CA1038377A - Water-soluble azo dyestuffs, their preparation and utilization - Google Patents
Water-soluble azo dyestuffs, their preparation and utilizationInfo
- Publication number
- CA1038377A CA1038377A CA211,552A CA211552A CA1038377A CA 1038377 A CA1038377 A CA 1038377A CA 211552 A CA211552 A CA 211552A CA 1038377 A CA1038377 A CA 1038377A
- Authority
- CA
- Canada
- Prior art keywords
- alkyl
- carbon atoms
- acid
- beta
- formula
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000002360 preparation method Methods 0.000 title claims description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 43
- -1 vinylsulfonyl Chemical group 0.000 claims abstract description 39
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 37
- 239000000460 chlorine Substances 0.000 claims abstract description 22
- 229910052801 chlorine Inorganic materials 0.000 claims abstract description 20
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 17
- 238000010168 coupling process Methods 0.000 claims abstract description 16
- 238000005859 coupling reaction Methods 0.000 claims abstract description 16
- 230000008878 coupling Effects 0.000 claims abstract description 15
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims abstract description 14
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims abstract description 11
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims abstract description 8
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N N-phenyl amine Natural products NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 claims abstract description 7
- 239000003795 chemical substances by application Substances 0.000 claims abstract description 7
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims abstract description 5
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims abstract description 5
- 229910052794 bromium Inorganic materials 0.000 claims abstract description 5
- 150000007519 polyprotic acids Polymers 0.000 claims abstract description 5
- RUFPHBVGCFYCNW-UHFFFAOYSA-N 1-naphthylamine Chemical group C1=CC=C2C(N)=CC=CC2=C1 RUFPHBVGCFYCNW-UHFFFAOYSA-N 0.000 claims abstract description 4
- KJCVRFUGPWSIIH-UHFFFAOYSA-N 1-naphthol Chemical group C1=CC=C2C(O)=CC=CC2=C1 KJCVRFUGPWSIIH-UHFFFAOYSA-N 0.000 claims abstract description 3
- QPKNFEVLZVJGBM-UHFFFAOYSA-N 2-aminonaphthalen-1-ol Chemical group C1=CC=CC2=C(O)C(N)=CC=C21 QPKNFEVLZVJGBM-UHFFFAOYSA-N 0.000 claims abstract description 3
- FTCOWMWIZNVSPP-UHFFFAOYSA-N 2-phenyl-4h-pyrazol-3-one Chemical group O=C1CC=NN1C1=CC=CC=C1 FTCOWMWIZNVSPP-UHFFFAOYSA-N 0.000 claims abstract description 3
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 claims abstract description 3
- 125000004442 acylamino group Chemical group 0.000 claims abstract description 3
- 125000004103 aminoalkyl group Chemical group 0.000 claims abstract description 3
- 125000003118 aryl group Chemical group 0.000 claims abstract description 3
- 125000000623 heterocyclic group Chemical group 0.000 claims abstract description 3
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims abstract 2
- 150000003927 aminopyridines Chemical group 0.000 claims abstract 2
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims abstract 2
- 125000004966 cyanoalkyl group Chemical group 0.000 claims abstract 2
- LVWZTYCIRDMTEY-UHFFFAOYSA-N metamizole Chemical group O=C1C(N(CS(O)(=O)=O)C)=C(C)N(C)N1C1=CC=CC=C1 LVWZTYCIRDMTEY-UHFFFAOYSA-N 0.000 claims abstract 2
- 239000002253 acid Substances 0.000 claims description 41
- 150000001875 compounds Chemical class 0.000 claims description 23
- 239000000975 dye Substances 0.000 claims description 21
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 20
- 239000001257 hydrogen Substances 0.000 claims description 17
- 229910052739 hydrogen Inorganic materials 0.000 claims description 17
- 238000000034 method Methods 0.000 claims description 13
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 claims description 13
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 11
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 11
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 8
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 claims description 7
- 239000000463 material Substances 0.000 claims description 7
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 7
- 239000001117 sulphuric acid Substances 0.000 claims description 7
- 235000011149 sulphuric acid Nutrition 0.000 claims description 7
- 150000003254 radicals Chemical class 0.000 claims description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 5
- IIACRCGMVDHOTQ-UHFFFAOYSA-N sulfamic acid Chemical compound NS(O)(=O)=O IIACRCGMVDHOTQ-UHFFFAOYSA-N 0.000 claims description 5
- 239000004952 Polyamide Substances 0.000 claims description 4
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 4
- 229920002647 polyamide Polymers 0.000 claims description 4
- 229920002554 vinyl polymer Polymers 0.000 claims description 4
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 claims description 3
- 239000004814 polyurethane Substances 0.000 claims description 3
- 239000004627 regenerated cellulose Substances 0.000 claims description 3
- KEQGZUUPPQEDPF-UHFFFAOYSA-N 1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(Cl)C(=O)N(Cl)C1=O KEQGZUUPPQEDPF-UHFFFAOYSA-N 0.000 claims description 2
- 229920003043 Cellulose fiber Polymers 0.000 claims description 2
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 claims description 2
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 claims description 2
- 125000004448 alkyl carbonyl group Chemical group 0.000 claims description 2
- 125000001769 aryl amino group Chemical group 0.000 claims description 2
- XTHPWXDJESJLNJ-UHFFFAOYSA-N chlorosulfonic acid Substances OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 claims description 2
- 150000007530 organic bases Chemical class 0.000 claims description 2
- 229920002635 polyurethane Polymers 0.000 claims description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 2
- ZVNYYNAAEVZNDW-UHFFFAOYSA-N 2-phenylpyrazol-3-amine Chemical group NC1=CC=NN1C1=CC=CC=C1 ZVNYYNAAEVZNDW-UHFFFAOYSA-N 0.000 claims 1
- 125000005090 alkenylcarbonyl group Chemical group 0.000 claims 1
- 125000004663 dialkyl amino group Chemical group 0.000 claims 1
- HSPSCWZIJWKZKD-UHFFFAOYSA-N n-chloroacetamide Chemical compound CC(=O)NCl HSPSCWZIJWKZKD-UHFFFAOYSA-N 0.000 claims 1
- 125000001624 naphthyl group Chemical group 0.000 claims 1
- FVIRGMIYFJWRGC-UHFFFAOYSA-N sulfurobromidic acid Chemical group OS(Br)(=O)=O FVIRGMIYFJWRGC-UHFFFAOYSA-N 0.000 claims 1
- 150000001412 amines Chemical class 0.000 abstract description 2
- ZISOEBMQOZOEOG-UHFFFAOYSA-N 1-phenylpyrazol-4-amine Chemical group C1=C(N)C=NN1C1=CC=CC=C1 ZISOEBMQOZOEOG-UHFFFAOYSA-N 0.000 abstract 1
- 239000000306 component Substances 0.000 description 30
- 238000004043 dyeing Methods 0.000 description 27
- 125000000751 azo group Chemical group [*]N=N[*] 0.000 description 21
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 20
- 229920000742 Cotton Polymers 0.000 description 15
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 15
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 14
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 14
- AKEJUJNQAAGONA-UHFFFAOYSA-N sulfur trioxide Inorganic materials O=S(=O)=O AKEJUJNQAAGONA-UHFFFAOYSA-N 0.000 description 14
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 12
- 210000002268 wool Anatomy 0.000 description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 11
- JJYPMNFTHPTTDI-UHFFFAOYSA-N 3-methylaniline Chemical compound CC1=CC=CC(N)=C1 JJYPMNFTHPTTDI-UHFFFAOYSA-N 0.000 description 10
- 239000000243 solution Substances 0.000 description 8
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 7
- 235000011167 hydrochloric acid Nutrition 0.000 description 7
- 229960000443 hydrochloric acid Drugs 0.000 description 7
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 229910000029 sodium carbonate Inorganic materials 0.000 description 6
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 5
- 229960000583 acetic acid Drugs 0.000 description 5
- 239000012954 diazonium Substances 0.000 description 5
- 150000001989 diazonium salts Chemical class 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 4
- IOVCWXUNBOPUCH-UHFFFAOYSA-N Nitrous acid Chemical compound ON=O IOVCWXUNBOPUCH-UHFFFAOYSA-N 0.000 description 4
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 4
- 235000011054 acetic acid Nutrition 0.000 description 4
- AFOSIXZFDONLBT-UHFFFAOYSA-N divinyl sulfone Chemical group C=CS(=O)(=O)C=C AFOSIXZFDONLBT-UHFFFAOYSA-N 0.000 description 4
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical compound CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 229910006069 SO3H Inorganic materials 0.000 description 3
- 239000011230 binding agent Substances 0.000 description 3
- 125000001246 bromo group Chemical group Br* 0.000 description 3
- 239000000835 fiber Substances 0.000 description 3
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 3
- 239000001103 potassium chloride Substances 0.000 description 3
- 235000011164 potassium chloride Nutrition 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- FAPWRFPIFSIZLT-UHFFFAOYSA-M sodium chloride Inorganic materials [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 3
- 235000002639 sodium chloride Nutrition 0.000 description 3
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Substances [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 3
- 125000000542 sulfonic acid group Chemical group 0.000 description 3
- 238000005406 washing Methods 0.000 description 3
- JWAZRIHNYRIHIV-UHFFFAOYSA-N 2-naphthol Chemical compound C1=CC=CC2=CC(O)=CC=C21 JWAZRIHNYRIHIV-UHFFFAOYSA-N 0.000 description 2
- FKNQCJSGGFJEIZ-UHFFFAOYSA-N 4-methylpyridine Chemical compound CC1=CC=NC=C1 FKNQCJSGGFJEIZ-UHFFFAOYSA-N 0.000 description 2
- HBZVNWNSRNTWPS-UHFFFAOYSA-N 6-amino-4-hydroxynaphthalene-2-sulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=C(O)C2=CC(N)=CC=C21 HBZVNWNSRNTWPS-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 239000004202 carbamide Substances 0.000 description 2
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 230000032050 esterification Effects 0.000 description 2
- 238000005886 esterification reaction Methods 0.000 description 2
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 2
- 239000004744 fabric Substances 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- NCBZRJODKRCREW-UHFFFAOYSA-N m-anisidine Chemical compound COC1=CC=CC(N)=C1 NCBZRJODKRCREW-UHFFFAOYSA-N 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 125000005184 naphthylamino group Chemical group C1(=CC=CC2=CC=CC=C12)N* 0.000 description 2
- RNVCVTLRINQCPJ-UHFFFAOYSA-N o-toluidine Chemical compound CC1=CC=CC=C1N RNVCVTLRINQCPJ-UHFFFAOYSA-N 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Substances [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 230000009257 reactivity Effects 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 239000004753 textile Substances 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- MBDUIEKYVPVZJH-UHFFFAOYSA-N 1-ethylsulfonylethane Chemical compound CCS(=O)(=O)CC MBDUIEKYVPVZJH-UHFFFAOYSA-N 0.000 description 1
- WVYIZGMCLSGZGG-UHFFFAOYSA-N 10-hydroxy-cis-12-octadecenoic acid Natural products CCCCCC=CCC(O)CCCCCCCCC(O)=O WVYIZGMCLSGZGG-UHFFFAOYSA-N 0.000 description 1
- YQSZHCXCUDINAM-UHFFFAOYSA-N 2-(4-methoxyphenyl)-5-methylpyrazol-3-amine Chemical compound C1=CC(OC)=CC=C1N1C(N)=CC(C)=N1 YQSZHCXCUDINAM-UHFFFAOYSA-N 0.000 description 1
- GWIAAIUASRVOIA-UHFFFAOYSA-N 2-aminonaphthalene-1-sulfonic acid Chemical compound C1=CC=CC2=C(S(O)(=O)=O)C(N)=CC=C21 GWIAAIUASRVOIA-UHFFFAOYSA-N 0.000 description 1
- ICSNLGPSRYBMBD-UHFFFAOYSA-N 2-aminopyridine Chemical compound NC1=CC=CC=N1 ICSNLGPSRYBMBD-UHFFFAOYSA-N 0.000 description 1
- YRGYYQCOWUULNF-UHFFFAOYSA-N 2-hydroxy-4-methyl-6-oxo-1h-pyridine-3-carbonitrile Chemical compound CC1=CC(=O)NC(O)=C1C#N YRGYYQCOWUULNF-UHFFFAOYSA-N 0.000 description 1
- PNPCRKVUWYDDST-UHFFFAOYSA-N 3-chloroaniline Chemical compound NC1=CC=CC(Cl)=C1 PNPCRKVUWYDDST-UHFFFAOYSA-N 0.000 description 1
- USWINTIHFQKJTR-UHFFFAOYSA-N 3-hydroxynaphthalene-2,7-disulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=C2C=C(S(O)(=O)=O)C(O)=CC2=C1 USWINTIHFQKJTR-UHFFFAOYSA-N 0.000 description 1
- RLSYSEBKIPOPNA-UHFFFAOYSA-N 4-(5-amino-3-methylpyrazol-1-yl)-2,5-dichlorobenzenesulfonic acid Chemical compound N1=C(C)C=C(N)N1C1=CC(Cl)=C(S(O)(=O)=O)C=C1Cl RLSYSEBKIPOPNA-UHFFFAOYSA-N 0.000 description 1
- PHZVGKMVVKFBCX-UHFFFAOYSA-N 4-aminonaphthalene-1,5-disulfonic acid Chemical compound C1=CC(S(O)(=O)=O)=C2C(N)=CC=C(S(O)(=O)=O)C2=C1 PHZVGKMVVKFBCX-UHFFFAOYSA-N 0.000 description 1
- AXZOOAUQDSXEMU-UHFFFAOYSA-N 4-methyl-2,6-bis(methylamino)pyridine-3-carbonitrile Chemical compound CNC1=CC(C)=C(C#N)C(NC)=N1 AXZOOAUQDSXEMU-UHFFFAOYSA-N 0.000 description 1
- FYTLHYRDGXRYEY-UHFFFAOYSA-N 5-Methyl-3-pyrazolamine Chemical compound CC=1C=C(N)NN=1 FYTLHYRDGXRYEY-UHFFFAOYSA-N 0.000 description 1
- KZCSUEYBKAPKNH-UHFFFAOYSA-N 6-aminonaphthalene-1,3-disulfonic acid Chemical compound OS(=O)(=O)C1=CC(S(O)(=O)=O)=CC2=CC(N)=CC=C21 KZCSUEYBKAPKNH-UHFFFAOYSA-N 0.000 description 1
- YUNBHHWDQDGWHC-UHFFFAOYSA-N 6-aminonaphthalene-1-sulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC2=CC(N)=CC=C21 YUNBHHWDQDGWHC-UHFFFAOYSA-N 0.000 description 1
- VVPHSMHEYVOVLH-UHFFFAOYSA-N 6-hydroxynaphthalene-2-sulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=CC2=CC(O)=CC=C21 VVPHSMHEYVOVLH-UHFFFAOYSA-N 0.000 description 1
- CILBUASZXQAPBO-UHFFFAOYSA-N 7-amino-8-phenylnaphthalene-1-sulfonic acid Chemical compound NC1=CC=C2C=CC=C(S(O)(=O)=O)C2=C1C1=CC=CC=C1 CILBUASZXQAPBO-UHFFFAOYSA-N 0.000 description 1
- CMOLPZZVECHXKN-UHFFFAOYSA-N 7-aminonaphthalene-1,3-disulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=C(S(O)(=O)=O)C2=CC(N)=CC=C21 CMOLPZZVECHXKN-UHFFFAOYSA-N 0.000 description 1
- DOBIZWYVJFIYOV-UHFFFAOYSA-N 7-hydroxynaphthalene-1,3-disulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=C(S(O)(=O)=O)C2=CC(O)=CC=C21 DOBIZWYVJFIYOV-UHFFFAOYSA-N 0.000 description 1
- HUYJTJXLNBOVFO-UHFFFAOYSA-N 7-hydroxynaphthalene-1-sulfonic acid Chemical compound C1=CC=C(S(O)(=O)=O)C2=CC(O)=CC=C21 HUYJTJXLNBOVFO-UHFFFAOYSA-N 0.000 description 1
- USFZMSVCRYTOJT-UHFFFAOYSA-N Ammonium acetate Chemical compound N.CC(O)=O USFZMSVCRYTOJT-UHFFFAOYSA-N 0.000 description 1
- 239000005695 Ammonium acetate Substances 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical compound [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-L Phosphate ion(2-) Chemical compound OP([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-L 0.000 description 1
- 229920000297 Rayon Polymers 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 239000005864 Sulphur Substances 0.000 description 1
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 1
- 241000193803 Therea Species 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 229910001514 alkali metal chloride Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 229940043376 ammonium acetate Drugs 0.000 description 1
- 235000019257 ammonium acetate Nutrition 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 229950011260 betanaphthol Drugs 0.000 description 1
- 125000005998 bromoethyl group Chemical group 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000005521 carbonamide group Chemical group 0.000 description 1
- 125000002843 carboxylic acid group Chemical group 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 238000010026 decatizing Methods 0.000 description 1
- 125000005265 dialkylamine group Chemical group 0.000 description 1
- 239000012374 esterification agent Substances 0.000 description 1
- 125000006125 ethylsulfonyl group Chemical group 0.000 description 1
- 238000009963 fulling Methods 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 159000000011 group IA salts Chemical class 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 150000004682 monohydrates Chemical class 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- GQPLMRYTRLFLPF-UHFFFAOYSA-N nitrous oxide Inorganic materials [O-][N+]#N GQPLMRYTRLFLPF-UHFFFAOYSA-N 0.000 description 1
- HCTVWSOKIJULET-LQDWTQKMSA-M phenoxymethylpenicillin potassium Chemical class [K+].N([C@H]1[C@H]2SC([C@@H](N2C1=O)C([O-])=O)(C)C)C(=O)COC1=CC=CC=C1 HCTVWSOKIJULET-LQDWTQKMSA-M 0.000 description 1
- LEVJVKGPFAQPOI-UHFFFAOYSA-N phenylmethanone Chemical compound O=[C]C1=CC=CC=C1 LEVJVKGPFAQPOI-UHFFFAOYSA-N 0.000 description 1
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- UBQKCCHYAOITMY-UHFFFAOYSA-N pyridin-2-ol Chemical compound OC1=CC=CC=N1 UBQKCCHYAOITMY-UHFFFAOYSA-N 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 238000005185 salting out Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 229960002668 sodium chloride Drugs 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 238000001694 spray drying Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 229920002994 synthetic fiber Polymers 0.000 description 1
- 150000003573 thiols Chemical class 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B62/00—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves
- C09B62/44—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group not directly attached to a heterocyclic ring
- C09B62/503—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group not directly attached to a heterocyclic ring the reactive group being an esterified or non-esterified hydroxyalkyl sulfonyl or mercaptoalkyl sulfonyl group, a quaternised or non-quaternised aminoalkyl sulfonyl group, a heterylmercapto alkyl sulfonyl group, a vinyl sulfonyl or a substituted vinyl sulfonyl group, or a thiophene-dioxide group
- C09B62/507—Azo dyes
- C09B62/51—Monoazo dyes
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19732351970 DE2351970C3 (de) | 1973-10-17 | Wasserlösliche Azoverbindungen, Verfahren zu deren Herstellung und ihre Verwendung als faserreaktive Farbstoffe |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1038377A true CA1038377A (en) | 1978-09-12 |
Family
ID=5895601
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA211,552A Expired CA1038377A (en) | 1973-10-17 | 1974-10-16 | Water-soluble azo dyestuffs, their preparation and utilization |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US4066638A (cg-RX-API-DMAC10.html) |
| JP (1) | JPS5855987B2 (cg-RX-API-DMAC10.html) |
| BE (1) | BE821193A (cg-RX-API-DMAC10.html) |
| CA (1) | CA1038377A (cg-RX-API-DMAC10.html) |
| CH (1) | CH586739A5 (cg-RX-API-DMAC10.html) |
| FR (1) | FR2248301B1 (cg-RX-API-DMAC10.html) |
| GB (1) | GB1458474A (cg-RX-API-DMAC10.html) |
| IN (1) | IN143191B (cg-RX-API-DMAC10.html) |
| IT (1) | IT1022897B (cg-RX-API-DMAC10.html) |
Families Citing this family (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1556908A (en) * | 1977-06-08 | 1979-11-28 | Ici Ltd | Reactiv dyes containing the residue of 1-hydroxy-7-amino-88-5-amino-2'4'-disulphophenylazo naphtaline-3,l-disulphoniic acid |
| US4271072A (en) * | 1977-12-20 | 1981-06-02 | American Hoechst Corporation | Azo dyestuffs containing -SO2 CH2 CH2 OSO3 H and -N(CH2 CH2 OSO3 H)2 groups |
| DE3025904A1 (de) * | 1980-07-09 | 1982-02-11 | Hoechst Ag, 6000 Frankfurt | Wasserloesliche azoverbindungen, verfahren zu ihrer herstellung und ihre verwendung als farbstoffe |
| DE3113001A1 (de) * | 1980-11-06 | 1982-06-09 | Hoechst Ag, 6000 Frankfurt | Wasserloesliche monoazoverbindungen, verfahren zu ihrer herstellung und ihre verwendung als farbstoffe |
| DE3139657A1 (de) | 1980-11-06 | 1982-06-16 | Hoechst Ag, 6000 Frankfurt | Wasserloesliche disazoverbindungen, verfahren zu ihrer herstellung und ihre verwendung als farbstoffe |
| DE3134357A1 (de) * | 1981-08-31 | 1983-03-10 | Hoechst Ag, 6000 Frankfurt | Wasserloesliche azoverbindungen, verfahren zu ihrer herstellung und ihre verwendung als farbstoffe |
| DE3427188A1 (de) * | 1984-07-24 | 1986-01-30 | Hoechst Ag, 6230 Frankfurt | Wasserloesliche pyridon-monoazoverbindungen, verfahren zu ihrer herstellung und ihre verwendung als farbstoffe |
| US4837310A (en) * | 1986-01-16 | 1989-06-06 | Sumitomo Chemical Company, Limited | Red or bluish-red fiber-reactive monoazo compound having 7-substituted amino-1-naphthol-sulfonic acid as coupling component between the chromophore and fiber reactive portions of the compound |
| DE3703565A1 (de) * | 1987-02-06 | 1988-08-18 | Hoechst Ag | Wasserloesliche monoazo-pyrazolon-verbindungen, verfahren zu ihrer herstellung und ihre verwendung als farbstoffe |
| DE3717667A1 (de) * | 1987-05-26 | 1988-12-15 | Hoechst Ag | Wasserloesliche naphthyl-azo-pyrazolon-verbindungen, verfahren zu ihrer herstellung und ihre verwendung als farbstoffe |
| ES2134884T3 (es) * | 1993-08-02 | 1999-10-16 | Dystar Japan Ltd | Colorantes reactivos rojos, sus composiciones y procedimiento de teñido que las utiliza. |
| US5446090A (en) * | 1993-11-12 | 1995-08-29 | Shearwater Polymers, Inc. | Isolatable, water soluble, and hydrolytically stable active sulfones of poly(ethylene glycol) and related polymers for modification of surfaces and molecules |
| US5456727A (en) * | 1994-05-24 | 1995-10-10 | Hoechst Celanese Corporation | Dye compositions for polyamides |
| DE4434989A1 (de) * | 1994-09-30 | 1996-04-04 | Basf Ag | Reaktive Azofarbstoffe mit einer Kupplungskomponente aus der Aminonaphthalinreihe |
| DE19511691A1 (de) * | 1995-03-30 | 1996-10-02 | Basf Ag | Reaktive Azofarbstoffe mit einer Kupplungskomponente aus der Reihe der Aminoaphthalinsulfonsäuren |
| DE19731166A1 (de) * | 1997-07-21 | 1999-01-28 | Basf Ag | Verwendung von Reaktivfarbstoffen zum Färben von Haaren |
| DE10110552A1 (de) * | 2001-03-05 | 2002-09-12 | Basf Ag | Neue Reaktivfarbstoffe und deren Verwendung zum Färben von Substraten, welche nucleophile Gruppen enthalten |
| DE10120531A1 (de) * | 2001-04-26 | 2002-10-31 | Basf Ag | Neue Reaktivfarbstoffe und deren Verwendung zum Färben von Substraten, welche nucleophile Gruppen enthalten |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE507417A (cg-RX-API-DMAC10.html) * | 1950-01-09 | |||
| DE1262475B (de) * | 1962-02-08 | 1968-03-07 | Hoechst Ag | Verfahren zur Herstellung von organischen Farbstoffen |
| DE1289929B (de) * | 1963-06-10 | 1969-02-27 | Hoechst Ag | Verfahren zur Herstellung von faserreaktiven organischen Farbstoffen |
| DE1282213B (de) * | 1964-12-03 | 1968-11-07 | Hoechst Ag | Wasserloeslicher gelber Monoazofarbstoff und Verfahren zu seiner Herstellung |
| DE1644162C3 (de) * | 1966-06-04 | 1975-05-22 | Hoechst Ag, 6000 Frankfurt | Ein wasserlöslicher Pyrazolon-monoazofarbstoff und Verfahren zu dessen Herstellung |
| US3553189A (en) * | 1967-04-13 | 1971-01-05 | Sumitomo Chemical Co | Amino-naphthol-azo-phenyl dyes |
| GB1220422A (en) * | 1968-02-28 | 1971-01-27 | Sumitomo Chemical Co | Reactive yellow monoazo dyes of the phenylazo-pyrazole series and process for the preparation thereof |
| US3642765A (en) * | 1969-04-01 | 1972-02-15 | Ciba Ltd | Mono azo dyestuffs containing a fiber-reactive group |
-
1974
- 1974-10-14 CH CH1376474A patent/CH586739A5/xx not_active IP Right Cessation
- 1974-10-15 US US05/514,994 patent/US4066638A/en not_active Expired - Lifetime
- 1974-10-15 IT IT28453/74A patent/IT1022897B/it active
- 1974-10-16 CA CA211,552A patent/CA1038377A/en not_active Expired
- 1974-10-16 JP JP49118324A patent/JPS5855987B2/ja not_active Expired
- 1974-10-17 FR FR7434949A patent/FR2248301B1/fr not_active Expired
- 1974-10-17 IN IN2305/CAL/74A patent/IN143191B/en unknown
- 1974-10-17 BE BE149636A patent/BE821193A/xx not_active IP Right Cessation
- 1974-10-17 GB GB4501174A patent/GB1458474A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| US4066638A (en) | 1978-01-03 |
| BE821193A (fr) | 1975-04-17 |
| FR2248301A1 (cg-RX-API-DMAC10.html) | 1975-05-16 |
| GB1458474A (en) | 1976-12-15 |
| JPS5067840A (cg-RX-API-DMAC10.html) | 1975-06-06 |
| FR2248301B1 (cg-RX-API-DMAC10.html) | 1978-11-24 |
| DE2351970A1 (de) | 1975-05-15 |
| IN143191B (cg-RX-API-DMAC10.html) | 1977-10-15 |
| IT1022897B (it) | 1978-04-20 |
| AU7435274A (en) | 1976-04-29 |
| JPS5855987B2 (ja) | 1983-12-13 |
| CH586739A5 (cg-RX-API-DMAC10.html) | 1977-04-15 |
| DE2351970B2 (de) | 1977-02-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1038377A (en) | Water-soluble azo dyestuffs, their preparation and utilization | |
| CA1087172A (en) | Dyestuffs, their preparation and use | |
| CA1157468A (en) | Water-soluble azo compounds, processes for their preparation and their use as dyestuffs | |
| KR880001391B1 (ko) | 수용성 디스아조 화합물의 제조방법 | |
| CA1106840A (en) | Water-soluble azo dyestuffs | |
| GB2034343A (en) | Reactive dyestuffs | |
| US2935506A (en) | New dyestuffs and process for dyeing therewith | |
| CA2327679C (en) | Triphendioxazine dyestuffs for dyeing organic substrates | |
| US3440240A (en) | Reactive azo-dyestuffs | |
| US4474697A (en) | Fluorotriazine-group-containing azo dyestuffs | |
| US3226176A (en) | Cellulose, wool, silk and leather fibers fast-dyed with chlorotriazine containing reactive dyestuffs | |
| US4855411A (en) | Water-soluble, monoazo dyes containing a ureido group and two sulfonyl fiber-reactive groups | |
| WO2013008201A2 (en) | Novel reactive dyes, there mixtures and processes thereof | |
| US3426008A (en) | Water-soluble monoazo dyestuffs and their metal complex compounds | |
| US3445449A (en) | Azophthalocyanine dyestuffs | |
| US3114746A (en) | Reactive dyestuffs | |
| US3377336A (en) | Metallized azo dyestuffs containing 2,3 - dichloroquinoxaline carboxamide or sulfonamide groups | |
| US3278549A (en) | Water-soluble dyestuffs and process for preparing them | |
| US3519616A (en) | Water-soluble monoazo dyestuffs | |
| US3349074A (en) | Water-soluble azo dyestuffs | |
| EP0265857B1 (en) | Water-soluble monoazodyes containing a ureido group and two sulfonyl fiber-reactive groups, process for their preparation and their use | |
| US3527760A (en) | Anthraquinone dyestuffs containing 2,3 - dihaloquinoxaline carboxamide or sulfonamide groups | |
| WO2002100953A1 (en) | Fiber reactive dyestuffs | |
| US3197456A (en) | Azo-dyestuffs | |
| JPS58204053A (ja) | 水溶性ジスアゾ化合物、その製法及び該化合物を染料として使用する方法 |