CA1079782A - Apparatus for producing ultraviolet radiation - Google Patents
Apparatus for producing ultraviolet radiationInfo
- Publication number
- CA1079782A CA1079782A CA259,240A CA259240A CA1079782A CA 1079782 A CA1079782 A CA 1079782A CA 259240 A CA259240 A CA 259240A CA 1079782 A CA1079782 A CA 1079782A
- Authority
- CA
- Canada
- Prior art keywords
- radiation
- lamps
- source
- exit opening
- reflector
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 230000005855 radiation Effects 0.000 title claims abstract description 149
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 claims abstract description 23
- 229910052753 mercury Inorganic materials 0.000 claims abstract description 23
- NJPPVKZQTLUDBO-UHFFFAOYSA-N novaluron Chemical compound C1=C(Cl)C(OC(F)(F)C(OC(F)(F)F)F)=CC=C1NC(=O)NC(=O)C1=C(F)C=CC=C1F NJPPVKZQTLUDBO-UHFFFAOYSA-N 0.000 claims description 4
- 239000000654 additive Substances 0.000 claims description 3
- 230000000996 additive effect Effects 0.000 claims description 3
- 239000011521 glass Substances 0.000 claims description 3
- 229910000497 Amalgam Inorganic materials 0.000 claims description 2
- 230000002441 reversible effect Effects 0.000 claims description 2
- 239000000126 substance Substances 0.000 claims description 2
- 238000001228 spectrum Methods 0.000 claims 1
- 238000011282 treatment Methods 0.000 abstract description 20
- 229910052724 xenon Inorganic materials 0.000 abstract description 18
- FHNFHKCVQCLJFQ-UHFFFAOYSA-N xenon atom Chemical compound [Xe] FHNFHKCVQCLJFQ-UHFFFAOYSA-N 0.000 abstract description 18
- 230000000694 effects Effects 0.000 abstract description 11
- 206010073306 Exposure to radiation Diseases 0.000 abstract description 3
- 230000002844 continuous effect Effects 0.000 abstract 1
- 229940041669 mercury Drugs 0.000 description 20
- 206010042496 Sunburn Diseases 0.000 description 11
- 230000035945 sensitivity Effects 0.000 description 5
- 230000008859 change Effects 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 239000000543 intermediate Substances 0.000 description 4
- 241000499883 Solaria <angiosperm> Species 0.000 description 3
- 230000037338 UVA radiation Effects 0.000 description 3
- 229940020445 flector Drugs 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 208000036366 Sensation of pressure Diseases 0.000 description 2
- 230000007423 decrease Effects 0.000 description 2
- 238000013461 design Methods 0.000 description 2
- 238000011161 development Methods 0.000 description 2
- 238000010586 diagram Methods 0.000 description 2
- 238000009826 distribution Methods 0.000 description 2
- 238000003780 insertion Methods 0.000 description 2
- 230000037431 insertion Effects 0.000 description 2
- 230000004044 response Effects 0.000 description 2
- 230000000284 resting effect Effects 0.000 description 2
- 235000008645 Chenopodium bonus henricus Nutrition 0.000 description 1
- 244000138502 Chenopodium bonus henricus Species 0.000 description 1
- 206010013082 Discomfort Diseases 0.000 description 1
- AYFVYJQAPQTCCC-GBXIJSLDSA-N L-threonine Chemical compound C[C@@H](O)[C@H](N)C(O)=O AYFVYJQAPQTCCC-GBXIJSLDSA-N 0.000 description 1
- 101150066650 LAMP5 gene Proteins 0.000 description 1
- 101150094640 Siae gene Proteins 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 230000006978 adaptation Effects 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000010304 firing Methods 0.000 description 1
- KEBHLNDPKPIPLI-UHFFFAOYSA-N hydron;2-(3h-inden-4-yloxymethyl)morpholine;chloride Chemical compound Cl.C=1C=CC=2C=CCC=2C=1OCC1CNCCO1 KEBHLNDPKPIPLI-UHFFFAOYSA-N 0.000 description 1
- 230000005923 long-lasting effect Effects 0.000 description 1
- 229940056960 melamin Drugs 0.000 description 1
- JDSHMPZPIAZGSV-UHFFFAOYSA-N melamine Chemical compound NC1=NC(N)=NC(N)=N1 JDSHMPZPIAZGSV-UHFFFAOYSA-N 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 238000005192 partition Methods 0.000 description 1
- 229920000136 polysorbate Polymers 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 238000009877 rendering Methods 0.000 description 1
- 230000001235 sensitizing effect Effects 0.000 description 1
- HBMJWWWQQXIZIP-UHFFFAOYSA-N silicon carbide Chemical compound [Si+]#[C-] HBMJWWWQQXIZIP-UHFFFAOYSA-N 0.000 description 1
- 229910010271 silicon carbide Inorganic materials 0.000 description 1
- 230000003595 spectral effect Effects 0.000 description 1
- 235000018553 tannin Nutrition 0.000 description 1
- 229920001864 tannin Polymers 0.000 description 1
- 239000001648 tannin Substances 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 238000009827 uniform distribution Methods 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61N—ELECTROTHERAPY; MAGNETOTHERAPY; RADIATION THERAPY; ULTRASOUND THERAPY
- A61N5/00—Radiation therapy
- A61N5/06—Radiation therapy using light
- A61N5/0613—Apparatus adapted for a specific treatment
- A61N5/0614—Tanning
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61N—ELECTROTHERAPY; MAGNETOTHERAPY; RADIATION THERAPY; ULTRASOUND THERAPY
- A61N5/00—Radiation therapy
- A61N5/06—Radiation therapy using light
- A61N2005/0635—Radiation therapy using light characterised by the body area to be irradiated
- A61N2005/0636—Irradiating the whole body
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61N—ELECTROTHERAPY; MAGNETOTHERAPY; RADIATION THERAPY; ULTRASOUND THERAPY
- A61N5/00—Radiation therapy
- A61N5/06—Radiation therapy using light
- A61N2005/065—Light sources therefor
- A61N2005/0655—Tubes
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61N—ELECTROTHERAPY; MAGNETOTHERAPY; RADIATION THERAPY; ULTRASOUND THERAPY
- A61N5/00—Radiation therapy
- A61N5/06—Radiation therapy using light
- A61N2005/0664—Details
- A61N2005/0665—Reflectors
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61N—ELECTROTHERAPY; MAGNETOTHERAPY; RADIATION THERAPY; ULTRASOUND THERAPY
- A61N5/00—Radiation therapy
- A61N5/06—Radiation therapy using light
- A61N2005/0664—Details
- A61N2005/0667—Filters
Landscapes
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Biomedical Technology (AREA)
- Pathology (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Radiology & Medical Imaging (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Radiation-Therapy Devices (AREA)
- Testing Resistance To Weather, Investigating Materials By Mechanical Methods (AREA)
- Magnetic Resonance Imaging Apparatus (AREA)
- Apparatus For Radiation Diagnosis (AREA)
Priority Applications (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CA347,553A CA1100168A (en) | 1975-08-26 | 1980-03-13 | Apparatus for producing ultraviolet radiation |
| CA347,554A CA1100169A (en) | 1975-08-26 | 1980-03-13 | Apparatus for producing ultraviolet radiation |
Applications Claiming Priority (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19752537955 DE2537955A1 (de) | 1974-08-30 | 1975-08-26 | Konfektformmaschine |
| DE19752537855 DE2537855A1 (de) | 1975-08-26 | 1975-08-26 | Geraet zur flaechenhaften uv-bestrahlung |
| DE19762603460 DE2603460C3 (de) | 1976-01-30 | 1976-01-30 | Bräunungsgerät zur flächenhaften UV-Bestrahlung |
| DE19762605487 DE2605487A1 (de) | 1975-08-26 | 1976-02-12 | Geraet zur flaechenhaften uv-bestrahlung |
| DE19762624297 DE2624297A1 (de) | 1975-08-26 | 1976-05-31 | Geraet fuer flaechenhaften uv-bestrahlung |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1079782A true CA1079782A (en) | 1980-06-17 |
Family
ID=37907087
Family Applications (3)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA259,240A Expired CA1079782A (en) | 1975-08-26 | 1976-08-17 | Apparatus for producing ultraviolet radiation |
| CA347,554A Expired CA1100169A (en) | 1975-08-26 | 1980-03-13 | Apparatus for producing ultraviolet radiation |
| CA347,553A Expired CA1100168A (en) | 1975-08-26 | 1980-03-13 | Apparatus for producing ultraviolet radiation |
Family Applications After (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA347,554A Expired CA1100169A (en) | 1975-08-26 | 1980-03-13 | Apparatus for producing ultraviolet radiation |
| CA347,553A Expired CA1100168A (en) | 1975-08-26 | 1980-03-13 | Apparatus for producing ultraviolet radiation |
Country Status (17)
| Country | Link |
|---|---|
| US (3) | US4095113A (OSRAM) |
| JP (1) | JPS5234587A (OSRAM) |
| AT (1) | AT375019B (OSRAM) |
| AU (1) | AU505720B2 (OSRAM) |
| BE (1) | BE845555A (OSRAM) |
| CA (3) | CA1079782A (OSRAM) |
| CH (1) | CH604746A5 (OSRAM) |
| DK (1) | DK147728C (OSRAM) |
| FI (1) | FI59929C (OSRAM) |
| FR (1) | FR2321908A1 (OSRAM) |
| GB (2) | GB1540489A (OSRAM) |
| IE (2) | IE43316B1 (OSRAM) |
| IT (1) | IT1069671B (OSRAM) |
| LU (1) | LU75653A1 (OSRAM) |
| NL (1) | NL184351C (OSRAM) |
| NO (1) | NO150307C (OSRAM) |
| SE (1) | SE428176B (OSRAM) |
Families Citing this family (66)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2707920C2 (de) * | 1977-02-24 | 1986-03-06 | Wolff System Service Gmbh, 6000 Frankfurt | Gerät zur UV-Photobehandlung der Psoriasis und ähnlicher Krankheiten |
| DE2537855A1 (de) * | 1975-08-26 | 1977-03-10 | Friedrich Wolff | Geraet zur flaechenhaften uv-bestrahlung |
| DE2609273A1 (de) * | 1976-03-05 | 1977-09-08 | Mutzhas Maximilian F | Bestrahlungseinrichtung mit ultraviolett-strahlenquelle |
| DE2616892A1 (de) * | 1976-04-15 | 1977-10-20 | Patra Patent Treuhand | Bestrahlungsgeraet zur behandlung von hautkrankheiten |
| DE2801552A1 (de) * | 1978-01-14 | 1979-07-19 | Otto Schlueter | Bestrahlungsgeraet fuer den menschlichen koerper |
| DE2829117C2 (de) * | 1978-07-03 | 1986-06-19 | Wolff System Service Gmbh, 6000 Frankfurt | UV-Bestrahlungsgerät |
| DE2930458A1 (de) * | 1979-07-27 | 1981-02-12 | Friedrich Wolff | Medizinisches bestrahlungsgeraet |
| US4499403A (en) * | 1979-09-06 | 1985-02-12 | General Electric Company | Skin tanning fluorescent lamp construction utilizing a phosphor combination |
| US4645969A (en) * | 1980-08-01 | 1987-02-24 | General Electric Company | Skin tanning fluorescent lamp construction utilizing a phosphor combination |
| NL8203861A (nl) * | 1982-10-05 | 1984-05-01 | Philips Nv | Bestralingsapparaat. |
| NL8303856A (nl) * | 1983-11-10 | 1985-06-03 | Philips Nv | Bestralingsinrichting. |
| US4563589A (en) * | 1984-01-09 | 1986-01-07 | Scheffer Herbert D | Ultraviolet curing lamp device |
| DE3413662A1 (de) | 1984-04-11 | 1985-10-17 | Walter 5208 Eitorf Kratz | Braeunungsgeraet mit die gesichtsbraeunung foerdernden einrichtungen |
| GB8410256D0 (en) * | 1984-04-19 | 1984-05-31 | Hancock M R | Support of sun tanning canopies |
| DE3422605A1 (de) * | 1984-06-18 | 1985-12-19 | Friedrich 7800 Freiburg Wolff | Geraet zur ganzkoerperbestrahlung |
| DE3431692A1 (de) * | 1984-08-29 | 1986-03-06 | Friedrich 7800 Freiburg Wolff | Leuchtstofflampe |
| DE8513789U1 (de) * | 1985-05-09 | 1985-12-19 | Nk-Optik Gesellschaft Fuer Elektro-Optische Geraete Mbh, 8 | Vorrichtung zum Aushärten von lichthärtendem Fingernagel- oder Fußnagelersatz |
| US4888525A (en) * | 1985-05-17 | 1989-12-19 | Nilssen Ole K | Sun tanning apparatus having electronic operating system |
| WO1987002256A1 (en) * | 1985-10-09 | 1987-04-23 | Commonwealth Scientific And Industrial Research Or | Phototherapy of skin wounds |
| JPS6343994A (ja) * | 1986-08-08 | 1988-02-25 | Sumikin Chem Co Ltd | コ−クス炉ガス中の粗軽油捕集方法 |
| NL8602584A (nl) * | 1986-10-15 | 1988-05-02 | Philips Nv | Bestralingsapparaat. |
| FR2605520B1 (fr) * | 1986-10-22 | 1990-11-23 | Verre Quartz Sa | Cabine publique de bronzage |
| FR2615398B1 (fr) * | 1987-05-18 | 1991-12-06 | Dixwell | Cabinet de traitement par ultraviolets |
| FR2620342A1 (fr) * | 1987-09-15 | 1989-03-17 | Jetsun International Sarl | Installation d'emission de rayonnement ultraviolet, notamment pour bronzage collectif |
| NL8800300A (nl) * | 1988-02-09 | 1989-09-01 | Philips Nv | Bestralingsapparaat. |
| DE3824647A1 (de) * | 1988-07-20 | 1990-02-01 | Wedeco Entkeimungsanlagen | Vorrichtung zur bestrahlung von medien mittels uv-licht |
| DE8816682U1 (de) * | 1988-08-29 | 1990-04-26 | Heraeus Kulzer GmbH, 63450 Hanau | Bestrahlungsgerät |
| US5282842A (en) * | 1991-03-27 | 1994-02-01 | Changaris David G | Method of inducing tanning by pulsed light and apparatus to effect same |
| FR2683051B1 (fr) * | 1991-10-25 | 1993-12-24 | Armines | Reflecteur pour source de rayonnement a angle de rayonnement lateral maximal controle. |
| US5716662A (en) * | 1994-09-16 | 1998-02-10 | Fitzburgh; Brian | Method for waxing snowboards, skis and the like |
| US5683437A (en) | 1995-10-17 | 1997-11-04 | Doty; John Stephen | Tanning bed |
| US6118130A (en) * | 1998-11-18 | 2000-09-12 | Fusion Uv Systems, Inc. | Extendable focal length lamp |
| KR100394222B1 (ko) * | 1999-07-13 | 2003-08-06 | 윤희선 | 고온/저온 치료기 |
| US6447537B1 (en) | 2000-06-21 | 2002-09-10 | Raymond A. Hartman | Targeted UV phototherapy apparatus and method |
| US6413268B1 (en) | 2000-08-11 | 2002-07-02 | Raymond A. Hartman | Apparatus and method for targeted UV phototherapy of skin disorders |
| WO2002055149A2 (en) * | 2000-10-20 | 2002-07-18 | Photomedex | Controlled dose delivery of ultraviolet light for treating skin disorders |
| US6673097B1 (en) * | 2001-02-23 | 2004-01-06 | Hollywood Tanning Systems, Inc. | Tanning booth having reduced tanning time |
| DE10110686A1 (de) * | 2001-03-06 | 2002-09-12 | Kopper Iris | Kosmetische oder medizinische Bestrahlungseinrichtung |
| CA2450718A1 (en) | 2001-06-13 | 2002-12-19 | Joseph T. Burgio | Apparatus for limited-heat curing of photosensitive coatings and inks |
| US7144248B2 (en) * | 2001-10-18 | 2006-12-05 | Irwin Dean S | Device for oral UV photo-therapy |
| US6567999B1 (en) | 2002-01-14 | 2003-05-27 | Keith L. Thurner | Shower stall unit with integral tanning lights |
| NL1021009C2 (nl) * | 2002-07-05 | 2004-01-09 | Sunshower B V | Douche-inrichting met bruiningsinrichting. |
| JP4448445B2 (ja) * | 2002-08-16 | 2010-04-07 | ベール ゲーエムベーハー ウント コー カーゲー | 制御装置内に使用するためのロールバンドカセット |
| DE10242719A1 (de) * | 2002-09-13 | 2004-03-18 | Cetelon Lackfabrik Walter Stier Gmbh & Co.Kg | Vorrichtung zur Härtung strahlungshärtbarer Beschichtungen |
| WO2004105859A2 (en) * | 2003-05-24 | 2004-12-09 | Ledeep, Llc | Skin tanning and light therapy system and method |
| DE10346131A1 (de) * | 2003-10-01 | 2005-05-12 | Heraeus Noblelight Gmbh | UV-Lampenanordnung und deren Verwendung |
| EP1673796A1 (en) * | 2003-10-02 | 2006-06-28 | Koninklijke Philips Electronics N.V. | Tanning apparatus |
| EP1538482B1 (en) * | 2003-12-05 | 2016-02-17 | Obducat AB | Device and method for large area lithography |
| US7030392B2 (en) * | 2003-12-10 | 2006-04-18 | Alex Waluszko | Ultraviolet lighting platform |
| JP4724430B2 (ja) * | 2004-02-06 | 2011-07-13 | 毅 高木 | 入浴用ユニット設備 |
| RU2270044C2 (ru) * | 2004-02-24 | 2006-02-20 | Сергей Евгеньевич Михайлов | Устройство для уф-облучения кожных покровов человека - солярий вертикальный |
| WO2005086846A2 (en) * | 2004-03-09 | 2005-09-22 | Ledeep, Llc | Phototherapy systems and methods |
| US20050240248A1 (en) * | 2004-04-23 | 2005-10-27 | Venuto Ralph Sr | High pressure tanning booth |
| US20060185585A1 (en) * | 2005-02-09 | 2006-08-24 | Mclean Salahedin B | Ski and snowboard waxing apparatus and method of use |
| US20060240764A1 (en) * | 2005-04-22 | 2006-10-26 | Pierce Christopher J | Air vent inserts |
| DE102006015166A1 (de) * | 2006-03-30 | 2007-10-11 | Heraeus Noblelight Gmbh | Besonnungsanlage |
| EP1849497A1 (en) * | 2006-04-26 | 2007-10-31 | Koninklijke Philips Electronics N.V. | Tanning apparatus |
| US7891802B2 (en) * | 2006-11-15 | 2011-02-22 | Ffei Ltd. | Ink pinning assembly |
| HUP0800505A2 (en) * | 2008-08-08 | 2010-05-28 | Nagy Tamas Soltesz | Sunning lamp arrangement |
| RU2420329C2 (ru) * | 2010-02-05 | 2011-06-10 | Леонид Федорович Порядков | Циркулярный солярий |
| US20150123015A1 (en) * | 2013-11-04 | 2015-05-07 | Nordson Corporation | Apparatus and methods for irradiating substrates with ultraviolet light |
| CN105115598B (zh) * | 2015-08-13 | 2018-01-16 | 成都奥晶科技有限责任公司 | 一种远紫外光远距离探测器和探测器光学系统 |
| US12233279B2 (en) | 2017-05-30 | 2025-02-25 | Icahn School Of Medicine At Mount Sinai | Device for photo-therapy and use thereof |
| US11273320B2 (en) * | 2017-05-30 | 2022-03-15 | Tcellerate Llc | Device for photo-therapy of Grover's disease and use thereof |
| US10960094B1 (en) | 2020-06-16 | 2021-03-30 | Innovative Technologies | Disinfection system |
| EP4029532B1 (en) * | 2021-01-05 | 2025-12-03 | The Boeing Company | Ultraviolet device and methods of using the same |
Family Cites Families (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2733351A (en) * | 1956-01-31 | Device for candling eggs | ||
| US828733A (en) * | 1906-01-17 | 1906-08-14 | Benjamin F Fuller | Cabinet for treating diseases by light. |
| FR444317A (fr) * | 1911-08-04 | 1912-10-15 | Georges Eugene Gaiffe | Appareil démontable et ajustable pour bains de lumière localisés |
| US1256522A (en) * | 1915-07-15 | 1918-02-19 | Alvyn L Croxton | Reflecting apparatus. |
| GB183137A (en) * | 1921-07-13 | 1922-12-28 | Hugo Picard | Irradiation chamber for therapeutical purposes |
| US2184644A (en) * | 1935-04-08 | 1939-12-26 | Franz Gutmann | Climate cabinet |
| DE886496C (de) * | 1939-12-29 | 1953-08-13 | Quarzlampen Gmbh | Therapeutische Bestrahlungslampe mit kurzwelliger Ultrarotstrahlung |
| US2348617A (en) * | 1941-02-19 | 1944-05-09 | Sun Kraft Inc | Ultraviolet ray generator |
| US2356592A (en) * | 1942-05-09 | 1944-08-22 | Hanovia Chemical & Mfg Co | Apparatus for producing ultra-violet radiation |
| FR58199E (OSRAM) * | 1947-06-18 | 1953-09-29 | ||
| DE806001C (de) * | 1948-11-19 | 1951-06-11 | Hoerner Fa Eugen | Reflecktor fuer leuchtende Flaechen |
| US2631588A (en) * | 1950-07-17 | 1953-03-17 | Arthon H Paschell | Booth for giving tan treatments |
| FR1119000A (fr) * | 1955-02-09 | 1956-06-13 | Applimo | Perfectionnements aux radiateurs à infra-rouge |
| US3084258A (en) * | 1959-08-17 | 1963-04-02 | Furedy Frank | Therapeutic lamp |
| CH366406A (fr) * | 1960-08-20 | 1962-12-31 | Infranor Sa | Projecteur donnant un éclairement pratiquement uniforme sur une surface rectangulaire |
| US3271786A (en) * | 1964-02-07 | 1966-09-13 | William M Joy | Portable sauna cabinet |
| DE1489220B2 (de) * | 1964-09-11 | 1972-02-24 | Quarzlampenfabrik Dr.-Ing. Felix W. Müller, 4300 Essen-Werden | Elektrische uv strahlenquelle fuer bestrahlungsgeraete |
| US3381289A (en) * | 1965-06-08 | 1968-04-30 | Westinghouse Electric Corp | Read-out indicator circuitry |
| US3483871A (en) * | 1966-05-20 | 1969-12-16 | Billy N Wilson | Suntanning device |
| IT972461B (it) * | 1972-07-20 | 1974-05-20 | F Maitan | Apparecchiatura per fototerapia bilateriale contemporanea pan irradiazione di mecnati affetti da ittero enolitico |
| US4010374A (en) * | 1975-06-02 | 1977-03-01 | Ppg Industries, Inc. | Ultraviolet light processor and method of exposing surfaces to ultraviolet light |
-
1976
- 1976-08-09 AT AT0590876A patent/AT375019B/de not_active IP Right Cessation
- 1976-08-13 GB GB16700/78A patent/GB1540489A/en not_active Expired
- 1976-08-13 CH CH1032076A patent/CH604746A5/xx not_active IP Right Cessation
- 1976-08-13 GB GB33845/76A patent/GB1540488A/en not_active Expired
- 1976-08-16 IE IE1485/79A patent/IE43316B1/en not_active IP Right Cessation
- 1976-08-16 IE IE1808/76A patent/IE43315B1/en not_active IP Right Cessation
- 1976-08-17 CA CA259,240A patent/CA1079782A/en not_active Expired
- 1976-08-20 NO NO76762886A patent/NO150307C/no unknown
- 1976-08-20 US US05/716,253 patent/US4095113A/en not_active Expired - Lifetime
- 1976-08-20 AU AU17021/76A patent/AU505720B2/en not_active Expired
- 1976-08-24 LU LU75653A patent/LU75653A1/xx unknown
- 1976-08-24 NL NLAANVRAGE7609410,A patent/NL184351C/xx not_active IP Right Cessation
- 1976-08-24 FI FI762425A patent/FI59929C/fi not_active IP Right Cessation
- 1976-08-25 JP JP51102191A patent/JPS5234587A/ja active Granted
- 1976-08-25 IT IT69081/76A patent/IT1069671B/it active
- 1976-08-25 DK DK382376A patent/DK147728C/da not_active IP Right Cessation
- 1976-08-25 SE SE7609401A patent/SE428176B/xx unknown
- 1976-08-26 BE BE170110A patent/BE845555A/xx not_active IP Right Cessation
- 1976-08-26 FR FR7625885A patent/FR2321908A1/fr active Granted
-
1978
- 1978-03-10 US US05/885,123 patent/US4196354A/en not_active Expired - Lifetime
-
1979
- 1979-11-28 US US06/097,966 patent/US4309616A/en not_active Expired - Lifetime
-
1980
- 1980-03-13 CA CA347,554A patent/CA1100169A/en not_active Expired
- 1980-03-13 CA CA347,553A patent/CA1100168A/en not_active Expired
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1079782A (en) | Apparatus for producing ultraviolet radiation | |
| US4469102A (en) | Suntanning booth | |
| US20250269198A1 (en) | Phototherapeutic apparatus for focused uvb radiation and vitamin d synthesis and associated systems and methods | |
| US4177384A (en) | Apparatus for producing ultraviolet radiation | |
| US3986513A (en) | Apparatus for irradiating the skin | |
| US4287554A (en) | Radiation apparatus | |
| US4974922A (en) | Light bath | |
| US4335724A (en) | Solarium | |
| DE2537855A1 (de) | Geraet zur flaechenhaften uv-bestrahlung | |
| CA2112132A1 (en) | Photodynamic stimulation device | |
| US4623796A (en) | Tanning apparatus with means which aid facial tanning | |
| DE3911679A1 (de) | Behandlungskabine | |
| US2631588A (en) | Booth for giving tan treatments | |
| Nachtwey et al. | A photobiological evaluation of tanning booths | |
| JPH0358747B2 (OSRAM) | ||
| DE19514602A1 (de) | Bestrahlungseinrichtung | |
| US2637322A (en) | Apparatus for producing healthful sleep | |
| DE2559610A1 (de) | Geraet zur flaechenhaften uv-bestrahlung | |
| US20110144728A1 (en) | Tanning lamp arrangement | |
| DE8904492U1 (de) | Behandlungskabine | |
| KR102631188B1 (ko) | 균일 태닝을 위한 태닝 장치 | |
| WO2001068184A1 (en) | Panel solarium | |
| GB2030694A (en) | Irradiation equipment in the form of a bed | |
| DE29702126U1 (de) | Therapie- und Behandlungskabine | |
| CN1097148A (zh) | 光综合治疗仪 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |