AU631271B2 - A process for the production of granulates of hydrated sodium perborate - Google Patents
A process for the production of granulates of hydrated sodium perborate Download PDFInfo
- Publication number
- AU631271B2 AU631271B2 AU68007/90A AU6800790A AU631271B2 AU 631271 B2 AU631271 B2 AU 631271B2 AU 68007/90 A AU68007/90 A AU 68007/90A AU 6800790 A AU6800790 A AU 6800790A AU 631271 B2 AU631271 B2 AU 631271B2
- Authority
- AU
- Australia
- Prior art keywords
- weight
- sodium perborate
- granulates
- bulk density
- granulate
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Ceased
Links
- 238000000034 method Methods 0.000 title claims abstract description 39
- 230000008569 process Effects 0.000 title claims abstract description 38
- 239000008187 granular material Substances 0.000 title claims description 58
- 229960001922 sodium perborate Drugs 0.000 title claims description 13
- 238000004519 manufacturing process Methods 0.000 title claims description 12
- YKLJGMBLPUQQOI-UHFFFAOYSA-M sodium;oxidooxy(oxo)borane Chemical compound [Na+].[O-]OB=O YKLJGMBLPUQQOI-UHFFFAOYSA-M 0.000 title claims description 12
- 238000005299 abrasion Methods 0.000 claims abstract description 22
- 239000002245 particle Substances 0.000 claims abstract description 15
- CPZRYQJPVUJHOS-UHFFFAOYSA-N [2-(2-phenylethyl)phenyl]methanol Chemical compound OCC1=CC=CC=C1CCC1=CC=CC=C1 CPZRYQJPVUJHOS-UHFFFAOYSA-N 0.000 claims abstract description 14
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims abstract description 13
- 239000001301 oxygen Substances 0.000 claims abstract description 13
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 13
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims abstract description 11
- 238000003860 storage Methods 0.000 claims abstract description 5
- XSVSPKKXQGNHMD-UHFFFAOYSA-N 5-bromo-3-methyl-1,2-thiazole Chemical compound CC=1C=C(Br)SN=1 XSVSPKKXQGNHMD-UHFFFAOYSA-N 0.000 claims description 16
- 239000007921 spray Substances 0.000 claims description 12
- 230000004580 weight loss Effects 0.000 claims description 9
- 239000000463 material Substances 0.000 claims description 7
- 230000009471 action Effects 0.000 claims description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 2
- 230000000052 comparative effect Effects 0.000 claims 1
- 238000005549 size reduction Methods 0.000 claims 1
- 230000008901 benefit Effects 0.000 abstract description 2
- 239000008188 pellet Substances 0.000 abstract 4
- 238000005194 fractionation Methods 0.000 abstract 1
- 230000008646 thermal stress Effects 0.000 abstract 1
- 230000018044 dehydration Effects 0.000 description 7
- 238000006297 dehydration reaction Methods 0.000 description 7
- 150000004682 monohydrates Chemical class 0.000 description 5
- 238000001694 spray drying Methods 0.000 description 5
- 238000001035 drying Methods 0.000 description 4
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 239000000428 dust Substances 0.000 description 3
- 239000011164 primary particle Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 150000004685 tetrahydrates Chemical class 0.000 description 3
- -1 Sodium perborate hydrates Chemical class 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 150000004677 hydrates Chemical class 0.000 description 2
- 238000012216 screening Methods 0.000 description 2
- 239000012418 sodium perborate tetrahydrate Substances 0.000 description 2
- IBDSNZLUHYKHQP-UHFFFAOYSA-N sodium;3-oxidodioxaborirane;tetrahydrate Chemical compound O.O.O.O.[Na+].[O-]B1OO1 IBDSNZLUHYKHQP-UHFFFAOYSA-N 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- 239000010457 zeolite Substances 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 239000004115 Sodium Silicate Substances 0.000 description 1
- 238000002441 X-ray diffraction Methods 0.000 description 1
- 229910021536 Zeolite Inorganic materials 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical compound O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 238000005469 granulation Methods 0.000 description 1
- 230000003179 granulation Effects 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- NVIFVTYDZMXWGX-UHFFFAOYSA-N sodium metaborate Chemical compound [Na+].[O-]B=O NVIFVTYDZMXWGX-UHFFFAOYSA-N 0.000 description 1
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 1
- 229910052911 sodium silicate Inorganic materials 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01B—NON-METALLIC ELEMENTS; COMPOUNDS THEREOF; METALLOIDS OR COMPOUNDS THEREOF NOT COVERED BY SUBCLASS C01C
- C01B15/00—Peroxides; Peroxyhydrates; Peroxyacids or salts thereof; Superoxides; Ozonides
- C01B15/055—Peroxyhydrates; Peroxyacids or salts thereof
- C01B15/12—Peroxyhydrates; Peroxyacids or salts thereof containing boron
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Glanulating (AREA)
- Detergent Compositions (AREA)
- Paper (AREA)
- Battery Electrode And Active Subsutance (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Medicines Containing Antibodies Or Antigens For Use As Internal Diagnostic Agents (AREA)
- Medicinal Preparation (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE3941851A DE3941851C1 (enExample) | 1989-12-19 | 1989-12-19 | |
| DE3941851 | 1989-12-19 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| AU6800790A AU6800790A (en) | 1991-06-27 |
| AU631271B2 true AU631271B2 (en) | 1992-11-19 |
Family
ID=6395759
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AU68007/90A Ceased AU631271B2 (en) | 1989-12-19 | 1990-12-12 | A process for the production of granulates of hydrated sodium perborate |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US5395602A (enExample) |
| EP (1) | EP0433653B1 (enExample) |
| JP (1) | JPH03199109A (enExample) |
| AT (1) | ATE115515T1 (enExample) |
| AU (1) | AU631271B2 (enExample) |
| CA (1) | CA2032557A1 (enExample) |
| DE (2) | DE3941851C1 (enExample) |
| TR (1) | TR24687A (enExample) |
| YU (1) | YU218090A (enExample) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE4018037A1 (de) * | 1990-02-10 | 1991-08-14 | Peroxid Chemie Gmbh | Verfahren zur herstellung von peroxoborat-agglomeraten |
| DE4122513A1 (de) * | 1990-08-16 | 1992-02-20 | Peroxid Chemie Gmbh | Verfahren zur herstellung von agglomeriertem natriumperborat-monohydrat mit verbesserten eigenschaften |
| US5203877A (en) * | 1990-08-16 | 1993-04-20 | Peroxid-Chemie Gmbh | Process for producing sodium perborate monohydrate agglomerate |
| DE4219229A1 (de) * | 1992-06-12 | 1993-12-16 | Degussa | Verfahren zur Erhöhung des Schüttgewichts von Natriumperborat-monohydrat |
| DE19516609C2 (de) * | 1995-05-10 | 1997-08-14 | Degussa | Verfahren zur Herstellung von abriebfestem Natriumperborat-monohydrat mit hoher Schüttdichte und hoher Lösegeschwindigkeit |
| GB2359546A (en) * | 2000-02-24 | 2001-08-29 | United States Borax Inc | Agglomerating sodium perborate monohydrate particles |
| US7718737B2 (en) * | 2004-03-02 | 2010-05-18 | Bridgestone Corporation | Rubber composition containing functionalized polymer nanoparticles |
Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AU569190B2 (en) * | 1985-02-26 | 1988-01-21 | Atochem | Manufacturing sodium perborate monohydrate |
| AU577835B2 (en) * | 1984-03-01 | 1988-10-06 | Atochem | Sodium perborate monohydrate from tetrahydrate |
| US4968500A (en) * | 1988-02-13 | 1990-11-06 | Degussa Aktiengesellschaft | Continuous method for preparation of granulated sodium perborate |
Family Cites Families (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US338924A (en) * | 1886-03-30 | cabson | ||
| US1076039A (en) * | 1904-07-09 | 1913-10-21 | Charles B Jacobs | Compound for making peroxid of hydrogen. |
| US2863835A (en) * | 1957-10-08 | 1958-12-09 | Theobald Ind | Perborate composition |
| CH553726A (de) * | 1968-08-13 | 1974-09-13 | Degussa | Verfahren zur herstellung von alkalimetall-perboraten nach dem spruehtrocknungsverfahren. |
| DE2203285A1 (de) * | 1972-01-25 | 1973-08-16 | Degussa | Verfahren zur herstellung von abriebfestem perboratmonohydrat |
| DE2258319C3 (de) * | 1972-11-29 | 1978-04-13 | Peroxid-Chemie Gmbh, 8023 Hoellriegelskreuth | Verfahren zur Herstellung von abriebfestem Natriumperboratmonohydrat |
| DE2444780C2 (de) * | 1974-09-19 | 1987-02-19 | Peroxid-Chemie GmbH, 8023 Höllriegelskreuth | Verfahren zur Herstellung von abriebfestem Natriumperboratmonohydrat |
| LU73751A1 (enExample) * | 1975-11-06 | 1977-06-03 | ||
| DE2652488C3 (de) * | 1976-11-18 | 1983-03-10 | Kali-Chemie Ag, 3000 Hannover | Verfahren zur Herstellung von Granulaten aus Zeolithen und sauerstoffabgebenden Verbindungen |
| LU77094A1 (enExample) * | 1977-04-08 | 1978-11-03 | Interox Sa | |
| LU77095A1 (enExample) * | 1977-04-08 | 1978-11-03 | ||
| US4320105A (en) * | 1980-10-20 | 1982-03-16 | Lithium Corporation Of America | Pellitizing method |
| DE3505158A1 (de) * | 1985-02-15 | 1986-08-21 | Peroxid-Chemie GmbH, 8023 Höllriegelskreuth | Superoxidiertes natriumperborat |
| IT1187668B (it) * | 1985-05-16 | 1987-12-23 | Montefluos Spa | Procedimento per ottenere perborato di sodio moncidrato granulare dotato di una buona resistenza meccanica |
| DE3518686A1 (de) * | 1985-05-24 | 1986-11-27 | Houpt, Friedhelm, 5778 Meschede | Reet-dacheindeckungselement aus kunststoff und verfahren zur verlegung desselben auf dachflaechen |
| IT1215566B (it) * | 1987-06-17 | 1990-02-14 | Ausimont Spa | Processo per ottenere peroborato di sodio monoidrato granulare. |
| EP0296813A1 (en) * | 1987-06-24 | 1988-12-28 | Imperial Chemical Industries Plc | Powder compositions and detergent compositions |
| US5108726A (en) * | 1988-08-19 | 1992-04-28 | Kerr-Mcgee Chemical Corporation | Compacts of spray dried water soluble compounds |
| DE59005958D1 (de) * | 1989-08-19 | 1994-07-07 | Henkel Kgaa | Verfahren zur granulierung von perboratmonohydrat. |
-
1989
- 1989-12-19 DE DE3941851A patent/DE3941851C1/de not_active Expired - Lifetime
-
1990
- 1990-11-14 DE DE59008020T patent/DE59008020D1/de not_active Expired - Fee Related
- 1990-11-14 AT AT90121760T patent/ATE115515T1/de not_active IP Right Cessation
- 1990-11-14 EP EP90121760A patent/EP0433653B1/de not_active Expired - Lifetime
- 1990-11-15 YU YU218090A patent/YU218090A/sh unknown
- 1990-11-22 JP JP2315670A patent/JPH03199109A/ja active Pending
- 1990-12-12 AU AU68007/90A patent/AU631271B2/en not_active Ceased
- 1990-12-18 CA CA002032557A patent/CA2032557A1/en not_active Abandoned
- 1990-12-18 US US07/628,913 patent/US5395602A/en not_active Expired - Fee Related
- 1990-12-25 TR TR90/1182A patent/TR24687A/xx unknown
Patent Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AU577835B2 (en) * | 1984-03-01 | 1988-10-06 | Atochem | Sodium perborate monohydrate from tetrahydrate |
| AU569190B2 (en) * | 1985-02-26 | 1988-01-21 | Atochem | Manufacturing sodium perborate monohydrate |
| US4968500A (en) * | 1988-02-13 | 1990-11-06 | Degussa Aktiengesellschaft | Continuous method for preparation of granulated sodium perborate |
Also Published As
| Publication number | Publication date |
|---|---|
| CA2032557A1 (en) | 1991-06-20 |
| US5395602A (en) | 1995-03-07 |
| DE59008020D1 (de) | 1995-01-26 |
| JPH03199109A (ja) | 1991-08-30 |
| DE3941851C1 (enExample) | 1991-06-20 |
| EP0433653A1 (de) | 1991-06-26 |
| YU218090A (sh) | 1993-10-20 |
| ATE115515T1 (de) | 1994-12-15 |
| TR24687A (tr) | 1992-03-01 |
| AU6800790A (en) | 1991-06-27 |
| EP0433653B1 (de) | 1994-12-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4970017A (en) | Process for production of granular detergent composition having high bulk density | |
| AU624084B2 (en) | Granular calcium hypochlorite composition and process for preparation thereof | |
| GB2275876B (en) | Grinding alkaline earth metal pigments | |
| EP0977709A1 (en) | Improved silica product for use in elastomers | |
| AU631271B2 (en) | A process for the production of granulates of hydrated sodium perborate | |
| EP0328768B1 (de) | Kontinuierliches Verfahren zur Herstellung von Natriumperborat-Granulaten | |
| US5108728A (en) | Process for the production of granulated dicalcium phosphate dihydrate | |
| DE69207990T2 (de) | Silicate | |
| DE60001203T2 (de) | Herstellung von Natriumborohydrid aus Natriumborohydriddihydrat in einem Wirbelbetttrockner | |
| US5182054A (en) | Process for granulating perborate monohydrate | |
| JPH0510400B2 (enExample) | ||
| US6248707B1 (en) | Method for producing sodium percarbonate | |
| JPH04332797A (ja) | 高嵩密度粒状洗剤の製造方法 | |
| US4215097A (en) | Process for the manufacture of sodium perborate monohydrate and product thereof | |
| US4863709A (en) | Calcium hypochlorite composition and process for preparation thereof | |
| CA1166820A (en) | Production of granular alkali metal diphosphates or triphosphates | |
| CA1296506C (en) | Process for preparing a sodium tripolyphosphate hexahydrate powder | |
| US5399328A (en) | Process for preparing peroxyborate agglomerates | |
| JPS61272300A (ja) | 高嵩密度粒状洗剤組成物の製造方法 | |
| JPH0710728B2 (ja) | 微粒硫酸カルシウムの製造方法 | |
| US5203877A (en) | Process for producing sodium perborate monohydrate agglomerate | |
| US7488439B2 (en) | Method for producing dust-free alkaline earth peroxides | |
| CA2030974C (en) | Process for preparing sodium tripolyphosphate | |
| KR100193054B1 (ko) | 안정한 과탄산나트륨 과립체의 제조방법 | |
| WO1999029623A1 (en) | Precipitated amorphous silicas having improved physical properties |