CA1133937A - Method for the production of metal soaps - Google Patents
Method for the production of metal soapsInfo
- Publication number
- CA1133937A CA1133937A CA349,149A CA349149A CA1133937A CA 1133937 A CA1133937 A CA 1133937A CA 349149 A CA349149 A CA 349149A CA 1133937 A CA1133937 A CA 1133937A
- Authority
- CA
- Canada
- Prior art keywords
- carboxylic acid
- water
- reaction
- metal
- employed
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000344 soap Substances 0.000 title claims abstract description 36
- 229910052751 metal Inorganic materials 0.000 title claims abstract description 31
- 239000002184 metal Substances 0.000 title claims abstract description 31
- 238000004519 manufacturing process Methods 0.000 title claims abstract description 14
- 238000000034 method Methods 0.000 title claims description 40
- 229910044991 metal oxide Inorganic materials 0.000 claims abstract description 8
- 150000004706 metal oxides Chemical class 0.000 claims abstract description 8
- 229910000000 metal hydroxide Inorganic materials 0.000 claims abstract description 6
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 claims abstract description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 28
- 238000006243 chemical reaction Methods 0.000 claims description 22
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 20
- 239000000203 mixture Substances 0.000 claims description 20
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 claims description 10
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 claims description 8
- 239000002253 acid Substances 0.000 claims description 7
- 238000002844 melting Methods 0.000 claims description 7
- 230000008018 melting Effects 0.000 claims description 7
- 125000004432 carbon atom Chemical group C* 0.000 claims description 5
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims description 4
- 238000013019 agitation Methods 0.000 claims description 4
- 229910052791 calcium Inorganic materials 0.000 claims description 4
- 239000011575 calcium Substances 0.000 claims description 4
- 230000000977 initiatory effect Effects 0.000 claims description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 3
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 3
- 150000001735 carboxylic acids Chemical class 0.000 claims description 3
- 238000010438 heat treatment Methods 0.000 claims description 3
- 239000011541 reaction mixture Substances 0.000 claims description 3
- 229910052708 sodium Inorganic materials 0.000 claims description 3
- 239000011734 sodium Substances 0.000 claims description 3
- 229910052725 zinc Inorganic materials 0.000 claims description 3
- 239000011701 zinc Substances 0.000 claims description 3
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 claims description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 claims description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 2
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 claims description 2
- 229910052744 lithium Inorganic materials 0.000 claims description 2
- 229910052749 magnesium Inorganic materials 0.000 claims description 2
- 239000011777 magnesium Substances 0.000 claims description 2
- 229910052700 potassium Inorganic materials 0.000 claims description 2
- 239000011591 potassium Substances 0.000 claims description 2
- 229910052718 tin Inorganic materials 0.000 claims description 2
- WOIHABYNKOEWFG-UHFFFAOYSA-N [Sr].[Ba] Chemical compound [Sr].[Ba] WOIHABYNKOEWFG-UHFFFAOYSA-N 0.000 claims 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 1
- 239000008187 granular material Substances 0.000 abstract description 9
- 150000004649 carbonic acid derivatives Chemical class 0.000 abstract description 2
- 150000004692 metal hydroxides Chemical class 0.000 abstract 1
- 239000007795 chemical reaction product Substances 0.000 description 12
- 206010001497 Agitation Diseases 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 239000000428 dust Substances 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000000654 additive Substances 0.000 description 3
- RQPZNWPYLFFXCP-UHFFFAOYSA-L barium dihydroxide Chemical compound [OH-].[OH-].[Ba+2] RQPZNWPYLFFXCP-UHFFFAOYSA-L 0.000 description 3
- 229910001863 barium hydroxide Inorganic materials 0.000 description 3
- 235000001465 calcium Nutrition 0.000 description 3
- 229960005069 calcium Drugs 0.000 description 3
- PYRZPBDTPRQYKG-UHFFFAOYSA-N cyclopentene-1-carboxylic acid Chemical compound OC(=O)C1=CCCC1 PYRZPBDTPRQYKG-UHFFFAOYSA-N 0.000 description 3
- 230000003247 decreasing effect Effects 0.000 description 3
- 238000009826 distribution Methods 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 239000002245 particle Substances 0.000 description 3
- 238000007039 two-step reaction Methods 0.000 description 3
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 239000007900 aqueous suspension Substances 0.000 description 2
- 229910052788 barium Inorganic materials 0.000 description 2
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 2
- CXKCTMHTOKXKQT-UHFFFAOYSA-N cadmium oxide Inorganic materials [Cd]=O CXKCTMHTOKXKQT-UHFFFAOYSA-N 0.000 description 2
- CFEAAQFZALKQPA-UHFFFAOYSA-N cadmium(2+);oxygen(2-) Chemical compound [O-2].[Cd+2] CFEAAQFZALKQPA-UHFFFAOYSA-N 0.000 description 2
- 235000014113 dietary fatty acids Nutrition 0.000 description 2
- 239000000194 fatty acid Substances 0.000 description 2
- 229930195729 fatty acid Natural products 0.000 description 2
- 150000004665 fatty acids Chemical class 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- 229910000464 lead oxide Inorganic materials 0.000 description 2
- YEXPOXQUZXUXJW-UHFFFAOYSA-N oxolead Chemical compound [Pb]=O YEXPOXQUZXUXJW-UHFFFAOYSA-N 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 235000015424 sodium Nutrition 0.000 description 2
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 1
- 230000003213 activating effect Effects 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- MGFRKBRDZIMZGO-UHFFFAOYSA-N barium cadmium Chemical compound [Cd].[Ba] MGFRKBRDZIMZGO-UHFFFAOYSA-N 0.000 description 1
- 229910052793 cadmium Inorganic materials 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000003925 fat Substances 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 230000001976 improved effect Effects 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 229960001078 lithium Drugs 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 235000001055 magnesium Nutrition 0.000 description 1
- 229940091250 magnesium supplement Drugs 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 235000007686 potassium Nutrition 0.000 description 1
- 229960003975 potassium Drugs 0.000 description 1
- 230000036647 reaction Effects 0.000 description 1
- 230000000630 rising effect Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 238000007873 sieving Methods 0.000 description 1
- 229940083542 sodium Drugs 0.000 description 1
- RBWSWDPRDBEWCR-RKJRWTFHSA-N sodium;(2r)-2-[(2r)-3,4-dihydroxy-5-oxo-2h-furan-2-yl]-2-hydroxyethanolate Chemical compound [Na+].[O-]C[C@@H](O)[C@H]1OC(=O)C(O)=C1O RBWSWDPRDBEWCR-RKJRWTFHSA-N 0.000 description 1
- 229910052712 strontium Inorganic materials 0.000 description 1
- CIOAGBVUUVVLOB-UHFFFAOYSA-N strontium atom Chemical compound [Sr] CIOAGBVUUVVLOB-UHFFFAOYSA-N 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000011787 zinc oxide Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C51/00—Preparation of carboxylic acids or their salts, halides or anhydrides
- C07C51/41—Preparation of salts of carboxylic acids
- C07C51/412—Preparation of salts of carboxylic acids by conversion of the acids, their salts, esters or anhydrides with the same carboxylic acid part
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Detergent Compositions (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2913592A DE2913592C2 (de) | 1979-04-04 | 1979-04-04 | Verfahen zur Herstellung von Metallseifen |
| DEP2913592.0 | 1979-04-04 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1133937A true CA1133937A (en) | 1982-10-19 |
Family
ID=6067447
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA349,149A Expired CA1133937A (en) | 1979-04-04 | 1980-04-03 | Method for the production of metal soaps |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US4294771A (https=) |
| EP (1) | EP0017827B2 (https=) |
| JP (1) | JPS5812267B2 (https=) |
| AT (1) | ATE795T1 (https=) |
| AU (1) | AU533022B2 (https=) |
| CA (1) | CA1133937A (https=) |
| DE (2) | DE2913592C2 (https=) |
| DK (1) | DK155879C (https=) |
| FI (1) | FI70700C (https=) |
| GR (1) | GR67224B (https=) |
| IE (1) | IE49666B1 (https=) |
| NO (1) | NO151011C (https=) |
| NZ (1) | NZ193251A (https=) |
| PH (1) | PH14123A (https=) |
| ZA (1) | ZA801797B (https=) |
Families Citing this family (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2913592C2 (de) | 1979-04-04 | 1988-11-10 | Chemische Werke München Otto Bärlocher GmbH, 8000 München | Verfahen zur Herstellung von Metallseifen |
| US4474683A (en) * | 1981-08-10 | 1984-10-02 | Armour-Dial, Inc. | Soap making process |
| US4397760A (en) * | 1981-08-10 | 1983-08-09 | Armour-Dial, Inc. | Rapid saponification process |
| DE3370318D1 (en) * | 1982-01-26 | 1987-04-23 | Mallinckrodt Inc | Granular metal soap product and process for producing metal soap |
| US4647401A (en) * | 1983-01-24 | 1987-03-03 | Rhone Poulenc Inc. | Process for preparing colloidal ceric oxide and complexes thereof with free organic acids |
| AU2378584A (en) * | 1983-02-02 | 1984-08-09 | National Distillers And Chemical Corporation | Preparation of alkaline earth and heavy metal soaps of aliphatic monocarboxylic acids by precipitaion |
| AU581691B2 (en) * | 1985-10-14 | 1989-03-02 | Balfour Manufacturing Company Limited | Process for the production of feedstuffs |
| JPS61159572A (ja) * | 1985-01-07 | 1986-07-19 | Hitachi Ltd | 連続スパツタ装置 |
| US4675027A (en) * | 1985-04-24 | 1987-06-23 | Mobil Oil Corporation | Fuel compositions having improved low temperature characteristics |
| US4772434A (en) * | 1986-10-03 | 1988-09-20 | The Dial Corporation | Soap making process |
| DE3728811A1 (de) * | 1987-08-28 | 1989-03-09 | Henkel Kgaa | Verfahren zur kontinuierlichen herstellung von fettsaeureseifen |
| DE3806192A1 (de) * | 1988-02-26 | 1989-09-07 | Neynaber Chemie Gmbh | Verfahren zur herstellung von pulverfoermigen basischen metallseifen |
| WO1990003358A1 (en) * | 1988-09-30 | 1990-04-05 | Mallinckrodt, Inc. | A process for the production of granular metal soaps |
| JPH0729975B2 (ja) * | 1990-11-30 | 1995-04-05 | 株式会社耕正 | 金属石鹸及びこれを含む熱可塑性樹脂組成物 |
| US5250714A (en) * | 1991-09-17 | 1993-10-05 | Church & Dwight Co., Inc. | Fatty acid salt production |
| GB9907185D0 (en) * | 1999-03-30 | 1999-05-26 | Feed Oil Company The Limited | A process for the production of fat |
| JP4815653B2 (ja) * | 2000-01-27 | 2011-11-16 | パナソニック株式会社 | 銀インキおよびその製造方法、電子部品の製造方法 |
| US6410783B1 (en) | 2000-10-19 | 2002-06-25 | Basf Corporation | Method of producing carboxylic acid salts |
| US7595412B2 (en) | 2001-08-16 | 2009-09-29 | Dover Chemical Corporation | Polymer dispersible polybasic metal carboxylate complexes |
| RU2208603C2 (ru) * | 2001-08-21 | 2003-07-20 | Закрытое акционерное общество "Каустик" | Способ получения маслорастворимых солей каталитически активных металлов |
| US20050131249A1 (en) * | 2002-04-12 | 2005-06-16 | Technical And Commerical Services International | Method of making salt |
| US6689894B1 (en) | 2003-02-05 | 2004-02-10 | Crompton Corporation | Process for preparing fatty acid zinc salts |
| ATE415950T1 (de) * | 2003-07-28 | 2008-12-15 | Mallinckrodt Inc | Verbesserte stearat-zusammensetzung und herstellungsverfahren dafür |
| EP1744770A2 (en) * | 2004-05-06 | 2007-01-24 | Osteologix A/S | High yield and rapid syntheses methods for producing metallo-organic salts |
| CA2507897A1 (en) * | 2004-06-07 | 2005-12-07 | Dover Chemical Corporation | High shear process for making metallic esters |
| JP5241480B2 (ja) * | 2008-12-26 | 2013-07-17 | 花王株式会社 | ナノ粒子の製造方法 |
Family Cites Families (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1068238B (de) * | 1959-11-05 | Chemische Fabrik Hoesch K.G., Düren | Verfahren zur Herstellung von elektrolytfreien normalen Bilaisalzen von Fettsäuren mit ß bis 30 Kohlenstoffatomen | |
| US2890232A (en) * | 1956-05-31 | 1959-06-09 | Swift & Co | Manufacture of metal soaps |
| GB1074093A (en) * | 1963-03-01 | 1967-06-28 | Unilever Ltd | Improvements in or relating to the manufacture of dry metallic soaps |
| NL134744C (https=) * | 1965-03-10 | |||
| DE1279658B (de) * | 1965-12-14 | 1968-10-10 | Baerlocher Chem | Verfahren zum Granulieren von wasserunloeslichen pulverfoermigen Stoffen |
| NL133881C (https=) * | 1966-03-15 | |||
| US3803188A (en) * | 1969-07-09 | 1974-04-09 | Norac Co | Manufacture of metallic soaps |
| DE2002185A1 (de) * | 1970-01-19 | 1971-07-29 | Baerlocher Chem | Verfahren zur Herstellung von Metallseifen und Metallseifengemischen nach dem Schmelzverfahren |
| US3779962A (en) * | 1970-10-09 | 1973-12-18 | G Koenen | Stabilizer-lubricant combinations for halogen-containing polymers |
| GB1406526A (en) * | 1973-05-30 | 1975-09-17 | Norac Co | Manufacture of metallic soaps |
| DE2361607C2 (de) * | 1973-12-11 | 1982-02-04 | The Norac Co., Inc., Azusa, Calif. | Verfahren zur Herstellung von Metallseifen |
| FR2311795A1 (fr) * | 1975-05-21 | 1976-12-17 | Rousselot | Procede de preparation de compositions stabilisantes et lubrifiantes au plomb pour chlorure de polyvinyle |
| US4060535A (en) * | 1976-08-31 | 1977-11-29 | Tenneco Chemicals, Inc. | Process for the production of metal salts of organic acids |
| DE2913592C2 (de) | 1979-04-04 | 1988-11-10 | Chemische Werke München Otto Bärlocher GmbH, 8000 München | Verfahen zur Herstellung von Metallseifen |
-
1979
- 1979-04-04 DE DE2913592A patent/DE2913592C2/de not_active Expired
-
1980
- 1980-03-21 GR GR61503A patent/GR67224B/el unknown
- 1980-03-24 FI FI800904A patent/FI70700C/fi not_active IP Right Cessation
- 1980-03-25 NZ NZ193251A patent/NZ193251A/xx unknown
- 1980-03-25 AU AU56818/80A patent/AU533022B2/en not_active Ceased
- 1980-03-26 ZA ZA00801797A patent/ZA801797B/xx unknown
- 1980-03-26 NO NO800874A patent/NO151011C/no unknown
- 1980-03-26 PH PH23814A patent/PH14123A/en unknown
- 1980-03-27 AT AT80101664T patent/ATE795T1/de active
- 1980-03-27 EP EP80101664A patent/EP0017827B2/de not_active Expired
- 1980-03-27 DE DE8080101664T patent/DE3060255D1/de not_active Expired
- 1980-03-27 US US06/134,194 patent/US4294771A/en not_active Expired - Lifetime
- 1980-04-01 DK DK142280A patent/DK155879C/da not_active IP Right Cessation
- 1980-04-03 JP JP55042919A patent/JPS5812267B2/ja not_active Expired
- 1980-04-03 IE IE700/80A patent/IE49666B1/en unknown
- 1980-04-03 CA CA349,149A patent/CA1133937A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DK155879B (da) | 1989-05-29 |
| NO800874L (no) | 1980-10-06 |
| FI70700C (fi) | 1986-10-06 |
| DE2913592C2 (de) | 1988-11-10 |
| DE3060255D1 (en) | 1982-05-06 |
| DK142280A (da) | 1980-10-05 |
| FI70700B (fi) | 1986-06-26 |
| AU533022B2 (en) | 1983-10-27 |
| EP0017827B1 (de) | 1982-03-31 |
| AU5681880A (en) | 1980-10-09 |
| FI800904A7 (fi) | 1980-10-05 |
| US4294771A (en) | 1981-10-13 |
| DK155879C (da) | 1989-10-16 |
| NZ193251A (en) | 1982-03-30 |
| GR67224B (https=) | 1981-06-25 |
| NO151011C (no) | 1985-01-30 |
| DE2913592B1 (de) | 1980-10-30 |
| ATE795T1 (de) | 1982-04-15 |
| IE800700L (en) | 1980-10-04 |
| EP0017827A1 (de) | 1980-10-29 |
| ZA801797B (en) | 1981-03-25 |
| JPS55136244A (en) | 1980-10-23 |
| DE2913592A1 (de) | 1980-10-30 |
| PH14123A (en) | 1981-02-26 |
| JPS5812267B2 (ja) | 1983-03-07 |
| EP0017827B2 (de) | 1988-12-07 |
| NO151011B (no) | 1984-10-15 |
| IE49666B1 (en) | 1985-11-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1133937A (en) | Method for the production of metal soaps | |
| US3687640A (en) | Agglomerating alkali metal silicate by tumbling and rolling while heating and cooling | |
| US3803188A (en) | Manufacture of metallic soaps | |
| JPS58127798A (ja) | 洗剤の製造法 | |
| US3837843A (en) | Process for thermal production of magnesium | |
| US3782906A (en) | Process for preparation of agglomerated hydrated alkali metal silicate glass particles | |
| US3918921A (en) | Process for making granular hydrated alkali metal silicate | |
| US3441511A (en) | Alkali metal hydroxide-containing agglomerates | |
| US5094827A (en) | High active oxygen content granulated sodium perborate product and method of making the same | |
| US4459272A (en) | Dry carbonation process | |
| US2580931A (en) | Production of sebacic acid | |
| US1988991A (en) | Manufacture of solid products containing alkali hypochlorite | |
| US3271317A (en) | Silicated sodium hydroxide | |
| US2804432A (en) | Process of making particles of caustic soda and caustic potash impregnated with gluconic acid | |
| US4857287A (en) | Fast-dissolving, non-caking, food grade sodium tripolyphosphate | |
| US2277827A (en) | Process of dehydrating magnesium chloride | |
| US2161515A (en) | Manufacture of alkali metasilicates and alkali metasilicate-containing compositions | |
| US2854420A (en) | Treating tall oil soap and product obtained thereby | |
| US2153872A (en) | Method of making alkali metal silicates | |
| US2304133A (en) | Production of anhydrous aluminum sulphate | |
| US2491160A (en) | Production of dichlorodiphenyltrichloroethane | |
| CN100387512C (zh) | 一种干法制备过碳酸钠的方法 | |
| US2861868A (en) | Method of producing substantially white, globular sodium bisulfate | |
| US4997634A (en) | Preparation of medium density, fast-dissolving, tetrasodium pyrophosphate | |
| US2403157A (en) | Manufacture of zincated alkalies |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |