CA1111413A - PROCESS FOR THE PREPARATION OF A [D-.alpha.-AMIDO-(P- HYDROXYPHENYL)-ACETAMIDO] GROUP CONTAINING PENICILLANIC ACID AND CEPHALOSPORANIC ACID DERIVATIVES - Google Patents
PROCESS FOR THE PREPARATION OF A [D-.alpha.-AMIDO-(P- HYDROXYPHENYL)-ACETAMIDO] GROUP CONTAINING PENICILLANIC ACID AND CEPHALOSPORANIC ACID DERIVATIVESInfo
- Publication number
- CA1111413A CA1111413A CA310,665A CA310665A CA1111413A CA 1111413 A CA1111413 A CA 1111413A CA 310665 A CA310665 A CA 310665A CA 1111413 A CA1111413 A CA 1111413A
- Authority
- CA
- Canada
- Prior art keywords
- compound
- amino
- methyl
- formula
- group
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims abstract description 73
- 230000008569 process Effects 0.000 title claims abstract description 60
- 238000002360 preparation method Methods 0.000 title claims abstract description 56
- YGBFLZPYDUKSPT-MRVPVSSYSA-N cephalosporanic acid Chemical class S1CC(COC(=O)C)=C(C(O)=O)N2C(=O)C[C@H]21 YGBFLZPYDUKSPT-MRVPVSSYSA-N 0.000 title claims abstract description 15
- RBKMMJSQKNKNEV-RITPCOANSA-N penicillanic acid Chemical compound OC(=O)[C@H]1C(C)(C)S[C@@H]2CC(=O)N21 RBKMMJSQKNKNEV-RITPCOANSA-N 0.000 title claims abstract description 9
- 241000965481 Darksidea alpha Species 0.000 title claims abstract 12
- NGHVIOIJCVXTGV-ALEPSDHESA-N 6-aminopenicillanic acid Chemical compound [O-]C(=O)[C@H]1C(C)(C)S[C@@H]2[C@H]([NH3+])C(=O)N21 NGHVIOIJCVXTGV-ALEPSDHESA-N 0.000 claims abstract description 45
- NGHVIOIJCVXTGV-UHFFFAOYSA-N 6beta-amino-penicillanic acid Natural products OC(=O)C1C(C)(C)SC2C(N)C(=O)N21 NGHVIOIJCVXTGV-UHFFFAOYSA-N 0.000 claims abstract description 43
- 238000005917 acylation reaction Methods 0.000 claims abstract description 17
- 230000010933 acylation Effects 0.000 claims abstract description 16
- 239000003795 chemical substances by application Substances 0.000 claims abstract description 10
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 claims description 109
- 239000000203 mixture Substances 0.000 claims description 50
- IJOOHPMOJXWVHK-UHFFFAOYSA-N chlorotrimethylsilane Chemical compound C[Si](C)(C)Cl IJOOHPMOJXWVHK-UHFFFAOYSA-N 0.000 claims description 44
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 43
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical group CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 claims description 39
- 150000001875 compounds Chemical class 0.000 claims description 38
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 34
- LSQZJLSUYDQPKJ-NJBDSQKTSA-N amoxicillin Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@H]3SC([C@@H](N3C2=O)C(O)=O)(C)C)=CC=C(O)C=C1 LSQZJLSUYDQPKJ-NJBDSQKTSA-N 0.000 claims description 33
- 239000000243 solution Substances 0.000 claims description 33
- 239000011541 reaction mixture Substances 0.000 claims description 32
- 238000006243 chemical reaction Methods 0.000 claims description 31
- 239000005051 trimethylchlorosilane Substances 0.000 claims description 21
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical group CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 claims description 20
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 19
- 229910052700 potassium Inorganic materials 0.000 claims description 19
- 239000011591 potassium Substances 0.000 claims description 19
- 239000002904 solvent Substances 0.000 claims description 19
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 claims description 18
- 229960003022 amoxicillin Drugs 0.000 claims description 18
- NBFNMSULHIODTC-CYJZLJNKSA-N cefadroxil monohydrate Chemical compound O.C1([C@@H](N)C(=O)N[C@H]2[C@@H]3N(C2=O)C(=C(CS3)C)C(O)=O)=CC=C(O)C=C1 NBFNMSULHIODTC-CYJZLJNKSA-N 0.000 claims description 18
- LSQZJLSUYDQPKJ-UHFFFAOYSA-N p-Hydroxyampicillin Natural products O=C1N2C(C(O)=O)C(C)(C)SC2C1NC(=O)C(N)C1=CC=C(O)C=C1 LSQZJLSUYDQPKJ-UHFFFAOYSA-N 0.000 claims description 18
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 claims description 17
- 239000012453 solvate Substances 0.000 claims description 16
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical group N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 15
- HSHGZXNAXBPPDL-HZGVNTEJSA-N 7beta-aminocephalosporanic acid Chemical compound S1CC(COC(=O)C)=C(C([O-])=O)N2C(=O)[C@@H]([NH3+])[C@@H]12 HSHGZXNAXBPPDL-HZGVNTEJSA-N 0.000 claims description 14
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 claims description 14
- 239000000376 reactant Substances 0.000 claims description 13
- ACXMTAJLYQCRGF-PBFPGSCMSA-N cefatrizine Chemical compound S([C@@H]1[C@@H](C(N1C=1C(O)=O)=O)NC(=O)[C@H](N)C=2C=CC(O)=CC=2)CC=1CSC1=CN=N[N]1 ACXMTAJLYQCRGF-PBFPGSCMSA-N 0.000 claims description 12
- 229960002420 cefatrizine Drugs 0.000 claims description 12
- 239000006184 cosolvent Substances 0.000 claims description 12
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 12
- 125000000217 alkyl group Chemical group 0.000 claims description 11
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 claims description 10
- 239000013078 crystal Substances 0.000 claims description 10
- 239000003960 organic solvent Substances 0.000 claims description 10
- AVQQQNCBBIEMEU-UHFFFAOYSA-N 1,1,3,3-tetramethylurea Chemical compound CN(C)C(=O)N(C)C AVQQQNCBBIEMEU-UHFFFAOYSA-N 0.000 claims description 9
- 229960004841 cefadroxil Drugs 0.000 claims description 9
- 229960001065 cefadroxil monohydrate Drugs 0.000 claims description 9
- 230000004048 modification Effects 0.000 claims description 9
- 238000012986 modification Methods 0.000 claims description 9
- 229910052757 nitrogen Chemical group 0.000 claims description 9
- 239000012452 mother liquor Substances 0.000 claims description 8
- 150000003512 tertiary amines Chemical class 0.000 claims description 8
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 claims description 6
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 6
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 claims description 6
- 229940113088 dimethylacetamide Drugs 0.000 claims description 6
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 claims description 6
- QMWWAEFYIXXXQW-UHFFFAOYSA-M potassium;2-[(4-ethoxy-4-oxobut-2-en-2-yl)amino]-2-phenylacetate Chemical compound [K+].CCOC(=O)C=C(C)NC(C([O-])=O)C1=CC=CC=C1 QMWWAEFYIXXXQW-UHFFFAOYSA-M 0.000 claims description 6
- 239000002244 precipitate Substances 0.000 claims description 6
- 229910052708 sodium Inorganic materials 0.000 claims description 6
- 239000011734 sodium Substances 0.000 claims description 6
- 239000003054 catalyst Substances 0.000 claims description 5
- 239000001257 hydrogen Substances 0.000 claims description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 5
- 238000002156 mixing Methods 0.000 claims description 5
- 238000000746 purification Methods 0.000 claims description 5
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 claims description 5
- 239000003799 water insoluble solvent Substances 0.000 claims description 5
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- 239000007864 aqueous solution Substances 0.000 claims description 3
- XXBDWLFCJWSEKW-UHFFFAOYSA-N dimethylbenzylamine Chemical compound CN(C)CC1=CC=CC=C1 XXBDWLFCJWSEKW-UHFFFAOYSA-N 0.000 claims description 3
- 125000000623 heterocyclic group Chemical group 0.000 claims description 3
- 150000007522 mineralic acids Chemical class 0.000 claims description 3
- WHQSYGRFZMUQGQ-UHFFFAOYSA-N n,n-dimethylformamide;hydrate Chemical compound O.CN(C)C=O WHQSYGRFZMUQGQ-UHFFFAOYSA-N 0.000 claims description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 claims description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 2
- 239000005864 Sulphur Chemical group 0.000 claims description 2
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 2
- 125000005842 heteroatom Chemical group 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 claims description 2
- NVIAYEIXYQCDAN-CLZZGJSISA-N 7beta-aminodeacetoxycephalosporanic acid Chemical compound S1CC(C)=C(C(O)=O)N2C(=O)[C@@H](N)[C@@H]12 NVIAYEIXYQCDAN-CLZZGJSISA-N 0.000 claims 3
- 239000012970 tertiary amine catalyst Substances 0.000 claims 2
- -1 7-ACA compound Chemical class 0.000 abstract description 17
- WRUZLCLJULHLEY-UHFFFAOYSA-N N-(p-hydroxyphenyl)glycine Chemical compound OC(=O)CNC1=CC=C(O)C=C1 WRUZLCLJULHLEY-UHFFFAOYSA-N 0.000 abstract 1
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 63
- 229940073584 methylene chloride Drugs 0.000 description 28
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 27
- 150000008064 anhydrides Chemical class 0.000 description 27
- 239000010410 layer Substances 0.000 description 25
- 229940086542 triethylamine Drugs 0.000 description 21
- 238000003756 stirring Methods 0.000 description 20
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 19
- 229940043265 methyl isobutyl ketone Drugs 0.000 description 19
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 18
- 238000001816 cooling Methods 0.000 description 18
- 239000002253 acid Substances 0.000 description 16
- 229960004920 amoxicillin trihydrate Drugs 0.000 description 15
- 238000006884 silylation reaction Methods 0.000 description 13
- 238000005406 washing Methods 0.000 description 13
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 12
- 239000000047 product Substances 0.000 description 12
- XMJHPCRAQCTCFT-UHFFFAOYSA-N methyl chloroformate Chemical compound COC(Cl)=O XMJHPCRAQCTCFT-UHFFFAOYSA-N 0.000 description 11
- 150000003839 salts Chemical class 0.000 description 10
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 9
- NBTOZLQBSIZIKS-UHFFFAOYSA-N methoxide Chemical compound [O-]C NBTOZLQBSIZIKS-UHFFFAOYSA-N 0.000 description 8
- NVIAYEIXYQCDAN-MHTLYPKNSA-N (6r,7s)-7-azaniumyl-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound S1CC(C)=C(C([O-])=O)N2C(=O)[C@H]([NH3+])[C@@H]12 NVIAYEIXYQCDAN-MHTLYPKNSA-N 0.000 description 7
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 7
- 229960005419 nitrogen Drugs 0.000 description 7
- 238000001228 spectrum Methods 0.000 description 7
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 6
- 238000002425 crystallisation Methods 0.000 description 6
- 230000003287 optical effect Effects 0.000 description 6
- 238000011084 recovery Methods 0.000 description 6
- 239000000725 suspension Substances 0.000 description 6
- LJCWONGJFPCTTL-UHFFFAOYSA-N 4-hydroxyphenylglycine Chemical compound OC(=O)C(N)C1=CC=C(O)C=C1 LJCWONGJFPCTTL-UHFFFAOYSA-N 0.000 description 5
- 239000012153 distilled water Substances 0.000 description 5
- FFUAGWLWBBFQJT-UHFFFAOYSA-N hexamethyldisilazane Chemical compound C[Si](C)(C)N[Si](C)(C)C FFUAGWLWBBFQJT-UHFFFAOYSA-N 0.000 description 5
- 239000012299 nitrogen atmosphere Substances 0.000 description 5
- 238000007086 side reaction Methods 0.000 description 5
- MLOZJRLUNNFSGD-IOJJLOCKSA-N (6r)-7-amino-8-oxo-3-(2h-triazol-4-ylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S([C@@H]1C(C(N1C=1C(O)=O)=O)N)CC=1CSC=1C=NNN=1 MLOZJRLUNNFSGD-IOJJLOCKSA-N 0.000 description 4
- 239000012043 crude product Substances 0.000 description 4
- 238000000605 extraction Methods 0.000 description 4
- 238000005259 measurement Methods 0.000 description 4
- 238000010899 nucleation Methods 0.000 description 4
- 239000012044 organic layer Substances 0.000 description 4
- 238000000926 separation method Methods 0.000 description 4
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 3
- 229930182555 Penicillin Natural products 0.000 description 3
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 230000008025 crystallization Effects 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- 239000011521 glass Substances 0.000 description 3
- 230000007062 hydrolysis Effects 0.000 description 3
- 238000006460 hydrolysis reaction Methods 0.000 description 3
- 239000012535 impurity Substances 0.000 description 3
- 238000011065 in-situ storage Methods 0.000 description 3
- 231100000252 nontoxic Toxicity 0.000 description 3
- 230000003000 nontoxic effect Effects 0.000 description 3
- 150000003377 silicon compounds Chemical class 0.000 description 3
- 238000003786 synthesis reaction Methods 0.000 description 3
- MRFJAULKKHVIGF-OGFXRTJISA-N (2r)-2-amino-2-(4-hydroxyphenyl)acetyl chloride;hydrochloride Chemical compound Cl.ClC(=O)[C@H](N)C1=CC=C(O)C=C1 MRFJAULKKHVIGF-OGFXRTJISA-N 0.000 description 2
- NVIAYEIXYQCDAN-HWZXHQHMSA-N (6r)-7-amino-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1CC(C)=C(C(O)=O)N2C(=O)C(N)[C@@H]12 NVIAYEIXYQCDAN-HWZXHQHMSA-N 0.000 description 2
- MASDFXZJIDNRTR-UHFFFAOYSA-N 1,3-bis(trimethylsilyl)urea Chemical compound C[Si](C)(C)NC(=O)N[Si](C)(C)C MASDFXZJIDNRTR-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 150000001413 amino acids Chemical class 0.000 description 2
- 239000012298 atmosphere Substances 0.000 description 2
- SIOVKLKJSOKLIF-UHFFFAOYSA-N bis(trimethylsilyl)acetamide Chemical compound C[Si](C)(C)OC(C)=N[Si](C)(C)C SIOVKLKJSOKLIF-UHFFFAOYSA-N 0.000 description 2
- FZFAMSAMCHXGEF-UHFFFAOYSA-N chloro formate Chemical compound ClOC=O FZFAMSAMCHXGEF-UHFFFAOYSA-N 0.000 description 2
- 230000008878 coupling Effects 0.000 description 2
- 238000010168 coupling process Methods 0.000 description 2
- 238000005859 coupling reaction Methods 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 230000036541 health Effects 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 150000004682 monohydrates Chemical class 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- 125000001506 1,2,3-triazol-5-yl group Chemical group [H]N1N=NC([H])=C1[*] 0.000 description 1
- JVSFQJZRHXAUGT-UHFFFAOYSA-N 2,2-dimethylpropanoyl chloride Chemical compound CC(C)(C)C(Cl)=O JVSFQJZRHXAUGT-UHFFFAOYSA-N 0.000 description 1
- YLHCHEBQIHXSIW-UHFFFAOYSA-N 2-amino-2-(4-hydroxyphenyl)acetyl chloride Chemical compound ClC(=O)C(N)C1=CC=C(O)C=C1 YLHCHEBQIHXSIW-UHFFFAOYSA-N 0.000 description 1
- MEAZEHJUPLREOQ-UHFFFAOYSA-N 2-amino-2-phenylacetyl chloride Chemical compound ClC(=O)C(N)C1=CC=CC=C1 MEAZEHJUPLREOQ-UHFFFAOYSA-N 0.000 description 1
- FVMDYYGIDFPZAX-UHFFFAOYSA-N 3-hydroxyphenylacetic acid Chemical compound OC(=O)CC1=CC=CC(O)=C1 FVMDYYGIDFPZAX-UHFFFAOYSA-N 0.000 description 1
- NVIAYEIXYQCDAN-UHFFFAOYSA-N 7-amino-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1CC(C)=C(C(O)=O)N2C(=O)C(N)C12 NVIAYEIXYQCDAN-UHFFFAOYSA-N 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 240000004178 Anthoxanthum odoratum Species 0.000 description 1
- 229930186147 Cephalosporin Natural products 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- LJCWONGJFPCTTL-SSDOTTSWSA-N D-4-hydroxyphenylglycine Chemical class [O-]C(=O)[C@H]([NH3+])C1=CC=C(O)C=C1 LJCWONGJFPCTTL-SSDOTTSWSA-N 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 229910021607 Silver chloride Inorganic materials 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- IPBVNPXQWQGGJP-UHFFFAOYSA-N acetic acid phenyl ester Natural products CC(=O)OC1=CC=CC=C1 IPBVNPXQWQGGJP-UHFFFAOYSA-N 0.000 description 1
- XMMFBEWONDCTLD-UHFFFAOYSA-N acetyl(dimethyl)azanium;chloride Chemical compound Cl.CN(C)C(C)=O XMMFBEWONDCTLD-UHFFFAOYSA-N 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 125000005103 alkyl silyl group Chemical group 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- AVKUERGKIZMTKX-NJBDSQKTSA-N ampicillin Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@H]3SC([C@@H](N3C2=O)C(O)=O)(C)C)=CC=CC=C1 AVKUERGKIZMTKX-NJBDSQKTSA-N 0.000 description 1
- 229960000723 ampicillin Drugs 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- 238000004364 calculation method Methods 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 229940124587 cephalosporin Drugs 0.000 description 1
- 150000001780 cephalosporins Chemical class 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 229960001701 chloroform Drugs 0.000 description 1
- 230000000332 continued effect Effects 0.000 description 1
- 235000019628 coolness Nutrition 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- IPZJQDSFZGZEOY-UHFFFAOYSA-N dimethylmethylene Chemical compound C[C]C IPZJQDSFZGZEOY-UHFFFAOYSA-N 0.000 description 1
- 238000007323 disproportionation reaction Methods 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 230000002255 enzymatic effect Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- BDAGIHXWWSANSR-UHFFFAOYSA-N formic acid Substances OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 1
- BDAGIHXWWSANSR-PFUFQJKNSA-N formic acid-d2 Chemical compound [2H]OC([2H])=O BDAGIHXWWSANSR-PFUFQJKNSA-N 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229910001385 heavy metal Inorganic materials 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 238000013383 initial experiment Methods 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000012009 microbiological test Methods 0.000 description 1
- 239000002808 molecular sieve Substances 0.000 description 1
- LWFWUJCJKPUZLV-UHFFFAOYSA-N n-trimethylsilylacetamide Chemical compound CC(=O)N[Si](C)(C)C LWFWUJCJKPUZLV-UHFFFAOYSA-N 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 150000001282 organosilanes Chemical class 0.000 description 1
- 150000002960 penicillins Chemical class 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 229940049953 phenylacetate Drugs 0.000 description 1
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical compound OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 1
- 150000005331 phenylglycines Chemical class 0.000 description 1
- 150000003017 phosphorus Chemical class 0.000 description 1
- 150000003018 phosphorus compounds Chemical class 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- 229920000136 polysorbate Polymers 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 235000015320 potassium carbonate Nutrition 0.000 description 1
- 230000000063 preceeding effect Effects 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- OVARTBFNCCXQKS-UHFFFAOYSA-N propan-2-one;hydrate Chemical compound O.CC(C)=O OVARTBFNCCXQKS-UHFFFAOYSA-N 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000004064 recycling Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 238000012827 research and development Methods 0.000 description 1
- HKZLPVFGJNLROG-UHFFFAOYSA-M silver monochloride Chemical compound [Cl-].[Ag+] HKZLPVFGJNLROG-UHFFFAOYSA-M 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 1
- HHGMADGROXARPN-UHFFFAOYSA-M sodium;2h-triazole-4-thiolate Chemical compound [Na+].[S-]C=1C=NNN=1 HHGMADGROXARPN-UHFFFAOYSA-M 0.000 description 1
- 230000002269 spontaneous effect Effects 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 239000001117 sulphuric acid Substances 0.000 description 1
- 235000011149 sulphuric acid Nutrition 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- 125000004055 thiomethyl group Chemical group [H]SC([H])([H])* 0.000 description 1
- 238000004448 titration Methods 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Cephalosporin Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL7709812.A NL162387C (nl) | 1977-09-06 | 1977-09-06 | Werkwijze voor het bereiden van 6-(d-alpha-amino-p- -hydroxyfenylacetamido)penicillanzuur. |
| NL7709812 | 1977-09-06 | ||
| EP78200140.8 | 1978-08-11 | ||
| EP78200140A EP0001133B1 (en) | 1977-09-06 | 1978-08-11 | Process for the preparation of 6- d-alpha-amino-(p-hydroxyphenyl)-acetamido penicillanic acid |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1111413A true CA1111413A (en) | 1981-10-27 |
Family
ID=19829143
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA310,665A Expired CA1111413A (en) | 1977-09-06 | 1978-09-05 | PROCESS FOR THE PREPARATION OF A [D-.alpha.-AMIDO-(P- HYDROXYPHENYL)-ACETAMIDO] GROUP CONTAINING PENICILLANIC ACID AND CEPHALOSPORANIC ACID DERIVATIVES |
Country Status (12)
| Country | Link |
|---|---|
| US (2) | US4128547A (enExample) |
| EP (2) | EP0019345B1 (enExample) |
| JP (1) | JPS5495590A (enExample) |
| CA (1) | CA1111413A (enExample) |
| DE (2) | DE2861547D1 (enExample) |
| DK (1) | DK151024C (enExample) |
| FI (1) | FI70714C (enExample) |
| IE (1) | IE48466B1 (enExample) |
| IT (1) | IT1160632B (enExample) |
| NL (1) | NL162387C (enExample) |
| NO (2) | NO160209C (enExample) |
| PT (1) | PT68511A (enExample) |
Families Citing this family (28)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1532682A (en) * | 1976-04-27 | 1978-11-22 | Bristol Myers Co | Process for the preparation of cephadroxil |
| ES459494A1 (es) * | 1977-06-04 | 1978-05-01 | Palomo Coll A Luis | Procedimiento de preparacion de hidrox-alfa-aminobencilpeni-cilina. |
| US4240960A (en) * | 1979-03-19 | 1980-12-23 | Bristol-Myers Company | Trimethylsilyl substituted penicillins |
| US4278600A (en) * | 1979-03-19 | 1981-07-14 | Bristol-Myers Company | Production of penicillins |
| US4310458A (en) * | 1979-03-19 | 1982-01-12 | Bristol-Myers Company | Production of penicillins |
| US4231954A (en) * | 1979-04-20 | 1980-11-04 | American Home Products Corporation | Dane salt and process for preparing aminopenicillins therefrom |
| US4301072A (en) * | 1979-04-20 | 1981-11-17 | American Home Products Corporation | Process for preparing aminopenicillins |
| CH654010A5 (de) * | 1979-05-25 | 1986-01-31 | Glaxo Group Ltd | Zwischenprodukte zur verwendung bei der herstellung von cephalosporin-antibiotika. |
| US4351766A (en) * | 1979-07-12 | 1982-09-28 | Bristol-Myers Company | Production of penicillins |
| IT1126544B (it) * | 1979-12-07 | 1986-05-21 | Dobfar Spa | Procedimento per la preparazione di derivati dell'acido 7-amino-desacetossi cefalosporanico |
| NL7908867A (nl) * | 1979-12-10 | 1981-07-01 | Gist Brocades Nv | Werkwijze voor het bereiden van 6-aminopenicillaanzuur- -1,1-dioxide en zijn zouten. |
| US4366098A (en) * | 1980-11-26 | 1982-12-28 | American Home Products Corporation | Process for preparing aminopenicillins |
| HU221200B1 (en) * | 1990-01-22 | 2002-08-28 | Biochemie Gmbh | Process for producing beta-lactames |
| AT396238B (de) * | 1991-05-17 | 1993-07-26 | Biochemie Gmbh | Neues verfahren und zwischenprodukte zur herstellung von 3-vinylcephalosporinverbindungen |
| AT395854B (de) * | 1991-05-24 | 1993-03-25 | Biochemie Gmbh | Neues verfahren zur herstellung von 7-amino-3azidomethyl-3-cephem-4-carbonsaeure und deren derivate |
| GB9115203D0 (en) * | 1991-07-15 | 1991-08-28 | Biochemie Gmbh | Improvements in or relating to beta lactam production |
| AT396108B (de) * | 1991-08-21 | 1993-06-25 | Biochemie Gmbh | Neues verfahren und neue zwischenprodukte zur herstellung von 7-aminocephalosporansaeurederivaten |
| ES2050621B1 (es) * | 1992-11-06 | 1994-12-16 | Antibioticos Sa | Un procedimiento mejorado para la preparacion de 6-*-aminopenicilinas. |
| GB9423459D0 (en) * | 1994-11-21 | 1995-01-11 | Biochemie Gmbh | Silylation process |
| KR100389644B1 (ko) * | 2001-02-26 | 2003-06-27 | 한미약품 주식회사 | 4-히드록시페닐글리신 무수물 및 이의 제조방법 |
| US20040077849A1 (en) * | 2002-10-16 | 2004-04-22 | Orchid Chemicals & Pharmaceuticals Limited | Process for the preparation of cefadroxil |
| US7230097B2 (en) * | 2003-03-10 | 2007-06-12 | Lupin Ltd. | Process for preparation of 7-[α-Amino (4-hydroxyphenyl) acetamido]-3-substituted-3-cephem-4-carboxylic acid |
| CN101772509B (zh) * | 2007-07-30 | 2013-12-04 | 中化帝斯曼制药有限公司荷兰公司 | 用于β-内酰胺化合物的硅烷基化的方法 |
| SI2176270T1 (sl) * | 2007-07-30 | 2019-11-29 | Centrient Pharmaceuticals Netherlands B V | Sestavki, ki vsebujejo spojine beta laktama |
| EP2614066B1 (en) * | 2010-09-07 | 2017-11-29 | DSM Sinochem Pharmaceuticals Netherlands B.V. | Process for the production of cephalosporins |
| CN103360412B (zh) * | 2013-06-08 | 2015-08-19 | 苏州中联化学制药有限公司 | 一种头孢羟氨苄的合成方法 |
| CN103772414B (zh) * | 2013-12-31 | 2016-03-09 | 福建省福抗药业股份有限公司 | 一种制备丙二醇头孢曲嗪的制备方法 |
| CN107986991A (zh) * | 2017-12-18 | 2018-05-04 | 湖南国发精细化工科技有限公司 | N-氯甲酰基-n[(4-三氟甲氧基)苯基]氨基甲酸甲酯的合成方法 |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| SE311519B (enExample) * | 1962-12-14 | 1969-06-16 | Astra Ab | |
| JPS5318515B2 (enExample) * | 1971-12-17 | 1978-06-15 | ||
| ES401263A1 (es) * | 1972-03-28 | 1975-02-16 | Beecham Group Ltd | Un procedimiento para la produccion de alfa - amino-(p-hi- droxibencil) penicilina. |
| CA1076560A (en) * | 1972-06-14 | 1980-04-29 | Smith Kline And French Canada Ltd. | 3-heterocyclic thiomethylcephalosporins |
| US3965098A (en) * | 1972-11-29 | 1976-06-22 | American Home Products Corporation | Intermediates for preparing cephalosporins and methods of production |
| KR780000197B1 (en) * | 1972-12-26 | 1978-05-26 | Bristol Myers Co | Method for preparing antibacterial agent |
| PL87745B1 (enExample) * | 1973-04-18 | 1976-07-31 | Politechnika Gdanska Danzig (Polen) | |
| YU36733B (en) * | 1973-10-26 | 1984-08-31 | Krka Novo Mesto | Process for preparing pure anhydrous 6-zd-(-)-alfa-aminophenylacetamidoc-penicillanic acid |
| US3912719A (en) * | 1974-01-28 | 1975-10-14 | Bristol Myers Co | Production of semisynthetic penicillins |
| NL7414083A (nl) * | 1974-05-17 | 1975-11-19 | Archifar Ind Chim Trentino | Werkwijze voor de bereiding van hydroxylgroe- pen-bevattende antibiotica. |
| US3946003A (en) * | 1974-08-20 | 1976-03-23 | Eli Lilly And Company | Hydroxy substituted phenylglycylamido-3-heterocyclic thiomethyl cephalosporins |
| US4148817A (en) * | 1976-03-25 | 1979-04-10 | Eli Lilly And Company | Process and intermediates for preparing cephalosporin antibiotics |
-
1977
- 1977-09-06 NL NL7709812.A patent/NL162387C/xx not_active IP Right Cessation
- 1977-11-25 US US05/854,821 patent/US4128547A/en not_active Expired - Lifetime
-
1978
- 1978-08-11 DE DE7878200140T patent/DE2861547D1/de not_active Expired
- 1978-08-11 EP EP80200702A patent/EP0019345B1/en not_active Expired
- 1978-08-11 EP EP78200140A patent/EP0001133B1/en not_active Expired
- 1978-08-11 DE DE8080200702T patent/DE2862468D1/de not_active Expired
- 1978-09-05 IT IT69044/78A patent/IT1160632B/it active
- 1978-09-05 PT PT68511A patent/PT68511A/pt unknown
- 1978-09-05 JP JP10903078A patent/JPS5495590A/ja active Granted
- 1978-09-05 DK DK391478A patent/DK151024C/da not_active IP Right Cessation
- 1978-09-05 CA CA310,665A patent/CA1111413A/en not_active Expired
- 1978-09-05 FI FI782719A patent/FI70714C/fi not_active IP Right Cessation
- 1978-09-05 NO NO783025A patent/NO160209C/no unknown
- 1978-09-06 IE IE1802/78A patent/IE48466B1/en not_active IP Right Cessation
-
1980
- 1980-10-03 US US06/193,801 patent/US4358588A/en not_active Expired - Lifetime
-
1985
- 1985-10-24 NO NO85854260A patent/NO161495C/no unknown
Also Published As
| Publication number | Publication date |
|---|---|
| NO783025L (no) | 1979-03-07 |
| FI782719A7 (fi) | 1979-03-07 |
| DE2861547D1 (en) | 1982-03-04 |
| DK151024C (da) | 1988-02-29 |
| DK391478A (da) | 1979-03-07 |
| JPS6354717B2 (enExample) | 1988-10-28 |
| EP0001133A1 (en) | 1979-03-21 |
| EP0001133B1 (en) | 1982-01-20 |
| EP0019345A1 (en) | 1980-11-26 |
| IE48466B1 (en) | 1985-02-06 |
| NL162387C (nl) | 1980-05-16 |
| IT7869044A0 (it) | 1978-09-05 |
| IE781802L (en) | 1979-03-06 |
| NL162387B (nl) | 1979-12-17 |
| NL7709812A (nl) | 1979-03-08 |
| DE2862468D1 (en) | 1985-07-25 |
| NO160209B (no) | 1988-12-12 |
| NO160209C (no) | 1989-03-22 |
| IT1160632B (it) | 1987-03-11 |
| NO854260L (no) | 1979-03-07 |
| US4128547A (en) | 1978-12-05 |
| NO161495C (no) | 1989-08-23 |
| PT68511A (en) | 1978-10-01 |
| US4358588A (en) | 1982-11-09 |
| JPS5495590A (en) | 1979-07-28 |
| EP0019345B1 (en) | 1985-06-19 |
| FI70714B (fi) | 1986-06-26 |
| NO161495B (no) | 1989-05-16 |
| DK151024B (da) | 1987-10-12 |
| FI70714C (fi) | 1986-10-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1111413A (en) | PROCESS FOR THE PREPARATION OF A [D-.alpha.-AMIDO-(P- HYDROXYPHENYL)-ACETAMIDO] GROUP CONTAINING PENICILLANIC ACID AND CEPHALOSPORANIC ACID DERIVATIVES | |
| KR100789156B1 (ko) | 세팔로스포린 중간체 | |
| EP0175814B1 (en) | Process for preparing cephem derivatives | |
| CA1052769A (en) | Process for preparing cefazolin | |
| JP2609039B2 (ja) | セフトリアキソンの新規製造法 | |
| US5608055A (en) | Beta lactam production | |
| US5034522A (en) | Method for the production of 3-methyl cephem derivatives | |
| RO109652B1 (ro) | Procedeu pentru prepararea unui antibiotic cefepim dihidroclorura hidrat | |
| HU212782B (en) | Water-free acylating process for stereospecifical producing antibioticum cephepim-dihydrochloride-hydrate | |
| US4118563A (en) | Production of 7-(2-aminomethylphenylacetamido-3-(1-carboxymethyltetrazol-5-ylthiomethyl)-3-cephem-4-carboxylic acid | |
| HU180687B (en) | Process for preparing 7-acyl-amido-ceph-3-eme-4-carboxylic acid derivatives | |
| EP0034394A2 (en) | Process for the preparation of 3'-bromosubstituted deacetoxycephalosporanic acid sulphoxide derivatives | |
| US4237280A (en) | Intermediate for cephalosporin type compound | |
| EP0003329B1 (en) | Cephalexin-amide complex, process for its production and use in cephalexin-monohydrate production | |
| US4376200A (en) | Heterocyclic thiomethylation of the 3-position of 7-aminocephalosporanic acids | |
| US4310460A (en) | Process for the production of 6-D-α-amino-p-hydroxyphenylacetamido penicillanic acid | |
| US4231954A (en) | Dane salt and process for preparing aminopenicillins therefrom | |
| US4301072A (en) | Process for preparing aminopenicillins | |
| US4433142A (en) | Process for the preparation of 7-(2-amino-2-phenylacetamido) cephem derivatives | |
| CA1161429A (en) | 2-(2-aminothiazol-4-yl)-n-(imidazolidin-2-on-1-yl)-2- imino-acetylaminocephalosporanic acids in pure syn- form, a process for their production and syn-acid used in such a process | |
| CA1095025A (en) | Process for preparing 2-acyloxymethylpenams and 3- acyloxy-cephams | |
| JPS6019914B2 (ja) | セファロスポラン酸化合物の製造方法 | |
| JPS6183188A (ja) | ペニシリンの製造法 | |
| IE50135B1 (en) | Process for the preparation of a(d-a-amino-(p-hydroxyphenyl)-acetamido)cephalosporanic acid derivatives | |
| Palomo-coll et al. | Efficient procedure for c'-3 substitution and c-7 n-acylation of 7-aminocepha-losporanic acid (7-aca): Synthesis of cefazolin antibiotic and related compounds |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry | ||
| MKEX | Expiry |
Effective date: 19981027 |