CA1105465A - 4-aminomethyl-1-(3,3,3-triarylpropyl)-4- arylpiperidine and related compounds - Google Patents
4-aminomethyl-1-(3,3,3-triarylpropyl)-4- arylpiperidine and related compoundsInfo
- Publication number
- CA1105465A CA1105465A CA302,344A CA302344A CA1105465A CA 1105465 A CA1105465 A CA 1105465A CA 302344 A CA302344 A CA 302344A CA 1105465 A CA1105465 A CA 1105465A
- Authority
- CA
- Canada
- Prior art keywords
- phenyl
- carbon atoms
- alkyl
- compound
- formula
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 150000001875 compounds Chemical class 0.000 title claims abstract description 73
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 42
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 40
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 22
- 239000002253 acid Substances 0.000 claims abstract description 21
- 125000005037 alkyl phenyl group Chemical group 0.000 claims abstract description 21
- 125000005059 halophenyl group Chemical group 0.000 claims abstract description 20
- 231100000252 nontoxic Toxicity 0.000 claims abstract description 20
- 230000003000 nontoxic effect Effects 0.000 claims abstract description 20
- 150000003839 salts Chemical class 0.000 claims abstract description 19
- 239000001257 hydrogen Substances 0.000 claims abstract description 14
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 14
- 125000004076 pyridyl group Chemical group 0.000 claims abstract description 13
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 11
- 125000001589 carboacyl group Chemical group 0.000 claims abstract description 6
- -1 lithium aluminum hydride Chemical compound 0.000 claims description 41
- 238000000034 method Methods 0.000 claims description 28
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 claims description 15
- 230000008569 process Effects 0.000 claims description 15
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 claims description 10
- WOLJJNNYUMTHCL-UHFFFAOYSA-N [4-phenyl-1-(3,3,3-triphenylpropyl)piperidin-4-yl]methanamine Chemical compound C1CC(CN)(C=2C=CC=CC=2)CCN1CCC(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 WOLJJNNYUMTHCL-UHFFFAOYSA-N 0.000 claims description 7
- 150000001263 acyl chlorides Chemical class 0.000 claims description 7
- 239000003638 chemical reducing agent Substances 0.000 claims description 7
- 239000012280 lithium aluminium hydride Substances 0.000 claims description 7
- 238000002360 preparation method Methods 0.000 claims description 7
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 claims description 6
- 230000010933 acylation Effects 0.000 claims description 6
- 238000005917 acylation reaction Methods 0.000 claims description 6
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 claims description 6
- 150000008065 acid anhydrides Chemical class 0.000 claims description 5
- 239000003960 organic solvent Substances 0.000 claims description 5
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 claims description 5
- 230000009467 reduction Effects 0.000 claims description 4
- GBHJFEYWPHVQNX-UHFFFAOYSA-N 4-phenyl-1-(3,3,3-triphenylpropanoyl)piperidine-4-carbonitrile Chemical compound C1CC(C=2C=CC=CC=2)(C#N)CCN1C(=O)CC(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 GBHJFEYWPHVQNX-UHFFFAOYSA-N 0.000 claims description 3
- 229910000027 potassium carbonate Inorganic materials 0.000 claims description 3
- 150000004678 hydrides Chemical class 0.000 claims description 2
- QJVBLRDJXFZHGB-UHFFFAOYSA-N n-[[4-phenyl-1-(3,3,3-triphenylpropyl)piperidin-4-yl]methyl]acetamide Chemical compound C1CC(CNC(=O)C)(C=2C=CC=CC=2)CCN1CCC(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 QJVBLRDJXFZHGB-UHFFFAOYSA-N 0.000 claims 2
- 101150047265 COR2 gene Proteins 0.000 claims 1
- 101100467189 Saccharomyces cerevisiae (strain ATCC 204508 / S288c) QCR2 gene Proteins 0.000 claims 1
- 230000000694 effects Effects 0.000 abstract description 5
- 229940125714 antidiarrheal agent Drugs 0.000 abstract 1
- 239000003793 antidiarrheal agent Substances 0.000 abstract 1
- 210000003169 central nervous system Anatomy 0.000 abstract 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 32
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 28
- 239000000203 mixture Substances 0.000 description 25
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 23
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 15
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 14
- 239000000243 solution Substances 0.000 description 13
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 13
- DLFVBJFMPXGRIB-UHFFFAOYSA-N thioacetamide Natural products CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 12
- 238000012360 testing method Methods 0.000 description 10
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 239000007983 Tris buffer Substances 0.000 description 8
- 239000004480 active ingredient Substances 0.000 description 8
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 8
- 239000008101 lactose Substances 0.000 description 7
- 235000002639 sodium chloride Nutrition 0.000 description 7
- 229920002261 Corn starch Polymers 0.000 description 6
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 6
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 6
- 239000001506 calcium phosphate Substances 0.000 description 6
- 239000008120 corn starch Substances 0.000 description 6
- 125000004482 piperidin-4-yl group Chemical group N1CCC(CC1)* 0.000 description 6
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 6
- 206010012735 Diarrhoea Diseases 0.000 description 5
- 241000699670 Mus sp. Species 0.000 description 5
- 241000700159 Rattus Species 0.000 description 5
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 5
- 239000004359 castor oil Substances 0.000 description 5
- 235000019438 castor oil Nutrition 0.000 description 5
- 235000019441 ethanol Nutrition 0.000 description 5
- ZEMPKEQAKRGZGQ-XOQCFJPHSA-N glycerol triricinoleate Natural products CCCCCC[C@@H](O)CC=CCCCCCCCC(=O)OC[C@@H](COC(=O)CCCCCCCC=CC[C@@H](O)CCCCCC)OC(=O)CCCCCCCC=CC[C@H](O)CCCCCC ZEMPKEQAKRGZGQ-XOQCFJPHSA-N 0.000 description 5
- 239000010410 layer Substances 0.000 description 5
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 5
- 239000003921 oil Substances 0.000 description 5
- 235000019198 oils Nutrition 0.000 description 5
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 5
- FSDNTQSJGHSJBG-UHFFFAOYSA-N piperidine-4-carbonitrile Chemical compound N#CC1CCNCC1 FSDNTQSJGHSJBG-UHFFFAOYSA-N 0.000 description 5
- 239000008159 sesame oil Substances 0.000 description 5
- 235000011803 sesame oil Nutrition 0.000 description 5
- 239000007787 solid Substances 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- 239000003826 tablet Substances 0.000 description 5
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 4
- 235000021355 Stearic acid Nutrition 0.000 description 4
- 230000001142 anti-diarrhea Effects 0.000 description 4
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical compound [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 4
- 239000002775 capsule Substances 0.000 description 4
- 239000003610 charcoal Substances 0.000 description 4
- 229940106265 charcoal Drugs 0.000 description 4
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 description 4
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 4
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 4
- 239000004615 ingredient Substances 0.000 description 4
- 235000019359 magnesium stearate Nutrition 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- 229920000609 methyl cellulose Polymers 0.000 description 4
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 4
- 239000012044 organic layer Substances 0.000 description 4
- 239000008194 pharmaceutical composition Substances 0.000 description 4
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 4
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 4
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 4
- 238000006467 substitution reaction Methods 0.000 description 4
- 239000000829 suppository Substances 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical class [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 4
- 108010010803 Gelatin Proteins 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- 241001465754 Metazoa Species 0.000 description 3
- 229920002472 Starch Polymers 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000003708 ampul Substances 0.000 description 3
- 229940110456 cocoa butter Drugs 0.000 description 3
- 235000019868 cocoa butter Nutrition 0.000 description 3
- 235000012343 cottonseed oil Nutrition 0.000 description 3
- 239000003937 drug carrier Substances 0.000 description 3
- 239000008273 gelatin Substances 0.000 description 3
- 229920000159 gelatin Polymers 0.000 description 3
- 235000019322 gelatine Nutrition 0.000 description 3
- 235000011852 gelatine desserts Nutrition 0.000 description 3
- 235000012054 meals Nutrition 0.000 description 3
- MZRVEZGGRBJDDB-UHFFFAOYSA-N n-Butyllithium Substances [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 3
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 3
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 229910052938 sodium sulfate Inorganic materials 0.000 description 3
- 235000011152 sodium sulphate Nutrition 0.000 description 3
- 235000019698 starch Nutrition 0.000 description 3
- 239000008117 stearic acid Substances 0.000 description 3
- 239000000454 talc Substances 0.000 description 3
- 229910052623 talc Inorganic materials 0.000 description 3
- LNAZSHAWQACDHT-XIYTZBAFSA-N (2r,3r,4s,5r,6s)-4,5-dimethoxy-2-(methoxymethyl)-3-[(2s,3r,4s,5r,6r)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6r)-4,5,6-trimethoxy-2-(methoxymethyl)oxan-3-yl]oxyoxane Chemical compound CO[C@@H]1[C@@H](OC)[C@H](OC)[C@@H](COC)O[C@H]1O[C@H]1[C@H](OC)[C@@H](OC)[C@H](O[C@H]2[C@@H]([C@@H](OC)[C@H](OC)O[C@@H]2COC)OC)O[C@@H]1COC LNAZSHAWQACDHT-XIYTZBAFSA-N 0.000 description 2
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 2
- 235000019739 Dicalciumphosphate Nutrition 0.000 description 2
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 2
- 239000001856 Ethyl cellulose Substances 0.000 description 2
- ZZSNKZQZMQGXPY-UHFFFAOYSA-N Ethyl cellulose Chemical compound CCOCC1OC(OC)C(OCC)C(OCC)C1OC1C(O)C(O)C(OC)C(CO)O1 ZZSNKZQZMQGXPY-UHFFFAOYSA-N 0.000 description 2
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- 241000699666 Mus <mouse, genus> Species 0.000 description 2
- 235000019483 Peanut oil Nutrition 0.000 description 2
- 239000004372 Polyvinyl alcohol Substances 0.000 description 2
- 229930006000 Sucrose Natural products 0.000 description 2
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 2
- 241000219161 Theobroma Species 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- CVQUNNXFAXJJFE-UHFFFAOYSA-N [4-phenyl-1-(3,3,3-triphenylpropyl)piperidin-4-yl]methanamine;hydrochloride Chemical compound Cl.C1CC(CN)(C=2C=CC=CC=2)CCN1CCC(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 CVQUNNXFAXJJFE-UHFFFAOYSA-N 0.000 description 2
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 230000000202 analgesic effect Effects 0.000 description 2
- 235000011010 calcium phosphates Nutrition 0.000 description 2
- 239000001768 carboxy methyl cellulose Substances 0.000 description 2
- 150000001244 carboxylic acid anhydrides Chemical class 0.000 description 2
- 125000002091 cationic group Chemical group 0.000 description 2
- 229920002678 cellulose Polymers 0.000 description 2
- 239000001913 cellulose Substances 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 125000000068 chlorophenyl group Chemical group 0.000 description 2
- 235000005687 corn oil Nutrition 0.000 description 2
- 239000002285 corn oil Substances 0.000 description 2
- 239000002385 cottonseed oil Substances 0.000 description 2
- NEFBYIFKOOEVPA-UHFFFAOYSA-K dicalcium phosphate Chemical compound [Ca+2].[Ca+2].[O-]P([O-])([O-])=O NEFBYIFKOOEVPA-UHFFFAOYSA-K 0.000 description 2
- 229910000390 dicalcium phosphate Inorganic materials 0.000 description 2
- 229940038472 dicalcium phosphate Drugs 0.000 description 2
- 229960004192 diphenoxylate Drugs 0.000 description 2
- HYPPXZBJBPSRLK-UHFFFAOYSA-N diphenoxylate Chemical compound C1CC(C(=O)OCC)(C=2C=CC=CC=2)CCN1CCC(C#N)(C=1C=CC=CC=1)C1=CC=CC=C1 HYPPXZBJBPSRLK-UHFFFAOYSA-N 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- LZCLXQDLBQLTDK-UHFFFAOYSA-N ethyl 2-hydroxypropanoate Chemical compound CCOC(=O)C(C)O LZCLXQDLBQLTDK-UHFFFAOYSA-N 0.000 description 2
- 235000019325 ethyl cellulose Nutrition 0.000 description 2
- 229920001249 ethyl cellulose Polymers 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000001761 ethyl methyl cellulose Substances 0.000 description 2
- 235000010944 ethyl methyl cellulose Nutrition 0.000 description 2
- 150000002191 fatty alcohols Chemical class 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 239000007903 gelatin capsule Substances 0.000 description 2
- 150000002431 hydrogen Chemical group 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 239000001923 methylcellulose Substances 0.000 description 2
- 235000010981 methylcellulose Nutrition 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 239000004006 olive oil Substances 0.000 description 2
- 235000008390 olive oil Nutrition 0.000 description 2
- 239000000312 peanut oil Substances 0.000 description 2
- WVDDGKGOMKODPV-ZQBYOMGUSA-N phenyl(114C)methanol Chemical compound O[14CH2]C1=CC=CC=C1 WVDDGKGOMKODPV-ZQBYOMGUSA-N 0.000 description 2
- 125000003386 piperidinyl group Chemical group 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- 229920002451 polyvinyl alcohol Polymers 0.000 description 2
- 229920001592 potato starch Polymers 0.000 description 2
- 229940080818 propionamide Drugs 0.000 description 2
- 230000004044 response Effects 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 2
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 239000005720 sucrose Substances 0.000 description 2
- 239000002511 suppository base Substances 0.000 description 2
- 239000004094 surface-active agent Substances 0.000 description 2
- 150000003626 triacylglycerols Chemical class 0.000 description 2
- 229940078499 tricalcium phosphate Drugs 0.000 description 2
- 235000019731 tricalcium phosphate Nutrition 0.000 description 2
- 229910000391 tricalcium phosphate Inorganic materials 0.000 description 2
- 235000015112 vegetable and seed oil Nutrition 0.000 description 2
- 239000008158 vegetable oil Substances 0.000 description 2
- 239000003981 vehicle Substances 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- OJDIXUSLJDWJFU-UHFFFAOYSA-N 1-(2-chloroethyl)-4-phenylpiperidine-4-carbonitrile Chemical compound C1CN(CCCl)CCC1(C#N)C1=CC=CC=C1 OJDIXUSLJDWJFU-UHFFFAOYSA-N 0.000 description 1
- NXUCFKFHJAQCBJ-UHFFFAOYSA-N 1-(3,3,3-triphenylpropyl)piperidine Chemical compound C1CCCCN1CCC(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 NXUCFKFHJAQCBJ-UHFFFAOYSA-N 0.000 description 1
- XUFARRLFNIQYGA-UHFFFAOYSA-N 1-[3,3-bis(4-bromophenyl)-3-(4-chlorophenyl)propanoyl]-4-phenylpiperidine-4-carbonitrile Chemical compound C1=CC(Cl)=CC=C1C(C=1C=CC(Br)=CC=1)(C=1C=CC(Br)=CC=1)CC(=O)N1CCC(C=2C=CC=CC=2)(C#N)CC1 XUFARRLFNIQYGA-UHFFFAOYSA-N 0.000 description 1
- MHSWMPFVUUTLQZ-UHFFFAOYSA-N 1-[3,3-bis(4-chlorophenyl)-3-pyridin-3-ylpropyl]-4-(4-methylphenyl)piperidine-4-carbonitrile Chemical compound C1=CC(C)=CC=C1C1(C#N)CCN(CCC(C=2C=CC(Cl)=CC=2)(C=2C=CC(Cl)=CC=2)C=2C=NC=CC=2)CC1 MHSWMPFVUUTLQZ-UHFFFAOYSA-N 0.000 description 1
- CMFWOYSUIGHFLD-UHFFFAOYSA-N 1-[3-(4-chlorophenyl)-3,3-diphenylpropanoyl]-4-phenylpiperidine-4-carbonitrile Chemical compound C1=CC(Cl)=CC=C1C(C=1C=CC=CC=1)(C=1C=CC=CC=1)CC(=O)N1CCC(C=2C=CC=CC=2)(C#N)CC1 CMFWOYSUIGHFLD-UHFFFAOYSA-N 0.000 description 1
- NDOBDGJMWCHMIW-UHFFFAOYSA-N 1-[3-(4-fluorophenyl)-3,3-diphenylpropanoyl]-4-phenylpiperidine-4-carbonitrile Chemical compound C1=CC(F)=CC=C1C(C=1C=CC=CC=1)(C=1C=CC=CC=1)CC(=O)N1CCC(C=2C=CC=CC=2)(C#N)CC1 NDOBDGJMWCHMIW-UHFFFAOYSA-N 0.000 description 1
- LLSKXGRDUPMXLC-UHFFFAOYSA-N 1-phenylpiperidine Chemical compound C1CCCCN1C1=CC=CC=C1 LLSKXGRDUPMXLC-UHFFFAOYSA-N 0.000 description 1
- 125000004201 2,4-dichlorophenyl group Chemical group [H]C1=C([H])C(*)=C(Cl)C([H])=C1Cl 0.000 description 1
- CWWCQGGNKDBSNT-UHFFFAOYSA-N 2-(2-phenoxyphenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC=C1OC1=CC=CC=C1 CWWCQGGNKDBSNT-UHFFFAOYSA-N 0.000 description 1
- ZWRYATZLPPAVOI-UHFFFAOYSA-N 2-[4-phenyl-1-(3,3,3-triphenylpropyl)piperidin-4-yl]propan-2-amine;dihydrochloride Chemical compound Cl.Cl.C1CC(C(C)(N)C)(C=2C=CC=CC=2)CCN1CCC(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 ZWRYATZLPPAVOI-UHFFFAOYSA-N 0.000 description 1
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 1
- KBJQGJRDSQDPTQ-UHFFFAOYSA-N 2-methyl-4-phenyl-1-(3,3,3-triphenylpropyl)piperidin-4-ol Chemical compound C1(=CC=CC=C1)C(CCN1C(CC(CC1)(C1=CC=CC=C1)O)C)(C1=CC=CC=C1)C1=CC=CC=C1 KBJQGJRDSQDPTQ-UHFFFAOYSA-N 0.000 description 1
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 125000006275 3-bromophenyl group Chemical group [H]C1=C([H])C(Br)=C([H])C(*)=C1[H] 0.000 description 1
- JHWZWIVZROVFEM-UHFFFAOYSA-N 4-(2-methylpropyl)-1,3-oxazolidine-2,5-dione Chemical compound CC(C)CC1NC(=O)OC1=O JHWZWIVZROVFEM-UHFFFAOYSA-N 0.000 description 1
- ZKNIFMGIEUGHDY-UHFFFAOYSA-N 4-(3,3,3-triphenylpropyl)morpholine Chemical compound C1COCCN1CCC(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 ZKNIFMGIEUGHDY-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- UWILYNPREMNRTF-UHFFFAOYSA-N 4-(4-methylphenyl)piperidine Chemical compound C1=CC(C)=CC=C1C1CCNCC1 UWILYNPREMNRTF-UHFFFAOYSA-N 0.000 description 1
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 1
- HIQIXEFWDLTDED-UHFFFAOYSA-N 4-hydroxy-1-piperidin-4-ylpyrrolidin-2-one Chemical compound O=C1CC(O)CN1C1CCNCC1 HIQIXEFWDLTDED-UHFFFAOYSA-N 0.000 description 1
- CQPHZBOPSZGTJM-UHFFFAOYSA-N 4-phenylpiperidin-1-ium-4-carbonitrile;chloride Chemical compound Cl.C=1C=CC=CC=1C1(C#N)CCNCC1 CQPHZBOPSZGTJM-UHFFFAOYSA-N 0.000 description 1
- UTBULQCHEUWJNV-UHFFFAOYSA-N 4-phenylpiperidine Chemical compound C1CNCCC1C1=CC=CC=C1 UTBULQCHEUWJNV-UHFFFAOYSA-N 0.000 description 1
- DMCVVFIWYIKAEJ-UHFFFAOYSA-N 4-phenylpiperidine-4-carbonitrile Chemical compound C=1C=CC=CC=1C1(C#N)CCNCC1 DMCVVFIWYIKAEJ-UHFFFAOYSA-N 0.000 description 1
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- 235000017060 Arachis glabrata Nutrition 0.000 description 1
- 244000105624 Arachis hypogaea Species 0.000 description 1
- 235000010777 Arachis hypogaea Nutrition 0.000 description 1
- 235000018262 Arachis monticola Nutrition 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 101100087530 Caenorhabditis elegans rom-1 gene Proteins 0.000 description 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 229920000623 Cellulose acetate phthalate Polymers 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- 229940126062 Compound A Drugs 0.000 description 1
- 229920000858 Cyclodextrin Polymers 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- 239000001116 FEMA 4028 Substances 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- NLDMNSXOCDLTTB-UHFFFAOYSA-N Heterophylliin A Natural products O1C2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C(OC(=O)C=2C=C(O)C(O)=C(O)C=2)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1 NLDMNSXOCDLTTB-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 240000007472 Leucaena leucocephala Species 0.000 description 1
- 235000010643 Leucaena leucocephala Nutrition 0.000 description 1
- 229910010082 LiAlH Inorganic materials 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- 240000003183 Manihot esculenta Species 0.000 description 1
- 235000016735 Manihot esculenta subsp esculenta Nutrition 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- 101100305983 Mus musculus Rom1 gene Proteins 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-N Propionic acid Substances CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 1
- 241000212342 Sium Species 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- SKMVRBWBOXUEFM-UHFFFAOYSA-N [1-(3,3-diphenyl-3-pyridin-3-ylpropyl)-4-phenylpiperidin-4-yl]methanol Chemical compound C1CC(CO)(C=2C=CC=CC=2)CCN1CCC(C=1C=NC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 SKMVRBWBOXUEFM-UHFFFAOYSA-N 0.000 description 1
- SYDNKKQPRAFGGX-UHFFFAOYSA-N [1-[3,3-bis(4-chlorophenyl)-3-phenylpropyl]-4-phenylpiperidin-4-yl]methanamine Chemical compound C1CC(CN)(C=2C=CC=CC=2)CCN1CCC(C=1C=CC(Cl)=CC=1)(C=1C=CC(Cl)=CC=1)C1=CC=CC=C1 SYDNKKQPRAFGGX-UHFFFAOYSA-N 0.000 description 1
- LOMXBONPONOCCT-UHFFFAOYSA-N [1-[3,3-bis(4-methylphenyl)-3-phenylpropyl]-4-phenylpiperidin-4-yl]methanamine Chemical compound C1=CC(C)=CC=C1C(C=1C=CC(C)=CC=1)(C=1C=CC=CC=1)CCN1CCC(CN)(C=2C=CC=CC=2)CC1 LOMXBONPONOCCT-UHFFFAOYSA-N 0.000 description 1
- CQFGRKADPGKJGW-UHFFFAOYSA-N [1-[3-(2,3-dimethylphenyl)-3,3-diphenylpropyl]-4-phenylpiperidin-4-yl]methanamine Chemical compound CC1=CC=CC(C(CCN2CCC(CN)(CC2)C=2C=CC=CC=2)(C=2C=CC=CC=2)C=2C=CC=CC=2)=C1C CQFGRKADPGKJGW-UHFFFAOYSA-N 0.000 description 1
- SSMYXEQJUXNHPB-UHFFFAOYSA-N [1-[3-(3,4-dichlorophenyl)-3,3-diphenylpropyl]-4-phenylpiperidin-4-yl]methanamine Chemical compound C1CC(CN)(C=2C=CC=CC=2)CCN1CCC(C=1C=C(Cl)C(Cl)=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 SSMYXEQJUXNHPB-UHFFFAOYSA-N 0.000 description 1
- JNOYBXGRYXHERH-UHFFFAOYSA-N [1-[3-(3-bromophenyl)-3,3-diphenylpropyl]-4-phenylpiperidin-4-yl]methanamine Chemical compound C1CC(CN)(C=2C=CC=CC=2)CCN1CCC(C=1C=C(Br)C=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 JNOYBXGRYXHERH-UHFFFAOYSA-N 0.000 description 1
- VKNVWJWNUDQGFH-UHFFFAOYSA-N [1-[3-(4-chlorophenyl)-3-(4-methylphenyl)-3-phenylpropyl]-4-(4-methylphenyl)piperidin-4-yl]methanamine Chemical compound C1=CC(C)=CC=C1C(C=1C=CC(Cl)=CC=1)(C=1C=CC=CC=1)CCN1CCC(CN)(C=2C=CC(C)=CC=2)CC1 VKNVWJWNUDQGFH-UHFFFAOYSA-N 0.000 description 1
- PVHCKGCHZJNZOT-UHFFFAOYSA-N [4-(3-fluorophenyl)-1-(3,3,3-triphenylpropyl)piperidin-4-yl]methanamine Chemical compound C1CC(CN)(C=2C=C(F)C=CC=2)CCN1CCC(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 PVHCKGCHZJNZOT-UHFFFAOYSA-N 0.000 description 1
- UMSWWGAQASCUQI-UHFFFAOYSA-N [4-(4-chlorophenyl)-1-[3-(4-chlorophenyl)-3-phenyl-3-pyridin-3-ylpropyl]piperidin-4-yl]methanamine Chemical compound C1CC(CN)(C=2C=CC(Cl)=CC=2)CCN1CCC(C=1C=NC=CC=1)(C=1C=CC(Cl)=CC=1)C1=CC=CC=C1 UMSWWGAQASCUQI-UHFFFAOYSA-N 0.000 description 1
- OAMLRPRXHQHTHL-UHFFFAOYSA-N [4-(4-methylphenyl)-1-(3,3,3-triphenylpropyl)piperidin-4-yl]methanamine Chemical compound C1=CC(C)=CC=C1C1(CN)CCN(CCC(C=2C=CC=CC=2)(C=2C=CC=CC=2)C=2C=CC=CC=2)CC1 OAMLRPRXHQHTHL-UHFFFAOYSA-N 0.000 description 1
- FMQZCNZBFMNERY-UHFFFAOYSA-N [4-phenyl-1-(3,3,3-triphenylpropyl)piperidin-4-yl]methanamine;dihydrochloride Chemical compound Cl.Cl.C1CC(CN)(C=2C=CC=CC=2)CCN1CCC(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 FMQZCNZBFMNERY-UHFFFAOYSA-N 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- 239000000783 alginic acid Substances 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 229960001126 alginic acid Drugs 0.000 description 1
- 150000004781 alginic acids Chemical class 0.000 description 1
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical compound [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- JPNZKPRONVOMLL-UHFFFAOYSA-N azane;octadecanoic acid Chemical class [NH4+].CCCCCCCCCCCCCCCCCC([O-])=O JPNZKPRONVOMLL-UHFFFAOYSA-N 0.000 description 1
- 235000013871 bee wax Nutrition 0.000 description 1
- 239000012166 beeswax Substances 0.000 description 1
- WHGYBXFWUBPSRW-FOUAGVGXSA-N beta-cyclodextrin Chemical compound OC[C@H]([C@H]([C@@H]([C@H]1O)O)O[C@H]2O[C@@H]([C@@H](O[C@H]3O[C@H](CO)[C@H]([C@@H]([C@H]3O)O)O[C@H]3O[C@H](CO)[C@H]([C@@H]([C@H]3O)O)O[C@H]3O[C@H](CO)[C@H]([C@@H]([C@H]3O)O)O[C@H]3O[C@H](CO)[C@H]([C@@H]([C@H]3O)O)O3)[C@H](O)[C@H]2O)CO)O[C@@H]1O[C@H]1[C@H](O)[C@@H](O)[C@@H]3O[C@@H]1CO WHGYBXFWUBPSRW-FOUAGVGXSA-N 0.000 description 1
- 235000011175 beta-cyclodextrine Nutrition 0.000 description 1
- 229960004853 betadex Drugs 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- SIPUZPBQZHNSDW-UHFFFAOYSA-N bis(2-methylpropyl)aluminum Chemical compound CC(C)C[Al]CC(C)C SIPUZPBQZHNSDW-UHFFFAOYSA-N 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 210000004534 cecum Anatomy 0.000 description 1
- 229940081734 cellulose acetate phthalate Drugs 0.000 description 1
- 235000013339 cereals Nutrition 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000003240 coconut oil Substances 0.000 description 1
- 235000019864 coconut oil Nutrition 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 235000005822 corn Nutrition 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- SBZXBUIDTXKZTM-UHFFFAOYSA-N diglyme Chemical compound COCCOCCOC SBZXBUIDTXKZTM-UHFFFAOYSA-N 0.000 description 1
- 229950001902 dimevamide Drugs 0.000 description 1
- 150000004862 dioxolanes Chemical class 0.000 description 1
- 229960005234 diphenoxylate hydrochloride Drugs 0.000 description 1
- MMXYNKLYVRNTCK-UHFFFAOYSA-N diphenyl-2-pyridylmethane Chemical compound C1=CC=CC=C1C(C=1N=CC=CC=1)C1=CC=CC=C1 MMXYNKLYVRNTCK-UHFFFAOYSA-N 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- 229940116333 ethyl lactate Drugs 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 230000002496 gastric effect Effects 0.000 description 1
- 230000005176 gastrointestinal motility Effects 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 229940074076 glycerol formal Drugs 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 238000005469 granulation Methods 0.000 description 1
- 230000003179 granulation Effects 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 125000003104 hexanoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000010514 hydrogenated cottonseed oil Substances 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 229940074928 isopropyl myristate Drugs 0.000 description 1
- DLEDOFVPSDKWEF-UHFFFAOYSA-N lithium butane Chemical compound [Li+].CCC[CH2-] DLEDOFVPSDKWEF-UHFFFAOYSA-N 0.000 description 1
- 239000007937 lozenge Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- CQDGTJPVBWZJAZ-UHFFFAOYSA-N monoethyl carbonate Chemical compound CCOC(O)=O CQDGTJPVBWZJAZ-UHFFFAOYSA-N 0.000 description 1
- AMLJWLYRONUCKO-UHFFFAOYSA-N n-(6-amino-5-iodopyridin-2-yl)acetamide Chemical compound CC(=O)NC1=CC=C(I)C(N)=N1 AMLJWLYRONUCKO-UHFFFAOYSA-N 0.000 description 1
- WHPVHASZOSYKAC-UHFFFAOYSA-N n-[1-[4-phenyl-1-(3,3,3-triphenylpropyl)piperidin-4-yl]propyl]pentan-1-amine Chemical compound C1CC(C(CC)NCCCCC)(C=2C=CC=CC=2)CCN1CCC(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 WHPVHASZOSYKAC-UHFFFAOYSA-N 0.000 description 1
- BZDBYCYVPKRVDI-UHFFFAOYSA-N n-[[1-(3,3-diphenyl-3-pyridin-2-ylpropyl)-4-phenylpiperidin-4-yl]methyl]propan-1-amine Chemical compound C1CC(CNCCC)(C=2C=CC=CC=2)CCN1CCC(C=1N=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 BZDBYCYVPKRVDI-UHFFFAOYSA-N 0.000 description 1
- RUQHOCZYOVUZPV-UHFFFAOYSA-N n-[[1-[3,3-bis(2,4-dichlorophenyl)-3-pyridin-3-ylpropyl]-4-phenylpiperidin-4-yl]methyl]ethanamine Chemical compound C1CC(CNCC)(C=2C=CC=CC=2)CCN1CCC(C=1C(=CC(Cl)=CC=1)Cl)(C=1C(=CC(Cl)=CC=1)Cl)C1=CC=CN=C1 RUQHOCZYOVUZPV-UHFFFAOYSA-N 0.000 description 1
- WMEGZCKIMUVNLB-UHFFFAOYSA-N n-[[1-[3,3-bis(4-chlorophenyl)-3-pyridin-3-ylpropyl]-4-(4-methylphenyl)piperidin-4-yl]methyl]acetamide Chemical compound C1CC(CNC(=O)C)(C=2C=CC(C)=CC=2)CCN1CCC(C=1C=NC=CC=1)(C=1C=CC(Cl)=CC=1)C1=CC=C(Cl)C=C1 WMEGZCKIMUVNLB-UHFFFAOYSA-N 0.000 description 1
- IQBUGSNTHUOREJ-UHFFFAOYSA-N n-[[1-[3,3-bis(4-methylphenyl)-3-phenylpropyl]-4-phenylpiperidin-4-yl]methyl]propan-1-amine Chemical compound C1CC(CNCCC)(C=2C=CC=CC=2)CCN1CCC(C=1C=CC(C)=CC=1)(C=1C=CC(C)=CC=1)C1=CC=CC=C1 IQBUGSNTHUOREJ-UHFFFAOYSA-N 0.000 description 1
- VZUHXWNZCVCBOC-UHFFFAOYSA-N n-[[1-[3,3-bis(4-methylphenyl)-3-pyridin-3-ylpropyl]-4-(4-methylphenyl)piperidin-4-yl]methyl]-n-ethylethanamine Chemical compound C1CC(CN(CC)CC)(C=2C=CC(C)=CC=2)CCN1CCC(C=1C=NC=CC=1)(C=1C=CC(C)=CC=1)C1=CC=C(C)C=C1 VZUHXWNZCVCBOC-UHFFFAOYSA-N 0.000 description 1
- CDIFSDRBVGIJLM-UHFFFAOYSA-N n-[[1-[3-(3,4-dichlorophenyl)-3,3-diphenylpropyl]-4-phenylpiperidin-4-yl]methyl]acetamide Chemical compound C1CC(CNC(=O)C)(C=2C=CC=CC=2)CCN1CCC(C=1C=C(Cl)C(Cl)=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 CDIFSDRBVGIJLM-UHFFFAOYSA-N 0.000 description 1
- PSUUUKNPQLYTTG-UHFFFAOYSA-N n-[[1-[3-(3,4-dichlorophenyl)-3,3-diphenylpropyl]-4-phenylpiperidin-4-yl]methyl]ethanamine Chemical compound C1CC(CNCC)(C=2C=CC=CC=2)CCN1CCC(C=1C=C(Cl)C(Cl)=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 PSUUUKNPQLYTTG-UHFFFAOYSA-N 0.000 description 1
- GWGXLOLIMMCWGT-UHFFFAOYSA-N n-[[4-(4-chlorophenyl)-1-[3-(4-chlorophenyl)-3-phenyl-3-pyridin-3-ylpropyl]piperidin-4-yl]methyl]-n-ethylethanamine Chemical compound C1CC(CN(CC)CC)(C=2C=CC(Cl)=CC=2)CCN1CCC(C=1C=NC=CC=1)(C=1C=CC(Cl)=CC=1)C1=CC=CC=C1 GWGXLOLIMMCWGT-UHFFFAOYSA-N 0.000 description 1
- YRYHOZKDKYYOHV-UHFFFAOYSA-N n-[[4-phenyl-1-[3,3,3-tris(4-chlorophenyl)propyl]piperidin-4-yl]methyl]acetamide Chemical compound C1CC(CNC(=O)C)(C=2C=CC=CC=2)CCN1CCC(C=1C=CC(Cl)=CC=1)(C=1C=CC(Cl)=CC=1)C1=CC=C(Cl)C=C1 YRYHOZKDKYYOHV-UHFFFAOYSA-N 0.000 description 1
- MJFUPVJUPAUWKN-UHFFFAOYSA-N n-[[4-phenyl-1-[3,3,3-tris(4-methylphenyl)propyl]piperidin-4-yl]methyl]-n-propylpropan-1-amine Chemical compound C1CC(CN(CCC)CCC)(C=2C=CC=CC=2)CCN1CCC(C=1C=CC(C)=CC=1)(C=1C=CC(C)=CC=1)C1=CC=C(C)C=C1 MJFUPVJUPAUWKN-UHFFFAOYSA-N 0.000 description 1
- CDFWJNRJMXELOB-UHFFFAOYSA-N n-ethyl-n-[[4-phenyl-1-(3,3,3-triphenylpropyl)piperidin-4-yl]methyl]ethanamine Chemical compound C1CC(CN(CC)CC)(C=2C=CC=CC=2)CCN1CCC(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 CDFWJNRJMXELOB-UHFFFAOYSA-N 0.000 description 1
- 210000000653 nervous system Anatomy 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 1
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid group Chemical group C(CCCCCCC\C=C/CCCCCCCC)(=O)O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 238000013021 overheating Methods 0.000 description 1
- 235000020232 peanut Nutrition 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 239000008363 phosphate buffer Substances 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- OHEDMAIVEXQCOZ-UHFFFAOYSA-N piperidine;dihydrochloride Chemical compound Cl.Cl.C1CCNCC1 OHEDMAIVEXQCOZ-UHFFFAOYSA-N 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- NQLVQOSNDJXLKG-UHFFFAOYSA-N prosulfocarb Chemical compound CCCN(CCC)C(=O)SCC1=CC=CC=C1 NQLVQOSNDJXLKG-UHFFFAOYSA-N 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 239000012177 spermaceti Substances 0.000 description 1
- 229940084106 spermaceti Drugs 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 238000012414 sterilization procedure Methods 0.000 description 1
- 230000002311 subsequent effect Effects 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 235000000346 sugar Nutrition 0.000 description 1
- 150000005846 sugar alcohols Polymers 0.000 description 1
- 150000008163 sugars Chemical class 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- LZTRCELOJRDYMQ-UHFFFAOYSA-N triphenylmethanol Chemical class C=1C=CC=CC=1C(C=1C=CC=CC=1)(O)C1=CC=CC=C1 LZTRCELOJRDYMQ-UHFFFAOYSA-N 0.000 description 1
- GPRLSGONYQIRFK-MNYXATJNSA-N triton Chemical compound [3H+] GPRLSGONYQIRFK-MNYXATJNSA-N 0.000 description 1
- 125000003774 valeryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/08—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms
- C07D211/18—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D211/26—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms with hydrocarbon radicals, substituted by nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/36—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D211/60—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D211/62—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals attached in position 4
- C07D211/64—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals attached in position 4 having an aryl radical as the second substituent in position 4
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Hydrogenated Pyridines (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/792,616 US4069223A (en) | 1977-05-02 | 1977-05-02 | 4-Aminomethyl-1-(3,3,3-triarylpropyl)-4-arylpiperidine and derivatives thereof |
| US792,616 | 1977-05-02 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1105465A true CA1105465A (en) | 1981-07-21 |
Family
ID=25157505
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA302,344A Expired CA1105465A (en) | 1977-05-02 | 1978-05-01 | 4-aminomethyl-1-(3,3,3-triarylpropyl)-4- arylpiperidine and related compounds |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US4069223A (enExample) |
| JP (1) | JPS549281A (enExample) |
| AU (1) | AU520250B2 (enExample) |
| CA (1) | CA1105465A (enExample) |
| DE (1) | DE2819210A1 (enExample) |
| FR (1) | FR2389605B1 (enExample) |
| GB (1) | GB1581923A (enExample) |
| NL (1) | NL7804725A (enExample) |
| SE (1) | SE7805011L (enExample) |
| ZA (1) | ZA782514B (enExample) |
Families Citing this family (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS53125944U (enExample) * | 1977-12-22 | 1978-10-06 | ||
| US4173641A (en) * | 1978-05-15 | 1979-11-06 | Pfizer Inc. | Di-O-n-alkyl glycerol derivatives as immune stimulants |
| US6190691B1 (en) | 1994-04-12 | 2001-02-20 | Adolor Corporation | Methods for treating inflammatory conditions |
| US5962477A (en) * | 1994-04-12 | 1999-10-05 | Adolor Corporation | Screening methods for cytokine inhibitors |
| US5849761A (en) * | 1995-09-12 | 1998-12-15 | Regents Of The University Of California | Peripherally active anti-hyperalgesic opiates |
| US6573282B1 (en) | 1995-09-12 | 2003-06-03 | Adolor Corporation | Peripherally active anti-hyperalgesic opiates |
| US5849762A (en) * | 1997-07-14 | 1998-12-15 | Adolor Corporation | Peripherally acting anti-pruritic opiates |
| US6353004B1 (en) | 1997-07-14 | 2002-03-05 | Adolor Coporation | Peripherally acting anti-pruritic opiates |
| US20030158220A1 (en) * | 1997-11-03 | 2003-08-21 | Foss Joseph F. | Use of methylnaltrexone and related compounds to treat chronic opioid use side effects |
| ATE460163T1 (de) * | 2001-04-12 | 2010-03-15 | Pharmacopeia Llc | Arly und diaryl piperidinderivate verwendbar als mch-hemmer |
| CA2811272C (en) | 2003-04-08 | 2016-12-20 | Progenics Pharmaceuticals, Inc. | Pharmaceutical formulations containing methylnaltrexone |
| AR057035A1 (es) | 2005-05-25 | 2007-11-14 | Progenics Pharm Inc | SíNTESIS DE (R)-N-METILNALTREXONA, COMPOSICIONES FARMACÉUTICAS Y USOS |
| AR057325A1 (es) | 2005-05-25 | 2007-11-28 | Progenics Pharm Inc | Sintesis de (s)-n-metilnaltrexona, composiciones farmaceuticas y usos |
| EP1749528A1 (en) | 2005-08-05 | 2007-02-07 | Pharma C S.A. | Pharmaceutical combinations containing a mu opioid agonist and an inhibitor of NO production |
| TWI489984B (zh) | 2006-08-04 | 2015-07-01 | Wyeth Corp | 用於非經腸道傳輸化合物之配方及其用途 |
| TW200817048A (en) * | 2006-09-08 | 2008-04-16 | Wyeth Corp | Dry powder compound formulations and uses thereof |
| JP2010522756A (ja) * | 2007-03-29 | 2010-07-08 | プロジェニックス ファーマシューティカルズ,インコーポレーテッド | 結晶形およびその使用 |
| PL2137191T3 (pl) * | 2007-03-29 | 2016-12-30 | Antagoniści obwodowego receptora opioidowego i ich zastosowania | |
| EP2565195B1 (en) * | 2007-03-29 | 2015-05-06 | Wyeth LLC | Peripheral opioid receptor and antagonists and uses thereof |
| AU2008349873B2 (en) | 2008-02-06 | 2014-02-13 | Progenics Pharmaceuticals, Inc. | Preparation and use of (R),(R)-2,2'-bis-methylnaltrexone |
| CA2676881C (en) | 2008-09-30 | 2017-04-25 | Wyeth | Peripheral opioid receptor antagonists and uses thereof |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1125112A (en) | 1966-01-07 | 1968-08-28 | Science Union & Cie | New derivatives of diazabicyclo-decane and process for preparing them |
| US3998832A (en) * | 1975-04-16 | 1976-12-21 | G. D. Searle & Co. | Anti-diarrheal compounds |
-
1977
- 1977-05-02 US US05/792,616 patent/US4069223A/en not_active Expired - Lifetime
-
1978
- 1978-05-01 AU AU35622/78A patent/AU520250B2/en not_active Expired
- 1978-05-01 CA CA302,344A patent/CA1105465A/en not_active Expired
- 1978-05-02 NL NL7804725A patent/NL7804725A/xx not_active Application Discontinuation
- 1978-05-02 JP JP5324578A patent/JPS549281A/ja active Pending
- 1978-05-02 FR FR7812998A patent/FR2389605B1/fr not_active Expired
- 1978-05-02 GB GB17228/78A patent/GB1581923A/en not_active Expired
- 1978-05-02 SE SE7805011A patent/SE7805011L/xx unknown
- 1978-05-02 ZA ZA00782514A patent/ZA782514B/xx unknown
- 1978-05-02 DE DE19782819210 patent/DE2819210A1/de active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| NL7804725A (nl) | 1978-11-06 |
| JPS549281A (en) | 1979-01-24 |
| ZA782514B (en) | 1979-06-27 |
| AU520250B2 (en) | 1982-01-21 |
| SE7805011L (sv) | 1978-11-03 |
| FR2389605A1 (enExample) | 1978-12-01 |
| US4069223A (en) | 1978-01-17 |
| FR2389605B1 (enExample) | 1981-07-17 |
| GB1581923A (en) | 1980-12-31 |
| AU3562278A (en) | 1979-11-08 |
| DE2819210A1 (de) | 1979-02-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1105465A (en) | 4-aminomethyl-1-(3,3,3-triarylpropyl)-4- arylpiperidine and related compounds | |
| CA1059512A (en) | 1-substituted-4-benzylpiperidines | |
| DK174153B1 (da) | N-Aralkyl-piperidenmethanolderivater, fremgangsmåde til fremstilling deraf og farmaceutisk præparat indeholdende sådanne derivater | |
| US4066654A (en) | 1-triarylalkyl-4-phenyl-4-piperidine carboxylic acids and derivatives | |
| CA1105466A (en) | 3,3,3-triarylalkyl-4-phenylalkyl-4-hydroxy piperidines and related compounds | |
| US5021428A (en) | Novel chemical compounds for the prophylactic treatment of migraine | |
| JPS5833876B2 (ja) | チカンサレタ 1 3− ジヒドロスピロ ( イソベンゾフラン ) カゴウブツノセイホウ | |
| JPH06340620A (ja) | 新規なアミノピペリジン、アミノピロリジンおよびアミノパー ヒドロアゼピン化合物 | |
| JPH05186425A (ja) | ポリサイクリックアミン化合物、そのエナンショマー、その製造方法、およびこれらを含有する薬剤組成物 | |
| EP0858457A1 (de) | 5-gliedrige heterocyclen, diese verbindungen enthaltende arzneimittel und deren verwendung sowie verfahren zu ihrer herstellung | |
| US4072686A (en) | 1-(3,3,3-Triarylalkyl)-4-phenyl-piperidinealkanols | |
| US5169096A (en) | N-aralkyl-piperidine-methanol derivatives | |
| US5595993A (en) | Antischemic piperazinyl- and piperidinyl-cyclohexanes | |
| PL91512B1 (enExample) | ||
| US4246268A (en) | Neuroleptic-4-(naphthylmethyl)piperidine derivatives | |
| JP3367670B2 (ja) | コリン作用薬としてのアザビシクロアリールアセチレンおよびアリーレニンオキシム | |
| US4912117A (en) | Novel chemical compounds | |
| EP0235663A1 (en) | Substituted tetrahydro-3-pyridine-carboxylic acid, ester, and amide cholinergic agents | |
| CA1079734A (en) | 1-(3,3,3,-triarylpropyl)-4-phenyl-4-piperidinemethanols | |
| CA1079277A (en) | 10(.omega.-(BENZOYLPIPERIDINYL)ALKYL) PHENOTHIAZINES | |
| US3899494A (en) | Substituted 6-phenyl benzo-naphthyridines | |
| CA2112083C (en) | Aryl substituted heterocyclic compounds | |
| US4613607A (en) | Medicaments based on derivatives of 1-(4-quinolyl)-2-(4-piperidyl)-ethanol or 1-(4-quinolyl)-3-(4-piperidyl)-propanol | |
| CA1040635A (en) | 1,4-disubstituted piperidines | |
| US3531487A (en) | 4-(n,n-disubstituted-amino)-piperidines |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry | ||
| MKEX | Expiry |
Effective date: 19980721 |