AU754726B2 - Process for adhering a photochromic coating to a polymeric substrate - Google Patents
Process for adhering a photochromic coating to a polymeric substrate Download PDFInfo
- Publication number
- AU754726B2 AU754726B2 AU59197/00A AU5919700A AU754726B2 AU 754726 B2 AU754726 B2 AU 754726B2 AU 59197/00 A AU59197/00 A AU 59197/00A AU 5919700 A AU5919700 A AU 5919700A AU 754726 B2 AU754726 B2 AU 754726B2
- Authority
- AU
- Australia
- Prior art keywords
- radicals
- photochromic
- hydrocarbon radical
- organic
- mixtures
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Ceased
Links
- 238000000034 method Methods 0.000 title claims description 62
- 239000000758 substrate Substances 0.000 title claims description 62
- 238000000576 coating method Methods 0.000 title claims description 56
- 230000008569 process Effects 0.000 title claims description 44
- 239000011248 coating agent Substances 0.000 title claims description 41
- 239000000203 mixture Substances 0.000 claims description 101
- -1 aromatic diazonium salts Chemical class 0.000 claims description 68
- 239000004215 Carbon black (E152) Substances 0.000 claims description 45
- 229930195733 hydrocarbon Natural products 0.000 claims description 45
- 239000000178 monomer Substances 0.000 claims description 31
- 239000008199 coating composition Substances 0.000 claims description 30
- 150000001875 compounds Chemical class 0.000 claims description 28
- 239000010410 layer Substances 0.000 claims description 28
- 239000000463 material Substances 0.000 claims description 26
- 230000005855 radiation Effects 0.000 claims description 26
- BLRPTPMANUNPDV-UHFFFAOYSA-N Silane Chemical compound [SiH4] BLRPTPMANUNPDV-UHFFFAOYSA-N 0.000 claims description 25
- 229910000077 silane Inorganic materials 0.000 claims description 25
- 230000001464 adherent effect Effects 0.000 claims description 21
- 239000012790 adhesive layer Substances 0.000 claims description 17
- 125000004432 carbon atom Chemical group C* 0.000 claims description 17
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 16
- 239000002253 acid Substances 0.000 claims description 15
- 238000011282 treatment Methods 0.000 claims description 15
- 230000003287 optical effect Effects 0.000 claims description 14
- 239000013047 polymeric layer Substances 0.000 claims description 14
- 229920000642 polymer Polymers 0.000 claims description 13
- 239000003960 organic solvent Substances 0.000 claims description 10
- 239000000853 adhesive Substances 0.000 claims description 9
- 230000001070 adhesive effect Effects 0.000 claims description 9
- 150000003839 salts Chemical class 0.000 claims description 8
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Polymers C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 claims description 7
- 239000011254 layer-forming composition Substances 0.000 claims description 7
- XFCMNSHQOZQILR-UHFFFAOYSA-N 2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCCOCCOC(=O)C(C)=C XFCMNSHQOZQILR-UHFFFAOYSA-N 0.000 claims description 6
- 229920000193 polymethacrylate Polymers 0.000 claims description 6
- 229920005989 resin Polymers 0.000 claims description 6
- 239000011347 resin Substances 0.000 claims description 6
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 6
- 229920002554 vinyl polymer Polymers 0.000 claims description 6
- JHQVCQDWGSXTFE-UHFFFAOYSA-N 2-(2-prop-2-enoxycarbonyloxyethoxy)ethyl prop-2-enyl carbonate Chemical compound C=CCOC(=O)OCCOCCOC(=O)OCC=C JHQVCQDWGSXTFE-UHFFFAOYSA-N 0.000 claims description 5
- 239000007787 solid Substances 0.000 claims description 5
- 229920001169 thermoplastic Polymers 0.000 claims description 5
- 239000004416 thermosoftening plastic Substances 0.000 claims description 5
- 239000003513 alkali Substances 0.000 claims description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 4
- 229920000515 polycarbonate Polymers 0.000 claims description 4
- 239000004417 polycarbonate Substances 0.000 claims description 4
- 229920002635 polyurethane Polymers 0.000 claims description 4
- 239000004814 polyurethane Substances 0.000 claims description 4
- GTELLNMUWNJXMQ-UHFFFAOYSA-N 2-ethyl-2-(hydroxymethyl)propane-1,3-diol;prop-2-enoic acid Chemical class OC(=O)C=C.OC(=O)C=C.OC(=O)C=C.CCC(CO)(CO)CO GTELLNMUWNJXMQ-UHFFFAOYSA-N 0.000 claims description 3
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 3
- 229920003229 poly(methyl methacrylate) Polymers 0.000 claims description 3
- 229920000647 polyepoxide Polymers 0.000 claims description 3
- 239000004926 polymethyl methacrylate Substances 0.000 claims description 3
- 125000005409 triarylsulfonium group Chemical group 0.000 claims description 3
- HIACAHMKXQESOV-UHFFFAOYSA-N 1,2-bis(prop-1-en-2-yl)benzene Chemical compound CC(=C)C1=CC=CC=C1C(C)=C HIACAHMKXQESOV-UHFFFAOYSA-N 0.000 claims description 2
- QEQVCPKISCKMOQ-UHFFFAOYSA-N 3h-benzo[f][1,2]benzoxazine Chemical class C1=CC=CC2=C(C=CNO3)C3=CC=C21 QEQVCPKISCKMOQ-UHFFFAOYSA-N 0.000 claims description 2
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 claims description 2
- 229920002732 Polyanhydride Polymers 0.000 claims description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 claims description 2
- 229920003180 amino resin Polymers 0.000 claims description 2
- 150000008430 aromatic amides Chemical class 0.000 claims description 2
- 150000001562 benzopyrans Chemical class 0.000 claims description 2
- 150000005130 benzoxazines Chemical class 0.000 claims description 2
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 2
- 125000005520 diaryliodonium group Chemical group 0.000 claims description 2
- 239000012954 diazonium Substances 0.000 claims description 2
- 239000003822 epoxy resin Substances 0.000 claims description 2
- LNEPOXFFQSENCJ-UHFFFAOYSA-N haloperidol Chemical compound C1CC(O)(C=2C=CC(Cl)=CC=2)CCN1CCCC(=O)C1=CC=C(F)C=C1 LNEPOXFFQSENCJ-UHFFFAOYSA-N 0.000 claims description 2
- 230000003301 hydrolyzing effect Effects 0.000 claims description 2
- 150000003949 imides Chemical class 0.000 claims description 2
- 125000001812 iodosyl group Chemical group O=I[*] 0.000 claims description 2
- 230000005865 ionizing radiation Effects 0.000 claims description 2
- 229920002037 poly(vinyl butyral) polymer Polymers 0.000 claims description 2
- 229920002689 polyvinyl acetate Polymers 0.000 claims description 2
- 239000011118 polyvinyl acetate Substances 0.000 claims description 2
- 125000001273 sulfonato group Chemical class [O-]S(*)(=O)=O 0.000 claims description 2
- VNWOJVJCRAHBJJ-UHFFFAOYSA-N 2-pentylcyclopentan-1-one Chemical compound CCCCCC1CCCC1=O VNWOJVJCRAHBJJ-UHFFFAOYSA-N 0.000 claims 1
- 241000569510 Spino Species 0.000 claims 1
- 150000003926 acrylamides Chemical class 0.000 claims 1
- 239000000243 solution Substances 0.000 description 26
- 239000002904 solvent Substances 0.000 description 14
- 239000000126 substance Substances 0.000 description 12
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 8
- 150000003254 radicals Chemical class 0.000 description 8
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 7
- 239000000975 dye Substances 0.000 description 6
- NXQMCAOPTPLPRL-UHFFFAOYSA-N 2-(2-benzoyloxyethoxy)ethyl benzoate Chemical compound C=1C=CC=CC=1C(=O)OCCOCCOC(=O)C1=CC=CC=C1 NXQMCAOPTPLPRL-UHFFFAOYSA-N 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 239000002537 cosmetic Substances 0.000 description 5
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 5
- 229910052753 mercury Inorganic materials 0.000 description 5
- 239000002987 primer (paints) Substances 0.000 description 5
- XDLMVUHYZWKMMD-UHFFFAOYSA-N 3-trimethoxysilylpropyl 2-methylprop-2-enoate Chemical compound CO[Si](OC)(OC)CCCOC(=O)C(C)=C XDLMVUHYZWKMMD-UHFFFAOYSA-N 0.000 description 4
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 description 4
- SBZXBUIDTXKZTM-UHFFFAOYSA-N diglyme Chemical compound COCCOCCOC SBZXBUIDTXKZTM-UHFFFAOYSA-N 0.000 description 4
- 238000005516 engineering process Methods 0.000 description 4
- 239000007789 gas Substances 0.000 description 4
- 230000004048 modification Effects 0.000 description 4
- 238000012986 modification Methods 0.000 description 4
- 229920003023 plastic Polymers 0.000 description 4
- 229920001223 polyethylene glycol Polymers 0.000 description 4
- 239000013615 primer Substances 0.000 description 4
- 150000004756 silanes Chemical class 0.000 description 4
- 238000004381 surface treatment Methods 0.000 description 4
- 238000012360 testing method Methods 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- CERQOIWHTDAKMF-UHFFFAOYSA-M Methacrylate Chemical compound CC(=C)C([O-])=O CERQOIWHTDAKMF-UHFFFAOYSA-M 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000003377 acid catalyst Substances 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 239000012952 cationic photoinitiator Substances 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 230000007547 defect Effects 0.000 description 3
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 3
- 238000005530 etching Methods 0.000 description 3
- 239000011159 matrix material Substances 0.000 description 3
- 229920000620 organic polymer Polymers 0.000 description 3
- 150000004880 oxines Chemical class 0.000 description 3
- 229910052760 oxygen Inorganic materials 0.000 description 3
- 239000004033 plastic Substances 0.000 description 3
- 229920000058 polyacrylate Polymers 0.000 description 3
- 229920000728 polyester Polymers 0.000 description 3
- 229920005862 polyol Polymers 0.000 description 3
- 150000003077 polyols Chemical class 0.000 description 3
- 239000004094 surface-active agent Substances 0.000 description 3
- BPSIOYPQMFLKFR-UHFFFAOYSA-N trimethoxy-[3-(oxiran-2-ylmethoxy)propyl]silane Chemical compound CO[Si](OC)(OC)CCCOCC1CO1 BPSIOYPQMFLKFR-UHFFFAOYSA-N 0.000 description 3
- AZQWKYJCGOJGHM-UHFFFAOYSA-N 1,4-benzoquinone Chemical compound O=C1C=CC(=O)C=C1 AZQWKYJCGOJGHM-UHFFFAOYSA-N 0.000 description 2
- ARXJGSRGQADJSQ-UHFFFAOYSA-N 1-methoxypropan-2-ol Chemical compound COCC(C)O ARXJGSRGQADJSQ-UHFFFAOYSA-N 0.000 description 2
- UJBOOUHRTQVGRU-UHFFFAOYSA-N 3-methylcyclohexan-1-one Chemical compound CC1CCCC(=O)C1 UJBOOUHRTQVGRU-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 2
- 239000002202 Polyethylene glycol Substances 0.000 description 2
- 238000005299 abrasion Methods 0.000 description 2
- DZBUGLKDJFMEHC-UHFFFAOYSA-N acridine Chemical compound C1=CC=CC2=CC3=CC=CC=C3N=C21 DZBUGLKDJFMEHC-UHFFFAOYSA-N 0.000 description 2
- 230000004913 activation Effects 0.000 description 2
- 239000002318 adhesion promoter Substances 0.000 description 2
- 239000006117 anti-reflective coating Substances 0.000 description 2
- 239000003963 antioxidant agent Substances 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- JKJWYKGYGWOAHT-UHFFFAOYSA-N bis(prop-2-enyl) carbonate Chemical compound C=CCOC(=O)OCC=C JKJWYKGYGWOAHT-UHFFFAOYSA-N 0.000 description 2
- QUZSUMLPWDHKCJ-UHFFFAOYSA-N bisphenol A dimethacrylate Chemical class C1=CC(OC(=O)C(=C)C)=CC=C1C(C)(C)C1=CC=C(OC(=O)C(C)=C)C=C1 QUZSUMLPWDHKCJ-UHFFFAOYSA-N 0.000 description 2
- 230000008859 change Effects 0.000 description 2
- 238000004140 cleaning Methods 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 230000000295 complement effect Effects 0.000 description 2
- 239000000356 contaminant Substances 0.000 description 2
- 239000008367 deionised water Substances 0.000 description 2
- 229910021641 deionized water Inorganic materials 0.000 description 2
- 239000003599 detergent Substances 0.000 description 2
- 238000003618 dip coating Methods 0.000 description 2
- 238000004851 dishwashing Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- UHESRSKEBRADOO-UHFFFAOYSA-N ethyl carbamate;prop-2-enoic acid Chemical compound OC(=O)C=C.CCOC(N)=O UHESRSKEBRADOO-UHFFFAOYSA-N 0.000 description 2
- STVZJERGLQHEKB-UHFFFAOYSA-N ethylene glycol dimethacrylate Chemical compound CC(=C)C(=O)OCCOC(=O)C(C)=C STVZJERGLQHEKB-UHFFFAOYSA-N 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 150000002894 organic compounds Chemical class 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- SOQBVABWOPYFQZ-UHFFFAOYSA-N oxygen(2-);titanium(4+) Chemical class [O-2].[O-2].[Ti+4] SOQBVABWOPYFQZ-UHFFFAOYSA-N 0.000 description 2
- WXZMFSXDPGVJKK-UHFFFAOYSA-N pentaerythritol Chemical compound OCC(CO)(CO)CO WXZMFSXDPGVJKK-UHFFFAOYSA-N 0.000 description 2
- QIWKUEJZZCOPFV-UHFFFAOYSA-N phenyl 2-methylprop-2-enoate Chemical class CC(=C)C(=O)OC1=CC=CC=C1 QIWKUEJZZCOPFV-UHFFFAOYSA-N 0.000 description 2
- KTNLYTNKBOKXRW-UHFFFAOYSA-N phenyliodanium Chemical compound [IH+]C1=CC=CC=C1 KTNLYTNKBOKXRW-UHFFFAOYSA-N 0.000 description 2
- 238000006552 photochemical reaction Methods 0.000 description 2
- 239000003505 polymerization initiator Substances 0.000 description 2
- 238000006116 polymerization reaction Methods 0.000 description 2
- RUOJZAUFBMNUDX-UHFFFAOYSA-N propylene carbonate Chemical compound CC1COC(=O)O1 RUOJZAUFBMNUDX-UHFFFAOYSA-N 0.000 description 2
- 230000001681 protective effect Effects 0.000 description 2
- 230000002829 reductive effect Effects 0.000 description 2
- 230000002441 reversible effect Effects 0.000 description 2
- LIVNPJMFVYWSIS-UHFFFAOYSA-N silicon monoxide Chemical class [Si-]#[O+] LIVNPJMFVYWSIS-UHFFFAOYSA-N 0.000 description 2
- 229910052814 silicon oxide Inorganic materials 0.000 description 2
- GUGNSJAORJLKGP-UHFFFAOYSA-K sodium 8-methoxypyrene-1,3,6-trisulfonate Chemical compound [Na+].[Na+].[Na+].C1=C2C(OC)=CC(S([O-])(=O)=O)=C(C=C3)C2=C2C3=C(S([O-])(=O)=O)C=C(S([O-])(=O)=O)C2=C1 GUGNSJAORJLKGP-UHFFFAOYSA-K 0.000 description 2
- 238000004528 spin coating Methods 0.000 description 2
- 238000009987 spinning Methods 0.000 description 2
- 238000005507 spraying Methods 0.000 description 2
- 238000007655 standard test method Methods 0.000 description 2
- 150000005846 sugar alcohols Polymers 0.000 description 2
- 238000010998 test method Methods 0.000 description 2
- HLZKNKRTKFSKGZ-UHFFFAOYSA-N tetradecan-1-ol Chemical compound CCCCCCCCCCCCCCO HLZKNKRTKFSKGZ-UHFFFAOYSA-N 0.000 description 2
- 229920001187 thermosetting polymer Polymers 0.000 description 2
- OGIDPMRJRNCKJF-UHFFFAOYSA-N titanium oxide Inorganic materials [Ti]=O OGIDPMRJRNCKJF-UHFFFAOYSA-N 0.000 description 2
- BLAVTCXLVOGPEW-UHFFFAOYSA-N 10-(1,2,2,3,6,6-hexamethylpiperidin-4-yl)oxy-10-oxodecanoic acid Chemical compound CC1C(OC(=O)CCCCCCCCC(O)=O)CC(C)(C)N(C)C1(C)C BLAVTCXLVOGPEW-UHFFFAOYSA-N 0.000 description 1
- COXCGWKSEPPDAA-UHFFFAOYSA-N 2,4-dimethylpentanenitrile Chemical compound CC(C)CC(C)C#N COXCGWKSEPPDAA-UHFFFAOYSA-N 0.000 description 1
- OZAIFHULBGXAKX-UHFFFAOYSA-N 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile Chemical compound N#CC(C)(C)N=NC(C)(C)C#N OZAIFHULBGXAKX-UHFFFAOYSA-N 0.000 description 1
- HWSSEYVMGDIFMH-UHFFFAOYSA-N 2-[2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethoxy]ethyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCCOCCOCCOC(=O)C(C)=C HWSSEYVMGDIFMH-UHFFFAOYSA-N 0.000 description 1
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 1
- CMWKITSNTDAEDT-UHFFFAOYSA-N 2-nitrobenzaldehyde Chemical compound [O-][N+](=O)C1=CC=CC=C1C=O CMWKITSNTDAEDT-UHFFFAOYSA-N 0.000 description 1
- IKYAJDOSWUATPI-UHFFFAOYSA-N 3-[dimethoxy(methyl)silyl]propane-1-thiol Chemical compound CO[Si](C)(OC)CCCS IKYAJDOSWUATPI-UHFFFAOYSA-N 0.000 description 1
- MCDBEBOBROAQSH-UHFFFAOYSA-N 3-[dimethoxy(methyl)silyl]propyl prop-2-enoate Chemical compound CO[Si](C)(OC)CCCOC(=O)C=C MCDBEBOBROAQSH-UHFFFAOYSA-N 0.000 description 1
- JSOZORWBKQSQCJ-UHFFFAOYSA-N 3-[ethoxy(dimethyl)silyl]propyl 2-methylprop-2-enoate Chemical compound CCO[Si](C)(C)CCCOC(=O)C(C)=C JSOZORWBKQSQCJ-UHFFFAOYSA-N 0.000 description 1
- ZCRUJAKCJLCJCP-UHFFFAOYSA-N 3-[methoxy(dimethyl)silyl]propyl prop-2-enoate Chemical compound CO[Si](C)(C)CCCOC(=O)C=C ZCRUJAKCJLCJCP-UHFFFAOYSA-N 0.000 description 1
- 125000003682 3-furyl group Chemical group O1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- 125000001541 3-thienyl group Chemical group S1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- DCQBZYNUSLHVJC-UHFFFAOYSA-N 3-triethoxysilylpropane-1-thiol Chemical compound CCO[Si](OCC)(OCC)CCCS DCQBZYNUSLHVJC-UHFFFAOYSA-N 0.000 description 1
- UUEWCQRISZBELL-UHFFFAOYSA-N 3-trimethoxysilylpropane-1-thiol Chemical compound CO[Si](OC)(OC)CCCS UUEWCQRISZBELL-UHFFFAOYSA-N 0.000 description 1
- KBQVDAIIQCXKPI-UHFFFAOYSA-N 3-trimethoxysilylpropyl prop-2-enoate Chemical compound CO[Si](OC)(OC)CCCOC(=O)C=C KBQVDAIIQCXKPI-UHFFFAOYSA-N 0.000 description 1
- 229920002799 BoPET Polymers 0.000 description 1
- 239000007848 Bronsted acid Substances 0.000 description 1
- DKPFZGUDAPQIHT-UHFFFAOYSA-N Butyl acetate Natural products CCCCOC(C)=O DKPFZGUDAPQIHT-UHFFFAOYSA-N 0.000 description 1
- 235000005979 Citrus limon Nutrition 0.000 description 1
- 244000131522 Citrus pyriformis Species 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- 239000004593 Epoxy Substances 0.000 description 1
- 229940123457 Free radical scavenger Drugs 0.000 description 1
- 108010001517 Galectin 3 Proteins 0.000 description 1
- 102100039558 Galectin-3 Human genes 0.000 description 1
- 229920004142 LEXAN™ Polymers 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- 239000004418 Lexan Substances 0.000 description 1
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 1
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 1
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 1
- RJUFJBKOKNCXHH-UHFFFAOYSA-N Methyl propionate Chemical compound CCC(=O)OC RJUFJBKOKNCXHH-UHFFFAOYSA-N 0.000 description 1
- 239000005041 Mylar™ Substances 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 241001310492 Pectis angustifolia Species 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 229920005372 Plexiglas® Polymers 0.000 description 1
- 229920002582 Polyethylene Glycol 600 Polymers 0.000 description 1
- 229920001328 Polyvinylidene chloride Polymers 0.000 description 1
- OKKRPWIIYQTPQF-UHFFFAOYSA-N Trimethylolpropane trimethacrylate Chemical compound CC(=C)C(=O)OCC(CC)(COC(=O)C(C)=C)COC(=O)C(C)=C OKKRPWIIYQTPQF-UHFFFAOYSA-N 0.000 description 1
- QISAYNXDUCNISJ-UHFFFAOYSA-N [(2,6-dimethoxybenzoyl)-phenylphosphoryl]-(2,6-dimethoxyphenyl)methanone Chemical compound COC1=CC=CC(OC)=C1C(=O)P(=O)(C=1C=CC=CC=1)C(=O)C1=C(OC)C=CC=C1OC QISAYNXDUCNISJ-UHFFFAOYSA-N 0.000 description 1
- NOZAQBYNLKNDRT-UHFFFAOYSA-N [diacetyloxy(ethenyl)silyl] acetate Chemical compound CC(=O)O[Si](OC(C)=O)(OC(C)=O)C=C NOZAQBYNLKNDRT-UHFFFAOYSA-N 0.000 description 1
- DUVRJGHTIVORLW-UHFFFAOYSA-N [diethoxy(methyl)silyl]methanethiol Chemical compound CCO[Si](C)(CS)OCC DUVRJGHTIVORLW-UHFFFAOYSA-N 0.000 description 1
- DNQFCBLYUTWWCH-UHFFFAOYSA-N [ethoxy(dimethyl)silyl]methyl 2-methylprop-2-enoate Chemical compound CCO[Si](C)(C)COC(=O)C(C)=C DNQFCBLYUTWWCH-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 238000000862 absorption spectrum Methods 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 229920006397 acrylic thermoplastic Polymers 0.000 description 1
- 125000003647 acryloyl group Chemical group O=C([*])C([H])=C([H])[H] 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000003113 alkalizing effect Effects 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 230000003078 antioxidant effect Effects 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 239000000981 basic dye Substances 0.000 description 1
- ISAOCJYIOMOJEB-UHFFFAOYSA-N benzoin Chemical group C=1C=CC=CC=1C(O)C(=O)C1=CC=CC=C1 ISAOCJYIOMOJEB-UHFFFAOYSA-N 0.000 description 1
- RWCCWEUUXYIKHB-UHFFFAOYSA-N benzophenone Chemical compound C=1C=CC=CC=1C(=O)C1=CC=CC=C1 RWCCWEUUXYIKHB-UHFFFAOYSA-N 0.000 description 1
- 239000012965 benzophenone Substances 0.000 description 1
- YCZWJBIXAUQULS-UHFFFAOYSA-M bis(4-methylphenyl)iodanium;bromide Chemical compound [Br-].C1=CC(C)=CC=C1[I+]C1=CC=C(C)C=C1 YCZWJBIXAUQULS-UHFFFAOYSA-M 0.000 description 1
- CSXPRVTYIFRYPR-UHFFFAOYSA-N bis(ethenyl)-diethoxysilane Chemical compound CCO[Si](C=C)(C=C)OCC CSXPRVTYIFRYPR-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- CDQSJQSWAWPGKG-UHFFFAOYSA-N butane-1,1-diol Chemical compound CCCC(O)O CDQSJQSWAWPGKG-UHFFFAOYSA-N 0.000 description 1
- YXZBWJWYWHRIMU-UBPCSPHJSA-I calcium trisodium 2-[bis[2-[bis(carboxylatomethyl)amino]ethyl]amino]acetate ytterbium-169 Chemical compound [Na+].[Na+].[Na+].[Ca+2].[169Yb].[O-]C(=O)CN(CC([O-])=O)CCN(CC(=O)[O-])CCN(CC([O-])=O)CC([O-])=O YXZBWJWYWHRIMU-UBPCSPHJSA-I 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 239000007809 chemical reaction catalyst Substances 0.000 description 1
- 239000011247 coating layer Substances 0.000 description 1
- 230000005495 cold plasma Effects 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 239000002131 composite material Substances 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 239000007822 coupling agent Substances 0.000 description 1
- 239000004148 curcumin Substances 0.000 description 1
- 238000007766 curtain coating Methods 0.000 description 1
- 150000001983 dialkylethers Chemical class 0.000 description 1
- VFHVQBAGLAREND-UHFFFAOYSA-N diphenylphosphoryl-(2,4,6-trimethylphenyl)methanone Chemical compound CC1=CC(C)=CC(C)=C1C(=O)P(=O)(C=1C=CC=CC=1)C1=CC=CC=C1 VFHVQBAGLAREND-UHFFFAOYSA-N 0.000 description 1
- KPUWHANPEXNPJT-UHFFFAOYSA-N disiloxane Chemical class [SiH3]O[SiH3] KPUWHANPEXNPJT-UHFFFAOYSA-N 0.000 description 1
- 230000005670 electromagnetic radiation Effects 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- 125000003700 epoxy group Chemical group 0.000 description 1
- NKSJNEHGWDZZQF-UHFFFAOYSA-N ethenyl(trimethoxy)silane Chemical compound CO[Si](OC)(OC)C=C NKSJNEHGWDZZQF-UHFFFAOYSA-N 0.000 description 1
- FEHYCIQPPPQNMI-UHFFFAOYSA-N ethenyl(triphenoxy)silane Chemical compound C=1C=CC=CC=1O[Si](OC=1C=CC=CC=1)(C=C)OC1=CC=CC=C1 FEHYCIQPPPQNMI-UHFFFAOYSA-N 0.000 description 1
- MABAWBWRUSBLKQ-UHFFFAOYSA-N ethenyl-tri(propan-2-yloxy)silane Chemical compound CC(C)O[Si](OC(C)C)(OC(C)C)C=C MABAWBWRUSBLKQ-UHFFFAOYSA-N 0.000 description 1
- WOXXJEVNDJOOLV-UHFFFAOYSA-N ethenyl-tris(2-methoxyethoxy)silane Chemical compound COCCO[Si](OCCOC)(OCCOC)C=C WOXXJEVNDJOOLV-UHFFFAOYSA-N 0.000 description 1
- BQRPSOKLSZSNAR-UHFFFAOYSA-N ethenyl-tris[(2-methylpropan-2-yl)oxy]silane Chemical compound CC(C)(C)O[Si](OC(C)(C)C)(OC(C)(C)C)C=C BQRPSOKLSZSNAR-UHFFFAOYSA-N 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- FRIPRWYKBIOZJU-UHFFFAOYSA-N fluorone Chemical compound C1=CC=C2OC3=CC(=O)C=CC3=CC2=C1 FRIPRWYKBIOZJU-UHFFFAOYSA-N 0.000 description 1
- 239000001021 fluorone dye Substances 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 230000004927 fusion Effects 0.000 description 1
- DWRNSCDYNYYYHT-UHFFFAOYSA-K gallium(iii) iodide Chemical compound I[Ga](I)I DWRNSCDYNYYYHT-UHFFFAOYSA-K 0.000 description 1
- 230000002070 germicidal effect Effects 0.000 description 1
- 239000004519 grease Substances 0.000 description 1
- ACCCMOQWYVYDOT-UHFFFAOYSA-N hexane-1,1-diol Chemical compound CCCCCC(O)O ACCCMOQWYVYDOT-UHFFFAOYSA-N 0.000 description 1
- FUZZWVXGSFPDMH-UHFFFAOYSA-M hexanoate Chemical compound CCCCCC([O-])=O FUZZWVXGSFPDMH-UHFFFAOYSA-M 0.000 description 1
- 229920001519 homopolymer Polymers 0.000 description 1
- 229910000037 hydrogen sulfide Inorganic materials 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 230000002209 hydrophobic effect Effects 0.000 description 1
- 230000005661 hydrophobic surface Effects 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 230000033444 hydroxylation Effects 0.000 description 1
- 238000005805 hydroxylation reaction Methods 0.000 description 1
- 238000005213 imbibition Methods 0.000 description 1
- 239000004434 industrial solvent Substances 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 239000003999 initiator Substances 0.000 description 1
- 239000000976 ink Substances 0.000 description 1
- 229910052809 inorganic oxide Inorganic materials 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 230000001678 irradiating effect Effects 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- 239000004611 light stabiliser Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910001507 metal halide Inorganic materials 0.000 description 1
- 150000005309 metal halides Chemical class 0.000 description 1
- 229910044991 metal oxide Inorganic materials 0.000 description 1
- 150000004706 metal oxides Chemical class 0.000 description 1
- 229940017219 methyl propionate Drugs 0.000 description 1
- 239000006082 mold release agent Substances 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- FVXBCDWMKCEPCL-UHFFFAOYSA-N nonane-1,1-diol Chemical compound CCCCCCCCC(O)O FVXBCDWMKCEPCL-UHFFFAOYSA-N 0.000 description 1
- 239000011368 organic material Substances 0.000 description 1
- 150000001282 organosilanes Chemical class 0.000 description 1
- 150000004893 oxazines Chemical class 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 125000005702 oxyalkylene group Chemical group 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- TWSRVQVEYJNFKQ-UHFFFAOYSA-N pentyl propanoate Chemical compound CCCCCOC(=O)CC TWSRVQVEYJNFKQ-UHFFFAOYSA-N 0.000 description 1
- 125000002080 perylenyl group Chemical group C1(=CC=C2C=CC=C3C4=CC=CC5=CC=CC(C1=C23)=C45)* 0.000 description 1
- CSHWQDPOILHKBI-UHFFFAOYSA-N peryrene Natural products C1=CC(C2=CC=CC=3C2=C2C=CC=3)=C3C2=CC=CC3=C1 CSHWQDPOILHKBI-UHFFFAOYSA-N 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 229920002401 polyacrylamide Polymers 0.000 description 1
- 229920006289 polycarbonate film Polymers 0.000 description 1
- 229920000139 polyethylene terephthalate Polymers 0.000 description 1
- 239000005020 polyethylene terephthalate Substances 0.000 description 1
- 239000002685 polymerization catalyst Substances 0.000 description 1
- 229920006324 polyoxymethylene Polymers 0.000 description 1
- 229920001451 polypropylene glycol Polymers 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- 229920002578 polythiourethane polymer Polymers 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 239000011253 protective coating Substances 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- 239000002516 radical scavenger Substances 0.000 description 1
- 238000000518 rheometry Methods 0.000 description 1
- 229940116351 sebacate Drugs 0.000 description 1
- CXMXRPHRNRROMY-UHFFFAOYSA-L sebacate(2-) Chemical compound [O-]C(=O)CCCCCCCCC([O-])=O CXMXRPHRNRROMY-UHFFFAOYSA-L 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 230000003595 spectral effect Effects 0.000 description 1
- 125000003003 spiro group Chemical group 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 229920003002 synthetic resin Polymers 0.000 description 1
- 239000000057 synthetic resin Substances 0.000 description 1
- ISXSCDLOGDJUNJ-UHFFFAOYSA-N tert-butyl prop-2-enoate Chemical compound CC(C)(C)OC(=O)C=C ISXSCDLOGDJUNJ-UHFFFAOYSA-N 0.000 description 1
- BRGJIIMZXMWMCC-UHFFFAOYSA-N tetradecan-2-ol Chemical compound CCCCCCCCCCCCC(C)O BRGJIIMZXMWMCC-UHFFFAOYSA-N 0.000 description 1
- 125000003396 thiol group Chemical group [H]S* 0.000 description 1
- HTSABYAWKQAHBT-UHFFFAOYSA-N trans 3-methylcyclohexanol Natural products CC1CCCC(O)C1 HTSABYAWKQAHBT-UHFFFAOYSA-N 0.000 description 1
- 238000005809 transesterification reaction Methods 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- UMFJXASDGBJDEB-UHFFFAOYSA-N triethoxy(prop-2-enyl)silane Chemical compound CCO[Si](CC=C)(OCC)OCC UMFJXASDGBJDEB-UHFFFAOYSA-N 0.000 description 1
- UZIAQVMNAXPCJQ-UHFFFAOYSA-N triethoxysilylmethyl 2-methylprop-2-enoate Chemical compound CCO[Si](OCC)(OCC)COC(=O)C(C)=C UZIAQVMNAXPCJQ-UHFFFAOYSA-N 0.000 description 1
- UOKUUKOEIMCYAI-UHFFFAOYSA-N trimethoxysilylmethyl 2-methylprop-2-enoate Chemical compound CO[Si](OC)(OC)COC(=O)C(C)=C UOKUUKOEIMCYAI-UHFFFAOYSA-N 0.000 description 1
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 239000010937 tungsten Substances 0.000 description 1
- 238000004506 ultrasonic cleaning Methods 0.000 description 1
- JOYRKODLDBILNP-UHFFFAOYSA-N urethane group Chemical group NC(=O)OCC JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 1
- 150000003673 urethanes Chemical class 0.000 description 1
- 238000001429 visible spectrum Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 229910052724 xenon Inorganic materials 0.000 description 1
- FHNFHKCVQCLJFQ-UHFFFAOYSA-N xenon atom Chemical compound [Xe] FHNFHKCVQCLJFQ-UHFFFAOYSA-N 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09D—COATING COMPOSITIONS, e.g. PAINTS, VARNISHES OR LACQUERS; FILLING PASTES; CHEMICAL PAINT OR INK REMOVERS; INKS; CORRECTING FLUIDS; WOODSTAINS; PASTES OR SOLIDS FOR COLOURING OR PRINTING; USE OF MATERIALS THEREFOR
- C09D4/00—Coating compositions, e.g. paints, varnishes or lacquers, based on organic non-macromolecular compounds having at least one polymerisable carbon-to-carbon unsaturated bond ; Coating compositions, based on monomers of macromolecular compounds of groups C09D183/00 - C09D183/16
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09K—MATERIALS FOR MISCELLANEOUS APPLICATIONS, NOT PROVIDED FOR ELSEWHERE
- C09K2323/00—Functional layers of liquid crystal optical display excluding electroactive liquid crystal layer characterised by chemical composition
- C09K2323/05—Bonding or intermediate layer characterised by chemical composition, e.g. sealant or spacer
- C09K2323/053—Organic silicon compound, e.g. organosilicon
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10S—TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10S348/00—Television
- Y10S348/902—Photochromic
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10T—TECHNICAL SUBJECTS COVERED BY FORMER US CLASSIFICATION
- Y10T428/00—Stock material or miscellaneous articles
- Y10T428/31504—Composite [nonstructural laminate]
- Y10T428/31652—Of asbestos
- Y10T428/31663—As siloxane, silicone or silane
Landscapes
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Paints Or Removers (AREA)
- Laminated Bodies (AREA)
- Manufacture Of Macromolecular Shaped Articles (AREA)
- Treatments Of Macromolecular Shaped Articles (AREA)
- Coating Of Shaped Articles Made Of Macromolecular Substances (AREA)
- Application Of Or Painting With Fluid Materials (AREA)
- Adhesives Or Adhesive Processes (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US09/348,135 US6150430A (en) | 1999-07-06 | 1999-07-06 | Process for adhering a photochromic coating to a polymeric substrate |
| US09/348135 | 1999-07-06 | ||
| PCT/US2000/018575 WO2001002472A1 (en) | 1999-07-06 | 2000-07-06 | Process for adhering a photochromic coating to a polymeric substrate |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| AU5919700A AU5919700A (en) | 2001-01-22 |
| AU754726B2 true AU754726B2 (en) | 2002-11-21 |
Family
ID=23366785
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AU59197/00A Ceased AU754726B2 (en) | 1999-07-06 | 2000-07-06 | Process for adhering a photochromic coating to a polymeric substrate |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US6150430A (enExample) |
| EP (1) | EP1200512B1 (enExample) |
| JP (1) | JP4638639B2 (enExample) |
| AU (1) | AU754726B2 (enExample) |
| BR (1) | BR0012208B1 (enExample) |
| DE (1) | DE60007753T2 (enExample) |
| WO (1) | WO2001002472A1 (enExample) |
Families Citing this family (127)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AU769249B2 (en) | 1999-07-02 | 2004-01-22 | Ppg Industries Ohio, Inc. | Poly(meth)acrylic photochromic coating |
| CZ20021370A3 (cs) * | 1999-10-28 | 2002-10-16 | Daicel Chemical Industries, Ltd. | Spouątěč elektrického typu a vyvíječ plynu |
| US6531076B2 (en) | 2000-02-04 | 2003-03-11 | Ppg Industries Ohio, Inc. | Photochromic organic resin composition |
| WO2001057106A1 (en) * | 2000-02-04 | 2001-08-09 | Ppg Industries Ohio, Inc. | Photochromic coated articles |
| FR2806076B1 (fr) * | 2000-03-08 | 2002-09-20 | Saint Gobain Vitrage | Substrat transparent revetu d'une couche polymere |
| US7077985B2 (en) | 2000-05-30 | 2006-07-18 | Vision-Ease Lens | Injection molding of lens |
| JP3922873B2 (ja) * | 2000-09-29 | 2007-05-30 | 株式会社トクヤマ | 硬化性組成物 |
| KR100652041B1 (ko) * | 2000-12-29 | 2006-11-30 | 엘지.필립스 엘시디 주식회사 | 액정표시소자 및 그 제조방법 |
| US6773108B2 (en) * | 2001-03-21 | 2004-08-10 | Invicta Corporation | Lens with photochromic elastomer film and method of making it |
| US6998072B2 (en) * | 2001-11-01 | 2006-02-14 | Transitions Optical, Inc. | Photochromic polymerizable compositions |
| US6916537B2 (en) * | 2001-11-01 | 2005-07-12 | Transitions Optical Inc. | Articles having a photochromic polymeric coating |
| US8017720B2 (en) | 2005-12-16 | 2011-09-13 | Ppg Industries Ohio, Inc. | Sulfur-containing oligomers and high index polyurethanes prepared therefrom |
| US7452611B2 (en) * | 2001-12-27 | 2008-11-18 | Transitions Optical, Inc. | Photochromic optical article |
| US7410691B2 (en) * | 2001-12-27 | 2008-08-12 | Ppg Industries Ohio, Inc. | Photochromic optical article |
| DE10202565A1 (de) * | 2002-01-24 | 2003-08-07 | Basf Coatings Ag | Gehärtete Materialien, Verfahren zu ihrer Herstellung und ihre Verwendung |
| US7036932B2 (en) * | 2002-10-04 | 2006-05-02 | Vision-Ease Lens | Laminated functional wafer for plastic optical elements |
| US20040071978A1 (en) * | 2002-10-15 | 2004-04-15 | Omnova Solutions Inc. | Laminate and method of production |
| US7009032B2 (en) | 2002-12-20 | 2006-03-07 | Ppg Industries Ohio, Inc. | Sulfide-containing polythiols |
| US7166357B2 (en) * | 2003-03-20 | 2007-01-23 | Transitions Optical, Inc. | Photochromic articles that activate behind ultraviolet radiation blocking transparencies and methods for preparation |
| US7320826B2 (en) * | 2003-03-20 | 2008-01-22 | Ppg Industries Ohio, Inc. | Photochromic articles with reduced temperature dependency and methods for preparation |
| US20040186241A1 (en) * | 2003-03-20 | 2004-09-23 | Gemert Barry Van | Photochromic ocular devices |
| US7262295B2 (en) | 2003-03-20 | 2007-08-28 | Transitions Optical, Inc. | Indeno-fused photochromic naphthopyrans, naphthols and photochromic articles |
| US7128415B2 (en) * | 2003-04-30 | 2006-10-31 | Polylite Taiwan Company, Ltd | Method of forming polarized or photochromic lenses by fusing polycarbonate with other plastic materials |
| US8582192B2 (en) | 2003-07-01 | 2013-11-12 | Transitions Optical, Inc. | Polarizing photochromic articles |
| US8211338B2 (en) | 2003-07-01 | 2012-07-03 | Transitions Optical, Inc | Photochromic compounds |
| WO2005006034A2 (en) | 2003-07-01 | 2005-01-20 | Transitions Optical, Inc. | Alignment facilities for optical dyes |
| US7256921B2 (en) | 2003-07-01 | 2007-08-14 | Transitions Optical, Inc. | Polarizing, photochromic devices and methods of making the same |
| US7632540B2 (en) | 2003-07-01 | 2009-12-15 | Transitions Optical, Inc. | Alignment facilities for optical dyes |
| US7342112B2 (en) | 2003-07-01 | 2008-03-11 | Ppg Industries Ohio, Inc. | Photochromic compounds |
| US8545015B2 (en) | 2003-07-01 | 2013-10-01 | Transitions Optical, Inc. | Polarizing photochromic articles |
| US8518546B2 (en) | 2003-07-01 | 2013-08-27 | Transitions Optical, Inc. | Photochromic compounds and compositions |
| US9096014B2 (en) | 2003-07-01 | 2015-08-04 | Transitions Optical, Inc. | Oriented polymeric sheets exhibiting dichroism and articles containing the same |
| US7978391B2 (en) | 2004-05-17 | 2011-07-12 | Transitions Optical, Inc. | Polarizing, photochromic devices and methods of making the same |
| US8089678B2 (en) | 2003-07-01 | 2012-01-03 | Transitions Optical, Inc | Clear to circular polarizing photochromic devices and methods of making the same |
| US8698117B2 (en) | 2003-07-01 | 2014-04-15 | Transitions Optical, Inc. | Indeno-fused ring compounds |
| US8545984B2 (en) | 2003-07-01 | 2013-10-01 | Transitions Optical, Inc. | Photochromic compounds and compositions |
| US6984262B2 (en) * | 2003-07-16 | 2006-01-10 | Transitions Optical, Inc. | Adhesion enhancing coating composition, process for using and articles produced |
| AU2004270746B2 (en) | 2003-09-09 | 2010-12-02 | Insight Equity A.P.X., Lp | Photochromic polyurethane laminate |
| US7858001B2 (en) | 2003-09-09 | 2010-12-28 | Insight Equity A.P.X., L.P. | Photochromic lens |
| US7488510B2 (en) * | 2003-10-28 | 2009-02-10 | Signet Armorlite, Inc. | Compositions and methods for the preparation of composite photochromic polycarbonate lenses |
| US7094368B2 (en) * | 2003-12-10 | 2006-08-22 | Transitions Optical, Inc. | Pyrano-quinolines, pyrano-quinolinones, combinations thereof, photochromic compositions and articles |
| US7097303B2 (en) | 2004-01-14 | 2006-08-29 | Ppg Industries Ohio, Inc. | Polarizing devices and methods of making the same |
| US20050196626A1 (en) * | 2004-03-04 | 2005-09-08 | Knox Carol L. | Photochromic optical article |
| US20050196616A1 (en) * | 2004-03-04 | 2005-09-08 | Stewart Kevin J. | Photochromic optical article |
| US7261843B2 (en) | 2004-03-04 | 2007-08-28 | Transitions Optical, Inc. | Photochromic optical article |
| US7189456B2 (en) | 2004-03-04 | 2007-03-13 | Transitions Optical, Inc. | Photochromic optical article |
| US7144966B2 (en) * | 2004-03-04 | 2006-12-05 | Basf Corporation | Acrylic composition for use in coating applications and a method of forming the same |
| US7811480B2 (en) * | 2004-03-04 | 2010-10-12 | Transitions Optical, Inc. | Photochromic optical article |
| US8563212B2 (en) * | 2004-07-16 | 2013-10-22 | Transitions Optical, Inc. | Methods for producing photosensitive microparticles, non-aqueous dispersions thereof and articles prepared therewith |
| US8153344B2 (en) * | 2004-07-16 | 2012-04-10 | Ppg Industries Ohio, Inc. | Methods for producing photosensitive microparticles, aqueous compositions thereof and articles prepared therewith |
| US8563213B2 (en) | 2004-07-16 | 2013-10-22 | Transitions Optical, Inc. | Methods for producing photosensitive microparticles |
| US9598527B2 (en) | 2004-09-01 | 2017-03-21 | Ppg Industries Ohio, Inc. | Polyurethanes, articles and coatings prepared therefrom and methods of making the same |
| US9464169B2 (en) | 2004-09-01 | 2016-10-11 | Ppg Industries Ohio, Inc. | Polyurethanes, articles and coatings prepared therefrom and methods of making the same |
| US11008418B2 (en) | 2004-09-01 | 2021-05-18 | Ppg Industries Ohio, Inc. | Polyurethanes, articles and coatings prepared therefrom and methods of making the same |
| US20090280709A1 (en) | 2004-09-01 | 2009-11-12 | Ppg Industries Ohio, Inc. | Polyurethanes, Articles and Coatings Prepared Therefrom and Methods of Making the Same |
| US11591436B2 (en) | 2004-09-01 | 2023-02-28 | Ppg Industries Ohio, Inc. | Polyurethane article and methods of making the same |
| US20090280329A1 (en) | 2004-09-01 | 2009-11-12 | Ppg Industries Ohio, Inc. | Polyurethanes, Articles and Coatings Prepared Therefrom and Methods of Making the Same |
| US11248083B2 (en) | 2004-09-01 | 2022-02-15 | Ppg Industries Ohio, Inc. | Aircraft windows |
| US11149107B2 (en) | 2004-09-01 | 2021-10-19 | Ppg Industries Ohio, Inc. | Polyurethanes, articles and coatings prepared therefrom and methods of making the same |
| KR100733920B1 (ko) * | 2004-09-17 | 2007-07-02 | 주식회사 엘지화학 | 에칭 레지스트용 잉크 조성물, 이를 이용한 에칭 레지스트패턴 형성 방법 및 미세 유로 형성 방법 |
| WO2006094313A2 (en) | 2005-03-04 | 2006-09-08 | Vision-Ease Lens | Forming method for polymeric laminated wafers comprising different film materials |
| US8647538B2 (en) | 2005-04-08 | 2014-02-11 | Transitions Optical, Inc. | Photochromic compounds having at least two photochromic moieties |
| US20060226402A1 (en) * | 2005-04-08 | 2006-10-12 | Beon-Kyu Kim | Ophthalmic devices comprising photochromic materials having extended PI-conjugated systems |
| US9139552B2 (en) | 2005-04-08 | 2015-09-22 | Transitions Optical, Inc. | Indeno-fused naphthopyrans having ethylenically unsaturated groups |
| US9052438B2 (en) * | 2005-04-08 | 2015-06-09 | Johnson & Johnson Vision Care, Inc. | Ophthalmic devices comprising photochromic materials with reactive substituents |
| US9028728B2 (en) | 2005-04-08 | 2015-05-12 | Transitions Optical, Inc. | Photochromic materials that include indeno-fused naphthopyrans |
| US8147725B2 (en) | 2005-04-08 | 2012-04-03 | Transitions Optical, Inc | Photochromic materials having extended pi-conjugated systems and compositions and articles including the same |
| US7556750B2 (en) * | 2005-04-08 | 2009-07-07 | Transitions Optical, Inc. | Photochromic materials with reactive substituents |
| US8158037B2 (en) | 2005-04-08 | 2012-04-17 | Johnson & Johnson Vision Care, Inc. | Photochromic materials having extended pi-conjugated systems and compositions and articles including the same |
| US20060228557A1 (en) * | 2005-04-08 | 2006-10-12 | Beon-Kyu Kim | Photochromic materials having extended pi-conjugated systems and compositions and articles including the same |
| US20060227287A1 (en) * | 2005-04-08 | 2006-10-12 | Frank Molock | Photochromic ophthalmic devices made with dual initiator system |
| DE102005029360B4 (de) * | 2005-06-24 | 2011-11-10 | Softal Corona & Plasma Gmbh | Zwei Verfahren zur kontinuierlichen Atmosphärendruck Plasmabehandlung von Werkstücken, insbesondere Materialplatten oder -bahnen |
| JP5021194B2 (ja) * | 2005-09-15 | 2012-09-05 | Hoya株式会社 | 硬化性組成物及びそれを用いた光学部材 |
| ES2339485T3 (es) * | 2005-12-14 | 2010-05-20 | The Procter And Gamble Company | Composiciones detergentes que contienen compuestos iniciadores de tipo azo para una capacidad de blanqueo mejorada y ventajas de eliminacion de manchas. |
| US7556751B2 (en) * | 2005-12-21 | 2009-07-07 | Transitions Optical, Inc. | Photochromic materials having electron-withdrawing substituents |
| US7527754B2 (en) * | 2005-12-21 | 2009-05-05 | Transitions Optical, Inc. | Photochromic indeno-fused naphthopyrans |
| US7687597B2 (en) | 2006-05-05 | 2010-03-30 | Ppg Industries Ohio, Inc. | Thioether functional oligomeric polythiols and articles prepared therefrom |
| US7481955B2 (en) * | 2006-05-31 | 2009-01-27 | Transitions Optical, Inc. | Photochromic materials comprising metallocenyl groups |
| US20070278461A1 (en) * | 2006-05-31 | 2007-12-06 | Transitions Optical, Inc. | Photochromic materials comprising haloalkyl groups |
| US20080107564A1 (en) | 2006-07-20 | 2008-05-08 | Shmuel Sternberg | Medical fluid access site with antiseptic indicator |
| US8748634B2 (en) * | 2006-10-30 | 2014-06-10 | Transitions Optical, Inc. | Photochromic materials demonstrating improved fade rates |
| US7906214B2 (en) | 2007-01-26 | 2011-03-15 | Transitions Optical, Inc. | Optical elements comprising compatiblizing coatings and methods of making the same |
| US7907346B2 (en) | 2007-03-16 | 2011-03-15 | Transitions Optical, Inc. | Photochromic materials and photochromic compositions and articles including the same |
| JP5118389B2 (ja) * | 2007-05-26 | 2013-01-16 | 中村製作所株式会社 | ワークへの凹所形成方法 |
| USRE47452E1 (en) | 2007-07-20 | 2019-06-25 | Baxter International Inc. | Antimicrobial housing and cover for a medical device |
| US9125973B2 (en) | 2007-07-20 | 2015-09-08 | Baxter International Inc. | Antimicrobial housing and cover for a medical device |
| JP2011508064A (ja) * | 2007-12-27 | 2011-03-10 | バクスター・インターナショナル・インコーポレイテッド | 照射硬化性コーティング |
| US8753561B2 (en) | 2008-06-20 | 2014-06-17 | Baxter International Inc. | Methods for processing substrates comprising metallic nanoparticles |
| US8178120B2 (en) | 2008-06-20 | 2012-05-15 | Baxter International Inc. | Methods for processing substrates having an antimicrobial coating |
| US20090326186A1 (en) * | 2008-06-27 | 2009-12-31 | Transitions Optical, Inc. | Mesogen containing compounds |
| US20100014010A1 (en) * | 2008-06-27 | 2010-01-21 | Transitions Optical, Inc. | Formulations comprising mesogen containing compounds |
| US8277826B2 (en) | 2008-06-25 | 2012-10-02 | Baxter International Inc. | Methods for making antimicrobial resins |
| US8431039B2 (en) | 2008-06-27 | 2013-04-30 | Transitions Optical, Inc. | Mesogenic stabilizers |
| US8349210B2 (en) | 2008-06-27 | 2013-01-08 | Transitions Optical, Inc. | Mesogenic stabilizers |
| US7910019B2 (en) | 2008-06-27 | 2011-03-22 | Transitions Optical, Inc. | Mesogen containing compounds |
| US8628685B2 (en) * | 2008-06-27 | 2014-01-14 | Transitions Optical, Inc | Mesogen-containing compounds |
| US8613868B2 (en) | 2008-06-27 | 2013-12-24 | Transitions Optical, Inc | Mesogenic stabilizers |
| US8623238B2 (en) | 2008-06-27 | 2014-01-07 | Transitions Optical, Inc. | Mesogenic stabilizers |
| US7910020B2 (en) * | 2008-06-27 | 2011-03-22 | Transitions Optical, Inc. | Liquid crystal compositions comprising mesogen containing compounds |
| US8084133B2 (en) * | 2008-08-06 | 2011-12-27 | Ppg Industries Ohio, Inc | Tintable film-forming compositions having high refractive indices and coated optical articles using same |
| US7911676B2 (en) * | 2008-12-16 | 2011-03-22 | Transitions Optical, Inc. | Photochromic optical articles prepared with reversible thermochromic materials |
| US20100232003A1 (en) | 2009-03-13 | 2010-09-16 | Transitions Optical, Inc. | Vision enhancing optical articles |
| US8518305B2 (en) | 2009-10-28 | 2013-08-27 | Transitions Optical, Inc. | Photochromic materials |
| US9475901B2 (en) * | 2009-12-08 | 2016-10-25 | Transitions Optical, Inc. | Photoalignment materials having improved adhesion |
| JP5278591B2 (ja) * | 2010-02-26 | 2013-09-04 | 株式会社ニコン | パターン形成方法 |
| US8277699B2 (en) | 2010-04-30 | 2012-10-02 | Transistions Optical, Inc. | Photochromic materials that include 6-amino substituted indeno-fused naphthopyrans |
| US8535577B2 (en) | 2010-04-30 | 2013-09-17 | Transitions Optical, Inc. | Photochromic materials that include 6-amino substituted indeno-fused naphthopyrans |
| US9034219B2 (en) | 2010-12-16 | 2015-05-19 | Transitions Optical, Inc. | Photochromic compounds and compositions |
| US8859097B2 (en) | 2010-12-16 | 2014-10-14 | Transitions Optical, Inc. | Photochromic compounds, compositions and articles |
| US8920928B2 (en) | 2010-12-16 | 2014-12-30 | Transitions Optical, Inc. | Photochromic compounds and compositions |
| US9042019B2 (en) | 2011-04-15 | 2015-05-26 | Qspex Technologies, Inc. | Anti-reflective lenses and methods for manufacturing the same |
| US9335443B2 (en) | 2011-04-15 | 2016-05-10 | Qspex Technologies, Inc. | Anti-reflective lenses and methods for manufacturing the same |
| US8641933B2 (en) | 2011-09-23 | 2014-02-04 | Ppg Industries Ohio, Inc | Composite crystal colloidal array with photochromic member |
| US10185057B2 (en) | 2011-11-11 | 2019-01-22 | Ppg Industries Ohio, Inc. | Coated articles having abrasion resistant, glass-like coatings |
| US20140097392A1 (en) * | 2012-10-05 | 2014-04-10 | E I Du Pont De Nemours And Company | Liquid coating compositions of polymer matrix resins with photochromic dyes and films made therefrom |
| US9568643B2 (en) | 2012-12-13 | 2017-02-14 | Ppg Industries Ohio, Inc. | Polyurethane urea-containing compositions and optical articles and methods for preparing them |
| US9081130B1 (en) | 2013-01-09 | 2015-07-14 | Insight Equity A.P.X., Lp | Photochromic polyurethane laminate |
| WO2015032034A1 (en) | 2013-09-04 | 2015-03-12 | Ppg Coatings (Tianjin) Co., Ltd. | Uv-curable coating compositions and methods for using the same |
| WO2015054037A1 (en) * | 2013-10-11 | 2015-04-16 | Transitions Optical, Inc. | Method of preparing a photochromic optical article using an organic solvent pretreatment and photochromic coating |
| JP6496803B2 (ja) * | 2014-07-11 | 2019-04-10 | ドルフ ケタール ケミカルズ (インディア)プライヴェート リミテッド | 接着促進システムおよびそのインク組成物 |
| MX368296B (es) | 2014-09-30 | 2019-09-27 | Transitions Optical Inc | Absorbentes de luz ultravioleta. |
| US10423061B2 (en) | 2015-09-03 | 2019-09-24 | Transitions Optical, Inc. | Multilayer photochromic articles |
| KR102480724B1 (ko) | 2015-10-30 | 2022-12-22 | 트랜지션즈 옵티칼 인코포레이티드 | 구배 광 반응성을 갖는 광학 제품 및 이의 제조 방법 |
| WO2017074429A1 (en) | 2015-10-30 | 2017-05-04 | Transitions Optical Ltd. | A method of making an optical article with an inkjet printing device |
| US10866455B2 (en) | 2017-10-19 | 2020-12-15 | Ppg Industries Ohio, Inc. | Display devices including photochromic-dichroic compounds and dichroic compounds |
| CN112341615B (zh) * | 2020-10-27 | 2021-07-27 | 北京航空航天大学 | 端烃基超支化聚酯以及包含其的光致聚合物材料 |
| CN121241281A (zh) | 2023-06-09 | 2025-12-30 | 全视线光学有限公司 | 光致变色镜片 |
Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4348462A (en) * | 1980-07-11 | 1982-09-07 | General Electric Company | Abrasion resistant ultraviolet light curable hard coating compositions |
| GB2113698A (en) * | 1982-01-13 | 1983-08-10 | Anic Spa | Polymerizable primer coating compositions and polycarbonates coated therewith |
| JPS62164537A (ja) * | 1986-01-17 | 1987-07-21 | 東レ株式会社 | 複合体 |
Family Cites Families (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3637416A (en) * | 1970-02-04 | 1972-01-25 | Mbt Corp | Method of treating synthetic plastic and elastomeric materials and articles produced thereby |
| US3971872A (en) * | 1974-09-30 | 1976-07-27 | American Optical Corporation | Process for the production of an abrasion resistant optical element |
| US4225631A (en) * | 1976-04-19 | 1980-09-30 | Itek Corporation | Abrasion resistant coatings for unsaturated polymeric substrates |
| US4101513A (en) * | 1977-02-02 | 1978-07-18 | Minnesota Mining And Manufacturing Company | Catalyst for condensation of hydrolyzable silanes and storage stable compositions thereof |
| JPS57158235A (en) * | 1981-03-26 | 1982-09-30 | Toray Ind Inc | Plastic molding |
| US4556605A (en) * | 1982-09-09 | 1985-12-03 | Kabushiki Kaisha Suwa Seikosha | Photochromic coating composition and photochromic synthetic resin ophthalmic lens |
| US4654262A (en) * | 1985-04-10 | 1987-03-31 | Itt Corporation | Polyolefin resin surface preparation |
| US4615947A (en) * | 1985-04-29 | 1986-10-07 | General Electric Company | Acrylic primer for adhering an organopolysiloxane |
| AU564689B2 (en) * | 1985-07-09 | 1987-08-20 | Kureha Kagaku Kogyo K.K. | Photochromic lens |
| JPS6210604A (ja) * | 1985-07-09 | 1987-01-19 | Kureha Chem Ind Co Ltd | 調光レンズ |
| US4673354A (en) * | 1985-10-01 | 1987-06-16 | Minnesota Mining And Manufacturing Company | Stable silanol priming solution for use in dentistry |
| DE3789547T2 (de) * | 1987-02-13 | 1994-07-14 | Toray Industries | Entspiegelter optischer Gegenstand und Verfahren zu dessen Herstellung. |
| JPH0816211B2 (ja) * | 1989-06-02 | 1996-02-21 | 信越化学工業株式会社 | プライマー組成物 |
| US5104692A (en) * | 1990-04-20 | 1992-04-14 | Pilkington Visioncare Holdings, Inc. | Two-layer antireflective coating applied in solution |
| US5639802A (en) * | 1991-05-20 | 1997-06-17 | Spectra Group Limited, Inc. | Cationic polymerization |
| GB9220986D0 (en) * | 1992-10-06 | 1992-11-18 | Ciba Geigy Ag | Chemical composition |
| US5733483A (en) * | 1995-01-13 | 1998-03-31 | Soane Technologies, Inc. | Method for formation of on-site coated and tinted optical elements |
| JPH08216271A (ja) * | 1995-02-10 | 1996-08-27 | Kureha Chem Ind Co Ltd | 合成樹脂製調光レンズの製造方法 |
| IL118087A (en) * | 1995-05-05 | 1999-05-09 | Innotech Inc | Adhesive photochromic matrix layers for use in optical articles and their preparation |
| US6004486A (en) * | 1995-09-11 | 1999-12-21 | Corning Incorporated | Photochromic spiroxazines with asymmetric monocyclic substituent, compositions and articles containing them |
| IL119781A0 (en) * | 1996-12-08 | 1997-03-18 | Yeda Res & Dev | Photochromic spirooxazine polysiloxanes |
| JP4110306B2 (ja) * | 1998-12-04 | 2008-07-02 | Jsr株式会社 | 防汚性積層体およびその製造方法 |
-
1999
- 1999-07-06 US US09/348,135 patent/US6150430A/en not_active Expired - Lifetime
-
2000
- 2000-07-06 AU AU59197/00A patent/AU754726B2/en not_active Ceased
- 2000-07-06 JP JP2001508256A patent/JP4638639B2/ja not_active Expired - Fee Related
- 2000-07-06 BR BRPI0012208-4A patent/BR0012208B1/pt not_active IP Right Cessation
- 2000-07-06 DE DE60007753T patent/DE60007753T2/de not_active Expired - Lifetime
- 2000-07-06 EP EP00945222A patent/EP1200512B1/en not_active Expired - Lifetime
- 2000-07-06 WO PCT/US2000/018575 patent/WO2001002472A1/en not_active Ceased
Patent Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4348462A (en) * | 1980-07-11 | 1982-09-07 | General Electric Company | Abrasion resistant ultraviolet light curable hard coating compositions |
| GB2113698A (en) * | 1982-01-13 | 1983-08-10 | Anic Spa | Polymerizable primer coating compositions and polycarbonates coated therewith |
| JPS62164537A (ja) * | 1986-01-17 | 1987-07-21 | 東レ株式会社 | 複合体 |
Also Published As
| Publication number | Publication date |
|---|---|
| EP1200512B1 (en) | 2004-01-14 |
| EP1200512A1 (en) | 2002-05-02 |
| WO2001002472A1 (en) | 2001-01-11 |
| JP4638639B2 (ja) | 2011-02-23 |
| BR0012208B1 (pt) | 2012-06-26 |
| BR0012208A (pt) | 2002-07-23 |
| AU5919700A (en) | 2001-01-22 |
| DE60007753D1 (de) | 2004-02-19 |
| DE60007753T2 (de) | 2004-11-11 |
| JP2003504438A (ja) | 2003-02-04 |
| US6150430A (en) | 2000-11-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AU754726B2 (en) | Process for adhering a photochromic coating to a polymeric substrate | |
| EP2001966B1 (en) | Abrasion resistant coating compositions and coated articles | |
| US6042737A (en) | Process for improving adhesion of coatings to polymeric substrates and articles produced thereby | |
| AU2004263829B2 (en) | Adhesion enhancing coating composition, process for using and coated or laminated articles produced | |
| AU738892B2 (en) | Process for producing an adherent polymeric layer on polymeric substrates and articles produced thereby | |
| KR100759624B1 (ko) | 광변색성 광학 제품 | |
| AU769249B2 (en) | Poly(meth)acrylic photochromic coating | |
| US20020061407A1 (en) | Abrasion resistant coating composition and coated articles | |
| EP1720955A1 (en) | Photochromic optical article | |
| HK1128300A (en) | Abrasion resistant coating compositions and coated articles |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| FGA | Letters patent sealed or granted (standard patent) | ||
| MK14 | Patent ceased section 143(a) (annual fees not paid) or expired |