CA1050544A - Process for the preparation of 2-acylamino-benzylamines - Google Patents
Process for the preparation of 2-acylamino-benzylaminesInfo
- Publication number
- CA1050544A CA1050544A CA205,415A CA205415A CA1050544A CA 1050544 A CA1050544 A CA 1050544A CA 205415 A CA205415 A CA 205415A CA 1050544 A CA1050544 A CA 1050544A
- Authority
- CA
- Canada
- Prior art keywords
- phenyl
- prepared
- reacting
- chloro
- benzylamine
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims abstract description 23
- 238000002360 preparation method Methods 0.000 title claims abstract description 11
- 150000001875 compounds Chemical class 0.000 claims abstract description 17
- 238000006243 chemical reaction Methods 0.000 claims abstract description 8
- 239000002253 acid Substances 0.000 claims description 14
- -1 hydroxycyclohexyl Chemical group 0.000 claims description 11
- 150000003839 salts Chemical class 0.000 claims description 11
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 9
- BHUKCEYZKFAGEY-UHFFFAOYSA-N 2-(methylamino)-1-morpholin-4-ylethanone Chemical compound CNCC(=O)N1CCOCC1 BHUKCEYZKFAGEY-UHFFFAOYSA-N 0.000 claims description 6
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 6
- UBKQQWZEERYSOW-UHFFFAOYSA-N 5-chloro-2-phenyl-4H-3,1-benzoxazine Chemical compound ClC1=CC=CC2=C1COC(=N2)C2=CC=CC=C2 UBKQQWZEERYSOW-UHFFFAOYSA-N 0.000 claims description 4
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims description 4
- 239000000460 chlorine Substances 0.000 claims description 4
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- FSYKKLYZXJSNPZ-UHFFFAOYSA-N sarcosine Chemical compound C[NH2+]CC([O-])=O FSYKKLYZXJSNPZ-UHFFFAOYSA-N 0.000 claims description 4
- 239000002904 solvent Substances 0.000 claims description 4
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 claims description 3
- 150000001412 amines Chemical class 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- HEPOIJKOXBKKNJ-UHFFFAOYSA-N 2-(propan-2-ylazaniumyl)acetate Chemical compound CC(C)NCC(O)=O HEPOIJKOXBKKNJ-UHFFFAOYSA-N 0.000 claims description 2
- VNGWVUIEAJNWDT-UHFFFAOYSA-N 5-bromo-2-phenyl-4H-3,1-benzoxazine Chemical compound BrC1=CC=CC2=C1COC(=N2)C2=CC=CC=C2 VNGWVUIEAJNWDT-UHFFFAOYSA-N 0.000 claims description 2
- WYVQPRSCIDJVSW-UHFFFAOYSA-N 6,8-dibromo-2-phenyl-4H-3,1-benzoxazine Chemical compound BrC=1C=C(C2=C(COC(=N2)C2=CC=CC=C2)C1)Br WYVQPRSCIDJVSW-UHFFFAOYSA-N 0.000 claims description 2
- DKWARGDCHPXUDA-UHFFFAOYSA-N 7-chloro-2-phenyl-4H-3,1-benzoxazine Chemical compound C1(=CC=CC=C1)C1=NC2=C(CO1)C=CC(=C2)Cl DKWARGDCHPXUDA-UHFFFAOYSA-N 0.000 claims description 2
- XTUVJUMINZSXGF-UHFFFAOYSA-N N-methylcyclohexylamine Chemical compound CNC1CCCCC1 XTUVJUMINZSXGF-UHFFFAOYSA-N 0.000 claims description 2
- PAMIQIKDUOTOBW-UHFFFAOYSA-N N-methylcyclohexylamine Natural products CN1CCCCC1 PAMIQIKDUOTOBW-UHFFFAOYSA-N 0.000 claims description 2
- 108010077895 Sarcosine Proteins 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 2
- XUWVIABDWDTJRZ-UHFFFAOYSA-N propan-2-ylazanide Chemical compound CC(C)[NH-] XUWVIABDWDTJRZ-UHFFFAOYSA-N 0.000 claims description 2
- 229940043230 sarcosine Drugs 0.000 claims description 2
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims description 2
- KSNNEUZOAFRTDS-UHFFFAOYSA-N fominoben Chemical compound ClC=1C=CC=C(NC(=O)C=2C=CC=CC=2)C=1CN(C)CC(=O)N1CCOCC1 KSNNEUZOAFRTDS-UHFFFAOYSA-N 0.000 claims 2
- 125000000590 4-methylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 claims 1
- CAIIHUQPTULPIY-UHFFFAOYSA-N 6,8-dibromo-2-phenyl-4H-3,1-benzoxazine hydrobromide Chemical compound Br.BrC=1C=C(C2=C(COC(=N2)C2=CC=CC=C2)C1)Br CAIIHUQPTULPIY-UHFFFAOYSA-N 0.000 claims 1
- ZZQSFFNQYSNMBT-UHFFFAOYSA-N N-[2,4-dibromo-6-[[methyl-(2-morpholin-4-yl-2-oxoethyl)amino]methyl]phenyl]benzamide Chemical compound C(C1=CC=CC=C1)(=O)NC1=C(CN(CC(=O)N2CCOCC2)C)C=C(C=C1Br)Br ZZQSFFNQYSNMBT-UHFFFAOYSA-N 0.000 claims 1
- DFDUDRITYNZCLP-UHFFFAOYSA-N N-[3-chloro-2-[[(2-morpholin-4-yl-2-oxoethyl)-propan-2-ylamino]methyl]phenyl]benzamide Chemical compound C(C1=CC=CC=C1)(=O)NC1=C(CN(CC(=O)N2CCOCC2)C(C)C)C(=CC=C1)Cl DFDUDRITYNZCLP-UHFFFAOYSA-N 0.000 claims 1
- WLMVUCVOAJYFKF-UHFFFAOYSA-N N-[5-chloro-2-[[methyl-[2-oxo-2-(propan-2-ylamino)ethyl]amino]methyl]phenyl]benzamide Chemical compound C(C)(C)NC(CN(C)CC1=C(C=C(C=C1)Cl)NC(C1=CC=CC=C1)=O)=O WLMVUCVOAJYFKF-UHFFFAOYSA-N 0.000 claims 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 claims 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 claims 1
- 239000000126 substance Substances 0.000 claims 1
- 239000000543 intermediate Substances 0.000 abstract description 2
- 230000000144 pharmacologic effect Effects 0.000 abstract description 2
- 239000007858 starting material Substances 0.000 abstract description 2
- 150000005130 benzoxazines Chemical class 0.000 abstract 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 abstract 1
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 abstract 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 5
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- WVDDGKGOMKODPV-UHFFFAOYSA-N hydroxymethyl benzene Natural products OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 3
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 235000019445 benzyl alcohol Nutrition 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- 230000018044 dehydration Effects 0.000 description 2
- 238000006297 dehydration reaction Methods 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- CXWXQJXEFPUFDZ-UHFFFAOYSA-N tetralin Chemical compound C1=CC=C2CCCCC2=C1 CXWXQJXEFPUFDZ-UHFFFAOYSA-N 0.000 description 2
- GVOYKJPMUUJXBS-UHFFFAOYSA-N 2-(aminomethyl)aniline Chemical class NCC1=CC=CC=C1N GVOYKJPMUUJXBS-UHFFFAOYSA-N 0.000 description 1
- YLZOPXRUQYQQID-UHFFFAOYSA-N 3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)-1-[4-[2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidin-5-yl]piperazin-1-yl]propan-1-one Chemical compound N1N=NC=2CN(CCC=21)CCC(=O)N1CCN(CC1)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F YLZOPXRUQYQQID-UHFFFAOYSA-N 0.000 description 1
- XAZNOOMRYLFDQO-UHFFFAOYSA-N 4h-3,1-benzoxazine Chemical class C1=CC=C2COC=NC2=C1 XAZNOOMRYLFDQO-UHFFFAOYSA-N 0.000 description 1
- BCQWCVSTWHSYNS-UHFFFAOYSA-N N-[2,4-dibromo-6-[[methyl-(2-morpholin-2-yl-2-oxoethyl)amino]methyl]phenyl]benzamide Chemical compound C(C1=CC=CC=C1)(=O)NC1=C(CN(CC(=O)C2CNCCO2)C)C=C(C=C1Br)Br BCQWCVSTWHSYNS-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 101150057388 Reln gene Proteins 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 150000003935 benzaldehydes Chemical class 0.000 description 1
- 150000003938 benzyl alcohols Chemical class 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 239000012024 dehydrating agents Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- GPDRKPABYHURLK-UHFFFAOYSA-N n-[2,4-dibromo-6-[[cyclohexyl(methyl)amino]methyl]phenyl]benzamide;hydrochloride Chemical compound Cl.C1CCCCC1N(C)CC1=CC(Br)=CC(Br)=C1NC(=O)C1=CC=CC=C1 GPDRKPABYHURLK-UHFFFAOYSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D265/00—Heterocyclic compounds containing six-membered rings having one nitrogen atom and one oxygen atom as the only ring hetero atoms
- C07D265/04—1,3-Oxazines; Hydrogenated 1,3-oxazines
- C07D265/12—1,3-Oxazines; Hydrogenated 1,3-oxazines condensed with carbocyclic rings or ring systems
- C07D265/14—1,3-Oxazines; Hydrogenated 1,3-oxazines condensed with carbocyclic rings or ring systems condensed with one six-membered ring
- C07D265/16—1,3-Oxazines; Hydrogenated 1,3-oxazines condensed with carbocyclic rings or ring systems condensed with one six-membered ring with only hydrogen or carbon atoms directly attached in positions 2 and 4
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/16—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms
- C07D295/18—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms by radicals derived from carboxylic acids, or sulfur or nitrogen analogues thereof
- C07D295/182—Radicals derived from carboxylic acids
- C07D295/185—Radicals derived from carboxylic acids from aliphatic carboxylic acids
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19732337456 DE2337456A1 (de) | 1973-07-24 | 1973-07-24 | Neues verfahren zur herstellung von 2-acylamino-benzylaminen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1050544A true CA1050544A (en) | 1979-03-13 |
Family
ID=5887784
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA205,415A Expired CA1050544A (en) | 1973-07-24 | 1974-07-23 | Process for the preparation of 2-acylamino-benzylamines |
Country Status (13)
| Country | Link |
|---|---|
| JP (2) | JPS5817456B2 (enExample) |
| AT (1) | AT333262B (enExample) |
| BG (1) | BG23744A3 (enExample) |
| CA (1) | CA1050544A (enExample) |
| CH (2) | CH605866A5 (enExample) |
| DK (1) | DK140009C (enExample) |
| ES (1) | ES427951A1 (enExample) |
| FI (2) | FI61311C (enExample) |
| HU (1) | HU167972B (enExample) |
| NL (1) | NL7409722A (enExample) |
| PL (1) | PL91391B1 (enExample) |
| SE (2) | SE413893B (enExample) |
| YU (1) | YU36366B (enExample) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JP6378894B2 (ja) * | 2014-02-27 | 2018-08-22 | 国立大学法人東京工業大学 | トリフルオロメチル基含有オキサジン類及びその製造方法 |
-
1974
- 1974-06-11 FI FI1775/74A patent/FI61311C/fi active
- 1974-06-20 AT AT510774A patent/AT333262B/de not_active IP Right Cessation
- 1974-06-26 BG BG027081A patent/BG23744A3/xx unknown
- 1974-07-01 YU YU01844/74A patent/YU36366B/xx unknown
- 1974-07-04 ES ES0427951A patent/ES427951A1/es not_active Expired
- 1974-07-18 NL NL7409722A patent/NL7409722A/xx not_active Application Discontinuation
- 1974-07-22 HU HUTO970A patent/HU167972B/hu unknown
- 1974-07-22 CH CH1453677A patent/CH605866A5/xx not_active IP Right Cessation
- 1974-07-22 CH CH1007774A patent/CH603562A5/xx not_active IP Right Cessation
- 1974-07-23 DK DK396774A patent/DK140009C/da not_active IP Right Cessation
- 1974-07-23 SE SE7409585A patent/SE413893B/xx unknown
- 1974-07-23 CA CA205,415A patent/CA1050544A/en not_active Expired
- 1974-07-23 PL PL1974172935A patent/PL91391B1/pl unknown
- 1974-07-23 JP JP49084539A patent/JPS5817456B2/ja not_active Expired
-
1977
- 1977-04-06 SE SE7704094A patent/SE7704094L/xx unknown
-
1980
- 1980-06-03 FI FI801782A patent/FI801782A7/fi not_active Application Discontinuation
-
1982
- 1982-11-15 JP JP57200254A patent/JPS6027672B2/ja not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| SE7704094L (sv) | 1977-04-06 |
| YU184474A (en) | 1981-11-13 |
| DK140009B (da) | 1979-06-05 |
| ATA510774A (de) | 1976-03-15 |
| NL7409722A (nl) | 1975-01-28 |
| PL91391B1 (enExample) | 1977-02-28 |
| CH603562A5 (en) | 1978-08-31 |
| AT333262B (de) | 1976-11-10 |
| FI177574A7 (enExample) | 1975-01-25 |
| BG23744A3 (bg) | 1977-10-12 |
| DK396774A (enExample) | 1975-03-10 |
| JPS5041834A (enExample) | 1975-04-16 |
| HU167972B (en) | 1976-01-28 |
| FI61311C (fi) | 1982-07-12 |
| SE413893B (sv) | 1980-06-30 |
| SE7409585L (sv) | 1975-01-27 |
| ES427951A1 (es) | 1976-09-01 |
| JPS58154563A (ja) | 1983-09-14 |
| YU36366B (en) | 1983-06-30 |
| DK140009C (da) | 1979-11-05 |
| FI801782A7 (fi) | 1981-01-01 |
| JPS5817456B2 (ja) | 1983-04-07 |
| CH605866A5 (enExample) | 1978-10-13 |
| JPS6027672B2 (ja) | 1985-06-29 |
| FI61311B (fi) | 1982-03-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3853915A (en) | 9-or 10-halo-4h-benzo{8 4,5{9 cyclo-hepta{8 1,2-b{9 thiophen-4-ones | |
| GB2069481A (en) | Substituted imidazole derivatives | |
| SU648104A3 (ru) | Способ получени производных 1,4-диазепина | |
| CA1204747A (en) | Piperazine derivatives and process for their production | |
| US4672063A (en) | Antiallergic 5-alkyl-1-phenyl-2-piperazinoalkylpyrazolin-3-one compounds | |
| US2940969A (en) | 1-substituted-4-[3-(9-xanthylidene)-propyl] piperazines and 1-substituted-4-[3-(10-thiaxanthylidene) propyl]-piperazines | |
| US2820817A (en) | Oxygenated indan compounds and method of making the same | |
| US3277108A (en) | Certain aralkyl sydnonimines | |
| CA1050544A (en) | Process for the preparation of 2-acylamino-benzylamines | |
| CA1107740A (en) | Process for preparing thiazolidine-2,4-dione derivatives | |
| US4435417A (en) | Antiinflammatory 3H-naphtho[1,2-d]imidazoles | |
| US4007203A (en) | 4-(1-Pyrolidenyl)-2H-1-benzothiopyran-3-carboxanilide | |
| US4049650A (en) | 1-[[[5-(Substituted phenyl)-2-oxazolyl]methylene]amino]-2,4-imidazolidinediones | |
| US3449357A (en) | 2-((2,6-substituted)phenoxymethyl)-2-imidazolines | |
| US4025537A (en) | Preparation of 3-carboalkoxy or 3-alkanoyl furans | |
| Lunsford et al. | Preparation of 4-Amino-1-butanols and Some Derivatives of Pharmacological Interest | |
| US3869468A (en) | 2-Substituted oxazole-4,5-dicarboxamides | |
| CA1188304A (en) | Tetrahydronaphthoxazoles | |
| US4212804A (en) | Process for the preparation of optionally substituted 2,3-indolinediones | |
| KR900007315B1 (ko) | 1-[2-(페닐메틸)페닐]피페라진 및 그의 산부가염 | |
| US3547921A (en) | Preparation of 1-substituted-4-aryl-3,4-dihydro-2(1h)-quinazolinones | |
| US4137321A (en) | Isoxazole carboxamides of m-aminotetramisole as anthelmintics | |
| CA1111034A (en) | Azathianaphthalene derivatives, process for their manufacture, pharmaceutical preparations containing them and their use | |
| US4013686A (en) | 4-(1-pyrrolidinyl)-2h-1-benzothiopyran-1,1-dioxide | |
| CA1162543A (en) | Process for the preparation of apovincaminic acid esters |