CA1058172A - Substituted nitrobenzophenone derivatives and a process for the preparation thereof - Google Patents
Substituted nitrobenzophenone derivatives and a process for the preparation thereofInfo
- Publication number
- CA1058172A CA1058172A CA205,477A CA205477A CA1058172A CA 1058172 A CA1058172 A CA 1058172A CA 205477 A CA205477 A CA 205477A CA 1058172 A CA1058172 A CA 1058172A
- Authority
- CA
- Canada
- Prior art keywords
- nitro
- benzophenone
- methyl
- preparation
- produced
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims abstract description 49
- 230000008569 process Effects 0.000 title claims abstract description 47
- 238000002360 preparation method Methods 0.000 title claims description 16
- UJHSIDUUJPTLDY-UHFFFAOYSA-N (2-nitrophenyl)-phenylmethanone Chemical class [O-][N+](=O)C1=CC=CC=C1C(=O)C1=CC=CC=C1 UJHSIDUUJPTLDY-UHFFFAOYSA-N 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims abstract description 25
- -1 piperidino, pyrrolidino Chemical group 0.000 claims abstract description 25
- 239000002253 acid Substances 0.000 claims abstract description 20
- 150000003839 salts Chemical class 0.000 claims abstract description 16
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 15
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims abstract description 14
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 11
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims abstract description 8
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 8
- 150000003242 quaternary ammonium salts Chemical class 0.000 claims abstract description 7
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 claims abstract description 6
- 125000004433 nitrogen atom Chemical group N* 0.000 claims abstract description 5
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 4
- 150000002367 halogens Chemical class 0.000 claims abstract description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 32
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 26
- 239000000126 substance Substances 0.000 claims description 19
- YBDBYPQFIMSFJW-UHFFFAOYSA-N (4-chloro-3-nitrophenyl)-phenylmethanone Chemical compound C1=C(Cl)C([N+](=O)[O-])=CC(C(=O)C=2C=CC=CC=2)=C1 YBDBYPQFIMSFJW-UHFFFAOYSA-N 0.000 claims description 17
- 239000012965 benzophenone Substances 0.000 claims description 17
- 150000001412 amines Chemical class 0.000 claims description 14
- 238000006243 chemical reaction Methods 0.000 claims description 10
- IOIWNQFKYZGKBN-UHFFFAOYSA-N [4-(4-methylpiperazin-1-yl)-3-nitrophenyl]-phenylmethanone Chemical compound C1CN(C)CCN1C1=CC=C(C(=O)C=2C=CC=CC=2)C=C1[N+]([O-])=O IOIWNQFKYZGKBN-UHFFFAOYSA-N 0.000 claims description 9
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 claims description 8
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 claims description 6
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 claims description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims description 6
- 239000011230 binding agent Substances 0.000 claims description 6
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 claims description 4
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 claims description 4
- OJGMBLNIHDZDGS-UHFFFAOYSA-N N-Ethylaniline Chemical compound CCNC1=CC=CC=C1 OJGMBLNIHDZDGS-UHFFFAOYSA-N 0.000 claims description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 4
- XTAQGEJTUAHPQY-UHFFFAOYSA-N [4-[methyl(octyl)amino]-3-nitrophenyl]-phenylmethanone Chemical compound C1=C([N+]([O-])=O)C(N(C)CCCCCCCC)=CC=C1C(=O)C1=CC=CC=C1 XTAQGEJTUAHPQY-UHFFFAOYSA-N 0.000 claims description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 4
- 239000012458 free base Substances 0.000 claims description 4
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 4
- 150000007530 organic bases Chemical group 0.000 claims description 4
- 239000003960 organic solvent Substances 0.000 claims description 4
- ZMTXSKUYSYBJSE-UHFFFAOYSA-N (3-nitro-4-piperidin-1-ylphenyl)-phenylmethanone Chemical compound [O-][N+](=O)C1=CC(C(=O)C=2C=CC=CC=2)=CC=C1N1CCCCC1 ZMTXSKUYSYBJSE-UHFFFAOYSA-N 0.000 claims description 3
- HHBAMTFXSSAHDN-UHFFFAOYSA-N (3-nitro-4-pyrrolidin-1-ylphenyl)-phenylmethanone Chemical compound [O-][N+](=O)C1=CC(C(=O)C=2C=CC=CC=2)=CC=C1N1CCCC1 HHBAMTFXSSAHDN-UHFFFAOYSA-N 0.000 claims description 3
- AJJXUPWZAVOODE-UHFFFAOYSA-N (4-morpholin-4-yl-3-nitrophenyl)-phenylmethanone Chemical compound [O-][N+](=O)C1=CC(C(=O)C=2C=CC=CC=2)=CC=C1N1CCOCC1 AJJXUPWZAVOODE-UHFFFAOYSA-N 0.000 claims description 3
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 claims description 3
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 3
- 125000006201 3-phenylpropyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 3
- UDIWAEGYDJIUSP-UHFFFAOYSA-N [4-[benzyl(methyl)amino]-3-nitrophenyl]-phenylmethanone Chemical compound C=1C=C(C(=O)C=2C=CC=CC=2)C=C([N+]([O-])=O)C=1N(C)CC1=CC=CC=C1 UDIWAEGYDJIUSP-UHFFFAOYSA-N 0.000 claims description 3
- JWOLHENSJADFDG-UHFFFAOYSA-N [4-[bis(2-methylpropyl)amino]-3-nitrophenyl]-phenylmethanone Chemical compound C1=C([N+]([O-])=O)C(N(CC(C)C)CC(C)C)=CC=C1C(=O)C1=CC=CC=C1 JWOLHENSJADFDG-UHFFFAOYSA-N 0.000 claims description 3
- KFGHEUFFORKTBH-UHFFFAOYSA-N [4-[cyclohexyl(ethyl)amino]-3-nitrophenyl]-phenylmethanone Chemical compound C=1C=C(C(=O)C=2C=CC=CC=2)C=C([N+]([O-])=O)C=1N(CC)C1CCCCC1 KFGHEUFFORKTBH-UHFFFAOYSA-N 0.000 claims description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 3
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 3
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 claims description 3
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 claims description 3
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 claims description 3
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 claims description 2
- PVOAHINGSUIXLS-UHFFFAOYSA-N 1-Methylpiperazine Chemical compound CN1CCNCC1 PVOAHINGSUIXLS-UHFFFAOYSA-N 0.000 claims description 2
- NJBCRXCAPCODGX-UHFFFAOYSA-N 2-methyl-n-(2-methylpropyl)propan-1-amine Chemical compound CC(C)CNCC(C)C NJBCRXCAPCODGX-UHFFFAOYSA-N 0.000 claims description 2
- QXNDZONIWRINJR-UHFFFAOYSA-N azocane Chemical compound C1CCCNCCC1 QXNDZONIWRINJR-UHFFFAOYSA-N 0.000 claims description 2
- RDHPKYGYEGBMSE-UHFFFAOYSA-N bromoethane Chemical compound CCBr RDHPKYGYEGBMSE-UHFFFAOYSA-N 0.000 claims description 2
- RIWRFSMVIUAEBX-UHFFFAOYSA-N n-methyl-1-phenylmethanamine Chemical compound CNCC1=CC=CC=C1 RIWRFSMVIUAEBX-UHFFFAOYSA-N 0.000 claims description 2
- SEGJNMCIMOLEDM-UHFFFAOYSA-N n-methyloctan-1-amine Chemical compound CCCCCCCCNC SEGJNMCIMOLEDM-UHFFFAOYSA-N 0.000 claims description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 2
- 150000003335 secondary amines Chemical class 0.000 claims description 2
- 239000000376 reactant Substances 0.000 claims 11
- XDXYSIBCCRBMFE-UHFFFAOYSA-N [4-(n-ethylanilino)-3-nitrophenyl]-phenylmethanone Chemical compound C=1C=C(C(=O)C=2C=CC=CC=2)C=C([N+]([O-])=O)C=1N(CC)C1=CC=CC=C1 XDXYSIBCCRBMFE-UHFFFAOYSA-N 0.000 claims 2
- ONLOWPRDSVDQGH-UHFFFAOYSA-N (4-bromo-3-nitrophenyl)-phenylmethanone Chemical compound C1=C(Br)C([N+](=O)[O-])=CC(C(=O)C=2C=CC=CC=2)=C1 ONLOWPRDSVDQGH-UHFFFAOYSA-N 0.000 claims 1
- AGVKXDPPPSLISR-UHFFFAOYSA-N n-ethylcyclohexanamine Chemical compound CCNC1CCCCC1 AGVKXDPPPSLISR-UHFFFAOYSA-N 0.000 claims 1
- JACMPVXHEARCBO-UHFFFAOYSA-N n-pentylpentan-1-amine Chemical compound CCCCCNCCCCC JACMPVXHEARCBO-UHFFFAOYSA-N 0.000 claims 1
- 230000001754 anti-pyretic effect Effects 0.000 abstract description 5
- 102000004190 Enzymes Human genes 0.000 abstract description 4
- 108090000790 Enzymes Proteins 0.000 abstract description 4
- 230000006698 induction Effects 0.000 abstract description 3
- 210000004185 liver Anatomy 0.000 abstract description 3
- 230000003228 microsomal effect Effects 0.000 abstract description 2
- 125000000467 secondary amino group Chemical class [H]N([*:1])[*:2] 0.000 abstract 1
- 229910052757 nitrogen Inorganic materials 0.000 description 15
- 229910052739 hydrogen Inorganic materials 0.000 description 14
- 229940024874 benzophenone Drugs 0.000 description 13
- 239000000203 mixture Substances 0.000 description 13
- 239000000047 product Substances 0.000 description 11
- 241001342522 Vampyrum spectrum Species 0.000 description 10
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 241000786363 Rhampholeon spectrum Species 0.000 description 9
- 241001465754 Metazoa Species 0.000 description 8
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 8
- 239000000243 solution Substances 0.000 description 8
- 229910052740 iodine Inorganic materials 0.000 description 7
- 229920006395 saturated elastomer Polymers 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- 239000002585 base Substances 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 5
- 239000013543 active substance Substances 0.000 description 5
- CPJSUEIXXCENMM-UHFFFAOYSA-N phenacetin Chemical compound CCOC1=CC=C(NC(C)=O)C=C1 CPJSUEIXXCENMM-UHFFFAOYSA-N 0.000 description 5
- 229960003893 phenacetin Drugs 0.000 description 5
- DDBREPKUVSBGFI-UHFFFAOYSA-N phenobarbital Chemical compound C=1C=CC=CC=1C1(CC)C(=O)NC(=O)NC1=O DDBREPKUVSBGFI-UHFFFAOYSA-N 0.000 description 5
- 229960002695 phenobarbital Drugs 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 4
- 239000000155 melt Substances 0.000 description 4
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- 125000004429 atom Chemical group 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 239000012153 distilled water Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 125000000623 heterocyclic group Chemical group 0.000 description 3
- 230000001939 inductive effect Effects 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 241000700159 Rattus Species 0.000 description 2
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 125000002947 alkylene group Chemical group 0.000 description 2
- 230000002082 anti-convulsion Effects 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- RWCCWEUUXYIKHB-UHFFFAOYSA-N benzophenone Chemical compound C=1C=CC=CC=1C(=O)C1=CC=CC=C1 RWCCWEUUXYIKHB-UHFFFAOYSA-N 0.000 description 2
- 210000003169 central nervous system Anatomy 0.000 description 2
- HVYWMOMLDIMFJA-DPAQBDIFSA-N cholesterol Chemical compound C1C=C2C[C@@H](O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC2 HVYWMOMLDIMFJA-DPAQBDIFSA-N 0.000 description 2
- 125000000753 cycloalkyl group Chemical group 0.000 description 2
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 239000001530 fumaric acid Substances 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 2
- 235000019341 magnesium sulphate Nutrition 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- 125000002112 pyrrolidino group Chemical group [*]N1C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 2
- 239000013558 reference substance Substances 0.000 description 2
- 238000005303 weighing Methods 0.000 description 2
- UGNJWQMNCJYWHG-UHFFFAOYSA-N 2,3,4-trimethoxy-6-methylphenol Chemical compound COC1=CC(C)=C(O)C(OC)=C1OC UGNJWQMNCJYWHG-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- ROLMZTIHUMKEAI-UHFFFAOYSA-N 4,5-difluoro-2-hydroxybenzonitrile Chemical compound OC1=CC(F)=C(F)C=C1C#N ROLMZTIHUMKEAI-UHFFFAOYSA-N 0.000 description 1
- XPYQFIISZQCINN-QVXDJYSKSA-N 4-amino-1-[(2r,3e,4s,5r)-3-(fluoromethylidene)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one;hydrate Chemical compound O.O=C1N=C(N)C=CN1[C@H]1C(=C/F)/[C@H](O)[C@@H](CO)O1 XPYQFIISZQCINN-QVXDJYSKSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 206010003591 Ataxia Diseases 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 239000001828 Gelatine Substances 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- 208000007101 Muscle Cramp Diseases 0.000 description 1
- QMGVPVSNSZLJIA-UHFFFAOYSA-N Nux Vomica Natural products C1C2C3C4N(C=5C6=CC=CC=5)C(=O)CC3OCC=C2CN2C1C46CC2 QMGVPVSNSZLJIA-UHFFFAOYSA-N 0.000 description 1
- CWRVKFFCRWGWCS-UHFFFAOYSA-N Pentrazole Chemical compound C1CCCCC2=NN=NN21 CWRVKFFCRWGWCS-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 208000005392 Spasm Diseases 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- AVYUKZRROFQFPA-UHFFFAOYSA-N Strychnin Natural products C1C2C3C4N(C=5C6=CC=CC=5)C(=O)CC3OC=CC2CN2C1C46CC2 AVYUKZRROFQFPA-UHFFFAOYSA-N 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 241000009298 Trigla lyra Species 0.000 description 1
- GOLLJWMMYHXYES-UHFFFAOYSA-N [2-(3-nitromorpholin-4-yl)phenyl]-phenylmethanone Chemical compound [N+](=O)([O-])C1N(CCOC1)C1=CC=CC=C1C(=O)C1=CC=CC=C1 GOLLJWMMYHXYES-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 239000002221 antipyretic Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 239000012752 auxiliary agent Substances 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 150000008366 benzophenones Chemical class 0.000 description 1
- 230000036760 body temperature Effects 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- JLQUFIHWVLZVTJ-UHFFFAOYSA-N carbosulfan Chemical compound CCCCN(CCCC)SN(C)C(=O)OC1=CC=CC2=C1OC(C)(C)C2 JLQUFIHWVLZVTJ-UHFFFAOYSA-N 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 235000012000 cholesterol Nutrition 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000001485 cycloalkadienyl group Chemical group 0.000 description 1
- 125000000392 cycloalkenyl group Chemical group 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 125000006612 decyloxy group Chemical group 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-N ethanesulfonic acid Chemical compound CCS(O)(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-N 0.000 description 1
- 235000019441 ethanol Nutrition 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 238000011049 filling Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 235000011087 fumaric acid Nutrition 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 230000009931 harmful effect Effects 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- 229960002456 hexobarbital Drugs 0.000 description 1
- UYXAWHWODHRRMR-UHFFFAOYSA-N hexobarbital Chemical compound O=C1N(C)C(=O)NC(=O)C1(C)C1=CCCCC1 UYXAWHWODHRRMR-UHFFFAOYSA-N 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- 230000000147 hypnotic effect Effects 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 210000003734 kidney Anatomy 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- IWYDHOAUDWTVEP-UHFFFAOYSA-N mandelic acid Chemical compound OC(=O)C(O)C1=CC=CC=C1 IWYDHOAUDWTVEP-UHFFFAOYSA-N 0.000 description 1
- 229960002510 mandelic acid Drugs 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 125000002950 monocyclic group Chemical group 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 230000003204 osmotic effect Effects 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000008194 pharmaceutical composition Substances 0.000 description 1
- 230000004526 pharmaceutical effect Effects 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 229940127557 pharmaceutical product Drugs 0.000 description 1
- 239000002504 physiological saline solution Substances 0.000 description 1
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 235000013772 propylene glycol Nutrition 0.000 description 1
- 238000010825 rotarod performance test Methods 0.000 description 1
- XMVJITFPVVRMHC-UHFFFAOYSA-N roxarsone Chemical group OC1=CC=C([As](O)(O)=O)C=C1[N+]([O-])=O XMVJITFPVVRMHC-UHFFFAOYSA-N 0.000 description 1
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 238000004904 shortening Methods 0.000 description 1
- RGHFKWPGWBFQLN-UHFFFAOYSA-M sodium;5,5-diethylpyrimidin-3-ide-2,4,6-trione Chemical compound [Na+].CCC1(CC)C([O-])=NC(=O)NC1=O RGHFKWPGWBFQLN-UHFFFAOYSA-M 0.000 description 1
- 230000003381 solubilizing effect Effects 0.000 description 1
- 238000000638 solvent extraction Methods 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 230000001954 sterilising effect Effects 0.000 description 1
- QMGVPVSNSZLJIA-FVWCLLPLSA-N strychnine Chemical compound O([C@H]1CC(N([C@H]2[C@H]1[C@H]1C3)C=4C5=CC=CC=4)=O)CC=C1CN1[C@@H]3[C@]25CC1 QMGVPVSNSZLJIA-FVWCLLPLSA-N 0.000 description 1
- 229960005453 strychnine Drugs 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 238000011200 topical administration Methods 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/10—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by doubly bound oxygen or sulphur atoms
- C07D295/112—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by doubly bound oxygen or sulphur atoms with the ring nitrogen atoms and the doubly bound oxygen or sulfur atoms separated by carbocyclic rings or by carbon chains interrupted by carbocyclic rings
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
Landscapes
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Pharmacology & Pharmacy (AREA)
- Engineering & Computer Science (AREA)
- Animal Behavior & Ethology (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Hydrogenated Pyridines (AREA)
- Pyrrole Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HURI517A HU167949B (enExample) | 1973-07-26 | 1973-07-26 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1058172A true CA1058172A (en) | 1979-07-10 |
Family
ID=11000927
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA205,477A Expired CA1058172A (en) | 1973-07-26 | 1974-07-23 | Substituted nitrobenzophenone derivatives and a process for the preparation thereof |
Country Status (22)
| Country | Link |
|---|---|
| US (2) | US3957777A (enExample) |
| JP (1) | JPS5545065B2 (enExample) |
| AT (1) | AT340395B (enExample) |
| BE (1) | BE818020A (enExample) |
| BG (1) | BG21849A3 (enExample) |
| CA (1) | CA1058172A (enExample) |
| CH (1) | CH605646A5 (enExample) |
| CS (1) | CS180640B2 (enExample) |
| DD (1) | DD116030A5 (enExample) |
| DE (1) | DE2435816C3 (enExample) |
| DK (1) | DK393574A (enExample) |
| ES (1) | ES428673A1 (enExample) |
| FI (1) | FI62056C (enExample) |
| FR (1) | FR2238483B1 (enExample) |
| GB (1) | GB1441872A (enExample) |
| HU (1) | HU167949B (enExample) |
| IL (1) | IL45139A (enExample) |
| NL (1) | NL7409731A (enExample) |
| PL (1) | PL91401B1 (enExample) |
| SE (1) | SE408170B (enExample) |
| SU (1) | SU673175A3 (enExample) |
| YU (1) | YU37312B (enExample) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2508445A1 (fr) * | 1981-06-29 | 1982-12-31 | Sori Soc Rech Ind | Nouveaux derives de benzoyl-phenyl-piperidine, leur procede de preparation et leur application, notamment en therapeutique |
| US5006563A (en) * | 1989-12-14 | 1991-04-09 | Hoechst-Roussel Pharmaceuticals Inc. | Alkylamino- and alkylamino alkyl diarylketones |
| US5177111A (en) * | 1989-12-14 | 1993-01-05 | Hoechst-Roussel Pharmaceuticals Inc. | Alkylamino- and alkylamino alkyl diarylketones and pharmaceutical compositions thereof |
| DE4425794A1 (de) * | 1994-07-21 | 1996-01-25 | Basf Ag | Nitrofarbstoffe |
| RU2522570C1 (ru) * | 2012-12-25 | 2014-07-20 | Федеральное государственное бюджетное образовательное учреждение высшего профессионального образования "Ярославский государственный университет им. П.Г. Демидова" | Способ совместного получения 3,3'-динитро-4,4'-бис(n, n-диметиламино)бензофенона и 3,3'-динитро-4-гидрокси-4'-(n, n-диметиламино)бензофенона |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3439016A (en) * | 1962-11-13 | 1969-04-15 | Hoffmann La Roche | 2-amino-2' and 4'-cyanobenzophenones |
| CH423051A (de) * | 1962-12-11 | 1966-10-31 | Ciba Geigy | Verfahren zur Herstellung neuer Nitrofarbstoffpigmente |
| GB1062950A (en) * | 1963-12-31 | 1967-03-22 | Gevaert Photo Prod Nv | Trimethine dyes |
| US3510517A (en) * | 1967-05-12 | 1970-05-05 | Velsicol Chemical Corp | 2-dimethylamino-5-chloro-benzhydrols |
| US3644528A (en) * | 1969-01-23 | 1972-02-22 | Phillips Petroleum Co | Calcium or magnesium-ketone reaction products as polymerization initiators |
-
1973
- 1973-07-26 HU HURI517A patent/HU167949B/hu unknown
-
1974
- 1974-06-25 AT AT527274A patent/AT340395B/de not_active IP Right Cessation
- 1974-06-27 IL IL45139A patent/IL45139A/xx unknown
- 1974-07-03 US US05/485,701 patent/US3957777A/en not_active Expired - Lifetime
- 1974-07-03 YU YU1883/74A patent/YU37312B/xx unknown
- 1974-07-09 GB GB3028774A patent/GB1441872A/en not_active Expired
- 1974-07-15 BG BG027245A patent/BG21849A3/xx unknown
- 1974-07-18 NL NL7409731A patent/NL7409731A/xx not_active Application Discontinuation
- 1974-07-19 CS CS7400005164A patent/CS180640B2/cs unknown
- 1974-07-22 DK DK393574A patent/DK393574A/da not_active Application Discontinuation
- 1974-07-22 FI FI2230/74A patent/FI62056C/fi active
- 1974-07-23 DD DD180077A patent/DD116030A5/xx unknown
- 1974-07-23 SE SE7409581A patent/SE408170B/xx unknown
- 1974-07-23 CA CA205,477A patent/CA1058172A/en not_active Expired
- 1974-07-24 CH CH1022174A patent/CH605646A5/xx not_active IP Right Cessation
- 1974-07-24 FR FR7425735A patent/FR2238483B1/fr not_active Expired
- 1974-07-24 PL PL1974172980A patent/PL91401B1/pl unknown
- 1974-07-24 BE BE146878A patent/BE818020A/xx not_active IP Right Cessation
- 1974-07-25 JP JP8556674A patent/JPS5545065B2/ja not_active Expired
- 1974-07-25 DE DE2435816A patent/DE2435816C3/de not_active Expired
- 1974-07-25 SU SU742048653A patent/SU673175A3/ru active
- 1974-07-26 ES ES428673A patent/ES428673A1/es not_active Expired
-
1975
- 1975-08-12 US US05/603,853 patent/US4221739A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5545065B2 (enExample) | 1980-11-15 |
| US4221739A (en) | 1980-09-09 |
| NL7409731A (nl) | 1975-01-28 |
| SE408170B (sv) | 1979-05-21 |
| FI62056C (fi) | 1982-11-10 |
| CS180640B2 (en) | 1978-01-31 |
| JPS5041844A (enExample) | 1975-04-16 |
| BG21849A3 (bg) | 1976-09-20 |
| CH605646A5 (enExample) | 1978-10-13 |
| YU188374A (en) | 1983-04-27 |
| IL45139A0 (en) | 1974-09-10 |
| DE2435816B2 (de) | 1977-12-08 |
| FI62056B (fi) | 1982-07-30 |
| FI223074A7 (enExample) | 1975-01-27 |
| HU167949B (enExample) | 1976-01-28 |
| IL45139A (en) | 1978-03-10 |
| AT340395B (de) | 1977-12-12 |
| AU7077774A (en) | 1976-01-08 |
| DD116030A5 (enExample) | 1975-11-05 |
| SU673175A3 (ru) | 1979-07-05 |
| DK393574A (enExample) | 1975-04-01 |
| GB1441872A (en) | 1976-07-07 |
| US3957777A (en) | 1976-05-18 |
| ES428673A1 (es) | 1976-09-01 |
| PL91401B1 (enExample) | 1977-02-28 |
| FR2238483B1 (enExample) | 1978-07-21 |
| SE7409581L (enExample) | 1975-01-27 |
| YU37312B (en) | 1984-08-31 |
| DE2435816A1 (de) | 1975-02-06 |
| DE2435816C3 (de) | 1978-08-24 |
| BE818020A (fr) | 1974-11-18 |
| ATA527274A (de) | 1977-04-15 |
| FR2238483A1 (enExample) | 1975-02-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPH0272170A (ja) | ナフトエ酸ラクトン誘導体 | |
| DE2523281A1 (de) | Derivate des trans-3-hydroxy-4-amino-chromans, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel | |
| EP0202580A2 (en) | 3,4-Dihydrobenzopyran derivatives | |
| EP0000220B1 (de) | Dihydrouracile, Verfahren zu ihrer Herstellung und sie enthaltende Arzneimittel | |
| EP0005232B1 (de) | Isochinolinderivate, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Zubereitungen | |
| CA1058172A (en) | Substituted nitrobenzophenone derivatives and a process for the preparation thereof | |
| US3932411A (en) | 3,4-Dihydro-2H-naphthalene-1-one-5-oxypropyl-piperazine compounds | |
| US4980354A (en) | Tetrahydronaphthalene and indane derivatives | |
| US3931222A (en) | Tetrahydro-carbazole derivates | |
| US3953448A (en) | Piperazino-anilido compounds | |
| EP0122488A1 (de) | Bis-(Piperazinyl- bzw. Homopiperazinyl)-Alkane | |
| US3975390A (en) | N-methyl substituted piperazino nitrobenzophenones and a process for the preparation thereof | |
| US4478838A (en) | 1-(3,4,5-Trimethoxycinnamoyl)-4-alkylaminocarbonylethyl piperazines | |
| US5703237A (en) | N-Aminoalkyl-2-anthraquinonecarboxamides; new dopamine receptor subtype specific ligands | |
| US4064121A (en) | Substituted nitrobenzophenone derivatives and a process for the preparation thereof | |
| US4140790A (en) | 3-(4-Substituted piperazino)-1-xanthene-9-carbonyloxy-propanes | |
| EP0005821A1 (de) | Indanaminderivate, Verfahren zur Herstellung derselben und Arzneimittel, welche diese enthalten | |
| DE2359820A1 (de) | 1-aminomethyl-2,2-diarylcyclopropancarbonsaeureamid-derivate und verfahren zu ihrer herstellung | |
| EP0004332A1 (de) | Isochinole,Verfahren zu ihrer Herstellung und diese enthaltende Arzneimittel | |
| DE2517020A1 (de) | Alkanolaminderivate, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel | |
| US3951963A (en) | 0-(Substituted-aminoalkyl)-5-nitroimidazole-(2)-aldoximes | |
| CA2251795C (en) | Novel n-aminoalkyl-1-biphenylenyl-2-carboxamides; new dopamine receptor subtype specific ligands | |
| US4014884A (en) | Basically substituted 3,4-dihydro-2H-isoquinolin-1-thiones | |
| US5451584A (en) | N-alkynyl carboxamides as sertonergic agents | |
| DE2654888A1 (de) | Diphenylacetamide, verfahren zu ihrer herstellung und sie enthaltende arzneimittel |