AU599312B2 - Method for treating muscle tension, muscle spasticity and anxiety with 3-aryloxy-azetidinecarboxamides - Google Patents
Method for treating muscle tension, muscle spasticity and anxiety with 3-aryloxy-azetidinecarboxamides Download PDFInfo
- Publication number
- AU599312B2 AU599312B2 AU53888/86A AU5388886A AU599312B2 AU 599312 B2 AU599312 B2 AU 599312B2 AU 53888/86 A AU53888/86 A AU 53888/86A AU 5388886 A AU5388886 A AU 5388886A AU 599312 B2 AU599312 B2 AU 599312B2
- Authority
- AU
- Australia
- Prior art keywords
- trifluoromethyl
- phenoxy
- azetidine
- carboxamide
- azetidinecarboxamide
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Ceased
Links
- 238000000034 method Methods 0.000 title claims description 41
- 208000019901 Anxiety disease Diseases 0.000 title claims description 12
- 230000036506 anxiety Effects 0.000 title claims description 12
- 206010049816 Muscle tightness Diseases 0.000 title claims description 9
- 208000008238 Muscle Spasticity Diseases 0.000 title claims description 7
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 claims description 61
- 238000004458 analytical method Methods 0.000 claims description 61
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 59
- 239000000047 product Substances 0.000 claims description 56
- 150000001875 compounds Chemical class 0.000 claims description 54
- 239000013078 crystal Substances 0.000 claims description 41
- -1 chloro, bromo, iodo Chemical group 0.000 claims description 39
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 33
- 239000002253 acid Substances 0.000 claims description 28
- 229910052757 nitrogen Inorganic materials 0.000 claims description 28
- 150000003839 salts Chemical class 0.000 claims description 28
- 229910052739 hydrogen Inorganic materials 0.000 claims description 22
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 22
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 claims description 20
- 239000001257 hydrogen Substances 0.000 claims description 20
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 20
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 17
- 125000003917 carbamoyl group Chemical class [H]N([H])C(*)=O 0.000 claims description 14
- 239000000706 filtrate Substances 0.000 claims description 14
- 150000003254 radicals Chemical class 0.000 claims description 13
- 125000004076 pyridyl group Chemical group 0.000 claims description 12
- 150000002431 hydrogen Chemical class 0.000 claims description 11
- 241001465754 Metazoa Species 0.000 claims description 10
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 claims description 9
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 9
- 125000003118 aryl group Chemical group 0.000 claims description 9
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 9
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 claims description 8
- 229910052760 oxygen Inorganic materials 0.000 claims description 8
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 7
- 125000001153 fluoro group Chemical group F* 0.000 claims description 7
- 210000003205 muscle Anatomy 0.000 claims description 7
- 239000001301 oxygen Substances 0.000 claims description 7
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 6
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 6
- 125000005843 halogen group Chemical group 0.000 claims description 5
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 claims description 5
- PVXOUGHWLCBJOW-UHFFFAOYSA-N azetidine-1-carboxamide Chemical compound NC(=O)N1CCC1 PVXOUGHWLCBJOW-UHFFFAOYSA-N 0.000 claims description 4
- 125000002393 azetidinyl group Chemical group 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- 125000004193 piperazinyl group Chemical group 0.000 claims description 4
- 125000003386 piperidinyl group Chemical group 0.000 claims description 4
- 125000000719 pyrrolidinyl group Chemical group 0.000 claims description 4
- 229910052717 sulfur Inorganic materials 0.000 claims description 4
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 3
- 238000010828 elution Methods 0.000 claims description 3
- 125000002883 imidazolyl group Chemical group 0.000 claims description 3
- 125000002757 morpholinyl group Chemical group 0.000 claims description 3
- JWBUJRUMOWMXCS-UHFFFAOYSA-N n-methyl-3-pyridin-2-yloxyazetidine-1-carboxamide Chemical compound C1N(C(=O)NC)CC1OC1=CC=CC=N1 JWBUJRUMOWMXCS-UHFFFAOYSA-N 0.000 claims description 3
- ZUTYSNQEFFGMKG-UHFFFAOYSA-N n-prop-2-enyl-3-pyridin-2-yloxyazetidine-1-carboxamide Chemical compound C1N(C(=O)NCC=C)CC1OC1=CC=CC=N1 ZUTYSNQEFFGMKG-UHFFFAOYSA-N 0.000 claims description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 3
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 3
- 239000011593 sulfur Substances 0.000 claims description 3
- YTRPOSQFCMQDPK-UHFFFAOYSA-N 3-(3-chlorophenoxy)azetidine-1-carboxamide Chemical compound C1N(C(=O)N)CC1OC1=CC=CC(Cl)=C1 YTRPOSQFCMQDPK-UHFFFAOYSA-N 0.000 claims description 2
- PXHQIJBXGKVVEN-UHFFFAOYSA-N 3-pyridin-2-yloxyazetidine-1-carboxamide Chemical compound C1N(C(=O)N)CC1OC1=CC=CC=N1 PXHQIJBXGKVVEN-UHFFFAOYSA-N 0.000 claims description 2
- 239000003937 drug carrier Substances 0.000 claims description 2
- 125000006310 cycloalkyl amino group Chemical group 0.000 claims 2
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 claims 1
- MFEIFYBOANETOF-UHFFFAOYSA-N 3-(3-chlorophenoxy)-n-prop-2-enylazetidine-1-carboxamide Chemical compound ClC1=CC=CC(OC2CN(C2)C(=O)NCC=C)=C1 MFEIFYBOANETOF-UHFFFAOYSA-N 0.000 claims 1
- BGNVRWKCNDRXDE-UHFFFAOYSA-N 3-[4-(trifluoromethyl)phenoxy]azetidine-1-carboxamide Chemical compound C1N(C(=O)N)CC1OC1=CC=C(C(F)(F)F)C=C1 BGNVRWKCNDRXDE-UHFFFAOYSA-N 0.000 claims 1
- 125000004186 cyclopropylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 claims 1
- 125000001664 diethylamino group Chemical group [H]C([H])([H])C([H])([H])N(*)C([H])([H])C([H])([H])[H] 0.000 claims 1
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 claims 1
- 125000004216 fluoromethyl group Chemical group [H]C([H])(F)* 0.000 claims 1
- GLHHXODPLUSSIJ-UHFFFAOYSA-N n-(2,6-dimethylphenyl)-3-[3-(trifluoromethyl)phenoxy]azetidine-1-carbothioamide Chemical compound CC1=CC=CC(C)=C1NC(=S)N1CC(OC=2C=C(C=CC=2)C(F)(F)F)C1 GLHHXODPLUSSIJ-UHFFFAOYSA-N 0.000 claims 1
- AHRBRLPMOPIRBV-UHFFFAOYSA-N n-(2-methylpropyl)-3-[4-(trifluoromethyl)phenoxy]azetidine-1-carboxamide Chemical compound C1N(C(=O)NCC(C)C)CC1OC1=CC=C(C(F)(F)F)C=C1 AHRBRLPMOPIRBV-UHFFFAOYSA-N 0.000 claims 1
- SEALWFDYCNCLNY-UHFFFAOYSA-N n-(cyclopropylmethyl)-3-[3-(trifluoromethyl)phenoxy]azetidine-1-carboxamide Chemical compound FC(F)(F)C1=CC=CC(OC2CN(C2)C(=O)NCC2CC2)=C1 SEALWFDYCNCLNY-UHFFFAOYSA-N 0.000 claims 1
- XYTDLEDSAYYSHI-UHFFFAOYSA-N n-[3-(diethylamino)propyl]-3-[3-(trifluoromethyl)phenoxy]azetidine-1-carbothioamide Chemical compound C1N(C(=S)NCCCN(CC)CC)CC1OC1=CC=CC(C(F)(F)F)=C1 XYTDLEDSAYYSHI-UHFFFAOYSA-N 0.000 claims 1
- ZLCBZXPTJIWYLB-UHFFFAOYSA-N n-benzyl-3-[3-(trifluoromethyl)phenoxy]azetidine-1-carboxamide Chemical compound FC(F)(F)C1=CC=CC(OC2CN(C2)C(=O)NCC=2C=CC=CC=2)=C1 ZLCBZXPTJIWYLB-UHFFFAOYSA-N 0.000 claims 1
- OIBIZQOMWPWYKW-UHFFFAOYSA-N n-methyl-3-[3-(trifluoromethyl)phenoxy]azetidine-1-carbothioamide Chemical compound C1N(C(=S)NC)CC1OC1=CC=CC(C(F)(F)F)=C1 OIBIZQOMWPWYKW-UHFFFAOYSA-N 0.000 claims 1
- JTFRITVGJZKYBU-UHFFFAOYSA-N n-phenyl-3-[3-(trifluoromethyl)phenoxy]azetidine-1-carboxamide Chemical compound FC(F)(F)C1=CC=CC(OC2CN(C2)C(=O)NC=2C=CC=CC=2)=C1 JTFRITVGJZKYBU-UHFFFAOYSA-N 0.000 claims 1
- GACNVLGLEIQNGN-UHFFFAOYSA-N n-phenyl-3-[4-(trifluoromethyl)phenoxy]azetidine-1-carboxamide Chemical compound C1=CC(C(F)(F)F)=CC=C1OC1CN(C(=O)NC=2C=CC=CC=2)C1 GACNVLGLEIQNGN-UHFFFAOYSA-N 0.000 claims 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 120
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 72
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 71
- 239000000243 solution Substances 0.000 description 63
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 54
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 54
- 239000011541 reaction mixture Substances 0.000 description 51
- 239000007787 solid Substances 0.000 description 51
- 238000003756 stirring Methods 0.000 description 48
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 46
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 39
- 239000000203 mixture Substances 0.000 description 37
- 239000003921 oil Substances 0.000 description 36
- 235000019198 oils Nutrition 0.000 description 36
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 34
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 34
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 34
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 31
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 31
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 31
- 238000001914 filtration Methods 0.000 description 31
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 27
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 27
- 238000006243 chemical reaction Methods 0.000 description 27
- 238000001953 recrystallisation Methods 0.000 description 27
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 26
- 238000012360 testing method Methods 0.000 description 20
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 17
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 17
- 235000019341 magnesium sulphate Nutrition 0.000 description 17
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 16
- 238000002360 preparation method Methods 0.000 description 16
- HONIICLYMWZJFZ-UHFFFAOYSA-N azetidine Chemical compound C1CNC1 HONIICLYMWZJFZ-UHFFFAOYSA-N 0.000 description 15
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 14
- ADXWWNMHZFPXKW-UHFFFAOYSA-N 3-[3-(trifluoromethyl)phenoxy]azetidine Chemical compound FC(F)(F)C1=CC=CC(OC2CNC2)=C1 ADXWWNMHZFPXKW-UHFFFAOYSA-N 0.000 description 13
- 239000000741 silica gel Substances 0.000 description 11
- 229910002027 silica gel Inorganic materials 0.000 description 11
- CZZYITDELCSZES-UHFFFAOYSA-N diphenylmethane Chemical compound C=1C=CC=CC=1CC1=CC=CC=C1 CZZYITDELCSZES-UHFFFAOYSA-N 0.000 description 10
- 235000019441 ethanol Nutrition 0.000 description 10
- 239000003158 myorelaxant agent Substances 0.000 description 10
- 239000002244 precipitate Substances 0.000 description 10
- 239000002002 slurry Substances 0.000 description 10
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 9
- 239000000843 powder Substances 0.000 description 9
- 230000035939 shock Effects 0.000 description 9
- 239000003208 petroleum Substances 0.000 description 8
- 241000700159 Rattus Species 0.000 description 7
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 7
- IDGUHHHQCWSQLU-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO IDGUHHHQCWSQLU-UHFFFAOYSA-N 0.000 description 7
- 239000000284 extract Substances 0.000 description 7
- 239000010410 layer Substances 0.000 description 7
- 235000006408 oxalic acid Nutrition 0.000 description 7
- 229960003010 sodium sulfate Drugs 0.000 description 7
- 229910052938 sodium sulfate Inorganic materials 0.000 description 7
- 235000011152 sodium sulphate Nutrition 0.000 description 7
- RKANEZKQFZAZHZ-UHFFFAOYSA-N 3-[4-(trifluoromethyl)phenoxy]azetidine Chemical compound C1=CC(C(F)(F)F)=CC=C1OC1CNC1 RKANEZKQFZAZHZ-UHFFFAOYSA-N 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- 239000012043 crude product Substances 0.000 description 6
- 230000000694 effects Effects 0.000 description 6
- HAMGRBXTJNITHG-UHFFFAOYSA-N methyl isocyanate Chemical compound CN=C=O HAMGRBXTJNITHG-UHFFFAOYSA-N 0.000 description 6
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 6
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 6
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 5
- 239000002249 anxiolytic agent Substances 0.000 description 5
- 239000003054 catalyst Substances 0.000 description 5
- 238000001816 cooling Methods 0.000 description 5
- 229940079593 drug Drugs 0.000 description 5
- 239000003814 drug Substances 0.000 description 5
- 238000001035 drying Methods 0.000 description 5
- 239000005457 ice water Substances 0.000 description 5
- 150000003891 oxalate salts Chemical class 0.000 description 5
- DQHZVOYMDYXEFV-UHFFFAOYSA-N oxalic acid;3-[3-(trifluoromethyl)phenoxy]azetidine Chemical compound OC(=O)C(O)=O.FC(F)(F)C1=CC=CC(OC2CNC2)=C1 DQHZVOYMDYXEFV-UHFFFAOYSA-N 0.000 description 5
- 239000012258 stirred mixture Substances 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- 238000001665 trituration Methods 0.000 description 5
- KDSNLYIMUZNERS-UHFFFAOYSA-N 2-methylpropanamine Chemical compound CC(C)CN KDSNLYIMUZNERS-UHFFFAOYSA-N 0.000 description 4
- VVJKKWFAADXIJK-UHFFFAOYSA-N Allylamine Chemical compound NCC=C VVJKKWFAADXIJK-UHFFFAOYSA-N 0.000 description 4
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 4
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 4
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 4
- 241000699670 Mus sp. Species 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- 239000000908 ammonium hydroxide Substances 0.000 description 4
- 239000003610 charcoal Substances 0.000 description 4
- 238000010790 dilution Methods 0.000 description 4
- 239000012895 dilution Substances 0.000 description 4
- 230000035622 drinking Effects 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 4
- 238000000425 proton nuclear magnetic resonance spectrum Methods 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- TWYHCXNPOTXNJF-UHFFFAOYSA-N 1-phenoxyazetidine Chemical compound C1CCN1OC1=CC=CC=C1 TWYHCXNPOTXNJF-UHFFFAOYSA-N 0.000 description 3
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- 101150043532 CISH gene Proteins 0.000 description 3
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 3
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 239000004480 active ingredient Substances 0.000 description 3
- HXBPYFMVGFDZFT-UHFFFAOYSA-N allyl isocyanate Chemical compound C=CCN=C=O HXBPYFMVGFDZFT-UHFFFAOYSA-N 0.000 description 3
- 230000000049 anti-anxiety effect Effects 0.000 description 3
- 230000001773 anti-convulsant effect Effects 0.000 description 3
- 239000001961 anticonvulsive agent Substances 0.000 description 3
- 229960003965 antiepileptics Drugs 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 239000012458 free base Substances 0.000 description 3
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 3
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 3
- GBMDVOWEEQVZKZ-UHFFFAOYSA-N methanol;hydrate Chemical compound O.OC GBMDVOWEEQVZKZ-UHFFFAOYSA-N 0.000 description 3
- QOHMWDJIBGVPIF-UHFFFAOYSA-N n',n'-diethylpropane-1,3-diamine Chemical compound CCN(CC)CCCN QOHMWDJIBGVPIF-UHFFFAOYSA-N 0.000 description 3
- CMUOJBJRZUHRMU-UHFFFAOYSA-N nitrourea Chemical compound NC(=O)N[N+]([O-])=O CMUOJBJRZUHRMU-UHFFFAOYSA-N 0.000 description 3
- 239000012044 organic layer Substances 0.000 description 3
- WEOSEWRUCNPFCW-UHFFFAOYSA-N oxalic acid;3-[4-(trifluoromethyl)phenoxy]azetidine Chemical compound OC(=O)C(O)=O.C1=CC(C(F)(F)F)=CC=C1OC1CNC1 WEOSEWRUCNPFCW-UHFFFAOYSA-N 0.000 description 3
- 239000012071 phase Substances 0.000 description 3
- 229910000027 potassium carbonate Inorganic materials 0.000 description 3
- JKANAVGODYYCQF-UHFFFAOYSA-N prop-2-yn-1-amine Chemical compound NCC#C JKANAVGODYYCQF-UHFFFAOYSA-N 0.000 description 3
- 238000012216 screening Methods 0.000 description 3
- 239000012312 sodium hydride Substances 0.000 description 3
- 229910000104 sodium hydride Inorganic materials 0.000 description 3
- 230000001148 spastic effect Effects 0.000 description 3
- 239000008399 tap water Substances 0.000 description 3
- 235000020679 tap water Nutrition 0.000 description 3
- 238000010998 test method Methods 0.000 description 3
- QFUSOYKIDBRREL-NSCUHMNNSA-N (e)-but-2-en-1-amine Chemical compound C\C=C\CN QFUSOYKIDBRREL-NSCUHMNNSA-N 0.000 description 2
- LCHTWRWPHBRTNO-UHFFFAOYSA-N 1-benzhydrylazetidin-3-ol;hydrochloride Chemical compound Cl.C1C(O)CN1C(C=1C=CC=CC=1)C1=CC=CC=C1 LCHTWRWPHBRTNO-UHFFFAOYSA-N 0.000 description 2
- HBJYHGBMEHJJOL-UHFFFAOYSA-N 2-[1-(1-phenylethyl)azetidin-3-yl]oxypyridine Chemical compound C=1C=CC=CC=1C(C)N(C1)CC1OC1=CC=CC=N1 HBJYHGBMEHJJOL-UHFFFAOYSA-N 0.000 description 2
- GNXFOGHNGIVQEH-UHFFFAOYSA-N 2-hydroxy-3-(2-methoxyphenoxy)propyl carbamate Chemical compound COC1=CC=CC=C1OCC(O)COC(N)=O GNXFOGHNGIVQEH-UHFFFAOYSA-N 0.000 description 2
- MGOLNIXAPIAKFM-UHFFFAOYSA-N 2-isocyanato-2-methylpropane Chemical compound CC(C)(C)N=C=O MGOLNIXAPIAKFM-UHFFFAOYSA-N 0.000 description 2
- GSLTVFIVJMCNBH-UHFFFAOYSA-N 2-isocyanatopropane Chemical compound CC(C)N=C=O GSLTVFIVJMCNBH-UHFFFAOYSA-N 0.000 description 2
- WRMNZCZEMHIOCP-UHFFFAOYSA-N 2-phenylethanol Chemical compound OCCC1=CC=CC=C1 WRMNZCZEMHIOCP-UHFFFAOYSA-N 0.000 description 2
- SCEBJTQQYDBZDJ-UHFFFAOYSA-N 2-sulfonylazetidine Chemical compound O=S(=O)=C1CCN1 SCEBJTQQYDBZDJ-UHFFFAOYSA-N 0.000 description 2
- SJTBRFHBXDZMPS-UHFFFAOYSA-N 3-fluorophenol Chemical compound OC1=CC=CC(F)=C1 SJTBRFHBXDZMPS-UHFFFAOYSA-N 0.000 description 2
- PFCBHFDNVFQUJI-UHFFFAOYSA-N 3-methylbut-2-en-1-amine Chemical compound CC(C)=CCN PFCBHFDNVFQUJI-UHFFFAOYSA-N 0.000 description 2
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 2
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 2
- HTJDQJBWANPRPF-UHFFFAOYSA-N Cyclopropylamine Chemical compound NC1CC1 HTJDQJBWANPRPF-UHFFFAOYSA-N 0.000 description 2
- LGDSHSYDSCRFAB-UHFFFAOYSA-N Methyl isothiocyanate Chemical compound CN=C=S LGDSHSYDSCRFAB-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 239000012298 atmosphere Substances 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- 239000001110 calcium chloride Substances 0.000 description 2
- 229910001628 calcium chloride Inorganic materials 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 239000010779 crude oil Substances 0.000 description 2
- 238000006264 debenzylation reaction Methods 0.000 description 2
- AAOVKJBEBIDNHE-UHFFFAOYSA-N diazepam Chemical compound N=1CC(=O)N(C)C2=CC=C(Cl)C=C2C=1C1=CC=CC=C1 AAOVKJBEBIDNHE-UHFFFAOYSA-N 0.000 description 2
- 229960003529 diazepam Drugs 0.000 description 2
- MGHPNCMVUAKAIE-UHFFFAOYSA-N diphenylmethanamine Chemical compound C=1C=CC=CC=1C(N)C1=CC=CC=C1 MGHPNCMVUAKAIE-UHFFFAOYSA-N 0.000 description 2
- 239000002552 dosage form Substances 0.000 description 2
- 230000004590 drinking behavior Effects 0.000 description 2
- 239000003480 eluent Substances 0.000 description 2
- 206010015037 epilepsy Diseases 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- WUDNUHPRLBTKOJ-UHFFFAOYSA-N ethyl isocyanate Chemical compound CCN=C=O WUDNUHPRLBTKOJ-UHFFFAOYSA-N 0.000 description 2
- 239000000499 gel Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 238000007912 intraperitoneal administration Methods 0.000 description 2
- 239000012948 isocyanate Substances 0.000 description 2
- 150000002513 isocyanates Chemical class 0.000 description 2
- 150000002540 isothiocyanates Chemical class 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 238000001819 mass spectrum Methods 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- 229960002330 methocarbamol Drugs 0.000 description 2
- 229920000609 methyl cellulose Polymers 0.000 description 2
- 239000001923 methylcellulose Substances 0.000 description 2
- 239000002480 mineral oil Substances 0.000 description 2
- 235000010446 mineral oil Nutrition 0.000 description 2
- BQJCRHHNABKAKU-KBQPJGBKSA-N morphine Chemical compound O([C@H]1[C@H](C=C[C@H]23)O)C4=C5[C@@]12CCN(C)[C@@H]3CC5=CC=C4O BQJCRHHNABKAKU-KBQPJGBKSA-N 0.000 description 2
- 229940035363 muscle relaxants Drugs 0.000 description 2
- QPBVKSLJBRCKIF-UHFFFAOYSA-N n,n-diethyl-3-isothiocyanatopropan-1-amine Chemical compound CCN(CC)CCCN=C=S QPBVKSLJBRCKIF-UHFFFAOYSA-N 0.000 description 2
- HNHVTXYLRVGMHD-UHFFFAOYSA-N n-butyl isocyanate Chemical compound CCCCN=C=O HNHVTXYLRVGMHD-UHFFFAOYSA-N 0.000 description 2
- 239000012299 nitrogen atmosphere Substances 0.000 description 2
- 238000007911 parenteral administration Methods 0.000 description 2
- 239000008194 pharmaceutical composition Substances 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- DGTNSSLYPYDJGL-UHFFFAOYSA-N phenyl isocyanate Chemical compound O=C=NC1=CC=CC=C1 DGTNSSLYPYDJGL-UHFFFAOYSA-N 0.000 description 2
- 229920003023 plastic Polymers 0.000 description 2
- 239000004033 plastic Substances 0.000 description 2
- 230000004044 response Effects 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- 229910052709 silver Inorganic materials 0.000 description 2
- 239000004332 silver Substances 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- JRMUNVKIHCOMHV-UHFFFAOYSA-M tetrabutylammonium bromide Chemical compound [Br-].CCCC[N+](CCCC)(CCCC)CCCC JRMUNVKIHCOMHV-UHFFFAOYSA-M 0.000 description 2
- ILWRPSCZWQJDMK-UHFFFAOYSA-N triethylazanium;chloride Chemical compound Cl.CCN(CC)CC ILWRPSCZWQJDMK-UHFFFAOYSA-N 0.000 description 2
- 239000003643 water by type Substances 0.000 description 2
- MSVZMUILYMLJCF-UHFFFAOYSA-N (1-benzhydrylazetidin-3-yl) methanesulfonate Chemical compound C1C(OS(=O)(=O)C)CN1C(C=1C=CC=CC=1)C1=CC=CC=C1 MSVZMUILYMLJCF-UHFFFAOYSA-N 0.000 description 1
- RVJIUWJMJDLQIP-XJKSGUPXSA-N (2s,3r)-1-benzhydryl-2-methylazetidin-3-ol Chemical compound C[C@H]1[C@H](O)CN1C(C=1C=CC=CC=1)C1=CC=CC=C1 RVJIUWJMJDLQIP-XJKSGUPXSA-N 0.000 description 1
- HBLIJBRWUHAOJE-MELYUZJYSA-N (2s,3r)-1-benzhydryl-2-methylazetidin-3-ol;oxalic acid Chemical compound OC(=O)C(O)=O.C[C@H]1[C@H](O)CN1C(C=1C=CC=CC=1)C1=CC=CC=C1 HBLIJBRWUHAOJE-MELYUZJYSA-N 0.000 description 1
- DYLIWHYUXAJDOJ-OWOJBTEDSA-N (e)-4-(6-aminopurin-9-yl)but-2-en-1-ol Chemical compound NC1=NC=NC2=C1N=CN2C\C=C\CO DYLIWHYUXAJDOJ-OWOJBTEDSA-N 0.000 description 1
- SUCGVQHNGIQXGD-UHFFFAOYSA-N 1,3-dichloro-2-isothiocyanatobenzene Chemical compound ClC1=CC=CC(Cl)=C1N=C=S SUCGVQHNGIQXGD-UHFFFAOYSA-N 0.000 description 1
- FZHOEGRWSUOTOO-UHFFFAOYSA-N 1-benzhydryl-3-[3-(trifluoromethyl)phenoxy]azetidine Chemical compound FC(F)(F)C1=CC=CC(OC2CN(C2)C(C=2C=CC=CC=2)C=2C=CC=CC=2)=C1 FZHOEGRWSUOTOO-UHFFFAOYSA-N 0.000 description 1
- GBOWGKOVMBDPJF-UHFFFAOYSA-N 1-fluoro-3-(trifluoromethyl)benzene Chemical compound FC1=CC=CC(C(F)(F)F)=C1 GBOWGKOVMBDPJF-UHFFFAOYSA-N 0.000 description 1
- ZQQSYPZAPHRXRY-UHFFFAOYSA-N 1-hydroxyazetidine Chemical compound ON1CCC1 ZQQSYPZAPHRXRY-UHFFFAOYSA-N 0.000 description 1
- OQURWGJAWSLGQG-UHFFFAOYSA-N 1-isocyanatopropane Chemical compound CCCN=C=O OQURWGJAWSLGQG-UHFFFAOYSA-N 0.000 description 1
- OVSKIKFHRZPJSS-UHFFFAOYSA-N 2,4-D Chemical compound OC(=O)COC1=CC=C(Cl)C=C1Cl OVSKIKFHRZPJSS-UHFFFAOYSA-N 0.000 description 1
- FVRNHDWWZTUGFV-UHFFFAOYSA-N 2-(azetidin-3-yloxy)benzamide Chemical compound NC(=O)C1=CC=CC=C1OC1CNC1 FVRNHDWWZTUGFV-UHFFFAOYSA-N 0.000 description 1
- KEIXSWIGWRZIMB-UHFFFAOYSA-N 2-[3-(trifluoromethyl)phenoxy]azetidine-1-carboxamide Chemical compound NC(=O)N1CCC1OC1=CC=CC(C(F)(F)F)=C1 KEIXSWIGWRZIMB-UHFFFAOYSA-N 0.000 description 1
- IMRWILPUOVGIMU-UHFFFAOYSA-N 2-bromopyridine Chemical compound BrC1=CC=CC=N1 IMRWILPUOVGIMU-UHFFFAOYSA-N 0.000 description 1
- BFPCWNJLKUBDAR-UHFFFAOYSA-N 2-cyclopropylethanamine;hydrochloride Chemical compound Cl.NCCC1CC1 BFPCWNJLKUBDAR-UHFFFAOYSA-N 0.000 description 1
- UULUECCNPPJFBU-UHFFFAOYSA-N 2-isothiocyanato-1,3-dimethylbenzene Chemical compound CC1=CC=CC(C)=C1N=C=S UULUECCNPPJFBU-UHFFFAOYSA-N 0.000 description 1
- VXDHQYLFEYUMFY-UHFFFAOYSA-N 2-methylprop-2-en-1-amine Chemical compound CC(=C)CN VXDHQYLFEYUMFY-UHFFFAOYSA-N 0.000 description 1
- BJKHMBZQLRODEW-UHFFFAOYSA-N 2-phenoxyazetidine-1-carboxamide Chemical compound NC(=O)N1CCC1OC1=CC=CC=C1 BJKHMBZQLRODEW-UHFFFAOYSA-N 0.000 description 1
- CBVMWQNDRJMCEB-UHFFFAOYSA-N 3-(3-fluorophenoxy)-n-methylazetidine-1-carboxamide Chemical compound C1N(C(=O)NC)CC1OC1=CC=CC(F)=C1 CBVMWQNDRJMCEB-UHFFFAOYSA-N 0.000 description 1
- AGNSXPQTRUBVSG-UHFFFAOYSA-N 3-(3-fluorophenoxy)azetidine;oxalic acid Chemical compound OC(=O)C(O)=O.FC1=CC=CC(OC2CNC2)=C1 AGNSXPQTRUBVSG-UHFFFAOYSA-N 0.000 description 1
- CCXGQYXFUVSJEW-UHFFFAOYSA-N 3-(azetidin-3-yloxy)benzamide Chemical compound NC(=O)C1=CC=CC(OC2CNC2)=C1 CCXGQYXFUVSJEW-UHFFFAOYSA-N 0.000 description 1
- UGEJOEBBMPOJMT-UHFFFAOYSA-N 3-(trifluoromethyl)phenol Chemical compound OC1=CC=CC(C(F)(F)F)=C1 UGEJOEBBMPOJMT-UHFFFAOYSA-N 0.000 description 1
- UMRYPVYCXBBOJV-UHFFFAOYSA-N 3-[2-(trifluoromethyl)phenoxy]azetidine Chemical compound FC(F)(F)C1=CC=CC=C1OC1CNC1 UMRYPVYCXBBOJV-UHFFFAOYSA-N 0.000 description 1
- LDXHWJITNCSIJC-UHFFFAOYSA-N 3-isothiocyanato-n,n-dimethylpropan-1-amine Chemical compound CN(C)CCCN=C=S LDXHWJITNCSIJC-UHFFFAOYSA-N 0.000 description 1
- CCDAHKDEKOTDGR-UHFFFAOYSA-N 3-phenoxyazetidine Chemical compound C1NCC1OC1=CC=CC=C1 CCDAHKDEKOTDGR-UHFFFAOYSA-N 0.000 description 1
- BAYGVMXZJBFEMB-UHFFFAOYSA-N 4-(trifluoromethyl)phenol Chemical compound OC1=CC=C(C(F)(F)F)C=C1 BAYGVMXZJBFEMB-UHFFFAOYSA-N 0.000 description 1
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 1
- 235000003911 Arachis Nutrition 0.000 description 1
- 244000105624 Arachis hypogaea Species 0.000 description 1
- RZMGMNVKDONYNL-UHFFFAOYSA-N C(C(=O)O)(=O)O.N1CCC1 Chemical compound C(C(=O)O)(=O)O.N1CCC1 RZMGMNVKDONYNL-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 241000518994 Conta Species 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- 102100032218 Cytokine-inducible SH2-containing protein Human genes 0.000 description 1
- YIIMEMSDCNDGTB-UHFFFAOYSA-N Dimethylcarbamoyl chloride Chemical compound CN(C)C(Cl)=O YIIMEMSDCNDGTB-UHFFFAOYSA-N 0.000 description 1
- 102100025027 E3 ubiquitin-protein ligase TRIM69 Human genes 0.000 description 1
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 1
- 102000020897 Formins Human genes 0.000 description 1
- 108091022623 Formins Proteins 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 101000943420 Homo sapiens Cytokine-inducible SH2-containing protein Proteins 0.000 description 1
- 101000830203 Homo sapiens E3 ubiquitin-protein ligase TRIM69 Proteins 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- NHTMVDHEPJAVLT-UHFFFAOYSA-N Isooctane Chemical compound CC(C)CC(C)(C)C NHTMVDHEPJAVLT-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 235000019759 Maize starch Nutrition 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-M Methanesulfonate Chemical compound CS([O-])(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-M 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 1
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 1
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 1
- HFIDILQZWGMQQP-UHFFFAOYSA-N O(C1=CC=CC=C1)C1N(CC1)C(N)=S Chemical compound O(C1=CC=CC=C1)C1N(CC1)C(N)=S HFIDILQZWGMQQP-UHFFFAOYSA-N 0.000 description 1
- 235000019502 Orange oil Nutrition 0.000 description 1
- 229920005372 Plexiglas® Polymers 0.000 description 1
- 241000220317 Rosa Species 0.000 description 1
- 244000061456 Solanum tuberosum Species 0.000 description 1
- 235000002595 Solanum tuberosum Nutrition 0.000 description 1
- 206010041953 Staring Diseases 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- 206010043376 Tetanus Diseases 0.000 description 1
- 241000287433 Turdus Species 0.000 description 1
- OILLHIQWPYRWOI-WMLDXEAASA-N [(2s,3r)-1-benzhydryl-2-methylazetidin-3-yl] methanesulfonate Chemical compound C[C@H]1[C@H](OS(C)(=O)=O)CN1C(C=1C=CC=CC=1)C1=CC=CC=C1 OILLHIQWPYRWOI-WMLDXEAASA-N 0.000 description 1
- OLJLAQYCECXEKT-UHFFFAOYSA-N [1-(methylcarbamoyl)azetidin-3-yl] methanesulfonate Chemical compound CNC(=O)N1CC(OS(C)(=O)=O)C1 OLJLAQYCECXEKT-UHFFFAOYSA-N 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000004104 aryloxy group Chemical group 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 206010008129 cerebral palsy Diseases 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- XTEGARKTQYYJKE-UHFFFAOYSA-N chloric acid Chemical compound OCl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-N 0.000 description 1
- 229940005991 chloric acid Drugs 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 229940110456 cocoa butter Drugs 0.000 description 1
- 235000019868 cocoa butter Nutrition 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 235000008504 concentrate Nutrition 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- 239000003179 convulsant agent Substances 0.000 description 1
- 239000002178 crystalline material Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- KQWGXHWJMSMDJJ-UHFFFAOYSA-N cyclohexyl isocyanate Chemical compound O=C=NC1CCCCC1 KQWGXHWJMSMDJJ-UHFFFAOYSA-N 0.000 description 1
- WUESWDIHTKHGQA-UHFFFAOYSA-N cyclohexylurea Chemical compound NC(=O)NC1CCCCC1 WUESWDIHTKHGQA-UHFFFAOYSA-N 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- HXSNGAHNYZBZTH-UHFFFAOYSA-N cyclopropylmethanamine;hydrochloride Chemical compound Cl.NCC1CC1 HXSNGAHNYZBZTH-UHFFFAOYSA-N 0.000 description 1
- 125000004985 dialkyl amino alkyl group Chemical group 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- GLUUGHFHXGJENI-UHFFFAOYSA-N diethylenediamine Natural products C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 1
- JVSWJIKNEAIKJW-UHFFFAOYSA-N dimethyl-hexane Natural products CCCCCC(C)C JVSWJIKNEAIKJW-UHFFFAOYSA-N 0.000 description 1
- 230000003292 diminished effect Effects 0.000 description 1
- MLYIHAGCLNADES-UHFFFAOYSA-N diphenylmethanamine;hydrobromide Chemical compound Br.C=1C=CC=CC=1C(N)C1=CC=CC=C1 MLYIHAGCLNADES-UHFFFAOYSA-N 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000009509 drug development Methods 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- WDCDAAMJNUHOIY-UHFFFAOYSA-N ethyl acetate;2-propan-2-yloxypropane Chemical compound CCOC(C)=O.CC(C)OC(C)C WDCDAAMJNUHOIY-UHFFFAOYSA-N 0.000 description 1
- OAYLNYINCPYISS-UHFFFAOYSA-N ethyl acetate;hexane Chemical compound CCCCCC.CCOC(C)=O OAYLNYINCPYISS-UHFFFAOYSA-N 0.000 description 1
- ANFZRGMDGDYNGA-UHFFFAOYSA-N ethyl acetate;propan-2-ol Chemical compound CC(C)O.CCOC(C)=O ANFZRGMDGDYNGA-UHFFFAOYSA-N 0.000 description 1
- OAMZXMDZZWGPMH-UHFFFAOYSA-N ethyl acetate;toluene Chemical compound CCOC(C)=O.CC1=CC=CC=C1 OAMZXMDZZWGPMH-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000012065 filter cake Substances 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 125000005456 glyceride group Chemical group 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- 239000008241 heterogeneous mixture Substances 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000004128 high performance liquid chromatography Methods 0.000 description 1
- 238000007327 hydrogenolysis reaction Methods 0.000 description 1
- 230000006698 induction Effects 0.000 description 1
- 230000002452 interceptive effect Effects 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 125000002346 iodo group Chemical group I* 0.000 description 1
- YDNLNVZZTACNJX-UHFFFAOYSA-N isocyanatomethylbenzene Chemical compound O=C=NCC1=CC=CC=C1 YDNLNVZZTACNJX-UHFFFAOYSA-N 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 150000002688 maleic acid derivatives Chemical class 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- BKBMACKZOSMMGT-UHFFFAOYSA-N methanol;toluene Chemical compound OC.CC1=CC=CC=C1 BKBMACKZOSMMGT-UHFFFAOYSA-N 0.000 description 1
- 229940043265 methyl isobutyl ketone Drugs 0.000 description 1
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 229960005181 morphine Drugs 0.000 description 1
- 229960004715 morphine sulfate Drugs 0.000 description 1
- GRVOTVYEFDAHCL-RTSZDRIGSA-N morphine sulfate pentahydrate Chemical compound O.O.O.O.O.OS(O)(=O)=O.O([C@H]1[C@H](C=C[C@H]23)O)C4=C5[C@@]12CCN(C)[C@@H]3CC5=CC=C4O.O([C@H]1[C@H](C=C[C@H]23)O)C4=C5[C@@]12CCN(C)[C@@H]3CC5=CC=C4O GRVOTVYEFDAHCL-RTSZDRIGSA-N 0.000 description 1
- 230000003387 muscular Effects 0.000 description 1
- OFCCYDUUBNUJIB-UHFFFAOYSA-N n,n-diethylcarbamoyl chloride Chemical compound CCN(CC)C(Cl)=O OFCCYDUUBNUJIB-UHFFFAOYSA-N 0.000 description 1
- GUOONOJYWQOJJP-DCMFLLSESA-N n-[(2s,3r)-3-hydroxy-1-phenyl-4-[[3-(trifluoromethoxy)phenyl]methylamino]butan-2-yl]-3-[methyl(methylsulfonyl)amino]-5-[(2r)-2-(4-methyl-1,3-thiazol-2-yl)pyrrolidine-1-carbonyl]benzamide Chemical compound C1([C@H]2CCCN2C(=O)C=2C=C(C=C(C=2)N(C)S(C)(=O)=O)C(=O)N[C@@H](CC=2C=CC=CC=2)[C@H](O)CNCC=2C=C(OC(F)(F)F)C=CC=2)=NC(C)=CS1 GUOONOJYWQOJJP-DCMFLLSESA-N 0.000 description 1
- CZGNWJWETXWLMW-UHFFFAOYSA-N n-methyl-3-phenoxyazetidine-1-carboxamide Chemical compound C1N(C(=O)NC)CC1OC1=CC=CC=C1 CZGNWJWETXWLMW-UHFFFAOYSA-N 0.000 description 1
- DYFFAVRFJWYYQO-UHFFFAOYSA-N n-methyl-n-phenylaniline Chemical compound C=1C=CC=CC=1N(C)C1=CC=CC=C1 DYFFAVRFJWYYQO-UHFFFAOYSA-N 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 238000010899 nucleation Methods 0.000 description 1
- 239000010502 orange oil Substances 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- BSCHIACBONPEOB-UHFFFAOYSA-N oxolane;hydrate Chemical compound O.C1CCOC1 BSCHIACBONPEOB-UHFFFAOYSA-N 0.000 description 1
- KHUXNRRPPZOJPT-UHFFFAOYSA-N phenoxy radical Chemical group O=C1C=C[CH]C=C1 KHUXNRRPPZOJPT-UHFFFAOYSA-N 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- 150000003016 phosphoric acids Chemical class 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 229920001592 potato starch Polymers 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- LJPYJRMMPVFEKR-UHFFFAOYSA-N prop-2-ynylurea Chemical compound NC(=O)NCC#C LJPYJRMMPVFEKR-UHFFFAOYSA-N 0.000 description 1
- SAALQYKUFCIMHR-UHFFFAOYSA-N propan-2-ol;2-propan-2-yloxypropane Chemical compound CC(C)O.CC(C)OC(C)C SAALQYKUFCIMHR-UHFFFAOYSA-N 0.000 description 1
- AAZYNPCMLRQUHI-UHFFFAOYSA-N propan-2-one;2-propan-2-yloxypropane Chemical compound CC(C)=O.CC(C)OC(C)C AAZYNPCMLRQUHI-UHFFFAOYSA-N 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 239000012066 reaction slurry Substances 0.000 description 1
- 230000002040 relaxant effect Effects 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000005624 silicic acid group Chemical class 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 229920002545 silicone oil Polymers 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 238000000638 solvent extraction Methods 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 238000010183 spectrum analysis Methods 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 238000007619 statistical method Methods 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000002511 suppository base Substances 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 239000003981 vehicle Substances 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Landscapes
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US70663285A | 1985-02-28 | 1985-02-28 | |
| US706632 | 1985-02-28 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| AU5388886A AU5388886A (en) | 1986-09-04 |
| AU599312B2 true AU599312B2 (en) | 1990-07-19 |
Family
ID=24838427
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AU53888/86A Ceased AU599312B2 (en) | 1985-02-28 | 1986-02-21 | Method for treating muscle tension, muscle spasticity and anxiety with 3-aryloxy-azetidinecarboxamides |
Country Status (12)
| Country | Link |
|---|---|
| JP (1) | JPH0699386B2 (cg-RX-API-DMAC7.html) |
| AU (1) | AU599312B2 (cg-RX-API-DMAC7.html) |
| CA (1) | CA1294274C (cg-RX-API-DMAC7.html) |
| DK (2) | DK168422B1 (cg-RX-API-DMAC7.html) |
| ES (1) | ES8802300A1 (cg-RX-API-DMAC7.html) |
| GR (1) | GR860531B (cg-RX-API-DMAC7.html) |
| IL (1) | IL77995A (cg-RX-API-DMAC7.html) |
| IN (1) | IN162808B (cg-RX-API-DMAC7.html) |
| NZ (1) | NZ215312A (cg-RX-API-DMAC7.html) |
| PH (1) | PH25525A (cg-RX-API-DMAC7.html) |
| PT (1) | PT82118B (cg-RX-API-DMAC7.html) |
| ZA (1) | ZA861215B (cg-RX-API-DMAC7.html) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3641343A1 (de) * | 1986-12-03 | 1988-06-16 | Hoechst Ag | Carbamoylimidazol-derivate, verfahren zu ihrer herstellung und ihre verwendung als fungizide |
| JP5624894B2 (ja) * | 2008-03-04 | 2014-11-12 | ヴァーナリスアールアンドディー リミテッドVernalis R&D Limited | アゼチジン誘導体 |
| CN113754541B (zh) * | 2020-06-02 | 2025-01-03 | 深圳湾实验室 | 靶向eb病毒核抗原蛋白的小分子抑制剂、制备方法及其应用 |
Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4226861A (en) * | 1978-04-18 | 1980-10-07 | A. H. Robins Company, Inc. | N-Lower-alkyl 3-phenoxy-1-azetidinecarboxamides |
| AU553528B2 (en) * | 1982-08-19 | 1986-07-17 | A.H. Robins Company, Incorporated | 3-phenoxy-1-acetidine carboxamides |
| AU569307B2 (en) * | 1983-07-06 | 1988-01-28 | A.H. Robins Company, Incorporated | 3-phenoxy-1-azetidinecarboxamides |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4505907A (en) * | 1982-09-02 | 1985-03-19 | A. H. Robins Company, Inc. | N-Formyl and N-hydroxymethyl-3-phenoxy-1-azetidinecarboxamides |
-
1986
- 1986-02-10 IN IN90/MAS/86A patent/IN162808B/en unknown
- 1986-02-18 ZA ZA861215A patent/ZA861215B/xx unknown
- 1986-02-21 AU AU53888/86A patent/AU599312B2/en not_active Ceased
- 1986-02-25 GR GR860531A patent/GR860531B/el unknown
- 1986-02-26 PH PH33452A patent/PH25525A/en unknown
- 1986-02-26 IL IL7799586A patent/IL77995A/xx not_active IP Right Cessation
- 1986-02-27 DK DK90186A patent/DK168422B1/da not_active IP Right Cessation
- 1986-02-27 NZ NZ21531286A patent/NZ215312A/xx unknown
- 1986-02-27 ES ES552472A patent/ES8802300A1/es not_active Expired
- 1986-02-27 CA CA000502877A patent/CA1294274C/en not_active Expired - Lifetime
- 1986-02-28 PT PT8211886A patent/PT82118B/pt not_active IP Right Cessation
- 1986-02-28 JP JP61043906A patent/JPH0699386B2/ja not_active Expired - Lifetime
-
1993
- 1993-03-29 DK DK36893A patent/DK170270B1/da not_active IP Right Cessation
Patent Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4226861A (en) * | 1978-04-18 | 1980-10-07 | A. H. Robins Company, Inc. | N-Lower-alkyl 3-phenoxy-1-azetidinecarboxamides |
| AU553528B2 (en) * | 1982-08-19 | 1986-07-17 | A.H. Robins Company, Incorporated | 3-phenoxy-1-acetidine carboxamides |
| AU569307B2 (en) * | 1983-07-06 | 1988-01-28 | A.H. Robins Company, Incorporated | 3-phenoxy-1-azetidinecarboxamides |
Also Published As
| Publication number | Publication date |
|---|---|
| DK90186D0 (da) | 1986-02-27 |
| GR860531B (en) | 1986-06-24 |
| IN162808B (cg-RX-API-DMAC7.html) | 1988-07-09 |
| DK168422B1 (da) | 1994-03-28 |
| DK90186A (da) | 1986-08-29 |
| DK36893A (da) | 1993-03-29 |
| ES8802300A1 (es) | 1987-05-01 |
| NZ215312A (en) | 1990-02-26 |
| ZA861215B (en) | 1986-10-29 |
| ES552472A0 (es) | 1987-05-01 |
| DK170270B1 (da) | 1995-07-24 |
| JPH0699386B2 (ja) | 1994-12-07 |
| JPS61205254A (ja) | 1986-09-11 |
| CA1294274C (en) | 1992-01-14 |
| AU5388886A (en) | 1986-09-04 |
| DK36893D0 (da) | 1993-03-29 |
| PT82118A (en) | 1986-03-01 |
| PH25525A (en) | 1991-07-24 |
| PT82118B (pt) | 1988-07-01 |
| IL77995A (en) | 1989-06-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US5607936A (en) | Substituted aryl piperazines as neurokinin antagonists | |
| DE69130597T2 (de) | Arylalkylamine, Verfahren zur Herstellung und diese enthaltende Arzneimittel | |
| JP5118692B2 (ja) | 11−β−ヒドロキシステロイドデヒドロゲナーゼ1の阻害剤としてのシクロヘキシル置換ピロリジノン | |
| DE69021472T2 (de) | Pyrazolderivate, Verfahren zu deren Herstellung und diese enthaltende pharmazeutische Zusammenstellung. | |
| AU766233B2 (en) | Substituted imidazolidinone derivatives | |
| DE60118704T2 (de) | Pyrimidin-derivate als selective inhibitoren von cox-2 | |
| US7973042B2 (en) | Derivatives of alkylpiperazine- and alkylhomopiperazine-carboxylates, preparation method thereof and use of same as fatty acid amido hydrolase enzyme inhibitors | |
| MXPA02003950A (es) | Heterociclicos de nitrogeno biciclicos heteroalquilamino sustituidos como inhibidores de proteina cinasa p38. | |
| JP2013545740A (ja) | バニロイド受容体リガンドとしての置換された複素芳香族カルボキサミド誘導体および尿素誘導体 | |
| DE60025848T2 (de) | Pyrimidin-derivate als selective inhibitoren von cox-2 | |
| JP2013534229A (ja) | バニロイド受容体リガンドとしての置換された環状カルボキサミド誘導体および尿素誘導体 | |
| KR900005022B1 (ko) | 1-(아미노알킬)-α, α-디아릴 피롤리딘-, 피페리딘- 및 호모피페리딘-아세트아미드 및 아세토니트릴, 및 이의 제조방법 | |
| DE69019293T2 (de) | Naphthyloxazolidon-Derivate. | |
| EA005117B1 (ru) | Производные 3-азабицикло(3.1.0)гексана, обладающие сродством к опиодному рецептору | |
| EP0144729B1 (en) | 11-Substituted 5H,11H-pyrrolo[2,1-c][1,4]benzoxazepines, a process for their preparation and their use in medicaments | |
| EP0194112B1 (en) | 3-aryl-oxyazetidinecarboxamides having anti-muscle tension, anti-muscle spasticity, anticonvulsant and antiepilectic activity | |
| US6310077B1 (en) | Enterokinetic benzamide | |
| US5130309A (en) | Aryloxy and aryloxyalklazetidines as antiarrhythmic and anticonvulsant agents | |
| AU599312B2 (en) | Method for treating muscle tension, muscle spasticity and anxiety with 3-aryloxy-azetidinecarboxamides | |
| DE69501791T2 (de) | Indol-derivate als 5-ht1-like agonisten | |
| AU599585B2 (en) | 3-Aryloxyazetidine carboxamides as anticonvulsants and antiepileptics | |
| JP2001517668A (ja) | N−5,6,7,8−テトラヒドロ(1、6)ナフチリジン−n’−フェニルウレア誘導体 | |
| US5068231A (en) | Method of treating muscular tension, muscle spasticity and anxiety with 3-aryloxy and 3-arylthioazetidinecarboxamides | |
| US5183902A (en) | Method of treating muscular tension, muscle spasticity and anxiety with 3-aryloxy and 3-arylthioazetidinecarboxamides | |
| US5151418A (en) | Method of treating muscular tension, muscle spasticity and anxiety with 3-aryloxy and 3-arylthioazetidinecarboxamides |