CA1046181A - Modified unsaturated polyester compositions - Google Patents
Modified unsaturated polyester compositionsInfo
- Publication number
- CA1046181A CA1046181A CA225,176A CA225176A CA1046181A CA 1046181 A CA1046181 A CA 1046181A CA 225176 A CA225176 A CA 225176A CA 1046181 A CA1046181 A CA 1046181A
- Authority
- CA
- Canada
- Prior art keywords
- copolymer
- dispersion
- units
- molecular weight
- polyoxypropylene
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000203 mixture Substances 0.000 title claims description 45
- 229920006305 unsaturated polyester Polymers 0.000 title description 10
- 239000006185 dispersion Substances 0.000 claims abstract description 38
- 229920001577 copolymer Polymers 0.000 claims abstract description 36
- 239000002270 dispersing agent Substances 0.000 claims abstract description 26
- 229920006337 unsaturated polyester resin Polymers 0.000 claims abstract description 25
- 239000007788 liquid Substances 0.000 claims abstract description 19
- 229920001296 polysiloxane Polymers 0.000 claims abstract description 18
- 229920000098 polyolefin Polymers 0.000 claims abstract description 4
- -1 polyoxyethylene Polymers 0.000 claims description 65
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 24
- 239000004205 dimethyl polysiloxane Substances 0.000 claims description 14
- KPUWHANPEXNPJT-UHFFFAOYSA-N disiloxane Chemical class [SiH3]O[SiH3] KPUWHANPEXNPJT-UHFFFAOYSA-N 0.000 claims description 12
- 229920000435 poly(dimethylsiloxane) Polymers 0.000 claims description 12
- 229920001451 polypropylene glycol Polymers 0.000 claims description 12
- 229920003171 Poly (ethylene oxide) Polymers 0.000 claims description 11
- 229920000642 polymer Polymers 0.000 claims description 11
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 10
- 239000005062 Polybutadiene Substances 0.000 claims description 6
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical group [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 claims description 6
- 229910052681 coesite Inorganic materials 0.000 claims description 6
- 229910052906 cristobalite Inorganic materials 0.000 claims description 6
- 238000010438 heat treatment Methods 0.000 claims description 6
- 229920002857 polybutadiene Polymers 0.000 claims description 6
- 229920002503 polyoxyethylene-polyoxypropylene Polymers 0.000 claims description 6
- 229910052682 stishovite Inorganic materials 0.000 claims description 6
- 229910052905 tridymite Inorganic materials 0.000 claims description 6
- 239000007795 chemical reaction product Substances 0.000 claims description 5
- 235000012239 silicon dioxide Nutrition 0.000 claims description 5
- 239000000945 filler Substances 0.000 claims description 4
- 229910052710 silicon Inorganic materials 0.000 claims description 4
- 239000000377 silicon dioxide Substances 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 239000000463 material Substances 0.000 claims description 3
- 229920001083 polybutene Polymers 0.000 claims description 3
- 229920003048 styrene butadiene rubber Polymers 0.000 claims description 3
- 239000004215 Carbon black (E152) Substances 0.000 claims 2
- 229930195733 hydrocarbon Natural products 0.000 claims 2
- 150000002430 hydrocarbons Chemical group 0.000 claims 1
- WCYWZMWISLQXQU-UHFFFAOYSA-N methyl Chemical group [CH3] WCYWZMWISLQXQU-UHFFFAOYSA-N 0.000 claims 1
- 229920005989 resin Polymers 0.000 abstract description 14
- 239000011347 resin Substances 0.000 abstract description 14
- 239000000654 additive Substances 0.000 abstract description 10
- 230000000996 additive effect Effects 0.000 abstract description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 13
- 239000012530 fluid Substances 0.000 description 12
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 9
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 9
- 235000013870 dimethyl polysiloxane Nutrition 0.000 description 9
- 150000003254 radicals Chemical class 0.000 description 9
- 238000012360 testing method Methods 0.000 description 9
- 239000008096 xylene Substances 0.000 description 9
- 238000002156 mixing Methods 0.000 description 8
- 238000000034 method Methods 0.000 description 6
- 239000000178 monomer Substances 0.000 description 6
- 229920001225 polyester resin Polymers 0.000 description 6
- 239000004645 polyester resin Substances 0.000 description 6
- KSBAEPSJVUENNK-UHFFFAOYSA-L tin(ii) 2-ethylhexanoate Chemical compound [Sn+2].CCCCC(CC)C([O-])=O.CCCCC(CC)C([O-])=O KSBAEPSJVUENNK-UHFFFAOYSA-L 0.000 description 6
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 5
- 239000003795 chemical substances by application Substances 0.000 description 5
- 238000010992 reflux Methods 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- 102400000830 Saposin-B Human genes 0.000 description 4
- 101800001697 Saposin-B Proteins 0.000 description 4
- 239000011521 glass Substances 0.000 description 4
- 229920000728 polyester Polymers 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- VAPKHDZBJXRVNG-UHFFFAOYSA-N 1-ethenyl-3-methylbenzene;1-ethenyl-4-methylbenzene Chemical group CC1=CC=C(C=C)C=C1.CC1=CC=CC(C=C)=C1 VAPKHDZBJXRVNG-UHFFFAOYSA-N 0.000 description 3
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 3
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- 238000005266 casting Methods 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 3
- 239000003085 diluting agent Substances 0.000 description 3
- 230000005484 gravity Effects 0.000 description 3
- 239000004615 ingredient Substances 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 3
- 229920002554 vinyl polymer Polymers 0.000 description 3
- 125000002348 vinylic group Chemical group 0.000 description 3
- MYRTYDVEIRVNKP-UHFFFAOYSA-N 1,2-Divinylbenzene Chemical compound C=CC1=CC=CC=C1C=C MYRTYDVEIRVNKP-UHFFFAOYSA-N 0.000 description 2
- 239000004342 Benzoyl peroxide Substances 0.000 description 2
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 2
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 2
- NIQCNGHVCWTJSM-UHFFFAOYSA-N Dimethyl phthalate Chemical compound COC(=O)C1=CC=CC=C1C(=O)OC NIQCNGHVCWTJSM-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 235000019400 benzoyl peroxide Nutrition 0.000 description 2
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 239000004927 clay Substances 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 238000011156 evaluation Methods 0.000 description 2
- 239000012467 final product Substances 0.000 description 2
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 239000003112 inhibitor Substances 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 150000002978 peroxides Chemical class 0.000 description 2
- 238000006116 polymerization reaction Methods 0.000 description 2
- HJWLCRVIBGQPNF-UHFFFAOYSA-N prop-2-enylbenzene Chemical compound C=CCC1=CC=CC=C1 HJWLCRVIBGQPNF-UHFFFAOYSA-N 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 239000010703 silicon Substances 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- PUPZLCDOIYMWBV-UHFFFAOYSA-N (+/-)-1,3-Butanediol Chemical compound CC(O)CCO PUPZLCDOIYMWBV-UHFFFAOYSA-N 0.000 description 1
- UICXTANXZJJIBC-UHFFFAOYSA-N 1-(1-hydroperoxycyclohexyl)peroxycyclohexan-1-ol Chemical compound C1CCCCC1(O)OOC1(OO)CCCCC1 UICXTANXZJJIBC-UHFFFAOYSA-N 0.000 description 1
- PAOHAQSLJSMLAT-UHFFFAOYSA-N 1-butylperoxybutane Chemical group CCCCOOCCCC PAOHAQSLJSMLAT-UHFFFAOYSA-N 0.000 description 1
- DNJRKFKAFWSXSE-UHFFFAOYSA-N 1-chloro-2-ethenoxyethane Chemical compound ClCCOC=C DNJRKFKAFWSXSE-UHFFFAOYSA-N 0.000 description 1
- BJELTSYBAHKXRW-UHFFFAOYSA-N 2,4,6-triallyloxy-1,3,5-triazine Chemical compound C=CCOC1=NC(OCC=C)=NC(OCC=C)=N1 BJELTSYBAHKXRW-UHFFFAOYSA-N 0.000 description 1
- XMNIXWIUMCBBBL-UHFFFAOYSA-N 2-(2-phenylpropan-2-ylperoxy)propan-2-ylbenzene Chemical compound C=1C=CC=CC=1C(C)(C)OOC(C)(C)C1=CC=CC=C1 XMNIXWIUMCBBBL-UHFFFAOYSA-N 0.000 description 1
- SBYMUDUGTIKLCR-UHFFFAOYSA-N 2-chloroethenylbenzene Chemical compound ClC=CC1=CC=CC=C1 SBYMUDUGTIKLCR-UHFFFAOYSA-N 0.000 description 1
- KGIGUEBEKRSTEW-UHFFFAOYSA-N 2-vinylpyridine Chemical compound C=CC1=CC=CC=N1 KGIGUEBEKRSTEW-UHFFFAOYSA-N 0.000 description 1
- UQRONKZLYKUEMO-UHFFFAOYSA-N 4-methyl-1-(2,4,6-trimethylphenyl)pent-4-en-2-one Chemical group CC(=C)CC(=O)Cc1c(C)cc(C)cc1C UQRONKZLYKUEMO-UHFFFAOYSA-N 0.000 description 1
- 240000008564 Boehmeria nivea Species 0.000 description 1
- 241000905957 Channa melasoma Species 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- 241000006460 Cyana Species 0.000 description 1
- 239000004641 Diallyl-phthalate Substances 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 1
- WHNWPMSKXPGLAX-UHFFFAOYSA-N N-Vinyl-2-pyrrolidone Chemical compound C=CN1CCCC1=O WHNWPMSKXPGLAX-UHFFFAOYSA-N 0.000 description 1
- UQKKDJWFQBNZBJ-UHFFFAOYSA-N Polydin Natural products OC1C(O)C(O)COC1OC1=CC(O)=C(CC(O)C(O2)C=3C=C(O)C(O)=CC=3)C2=C1 UQKKDJWFQBNZBJ-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical class [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 102100034742 Rotatin Human genes 0.000 description 1
- 101710200213 Rotatin Proteins 0.000 description 1
- 229910020487 SiO3/2 Inorganic materials 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical group C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 1
- 239000002174 Styrene-butadiene Substances 0.000 description 1
- 102100035115 Testin Human genes 0.000 description 1
- 101710070533 Testin Proteins 0.000 description 1
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 235000011037 adipic acid Nutrition 0.000 description 1
- 150000001279 adipic acids Chemical class 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- XYLMUPLGERFSHI-UHFFFAOYSA-N alpha-Methylstyrene Chemical compound CC(=C)C1=CC=CC=C1 XYLMUPLGERFSHI-UHFFFAOYSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- 239000010425 asbestos Substances 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- QUDWYFHPNIMBFC-UHFFFAOYSA-N bis(prop-2-enyl) benzene-1,2-dicarboxylate Chemical compound C=CCOC(=O)C1=CC=CC=C1C(=O)OCC=C QUDWYFHPNIMBFC-UHFFFAOYSA-N 0.000 description 1
- 125000006278 bromobenzyl group Chemical group 0.000 description 1
- 229920005557 bromobutyl Polymers 0.000 description 1
- MTAZNLWOLGHBHU-UHFFFAOYSA-N butadiene-styrene rubber Chemical compound C=CC=C.C=CC1=CC=CC=C1 MTAZNLWOLGHBHU-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000005587 carbonate group Chemical group 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000006482 condensation reaction Methods 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 238000004132 cross linking Methods 0.000 description 1
- 239000003431 cross linking reagent Substances 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- 150000001990 dicarboxylic acid derivatives Chemical class 0.000 description 1
- 125000004188 dichlorophenyl group Chemical group 0.000 description 1
- FBSAITBEAPNWJG-UHFFFAOYSA-N dimethyl phthalate Natural products CC(=O)OC1=CC=CC=C1OC(C)=O FBSAITBEAPNWJG-UHFFFAOYSA-N 0.000 description 1
- 229960001826 dimethylphthalate Drugs 0.000 description 1
- SZXQTJUDPRGNJN-UHFFFAOYSA-N dipropylene glycol Chemical compound OCCCOCCCO SZXQTJUDPRGNJN-UHFFFAOYSA-N 0.000 description 1
- 125000005066 dodecenyl group Chemical group C(=CCCCCCCCCCC)* 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- XWRLQRLQUKZEEU-UHFFFAOYSA-N ethyl(hydroxy)silicon Chemical compound CC[Si]O XWRLQRLQUKZEEU-UHFFFAOYSA-N 0.000 description 1
- 239000002657 fibrous material Substances 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 125000006038 hexenyl group Chemical group 0.000 description 1
- 229920001519 homopolymer Polymers 0.000 description 1
- 150000002432 hydroperoxides Chemical class 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 229920000126 latex Polymers 0.000 description 1
- 230000001050 lubricating effect Effects 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- GEMHFKXPOCTAIP-UHFFFAOYSA-N n,n-dimethyl-n'-phenylcarbamimidoyl chloride Chemical compound CN(C)C(Cl)=NC1=CC=CC=C1 GEMHFKXPOCTAIP-UHFFFAOYSA-N 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- XNGIFLGASWRNHJ-UHFFFAOYSA-L phthalate(2-) Chemical compound [O-]C(=O)C1=CC=CC=C1C([O-])=O XNGIFLGASWRNHJ-UHFFFAOYSA-L 0.000 description 1
- 150000003022 phthalic acids Chemical class 0.000 description 1
- 230000002028 premature Effects 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- 238000003847 radiation curing Methods 0.000 description 1
- 239000012763 reinforcing filler Substances 0.000 description 1
- 230000002940 repellent Effects 0.000 description 1
- 239000005871 repellent Substances 0.000 description 1
- 239000012260 resinous material Substances 0.000 description 1
- 229910052895 riebeckite Inorganic materials 0.000 description 1
- 150000003330 sebacic acids Chemical class 0.000 description 1
- SCPYDCQAZCOKTP-UHFFFAOYSA-N silanol Chemical compound [SiH3]O SCPYDCQAZCOKTP-UHFFFAOYSA-N 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 230000003068 static effect Effects 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 239000011115 styrene butadiene Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 125000005023 xylyl group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L67/00—Compositions of polyesters obtained by reactions forming a carboxylic ester link in the main chain; Compositions of derivatives of such polymers
- C08L67/06—Unsaturated polyesters
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Macromonomer-Based Addition Polymer (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/514,689 US3959203A (en) | 1974-10-15 | 1974-10-15 | Modified unsaturated polyester compositions |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1046181A true CA1046181A (en) | 1979-01-09 |
Family
ID=24048293
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA225,176A Expired CA1046181A (en) | 1974-10-15 | 1975-04-22 | Modified unsaturated polyester compositions |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US3959203A (OSRAM) |
| JP (1) | JPS5142750A (OSRAM) |
| AU (1) | AU498104B2 (OSRAM) |
| BE (1) | BE834481A (OSRAM) |
| BR (1) | BR7505448A (OSRAM) |
| CA (1) | CA1046181A (OSRAM) |
| DE (1) | DE2545434C3 (OSRAM) |
| FR (1) | FR2288123A1 (OSRAM) |
| GB (1) | GB1510194A (OSRAM) |
Families Citing this family (29)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS51125479A (en) * | 1974-11-22 | 1976-11-01 | Ppg Industries Inc | Radiation curable composition containing organic silicon compound |
| DE2545874C2 (de) * | 1975-10-14 | 1982-11-11 | Plate Bonn Gmbh, 5300 Bonn | Heißsiegel-Schmelzklebstoff und dessen Verwendung |
| DE2621740C2 (de) * | 1976-05-15 | 1982-03-25 | Rütgerswerke AG, 6000 Frankfurt | Formmassen auf der Basis von ungesättigten Polyestern |
| US4129543A (en) * | 1976-06-18 | 1978-12-12 | Hi-Tech Industries, Inc. | Thermosetting molding resin compositions |
| JPS54141849A (en) * | 1978-04-26 | 1979-11-05 | Japan Styrene Paper Corp | Insulating material composed of synthetic resin foam |
| DE2827594B1 (de) * | 1978-06-23 | 1979-10-25 | Bayer Ag | Kerbschlagfeste ABS-Polymere |
| US4225554A (en) * | 1978-07-26 | 1980-09-30 | Hi-Tech Industries, Inc. | Thermosetting molding resin compositions |
| DE2928813C2 (de) * | 1978-10-16 | 1984-06-28 | Th. Goldschmidt Ag, 4300 Essen | Gleit- und Trennmittel für Gummiformkörper |
| JPS56103026U (OSRAM) * | 1979-12-30 | 1981-08-12 | ||
| JPS57100241A (en) * | 1980-12-15 | 1982-06-22 | Toyo Pairu Hiyuumukan Seisakus | Heat insulating building |
| JPS5873817U (ja) * | 1981-11-12 | 1983-05-19 | 株式会社東洋パイルヒユ−ム管製作所 | 断熱複合板 |
| JPS60130034U (ja) * | 1984-02-09 | 1985-08-31 | アロン化成株式会社 | 二層構造 |
| US4730012A (en) * | 1985-10-09 | 1988-03-08 | Espeland Arthur J | Building material composition |
| US4623694A (en) | 1985-11-18 | 1986-11-18 | Dow Corning Corporation | Curable organosiloxane compositions containing an emulsified epoxide compound and elastomeric materials prepared therefrom |
| EP0261919A3 (en) * | 1986-09-24 | 1988-06-29 | The Dow Chemical Company | Composite building panel |
| DE3634084A1 (de) * | 1986-10-07 | 1988-04-21 | Hanse Chemie Gmbh | Modifiziertes reaktionsharz, verfahren zu seiner herstellung und seine verwendung |
| JPS6384334U (OSRAM) * | 1986-11-22 | 1988-06-02 | ||
| JPH01122965A (ja) * | 1987-11-05 | 1989-05-16 | Taiyo Yuden Co Ltd | 圧電性磁器組成物 |
| EP0335406B1 (en) * | 1988-03-31 | 1995-09-20 | Union Carbide Corporation | Low profile molding system |
| WO1989010382A1 (en) * | 1988-04-27 | 1989-11-02 | Signworld International Pty. Ltd. | Method and means for forming moulded products |
| US5256708A (en) * | 1991-07-22 | 1993-10-26 | Owens-Corning Fiberglas Technology, Inc. | Unsaturated polyester resin compositions containing compatible compounds having sulfur-containing substituents |
| US5256709A (en) * | 1991-07-22 | 1993-10-26 | Owens-Corning Fiberglas Technology, Inc. | Unsaturated polyester resin compositions containing compatible compounds having aromatic substituents |
| US5338783A (en) * | 1991-12-11 | 1994-08-16 | Stc, Inc. | Silicone binder material and products formed therefrom |
| US5605657A (en) * | 1992-05-14 | 1997-02-25 | Uniroyal Chemical Company, Inc. | Industrial solid tires and method of manufacture |
| JP3730317B2 (ja) * | 1996-05-30 | 2006-01-05 | 東レ・ダウコーニング株式会社 | 人工大理石用熱硬化性樹脂組成物および人工大理石 |
| US6013752A (en) * | 1997-06-04 | 2000-01-11 | Ameron International Corporation | Halogenated resin compositions |
| US6109394A (en) * | 1997-11-18 | 2000-08-29 | Ingersoll-Rand Company | Lubricant impregnated wear pads for extendable booms on material handling devices |
| EP2663598B1 (de) * | 2011-01-10 | 2017-04-26 | Elantas GMBH | Tränkharzformulierung für elektrische wicklungen |
| WO2024140689A1 (en) * | 2022-12-29 | 2024-07-04 | Momentive Performance Materials Inc. | Adjuvant compositions and method for treating plant using the same |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2890188A (en) * | 1951-12-17 | 1959-06-09 | Dow Corning | Siloxane elastomers compounded with hydroxylated silanes |
| DE1107742B (de) * | 1955-03-17 | 1961-05-31 | Westinghouse Electric Corp | Verwendung einer waermehaertbaren Polyesterharzmasse als Isolationsmasse in der Elektrotechnik |
| GB941493A (en) * | 1961-01-30 | 1963-11-13 | Ici Ltd | Melt spinning polyester filaments |
| US3511788A (en) * | 1965-02-03 | 1970-05-12 | Dow Corning | Foams,compositions,method for making foams and foam covered substrate ii |
| US3784479A (en) * | 1972-05-15 | 1974-01-08 | Dow Corning | Foam control composition |
| US3843577A (en) * | 1972-12-26 | 1974-10-22 | Dow Corning | Siloxane-modified epoxy resin compositions |
| JPS49132184A (OSRAM) * | 1973-04-09 | 1974-12-18 |
-
1974
- 1974-10-15 US US05/514,689 patent/US3959203A/en not_active Expired - Lifetime
-
1975
- 1975-04-22 CA CA225,176A patent/CA1046181A/en not_active Expired
- 1975-04-30 AU AU80688/75A patent/AU498104B2/en not_active Expired
- 1975-05-21 GB GB21776/75A patent/GB1510194A/en not_active Expired
- 1975-06-17 JP JP50073626A patent/JPS5142750A/ja active Granted
- 1975-08-26 BR BR7505448*A patent/BR7505448A/pt unknown
- 1975-10-10 DE DE2545434A patent/DE2545434C3/de not_active Expired
- 1975-10-14 BE BE160910A patent/BE834481A/xx not_active IP Right Cessation
- 1975-10-14 FR FR7531396A patent/FR2288123A1/fr active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| FR2288123B1 (OSRAM) | 1977-12-16 |
| JPS5338112B2 (OSRAM) | 1978-10-13 |
| US3959203A (en) | 1976-05-25 |
| DE2545434B2 (de) | 1981-01-22 |
| JPS5142750A (en) | 1976-04-12 |
| FR2288123A1 (fr) | 1976-05-14 |
| DE2545434A1 (de) | 1976-04-22 |
| DE2545434C3 (de) | 1981-12-24 |
| AU8068875A (en) | 1976-11-04 |
| BR7505448A (pt) | 1976-08-17 |
| AU498104B2 (en) | 1979-02-08 |
| GB1510194A (en) | 1978-05-10 |
| BE834481A (fr) | 1976-04-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1046181A (en) | Modified unsaturated polyester compositions | |
| EP0028841B1 (en) | Improved polyester moldings | |
| CA1058052A (en) | Foam control composition | |
| US2890188A (en) | Siloxane elastomers compounded with hydroxylated silanes | |
| US3865544A (en) | Dyeing with foam control composition of silica, polyoxypropylenes and polydimethylsiloxane | |
| US3843577A (en) | Siloxane-modified epoxy resin compositions | |
| US3960575A (en) | Detergent resistant polish compositions | |
| US3355406A (en) | Silicone rubber latexes reinforced with silsesquioxanes | |
| US4555534A (en) | Uniformly pigmented, low shrinking polyester molding compositions | |
| US2811408A (en) | Method of molding plastic articles | |
| US3926885A (en) | Siloxane-modified epoxy resin compositions | |
| US3686356A (en) | Method of blending polyorganosiloxane and organic vinylic thermoplastics and products thereof | |
| US4234713A (en) | Curable solventless organopolysiloxane compositions | |
| WO1982001555A1 (en) | Epoxy-polysiloxane composition for coating heat sensitive substrates | |
| US3070560A (en) | Composition comprising a polysiloxane resin, silica filler, a hydroxylated siloxane, and a boron compound | |
| US4661556A (en) | Method of producing reinforced aqueous emulsion of polydiorganosiloxane | |
| US3338847A (en) | Silicone rubber foam compositions | |
| US2851379A (en) | Process of impregnating material with a resinous bonding composition | |
| US5428097A (en) | Silicone rubber composition | |
| CA1171585A (en) | Composition containing an unsaturated polyester, a low profile thermoplastic polymer additive, a polymerizable monomer and an epoxy compound | |
| EP0335406B1 (en) | Low profile molding system | |
| JPH0726145A (ja) | シリコーンコンパウンドおよびその製造方法 | |
| US5004765A (en) | Low profile molding system | |
| US3696068A (en) | Organosiloxane elastomers | |
| US2927910A (en) | Organosiloxane-phenol-aldehyde resin cements |