQPN-PVHGPHFFSA-N Heroin Chemical compound O([C@H]1[C@H](C=C[C@H]23)OC(C)=O)C4=C5[C@@]12CCN(C)[C@@H]3CC5=CC=C4OC(C)=O GVGLGOZIDCSQPN-PVHGPHFFSA-N 0.000 description 1
- 101000900446 Homo sapiens COX assembly mitochondrial protein 2 homolog Proteins 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- OWIKHYCFFJSOEH-UHFFFAOYSA-N Isocyanic acid Chemical compound N=C=O OWIKHYCFFJSOEH-UHFFFAOYSA-N 0.000 description 1
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 1
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 1
- 241001024304 Mino Species 0.000 description 1
- NQTADLQHYWFPDB-UHFFFAOYSA-N N-Hydroxysuccinimide Chemical class ON1C(=O)CCC1=O NQTADLQHYWFPDB-UHFFFAOYSA-N 0.000 description 1
- 125000003047 N-acetyl group Chemical group 0.000 description 1
- 150000007945 N-acyl ureas Chemical class 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 235000019502 Orange oil Nutrition 0.000 description 1
- CBENFWSGALASAD-UHFFFAOYSA-N Ozone Chemical compound [O-][O+]=O CBENFWSGALASAD-UHFFFAOYSA-N 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- ZTHYODDOHIVTJV-UHFFFAOYSA-N Propyl gallate Chemical compound CCCOC(=O)C1=CC(O)=C(O)C(O)=C1 ZTHYODDOHIVTJV-UHFFFAOYSA-N 0.000 description 1
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 1
- BUGBHKTXTAQXES-UHFFFAOYSA-N Selenium Chemical compound [Se] BUGBHKTXTAQXES-UHFFFAOYSA-N 0.000 description 1
- 239000005864 Sulphur Chemical group 0.000 description 1
- 229910021623 Tin(IV) bromide Inorganic materials 0.000 description 1
- OGQICQVSFDPSEI-UHFFFAOYSA-N Zorac Chemical compound N1=CC(C(=O)OCC)=CC=C1C#CC1=CC=C(SCCC2(C)C)C2=C1 OGQICQVSFDPSEI-UHFFFAOYSA-N 0.000 description 1
- GDANERAUMJTVDF-BAFYGKSASA-N [(5r)-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-3-yl]methyl carbamate Chemical compound S1C(COC(=O)N)CN2C(=O)C[C@H]21 GDANERAUMJTVDF-BAFYGKSASA-N 0.000 description 1
- DPYJXSZZFJPJPH-BAFYGKSASA-N [(6r)-8-oxo-5-thia-1-azabicyclo[4.2.0]octan-3-yl] carbamate Chemical compound C1C(OC(=O)N)CS[C@@H]2CC(=O)N21 DPYJXSZZFJPJPH-BAFYGKSASA-N 0.000 description 1
- RNBGAGRHWQAQOG-LWGCWRROSA-N [N+](=O)([O-])C1=CC=C(COC(=O)[C@H]2C([S@@]([C@H]3N2C([C@H]3C3=CC=CC=C3)=O)=O)NC(C(C)C)=O)C=C1 Chemical compound [N+](=O)([O-])C1=CC=C(COC(=O)[C@H]2C([S@@]([C@H]3N2C([C@H]3C3=CC=CC=C3)=O)=O)NC(C(C)C)=O)C=C1 RNBGAGRHWQAQOG-LWGCWRROSA-N 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 1
- PQLAYKMGZDUDLQ-UHFFFAOYSA-K aluminium bromide Chemical compound Br[Al](Br)Br PQLAYKMGZDUDLQ-UHFFFAOYSA-K 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 150000001409 amidines Chemical class 0.000 description 1
- 229910052787 antimony Inorganic materials 0.000 description 1
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 229940054720 avage Drugs 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- JILMXYJEXJSCLZ-SNRPDXJESA-N benzhydryl (5R)-3-(2-methylpropanoylamino)-4,7-dioxo-6-phenoxy-4lambda4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate Chemical compound C1(=CC=CC=C1)C(C1=CC=CC=C1)OC(=O)C1C(S([C@H]2N1C(C2OC1=CC=CC=C1)=O)=O)NC(C(C)C)=O JILMXYJEXJSCLZ-SNRPDXJESA-N 0.000 description 1
- AQIHMSVIAGNIDM-UHFFFAOYSA-N benzoyl bromide Chemical compound BrC(=O)C1=CC=CC=C1 AQIHMSVIAGNIDM-UHFFFAOYSA-N 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- 239000003782 beta lactam antibiotic agent Substances 0.000 description 1
- 230000003115 biocidal effect Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- 229940006460 bromide ion Drugs 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- IYYIVELXUANFED-UHFFFAOYSA-N bromo(trimethyl)silane Chemical compound C[Si](C)(C)Br IYYIVELXUANFED-UHFFFAOYSA-N 0.000 description 1
- 239000006172 buffering agent Substances 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 1
- 150000001718 carbodiimides Chemical class 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 229960004424 carbon dioxide Drugs 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- 125000004181 carboxyalkyl group Chemical group 0.000 description 1
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 230000007073 chemical hydrolysis Effects 0.000 description 1
- OWKYKZFZSPIEMN-UHFFFAOYSA-N chloro(isocyanatoselanyl)methane Chemical compound ClC[Se]N=C=O OWKYKZFZSPIEMN-UHFFFAOYSA-N 0.000 description 1
- 238000013375 chromatographic separation Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- HPXRVTGHNJAIIH-UHFFFAOYSA-N cyclohexanol Chemical compound OC1CCCCC1 HPXRVTGHNJAIIH-UHFFFAOYSA-N 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- AEWQHJSJPBWPII-UHFFFAOYSA-N dichloro(isocyanatoselanyl)methane;trichloro(isocyanatoselanyl)methane Chemical compound ClC(Cl)[Se]N=C=O.ClC(Cl)(Cl)[Se]N=C=O AEWQHJSJPBWPII-UHFFFAOYSA-N 0.000 description 1
- AOIRQJNEZHAFKN-UHFFFAOYSA-N dichloro(isocyanatosulfanyl)methane Chemical compound ClC(Cl)SN=C=O AOIRQJNEZHAFKN-UHFFFAOYSA-N 0.000 description 1
- YMWUJEATGCHHMB-DICFDUPASA-N dichloromethane-d2 Chemical compound [2H]C([2H])(Cl)Cl YMWUJEATGCHHMB-DICFDUPASA-N 0.000 description 1
- NPOMSUOUAZCMBL-UHFFFAOYSA-N dichloromethane;ethoxyethane Chemical compound ClCCl.CCOCC NPOMSUOUAZCMBL-UHFFFAOYSA-N 0.000 description 1
- 125000004188 dichlorophenyl group Chemical group 0.000 description 1
- FVCOIAYSJZGECG-UHFFFAOYSA-N diethylhydroxylamine Chemical compound CCN(O)CC FVCOIAYSJZGECG-UHFFFAOYSA-N 0.000 description 1
- SMJPCVBZLMOZFT-UHFFFAOYSA-N difluoro(isocyanatosulfanyl)methane Chemical compound FC(F)SN=C=O SMJPCVBZLMOZFT-UHFFFAOYSA-N 0.000 description 1
- 125000006222 dimethylaminomethyl group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])* 0.000 description 1
- LIKFHECYJZWXFJ-UHFFFAOYSA-N dimethyldichlorosilane Chemical compound C[Si](C)(Cl)Cl LIKFHECYJZWXFJ-UHFFFAOYSA-N 0.000 description 1
- KUMNEOGIHFCNQW-UHFFFAOYSA-N diphenyl phosphite Chemical compound C=1C=CC=CC=1OP([O-])OC1=CC=CC=C1 KUMNEOGIHFCNQW-UHFFFAOYSA-N 0.000 description 1
- WMYNMYVRWWCRPS-UHFFFAOYSA-N ethynoxyethane Chemical group CCOC#C WMYNMYVRWWCRPS-UHFFFAOYSA-N 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 235000019634 flavors Nutrition 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 239000000295 fuel oil Substances 0.000 description 1
- 238000007429 general method Methods 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000001188 haloalkyl group Chemical group 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 125000001475 halogen functional group Chemical group 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hcl hcl Chemical compound Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- UQEAIHBTYFGYIE-UHFFFAOYSA-N hexamethyldisiloxane Chemical compound C[Si](C)(C)O[Si](C)(C)C UQEAIHBTYFGYIE-UHFFFAOYSA-N 0.000 description 1
- XXMIOPMDWAUFGU-UHFFFAOYSA-N hexane-1,6-diol Chemical compound OCCCCCCO XXMIOPMDWAUFGU-UHFFFAOYSA-N 0.000 description 1
- 150000002483 hydrogen compounds Chemical class 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 230000010354 integration Effects 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- KSRHWBLHVZJTKV-UHFFFAOYSA-N iodobenzene dichloride Chemical compound ClI(Cl)C1=CC=CC=C1 KSRHWBLHVZJTKV-UHFFFAOYSA-N 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- PGJJYYADLKWXLJ-UHFFFAOYSA-N isocyanato(trimethoxy)silane Chemical compound CO[Si](OC)(OC)N=C=O PGJJYYADLKWXLJ-UHFFFAOYSA-N 0.000 description 1
- FJCLLKGVXXWVTA-UHFFFAOYSA-N isocyanatoselanylimino(oxo)methane Chemical compound O=C=N[Se]N=C=O FJCLLKGVXXWVTA-UHFFFAOYSA-N 0.000 description 1
- RCHRKGAVHJRQBI-UHFFFAOYSA-N isocyanatosulfinylimino(oxo)methane Chemical compound O=C=NS(=O)N=C=O RCHRKGAVHJRQBI-UHFFFAOYSA-N 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- CTAPFRYPJLPFDF-UHFFFAOYSA-N isoxazole Chemical class C=1C=NOC=1 CTAPFRYPJLPFDF-UHFFFAOYSA-N 0.000 description 1
- 125000000842 isoxazolyl group Chemical group 0.000 description 1
- 150000003932 ketenimines Chemical class 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 150000003951 lactams Chemical group 0.000 description 1
- 238000004811 liquid chromatography Methods 0.000 description 1
- 239000007937 lozenge Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 230000001404 mediated effect Effects 0.000 description 1
- MYWUZJCMWCOHBA-VIFPVBQESA-N methamphetamine Chemical compound CN[C@@H](C)CC1=CC=CC=C1 MYWUZJCMWCOHBA-VIFPVBQESA-N 0.000 description 1
- HNQIVZYLYMDVSB-UHFFFAOYSA-N methanesulfonimidic acid Chemical compound CS(N)(=O)=O HNQIVZYLYMDVSB-UHFFFAOYSA-N 0.000 description 1
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- QRNDDJXJUHBGSG-UHFFFAOYSA-N methoxyethyne Chemical group COC#C QRNDDJXJUHBGSG-UHFFFAOYSA-N 0.000 description 1
- PHBYJSOMJRZRIO-UHFFFAOYSA-N methylsilylurea Chemical compound C[SiH2]NC(=O)N PHBYJSOMJRZRIO-UHFFFAOYSA-N 0.000 description 1
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 1
- 244000005700 microbiome Species 0.000 description 1
- VMESOKCXSYNAKD-UHFFFAOYSA-N n,n-dimethylhydroxylamine Chemical compound CN(C)O VMESOKCXSYNAKD-UHFFFAOYSA-N 0.000 description 1
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 1
- HMBVYQYJBMCAFC-UKRRQHHQSA-N n-[(6r,7r)-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]-2-phenoxyacetamide Chemical compound N([C@H]1[C@@H]2N(C1=O)C=C(CS2)C)C(=O)COC1=CC=CC=C1 HMBVYQYJBMCAFC-UKRRQHHQSA-N 0.000 description 1
- OKAGBRFNQJFAHH-UHFFFAOYSA-N n-ethyl-n-ethynyl-3,3-dimethylbutan-2-amine Chemical compound CCN(C#C)C(C)C(C)(C)C OKAGBRFNQJFAHH-UHFFFAOYSA-N 0.000 description 1
- ITYOPMRLCKEGTK-UHFFFAOYSA-N n-ethyl-n-ethynylbutan-2-amine Chemical compound CCC(C)N(CC)C#C ITYOPMRLCKEGTK-UHFFFAOYSA-N 0.000 description 1
- OFCWARZFOCWTRV-UHFFFAOYSA-N n-ethynyl-n,2,2-trimethylpropan-1-amine Chemical compound C#CN(C)CC(C)(C)C OFCWARZFOCWTRV-UHFFFAOYSA-N 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- 230000000269 nucleophilic effect Effects 0.000 description 1
- UGTVWEKOUKZLJJ-UHFFFAOYSA-N o-(chloromethyl) n-(oxomethylidene)carbamothioate Chemical compound ClCOC(=S)N=C=O UGTVWEKOUKZLJJ-UHFFFAOYSA-N 0.000 description 1
- 239000010502 orange oil Substances 0.000 description 1
- 125000001715 oxadiazolyl group Chemical group 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 229960003540 oxyquinoline Drugs 0.000 description 1
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 239000008194 pharmaceutical composition Substances 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- SXADIBFZNXBEGI-UHFFFAOYSA-N phosphoramidous acid Chemical class NP(O)O SXADIBFZNXBEGI-UHFFFAOYSA-N 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- CPGRMGOILBSUQC-UHFFFAOYSA-N phosphoryl azide Chemical compound [N-]=[N+]=NP(=O)(N=[N+]=[N-])N=[N+]=[N-] CPGRMGOILBSUQC-UHFFFAOYSA-N 0.000 description 1
- 125000005633 phthalidyl group Chemical group 0.000 description 1
- 125000000612 phthaloyl group Chemical group C(C=1C(C(=O)*)=CC=CC1)(=O)* 0.000 description 1
- CFZKDDTWZYUZKS-UHFFFAOYSA-N picoline N-oxide Chemical compound CC1=CC=CC=[N+]1[O-] CFZKDDTWZYUZKS-UHFFFAOYSA-N 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- RIBFXMJCUYXJDZ-UHFFFAOYSA-N propanoyl bromide Chemical compound CCC(Br)=O RIBFXMJCUYXJDZ-UHFFFAOYSA-N 0.000 description 1
- BBFCIBZLAVOLCF-UHFFFAOYSA-N pyridin-1-ium;bromide Chemical compound Br.C1=CC=NC=C1 BBFCIBZLAVOLCF-UHFFFAOYSA-N 0.000 description 1
- 238000010791 quenching Methods 0.000 description 1
- 230000000171 quenching effect Effects 0.000 description 1
- MCJGNVYPOGVAJF-UHFFFAOYSA-N quinolin-8-ol Chemical compound C1=CN=C2C(O)=CC=CC2=C1 MCJGNVYPOGVAJF-UHFFFAOYSA-N 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- 239000010948 rhodium Substances 0.000 description 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 1
- 230000002000 scavenging effect Effects 0.000 description 1
- 229910052711 selenium Inorganic materials 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- AIFMYMZGQVTROK-UHFFFAOYSA-N silicon tetrabromide Chemical compound Br[Si](Br)(Br)Br AIFMYMZGQVTROK-UHFFFAOYSA-N 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- APSBXTVYXVQYAB-UHFFFAOYSA-M sodium docusate Chemical compound [Na+].CCCCC(CC)COC(=O)CC(S([O-])(=O)=O)C(=O)OCC(CC)CCCC APSBXTVYXVQYAB-UHFFFAOYSA-M 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000008174 sterile solution Substances 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 1
- 229940124530 sulfonamide Drugs 0.000 description 1
- 150000003456 sulfonamides Chemical class 0.000 description 1
- 239000002511 suppository base Substances 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 150000003536 tetrazoles Chemical class 0.000 description 1
- 125000005301 thienylmethyl group Chemical group [H]C1=C([H])C([H])=C(S1)C([H])([H])* 0.000 description 1
- 150000007970 thio esters Chemical class 0.000 description 1
- HFRXJVQOXRXOPP-UHFFFAOYSA-N thionyl bromide Chemical compound BrS(Br)=O HFRXJVQOXRXOPP-UHFFFAOYSA-N 0.000 description 1
- LTSUHJWLSNQKIP-UHFFFAOYSA-J tin(iv) bromide Chemical compound Br[Sn](Br)(Br)Br LTSUHJWLSNQKIP-UHFFFAOYSA-J 0.000 description 1
- LMYRWZFENFIFIT-UHFFFAOYSA-N toluene-4-sulfonamide Chemical compound CC1=CC=C(S(N)(=O)=O)C=C1 LMYRWZFENFIFIT-UHFFFAOYSA-N 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 150000003852 triazoles Chemical class 0.000 description 1
- GEWRGPBMDJVIDP-UHFFFAOYSA-N trichloro(isocyanatosulfanyl)methane Chemical compound ClC(Cl)(Cl)SN=C=O GEWRGPBMDJVIDP-UHFFFAOYSA-N 0.000 description 1
- FAQYAMRNWDIXMY-UHFFFAOYSA-N trichloroborane Chemical compound ClB(Cl)Cl FAQYAMRNWDIXMY-UHFFFAOYSA-N 0.000 description 1
- 125000006000 trichloroethyl group Chemical group 0.000 description 1
- OZEFVOPTJSERLH-UHFFFAOYSA-N trifluoro(isocyanatosulfanyl)methane Chemical compound FC(F)(F)SN=C=O OZEFVOPTJSERLH-UHFFFAOYSA-N 0.000 description 1
- AUILUEXXDWUIBU-UHFFFAOYSA-N triisocyanatoalumane Chemical compound [Al+3].[N-]=C=O.[N-]=C=O.[N-]=C=O AUILUEXXDWUIBU-UHFFFAOYSA-N 0.000 description 1
- SZXLFRCOEKCGSL-UHFFFAOYSA-N triisocyanatoborane Chemical compound O=C=NB(N=C=O)N=C=O SZXLFRCOEKCGSL-UHFFFAOYSA-N 0.000 description 1
- LXUMNUAVISZZPN-UHFFFAOYSA-N triisocyanatophosphane Chemical compound O=C=NP(N=C=O)N=C=O LXUMNUAVISZZPN-UHFFFAOYSA-N 0.000 description 1
- QLYZQYBAIRVLPF-UHFFFAOYSA-N triisocyanatostibane Chemical compound O=C=N[Sb](N=C=O)N=C=O QLYZQYBAIRVLPF-UHFFFAOYSA-N 0.000 description 1
- 239000003981 vehicle Substances 0.000 description 1
- 239000011800 void material Substances 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 229940102001 zinc bromide Drugs 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/04—Antibacterial agents
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y02—TECHNOLOGIES OR APPLICATIONS FOR MITIGATION OR ADAPTATION AGAINST CLIMATE CHANGE
- Y02P—CLIMATE CHANGE MITIGATION TECHNOLOGIES IN THE PRODUCTION OR PROCESSING OF GOODS
- Y02P20/00—Technologies relating to chemical industry
- Y02P20/50—Improvements relating to the production of bulk chemicals
- Y02P20/55—Design of synthesis routes, e.g. reducing the use of auxiliary or protecting groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Health & Medical Sciences (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Oncology (AREA)
- Pharmacology & Pharmacy (AREA)
- Communicable Diseases (AREA)
- Animal Behavior & Ethology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Cephalosporin Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Priority Applications (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CA000420049A CA1157013A (en) | 1978-04-03 | 1983-01-21 | Process for the preparation of (substituted)-2- carbamoyloxymethylpenam and (substituted)3- carbamoyloxycepham |
| CA000420050A CA1157014A (en) | 1978-04-03 | 1983-01-21 | Process for the preparation of (substituted)-2- carbamoyloxymethylpenam and (substituted)-3- carbamoyloxycepham |
| CA000420048A CA1157012A (en) | 1978-04-03 | 1983-01-21 | Process for the preparation of (subtituted)-2- carbamoyloxymethylpenam and (substituted)-3- carbamoyloxycepham |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US893,092 | 1978-04-03 | ||
| US05/893,092 US4322347A (en) | 1978-04-03 | 1978-04-03 | 2-Carbamoyloxymethyl-penicillin derivatives |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1140915A true CA1140915A (en) | 1983-02-08 |
Family
ID=25401020
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000322307A Expired CA1140915A (en) | 1978-04-03 | 1979-02-26 | Process for the preparation of (substituted)-2-carbamoyloxymethylpenam and (substituted)-3-carbamolyoxycepham |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US4322347A (enExample) |
| JP (1) | JPS54132594A (enExample) |
| BE (1) | BE875247A (enExample) |
| CA (1) | CA1140915A (enExample) |
| CH (1) | CH642080A5 (enExample) |
| DE (1) | DE2912483A1 (enExample) |
| DK (1) | DK129779A (enExample) |
| FR (1) | FR2421903B1 (enExample) |
| GB (1) | GB2017705B (enExample) |
| IE (1) | IE49046B1 (enExample) |
| IT (1) | IT1116851B (enExample) |
| LU (1) | LU81108A1 (enExample) |
| NL (1) | NL7902443A (enExample) |
| SE (3) | SE448239B (enExample) |
| YU (5) | YU41860B (enExample) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4374982A (en) * | 1979-11-07 | 1983-02-22 | Bristol-Myers Company | Cepham compounds |
| IT1148888B (it) * | 1980-07-15 | 1986-12-03 | Schiena Ricerche Di | Composti antibiotici |
| IL92139A0 (en) * | 1988-10-31 | 1990-07-12 | Hoffmann La Roche | Penicillanic acid derivatives,their manufacture and pharmaceutical compositions containing them |
| US5604222A (en) * | 1993-12-27 | 1997-02-18 | Lupin Laboratories, Ltd. | Method for the preparation of 2-chloro sulfinyl azetidinones |
| US5578721A (en) * | 1994-07-11 | 1996-11-26 | Lupin Laboratories Limited | Process for preparation of 3-exomethylene cepham sulfoxide esters |
| WO2013092481A1 (en) | 2011-12-20 | 2013-06-27 | F. Hoffmann-La Roche Ag | 2',4'-difluoro-2'-methyl substituted nucleoside derivatives as inhibitors of hcv rna replication |
| WO2013092447A1 (en) | 2011-12-20 | 2013-06-27 | F. Hoffmann-La Roche Ag | 4'-azido, 3'-fluoro substituted nucleoside derivatives as inhibitors of hcv rna replication |
| US20180200280A1 (en) | 2013-05-16 | 2018-07-19 | Riboscience Llc | 4'-Fluoro-2'-Methyl Substituted Nucleoside Derivatives as Inhibitors of HCV RNA Replication |
| CN105307662B (zh) | 2013-05-16 | 2019-06-04 | 里博科学有限责任公司 | 4’-氟-2’-甲基取代的核苷衍生物 |
| PE20160119A1 (es) | 2013-05-16 | 2016-02-24 | Riboscience Llc | Derivados de nucleosido 4'-azido, 3'-desoxi-3'-fluoro sustituido |
| AR112702A1 (es) | 2017-09-21 | 2019-11-27 | Riboscience Llc | Derivados de nucleósidos sustituidos con 4-fluoro-2-metilo como inhibidores de la replicación de hcv arn |
Family Cites Families (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3275626A (en) * | 1962-07-31 | 1966-09-27 | Lilly Co Eli | Penicillin conversion via sulfoxide |
| US3714156A (en) * | 1970-06-22 | 1973-01-30 | Univ California | Lactam process |
| BE787618A (fr) | 1971-08-17 | 1973-02-16 | Gist Brocades Nv | Procede pour preparer des composes heterocycliques |
| GB1425827A (en) * | 1972-03-13 | 1976-02-18 | Astra Laekemedel Ab | Penicillins and cephalosporins |
| US4218374A (en) * | 1972-10-20 | 1980-08-19 | Fujisawa Pharmaceutical Company, Limited | Penam derivatives |
| GB1465893A (en) * | 1973-02-09 | 1977-03-02 | Gist Brocades Nv | I-carboxypropenyl-4-iminothio-azetidine-2-one derivatives methods for their preparation and use |
| DE2309599A1 (de) * | 1973-02-26 | 1974-09-05 | Bayer Ag | Verfahren zur herstellung von 7-acylamino-desacetoxy-cephalosporansaeurederivaten |
| US4010156A (en) * | 1973-04-19 | 1977-03-01 | American Home Products Corporation | Process for the rearrangement of penicillins to cephalosporins and intermediate compounds thereof |
| DE2320040A1 (de) | 1973-04-19 | 1974-11-07 | Bayer Ag | Verfahren zur herstellung von 7acylamino-desacetoxy-cephalosporansaeureester |
| GB1467604A (en) * | 1974-06-27 | 1977-03-16 | Toyama Chemical Co Ltd | Bis-type penicillins and process for producing the same |
| FR2340093A1 (fr) | 1976-02-05 | 1977-09-02 | Roussel Uclaf | Derives de l'acide 3-carbamoyloxymethyl 7-amino thiazolyl acetamido cephalosporanique, leur procede de preparation et leur application comme medicaments |
| GB1573614A (en) * | 1976-02-25 | 1980-08-28 | Leo Pharm Prod Ltd | Amidinopenicillanoyloxyalkyl cephalosporanates |
| DE2655949A1 (de) * | 1976-12-10 | 1978-06-15 | Gruenenthal Gmbh | Neue cephalosporin- und penicillinderivate, verfahren zu deren herstellung und diese produkte enthaltende arzneimittel |
| US4182711A (en) * | 1978-04-27 | 1980-01-08 | Bristol-Myers Company | Antibacterial agents of the β-lactam type |
| CA1125745A (en) * | 1978-11-20 | 1982-06-15 | Joseph Kaspi | PROCESS FOR PREPARING .beta.-LACTAM ANTIBIOTICS |
-
1978
- 1978-04-03 US US05/893,092 patent/US4322347A/en not_active Expired - Lifetime
-
1979
- 1979-02-26 CA CA000322307A patent/CA1140915A/en not_active Expired
- 1979-03-23 IT IT48457/79A patent/IT1116851B/it active
- 1979-03-29 FR FR7907972A patent/FR2421903B1/fr not_active Expired
- 1979-03-29 DE DE19792912483 patent/DE2912483A1/de not_active Withdrawn
- 1979-03-29 NL NL7902443A patent/NL7902443A/xx not_active Application Discontinuation
- 1979-03-29 DK DK129779A patent/DK129779A/da unknown
- 1979-03-30 BE BE0/194349A patent/BE875247A/xx not_active IP Right Cessation
- 1979-03-30 YU YU756/79A patent/YU41860B/xx unknown
- 1979-04-02 LU LU81108A patent/LU81108A1/de unknown
- 1979-04-02 SE SE7902916A patent/SE448239B/sv not_active IP Right Cessation
- 1979-04-03 CH CH310279A patent/CH642080A5/fr not_active IP Right Cessation
- 1979-04-03 JP JP3942679A patent/JPS54132594A/ja active Granted
- 1979-04-03 GB GB7911570A patent/GB2017705B/en not_active Expired
- 1979-08-08 IE IE947/79A patent/IE49046B1/en unknown
-
1982
- 1982-09-30 YU YU2205/82A patent/YU42802B/xx unknown
- 1982-09-30 YU YU2206/82A patent/YU42803B/xx unknown
- 1982-09-30 YU YU2207/82A patent/YU42050B/xx unknown
- 1982-09-30 YU YU2204/82A patent/YU43096B/xx unknown
-
1984
- 1984-04-13 SE SE8402090A patent/SE458610B/sv not_active IP Right Cessation
- 1984-04-13 SE SE8402089A patent/SE458609B/sv not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| SE8402089L (sv) | 1984-04-13 |
| YU42802B (en) | 1988-12-31 |
| SE8402090L (sv) | 1984-04-13 |
| YU42050B (en) | 1988-04-30 |
| YU43096B (en) | 1989-02-28 |
| YU220582A (en) | 1983-01-21 |
| LU81108A1 (de) | 1979-11-07 |
| GB2017705A (en) | 1979-10-10 |
| YU220682A (en) | 1983-01-21 |
| YU42803B (en) | 1988-12-31 |
| IE790947L (en) | 1979-10-03 |
| BE875247A (fr) | 1979-10-01 |
| YU220482A (en) | 1983-01-21 |
| IE49046B1 (en) | 1985-07-24 |
| JPS54132594A (en) | 1979-10-15 |
| SE8402090D0 (sv) | 1984-04-13 |
| US4322347A (en) | 1982-03-30 |
| SE8402089D0 (sv) | 1984-04-13 |
| NL7902443A (nl) | 1979-10-05 |
| DK129779A (da) | 1979-10-04 |
| SE458609B (sv) | 1989-04-17 |
| FR2421903B1 (fr) | 1986-08-29 |
| CH642080A5 (fr) | 1984-03-30 |
| YU220782A (en) | 1983-01-21 |
| YU75679A (en) | 1983-01-21 |
| SE458610B (sv) | 1989-04-17 |
| GB2017705B (en) | 1982-10-27 |
| IT7948457A0 (it) | 1979-03-23 |
| FR2421903A1 (fr) | 1979-11-02 |
| SE7902916L (sv) | 1979-10-04 |
| YU41860B (en) | 1988-02-29 |
| JPH0217557B2 (enExample) | 1990-04-20 |
| IT1116851B (it) | 1986-02-10 |
| SE448239B (sv) | 1987-02-02 |
| DE2912483A1 (de) | 1979-10-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4539149A (en) | β-Lactam antibacterial agents | |
| SE463514B (sv) | Foerfarande foer framstaellning av penemderivat | |
| CA1140915A (en) | Process for the preparation of (substituted)-2-carbamoyloxymethylpenam and (substituted)-3-carbamolyoxycepham | |
| US5246926A (en) | Cephalosporin derivatives | |
| CA1109859A (en) | Thiooxime cephalosporin and penicillin derivatives | |
| US4537886A (en) | β-lactam antibacterial agents and compositions containing them | |
| US5064649A (en) | Cephalosporin derivatives | |
| EP0114752B1 (en) | Beta-lactam antibacterial agents | |
| US4432970A (en) | 6-beta-Halopenicillanic acid 1,1-dioxides as beta-lactamase inhibitors | |
| US4310459A (en) | Process for producing carbamoyl substituted penams and carbamoyl substituted cephams from penicillin sulfoxide esters | |
| US4820701A (en) | Penam derivatives | |
| CA1070688A (en) | Cephalosporin analogues | |
| US5275816A (en) | Cephalosporin derivatives | |
| US4374982A (en) | Cepham compounds | |
| US4518773A (en) | "3-Carbamoyloxy cephalosporins" | |
| US4426520A (en) | 3-Carbamoyloxy-cepham-4-carboxylic acid derivatives | |
| US3968109A (en) | Production of 2-(thio substituted)cephalosporin sulfoxides and 2-(thio substituted)cephalosporins | |
| CA1157012A (en) | Process for the preparation of (subtituted)-2- carbamoyloxymethylpenam and (substituted)-3- carbamoyloxycepham | |
| CA1157013A (en) | Process for the preparation of (substituted)-2- carbamoyloxymethylpenam and (substituted)3- carbamoyloxycepham | |
| EP0114750A2 (en) | Beta-lactam antibacterial agents | |
| US4407755A (en) | 6-Amino penam derivatives | |
| CA1242188A (en) | 3-methoxy-2-oxoazetidine derivatives and their production | |
| CA1157014A (en) | Process for the preparation of (substituted)-2- carbamoyloxymethylpenam and (substituted)-3- carbamoyloxycepham | |
| GB1560532A (en) | Cepham and penam compounds | |
| US4416883A (en) | Penicillin derivatives |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |