CA1070694A - Preparation of acylamido-1-(3-indolyl-aklylene)piperidines - Google Patents
Preparation of acylamido-1-(3-indolyl-aklylene)piperidinesInfo
- Publication number
- CA1070694A CA1070694A CA273,375A CA273375A CA1070694A CA 1070694 A CA1070694 A CA 1070694A CA 273375 A CA273375 A CA 273375A CA 1070694 A CA1070694 A CA 1070694A
- Authority
- CA
- Canada
- Prior art keywords
- formula
- compound
- ethyl
- lower alkyl
- indolyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 150000003053 piperidines Chemical class 0.000 title abstract 2
- -1 pyridinium compound Chemical class 0.000 claims abstract description 15
- 239000002904 solvent Substances 0.000 claims abstract description 7
- 229910052783 alkali metal Inorganic materials 0.000 claims abstract description 5
- 150000001340 alkali metals Chemical class 0.000 claims abstract description 5
- 238000004519 manufacturing process Methods 0.000 claims abstract description 4
- 150000001875 compounds Chemical class 0.000 claims description 23
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical group CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 claims description 18
- 229910052739 hydrogen Inorganic materials 0.000 claims description 14
- 239000001257 hydrogen Substances 0.000 claims description 14
- 125000000217 alkyl group Chemical group 0.000 claims description 12
- 238000000034 method Methods 0.000 claims description 12
- 125000004122 cyclic group Chemical group 0.000 claims description 9
- 125000004432 carbon atom Chemical group C* 0.000 claims description 7
- 230000009467 reduction Effects 0.000 claims description 7
- 125000003545 alkoxy group Chemical group 0.000 claims description 6
- JYVLIDXNZAXMDK-UHFFFAOYSA-N pentan-2-ol Chemical group CCCC(C)O JYVLIDXNZAXMDK-UHFFFAOYSA-N 0.000 claims description 6
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 5
- 229910052736 halogen Inorganic materials 0.000 claims description 5
- 150000002367 halogens Chemical group 0.000 claims description 5
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 5
- 125000003118 aryl group Chemical group 0.000 claims description 4
- JXZZEXZZKAWDSP-UHFFFAOYSA-N 3-(2-(4-Benzamidopiperid-1-yl)ethyl)indole Chemical compound C1CN(CCC=2C3=CC=CC=C3NC=2)CCC1NC(=O)C1=CC=CC=C1 JXZZEXZZKAWDSP-UHFFFAOYSA-N 0.000 claims description 3
- 239000002253 acid Substances 0.000 claims description 3
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 3
- 150000003839 salts Chemical class 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 150000001450 anions Chemical group 0.000 claims description 2
- 125000003435 aroyl group Chemical group 0.000 claims description 2
- 125000002102 aryl alkyloxo group Chemical group 0.000 claims description 2
- 125000004104 aryloxy group Chemical group 0.000 claims description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 2
- 150000002431 hydrogen Chemical group 0.000 claims 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 1
- 150000002475 indoles Chemical class 0.000 abstract description 2
- 230000000875 corresponding effect Effects 0.000 abstract 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N tetrahydropyridine hydrochloride Natural products C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 abstract 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 45
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 description 12
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 11
- 229910000033 sodium borohydride Inorganic materials 0.000 description 11
- 239000012279 sodium borohydride Substances 0.000 description 11
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 9
- 239000007858 starting material Substances 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 9
- 238000001914 filtration Methods 0.000 description 7
- PZOUSPYUWWUPPK-UHFFFAOYSA-N indole Natural products CC1=CC=CC2=C1C=CN2 PZOUSPYUWWUPPK-UHFFFAOYSA-N 0.000 description 6
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine Natural products C1=CC=C2CC=NC2=C1 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 6
- ITHIIWSDRXWJCY-UHFFFAOYSA-N n-[1-[2-(1h-indol-3-yl)ethyl]pyridin-1-ium-4-yl]benzamide;bromide Chemical compound [Br-].C=1C=[N+](CCC=2C3=CC=CC=C3NC=2)C=CC=1NC(=O)C1=CC=CC=C1 ITHIIWSDRXWJCY-UHFFFAOYSA-N 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 4
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 4
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 4
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- BTANRVKWQNVYAZ-UHFFFAOYSA-N butan-2-ol Chemical compound CCC(C)O BTANRVKWQNVYAZ-UHFFFAOYSA-N 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- VSWICNJIUPRZIK-UHFFFAOYSA-N 2-piperideine Chemical compound C1CNC=CC1 VSWICNJIUPRZIK-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- AMQJEAYHLZJPGS-UHFFFAOYSA-N N-Pentanol Chemical group CCCCCO AMQJEAYHLZJPGS-UHFFFAOYSA-N 0.000 description 2
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 2
- 229960002056 indoramin Drugs 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- 125000000242 4-chlorobenzoyl group Chemical group ClC1=CC=C(C(=O)*)C=C1 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 208000001953 Hypotension Diseases 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 239000000739 antihistaminic agent Substances 0.000 description 1
- 239000002220 antihypertensive agent Substances 0.000 description 1
- 229940054051 antipsychotic indole derivative Drugs 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 description 1
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 235000019256 formaldehyde Nutrition 0.000 description 1
- 238000007327 hydrogenolysis reaction Methods 0.000 description 1
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 1
- 208000021822 hypotensive Diseases 0.000 description 1
- 230000001077 hypotensive effect Effects 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- HZZCZFXEMXEVKJ-UHFFFAOYSA-N n-[1-[2-(1h-indol-3-yl)ethyl]piperidin-3-yl]benzamide Chemical compound C1CCN(CCC=2C3=CC=CC=C3NC=2)CC1NC(=O)C1=CC=CC=C1 HZZCZFXEMXEVKJ-UHFFFAOYSA-N 0.000 description 1
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- BBFCIBZLAVOLCF-UHFFFAOYSA-N pyridin-1-ium;bromide Chemical compound Br.C1=CC=NC=C1 BBFCIBZLAVOLCF-UHFFFAOYSA-N 0.000 description 1
- 238000011946 reduction process Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/06—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Plural Heterocyclic Compounds (AREA)
- Indole Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB7610114A GB1542137A (en) | 1976-03-12 | 1976-03-12 | Process for preparing 3(piperidinoalkyl)indoles |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1070694A true CA1070694A (en) | 1980-01-29 |
Family
ID=9961755
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA273,375A Expired CA1070694A (en) | 1976-03-12 | 1977-02-28 | Preparation of acylamido-1-(3-indolyl-aklylene)piperidines |
Country Status (26)
| Country | Link |
|---|---|
| US (1) | US4162252A (enExample) |
| JP (1) | JPS52111579A (enExample) |
| AR (1) | AR219069A1 (enExample) |
| AT (1) | AT353790B (enExample) |
| AU (1) | AU503764B2 (enExample) |
| BE (1) | BE852154A (enExample) |
| CA (1) | CA1070694A (enExample) |
| CH (1) | CH624680A5 (enExample) |
| DE (1) | DE2710714A1 (enExample) |
| DK (1) | DK143560C (enExample) |
| EG (1) | EG12701A (enExample) |
| ES (1) | ES456741A1 (enExample) |
| FI (1) | FI62299C (enExample) |
| FR (1) | FR2343738A1 (enExample) |
| GB (1) | GB1542137A (enExample) |
| GR (1) | GR64391B (enExample) |
| IE (1) | IE44446B1 (enExample) |
| IN (1) | IN145905B (enExample) |
| KE (1) | KE3182A (enExample) |
| MX (1) | MX4543E (enExample) |
| NL (1) | NL187112C (enExample) |
| NZ (1) | NZ183421A (enExample) |
| PT (1) | PT66294B (enExample) |
| SE (1) | SE435714B (enExample) |
| YU (1) | YU39991B (enExample) |
| ZA (1) | ZA771092B (enExample) |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3238215A (en) * | 1963-10-17 | 1966-03-01 | Sterling Drug Inc | 1-[(3-, 2-, and 1-indolyl)-lower-alkyl-, lower-alkenyl-, and lower-alkynyl]piperidines |
| GB1273563A (en) * | 1968-07-24 | 1972-05-10 | Wyeth John & Brother Ltd | Indoles |
| BE774645A (en) * | 1971-10-28 | 1972-02-14 | Wyeth John & Brother Ltd | 3-(cycloalkane amidopyridyl(or hydro-pyridyl)-alkyl-) - indoles - as anti inflammatory,hypotensive and antihistaminic agents |
| BE794333A (fr) * | 1972-01-20 | 1973-07-19 | Wyeth John & Brother Ltd | Composes heterocycliques azotes therapeutiques |
| GB1425354A (en) * | 1973-10-10 | 1976-02-18 | Wyeth John & Brother Ltd | Indole derivatives |
-
1976
- 1976-03-12 GB GB7610114A patent/GB1542137A/en not_active Expired
-
1977
- 1977-02-21 IE IE366/77A patent/IE44446B1/en not_active IP Right Cessation
- 1977-02-23 NZ NZ183421A patent/NZ183421A/xx unknown
- 1977-02-23 ZA ZA00771092A patent/ZA771092B/xx unknown
- 1977-02-24 AU AU22620/77A patent/AU503764B2/en not_active Expired
- 1977-02-25 YU YU523/77A patent/YU39991B/xx unknown
- 1977-02-25 GR GR52849A patent/GR64391B/el unknown
- 1977-02-28 CA CA273,375A patent/CA1070694A/en not_active Expired
- 1977-02-28 US US05/772,058 patent/US4162252A/en not_active Expired - Lifetime
- 1977-03-03 NL NLAANVRAGE7702314,A patent/NL187112C/xx not_active IP Right Cessation
- 1977-03-07 BE BE175526A patent/BE852154A/xx not_active IP Right Cessation
- 1977-03-07 IN IN332/CAL/77A patent/IN145905B/en unknown
- 1977-03-08 FR FR7706803A patent/FR2343738A1/fr active Granted
- 1977-03-08 AR AR266777A patent/AR219069A1/es active
- 1977-03-08 FI FI770735A patent/FI62299C/fi not_active IP Right Cessation
- 1977-03-09 EG EG145/77A patent/EG12701A/xx active
- 1977-03-09 AT AT157577A patent/AT353790B/de not_active IP Right Cessation
- 1977-03-10 DK DK105677A patent/DK143560C/da not_active IP Right Cessation
- 1977-03-10 CH CH305477A patent/CH624680A5/de not_active IP Right Cessation
- 1977-03-11 MX MX775533U patent/MX4543E/es unknown
- 1977-03-11 DE DE19772710714 patent/DE2710714A1/de active Granted
- 1977-03-11 JP JP2690677A patent/JPS52111579A/ja active Granted
- 1977-03-11 ES ES456741A patent/ES456741A1/es not_active Expired
- 1977-03-11 PT PT66294A patent/PT66294B/pt unknown
- 1977-03-11 SE SE7702802A patent/SE435714B/xx not_active IP Right Cessation
-
1981
- 1981-12-24 KE KE3182A patent/KE3182A/xx unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4423049A (en) | 2-[4-[(4,4-Dialkyl-2,6-piperidinedion-1-yl)butyl]-1-piperazinyl]pyrimidines | |
| EP0254322B1 (en) | Benzimidazole derivatives | |
| CA1237722A (en) | 2-¬4-¬(4,4,-dialkyl-2,6,-piperidinedion-1- yl)butyl|-1-piperazinyl| pyridines | |
| US4281132A (en) | Piperidino ureas and thioureas | |
| IE44276B1 (en) | Oxygenated n-aryl-diazacyclic compounds | |
| SU1436873A3 (ru) | Способ получени производных 1,2,4-триазолокарбамата или их кислотно-аддитивных солей | |
| CA1247101A (en) | 5-alkyl-1-phenyl-2-piperazinoalkylpyrazolin-3-one compounds, intermediates and methods for their preparation, and pharmaceutical compositions containing them | |
| US4436913A (en) | 1H- and 2H- indazole derivatives | |
| BG64559B1 (bg) | Метод за получаване на 5-{4-[2-(n-метил-n-(2-пиридил)амино)-етокси]бензил}-2,4-тиазолидиндион | |
| CA1093558A (en) | 3-benzoyl-or thenoyl-1-[1-(indole-3-ylmethyl) piperid-4-yl] urea compounds | |
| US4105771A (en) | 1-Aminoalkylpiperidine derivatives | |
| US4556739A (en) | 3,4-Dialkoxy-2-alkylcarbonyl analino compounds | |
| CA1070694A (en) | Preparation of acylamido-1-(3-indolyl-aklylene)piperidines | |
| GB1567313A (en) | 2,3-dihydro-3-hydroxy-1h-benz-(de)isoquinolin-1-one derivatives | |
| IL116384A (en) | Ylidene compounds and their preparation | |
| GB2044254A (en) | Novel piperidine derivatives | |
| US4242347A (en) | Hypotensive indolylalkylpiperidyl guanidines and isoureas | |
| JPH02124885A (ja) | イミダゾール抗不整脈剤 | |
| US5025011A (en) | Fused pyridines active on the cardiovascular system | |
| SK145798A3 (en) | Process for the production of formylimidazoles | |
| US4555573A (en) | Certain 6-benzamidomethyl-2(1H)-pyridone derivatives | |
| US4303663A (en) | Butyrophenone compounds | |
| US4091095A (en) | Phosphinyl compounds | |
| KR810000888B1 (ko) | 인돌유도체의 제조방법 | |
| US4140691A (en) | Process for preparing 3-[2-(4-benzamidopiperid-1-yl)ethyl]indole |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |