CA1038381A - Benzodiazepine derivatives and process for preparing the same - Google Patents
Benzodiazepine derivatives and process for preparing the sameInfo
- Publication number
- CA1038381A CA1038381A CA036,241A CA36241A CA1038381A CA 1038381 A CA1038381 A CA 1038381A CA 36241 A CA36241 A CA 36241A CA 1038381 A CA1038381 A CA 1038381A
- Authority
- CA
- Canada
- Prior art keywords
- tetrahydro
- benzodiazepin
- chloro
- process according
- compound
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 125000003310 benzodiazepinyl group Chemical class N1N=C(C=CC2=C1C=CC=C2)* 0.000 title abstract 3
- 229940053197 benzodiazepine derivative antiepileptics Drugs 0.000 title description 12
- 238000004519 manufacturing process Methods 0.000 title description 3
- -1 phenacyl group Chemical group 0.000 claims abstract description 72
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 34
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 19
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 12
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 8
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims abstract description 8
- 125000005843 halogen group Chemical group 0.000 claims abstract description 6
- 125000000753 cycloalkyl group Chemical group 0.000 claims abstract description 5
- 125000003884 phenylalkyl group Chemical group 0.000 claims abstract description 5
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 4
- 125000004093 cyano group Chemical group *C#N 0.000 claims abstract description 4
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 claims abstract description 4
- 125000001624 naphthyl group Chemical group 0.000 claims abstract description 4
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims abstract description 4
- 125000004430 oxygen atom Chemical group O* 0.000 claims abstract description 4
- 229910052717 sulfur Chemical group 0.000 claims abstract description 4
- 125000004434 sulfur atom Chemical group 0.000 claims abstract description 4
- 150000001875 compounds Chemical class 0.000 claims description 76
- 238000000034 method Methods 0.000 claims description 76
- 229940049706 benzodiazepine Drugs 0.000 claims description 23
- 239000000126 substance Substances 0.000 claims description 23
- 239000002253 acid Substances 0.000 claims description 20
- 150000001557 benzodiazepines Chemical class 0.000 claims description 17
- HXKKHQJGJAFBHI-UHFFFAOYSA-N 1-aminopropan-2-ol Chemical compound CC(O)CN HXKKHQJGJAFBHI-UHFFFAOYSA-N 0.000 claims description 15
- 238000002360 preparation method Methods 0.000 claims description 9
- 150000002148 esters Chemical class 0.000 claims description 5
- 150000003254 radicals Chemical class 0.000 claims description 5
- SVUOLADPCWQTTE-UHFFFAOYSA-N 1h-1,2-benzodiazepine Chemical compound N1N=CC=CC2=CC=CC=C12 SVUOLADPCWQTTE-UHFFFAOYSA-N 0.000 claims description 4
- 150000003014 phosphoric acid esters Chemical class 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims 6
- 239000001257 hydrogen Substances 0.000 claims 6
- 229910052736 halogen Inorganic materials 0.000 claims 4
- 150000002367 halogens Chemical group 0.000 claims 2
- 125000003258 trimethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])[*:1] 0.000 claims 2
- PIHNXGRYRGLWTB-UHFFFAOYSA-N n-(2-benzoyl-4-chlorophenyl)-2-(1-hydroxypropan-2-ylamino)acetamide Chemical compound OCC(C)NCC(=O)NC1=CC=C(Cl)C=C1C(=O)C1=CC=CC=C1 PIHNXGRYRGLWTB-UHFFFAOYSA-N 0.000 claims 1
- YTKSEOFTVIBVIX-UHFFFAOYSA-N n-(2-benzoyl-4-chlorophenyl)-2-(2-hydroxypropylamino)acetamide Chemical compound CC(O)CNCC(=O)NC1=CC=C(Cl)C=C1C(=O)C1=CC=CC=C1 YTKSEOFTVIBVIX-UHFFFAOYSA-N 0.000 claims 1
- 150000003459 sulfonic acid esters Chemical class 0.000 claims 1
- 230000000694 effects Effects 0.000 abstract description 6
- 230000001430 anti-depressive effect Effects 0.000 abstract description 2
- 239000000935 antidepressant agent Substances 0.000 abstract description 2
- 210000003169 central nervous system Anatomy 0.000 abstract description 2
- 230000002349 favourable effect Effects 0.000 abstract description 2
- 231100000053 low toxicity Toxicity 0.000 abstract description 2
- 239000003204 tranquilizing agent Substances 0.000 abstract description 2
- 230000002936 tranquilizing effect Effects 0.000 abstract description 2
- 150000002500 ions Chemical class 0.000 abstract 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 87
- 238000006243 chemical reaction Methods 0.000 description 77
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 63
- 239000002904 solvent Substances 0.000 description 56
- 239000000203 mixture Substances 0.000 description 51
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 49
- 239000000047 product Substances 0.000 description 48
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 45
- 238000002844 melting Methods 0.000 description 45
- 230000008018 melting Effects 0.000 description 45
- 239000011541 reaction mixture Substances 0.000 description 40
- 238000000354 decomposition reaction Methods 0.000 description 36
- 239000000243 solution Substances 0.000 description 35
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 33
- 239000000543 intermediate Substances 0.000 description 32
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 28
- 238000010992 reflux Methods 0.000 description 26
- 239000012965 benzophenone Substances 0.000 description 23
- 229940024874 benzophenone Drugs 0.000 description 22
- 235000013350 formula milk Nutrition 0.000 description 22
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 21
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 19
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 19
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 16
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 16
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 16
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 15
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 15
- 239000001632 sodium acetate Substances 0.000 description 15
- 235000017281 sodium acetate Nutrition 0.000 description 15
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 14
- 229940102253 isopropanolamine Drugs 0.000 description 14
- MRXZRJQRQWTKIX-UHFFFAOYSA-N n-(2-benzoylphenyl)acetamide Chemical class CC(=O)NC1=CC=CC=C1C(=O)C1=CC=CC=C1 MRXZRJQRQWTKIX-UHFFFAOYSA-N 0.000 description 14
- 239000003960 organic solvent Substances 0.000 description 12
- 159000000000 sodium salts Chemical class 0.000 description 12
- 239000000460 chlorine Substances 0.000 description 11
- 239000000284 extract Substances 0.000 description 11
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 10
- 239000013078 crystal Substances 0.000 description 9
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 8
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 7
- 238000004458 analytical method Methods 0.000 description 7
- RWCCWEUUXYIKHB-UHFFFAOYSA-N benzophenone Chemical compound C=1C=CC=CC=1C(=O)C1=CC=CC=C1 RWCCWEUUXYIKHB-UHFFFAOYSA-N 0.000 description 7
- 239000011230 binding agent Substances 0.000 description 7
- 239000003921 oil Substances 0.000 description 7
- 235000019198 oils Nutrition 0.000 description 7
- 229940086542 triethylamine Drugs 0.000 description 7
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 6
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 6
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 6
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 6
- 239000007795 chemical reaction product Substances 0.000 description 6
- 238000004821 distillation Methods 0.000 description 6
- 239000000741 silica gel Substances 0.000 description 6
- 229910002027 silica gel Inorganic materials 0.000 description 6
- 239000008096 xylene Substances 0.000 description 6
- ROXAFEIDZVHGFX-UHFFFAOYSA-N 1,3,4,5-tetrahydro-1,4-benzodiazepin-2-one Chemical compound N1C(=O)CNCC2=CC=CC=C21 ROXAFEIDZVHGFX-UHFFFAOYSA-N 0.000 description 5
- 239000003513 alkali Substances 0.000 description 5
- 150000008366 benzophenones Chemical class 0.000 description 5
- 239000007810 chemical reaction solvent Substances 0.000 description 5
- 238000010828 elution Methods 0.000 description 5
- 238000000605 extraction Methods 0.000 description 5
- 238000001914 filtration Methods 0.000 description 5
- 150000003839 salts Chemical class 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- WUGQZFFCHPXWKQ-UHFFFAOYSA-N Propanolamine Chemical compound NCCCO WUGQZFFCHPXWKQ-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 4
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 4
- 238000002955 isolation Methods 0.000 description 4
- FDPIMTJIUBPUKL-UHFFFAOYSA-N pentan-3-one Chemical compound CCC(=O)CC FDPIMTJIUBPUKL-UHFFFAOYSA-N 0.000 description 4
- 238000001953 recrystallisation Methods 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- 238000004587 chromatography analysis Methods 0.000 description 3
- 150000004292 cyclic ethers Chemical class 0.000 description 3
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 3
- 239000003937 drug carrier Substances 0.000 description 3
- 229940031098 ethanolamine Drugs 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 238000011065 in-situ storage Methods 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 239000000825 pharmaceutical preparation Substances 0.000 description 3
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 3
- 229960005335 propanol Drugs 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 2
- QQWBCGOFBSOLOV-UHFFFAOYSA-N 1,3,4,5,5a,6-hexahydro-1,4-benzodiazepin-2-one Chemical compound N1C(CNCC2C1=CC=CC2)=O QQWBCGOFBSOLOV-UHFFFAOYSA-N 0.000 description 2
- RXYPXQSKLGGKOL-UHFFFAOYSA-N 1,4-dimethylpiperazine Chemical compound CN1CCN(C)CC1 RXYPXQSKLGGKOL-UHFFFAOYSA-N 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- KXOJJLWIXYKLHF-UHFFFAOYSA-N ClC=1C=CC=C(C(=O)C2C(C=CC=C2)(Cl)NC(CBr)=O)C=1 Chemical compound ClC=1C=CC=C(C(=O)C2C(C=CC=C2)(Cl)NC(CBr)=O)C=1 KXOJJLWIXYKLHF-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 2
- SUAKHGWARZSWIH-UHFFFAOYSA-N N,N‐diethylformamide Chemical compound CCN(CC)C=O SUAKHGWARZSWIH-UHFFFAOYSA-N 0.000 description 2
- YVYGFAGEACGEJX-UHFFFAOYSA-N N-(2-benzoyl-4-nitrophenyl)-2-(2-hydroxyethylamino)acetamide Chemical compound [N+](=O)([O-])C=1C=CC(=C(C(=O)C2=CC=CC=C2)C1)NC(CNCCO)=O YVYGFAGEACGEJX-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- YOJIXTYNICPTQR-UHFFFAOYSA-N [2-(2-amino-3-benzoyl-5-chlorophenyl)-2-oxoethyl] 4-methylbenzenesulfonate Chemical compound ClC=1C=C(C(=C(C(=O)C2=CC=CC=C2)C1)N)C(COS(=O)(=O)C1=CC=C(C)C=C1)=O YOJIXTYNICPTQR-UHFFFAOYSA-N 0.000 description 2
- 230000002411 adverse Effects 0.000 description 2
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 2
- 150000001339 alkali metal compounds Chemical class 0.000 description 2
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 2
- 239000002249 anxiolytic agent Substances 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- 239000012141 concentrate Substances 0.000 description 2
- 235000008504 concentrate Nutrition 0.000 description 2
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000012458 free base Substances 0.000 description 2
- 150000008282 halocarbons Chemical class 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 150000007530 organic bases Chemical class 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 238000007669 thermal treatment Methods 0.000 description 2
- 238000011282 treatment Methods 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- MAOBFOXLCJIFLV-UHFFFAOYSA-N (2-aminophenyl)-phenylmethanone Chemical compound NC1=CC=CC=C1C(=O)C1=CC=CC=C1 MAOBFOXLCJIFLV-UHFFFAOYSA-N 0.000 description 1
- RGGLEJFUEMKQSH-UHFFFAOYSA-N 1,4-benzodiazepin-2-one Chemical compound O=C1C=NC=C2C=CC=CC2=N1 RGGLEJFUEMKQSH-UHFFFAOYSA-N 0.000 description 1
- PEGJZBBHDJDXEP-UHFFFAOYSA-N 1-(2-amino-3-benzoyl-5-chlorophenyl)-2-bromoethanone Chemical compound ClC=1C=C(C(=C(C(=O)C2=CC=CC=C2)C1)N)C(CBr)=O PEGJZBBHDJDXEP-UHFFFAOYSA-N 0.000 description 1
- OMLHDIVWYABBHN-UHFFFAOYSA-N 1-(3-amino-4-benzoyl-6-chloro-2-methylphenyl)-2-bromoethanone Chemical compound CC=1C(=C(C(=O)C2=CC=CC=C2)C=C(C1C(CBr)=O)Cl)N OMLHDIVWYABBHN-UHFFFAOYSA-N 0.000 description 1
- PAMIQIKDUOTOBW-UHFFFAOYSA-N 1-methylpiperidine Chemical compound CN1CCCCC1 PAMIQIKDUOTOBW-UHFFFAOYSA-N 0.000 description 1
- LHASZEBEQGPCFM-CJFMBICVSA-N 2-amino-4-[(1r)-1-[[(6r)-6-[(5-chloro-2-methoxyphenyl)methyl]-7-oxo-3-(phenoxyamino)-5,6-dihydro-2h-1,4-diazepine-1-carbonyl]amino]propyl]benzoic acid Chemical compound C([C@@H]1CNC(CN(C1=O)C(=O)N[C@H](CC)C=1C=C(N)C(C(O)=O)=CC=1)=NOC=1C=CC=CC=1)C1=CC(Cl)=CC=C1OC LHASZEBEQGPCFM-CJFMBICVSA-N 0.000 description 1
- ZIWZCDRHKRIADU-UHFFFAOYSA-N 2-amino-n-(2-benzoylphenyl)acetamide Chemical class NCC(=O)NC1=CC=CC=C1C(=O)C1=CC=CC=C1 ZIWZCDRHKRIADU-UHFFFAOYSA-N 0.000 description 1
- OGMADIBCHLQMIP-UHFFFAOYSA-N 2-aminoethanethiol;hydron;chloride Chemical compound Cl.NCCS OGMADIBCHLQMIP-UHFFFAOYSA-N 0.000 description 1
- UMEPUVQOEZOFCA-UHFFFAOYSA-N 2-bromo-N-[2-(3-chlorobenzoyl)phenyl]acetamide Chemical compound ClC=1C=CC=C(C(=O)C2=C(C=CC=C2)NC(CBr)=O)C=1 UMEPUVQOEZOFCA-UHFFFAOYSA-N 0.000 description 1
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical compound CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- CSDQQAQKBAQLLE-UHFFFAOYSA-N 4-(4-chlorophenyl)-4,5,6,7-tetrahydrothieno[3,2-c]pyridine Chemical compound C1=CC(Cl)=CC=C1C1C(C=CS2)=C2CCN1 CSDQQAQKBAQLLE-UHFFFAOYSA-N 0.000 description 1
- SREVNOABLVPRHG-UHFFFAOYSA-N 5-phenyl-1,3,4,5-tetrahydro-1,4-benzodiazepin-2-one Chemical class C12=CC=CC=C2NC(=O)CNC1C1=CC=CC=C1 SREVNOABLVPRHG-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 229910015900 BF3 Inorganic materials 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- VVNCNSJFMMFHPL-VKHMYHEASA-N D-penicillamine Chemical compound CC(C)(S)[C@@H](N)C(O)=O VVNCNSJFMMFHPL-VKHMYHEASA-N 0.000 description 1
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- QODLNBFEOWJIPU-UHFFFAOYSA-N N-(2-benzoyl-4,6-dimethylphenyl)-2-bromoacetamide Chemical compound CC=1C(=C(C(=O)C2=CC=CC=C2)C=C(C1)C)NC(CBr)=O QODLNBFEOWJIPU-UHFFFAOYSA-N 0.000 description 1
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 1
- QIORBEOQTCRKOH-UHFFFAOYSA-N N-[2-(2-chlorobenzoyl)-4-nitrophenyl]-2-(2-hydroxyethylamino)acetamide Chemical compound [N+](=O)([O-])C=1C=CC(=C(C(=O)C2=C(C=CC=C2)Cl)C1)NC(CNCCO)=O QIORBEOQTCRKOH-UHFFFAOYSA-N 0.000 description 1
- KEAQABJNSLTAEE-UHFFFAOYSA-N N-[2-(2-chlorobenzoyl)-4-nitrophenyl]-2-(2-hydroxypropylamino)acetamide Chemical compound [N+](=O)([O-])C=1C=CC(=C(C(=O)C2=C(C=CC=C2)Cl)C1)NC(CNCC(C)O)=O KEAQABJNSLTAEE-UHFFFAOYSA-N 0.000 description 1
- 206010029333 Neurosis Diseases 0.000 description 1
- 235000008331 Pinus X rigitaeda Nutrition 0.000 description 1
- 235000011613 Pinus brutia Nutrition 0.000 description 1
- 241000018646 Pinus brutia Species 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric Acid Chemical class [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 150000001341 alkaline earth metal compounds Chemical class 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 239000012752 auxiliary agent Substances 0.000 description 1
- 159000000009 barium salts Chemical class 0.000 description 1
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- SURLGNKAQXKNSP-DBLYXWCISA-N chlorin Chemical compound C\1=C/2\N/C(=C\C3=N/C(=C\C=4NC(/C=C\5/C=CC/1=N/5)=CC=4)/C=C3)/CC\2 SURLGNKAQXKNSP-DBLYXWCISA-N 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- UFULAYFCSOUIOV-UHFFFAOYSA-N cysteamine Chemical compound NCCS UFULAYFCSOUIOV-UHFFFAOYSA-N 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 229940075911 depen Drugs 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 229910000103 lithium hydride Inorganic materials 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 229960003151 mercaptamine Drugs 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229910000000 metal hydroxide Inorganic materials 0.000 description 1
- 150000004692 metal hydroxides Chemical class 0.000 description 1
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 1
- NBTOZLQBSIZIKS-UHFFFAOYSA-N methoxide Chemical compound [O-]C NBTOZLQBSIZIKS-UHFFFAOYSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- USZJZGVAIGKLRF-UHFFFAOYSA-N n-(2-benzoyl-4-nitrophenyl)-2-bromoacetamide Chemical compound [O-][N+](=O)C1=CC=C(NC(=O)CBr)C(C(=O)C=2C=CC=CC=2)=C1 USZJZGVAIGKLRF-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 208000015238 neurotic disease Diseases 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 230000003204 osmotic effect Effects 0.000 description 1
- 239000008014 pharmaceutical binder Substances 0.000 description 1
- 239000008023 pharmaceutical filler Substances 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- 150000003016 phosphoric acids Chemical class 0.000 description 1
- 235000011056 potassium acetate Nutrition 0.000 description 1
- 239000011736 potassium bicarbonate Substances 0.000 description 1
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 235000011181 potassium carbonates Nutrition 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- HHFOOWPWAXNJNY-UHFFFAOYSA-N promoxolane Chemical compound CC(C)C1(C(C)C)OCC(CO)O1 HHFOOWPWAXNJNY-UHFFFAOYSA-N 0.000 description 1
- 229950008352 promoxolane Drugs 0.000 description 1
- 229940001470 psychoactive drug Drugs 0.000 description 1
- 239000004089 psychotropic agent Substances 0.000 description 1
- 230000036647 reaction Effects 0.000 description 1
- 238000006798 ring closing metathesis reaction Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- RBWSWDPRDBEWCR-RKJRWTFHSA-N sodium;(2r)-2-[(2r)-3,4-dihydroxy-5-oxo-2h-furan-2-yl]-2-hydroxyethanolate Chemical compound [Na+].[O-]C[C@@H](O)[C@H]1OC(=O)C(O)=C1O RBWSWDPRDBEWCR-RKJRWTFHSA-N 0.000 description 1
- CMXPERZAMAQXSF-UHFFFAOYSA-M sodium;1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate;1,8-dihydroxyanthracene-9,10-dione Chemical compound [Na+].O=C1C2=CC=CC(O)=C2C(=O)C2=C1C=CC=C2O.CCCCC(CC)COC(=O)CC(S([O-])(=O)=O)C(=O)OCC(CC)CCCC CMXPERZAMAQXSF-UHFFFAOYSA-M 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- IMFACGCPASFAPR-UHFFFAOYSA-N tributylamine Chemical compound CCCCN(CCCC)CCCC IMFACGCPASFAPR-UHFFFAOYSA-N 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D513/00—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for in groups C07D463/00, C07D477/00 or C07D499/00 - C07D507/00
- C07D513/02—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for in groups C07D463/00, C07D477/00 or C07D499/00 - C07D507/00 in which the condensed system contains two hetero rings
- C07D513/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C233/00—Carboxylic acid amides
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C233/00—Carboxylic acid amides
- C07C233/01—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms
- C07C233/02—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having nitrogen atoms of carboxamide groups bound to hydrogen atoms or to carbon atoms of unsubstituted hydrocarbon radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C237/00—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
- C07D487/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D498/00—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D498/02—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and oxygen atoms as the only ring hetero atoms in which the condensed system contains two hetero rings
- C07D498/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CA109788A CA931564A (en) | 1967-11-27 | 1971-04-06 | Benzodiazepin compounds |
| CA109,789A CA1035785A (en) | 1967-11-27 | 1971-04-06 | Substituted aminoacetylaminobenzophenone compounds and process of preparing the same |
Applications Claiming Priority (11)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP7600867 | 1967-11-27 | ||
| JP7600767 | 1967-11-27 | ||
| JP7600567 | 1967-11-27 | ||
| JP4572268 | 1968-07-01 | ||
| JP6270068 | 1968-08-31 | ||
| JP6269968 | 1968-08-31 | ||
| JP7601268 | 1968-10-18 | ||
| JP43076013A JPS4830076B1 (enExample) | 1968-10-18 | 1968-10-18 | |
| JP7749868 | 1968-10-24 | ||
| JP7749968 | 1968-10-24 | ||
| JP7876868 | 1968-10-29 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1038381A true CA1038381A (en) | 1978-09-12 |
Family
ID=27581992
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA036,241A Expired CA1038381A (en) | 1967-11-27 | 1968-11-26 | Benzodiazepine derivatives and process for preparing the same |
Country Status (14)
| Country | Link |
|---|---|
| US (2) | US3914215A (enExample) |
| AT (1) | AT299203B (enExample) |
| CA (1) | CA1038381A (enExample) |
| CH (1) | CH518302A (enExample) |
| DE (1) | DE1817923C3 (enExample) |
| DK (1) | DK141780B (enExample) |
| FI (1) | FI49048C (enExample) |
| GB (1) | GB1254736A (enExample) |
| IE (1) | IE32894B1 (enExample) |
| IL (2) | IL39770A (enExample) |
| NL (1) | NL170957C (enExample) |
| NO (1) | NO127055B (enExample) |
| SE (1) | SE346791B (enExample) |
| YU (3) | YU36709B (enExample) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IL33190A (en) * | 1968-10-24 | 1972-11-28 | Sankyo Co | Benzodiazepine compounds and their preparation |
| CH574443A5 (enExample) * | 1970-04-06 | 1976-04-15 | Hoffmann La Roche | |
| LU65340A1 (enExample) * | 1972-05-12 | 1973-11-22 | ||
| US3928415A (en) * | 1973-05-08 | 1975-12-23 | Cassella Farbwerke Mainkur Ag | Benzophenone derivatives and process for their production II |
| JPS584035B2 (ja) * | 1974-05-07 | 1983-01-24 | 武田薬品工業株式会社 | イコウカンカゴウブツノ セイゾウホウ |
| US4007219A (en) * | 1974-08-20 | 1977-02-08 | Hoffmann-La Roche Inc. | Benzophenone glycinamide derivatives |
| FR2403330A1 (fr) * | 1977-06-16 | 1979-04-13 | Fabre Sa Pierre | Nouveaux derives de benzoyl-2-chloro-4-glycinanilides substitues, leur procede de preparation et leur application en tant que medicaments |
| FR2436776A1 (fr) * | 1978-09-25 | 1980-04-18 | Fabre Sa Pierre | Nouveaux derives d'ortho chloro benzoyl-2 chloro-4 glycylanilide, leur preparation et leur application en tant que medicaments |
| FR2459793A1 (fr) * | 1979-06-25 | 1981-01-16 | Fabre Sa Pierre | Nouveaux derives de benzoyl-2 nitro-4 anilides, leur preparation et leur application en tant que medicaments |
| US4289770A (en) * | 1980-06-13 | 1981-09-15 | Pierre Fabre S.A. | 2-Benzoyl-4-nitroanilides and their use as medicaments |
| FR2525214B1 (fr) * | 1982-04-16 | 1986-02-07 | Fabre Sa Pierre | Nouveaux derives d'halogeno benzoyl-2 nitro-4 glycylanilides, leur procede de preparation et leur application en therapeutique |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3371085A (en) * | 1959-12-10 | 1968-02-27 | Hoffmann La Roche | 5-aryl-3h-1,4-benzodiazepin-2(1h)-ones |
-
1968
- 1968-11-14 US US775914A patent/US3914215A/en not_active Expired - Lifetime
- 1968-11-18 IL IL39770A patent/IL39770A/en unknown
- 1968-11-18 IL IL31094A patent/IL31094A/xx unknown
- 1968-11-25 NL NLAANVRAGE6816789,A patent/NL170957C/xx not_active IP Right Cessation
- 1968-11-26 DE DE1817923A patent/DE1817923C3/de not_active Expired
- 1968-11-26 CA CA036,241A patent/CA1038381A/en not_active Expired
- 1968-11-26 FI FI683360A patent/FI49048C/fi active
- 1968-11-26 DK DK576868AA patent/DK141780B/da unknown
- 1968-11-26 IE IE1442/68A patent/IE32894B1/xx unknown
- 1968-11-26 NO NO04705/68A patent/NO127055B/no unknown
- 1968-11-27 CH CH1769168A patent/CH518302A/de not_active IP Right Cessation
- 1968-11-27 AT AT1155368A patent/AT299203B/de not_active IP Right Cessation
- 1968-11-27 SE SE16146/68A patent/SE346791B/xx unknown
- 1968-11-27 GB GB56354/68A patent/GB1254736A/en not_active Expired
- 1968-11-27 YU YU2794/68A patent/YU36709B/xx unknown
-
1970
- 1970-05-25 US US00048695A patent/US3772371A/en not_active Expired - Lifetime
-
1979
- 1979-09-20 YU YU2298/79A patent/YU41664B/xx unknown
- 1979-09-20 YU YU2297/79A patent/YU41413B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| IL31094A0 (en) | 1969-01-29 |
| NL6816789A (enExample) | 1969-05-29 |
| DE1817923B2 (de) | 1977-11-24 |
| YU41413B (en) | 1987-04-30 |
| IL39770A (en) | 1972-10-29 |
| US3914215A (en) | 1975-10-21 |
| FI49048C (fi) | 1975-03-10 |
| AT299203B (de) | 1972-06-12 |
| DK141780C (enExample) | 1980-12-01 |
| DE1817923C3 (de) | 1978-08-03 |
| DK141780B (da) | 1980-06-16 |
| DE1817923A1 (de) | 1974-06-06 |
| CH518302A (de) | 1972-01-31 |
| GB1254736A (en) | 1971-11-24 |
| NO127055B (enExample) | 1973-04-30 |
| NL170957B (nl) | 1982-08-16 |
| IE32894L (en) | 1969-05-27 |
| SE346791B (enExample) | 1972-07-17 |
| NL170957C (nl) | 1983-01-17 |
| US3772371A (en) | 1973-11-13 |
| YU279468A (en) | 1982-06-18 |
| YU41664B (en) | 1987-12-31 |
| FI49048B (enExample) | 1974-12-02 |
| YU36709B (en) | 1984-08-31 |
| IL31094A (en) | 1972-09-28 |
| IE32894B1 (en) | 1974-01-09 |
| YU229879A (en) | 1983-12-31 |
| YU229779A (en) | 1983-01-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3987052A (en) | 6-Phenyl-4H-s-triazolo[4,3-a][1,4]benzodiazepines | |
| US3539573A (en) | 11-basic substituted dibenzodiazepines and dibenzothiazepines | |
| US6174881B1 (en) | Hydroxymethylimidazodiazepines and their esters | |
| US3701782A (en) | 1-carbolower alkoxy - 6 - phenyl-4h-s-triazolo(1,4)benzodiazepine compounds | |
| CA1038381A (en) | Benzodiazepine derivatives and process for preparing the same | |
| US3933794A (en) | 2-(2-Alkynylamino)-3H-1,4-benzodiazepines | |
| CA1067491A (en) | Diazepine derivatives | |
| US3646055A (en) | 2 4-dihydro-6-phenyl-ih-s-triazolo(4 3-a)(1 4) benzodiazepin-1-ones | |
| CH630381A5 (de) | Verfahren zur herstellung von diazepinderivaten. | |
| CA1073904A (en) | Substituted 6-aryl-4h-s-triazolo-(3,4c)-thieno-(2,3e)-1,4-diazepines and processes for production thereof | |
| US3910946A (en) | 4H-Imidazo{8 1,2-a{9 {8 1,4{9 benzodiazepines | |
| US3734922A (en) | Certain 4h-s-triazolo(4,3-a)(1,4)benzodiazepines | |
| Fryer et al. | Quinazolines and 1, 4‐benzodiazepines XVII. Synthesis of 1, 3‐dihydro‐5‐pyridyl‐2H‐1, 4‐benzodiazepine derivatives | |
| US3933816A (en) | 3-(Substituted aminomethyl)-7-substituted-3,5-dihydro-as-triazino[4,3-a][1,5]benzodiazepines | |
| US3927016A (en) | 6-Substituted 4H-imidazo (1,2-a) (1,4)-benzodiazepine-1-carboxaldehydes and processes for their production | |
| NO153263B (no) | Lavtirriterende fast eller flytende saapepreparat | |
| US3464977A (en) | 5-(amino-loweralkyl)-4,5-dihydrothieno-(2,3-b)benzothiazepin-4-ones | |
| US3903103A (en) | 4-Amino-s-triazolo-{8 4,3-a{9 {8 1,4{9 benzodiazepine | |
| CA1170258A (en) | 5-substituted 9-cyanomethylene-dithieno [3,4-b:4',3'-e]-azepines, their preparation and therapeutic agents which contain these compounds | |
| US3717654A (en) | 2,5,6,7-tetrahydro-3h-s-triazolo(4,3-d)(1,4)benzodiazepin-3-one compounds and their production | |
| US4081452A (en) | Novel derivatives of 4H-s-triazolo[4,3-α][1,4]benzodiazepines | |
| US4191760A (en) | Dibenzodiazepines | |
| US3882112A (en) | 7-Phenyl-3-{8 2-(dialkylamino)-alkyl{9 -3,4-dihydroas-triazino{8 4,3-a{9 {8 1,4{9 benzodiazepin-2(1h)-ones | |
| US4028356A (en) | Triazinobenzodiazepines | |
| CA1211437A (en) | Benzazepines |