AU2014235280B2 - Histone demethylase inhibitors - Google Patents
Histone demethylase inhibitors Download PDFInfo
- Publication number
- AU2014235280B2 AU2014235280B2 AU2014235280A AU2014235280A AU2014235280B2 AU 2014235280 B2 AU2014235280 B2 AU 2014235280B2 AU 2014235280 A AU2014235280 A AU 2014235280A AU 2014235280 A AU2014235280 A AU 2014235280A AU 2014235280 B2 AU2014235280 B2 AU 2014235280B2
- Authority
- AU
- Australia
- Prior art keywords
- pyrimidin
- compound
- alkyl
- found
- calc
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Ceased
Links
- 108010074870 Histone Demethylases Proteins 0.000 title claims abstract description 31
- 102000008157 Histone Demethylases Human genes 0.000 title claims abstract description 31
- 239000003112 inhibitor Substances 0.000 title description 5
- 150000001875 compounds Chemical class 0.000 claims abstract description 394
- 238000000034 method Methods 0.000 claims abstract description 207
- -1 pyrido[3,4-d]pyrimidin-4-one derivative compounds Chemical class 0.000 claims abstract description 123
- 239000000203 mixture Substances 0.000 claims abstract description 82
- 206010028980 Neoplasm Diseases 0.000 claims abstract description 27
- 201000011510 cancer Diseases 0.000 claims abstract description 19
- 230000005764 inhibitory process Effects 0.000 claims abstract description 14
- 239000008194 pharmaceutical composition Chemical class 0.000 claims abstract description 11
- 238000011282 treatment Methods 0.000 claims abstract description 10
- 125000000217 alkyl group Chemical group 0.000 claims description 97
- 125000000623 heterocyclic group Chemical group 0.000 claims description 64
- 125000002947 alkylene group Chemical group 0.000 claims description 63
- 125000001072 heteroaryl group Chemical group 0.000 claims description 59
- 150000003839 salts Chemical class 0.000 claims description 50
- 125000003118 aryl group Chemical group 0.000 claims description 47
- 125000004452 carbocyclyl group Chemical group 0.000 claims description 46
- 125000004415 heterocyclylalkyl group Chemical group 0.000 claims description 29
- 125000005884 carbocyclylalkyl group Chemical group 0.000 claims description 25
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 22
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 22
- 239000001257 hydrogen Substances 0.000 claims description 18
- 229910052739 hydrogen Inorganic materials 0.000 claims description 18
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 16
- 101001088892 Homo sapiens Lysine-specific demethylase 5A Proteins 0.000 claims description 15
- 125000004446 heteroarylalkyl group Chemical group 0.000 claims description 15
- 102100033246 Lysine-specific demethylase 5A Human genes 0.000 claims description 14
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 14
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 13
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 13
- 125000003545 alkoxy group Chemical group 0.000 claims description 11
- 125000003282 alkyl amino group Chemical group 0.000 claims description 11
- 230000002401 inhibitory effect Effects 0.000 claims description 10
- 125000003226 pyrazolyl group Chemical group 0.000 claims description 10
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 8
- 239000001301 oxygen Substances 0.000 claims description 8
- 229910052760 oxygen Inorganic materials 0.000 claims description 8
- 125000001769 aryl amino group Chemical group 0.000 claims description 7
- 125000004104 aryloxy group Chemical group 0.000 claims description 7
- 125000003161 (C1-C6) alkylene group Chemical group 0.000 claims description 6
- 101100295738 Gallus gallus COR3 gene Proteins 0.000 claims description 6
- 125000001153 fluoro group Chemical group F* 0.000 claims description 6
- 239000003814 drug Substances 0.000 claims description 5
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 5
- 125000001544 thienyl group Chemical group 0.000 claims description 5
- 125000000499 benzofuranyl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 claims description 4
- 125000003453 indazolyl group Chemical group N1N=C(C2=C1C=CC=C2)* 0.000 claims description 4
- 238000004519 manufacturing process Methods 0.000 claims description 4
- 230000001404 mediated effect Effects 0.000 claims description 4
- 125000002098 pyridazinyl group Chemical group 0.000 claims description 4
- 125000004076 pyridyl group Chemical group 0.000 claims description 4
- 125000000168 pyrrolyl group Chemical group 0.000 claims description 4
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims description 3
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 claims description 3
- 125000002541 furyl group Chemical group 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 150000002367 halogens Chemical class 0.000 claims description 3
- 125000002883 imidazolyl group Chemical group 0.000 claims description 3
- 125000001041 indolyl group Chemical group 0.000 claims description 3
- 125000001786 isothiazolyl group Chemical group 0.000 claims description 3
- 125000000842 isoxazolyl group Chemical group 0.000 claims description 3
- 125000005322 morpholin-1-yl group Chemical group 0.000 claims description 3
- 125000002757 morpholinyl group Chemical group 0.000 claims description 3
- 125000002971 oxazolyl group Chemical group 0.000 claims description 3
- 125000000714 pyrimidinyl group Chemical group 0.000 claims description 3
- 125000000335 thiazolyl group Chemical group 0.000 claims description 3
- 125000006570 (C5-C6) heteroaryl group Chemical group 0.000 claims description 2
- 229910006074 SO2NH2 Inorganic materials 0.000 claims 2
- 101100294106 Caenorhabditis elegans nhr-3 gene Proteins 0.000 claims 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 abstract description 14
- 201000010099 disease Diseases 0.000 abstract description 11
- 206010006187 Breast cancer Diseases 0.000 abstract description 7
- 208000026310 Breast neoplasm Diseases 0.000 abstract description 7
- 206010005003 Bladder cancer Diseases 0.000 abstract description 5
- 206010058467 Lung neoplasm malignant Diseases 0.000 abstract description 5
- 208000000236 Prostatic Neoplasms Diseases 0.000 abstract description 5
- 208000007097 Urinary Bladder Neoplasms Diseases 0.000 abstract description 5
- 201000005202 lung cancer Diseases 0.000 abstract description 5
- 208000020816 lung neoplasm Diseases 0.000 abstract description 5
- 201000005112 urinary bladder cancer Diseases 0.000 abstract description 5
- 206010060862 Prostate cancer Diseases 0.000 abstract description 4
- 201000001441 melanoma Diseases 0.000 abstract description 4
- 230000001613 neoplastic effect Effects 0.000 abstract description 3
- DNCYBUMDUBHIJZ-UHFFFAOYSA-N 1h-pyrimidin-6-one Chemical compound O=C1C=CN=CN1 DNCYBUMDUBHIJZ-UHFFFAOYSA-N 0.000 description 231
- 238000002360 preparation method Methods 0.000 description 231
- 238000005481 NMR spectroscopy Methods 0.000 description 185
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 99
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 80
- 239000000243 solution Substances 0.000 description 64
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 63
- 239000011541 reaction mixture Substances 0.000 description 49
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 48
- 239000007787 solid Substances 0.000 description 36
- 125000004432 carbon atom Chemical group C* 0.000 description 32
- QMOPAFMMLWUTKI-UHFFFAOYSA-N 1h-pyrido[3,4-d]pyrimidin-4-one Chemical group N1=CC=C2C(O)=NC=NC2=C1 QMOPAFMMLWUTKI-UHFFFAOYSA-N 0.000 description 30
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 30
- 150000003254 radicals Chemical class 0.000 description 30
- HCDMJFOHIXMBOV-UHFFFAOYSA-N 3-(2,6-difluoro-3,5-dimethoxyphenyl)-1-ethyl-8-(morpholin-4-ylmethyl)-4,7-dihydropyrrolo[4,5]pyrido[1,2-d]pyrimidin-2-one Chemical compound C=1C2=C3N(CC)C(=O)N(C=4C(=C(OC)C=C(OC)C=4F)F)CC3=CN=C2NC=1CN1CCOCC1 HCDMJFOHIXMBOV-UHFFFAOYSA-N 0.000 description 28
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 27
- 238000006243 chemical reaction Methods 0.000 description 27
- 229910001868 water Inorganic materials 0.000 description 26
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 25
- 238000010898 silica gel chromatography Methods 0.000 description 24
- 108010033040 Histones Proteins 0.000 description 23
- 125000004575 3-pyrrolidinyl group Chemical group [H]N1C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 21
- 239000000126 substance Substances 0.000 description 21
- 238000005160 1H NMR spectroscopy Methods 0.000 description 18
- 210000004027 cell Anatomy 0.000 description 16
- 108090000623 proteins and genes Proteins 0.000 description 16
- 125000001424 substituent group Chemical group 0.000 description 16
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 15
- 101000615488 Homo sapiens Methyl-CpG-binding domain protein 2 Proteins 0.000 description 15
- 102100021299 Methyl-CpG-binding domain protein 2 Human genes 0.000 description 15
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 15
- 238000003556 assay Methods 0.000 description 15
- 239000000047 product Substances 0.000 description 15
- KPGXRSRHYNQIFN-UHFFFAOYSA-N 2-oxoglutaric acid Chemical compound OC(=O)CCC(=O)C(O)=O KPGXRSRHYNQIFN-UHFFFAOYSA-N 0.000 description 14
- 101001088893 Homo sapiens Lysine-specific demethylase 4C Proteins 0.000 description 14
- 102100033230 Lysine-specific demethylase 4C Human genes 0.000 description 14
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical class CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 14
- 239000002904 solvent Substances 0.000 description 14
- XIALRQNUNYOSJP-UHFFFAOYSA-N 2-chloro-1h-pyrido[3,4-d]pyrimidin-4-one Chemical compound N1=CC=C2C(O)=NC(Cl)=NC2=C1 XIALRQNUNYOSJP-UHFFFAOYSA-N 0.000 description 13
- 102000006947 Histones Human genes 0.000 description 13
- 125000003709 fluoroalkyl group Chemical group 0.000 description 13
- 229910052799 carbon Inorganic materials 0.000 description 12
- 125000005843 halogen group Chemical group 0.000 description 12
- 235000018102 proteins Nutrition 0.000 description 12
- 102000004169 proteins and genes Human genes 0.000 description 12
- 125000000246 pyrimidin-2-yl group Chemical group [H]C1=NC(*)=NC([H])=C1[H] 0.000 description 12
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 11
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 11
- 239000002253 acid Substances 0.000 description 11
- 125000004450 alkenylene group Chemical group 0.000 description 11
- 229910052757 nitrogen Inorganic materials 0.000 description 11
- KAUABWYBFARJAF-UHFFFAOYSA-N 1h-pyrazol-4-ol Chemical compound OC=1C=NNC=1 KAUABWYBFARJAF-UHFFFAOYSA-N 0.000 description 10
- 125000004122 cyclic group Chemical group 0.000 description 10
- 238000001514 detection method Methods 0.000 description 10
- 238000007069 methylation reaction Methods 0.000 description 10
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 10
- 239000000651 prodrug Substances 0.000 description 10
- 229940002612 prodrug Drugs 0.000 description 10
- KDXKERNSBIXSRK-YFKPBYRVSA-N L-lysine Chemical compound NCCCC[C@H](N)C(O)=O KDXKERNSBIXSRK-YFKPBYRVSA-N 0.000 description 9
- 125000003342 alkenyl group Chemical group 0.000 description 9
- 125000000304 alkynyl group Chemical group 0.000 description 9
- 235000018977 lysine Nutrition 0.000 description 9
- 125000004433 nitrogen atom Chemical group N* 0.000 description 9
- 239000003921 oil Substances 0.000 description 9
- 239000011734 sodium Substances 0.000 description 9
- 229910000104 sodium hydride Inorganic materials 0.000 description 9
- 238000012360 testing method Methods 0.000 description 9
- OKKJLVBELUTLKV-MZCSYVLQSA-N Deuterated methanol Chemical compound [2H]OC([2H])([2H])[2H] OKKJLVBELUTLKV-MZCSYVLQSA-N 0.000 description 8
- 101100477411 Dictyostelium discoideum set1 gene Proteins 0.000 description 8
- 101000613625 Homo sapiens Lysine-specific demethylase 4A Proteins 0.000 description 8
- KDXKERNSBIXSRK-UHFFFAOYSA-N Lysine Natural products NCCCCC(N)C(O)=O KDXKERNSBIXSRK-UHFFFAOYSA-N 0.000 description 8
- 239000004472 Lysine Substances 0.000 description 8
- 102100040863 Lysine-specific demethylase 4A Human genes 0.000 description 8
- 230000008901 benefit Effects 0.000 description 8
- 230000011987 methylation Effects 0.000 description 8
- 238000003786 synthesis reaction Methods 0.000 description 8
- 238000002877 time resolved fluorescence resonance energy transfer Methods 0.000 description 8
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 8
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 7
- YFCIFWOJYYFDQP-PTWZRHHISA-N 4-[3-amino-6-[(1S,3S,4S)-3-fluoro-4-hydroxycyclohexyl]pyrazin-2-yl]-N-[(1S)-1-(3-bromo-5-fluorophenyl)-2-(methylamino)ethyl]-2-fluorobenzamide Chemical compound CNC[C@@H](NC(=O)c1ccc(cc1F)-c1nc(cnc1N)[C@H]1CC[C@H](O)[C@@H](F)C1)c1cc(F)cc(Br)c1 YFCIFWOJYYFDQP-PTWZRHHISA-N 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 7
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 7
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 7
- 230000000694 effects Effects 0.000 description 7
- 238000004128 high performance liquid chromatography Methods 0.000 description 7
- 108090000765 processed proteins & peptides Proteins 0.000 description 7
- 239000000758 substrate Substances 0.000 description 7
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 7
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 6
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 6
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 6
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 6
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 6
- HWXBTNAVRSUOJR-UHFFFAOYSA-N alpha-hydroxyglutaric acid Natural products OC(=O)C(O)CCC(O)=O HWXBTNAVRSUOJR-UHFFFAOYSA-N 0.000 description 6
- 229940009533 alpha-ketoglutaric acid Drugs 0.000 description 6
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 6
- 230000015572 biosynthetic process Effects 0.000 description 6
- 229960002685 biotin Drugs 0.000 description 6
- 239000011616 biotin Substances 0.000 description 6
- 239000000872 buffer Substances 0.000 description 6
- 125000000753 cycloalkyl group Chemical group 0.000 description 6
- 235000019439 ethyl acetate Nutrition 0.000 description 6
- 239000012044 organic layer Substances 0.000 description 6
- 125000004430 oxygen atom Chemical group O* 0.000 description 6
- 125000003107 substituted aryl group Chemical group 0.000 description 6
- MMQINJPURSSAHV-SNVBAGLBSA-N 2-[1-[(3r)-piperidin-3-yl]pyrazol-4-yl]oxy-1h-pyrido[3,4-d]pyrimidin-4-one Chemical compound N1C2=CN=CC=C2C(=O)N=C1OC(=C1)C=NN1[C@@H]1CCCNC1 MMQINJPURSSAHV-SNVBAGLBSA-N 0.000 description 5
- NNQSZQSLYJTIGS-SECBINFHSA-N 2-[1-[(3r)-pyrrolidin-3-yl]pyrazol-4-yl]oxy-1h-pyrido[3,4-d]pyrimidin-4-one Chemical compound N1C2=CN=CC=C2C(=O)N=C1OC(=C1)C=NN1[C@@H]1CCNC1 NNQSZQSLYJTIGS-SECBINFHSA-N 0.000 description 5
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 5
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 5
- 101150041968 CDC13 gene Proteins 0.000 description 5
- 102100033247 Lysine-specific demethylase 5B Human genes 0.000 description 5
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 5
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 5
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 5
- 239000012346 acetyl chloride Substances 0.000 description 5
- 239000002585 base Substances 0.000 description 5
- 150000001721 carbon Chemical group 0.000 description 5
- 239000003153 chemical reaction reagent Substances 0.000 description 5
- 125000004093 cyano group Chemical group *C#N 0.000 description 5
- ZOOSILUVXHVRJE-UHFFFAOYSA-N cyclopropanecarbonyl chloride Chemical compound ClC(=O)C1CC1 ZOOSILUVXHVRJE-UHFFFAOYSA-N 0.000 description 5
- 125000005842 heteroatom Chemical group 0.000 description 5
- 150000002430 hydrocarbons Chemical group 0.000 description 5
- 125000001841 imino group Chemical group [H]N=* 0.000 description 5
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 5
- 229910000027 potassium carbonate Inorganic materials 0.000 description 5
- OZLIBRFWDOSHRS-UHFFFAOYSA-N (2,5-dioxopyrrolidin-1-yl) 2-cyanoacetate Chemical compound N#CCC(=O)ON1C(=O)CCC1=O OZLIBRFWDOSHRS-UHFFFAOYSA-N 0.000 description 4
- WNEODWDFDXWOLU-QHCPKHFHSA-N 3-[3-(hydroxymethyl)-4-[1-methyl-5-[[5-[(2s)-2-methyl-4-(oxetan-3-yl)piperazin-1-yl]pyridin-2-yl]amino]-6-oxopyridin-3-yl]pyridin-2-yl]-7,7-dimethyl-1,2,6,8-tetrahydrocyclopenta[3,4]pyrrolo[3,5-b]pyrazin-4-one Chemical compound C([C@@H](N(CC1)C=2C=NC(NC=3C(N(C)C=C(C=3)C=3C(=C(N4C(C5=CC=6CC(C)(C)CC=6N5CC4)=O)N=CC=3)CO)=O)=CC=2)C)N1C1COC1 WNEODWDFDXWOLU-QHCPKHFHSA-N 0.000 description 4
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 4
- 108010077544 Chromatin Proteins 0.000 description 4
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 4
- 101001088883 Homo sapiens Lysine-specific demethylase 5B Proteins 0.000 description 4
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 4
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- 150000001412 amines Chemical class 0.000 description 4
- 125000004429 atom Chemical group 0.000 description 4
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 4
- 239000012267 brine Substances 0.000 description 4
- FJDQFPXHSGXQBY-UHFFFAOYSA-L caesium carbonate Chemical compound [Cs+].[Cs+].[O-]C([O-])=O FJDQFPXHSGXQBY-UHFFFAOYSA-L 0.000 description 4
- 229910000024 caesium carbonate Inorganic materials 0.000 description 4
- 230000001413 cellular effect Effects 0.000 description 4
- 210000003483 chromatin Anatomy 0.000 description 4
- 238000004587 chromatography analysis Methods 0.000 description 4
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 description 4
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 4
- 230000017858 demethylation Effects 0.000 description 4
- 238000010520 demethylation reaction Methods 0.000 description 4
- 230000004069 differentiation Effects 0.000 description 4
- 239000000284 extract Substances 0.000 description 4
- 239000000543 intermediate Substances 0.000 description 4
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 4
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 4
- 125000004043 oxo group Chemical group O=* 0.000 description 4
- 239000002244 precipitate Substances 0.000 description 4
- 238000002953 preparative HPLC Methods 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 230000001105 regulatory effect Effects 0.000 description 4
- 239000000377 silicon dioxide Substances 0.000 description 4
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- QKSQWQOAUQFORH-UHFFFAOYSA-N tert-butyl n-[(2-methylpropan-2-yl)oxycarbonylimino]carbamate Chemical compound CC(C)(C)OC(=O)N=NC(=O)OC(C)(C)C QKSQWQOAUQFORH-UHFFFAOYSA-N 0.000 description 4
- 230000001225 therapeutic effect Effects 0.000 description 4
- 125000000464 thioxo group Chemical group S=* 0.000 description 4
- MBYQPPXEXWRMQC-UHFFFAOYSA-N (2-chlorophenyl)methanol Chemical compound OCC1=CC=CC=C1Cl MBYQPPXEXWRMQC-UHFFFAOYSA-N 0.000 description 3
- BELUNASLYMZLPW-UHFFFAOYSA-N 1-benzylpyrazol-4-ol Chemical compound C1=C(O)C=NN1CC1=CC=CC=C1 BELUNASLYMZLPW-UHFFFAOYSA-N 0.000 description 3
- LEYOXMLEUJOPNO-UHFFFAOYSA-N 1-chloro-1-(1-chlorocyclopropyl)sulfonylcyclopropane Chemical compound C1CC1(Cl)S(=O)(=O)C1(Cl)CC1 LEYOXMLEUJOPNO-UHFFFAOYSA-N 0.000 description 3
- LUYAMNYBNTVQJG-UHFFFAOYSA-N 1-chloro-2-(2-chloroethylsulfonyl)ethane Chemical compound ClCCS(=O)(=O)CCCl LUYAMNYBNTVQJG-UHFFFAOYSA-N 0.000 description 3
- NYKRSGJRIJJRRK-UHFFFAOYSA-N 1-chloro-2-(2-chlorophenyl)sulfonylbenzene Chemical compound ClC1=CC=CC=C1S(=O)(=O)C1=CC=CC=C1Cl NYKRSGJRIJJRRK-UHFFFAOYSA-N 0.000 description 3
- JKMHFZQWWAIEOD-UHFFFAOYSA-N 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonic acid Chemical compound OCC[NH+]1CCN(CCS([O-])(=O)=O)CC1 JKMHFZQWWAIEOD-UHFFFAOYSA-N 0.000 description 3
- BMIBJCFFZPYJHF-UHFFFAOYSA-N 2-methoxy-5-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine Chemical compound COC1=NC=C(C)C=C1B1OC(C)(C)C(C)(C)O1 BMIBJCFFZPYJHF-UHFFFAOYSA-N 0.000 description 3
- QPRQEDXDYOZYLA-UHFFFAOYSA-N 2-methylbutan-1-ol Chemical compound CCC(C)CO QPRQEDXDYOZYLA-UHFFFAOYSA-N 0.000 description 3
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- 208000005623 Carcinogenesis Diseases 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 3
- 102000004190 Enzymes Human genes 0.000 description 3
- 108090000790 Enzymes Proteins 0.000 description 3
- 239000007995 HEPES buffer Substances 0.000 description 3
- 102000016624 JmjC domains Human genes 0.000 description 3
- 108050006228 JmjC domains Proteins 0.000 description 3
- UEEJHVSXFDXPFK-UHFFFAOYSA-N N-dimethylaminoethanol Chemical compound CN(C)CCO UEEJHVSXFDXPFK-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 3
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 3
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 3
- PZBFGYYEXUXCOF-UHFFFAOYSA-N TCEP Chemical compound OC(=O)CCP(CCC(O)=O)CCC(O)=O PZBFGYYEXUXCOF-UHFFFAOYSA-N 0.000 description 3
- 125000004419 alkynylene group Chemical group 0.000 description 3
- 150000001413 amino acids Chemical class 0.000 description 3
- 150000005840 aryl radicals Chemical class 0.000 description 3
- 239000012131 assay buffer Substances 0.000 description 3
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 3
- 230000036952 cancer formation Effects 0.000 description 3
- 239000004202 carbamide Substances 0.000 description 3
- 231100000504 carcinogenesis Toxicity 0.000 description 3
- 238000000423 cell based assay Methods 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 150000001805 chlorine compounds Chemical class 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 238000009833 condensation Methods 0.000 description 3
- 230000005494 condensation Effects 0.000 description 3
- 230000008878 coupling Effects 0.000 description 3
- 238000010168 coupling process Methods 0.000 description 3
- 238000005859 coupling reaction Methods 0.000 description 3
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 3
- 208000035475 disorder Diseases 0.000 description 3
- 239000003937 drug carrier Substances 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- SFNALCNOMXIBKG-UHFFFAOYSA-N ethylene glycol monododecyl ether Chemical compound CCCCCCCCCCCCOCCO SFNALCNOMXIBKG-UHFFFAOYSA-N 0.000 description 3
- 230000005284 excitation Effects 0.000 description 3
- IMBKASBLAKCLEM-UHFFFAOYSA-L ferrous ammonium sulfate (anhydrous) Chemical compound [NH4+].[NH4+].[Fe+2].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O IMBKASBLAKCLEM-UHFFFAOYSA-L 0.000 description 3
- 238000003818 flash chromatography Methods 0.000 description 3
- 230000006870 function Effects 0.000 description 3
- 125000000524 functional group Chemical group 0.000 description 3
- 238000005227 gel permeation chromatography Methods 0.000 description 3
- 230000007062 hydrolysis Effects 0.000 description 3
- 238000006460 hydrolysis reaction Methods 0.000 description 3
- 238000000338 in vitro Methods 0.000 description 3
- 238000001727 in vivo Methods 0.000 description 3
- 238000011534 incubation Methods 0.000 description 3
- 235000015320 potassium carbonate Nutrition 0.000 description 3
- 230000000069 prophylactic effect Effects 0.000 description 3
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 3
- 239000000376 reactant Substances 0.000 description 3
- 239000000741 silica gel Substances 0.000 description 3
- 229910002027 silica gel Inorganic materials 0.000 description 3
- 239000012312 sodium hydride Substances 0.000 description 3
- PPASLZSBLFJQEF-RXSVEWSESA-M sodium-L-ascorbate Chemical compound [Na+].OC[C@H](O)[C@H]1OC(=O)C(O)=C1[O-] PPASLZSBLFJQEF-RXSVEWSESA-M 0.000 description 3
- 235000019187 sodium-L-ascorbate Nutrition 0.000 description 3
- 239000011755 sodium-L-ascorbate Substances 0.000 description 3
- 238000001228 spectrum Methods 0.000 description 3
- 208000024891 symptom Diseases 0.000 description 3
- 239000003826 tablet Substances 0.000 description 3
- CXWXQJXEFPUFDZ-UHFFFAOYSA-N tetralin Chemical group C1=CC=C2CCCCC2=C1 CXWXQJXEFPUFDZ-UHFFFAOYSA-N 0.000 description 3
- 210000001519 tissue Anatomy 0.000 description 3
- 241000701447 unidentified baculovirus Species 0.000 description 3
- STVBVTWXWZMRPZ-UHFFFAOYSA-N (2,3-dichlorophenyl)methanol Chemical compound OCC1=CC=CC(Cl)=C1Cl STVBVTWXWZMRPZ-UHFFFAOYSA-N 0.000 description 2
- QKJGOHIJTUXQAB-UHFFFAOYSA-N (3-fluoro-5-hydroxyphenyl)-morpholin-4-ylmethanone Chemical compound OC1=CC(F)=CC(C(=O)N2CCOCC2)=C1 QKJGOHIJTUXQAB-UHFFFAOYSA-N 0.000 description 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 2
- OGXRAAWFVXFXBV-UHFFFAOYSA-N 1-(1-phenylethyl)pyrazol-4-ol Chemical compound C1=C(O)C=NN1C(C)C1=CC=CC=C1 OGXRAAWFVXFXBV-UHFFFAOYSA-N 0.000 description 2
- CXUCKELNYMZTRT-UHFFFAOYSA-N 1-Ethyl-2-benzimidazolinone Chemical compound C1=CC=C2NC(=O)N(CC)C2=C1 CXUCKELNYMZTRT-UHFFFAOYSA-N 0.000 description 2
- VOXZDWNPVJITMN-ZBRFXRBCSA-N 17β-estradiol Chemical compound OC1=CC=C2[C@H]3CC[C@](C)([C@H](CC4)O)[C@@H]4[C@@H]3CCC2=C1 VOXZDWNPVJITMN-ZBRFXRBCSA-N 0.000 description 2
- YBYIRNPNPLQARY-UHFFFAOYSA-N 1H-indene Chemical group C1=CC=C2CC=CC2=C1 YBYIRNPNPLQARY-UHFFFAOYSA-N 0.000 description 2
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- XURKONIWFULYEQ-MRXNPFEDSA-N 2-[1-[(3r)-1-(4-fluorophenyl)piperidin-3-yl]pyrazol-4-yl]oxy-1h-pyrido[3,4-d]pyrimidin-4-one Chemical compound C1=CC(F)=CC=C1N1C[C@H](N2N=CC(OC=3NC4=CN=CC=C4C(=O)N=3)=C2)CCC1 XURKONIWFULYEQ-MRXNPFEDSA-N 0.000 description 2
- NZSIFZPWVWCNSG-LBPRGKRZSA-N 2-[1-[(3s)-1-cyclopropylsulfonylpiperidin-3-yl]pyrazol-4-yl]oxy-1h-pyrido[3,4-d]pyrimidin-4-one Chemical compound C([C@@H](C1)N2N=CC(=C2)OC2=NC(C3=CC=NC=C3N2)=O)CCN1S(=O)(=O)C1CC1 NZSIFZPWVWCNSG-LBPRGKRZSA-N 0.000 description 2
- NNQSZQSLYJTIGS-VIFPVBQESA-N 2-[1-[(3s)-pyrrolidin-3-yl]pyrazol-4-yl]oxy-1h-pyrido[3,4-d]pyrimidin-4-one Chemical compound N1C2=CN=CC=C2C(=O)N=C1OC(=C1)C=NN1[C@H]1CCNC1 NNQSZQSLYJTIGS-VIFPVBQESA-N 0.000 description 2
- YFZHXSYEBJGHFA-UHFFFAOYSA-N 2-morpholin-4-yl-1h-pyridin-4-one Chemical compound OC1=CC=NC(N2CCOCC2)=C1 YFZHXSYEBJGHFA-UHFFFAOYSA-N 0.000 description 2
- WRMNZCZEMHIOCP-UHFFFAOYSA-N 2-phenylethanol Chemical compound OCCC1=CC=CC=C1 WRMNZCZEMHIOCP-UHFFFAOYSA-N 0.000 description 2
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 2
- WDNBURPWRNALGP-UHFFFAOYSA-N 3,4-Dichlorophenol Chemical compound OC1=CC=C(Cl)C(Cl)=C1 WDNBURPWRNALGP-UHFFFAOYSA-N 0.000 description 2
- BNPWVUJOPCGHIK-UHFFFAOYSA-N 3,4-difluorophenol Chemical compound OC1=CC=C(F)C(F)=C1 BNPWVUJOPCGHIK-UHFFFAOYSA-N 0.000 description 2
- SMFFZOQLHYIRDA-UHFFFAOYSA-N 3,4-dimethoxyphenol Chemical compound COC1=CC=C(O)C=C1OC SMFFZOQLHYIRDA-UHFFFAOYSA-N 0.000 description 2
- HMNKTRSOROOSPP-UHFFFAOYSA-N 3-Ethylphenol Chemical compound CCC1=CC=CC(O)=C1 HMNKTRSOROOSPP-UHFFFAOYSA-N 0.000 description 2
- ASHGTJPOSUFTGB-UHFFFAOYSA-N 3-methoxyphenol Chemical compound COC1=CC=CC(O)=C1 ASHGTJPOSUFTGB-UHFFFAOYSA-N 0.000 description 2
- MPWGZBWDLMDIHO-UHFFFAOYSA-N 3-propylphenol Chemical compound CCCC1=CC=CC(O)=C1 MPWGZBWDLMDIHO-UHFFFAOYSA-N 0.000 description 2
- VKRFUGHXKNNIJO-UHFFFAOYSA-N 4,4,4-trifluorobutan-1-ol Chemical compound OCCCC(F)(F)F VKRFUGHXKNNIJO-UHFFFAOYSA-N 0.000 description 2
- MOOUWXDQAUXZRG-UHFFFAOYSA-N 4-(trifluoromethyl)benzyl alcohol Chemical compound OCC1=CC=C(C(F)(F)F)C=C1 MOOUWXDQAUXZRG-UHFFFAOYSA-N 0.000 description 2
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 description 2
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 2
- 108020004414 DNA Proteins 0.000 description 2
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical compound OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 2
- 239000007821 HATU Substances 0.000 description 2
- IVDFJHOHABJVEH-UHFFFAOYSA-N HOCMe2CMe2OH Natural products CC(C)(O)C(C)(C)O IVDFJHOHABJVEH-UHFFFAOYSA-N 0.000 description 2
- 108010034791 Heterochromatin Proteins 0.000 description 2
- 101710160287 Heterochromatin protein 1 Proteins 0.000 description 2
- 101001050886 Homo sapiens Lysine-specific histone demethylase 1A Proteins 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 102000058057 JmjC domain-containing Human genes 0.000 description 2
- 108700001203 JmjC domain-containing Proteins 0.000 description 2
- 102100024985 Lysine-specific histone demethylase 1A Human genes 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- 241000699666 Mus <mouse, genus> Species 0.000 description 2
- 241000699670 Mus sp. Species 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical group C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- LCTONWCANYUPML-UHFFFAOYSA-N Pyruvic acid Chemical compound CC(=O)C(O)=O LCTONWCANYUPML-UHFFFAOYSA-N 0.000 description 2
- 239000006146 Roswell Park Memorial Institute medium Substances 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- 108010021119 Trichosanthin Proteins 0.000 description 2
- RHQDFWAXVIIEBN-UHFFFAOYSA-N Trifluoroethanol Chemical compound OCC(F)(F)F RHQDFWAXVIIEBN-UHFFFAOYSA-N 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- IYABWNGZIDDRAK-UHFFFAOYSA-N allene Chemical group C=C=C IYABWNGZIDDRAK-UHFFFAOYSA-N 0.000 description 2
- 235000001014 amino acid Nutrition 0.000 description 2
- 229940024606 amino acid Drugs 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- 235000009697 arginine Nutrition 0.000 description 2
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 2
- 125000005605 benzo group Chemical group 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 150000001558 benzoic acid derivatives Chemical class 0.000 description 2
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 description 2
- 235000019445 benzyl alcohol Nutrition 0.000 description 2
- 125000002619 bicyclic group Chemical group 0.000 description 2
- MUALRAIOVNYAIW-UHFFFAOYSA-N binap Chemical compound C1=CC=CC=C1P(C=1C(=C2C=CC=CC2=CC=1)C=1C2=CC=CC=C2C=CC=1P(C=1C=CC=CC=1)C=1C=CC=CC=1)C1=CC=CC=C1 MUALRAIOVNYAIW-UHFFFAOYSA-N 0.000 description 2
- 230000033228 biological regulation Effects 0.000 description 2
- QARVLSVVCXYDNA-UHFFFAOYSA-N bromobenzene Chemical compound BrC1=CC=CC=C1 QARVLSVVCXYDNA-UHFFFAOYSA-N 0.000 description 2
- BTANRVKWQNVYAZ-UHFFFAOYSA-N butan-2-ol Chemical compound CCC(C)O BTANRVKWQNVYAZ-UHFFFAOYSA-N 0.000 description 2
- RYYVLZVUVIJVGH-UHFFFAOYSA-N caffeine Chemical compound CN1C(=O)N(C)C(=O)C2=C1N=CN2C RYYVLZVUVIJVGH-UHFFFAOYSA-N 0.000 description 2
- 229910002092 carbon dioxide Inorganic materials 0.000 description 2
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 230000010261 cell growth Effects 0.000 description 2
- 239000012320 chlorinating reagent Substances 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229940125904 compound 1 Drugs 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- GUDMZGLFZNLYEY-UHFFFAOYSA-N cyclopropylmethanol Chemical compound OCC1CC1 GUDMZGLFZNLYEY-UHFFFAOYSA-N 0.000 description 2
- 238000010790 dilution Methods 0.000 description 2
- 239000012895 dilution Substances 0.000 description 2
- 210000001671 embryonic stem cell Anatomy 0.000 description 2
- 238000005516 engineering process Methods 0.000 description 2
- 230000008029 eradication Effects 0.000 description 2
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 230000014509 gene expression Effects 0.000 description 2
- KWIUHFFTVRNATP-UHFFFAOYSA-N glycine betaine Chemical compound C[N+](C)(C)CC([O-])=O KWIUHFFTVRNATP-UHFFFAOYSA-N 0.000 description 2
- 230000012010 growth Effects 0.000 description 2
- 210000004458 heterochromatin Anatomy 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 125000002632 imidazolidinyl group Chemical group 0.000 description 2
- 125000002636 imidazolinyl group Chemical group 0.000 description 2
- 238000003119 immunoblot Methods 0.000 description 2
- PQNFLJBBNBOBRQ-UHFFFAOYSA-N indane Chemical group C1=CC=C2CCCC2=C1 PQNFLJBBNBOBRQ-UHFFFAOYSA-N 0.000 description 2
- 150000007529 inorganic bases Chemical class 0.000 description 2
- 229910052742 iron Inorganic materials 0.000 description 2
- TWBYWOBDOCUKOW-UHFFFAOYSA-M isonicotinate Chemical compound [O-]C(=O)C1=CC=NC=C1 TWBYWOBDOCUKOW-UHFFFAOYSA-M 0.000 description 2
- 101150076630 jhdm-1 gene Proteins 0.000 description 2
- 125000003588 lysine group Chemical class [H]N([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])(N([H])[H])C(*)=O 0.000 description 2
- 235000019359 magnesium stearate Nutrition 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- KSZMBXHYSQDICN-UHFFFAOYSA-N methyl 3-amino-2-chloropyridine-4-carboxylate Chemical compound COC(=O)C1=CC=NC(Cl)=C1N KSZMBXHYSQDICN-UHFFFAOYSA-N 0.000 description 2
- UHOVQNZJYSORNB-UHFFFAOYSA-N monobenzene Natural products C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 2
- 125000002950 monocyclic group Chemical group 0.000 description 2
- ZKSYUNLBFSOENV-UHFFFAOYSA-N n-(2-hydroxyethyl)benzamide Chemical compound OCCNC(=O)C1=CC=CC=C1 ZKSYUNLBFSOENV-UHFFFAOYSA-N 0.000 description 2
- 238000010534 nucleophilic substitution reaction Methods 0.000 description 2
- 150000007530 organic bases Chemical class 0.000 description 2
- PCPUMGYALMOCHF-UHFFFAOYSA-N oxolan-3-ylmethanol Chemical compound OCC1CCOC1 PCPUMGYALMOCHF-UHFFFAOYSA-N 0.000 description 2
- NWVVVBRKAWDGAB-UHFFFAOYSA-N p-methoxyphenol Chemical compound COC1=CC=C(O)C=C1 NWVVVBRKAWDGAB-UHFFFAOYSA-N 0.000 description 2
- 239000008188 pellet Substances 0.000 description 2
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 2
- 125000004483 piperidin-3-yl group Chemical group N1CC(CCC1)* 0.000 description 2
- 125000004482 piperidin-4-yl group Chemical group N1CCC(CC1)* 0.000 description 2
- DNUTZBZXLPWRJG-UHFFFAOYSA-M piperidine-1-carboxylate Chemical compound [O-]C(=O)N1CCCCC1 DNUTZBZXLPWRJG-UHFFFAOYSA-M 0.000 description 2
- 230000001323 posttranslational effect Effects 0.000 description 2
- 235000011181 potassium carbonates Nutrition 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- 230000019639 protein methylation Effects 0.000 description 2
- LVTJOONKWUXEFR-FZRMHRINSA-N protoneodioscin Natural products O(C[C@@H](CC[C@]1(O)[C@H](C)[C@@H]2[C@]3(C)[C@H]([C@H]4[C@@H]([C@]5(C)C(=CC4)C[C@@H](O[C@@H]4[C@H](O[C@H]6[C@@H](O)[C@@H](O)[C@@H](O)[C@H](C)O6)[C@@H](O)[C@H](O[C@H]6[C@@H](O)[C@@H](O)[C@@H](O)[C@H](C)O6)[C@H](CO)O4)CC5)CC3)C[C@@H]2O1)C)[C@H]1[C@H](O)[C@H](O)[C@H](O)[C@@H](CO)O1 LVTJOONKWUXEFR-FZRMHRINSA-N 0.000 description 2
- 125000003072 pyrazolidinyl group Chemical group 0.000 description 2
- 125000002294 quinazolinyl group Chemical group N1=C(N=CC2=CC=CC=C12)* 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 230000009758 senescence Effects 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- KXCAEQNNTZANTK-UHFFFAOYSA-N stannane Chemical compound [SnH4] KXCAEQNNTZANTK-UHFFFAOYSA-N 0.000 description 2
- 229910000080 stannane Inorganic materials 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 229910052717 sulfur Chemical group 0.000 description 2
- 239000011593 sulfur Chemical group 0.000 description 2
- OEYCKAKSZHBNOB-UHFFFAOYSA-N tert-butyl 4-(4-hydroxypyrazol-1-yl)piperidine-1-carboxylate Chemical compound C1CN(C(=O)OC(C)(C)C)CCC1N1N=CC(O)=C1 OEYCKAKSZHBNOB-UHFFFAOYSA-N 0.000 description 2
- VEXMBIYPLRXZPO-UHFFFAOYSA-N tert-butyl 4-(4-oxo-1h-pyridin-2-yl)piperazine-1-carboxylate Chemical compound C1CN(C(=O)OC(C)(C)C)CCN1C1=CC(=O)C=CN1 VEXMBIYPLRXZPO-UHFFFAOYSA-N 0.000 description 2
- QVVOOULMGMQNBF-UHFFFAOYSA-N tert-butyl 4-[4-[(4-oxo-1h-pyrido[3,4-d]pyrimidin-2-yl)oxy]pyridin-2-yl]piperazine-1-carboxylate Chemical compound C1CN(C(=O)OC(C)(C)C)CCN1C1=CC(OC=2NC3=CN=CC=C3C(=O)N=2)=CC=N1 QVVOOULMGMQNBF-UHFFFAOYSA-N 0.000 description 2
- YAPQBXQYLJRXSA-UHFFFAOYSA-N theobromine Chemical compound CN1C(=O)NC(=O)C2=C1N=CN2C YAPQBXQYLJRXSA-UHFFFAOYSA-N 0.000 description 2
- 238000004809 thin layer chromatography Methods 0.000 description 2
- 125000003396 thiol group Chemical group [H]S* 0.000 description 2
- 125000004568 thiomorpholinyl group Chemical group 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- 230000009466 transformation Effects 0.000 description 2
- 238000000844 transformation Methods 0.000 description 2
- GKASDNZWUGIAMG-UHFFFAOYSA-N triethyl orthoformate Chemical compound CCOC(OCC)OCC GKASDNZWUGIAMG-UHFFFAOYSA-N 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 2
- VCGRFBXVSFAGGA-UHFFFAOYSA-N (1,1-dioxo-1,4-thiazinan-4-yl)-[6-[[3-(4-fluorophenyl)-5-methyl-1,2-oxazol-4-yl]methoxy]pyridin-3-yl]methanone Chemical compound CC=1ON=C(C=2C=CC(F)=CC=2)C=1COC(N=C1)=CC=C1C(=O)N1CCS(=O)(=O)CC1 VCGRFBXVSFAGGA-UHFFFAOYSA-N 0.000 description 1
- IIBSDEGSGLVNOY-UHFFFAOYSA-N (1-ethylpyrazol-4-yl)boronic acid Chemical compound CCN1C=C(B(O)O)C=N1 IIBSDEGSGLVNOY-UHFFFAOYSA-N 0.000 description 1
- VLVZNLMUFJYZDG-UHFFFAOYSA-N (1-propan-2-ylpyrazol-4-yl)boronic acid Chemical compound CC(C)N1C=C(B(O)O)C=N1 VLVZNLMUFJYZDG-UHFFFAOYSA-N 0.000 description 1
- VNOMEAQPOMDWSR-SSDOTTSWSA-N (1r)-2,2,2-trifluoro-1-phenylethanol Chemical compound FC(F)(F)[C@H](O)C1=CC=CC=C1 VNOMEAQPOMDWSR-SSDOTTSWSA-N 0.000 description 1
- WKKHCCZLKYKUDN-UHFFFAOYSA-N (2,6-dichlorophenyl)methanol Chemical compound OCC1=C(Cl)C=CC=C1Cl WKKHCCZLKYKUDN-UHFFFAOYSA-N 0.000 description 1
- HZDNNJABYXNPPV-UHFFFAOYSA-N (2-chloro-2-oxoethyl) acetate Chemical compound CC(=O)OCC(Cl)=O HZDNNJABYXNPPV-UHFFFAOYSA-N 0.000 description 1
- MFGWMAAZYZSWMY-UHFFFAOYSA-N (2-naphthyl)methanol Chemical compound C1=CC=CC2=CC(CO)=CC=C21 MFGWMAAZYZSWMY-UHFFFAOYSA-N 0.000 description 1
- VKTQADPEPIVMHK-UHFFFAOYSA-N (2-phenylphenyl)methanol Chemical compound OCC1=CC=CC=C1C1=CC=CC=C1 VKTQADPEPIVMHK-UHFFFAOYSA-N 0.000 description 1
- QBYIENPQHBMVBV-HFEGYEGKSA-N (2R)-2-hydroxy-2-phenylacetic acid Chemical compound O[C@@H](C(O)=O)c1ccccc1.O[C@@H](C(O)=O)c1ccccc1 QBYIENPQHBMVBV-HFEGYEGKSA-N 0.000 description 1
- ZSRDNPVYGSFUMD-UHFFFAOYSA-N (3-chlorophenyl)methanol Chemical compound OCC1=CC=CC(Cl)=C1 ZSRDNPVYGSFUMD-UHFFFAOYSA-N 0.000 description 1
- KEDQBHTWUKQOGG-UHFFFAOYSA-N (3-hydroxyphenyl) carbamate Chemical compound NC(=O)OC1=CC=CC(O)=C1 KEDQBHTWUKQOGG-UHFFFAOYSA-N 0.000 description 1
- WGUZZTGZDPJWSG-UHFFFAOYSA-N (3-phenylphenyl)methanol Chemical compound OCC1=CC=CC(C=2C=CC=CC=2)=C1 WGUZZTGZDPJWSG-UHFFFAOYSA-N 0.000 description 1
- MAYZWDRUFKUGGP-VIFPVBQESA-N (3s)-1-[5-tert-butyl-3-[(1-methyltetrazol-5-yl)methyl]triazolo[4,5-d]pyrimidin-7-yl]pyrrolidin-3-ol Chemical compound CN1N=NN=C1CN1C2=NC(C(C)(C)C)=NC(N3C[C@@H](O)CC3)=C2N=N1 MAYZWDRUFKUGGP-VIFPVBQESA-N 0.000 description 1
- PTHGDVCPCZKZKR-UHFFFAOYSA-N (4-chlorophenyl)methanol Chemical compound OCC1=CC=C(Cl)C=C1 PTHGDVCPCZKZKR-UHFFFAOYSA-N 0.000 description 1
- GEZMEIHVFSWOCA-UHFFFAOYSA-N (4-fluorophenyl)methanol Chemical compound OCC1=CC=C(F)C=C1 GEZMEIHVFSWOCA-UHFFFAOYSA-N 0.000 description 1
- 125000006732 (C1-C15) alkyl group Chemical group 0.000 description 1
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 description 1
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 description 1
- 125000006527 (C1-C5) alkyl group Chemical group 0.000 description 1
- 125000006833 (C1-C5) alkylene group Chemical group 0.000 description 1
- ZGYIXVSQHOKQRZ-COIATFDQSA-N (e)-n-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-3-cyano-7-[(3s)-oxolan-3-yl]oxyquinolin-6-yl]-4-(dimethylamino)but-2-enamide Chemical compound N#CC1=CN=C2C=C(O[C@@H]3COCC3)C(NC(=O)/C=C/CN(C)C)=CC2=C1NC(C=C1Cl)=CC=C1OCC1=CC=CC=N1 ZGYIXVSQHOKQRZ-COIATFDQSA-N 0.000 description 1
- MOWXJLUYGFNTAL-DEOSSOPVSA-N (s)-[2-chloro-4-fluoro-5-(7-morpholin-4-ylquinazolin-4-yl)phenyl]-(6-methoxypyridazin-3-yl)methanol Chemical compound N1=NC(OC)=CC=C1[C@@H](O)C1=CC(C=2C3=CC=C(C=C3N=CN=2)N2CCOCC2)=C(F)C=C1Cl MOWXJLUYGFNTAL-DEOSSOPVSA-N 0.000 description 1
- WBYWAXJHAXSJNI-VOTSOKGWSA-M .beta-Phenylacrylic acid Natural products [O-]C(=O)\C=C\C1=CC=CC=C1 WBYWAXJHAXSJNI-VOTSOKGWSA-M 0.000 description 1
- 108091064702 1 family Proteins 0.000 description 1
- 101150084750 1 gene Proteins 0.000 description 1
- IBWNUWSYEJOUAH-UHFFFAOYSA-N 1,1,1-trifluorobutan-2-ol Chemical compound CCC(O)C(F)(F)F IBWNUWSYEJOUAH-UHFFFAOYSA-N 0.000 description 1
- 125000005988 1,1-dioxo-thiomorpholinyl group Chemical group 0.000 description 1
- JAAJQSRLGAYGKZ-UHFFFAOYSA-N 1,2,3,4-tetrahydronaphthalen-1-ol Chemical compound C1=CC=C2C(O)CCCC2=C1 JAAJQSRLGAYGKZ-UHFFFAOYSA-N 0.000 description 1
- LBARXHIIOCOWOG-UHFFFAOYSA-N 1,2,3,4-tetrahydronaphthalen-1-ylmethanol Chemical compound C1=CC=C2C(CO)CCCC2=C1 LBARXHIIOCOWOG-UHFFFAOYSA-N 0.000 description 1
- WWPWWAHQDTYCPM-UHFFFAOYSA-N 1,2,3,4-tetrahydronaphthalen-2-ylmethanol Chemical compound C1=CC=C2CC(CO)CCC2=C1 WWPWWAHQDTYCPM-UHFFFAOYSA-N 0.000 description 1
- 125000005871 1,3-benzodioxolyl group Chemical group 0.000 description 1
- 125000005877 1,4-benzodioxanyl group Chemical group 0.000 description 1
- APWRZPQBPCAXFP-UHFFFAOYSA-N 1-(1-oxo-2H-isoquinolin-5-yl)-5-(trifluoromethyl)-N-[2-(trifluoromethyl)pyridin-4-yl]pyrazole-4-carboxamide Chemical compound O=C1NC=CC2=C(C=CC=C12)N1N=CC(=C1C(F)(F)F)C(=O)NC1=CC(=NC=C1)C(F)(F)F APWRZPQBPCAXFP-UHFFFAOYSA-N 0.000 description 1
- IYTHMJXDOLOXLU-UHFFFAOYSA-N 1-(1-phenylpropyl)pyrazol-4-ol Chemical compound C1=C(O)C=NN1C(CC)C1=CC=CC=C1 IYTHMJXDOLOXLU-UHFFFAOYSA-N 0.000 description 1
- AKMNUCBQGHFICM-UHFFFAOYSA-N 1-(2-methyl-1,3-benzoxazol-6-yl)-3-(1,5-naphthyridin-4-yl)urea Chemical compound C1=CN=C2C(NC(=O)NC3=CC=C4N=C(OC4=C3)C)=CC=NC2=C1 AKMNUCBQGHFICM-UHFFFAOYSA-N 0.000 description 1
- FFWQLZFIMNTUCZ-UHFFFAOYSA-N 1-(bromomethyl)-2-fluorobenzene Chemical compound FC1=CC=CC=C1CBr FFWQLZFIMNTUCZ-UHFFFAOYSA-N 0.000 description 1
- NVNPLEPBDPJYRZ-UHFFFAOYSA-N 1-(bromomethyl)-4-fluorobenzene Chemical compound FC1=CC=C(CBr)C=C1 NVNPLEPBDPJYRZ-UHFFFAOYSA-N 0.000 description 1
- PWMWNFMRSKOCEY-UHFFFAOYSA-N 1-Phenyl-1,2-ethanediol Chemical compound OCC(O)C1=CC=CC=C1 PWMWNFMRSKOCEY-UHFFFAOYSA-N 0.000 description 1
- CMOAASAAHVSUNP-UHFFFAOYSA-N 1-[(2-fluorophenyl)methyl]pyrazol-4-ol Chemical compound C1=C(O)C=NN1CC1=CC=CC=C1F CMOAASAAHVSUNP-UHFFFAOYSA-N 0.000 description 1
- JWOHBPPVVDQMKB-UHFFFAOYSA-N 1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid Chemical compound CC(C)(C)OC(=O)N1CCC(C(O)=O)CC1 JWOHBPPVVDQMKB-UHFFFAOYSA-N 0.000 description 1
- ABDDQTDRAHXHOC-QMMMGPOBSA-N 1-[(7s)-5,7-dihydro-4h-thieno[2,3-c]pyran-7-yl]-n-methylmethanamine Chemical compound CNC[C@@H]1OCCC2=C1SC=C2 ABDDQTDRAHXHOC-QMMMGPOBSA-N 0.000 description 1
- LJMANVXPNLJWMP-UHFFFAOYSA-N 1-[cyclopropyl(phenyl)methyl]pyrazol-4-ol Chemical compound C1=C(O)C=NN1C(C=1C=CC=CC=1)C1CC1 LJMANVXPNLJWMP-UHFFFAOYSA-N 0.000 description 1
- NTWWUWHQMMQLSI-UHFFFAOYSA-N 1-benzofuran-3-ylmethanol Chemical compound C1=CC=C2C(CO)=COC2=C1 NTWWUWHQMMQLSI-UHFFFAOYSA-N 0.000 description 1
- YZUPZGFPHUVJKC-UHFFFAOYSA-N 1-bromo-2-methoxyethane Chemical compound COCCBr YZUPZGFPHUVJKC-UHFFFAOYSA-N 0.000 description 1
- CRRUGYDDEMGVDY-UHFFFAOYSA-N 1-bromoethylbenzene Chemical compound CC(Br)C1=CC=CC=C1 CRRUGYDDEMGVDY-UHFFFAOYSA-N 0.000 description 1
- GWQSENYKCGJTRI-UHFFFAOYSA-N 1-chloro-4-iodobenzene Chemical compound ClC1=CC=C(I)C=C1 GWQSENYKCGJTRI-UHFFFAOYSA-N 0.000 description 1
- KGNQDBQYEBMPFZ-UHFFFAOYSA-N 1-fluoro-4-iodobenzene Chemical compound FC1=CC=C(I)C=C1 KGNQDBQYEBMPFZ-UHFFFAOYSA-N 0.000 description 1
- 125000005987 1-oxo-thiomorpholinyl group Chemical group 0.000 description 1
- 125000004214 1-pyrrolidinyl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 102100027833 14-3-3 protein sigma Human genes 0.000 description 1
- XEZNGIUYQVAUSS-UHFFFAOYSA-N 18-crown-6 Chemical compound C1COCCOCCOCCOCCOCCO1 XEZNGIUYQVAUSS-UHFFFAOYSA-N 0.000 description 1
- MNNWQAIAFUMNOS-UHFFFAOYSA-N 1h-pyrido[3,4-d]pyrimidine-2,4-dione Chemical compound N1=CC=C2C(=O)NC(=O)NC2=C1 MNNWQAIAFUMNOS-UHFFFAOYSA-N 0.000 description 1
- VNOMEAQPOMDWSR-UHFFFAOYSA-N 2,2,2-trifluoro-1-phenylethanol Chemical compound FC(F)(F)C(O)C1=CC=CC=C1 VNOMEAQPOMDWSR-UHFFFAOYSA-N 0.000 description 1
- 125000004206 2,2,2-trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 description 1
- VOGSDFLJZPNWHY-UHFFFAOYSA-N 2,2-difluoroethanol Chemical compound OCC(F)F VOGSDFLJZPNWHY-UHFFFAOYSA-N 0.000 description 1
- RPEPGIOVXBBUMJ-UHFFFAOYSA-N 2,3-difluorophenol Chemical compound OC1=CC=CC(F)=C1F RPEPGIOVXBBUMJ-UHFFFAOYSA-N 0.000 description 1
- TYALRRRJZSULDN-UHFFFAOYSA-N 2,3-dihydro-1-benzofuran-3-ylmethanol Chemical compound C1=CC=C2C(CO)COC2=C1 TYALRRRJZSULDN-UHFFFAOYSA-N 0.000 description 1
- GJZQCDPVYVQVBP-UHFFFAOYSA-N 2,3-dihydro-1h-inden-1-ylmethanol Chemical compound C1=CC=C2C(CO)CCC2=C1 GJZQCDPVYVQVBP-UHFFFAOYSA-N 0.000 description 1
- KMGCKSAIIHOKCX-UHFFFAOYSA-N 2,3-dihydro-1h-inden-2-ol Chemical compound C1=CC=C2CC(O)CC2=C1 KMGCKSAIIHOKCX-UHFFFAOYSA-N 0.000 description 1
- HCSBTDBGTNZOAB-UHFFFAOYSA-N 2,3-dinitrobenzoic acid Chemical class OC(=O)C1=CC=CC([N+]([O-])=O)=C1[N+]([O-])=O HCSBTDBGTNZOAB-UHFFFAOYSA-N 0.000 description 1
- YJUVYWACDUJBDG-UHFFFAOYSA-N 2,4-dichloropyrido[3,4-d]pyrimidine Chemical compound C1=CN=CC2=NC(Cl)=NC(Cl)=C21 YJUVYWACDUJBDG-UHFFFAOYSA-N 0.000 description 1
- LFPWLOXTYIAOGY-UHFFFAOYSA-N 2-(1,2,3,4-tetrahydronaphthalen-1-ylmethoxy)-1h-pyrido[3,4-d]pyrimidin-4-one Chemical compound N1C2=CN=CC=C2C(=O)N=C1OCC1C2=CC=CC=C2CCC1 LFPWLOXTYIAOGY-UHFFFAOYSA-N 0.000 description 1
- IETDEMYXQHOBRS-UHFFFAOYSA-N 2-(1,2,3,4-tetrahydronaphthalen-1-yloxy)-1h-pyrido[3,4-d]pyrimidin-4-one Chemical compound N1C2=CN=CC=C2C(=O)N=C1OC1C2=CC=CC=C2CCC1 IETDEMYXQHOBRS-UHFFFAOYSA-N 0.000 description 1
- MTRCDTBBSBYFFU-UHFFFAOYSA-N 2-(1,2,3,4-tetrahydronaphthalen-2-ylmethoxy)-3H-pyrido[3,4-d]pyrimidin-4-one Chemical compound C1C(CCC2=CC=CC=C12)COC=1N=C(C2=C(N1)C=NC=C2)O MTRCDTBBSBYFFU-UHFFFAOYSA-N 0.000 description 1
- VTDKNILYZVYLAX-UHFFFAOYSA-N 2-(1,3-dimethylindazol-6-yl)oxy-8-(1-methylimidazol-4-yl)-1h-pyrido[3,4-d]pyrimidin-4-one Chemical compound C=1C=C2C(C)=NN(C)C2=CC=1OC(NC1=2)=NC(=O)C1=CC=NC=2C1=CN(C)C=N1 VTDKNILYZVYLAX-UHFFFAOYSA-N 0.000 description 1
- BHEKABPMWXXBAE-UHFFFAOYSA-N 2-(1-benzofuran-3-ylmethoxy)-1h-pyrido[3,4-d]pyrimidin-4-one Chemical compound N1C2=CN=CC=C2C(=O)N=C1OCC1=COC2=CC=CC=C12 BHEKABPMWXXBAE-UHFFFAOYSA-N 0.000 description 1
- FRWZIBVDRVSSQI-UHFFFAOYSA-N 2-(1-propylpyrazol-4-yl)oxy-3H-pyrido[3,4-d]pyrimidin-4-one Chemical compound C(CC)N1N=CC(=C1)OC=1N=C(C2=C(N1)C=NC=C2)O FRWZIBVDRVSSQI-UHFFFAOYSA-N 0.000 description 1
- MMFUZPMIZNZYSL-UHFFFAOYSA-N 2-(2,2,2-trifluoro-1-phenylethoxy)-3H-pyrido[3,4-d]pyrimidin-4-one Chemical compound FC(C(OC=1N=C(C2=C(N1)C=NC=C2)O)C2=CC=CC=C2)(F)F MMFUZPMIZNZYSL-UHFFFAOYSA-N 0.000 description 1
- HRBLSBRWIWIOGW-UHFFFAOYSA-N 2-(2,2,2-trifluoroethoxy)ethanol Chemical compound OCCOCC(F)(F)F HRBLSBRWIWIOGW-UHFFFAOYSA-N 0.000 description 1
- FCPGYOAPDOQGJZ-UHFFFAOYSA-N 2-(2,3-dihydro-1-benzofuran-3-ylmethoxy)-1h-pyrido[3,4-d]pyrimidin-4-one Chemical compound N1C2=CN=CC=C2C(=O)N=C1OCC1C2=CC=CC=C2OC1 FCPGYOAPDOQGJZ-UHFFFAOYSA-N 0.000 description 1
- HKCYNSISOKWWEJ-UHFFFAOYSA-N 2-(2,3-dihydro-1H-inden-1-ylmethoxy)-3H-pyrido[3,4-d]pyrimidin-4-one Chemical compound C1(CCC2=CC=CC=C12)COC=1N=C(C2=C(N1)C=NC=C2)O HKCYNSISOKWWEJ-UHFFFAOYSA-N 0.000 description 1
- JFXHWLCGOBHDBT-UHFFFAOYSA-N 2-(2,3-dihydro-1h-inden-1-yloxy)-1h-pyrido[3,4-d]pyrimidin-4-one Chemical compound N1C2=CN=CC=C2C(=O)N=C1OC1C2=CC=CC=C2CC1 JFXHWLCGOBHDBT-UHFFFAOYSA-N 0.000 description 1
- KLBDIHPJEZHCBD-UHFFFAOYSA-N 2-(2,3-dihydro-1h-inden-2-yloxy)-1h-pyrido[3,4-d]pyrimidin-4-one Chemical compound N1C2=CN=CC=C2C(=O)N=C1OC1CC2=CC=CC=C2C1 KLBDIHPJEZHCBD-UHFFFAOYSA-N 0.000 description 1
- HYRDZEPBDFLDTR-UHFFFAOYSA-N 2-(2-hydroxy-2-methylpropoxy)-8-(1-methylimidazol-4-yl)-1h-pyrido[3,4-d]pyrimidin-4-one Chemical compound CN1C=NC(C=2C3=C(C(N=C(OCC(C)(C)O)N3)=O)C=CN=2)=C1 HYRDZEPBDFLDTR-UHFFFAOYSA-N 0.000 description 1
- XMTCDJGEDXMGJN-UHFFFAOYSA-N 2-(2-hydroxyethoxy)-8-(1-methylimidazol-4-yl)-3H-pyrido[3,4-d]pyrimidin-4-one Chemical compound OCCOC=1N=C(C2=C(N1)C(=NC=C2)C=2N=CN(C2)C)O XMTCDJGEDXMGJN-UHFFFAOYSA-N 0.000 description 1
- CBDWLOMDLAQHDH-UHFFFAOYSA-N 2-(3,4-dichlorophenoxy)-1h-pyrido[3,4-d]pyrimidin-4-one Chemical compound C1=C(Cl)C(Cl)=CC=C1OC1=NC(=O)C2=CC=NC=C2N1 CBDWLOMDLAQHDH-UHFFFAOYSA-N 0.000 description 1
- KNMWKTSBYWVQIZ-UHFFFAOYSA-N 2-(3,4-dichlorophenoxy)-8-(1-methylimidazol-4-yl)-1h-pyrido[3,4-d]pyrimidin-4-one Chemical compound CN1C=NC(C=2C3=C(C(N=C(OC=4C=C(Cl)C(Cl)=CC=4)N3)=O)C=CN=2)=C1 KNMWKTSBYWVQIZ-UHFFFAOYSA-N 0.000 description 1
- GITOMJDYNUMCOV-UHFFFAOYSA-N 2-(3,4-dichlorophenyl)ethanol Chemical compound OCCC1=CC=C(Cl)C(Cl)=C1 GITOMJDYNUMCOV-UHFFFAOYSA-N 0.000 description 1
- RNMXAMGZLXIKCD-UHFFFAOYSA-N 2-(3,4-dihydro-2h-chromen-4-ylmethoxy)-1h-pyrido[3,4-d]pyrimidin-4-one Chemical compound N1C2=CN=CC=C2C(=O)N=C1OCC1C2=CC=CC=C2OCC1 RNMXAMGZLXIKCD-UHFFFAOYSA-N 0.000 description 1
- DLXJNZXSHMRRNQ-UHFFFAOYSA-N 2-(3,4-dihydro-2h-chromen-4-yloxy)-1h-pyrido[3,4-d]pyrimidin-4-one Chemical compound N1C2=CN=CC=C2C(=O)N=C1OC1C2=CC=CC=C2OCC1 DLXJNZXSHMRRNQ-UHFFFAOYSA-N 0.000 description 1
- CPBXMZZCYYHOGH-UHFFFAOYSA-N 2-(3-methoxyphenoxy)-3H-pyrido[3,4-d]pyrimidin-4-one Chemical compound COC=1C=C(OC=2N=C(C3=C(N2)C=NC=C3)O)C=CC1 CPBXMZZCYYHOGH-UHFFFAOYSA-N 0.000 description 1
- LKQWIIJIQQWUAN-UHFFFAOYSA-N 2-(4-chlorophenoxy)-1h-pyrido[3,4-d]pyrimidin-4-one Chemical compound C1=CC(Cl)=CC=C1OC1=NC(=O)C2=CC=NC=C2N1 LKQWIIJIQQWUAN-UHFFFAOYSA-N 0.000 description 1
- HZFRKZWBVUJYDA-UHFFFAOYSA-N 2-(4-chlorophenyl)ethanol Chemical compound OCCC1=CC=C(Cl)C=C1 HZFRKZWBVUJYDA-UHFFFAOYSA-N 0.000 description 1
- ZHTKJFJLUVQPSU-UHFFFAOYSA-N 2-(naphthalen-1-ylmethoxy)-1h-pyrido[3,4-d]pyrimidin-4-one Chemical compound N1C2=CN=CC=C2C(=O)N=C1OCC1=CC=CC2=CC=CC=C12 ZHTKJFJLUVQPSU-UHFFFAOYSA-N 0.000 description 1
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 1
- RNDNSYIPLPAXAZ-UHFFFAOYSA-N 2-Phenyl-1-propanol Chemical compound OCC(C)C1=CC=CC=C1 RNDNSYIPLPAXAZ-UHFFFAOYSA-N 0.000 description 1
- XGSFDNPZSAIYDG-UHFFFAOYSA-N 2-[(2,3-dichlorophenyl)methoxy]-1h-pyrido[3,4-d]pyrimidin-4-one Chemical compound ClC1=CC=CC(COC=2NC3=CN=CC=C3C(=O)N=2)=C1Cl XGSFDNPZSAIYDG-UHFFFAOYSA-N 0.000 description 1
- WZOJABXZYFSNIJ-UHFFFAOYSA-N 2-[(2,3-dichlorophenyl)methoxy]-8-(1-methylimidazol-4-yl)-1h-pyrido[3,4-d]pyrimidin-4-one Chemical compound CN1C=NC(C=2C3=C(C(N=C(OCC=4C(=C(Cl)C=CC=4)Cl)N3)=O)C=CN=2)=C1 WZOJABXZYFSNIJ-UHFFFAOYSA-N 0.000 description 1
- ZGPBIBGAIFYPCQ-UHFFFAOYSA-N 2-[(2,3-difluorophenyl)methoxy]-1h-pyrido[3,4-d]pyrimidin-4-one Chemical compound FC1=CC=CC(COC=2NC3=CN=CC=C3C(=O)N=2)=C1F ZGPBIBGAIFYPCQ-UHFFFAOYSA-N 0.000 description 1
- APEQZVNFKSBWDR-UHFFFAOYSA-N 2-[(2,6-dichlorophenyl)methoxy]-1h-pyrido[3,4-d]pyrimidin-4-one Chemical compound ClC1=CC=CC(Cl)=C1COC1=NC(=O)C2=CC=NC=C2N1 APEQZVNFKSBWDR-UHFFFAOYSA-N 0.000 description 1
- NQJQTKGNJKUKPL-UHFFFAOYSA-N 2-[(2-chlorophenyl)methoxy]-1h-pyrido[3,4-d]pyrimidin-4-one Chemical compound ClC1=CC=CC=C1COC1=NC(=O)C2=CC=NC=C2N1 NQJQTKGNJKUKPL-UHFFFAOYSA-N 0.000 description 1
- PSZYUNXKBSUHCD-UHFFFAOYSA-N 2-[(2-chlorophenyl)methoxy]-8-(1-methylimidazol-4-yl)-1h-pyrido[3,4-d]pyrimidin-4-one Chemical compound CN1C=NC(C=2C3=C(C(N=C(OCC=4C(=CC=CC=4)Cl)N3)=O)C=CN=2)=C1 PSZYUNXKBSUHCD-UHFFFAOYSA-N 0.000 description 1
- UGNFOKJLUDOCCB-UHFFFAOYSA-N 2-[(2-fluorophenyl)methoxy]-1h-pyrido[3,4-d]pyrimidin-4-one Chemical compound FC1=CC=CC=C1COC1=NC(=O)C2=CC=NC=C2N1 UGNFOKJLUDOCCB-UHFFFAOYSA-N 0.000 description 1
- QNHPHDCMAACVNW-UHFFFAOYSA-N 2-[(2-phenylphenyl)methoxy]-1h-pyrido[3,4-d]pyrimidin-4-one Chemical compound N1C2=CN=CC=C2C(=O)N=C1OCC1=CC=CC=C1C1=CC=CC=C1 QNHPHDCMAACVNW-UHFFFAOYSA-N 0.000 description 1
- KHZJFQGRWLOAPH-UHFFFAOYSA-N 2-[(3-fluorophenyl)methoxy]-1h-pyrido[3,4-d]pyrimidin-4-one Chemical compound FC1=CC=CC(COC=2NC3=CN=CC=C3C(=O)N=2)=C1 KHZJFQGRWLOAPH-UHFFFAOYSA-N 0.000 description 1
- QTDHXMBWHMETNH-UHFFFAOYSA-N 2-[(3-phenylphenyl)methoxy]-1h-pyrido[3,4-d]pyrimidin-4-one Chemical compound N1C2=CN=CC=C2C(=O)N=C1OCC(C=1)=CC=CC=1C1=CC=CC=C1 QTDHXMBWHMETNH-UHFFFAOYSA-N 0.000 description 1
- XHTWBUITUGQGOM-UHFFFAOYSA-N 2-[(4-chlorophenyl)methoxy]-8-(1-methylimidazol-4-yl)-1h-pyrido[3,4-d]pyrimidin-4-one Chemical compound CN1C=NC(C=2C3=C(C(N=C(OCC=4C=CC(Cl)=CC=4)N3)=O)C=CN=2)=C1 XHTWBUITUGQGOM-UHFFFAOYSA-N 0.000 description 1
- QEMQEETWILVKQH-UHFFFAOYSA-N 2-[1-(1-benzylpiperidin-4-yl)pyrazol-4-yl]oxy-3H-pyrido[3,4-d]pyrimidin-4-one Chemical compound C(C1=CC=CC=C1)N1CCC(CC1)N1N=CC(=C1)OC=1N=C(C2=C(N1)C=NC=C2)O QEMQEETWILVKQH-UHFFFAOYSA-N 0.000 description 1
- GHYRIRPRPLDPMF-UHFFFAOYSA-N 2-[1-(2-morpholin-4-ylethyl)pyrazol-4-yl]oxy-1h-pyrido[3,4-d]pyrimidin-4-one Chemical compound N1C2=CN=CC=C2C(=O)N=C1OC(=C1)C=NN1CCN1CCOCC1 GHYRIRPRPLDPMF-UHFFFAOYSA-N 0.000 description 1
- LGWIARLSMKENNX-LLVKDONJSA-N 2-[1-[(1r)-1-(2-fluorophenyl)ethyl]pyrazol-4-yl]oxy-1h-pyrido[3,4-d]pyrimidin-4-one Chemical compound C1([C@@H](C)N2N=CC(OC=3NC4=CN=CC=C4C(=O)N=3)=C2)=CC=CC=C1F LGWIARLSMKENNX-LLVKDONJSA-N 0.000 description 1
- FZUAZLYMSHQPRI-CQSZACIVSA-N 2-[1-[(3R)-1-(benzenesulfonyl)pyrrolidin-3-yl]pyrazol-4-yl]oxy-3H-pyrido[3,4-d]pyrimidin-4-one Chemical compound C1(=CC=CC=C1)S(=O)(=O)N1C[C@@H](CC1)N1N=CC(=C1)OC=1N=C(C2=C(N1)C=NC=C2)O FZUAZLYMSHQPRI-CQSZACIVSA-N 0.000 description 1
- HZCPYRRYWCYJOU-GFCCVEGCSA-N 2-[1-[(3R)-1-(cyclopropanecarbonyl)pyrrolidin-3-yl]pyrazol-4-yl]oxy-3H-pyrido[3,4-d]pyrimidin-4-one Chemical compound Oc1nc(Oc2cnn(c2)[C@@H]2CCN(C2)C(=O)C2CC2)nc2cnccc12 HZCPYRRYWCYJOU-GFCCVEGCSA-N 0.000 description 1
- QGZGFTUMCSABSB-NSHDSACASA-N 2-[1-[(3S)-1-[2-(methylamino)acetyl]pyrrolidin-3-yl]pyrazol-4-yl]oxy-3H-pyrido[3,4-d]pyrimidin-4-one Chemical compound OC=1C2=C(N=C(N1)OC=1C=NN(C1)[C@@H]1CN(CC1)C(CNC)=O)C=NC=C2 QGZGFTUMCSABSB-NSHDSACASA-N 0.000 description 1
- CMOJRHBRTNDPPS-NSHDSACASA-N 2-[1-[(3S)-1-cyclopropylsulfonylpyrrolidin-3-yl]pyrazol-4-yl]oxy-3H-pyrido[3,4-d]pyrimidin-4-one Chemical compound C1(CC1)S(=O)(=O)N1C[C@H](CC1)N1N=CC(=C1)OC=1N=C(C2=C(N1)C=NC=C2)O CMOJRHBRTNDPPS-NSHDSACASA-N 0.000 description 1
- RJYAIHWCRCJPSH-OAHLLOKOSA-N 2-[1-[(3r)-1-(4-fluorophenyl)pyrrolidin-3-yl]pyrazol-4-yl]oxy-1h-pyrido[3,4-d]pyrimidin-4-one Chemical compound C1=CC(F)=CC=C1N1C[C@H](N2N=CC(OC=3NC4=CN=CC=C4C(=O)N=3)=C2)CC1 RJYAIHWCRCJPSH-OAHLLOKOSA-N 0.000 description 1
- SWJJRCHQZZTLIE-OAHLLOKOSA-N 2-[1-[(3r)-1-(benzenesulfonyl)piperidin-3-yl]pyrazol-4-yl]oxy-1h-pyrido[3,4-d]pyrimidin-4-one Chemical compound C([C@H](C1)N2N=CC(=C2)OC2=NC(C3=CC=NC=C3N2)=O)CCN1S(=O)(=O)C1=CC=CC=C1 SWJJRCHQZZTLIE-OAHLLOKOSA-N 0.000 description 1
- OUAUMRFHYJTUCM-CYBMUJFWSA-N 2-[1-[(3r)-1-(cyclopropanecarbonyl)piperidin-3-yl]pyrazol-4-yl]oxy-1h-pyrido[3,4-d]pyrimidin-4-one Chemical compound C([C@@H](CCC1)N2N=CC(OC=3NC4=CN=CC=C4C(=O)N=3)=C2)N1C(=O)C1CC1 OUAUMRFHYJTUCM-CYBMUJFWSA-N 0.000 description 1
- DPDGFBBJLKJOMH-GFCCVEGCSA-N 2-[1-[(3r)-1-acetylpiperidin-3-yl]pyrazol-4-yl]oxy-1h-pyrido[3,4-d]pyrimidin-4-one Chemical compound C1N(C(=O)C)CCC[C@H]1N1N=CC(OC=2NC3=CN=CC=C3C(=O)N=2)=C1 DPDGFBBJLKJOMH-GFCCVEGCSA-N 0.000 description 1
- IRBJUYNHAMFOES-LLVKDONJSA-N 2-[1-[(3r)-1-acetylpyrrolidin-3-yl]pyrazol-4-yl]oxy-1h-pyrido[3,4-d]pyrimidin-4-one Chemical compound C1N(C(=O)C)CC[C@H]1N1N=CC(OC=2NC3=CN=CC=C3C(=O)N=2)=C1 IRBJUYNHAMFOES-LLVKDONJSA-N 0.000 description 1
- FJDQZYZJGPFTMR-MRXNPFEDSA-N 2-[1-[(3r)-1-benzylpyrrolidin-3-yl]pyrazol-4-yl]oxy-1h-pyrido[3,4-d]pyrimidin-4-one Chemical compound C([C@H](C1)N2N=CC(=C2)OC2=NC(C3=CC=NC=C3N2)=O)CN1CC1=CC=CC=C1 FJDQZYZJGPFTMR-MRXNPFEDSA-N 0.000 description 1
- ZPUNFCAWPPVJCW-GFCCVEGCSA-N 2-[1-[(3r)-1-ethylsulfonylpiperidin-3-yl]pyrazol-4-yl]oxy-1h-pyrido[3,4-d]pyrimidin-4-one Chemical compound C1N(S(=O)(=O)CC)CCC[C@H]1N1N=CC(OC=2NC3=CN=CC=C3C(=O)N=2)=C1 ZPUNFCAWPPVJCW-GFCCVEGCSA-N 0.000 description 1
- YLDNNDOVZCJCTN-LLVKDONJSA-N 2-[1-[(3r)-piperidin-3-yl]pyrazol-4-yl]-1h-pyrido[3,4-d]pyrimidin-4-one Chemical compound N1C2=CN=CC=C2C(=O)N=C1C(=C1)C=NN1[C@@H]1CCCNC1 YLDNNDOVZCJCTN-LLVKDONJSA-N 0.000 description 1
- KOPIPLUACLDAHE-ZDUSSCGKSA-N 2-[1-[(3s)-1-(2-fluorophenyl)pyrrolidin-3-yl]pyrazol-4-yl]oxy-1h-pyrido[3,4-d]pyrimidin-4-one Chemical compound FC1=CC=CC=C1N1C[C@@H](N2N=CC(OC=3NC4=CN=CC=C4C(=O)N=3)=C2)CC1 KOPIPLUACLDAHE-ZDUSSCGKSA-N 0.000 description 1
- XKWSMYRJZWFAGJ-JTQLQIEISA-N 2-[1-[(3s)-1-(2-hydroxyacetyl)pyrrolidin-3-yl]pyrazol-4-yl]oxy-1h-pyrido[3,4-d]pyrimidin-4-one Chemical compound C1N(C(=O)CO)CC[C@@H]1N1N=CC(OC=2NC3=CN=CC=C3C(=O)N=2)=C1 XKWSMYRJZWFAGJ-JTQLQIEISA-N 0.000 description 1
- SWJJRCHQZZTLIE-HNNXBMFYSA-N 2-[1-[(3s)-1-(benzenesulfonyl)piperidin-3-yl]pyrazol-4-yl]oxy-1h-pyrido[3,4-d]pyrimidin-4-one Chemical compound C([C@@H](C1)N2N=CC(=C2)OC2=NC(C3=CC=NC=C3N2)=O)CCN1S(=O)(=O)C1=CC=CC=C1 SWJJRCHQZZTLIE-HNNXBMFYSA-N 0.000 description 1
- HZCPYRRYWCYJOU-LBPRGKRZSA-N 2-[1-[(3s)-1-(cyclopropanecarbonyl)pyrrolidin-3-yl]pyrazol-4-yl]oxy-1h-pyrido[3,4-d]pyrimidin-4-one Chemical compound C([C@H](CC1)N2N=CC(OC=3NC4=CN=CC=C4C(=O)N=3)=C2)N1C(=O)C1CC1 HZCPYRRYWCYJOU-LBPRGKRZSA-N 0.000 description 1
- IRBJUYNHAMFOES-NSHDSACASA-N 2-[1-[(3s)-1-acetylpyrrolidin-3-yl]pyrazol-4-yl]oxy-1h-pyrido[3,4-d]pyrimidin-4-one Chemical compound C1N(C(=O)C)CC[C@@H]1N1N=CC(OC=2NC3=CN=CC=C3C(=O)N=2)=C1 IRBJUYNHAMFOES-NSHDSACASA-N 0.000 description 1
- XPYZBARZMOTZNZ-INIZCTEOSA-N 2-[1-[(3s)-1-benzoylpiperidin-3-yl]pyrazol-4-yl]oxy-1h-pyrido[3,4-d]pyrimidin-4-one Chemical compound C([C@H](CCC1)N2N=CC(OC=3NC4=CN=CC=C4C(=O)N=3)=C2)N1C(=O)C1=CC=CC=C1 XPYZBARZMOTZNZ-INIZCTEOSA-N 0.000 description 1
- JPDTXBUMTOVBCT-HNNXBMFYSA-N 2-[1-[(3s)-1-benzoylpyrrolidin-3-yl]pyrazol-4-yl]oxy-1h-pyrido[3,4-d]pyrimidin-4-one Chemical compound C([C@H](CC1)N2N=CC(OC=3NC4=CN=CC=C4C(=O)N=3)=C2)N1C(=O)C1=CC=CC=C1 JPDTXBUMTOVBCT-HNNXBMFYSA-N 0.000 description 1
- CCZFELUQXWMJLX-KRWDZBQOSA-N 2-[1-[(3s)-1-benzylpiperidin-3-yl]pyrazol-4-yl]oxy-1h-pyrido[3,4-d]pyrimidin-4-one Chemical compound C([C@@H](C1)N2N=CC(=C2)OC2=NC(C3=CC=NC=C3N2)=O)CCN1CC1=CC=CC=C1 CCZFELUQXWMJLX-KRWDZBQOSA-N 0.000 description 1
- DQKJPEFRHKBNRV-NSHDSACASA-N 2-[1-[(3s)-1-ethylsulfonylpyrrolidin-3-yl]pyrazol-4-yl]oxy-1h-pyrido[3,4-d]pyrimidin-4-one Chemical compound C1N(S(=O)(=O)CC)CC[C@@H]1N1N=CC(OC=2NC3=CN=CC=C3C(=O)N=2)=C1 DQKJPEFRHKBNRV-NSHDSACASA-N 0.000 description 1
- NQWZGUNCMMMRDP-UHFFFAOYSA-N 2-[2-(3,4-dichlorophenyl)ethoxy]-1h-pyrido[3,4-d]pyrimidin-4-one Chemical compound C1=C(Cl)C(Cl)=CC=C1CCOC1=NC(=O)C2=CC=NC=C2N1 NQWZGUNCMMMRDP-UHFFFAOYSA-N 0.000 description 1
- BIKLWCSEASZCNR-UHFFFAOYSA-N 2-[2-(4-chlorophenyl)ethoxy]-1h-pyrido[3,4-d]pyrimidin-4-one Chemical compound C1=CC(Cl)=CC=C1CCOC1=NC(=O)C2=CC=NC=C2N1 BIKLWCSEASZCNR-UHFFFAOYSA-N 0.000 description 1
- QCOXMCCIBPMNGW-UHFFFAOYSA-N 2-[3-(dimethylamino)phenoxy]-3H-pyrido[3,4-d]pyrimidin-4-one Chemical compound CN(C=1C=C(OC=2N=C(C3=C(N=2)C=NC=C3)O)C=CC=1)C QCOXMCCIBPMNGW-UHFFFAOYSA-N 0.000 description 1
- UFNDTGJAKWDKQB-VIFPVBQESA-N 2-[5-[(3S)-1-(2-chloroacetyl)pyrrolidin-3-yl]-1H-pyrazol-4-yl]-3H-pyrido[3,4-d]pyrimidin-4-one Chemical compound OC=1C2=C(N=C(N1)C=1C(=NNC1)[C@@H]1CN(CC1)C(CCl)=O)C=NC=C2 UFNDTGJAKWDKQB-VIFPVBQESA-N 0.000 description 1
- AVVXNBGLWSIXIE-UHFFFAOYSA-N 2-[[2-(trifluoromethyl)phenyl]methoxy]-1h-pyrido[3,4-d]pyrimidin-4-one Chemical compound FC(F)(F)C1=CC=CC=C1COC1=NC(=O)C2=CC=NC=C2N1 AVVXNBGLWSIXIE-UHFFFAOYSA-N 0.000 description 1
- MJDSIJLETQJIAN-UHFFFAOYSA-N 2-[[4-(trifluoromethyl)phenyl]methoxy]-1h-pyrido[3,4-d]pyrimidin-4-one Chemical compound C1=CC(C(F)(F)F)=CC=C1COC1=NC(=O)C2=CC=NC=C2N1 MJDSIJLETQJIAN-UHFFFAOYSA-N 0.000 description 1
- MSWZFWKMSRAUBD-IVMDWMLBSA-N 2-amino-2-deoxy-D-glucopyranose Chemical compound N[C@H]1C(O)O[C@H](CO)[C@@H](O)[C@@H]1O MSWZFWKMSRAUBD-IVMDWMLBSA-N 0.000 description 1
- IKCLCGXPQILATA-UHFFFAOYSA-N 2-chlorobenzoic acid Chemical class OC(=O)C1=CC=CC=C1Cl IKCLCGXPQILATA-UHFFFAOYSA-N 0.000 description 1
- LUNMJRJMSXZSLC-UHFFFAOYSA-N 2-cyclopropylethanol Chemical compound OCCC1CC1 LUNMJRJMSXZSLC-UHFFFAOYSA-N 0.000 description 1
- BFSVOASYOCHEOV-UHFFFAOYSA-N 2-diethylaminoethanol Chemical compound CCN(CC)CCO BFSVOASYOCHEOV-UHFFFAOYSA-N 0.000 description 1
- 229940013085 2-diethylaminoethanol Drugs 0.000 description 1
- HFHFGHLXUCOHLN-UHFFFAOYSA-N 2-fluorophenol Chemical compound OC1=CC=CC=C1F HFHFGHLXUCOHLN-UHFFFAOYSA-N 0.000 description 1
- 125000006088 2-oxoazepinyl group Chemical group 0.000 description 1
- 125000004638 2-oxopiperazinyl group Chemical group O=C1N(CCNC1)* 0.000 description 1
- 125000004637 2-oxopiperidinyl group Chemical group O=C1N(CCCC1)* 0.000 description 1
- QCDWFXQBSFUVSP-UHFFFAOYSA-N 2-phenoxyethanol Chemical compound OCCOC1=CC=CC=C1 QCDWFXQBSFUVSP-UHFFFAOYSA-N 0.000 description 1
- CUZKCNWZBXLAJX-UHFFFAOYSA-N 2-phenylmethoxyethanol Chemical compound OCCOCC1=CC=CC=C1 CUZKCNWZBXLAJX-UHFFFAOYSA-N 0.000 description 1
- YNCYQAWGWIKYAI-UHFFFAOYSA-N 2-propan-2-yloxy-1h-pyrido[3,4-d]pyrimidin-4-one Chemical compound C1=NC=C2NC(OC(C)C)=NC(=O)C2=C1 YNCYQAWGWIKYAI-UHFFFAOYSA-N 0.000 description 1
- HCGFUIQPSOCUHI-UHFFFAOYSA-N 2-propan-2-yloxyethanol Chemical compound CC(C)OCCO HCGFUIQPSOCUHI-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000004485 2-pyrrolidinyl group Chemical group [H]N1C([H])([H])C([H])([H])C([H])([H])C1([H])* 0.000 description 1
- MGSHXMOLUWTMGP-UHFFFAOYSA-N 3'-carboxy-alpha-chromanol Chemical compound C1=CC=C2C(O)CCOC2=C1 MGSHXMOLUWTMGP-UHFFFAOYSA-N 0.000 description 1
- HDBGBTNNPRCVND-UHFFFAOYSA-N 3,3,3-trifluoropropan-1-ol Chemical compound OCCC(F)(F)F HDBGBTNNPRCVND-UHFFFAOYSA-N 0.000 description 1
- JCIBYIVDOVFNJS-UHFFFAOYSA-N 3,4-dihydro-2h-chromen-4-ylmethanol Chemical compound C1=CC=C2C(CO)CCOC2=C1 JCIBYIVDOVFNJS-UHFFFAOYSA-N 0.000 description 1
- WPNHIYWMMCVBGE-UHFFFAOYSA-N 3,5-difluoro-4-methoxyphenol Chemical compound COC1=C(F)C=C(O)C=C1F WPNHIYWMMCVBGE-UHFFFAOYSA-N 0.000 description 1
- BYHQTRFJOGIQAO-GOSISDBHSA-N 3-(4-bromophenyl)-8-[(2R)-2-hydroxypropyl]-1-[(3-methoxyphenyl)methyl]-1,3,8-triazaspiro[4.5]decan-2-one Chemical compound C[C@H](CN1CCC2(CC1)CN(C(=O)N2CC3=CC(=CC=C3)OC)C4=CC=C(C=C4)Br)O BYHQTRFJOGIQAO-GOSISDBHSA-N 0.000 description 1
- MESJRHHDBDCQTH-UHFFFAOYSA-N 3-(dimethylamino)phenol Chemical compound CN(C)C1=CC=CC(O)=C1 MESJRHHDBDCQTH-UHFFFAOYSA-N 0.000 description 1
- PYSGFFTXMUWEOT-UHFFFAOYSA-N 3-(dimethylamino)propan-1-ol Chemical compound CN(C)CCCO PYSGFFTXMUWEOT-UHFFFAOYSA-N 0.000 description 1
- UGEJOEBBMPOJMT-UHFFFAOYSA-N 3-(trifluoromethyl)phenol Chemical compound OC1=CC=CC(C(F)(F)F)=C1 UGEJOEBBMPOJMT-UHFFFAOYSA-N 0.000 description 1
- SRVXSISGYBMIHR-UHFFFAOYSA-N 3-[3-[3-(2-amino-2-oxoethyl)phenyl]-5-chlorophenyl]-3-(5-methyl-1,3-thiazol-2-yl)propanoic acid Chemical compound S1C(C)=CN=C1C(CC(O)=O)C1=CC(Cl)=CC(C=2C=C(CC(N)=O)C=CC=2)=C1 SRVXSISGYBMIHR-UHFFFAOYSA-N 0.000 description 1
- QWUCBIZSYQTOAO-UHFFFAOYSA-N 3-amino-2-chloropyridine-4-carboxamide Chemical compound NC(=O)C1=CC=NC(Cl)=C1N QWUCBIZSYQTOAO-UHFFFAOYSA-N 0.000 description 1
- MRZUGOPPUMNHGA-UHFFFAOYSA-N 3-aminopyridine-4-carboxamide Chemical compound NC(=O)C1=CC=NC=C1N MRZUGOPPUMNHGA-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- HORNXRXVQWOLPJ-UHFFFAOYSA-N 3-chlorophenol Chemical compound OC1=CC=CC(Cl)=C1 HORNXRXVQWOLPJ-UHFFFAOYSA-N 0.000 description 1
- ORECFXMTZQZHSP-UHFFFAOYSA-N 3-fluoro-4-methoxyphenol Chemical compound COC1=CC=C(O)C=C1F ORECFXMTZQZHSP-UHFFFAOYSA-N 0.000 description 1
- PYZWGHVZOQTMCW-UHFFFAOYSA-N 3-fluoro-5-hydroxybenzoic acid Chemical compound OC(=O)C1=CC(O)=CC(F)=C1 PYZWGHVZOQTMCW-UHFFFAOYSA-N 0.000 description 1
- QDHRSLFSDGCJFX-UHFFFAOYSA-N 3-fluorobenzyl alcohol Chemical compound OCC1=CC=CC(F)=C1 QDHRSLFSDGCJFX-UHFFFAOYSA-N 0.000 description 1
- SJTBRFHBXDZMPS-UHFFFAOYSA-N 3-fluorophenol Chemical compound OC1=CC=CC(F)=C1 SJTBRFHBXDZMPS-UHFFFAOYSA-N 0.000 description 1
- RBBAICIVZRBGGI-GFCCVEGCSA-N 3-oxo-3-[(3r)-3-[4-[(4-oxo-1h-pyrido[3,4-d]pyrimidin-2-yl)oxy]pyrazol-1-yl]piperidin-1-yl]propanenitrile Chemical compound C1N(C(CC#N)=O)CCC[C@H]1N1N=CC(OC=2NC3=CN=CC=C3C(=O)N=2)=C1 RBBAICIVZRBGGI-GFCCVEGCSA-N 0.000 description 1
- SDAUZGJTDLHRGU-LLVKDONJSA-N 3-oxo-3-[(3r)-3-[4-[(4-oxo-1h-pyrido[3,4-d]pyrimidin-2-yl)oxy]pyrazol-1-yl]pyrrolidin-1-yl]propanenitrile Chemical compound C1N(C(CC#N)=O)CC[C@H]1N1N=CC(OC=2NC3=CN=CC=C3C(=O)N=2)=C1 SDAUZGJTDLHRGU-LLVKDONJSA-N 0.000 description 1
- RBBAICIVZRBGGI-LBPRGKRZSA-N 3-oxo-3-[(3s)-3-[4-[(4-oxo-1h-pyrido[3,4-d]pyrimidin-2-yl)oxy]pyrazol-1-yl]piperidin-1-yl]propanenitrile Chemical compound C1N(C(CC#N)=O)CCC[C@@H]1N1N=CC(OC=2NC3=CN=CC=C3C(=O)N=2)=C1 RBBAICIVZRBGGI-LBPRGKRZSA-N 0.000 description 1
- SDAUZGJTDLHRGU-NSHDSACASA-N 3-oxo-3-[(3s)-3-[4-[(4-oxo-1h-pyrido[3,4-d]pyrimidin-2-yl)oxy]pyrazol-1-yl]pyrrolidin-1-yl]propanenitrile Chemical compound C1N(C(CC#N)=O)CC[C@@H]1N1N=CC(OC=2NC3=CN=CC=C3C(=O)N=2)=C1 SDAUZGJTDLHRGU-NSHDSACASA-N 0.000 description 1
- VLJSLTNSFSOYQR-UHFFFAOYSA-N 3-propan-2-ylphenol Chemical compound CC(C)C1=CC=CC(O)=C1 VLJSLTNSFSOYQR-UHFFFAOYSA-N 0.000 description 1
- NIGIGWPNXVNZRK-UHFFFAOYSA-N 4-(2-methoxyethoxy)phenol Chemical compound COCCOC1=CC=C(O)C=C1 NIGIGWPNXVNZRK-UHFFFAOYSA-N 0.000 description 1
- MHCRLDZZHOVFEE-UHFFFAOYSA-N 4-(4-aminophenyl)morpholin-3-one Chemical compound C1=CC(N)=CC=C1N1C(=O)COCC1 MHCRLDZZHOVFEE-UHFFFAOYSA-N 0.000 description 1
- VYYVHHWQRAEFOL-UHFFFAOYSA-N 4-[(4-aminophenoxy)methyl]aniline Chemical compound C1=CC(N)=CC=C1COC1=CC=C(N)C=C1 VYYVHHWQRAEFOL-UHFFFAOYSA-N 0.000 description 1
- KVCQTKNUUQOELD-UHFFFAOYSA-N 4-amino-n-[1-(3-chloro-2-fluoroanilino)-6-methylisoquinolin-5-yl]thieno[3,2-d]pyrimidine-7-carboxamide Chemical compound N=1C=CC2=C(NC(=O)C=3C4=NC=NC(N)=C4SC=3)C(C)=CC=C2C=1NC1=CC=CC(Cl)=C1F KVCQTKNUUQOELD-UHFFFAOYSA-N 0.000 description 1
- WXNZTHHGJRFXKQ-UHFFFAOYSA-N 4-chlorophenol Chemical compound OC1=CC=C(Cl)C=C1 WXNZTHHGJRFXKQ-UHFFFAOYSA-N 0.000 description 1
- JVVRCYWZTJLJSG-UHFFFAOYSA-N 4-dimethylaminophenol Chemical compound CN(C)C1=CC=C(O)C=C1 JVVRCYWZTJLJSG-UHFFFAOYSA-N 0.000 description 1
- MRARGBDWPXWTCL-UHFFFAOYSA-N 4-ethoxy-3,5-difluorophenol Chemical compound CCOC1=C(F)C=C(O)C=C1F MRARGBDWPXWTCL-UHFFFAOYSA-N 0.000 description 1
- CZKLEJHVLCMVQR-UHFFFAOYSA-N 4-fluorobenzoyl chloride Chemical compound FC1=CC=C(C(Cl)=O)C=C1 CZKLEJHVLCMVQR-UHFFFAOYSA-N 0.000 description 1
- RHMPLDJJXGPMEX-UHFFFAOYSA-N 4-fluorophenol Chemical compound OC1=CC=C(F)C=C1 RHMPLDJJXGPMEX-UHFFFAOYSA-N 0.000 description 1
- 125000005986 4-piperidonyl group Chemical group 0.000 description 1
- 125000004487 4-tetrahydropyranyl group Chemical group [H]C1([H])OC([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- IRPVABHDSJVBNZ-RTHVDDQRSA-N 5-[1-(cyclopropylmethyl)-5-[(1R,5S)-3-(oxetan-3-yl)-3-azabicyclo[3.1.0]hexan-6-yl]pyrazol-3-yl]-3-(trifluoromethyl)pyridin-2-amine Chemical compound C1=C(C(F)(F)F)C(N)=NC=C1C1=NN(CC2CC2)C(C2[C@@H]3CN(C[C@@H]32)C2COC2)=C1 IRPVABHDSJVBNZ-RTHVDDQRSA-N 0.000 description 1
- KCBWAFJCKVKYHO-UHFFFAOYSA-N 6-(4-cyclopropyl-6-methoxypyrimidin-5-yl)-1-[[4-[1-propan-2-yl-4-(trifluoromethyl)imidazol-2-yl]phenyl]methyl]pyrazolo[3,4-d]pyrimidine Chemical compound C1(CC1)C1=NC=NC(=C1C1=NC=C2C(=N1)N(N=C2)CC1=CC=C(C=C1)C=1N(C=C(N=1)C(F)(F)F)C(C)C)OC KCBWAFJCKVKYHO-UHFFFAOYSA-N 0.000 description 1
- PXCULZJOQBMGJK-UHFFFAOYSA-N 8-(1-methylimidazol-4-yl)-2-(1,1,1-trifluorobutan-2-yloxy)-1h-pyrido[3,4-d]pyrimidin-4-one Chemical compound C=12NC(OC(CC)C(F)(F)F)=NC(=O)C2=CC=NC=1C1=CN(C)C=N1 PXCULZJOQBMGJK-UHFFFAOYSA-N 0.000 description 1
- RPMKELKOMDYVET-UHFFFAOYSA-N 8-(1-methylimidazol-4-yl)-2-(oxan-4-ylmethoxy)-1h-pyrido[3,4-d]pyrimidin-4-one Chemical compound CN1C=NC(C=2C3=C(C(N=C(OCC4CCOCC4)N3)=O)C=CN=2)=C1 RPMKELKOMDYVET-UHFFFAOYSA-N 0.000 description 1
- MPIWHRUYFIEGEM-UHFFFAOYSA-N 8-(1-methylimidazol-4-yl)-2-(oxolan-3-ylmethoxy)-1h-pyrido[3,4-d]pyrimidin-4-one Chemical compound CN1C=NC(C=2C3=C(C(N=C(OCC4COCC4)N3)=O)C=CN=2)=C1 MPIWHRUYFIEGEM-UHFFFAOYSA-N 0.000 description 1
- QIDZEXKYITYEGK-MRXNPFEDSA-N 8-(1-methylimidazol-4-yl)-2-[(1R)-2,2,2-trifluoro-1-phenylethoxy]-3H-pyrido[3,4-d]pyrimidin-4-one Chemical compound Cn1cnc(c1)-c1nccc2c(O)nc(O[C@H](c3ccccc3)C(F)(F)F)nc12 QIDZEXKYITYEGK-MRXNPFEDSA-N 0.000 description 1
- BLDWCYGKGVVGNB-UHFFFAOYSA-N 8-(1-methylimidazol-4-yl)-2-[[2-(trifluoromethyl)phenyl]methoxy]-1h-pyrido[3,4-d]pyrimidin-4-one Chemical compound CN1C=NC(C=2C3=C(C(N=C(OCC=4C(=CC=CC=4)C(F)(F)F)N3)=O)C=CN=2)=C1 BLDWCYGKGVVGNB-UHFFFAOYSA-N 0.000 description 1
- XYWVHUCPWKPMBZ-UHFFFAOYSA-N 8-(1-methylimidazol-4-yl)-2-[[4-(trifluoromethyl)phenyl]methoxy]-1h-pyrido[3,4-d]pyrimidin-4-one Chemical compound CN1C=NC(C=2C3=C(C(N=C(OCC=4C=CC(=CC=4)C(F)(F)F)N3)=O)C=CN=2)=C1 XYWVHUCPWKPMBZ-UHFFFAOYSA-N 0.000 description 1
- RBBCKXJDAOJFAT-UHFFFAOYSA-N 8-(1-methylimidazol-4-yl)-2-phenylmethoxy-1h-pyrido[3,4-d]pyrimidin-4-one Chemical compound CN1C=NC(C=2C3=C(C(N=C(OCC=4C=CC=CC=4)N3)=O)C=CN=2)=C1 RBBCKXJDAOJFAT-UHFFFAOYSA-N 0.000 description 1
- CYJRNFFLTBEQSQ-UHFFFAOYSA-N 8-(3-methyl-1-benzothiophen-5-yl)-N-(4-methylsulfonylpyridin-3-yl)quinoxalin-6-amine Chemical compound CS(=O)(=O)C1=C(C=NC=C1)NC=1C=C2N=CC=NC2=C(C=1)C=1C=CC2=C(C(=CS2)C)C=1 CYJRNFFLTBEQSQ-UHFFFAOYSA-N 0.000 description 1
- XCVYDMTVYTYQMI-UHFFFAOYSA-N 8-[(2-hydroxy-1H-indol-3-yl)diazenyl]-3-methyl-7-prop-2-enylpurine-2,6-dione Chemical compound CN1C2=C(C(=O)NC1=O)N(C(=N2)N=NC3=C(NC4=CC=CC=C43)O)CC=C XCVYDMTVYTYQMI-UHFFFAOYSA-N 0.000 description 1
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 1
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- HGINCPLSRVDWNT-UHFFFAOYSA-N Acrolein Chemical compound C=CC=O HGINCPLSRVDWNT-UHFFFAOYSA-N 0.000 description 1
- 201000004384 Alopecia Diseases 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- USFZMSVCRYTOJT-UHFFFAOYSA-N Ammonium acetate Chemical compound N.CC(O)=O USFZMSVCRYTOJT-UHFFFAOYSA-N 0.000 description 1
- 239000004475 Arginine Substances 0.000 description 1
- IYHHRZBKXXKDDY-UHFFFAOYSA-N BI-605906 Chemical compound N=1C=2SC(C(N)=O)=C(N)C=2C(C(F)(F)CC)=CC=1N1CCC(S(C)(=O)=O)CC1 IYHHRZBKXXKDDY-UHFFFAOYSA-N 0.000 description 1
- 108700020463 BRCA1 Proteins 0.000 description 1
- 102000036365 BRCA1 Human genes 0.000 description 1
- 101150072950 BRCA1 gene Proteins 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- YHQMAXXNJFMNKF-LLVKDONJSA-N CC(C)(C)OC(=O)N1CC[C@H](C1)c1n[nH]cc1Oc1nc(O)c2ccncc2n1 Chemical compound CC(C)(C)OC(=O)N1CC[C@H](C1)c1n[nH]cc1Oc1nc(O)c2ccncc2n1 YHQMAXXNJFMNKF-LLVKDONJSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- 102000014914 Carrier Proteins Human genes 0.000 description 1
- 102100035888 Caveolin-1 Human genes 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- VGCXGMAHQTYDJK-UHFFFAOYSA-N Chloroacetyl chloride Chemical compound ClCC(Cl)=O VGCXGMAHQTYDJK-UHFFFAOYSA-N 0.000 description 1
- WBYWAXJHAXSJNI-SREVYHEPSA-N Cinnamic acid Chemical compound OC(=O)\C=C/C1=CC=CC=C1 WBYWAXJHAXSJNI-SREVYHEPSA-N 0.000 description 1
- 229940126062 Compound A Drugs 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- OCUCCJIRFHNWBP-IYEMJOQQSA-L Copper gluconate Chemical class [Cu+2].OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C([O-])=O.OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C([O-])=O OCUCCJIRFHNWBP-IYEMJOQQSA-L 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- XBPCUCUWBYBCDP-UHFFFAOYSA-N Dicyclohexylamine Chemical compound C1CCCCC1NC1CCCCC1 XBPCUCUWBYBCDP-UHFFFAOYSA-N 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- GISRWBROCYNDME-PELMWDNLSA-N F[C@H]1[C@H]([C@H](NC1=O)COC1=NC=CC2=CC(=C(C=C12)OC)C(=O)N)C Chemical compound F[C@H]1[C@H]([C@H](NC1=O)COC1=NC=CC2=CC(=C(C=C12)OC)C(=O)N)C GISRWBROCYNDME-PELMWDNLSA-N 0.000 description 1
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 108700028146 Genetic Enhancer Elements Proteins 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 102100031181 Glyceraldehyde-3-phosphate dehydrogenase Human genes 0.000 description 1
- NLDMNSXOCDLTTB-UHFFFAOYSA-N Heterophylliin A Natural products O1C2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C(OC(=O)C=2C=C(O)C(O)=C(O)C=2)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1 NLDMNSXOCDLTTB-UHFFFAOYSA-N 0.000 description 1
- 102100039869 Histone H2B type F-S Human genes 0.000 description 1
- 102000011787 Histone Methyltransferases Human genes 0.000 description 1
- 108010036115 Histone Methyltransferases Proteins 0.000 description 1
- 102100035864 Histone lysine demethylase PHF8 Human genes 0.000 description 1
- 101000723509 Homo sapiens 14-3-3 protein sigma Proteins 0.000 description 1
- 101000715467 Homo sapiens Caveolin-1 Proteins 0.000 description 1
- 101001035372 Homo sapiens Histone H2B type F-S Proteins 0.000 description 1
- 101001000378 Homo sapiens Histone lysine demethylase PHF8 Proteins 0.000 description 1
- 101000613958 Homo sapiens Lysine-specific demethylase 2A Proteins 0.000 description 1
- 101000613629 Homo sapiens Lysine-specific demethylase 4B Proteins 0.000 description 1
- 101001088895 Homo sapiens Lysine-specific demethylase 4D Proteins 0.000 description 1
- 101001088900 Homo sapiens Lysine-specific demethylase 4E Proteins 0.000 description 1
- 101000692954 Homo sapiens Lysine-specific demethylase PHF2 Proteins 0.000 description 1
- 101001012157 Homo sapiens Receptor tyrosine-protein kinase erbB-2 Proteins 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- LPHGQDQBBGAPDZ-UHFFFAOYSA-N Isocaffeine Natural products CN1C(=O)N(C)C(=O)C2=C1N(C)C=N2 LPHGQDQBBGAPDZ-UHFFFAOYSA-N 0.000 description 1
- 101150086476 KDM5B gene Proteins 0.000 description 1
- ODKSFYDXXFIFQN-BYPYZUCNSA-P L-argininium(2+) Chemical compound NC(=[NH2+])NCCC[C@H]([NH3+])C(O)=O ODKSFYDXXFIFQN-BYPYZUCNSA-P 0.000 description 1
- CKLJMWTZIZZHCS-REOHCLBHSA-N L-aspartic acid Chemical compound OC(=O)[C@@H](N)CC(O)=O CKLJMWTZIZZHCS-REOHCLBHSA-N 0.000 description 1
- WHUUTDBJXJRKMK-VKHMYHEASA-N L-glutamic acid Chemical compound OC(=O)[C@@H](N)CCC(O)=O WHUUTDBJXJRKMK-VKHMYHEASA-N 0.000 description 1
- HNDVDQJCIGZPNO-YFKPBYRVSA-N L-histidine Chemical compound OC(=O)[C@@H](N)CC1=CN=CN1 HNDVDQJCIGZPNO-YFKPBYRVSA-N 0.000 description 1
- FFEARJCKVFRZRR-BYPYZUCNSA-N L-methionine Chemical compound CSCC[C@H](N)C(O)=O FFEARJCKVFRZRR-BYPYZUCNSA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 102100040598 Lysine-specific demethylase 2A Human genes 0.000 description 1
- 102100040860 Lysine-specific demethylase 4B Human genes 0.000 description 1
- 102100033231 Lysine-specific demethylase 4D Human genes 0.000 description 1
- 102100033232 Lysine-specific demethylase 4E Human genes 0.000 description 1
- 102100026395 Lysine-specific demethylase PHF2 Human genes 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 1
- 206010073150 Multiple endocrine neoplasia Type 1 Diseases 0.000 description 1
- AYCPARAPKDAOEN-LJQANCHMSA-N N-[(1S)-2-(dimethylamino)-1-phenylethyl]-6,6-dimethyl-3-[(2-methyl-4-thieno[3,2-d]pyrimidinyl)amino]-1,4-dihydropyrrolo[3,4-c]pyrazole-5-carboxamide Chemical compound C1([C@H](NC(=O)N2C(C=3NN=C(NC=4C=5SC=CC=5N=C(C)N=4)C=3C2)(C)C)CN(C)C)=CC=CC=C1 AYCPARAPKDAOEN-LJQANCHMSA-N 0.000 description 1
- MBBZMMPHUWSWHV-BDVNFPICSA-N N-methylglucamine Chemical compound CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO MBBZMMPHUWSWHV-BDVNFPICSA-N 0.000 description 1
- 150000001204 N-oxides Chemical class 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- JCXJVPUVTGWSNB-UHFFFAOYSA-N Nitrogen dioxide Chemical compound O=[N]=O JCXJVPUVTGWSNB-UHFFFAOYSA-N 0.000 description 1
- 108020005497 Nuclear hormone receptor Proteins 0.000 description 1
- 102000007399 Nuclear hormone receptor Human genes 0.000 description 1
- 108010047956 Nucleosomes Proteins 0.000 description 1
- YHQMAXXNJFMNKF-NSHDSACASA-N OC=1C2=C(N=C(N1)OC=1C(=NNC1)[C@@H]1CN(CC1)C(=O)OC(C)(C)C)C=NC=C2 Chemical compound OC=1C2=C(N=C(N1)OC=1C(=NNC1)[C@@H]1CN(CC1)C(=O)OC(C)(C)C)C=NC=C2 YHQMAXXNJFMNKF-NSHDSACASA-N 0.000 description 1
- 102100027069 Odontogenic ameloblast-associated protein Human genes 0.000 description 1
- 101710091533 Odontogenic ameloblast-associated protein Proteins 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 108010011536 PTEN Phosphohydrolase Proteins 0.000 description 1
- 102000014160 PTEN Phosphohydrolase Human genes 0.000 description 1
- 235000008673 Persea americana Nutrition 0.000 description 1
- 240000002426 Persea americana var. drymifolia Species 0.000 description 1
- DYUQAZSOFZSPHD-UHFFFAOYSA-N Phenylpropanol Chemical compound CCC(O)C1=CC=CC=C1 DYUQAZSOFZSPHD-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- IWYDHOAUDWTVEP-UHFFFAOYSA-N R-2-phenyl-2-hydroxyacetic acid Natural products OC(=O)C(O)C1=CC=CC=C1 IWYDHOAUDWTVEP-UHFFFAOYSA-N 0.000 description 1
- 102100030086 Receptor tyrosine-protein kinase erbB-2 Human genes 0.000 description 1
- 201000000582 Retinoblastoma Diseases 0.000 description 1
- 108700025701 Retinoblastoma Genes Proteins 0.000 description 1
- AUNGANRZJHBGPY-SCRDCRAPSA-N Riboflavin Chemical compound OC[C@@H](O)[C@@H](O)[C@@H](O)CN1C=2C=C(C)C(C)=CC=2N=C2C1=NC(=O)NC2=O AUNGANRZJHBGPY-SCRDCRAPSA-N 0.000 description 1
- WINXNKPZLFISPD-UHFFFAOYSA-M Saccharin sodium Chemical compound [Na+].C1=CC=C2C(=O)[N-]S(=O)(=O)C2=C1 WINXNKPZLFISPD-UHFFFAOYSA-M 0.000 description 1
- 206010041067 Small cell lung cancer Diseases 0.000 description 1
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 208000005718 Stomach Neoplasms Diseases 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical class OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 108700025716 Tumor Suppressor Genes Proteins 0.000 description 1
- 102000044209 Tumor Suppressor Genes Human genes 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- LXRZVMYMQHNYJB-UNXOBOICSA-N [(1R,2S,4R)-4-[[5-[4-[(1R)-7-chloro-1,2,3,4-tetrahydroisoquinolin-1-yl]-5-methylthiophene-2-carbonyl]pyrimidin-4-yl]amino]-2-hydroxycyclopentyl]methyl sulfamate Chemical compound CC1=C(C=C(S1)C(=O)C1=C(N[C@H]2C[C@H](O)[C@@H](COS(N)(=O)=O)C2)N=CN=C1)[C@@H]1NCCC2=C1C=C(Cl)C=C2 LXRZVMYMQHNYJB-UNXOBOICSA-N 0.000 description 1
- TWQNSHZTQSLJEE-UHFFFAOYSA-N [2-(trifluoromethyl)phenyl]methanol Chemical compound OCC1=CC=CC=C1C(F)(F)F TWQNSHZTQSLJEE-UHFFFAOYSA-N 0.000 description 1
- LTIZJXARMKGZLT-NSHDSACASA-N [2-oxo-2-[(3S)-3-[4-[(4-oxo-3H-pyrido[3,4-d]pyrimidin-2-yl)oxy]-1H-pyrazol-5-yl]pyrrolidin-1-yl]ethyl] acetate Chemical compound C(C)(=O)OCC(=O)N1C[C@H](CC1)C1=NNC=C1OC=1N=C(C2=C(N1)C=NC=C2)O LTIZJXARMKGZLT-NSHDSACASA-N 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 230000021736 acetylation Effects 0.000 description 1
- 238000006640 acetylation reaction Methods 0.000 description 1
- 125000000641 acridinyl group Chemical group C1(=CC=CC2=NC3=CC=CC=C3C=C12)* 0.000 description 1
- HFBMWMNUJJDEQZ-UHFFFAOYSA-N acryloyl chloride Chemical compound ClC(=O)C=C HFBMWMNUJJDEQZ-UHFFFAOYSA-N 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 125000005073 adamantyl group Chemical group C12(CC3CC(CC(C1)C3)C2)* 0.000 description 1
- 230000011759 adipose tissue development Effects 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 230000001093 anti-cancer Effects 0.000 description 1
- 230000006907 apoptotic process Effects 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 description 1
- 229960003121 arginine Drugs 0.000 description 1
- 150000001484 arginines Chemical class 0.000 description 1
- 159000000032 aromatic acids Chemical class 0.000 description 1
- 229940009098 aspartate Drugs 0.000 description 1
- 125000002785 azepinyl group Chemical group 0.000 description 1
- 150000007514 bases Chemical class 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical class OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- CSKNSYBAZOQPLR-UHFFFAOYSA-N benzenesulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=CC=C1 CSKNSYBAZOQPLR-UHFFFAOYSA-N 0.000 description 1
- 125000005870 benzindolyl group Chemical group 0.000 description 1
- 125000005873 benzo[d]thiazolyl group Chemical group 0.000 description 1
- 125000000928 benzodioxinyl group Chemical group O1C(=COC2=C1C=CC=C2)* 0.000 description 1
- 125000002047 benzodioxolyl group Chemical group O1OC(C2=C1C=CC=C2)* 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 125000005878 benzonaphthofuranyl group Chemical group 0.000 description 1
- 125000005872 benzooxazolyl group Chemical group 0.000 description 1
- 125000004619 benzopyranyl group Chemical group O1C(C=CC2=C1C=CC=C2)* 0.000 description 1
- 125000005874 benzothiadiazolyl group Chemical group 0.000 description 1
- 125000003354 benzotriazolyl group Chemical group N1N=NC2=C1C=CC=C2* 0.000 description 1
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 1
- MSWZFWKMSRAUBD-UHFFFAOYSA-N beta-D-galactosamine Natural products NC1C(O)OC(CO)C(O)C1O MSWZFWKMSRAUBD-UHFFFAOYSA-N 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- 229960003237 betaine Drugs 0.000 description 1
- BVCRERJDOOBZOH-UHFFFAOYSA-N bicyclo[2.2.1]heptanyl Chemical group C1C[C+]2CC[C-]1C2 BVCRERJDOOBZOH-UHFFFAOYSA-N 0.000 description 1
- 108091008324 binding proteins Proteins 0.000 description 1
- 238000010256 biochemical assay Methods 0.000 description 1
- 238000012925 biological evaluation Methods 0.000 description 1
- 230000031018 biological processes and functions Effects 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-M bisulphate group Chemical group S([O-])(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- ILAJWURWJKXJPW-UHFFFAOYSA-N butanedioic acid;octanedioic acid Chemical class OC(=O)CCC(O)=O.OC(=O)CCCCCCC(O)=O ILAJWURWJKXJPW-UHFFFAOYSA-N 0.000 description 1
- 125000000480 butynyl group Chemical group [*]C#CC([H])([H])C([H])([H])[H] 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 229960001948 caffeine Drugs 0.000 description 1
- VJEONQKOZGKCAK-UHFFFAOYSA-N caffeine Natural products CN1C(=O)N(C)C(=O)C2=C1C=CN2C VJEONQKOZGKCAK-UHFFFAOYSA-N 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 125000000609 carbazolyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3NC12)* 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 230000024245 cell differentiation Effects 0.000 description 1
- 230000003915 cell function Effects 0.000 description 1
- 230000033077 cellular process Effects 0.000 description 1
- 230000005754 cellular signaling Effects 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 235000010980 cellulose Nutrition 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- PBAYDYUZOSNJGU-UHFFFAOYSA-N chelidonic acid Natural products OC(=O)C1=CC(=O)C=C(C(O)=O)O1 PBAYDYUZOSNJGU-UHFFFAOYSA-N 0.000 description 1
- 238000005660 chlorination reaction Methods 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- VDANGULDQQJODZ-UHFFFAOYSA-N chloroprocaine Chemical compound CCN(CC)CCOC(=O)C1=CC=C(N)C=C1Cl VDANGULDQQJODZ-UHFFFAOYSA-N 0.000 description 1
- 229960002023 chloroprocaine Drugs 0.000 description 1
- OEYIOHPDSNJKLS-UHFFFAOYSA-N choline Chemical compound C[N+](C)(C)CCO OEYIOHPDSNJKLS-UHFFFAOYSA-N 0.000 description 1
- 229960001231 choline Drugs 0.000 description 1
- 210000000349 chromosome Anatomy 0.000 description 1
- 235000013985 cinnamic acid Nutrition 0.000 description 1
- 229930016911 cinnamic acid Natural products 0.000 description 1
- 125000000259 cinnolinyl group Chemical group N1=NC(=CC2=CC=CC=C12)* 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- 150000001860 citric acid derivatives Chemical class 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 239000007891 compressed tablet Substances 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 125000000392 cycloalkenyl group Chemical group 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- WPOPOPFNZYPKAV-UHFFFAOYSA-N cyclobutylmethanol Chemical compound OCC1CCC1 WPOPOPFNZYPKAV-UHFFFAOYSA-N 0.000 description 1
- 125000001162 cycloheptenyl group Chemical group C1(=CCCCCC1)* 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000522 cyclooctenyl group Chemical group C1(=CCCCCCC1)* 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- XCIXKGXIYUWCLL-UHFFFAOYSA-N cyclopentanol Chemical compound OC1CCCC1 XCIXKGXIYUWCLL-UHFFFAOYSA-N 0.000 description 1
- 125000002433 cyclopentenyl group Chemical group C1(=CCCC1)* 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- PFWWSGFPICCWGU-UHFFFAOYSA-N cyclopropanesulfonyl chloride Chemical compound ClS(=O)(=O)C1CC1 PFWWSGFPICCWGU-UHFFFAOYSA-N 0.000 description 1
- 230000009089 cytolysis Effects 0.000 description 1
- 125000005507 decahydroisoquinolyl group Chemical group 0.000 description 1
- 125000004855 decalinyl group Chemical group C1(CCCC2CCCCC12)* 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 230000003111 delayed effect Effects 0.000 description 1
- 230000002939 deleterious effect Effects 0.000 description 1
- 238000000326 densiometry Methods 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 238000013461 design Methods 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- 238000003745 diagnosis Methods 0.000 description 1
- 125000005509 dibenzothiophenyl group Chemical group 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 125000001028 difluoromethyl group Chemical group [H]C(F)(F)* 0.000 description 1
- 125000005879 dioxolanyl group Chemical group 0.000 description 1
- 235000011180 diphosphates Nutrition 0.000 description 1
- 238000007907 direct compression Methods 0.000 description 1
- 125000005883 dithianyl group Chemical group 0.000 description 1
- 230000019975 dosage compensation by inactivation of X chromosome Effects 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 238000009510 drug design Methods 0.000 description 1
- 230000005014 ectopic expression Effects 0.000 description 1
- 238000007824 enzymatic assay Methods 0.000 description 1
- 230000002255 enzymatic effect Effects 0.000 description 1
- 229960005309 estradiol Drugs 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 1
- 229940012017 ethylenediamine Drugs 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- KTWOOEGAPBSYNW-UHFFFAOYSA-N ferrocene Chemical compound [Fe+2].C=1C=C[CH-]C=1.C=1C=C[CH-]C=1 KTWOOEGAPBSYNW-UHFFFAOYSA-N 0.000 description 1
- RWTNPBWLLIMQHL-UHFFFAOYSA-N fexofenadine Chemical compound C1=CC(C(C)(C(O)=O)C)=CC=C1C(O)CCCN1CCC(C(O)(C=2C=CC=CC=2)C=2C=CC=CC=2)CC1 RWTNPBWLLIMQHL-UHFFFAOYSA-N 0.000 description 1
- RMBPEFMHABBEKP-UHFFFAOYSA-N fluorene Chemical group C1=CC=C2C3=C[CH]C=CC3=CC2=C1 RMBPEFMHABBEKP-UHFFFAOYSA-N 0.000 description 1
- 125000004216 fluoromethyl group Chemical group [H]C([H])(F)* 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-L fumarate(2-) Chemical class [O-]C(=O)\C=C\C([O-])=O VZCYOOQTPOCHFL-OWOJBTEDSA-L 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 235000011087 fumaric acid Nutrition 0.000 description 1
- 125000003844 furanonyl group Chemical group 0.000 description 1
- 206010017758 gastric cancer Diseases 0.000 description 1
- 210000001035 gastrointestinal tract Anatomy 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 230000030279 gene silencing Effects 0.000 description 1
- 238000012226 gene silencing method Methods 0.000 description 1
- 229960002442 glucosamine Drugs 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 235000001727 glucose Nutrition 0.000 description 1
- 229930195712 glutamate Natural products 0.000 description 1
- 108020004445 glyceraldehyde-3-phosphate dehydrogenase Proteins 0.000 description 1
- 125000002795 guanidino group Chemical group C(N)(=N)N* 0.000 description 1
- 208000024963 hair loss Diseases 0.000 description 1
- 230000003676 hair loss Effects 0.000 description 1
- 125000000262 haloalkenyl group Chemical group 0.000 description 1
- 125000000232 haloalkynyl group Chemical group 0.000 description 1
- 230000003862 health status Effects 0.000 description 1
- 125000005114 heteroarylalkoxy group Chemical group 0.000 description 1
- 125000005980 hexynyl group Chemical group 0.000 description 1
- HNDVDQJCIGZPNO-UHFFFAOYSA-N histidine Natural products OC(=O)C(N)CC1=CN=CN1 HNDVDQJCIGZPNO-UHFFFAOYSA-N 0.000 description 1
- 229960002885 histidine Drugs 0.000 description 1
- 235000014304 histidine Nutrition 0.000 description 1
- 102000033785 histone binding proteins Human genes 0.000 description 1
- 108091009732 histone binding proteins Proteins 0.000 description 1
- XGIHQYAWBCFNPY-AZOCGYLKSA-N hydrabamine Chemical compound C([C@@H]12)CC3=CC(C(C)C)=CC=C3[C@@]2(C)CCC[C@@]1(C)CNCCNC[C@@]1(C)[C@@H]2CCC3=CC(C(C)C)=CC=C3[C@@]2(C)CCC1 XGIHQYAWBCFNPY-AZOCGYLKSA-N 0.000 description 1
- 125000000717 hydrazino group Chemical group [H]N([*])N([H])[H] 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 229940071870 hydroiodic acid Drugs 0.000 description 1
- 238000005805 hydroxylation reaction Methods 0.000 description 1
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Substances C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 1
- 238000003018 immunoassay Methods 0.000 description 1
- 238000002513 implantation Methods 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- YIAPLDFPUUJILH-UHFFFAOYSA-N indan-1-ol Chemical compound C1=CC=C2C(O)CCC2=C1 YIAPLDFPUUJILH-UHFFFAOYSA-N 0.000 description 1
- ZOAMBXDOGPRZLP-UHFFFAOYSA-N indole-3-acetamide Chemical compound C1=CC=C2C(CC(=O)N)=CNC2=C1 ZOAMBXDOGPRZLP-UHFFFAOYSA-N 0.000 description 1
- 125000003387 indolinyl group Chemical group N1(CCC2=CC=CC=C12)* 0.000 description 1
- 125000003406 indolizinyl group Chemical group C=1(C=CN2C=CC=CC12)* 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 206010073095 invasive ductal breast carcinoma Diseases 0.000 description 1
- 201000010985 invasive ductal carcinoma Diseases 0.000 description 1
- 150000004694 iodide salts Chemical class 0.000 description 1
- 125000002346 iodo group Chemical group I* 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- PHTQWCKDNZKARW-UHFFFAOYSA-N isoamylol Chemical compound CC(C)CCO PHTQWCKDNZKARW-UHFFFAOYSA-N 0.000 description 1
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- KQNPFQTWMSNSAP-UHFFFAOYSA-N isobutyric acid Chemical class CC(C)C(O)=O KQNPFQTWMSNSAP-UHFFFAOYSA-N 0.000 description 1
- 125000004594 isoindolinyl group Chemical group C1(NCC2=CC=CC=C12)* 0.000 description 1
- 125000000904 isoindolyl group Chemical group C=1(NC=C2C=CC=CC12)* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 1
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 description 1
- 125000005956 isoquinolyl group Chemical group 0.000 description 1
- 125000004628 isothiazolidinyl group Chemical group S1N(CCC1)* 0.000 description 1
- 125000003965 isoxazolidinyl group Chemical group 0.000 description 1
- 150000003893 lactate salts Chemical class 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- IIXWYSCJSQVBQM-LLVKDONJSA-N lorlatinib Chemical compound N=1N(C)C(C#N)=C2C=1CN(C)C(=O)C1=CC=C(F)C=C1[C@@H](C)OC1=CC2=CN=C1N IIXWYSCJSQVBQM-LLVKDONJSA-N 0.000 description 1
- 229940031703 low substituted hydroxypropyl cellulose Drugs 0.000 description 1
- 239000006166 lysate Substances 0.000 description 1
- 229960003646 lysine Drugs 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- ZLNQQNXFFQJAID-UHFFFAOYSA-L magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 description 1
- 239000001095 magnesium carbonate Substances 0.000 description 1
- 229910000021 magnesium carbonate Inorganic materials 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 150000002688 maleic acid derivatives Chemical class 0.000 description 1
- 150000004701 malic acid derivatives Chemical class 0.000 description 1
- 150000002690 malonic acid derivatives Chemical class 0.000 description 1
- 229960002510 mandelic acid Drugs 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- 108010082117 matrigel Proteins 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 239000012528 membrane Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 125000005341 metaphosphate group Chemical group 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-M methanesulfonate group Chemical class CS(=O)(=O)[O-] AFVFQIVMOAPDHO-UHFFFAOYSA-M 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- WSFSSNUMVMOOMR-BJUDXGSMSA-N methanone Chemical compound O=[11CH2] WSFSSNUMVMOOMR-BJUDXGSMSA-N 0.000 description 1
- 229930182817 methionine Natural products 0.000 description 1
- XLQIGLBALJNHKR-UHFFFAOYSA-N methyl 3-aminopyridine-4-carboxylate Chemical compound COC(=O)C1=CC=NC=C1N XLQIGLBALJNHKR-UHFFFAOYSA-N 0.000 description 1
- QPJVMBTYPHYUOC-UHFFFAOYSA-N methyl benzoate Chemical class COC(=O)C1=CC=CC=C1 QPJVMBTYPHYUOC-UHFFFAOYSA-N 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- WBYWAXJHAXSJNI-UHFFFAOYSA-N methyl p-hydroxycinnamate Natural products OC(=O)C=CC1=CC=CC=C1 WBYWAXJHAXSJNI-UHFFFAOYSA-N 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 1
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 1
- 239000008108 microcrystalline cellulose Substances 0.000 description 1
- 229940016286 microcrystalline cellulose Drugs 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 125000004312 morpholin-2-yl group Chemical group [H]N1C([H])([H])C([H])([H])OC([H])(*)C1([H])[H] 0.000 description 1
- NOUUUQMKVOUUNR-UHFFFAOYSA-N n,n'-diphenylethane-1,2-diamine Chemical compound C=1C=CC=CC=1NCCNC1=CC=CC=C1 NOUUUQMKVOUUNR-UHFFFAOYSA-N 0.000 description 1
- OBSKGKGKPGOOTB-UHFFFAOYSA-N n-(2-hydroxyethyl)-n-methylacetamide Chemical compound CC(=O)N(C)CCO OBSKGKGKPGOOTB-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004593 naphthyridinyl group Chemical group N1=C(C=CC2=CC=CN=C12)* 0.000 description 1
- 150000002823 nitrates Chemical class 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 208000002154 non-small cell lung carcinoma Diseases 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 108020004017 nuclear receptors Proteins 0.000 description 1
- NIHNNTQXNPWCJQ-UHFFFAOYSA-N o-biphenylenemethane Chemical group C1=CC=C2CC3=CC=CC=C3C2=C1 NIHNNTQXNPWCJQ-UHFFFAOYSA-N 0.000 description 1
- 125000005060 octahydroindolyl group Chemical group N1(CCC2CCCCC12)* 0.000 description 1
- 125000005061 octahydroisoindolyl group Chemical group C1(NCC2CCCCC12)* 0.000 description 1
- WWZKQHOCKIZLMA-UHFFFAOYSA-M octanoate Chemical class CCCCCCCC([O-])=O WWZKQHOCKIZLMA-UHFFFAOYSA-M 0.000 description 1
- 230000006548 oncogenic transformation Effects 0.000 description 1
- 239000006186 oral dosage form Substances 0.000 description 1
- 239000007935 oral tablet Substances 0.000 description 1
- 229940096978 oral tablet Drugs 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 238000006053 organic reaction Methods 0.000 description 1
- 125000001715 oxadiazolyl group Chemical group 0.000 description 1
- 150000003891 oxalate salts Chemical class 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- LMYJGUNNJIDROI-UHFFFAOYSA-N oxan-4-ol Chemical compound OC1CCOCC1 LMYJGUNNJIDROI-UHFFFAOYSA-N 0.000 description 1
- YSNVSVCWTBLLRW-UHFFFAOYSA-N oxan-4-ylmethanol Chemical compound OCC1CCOCC1 YSNVSVCWTBLLRW-UHFFFAOYSA-N 0.000 description 1
- 125000000160 oxazolidinyl group Chemical group 0.000 description 1
- 238000005895 oxidative decarboxylation reaction Methods 0.000 description 1
- 125000000466 oxiranyl group Chemical group 0.000 description 1
- 125000005476 oxopyrrolidinyl group Chemical group 0.000 description 1
- PIBWKRNGBLPSSY-UHFFFAOYSA-L palladium(II) chloride Chemical compound Cl[Pd]Cl PIBWKRNGBLPSSY-UHFFFAOYSA-L 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 1
- 125000005981 pentynyl group Chemical group 0.000 description 1
- 230000003285 pharmacodynamic effect Effects 0.000 description 1
- 125000001791 phenazinyl group Chemical group C1(=CC=CC2=NC3=CC=CC=C3N=C12)* 0.000 description 1
- 125000001484 phenothiazinyl group Chemical group C1(=CC=CC=2SC3=CC=CC=C3NC12)* 0.000 description 1
- 125000001644 phenoxazinyl group Chemical group C1(=CC=CC=2OC3=CC=CC=C3NC12)* 0.000 description 1
- 229960005323 phenoxyethanol Drugs 0.000 description 1
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical class OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 125000005498 phthalate group Chemical class 0.000 description 1
- 125000004592 phthalazinyl group Chemical group C1(=NN=CC2=CC=CC=C12)* 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 230000004962 physiological condition Effects 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 125000004193 piperazinyl group Chemical group 0.000 description 1
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000003386 piperidinyl group Chemical group 0.000 description 1
- 229920000768 polyamine Polymers 0.000 description 1
- 229920002981 polyvinylidene fluoride Polymers 0.000 description 1
- 230000029279 positive regulation of transcription, DNA-dependent Effects 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- MFDFERRIHVXMIY-UHFFFAOYSA-N procaine Chemical compound CCN(CC)CCOC(=O)C1=CC=C(N)C=C1 MFDFERRIHVXMIY-UHFFFAOYSA-N 0.000 description 1
- 229960004919 procaine Drugs 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 230000035755 proliferation Effects 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 125000002568 propynyl group Chemical group [*]C#CC([H])([H])[H] 0.000 description 1
- 210000002307 prostate Anatomy 0.000 description 1
- 235000004252 protein component Nutrition 0.000 description 1
- 125000001042 pteridinyl group Chemical group N1=C(N=CC2=NC=CN=C12)* 0.000 description 1
- 150000003212 purines Chemical class 0.000 description 1
- 125000000561 purinyl group Chemical group N1=C(N=C2N=CNC2=C1)* 0.000 description 1
- 125000003373 pyrazinyl group Chemical group 0.000 description 1
- 125000004289 pyrazol-3-yl group Chemical group [H]N1N=C(*)C([H])=C1[H] 0.000 description 1
- ILVXOBCQQYKLDS-UHFFFAOYSA-N pyridine N-oxide Chemical compound [O-][N+]1=CC=CC=C1 ILVXOBCQQYKLDS-UHFFFAOYSA-N 0.000 description 1
- 229940107700 pyruvic acid Drugs 0.000 description 1
- 238000011002 quantification Methods 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 1
- 125000001567 quinoxalinyl group Chemical group N1=C(C=NC2=CC=CC=C12)* 0.000 description 1
- 125000004621 quinuclidinyl group Chemical group N12C(CC(CC1)CC2)* 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 108020003175 receptors Proteins 0.000 description 1
- 102000005962 receptors Human genes 0.000 description 1
- 230000022532 regulation of transcription, DNA-dependent Effects 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 238000012552 review Methods 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- CXMXRPHRNRROMY-UHFFFAOYSA-N sebacic acid Chemical class OC(=O)CCCCCCCCC(O)=O CXMXRPHRNRROMY-UHFFFAOYSA-N 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- XIIOFHFUYBLOLW-UHFFFAOYSA-N selpercatinib Chemical compound OC(COC=1C=C(C=2N(C=1)N=CC=2C#N)C=1C=NC(=CC=1)N1CC2N(C(C1)C2)CC=1C=NC(=CC=1)OC)(C)C XIIOFHFUYBLOLW-UHFFFAOYSA-N 0.000 description 1
- 210000002966 serum Anatomy 0.000 description 1
- 230000001568 sexual effect Effects 0.000 description 1
- 230000011664 signaling Effects 0.000 description 1
- XGVXKJKTISMIOW-ZDUSSCGKSA-N simurosertib Chemical compound N1N=CC(C=2SC=3C(=O)NC(=NC=3C=2)[C@H]2N3CCC(CC3)C2)=C1C XGVXKJKTISMIOW-ZDUSSCGKSA-N 0.000 description 1
- 150000003384 small molecules Chemical class 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 239000012321 sodium triacetoxyborohydride Substances 0.000 description 1
- 239000012453 solvate Substances 0.000 description 1
- 238000003797 solvolysis reaction Methods 0.000 description 1
- 238000000527 sonication Methods 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 201000011549 stomach cancer Diseases 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-L succinate(2-) Chemical compound [O-]C(=O)CCC([O-])=O KDYFGRWQOYBRFD-UHFFFAOYSA-L 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical class [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 235000011149 sulphuric acid Nutrition 0.000 description 1
- 230000004083 survival effect Effects 0.000 description 1
- 238000001308 synthesis method Methods 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 150000003892 tartrate salts Chemical class 0.000 description 1
- 238000003419 tautomerization reaction Methods 0.000 description 1
- ISIJQEHRDSCQIU-UHFFFAOYSA-N tert-butyl 2,7-diazaspiro[4.5]decane-7-carboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CCCC11CNCC1 ISIJQEHRDSCQIU-UHFFFAOYSA-N 0.000 description 1
- XXZXGTFOJBGUFE-INIZCTEOSA-N tert-butyl 4-[(3s)-3-[4-(4-oxo-1h-pyrido[3,4-d]pyrimidin-2-yl)-1h-pyrazol-5-yl]pyrrolidine-1-carbonyl]piperidine-1-carboxylate Chemical compound C1CN(C(=O)OC(C)(C)C)CCC1C(=O)N1C[C@@H](C2=C(C=NN2)C=2NC3=CN=CC=C3C(=O)N=2)CC1 XXZXGTFOJBGUFE-INIZCTEOSA-N 0.000 description 1
- QSQWENQPOSRWLP-UHFFFAOYSA-N tert-butyl 4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]piperidine-1-carboxylate Chemical compound C1CN(C(=O)OC(C)(C)C)CCC1N1N=CC(B2OC(C)(C)C(C)(C)O2)=C1 QSQWENQPOSRWLP-UHFFFAOYSA-N 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 210000001550 testis Anatomy 0.000 description 1
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 1
- BSYVTEYKTMYBMK-UHFFFAOYSA-N tetrahydrofurfuryl alcohol Chemical compound OCC1CCCO1 BSYVTEYKTMYBMK-UHFFFAOYSA-N 0.000 description 1
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 1
- 125000000147 tetrahydroquinolinyl group Chemical group N1(CCCC2=CC=CC=C12)* 0.000 description 1
- 125000003831 tetrazolyl group Chemical group 0.000 description 1
- 229960004559 theobromine Drugs 0.000 description 1
- 125000001113 thiadiazolyl group Chemical group 0.000 description 1
- 125000001984 thiazolidinyl group Chemical group 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-M toluenesulfonate group Chemical group C=1(C(=CC=CC1)S(=O)(=O)[O-])C LBLYYCQCTBFVLH-UHFFFAOYSA-M 0.000 description 1
- 238000013518 transcription Methods 0.000 description 1
- 230000035897 transcription Effects 0.000 description 1
- 230000002103 transcriptional effect Effects 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- 238000011269 treatment regimen Methods 0.000 description 1
- 125000004306 triazinyl group Chemical group 0.000 description 1
- 125000001425 triazolyl group Chemical group 0.000 description 1
- WCEWCRAPSCLFOV-UHFFFAOYSA-N tributyl-(1-methylimidazol-4-yl)stannane Chemical compound CCCC[Sn](CCCC)(CCCC)C1=CN(C)C=N1 WCEWCRAPSCLFOV-UHFFFAOYSA-N 0.000 description 1
- DTQVDTLACAAQTR-DYCDLGHISA-N trifluoroacetic acid-d1 Chemical compound [2H]OC(=O)C(F)(F)F DTQVDTLACAAQTR-DYCDLGHISA-N 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- UCPYLLCMEDAXFR-UHFFFAOYSA-N triphosgene Chemical compound ClC(Cl)(Cl)OC(=O)OC(Cl)(Cl)Cl UCPYLLCMEDAXFR-UHFFFAOYSA-N 0.000 description 1
- YFTHZRPMJXBUME-UHFFFAOYSA-N tripropylamine Chemical compound CCCN(CCC)CCC YFTHZRPMJXBUME-UHFFFAOYSA-N 0.000 description 1
- 125000005455 trithianyl group Chemical group 0.000 description 1
- 239000003981 vehicle Substances 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 239000003039 volatile agent Substances 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- NWONKYPBYAMBJT-UHFFFAOYSA-L zinc sulfate Chemical compound [Zn+2].[O-]S([O-])(=O)=O NWONKYPBYAMBJT-UHFFFAOYSA-L 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Public Health (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Pharmacology & Pharmacy (AREA)
- Veterinary Medicine (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Engineering & Computer Science (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Enzymes And Modification Thereof (AREA)
- Preparation Of Compounds By Using Micro-Organisms (AREA)
- Immobilizing And Processing Of Enzymes And Microorganisms (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US201361791406P | 2013-03-15 | 2013-03-15 | |
| US61/791,406 | 2013-03-15 | ||
| PCT/US2014/024998 WO2014151106A1 (en) | 2013-03-15 | 2014-03-12 | Histone demethylase inhibitors |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| AU2014235280A1 AU2014235280A1 (en) | 2015-09-17 |
| AU2014235280B2 true AU2014235280B2 (en) | 2017-08-31 |
Family
ID=51580888
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AU2014235280A Ceased AU2014235280B2 (en) | 2013-03-15 | 2014-03-12 | Histone demethylase inhibitors |
Country Status (17)
| Country | Link |
|---|---|
| US (2) | US9994562B2 (cg-RX-API-DMAC7.html) |
| EP (1) | EP2970211B1 (cg-RX-API-DMAC7.html) |
| JP (1) | JP6332654B2 (cg-RX-API-DMAC7.html) |
| AU (1) | AU2014235280B2 (cg-RX-API-DMAC7.html) |
| CA (1) | CA2903465A1 (cg-RX-API-DMAC7.html) |
| CY (1) | CY1119476T1 (cg-RX-API-DMAC7.html) |
| DK (1) | DK2970211T3 (cg-RX-API-DMAC7.html) |
| ES (1) | ES2644828T3 (cg-RX-API-DMAC7.html) |
| HR (1) | HRP20171609T1 (cg-RX-API-DMAC7.html) |
| HU (1) | HUE034906T2 (cg-RX-API-DMAC7.html) |
| LT (1) | LT2970211T (cg-RX-API-DMAC7.html) |
| PL (1) | PL2970211T3 (cg-RX-API-DMAC7.html) |
| PT (1) | PT2970211T (cg-RX-API-DMAC7.html) |
| RS (1) | RS56561B1 (cg-RX-API-DMAC7.html) |
| SI (1) | SI2970211T1 (cg-RX-API-DMAC7.html) |
| SM (1) | SMT201700493T1 (cg-RX-API-DMAC7.html) |
| WO (1) | WO2014151106A1 (cg-RX-API-DMAC7.html) |
Families Citing this family (61)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| RS55764B1 (sr) | 2012-10-02 | 2017-07-31 | Gilead Sciences | Inhibitori histonskih demetilaza |
| JP6514117B2 (ja) | 2013-02-27 | 2019-05-15 | エピセラピューティクス アーペーエス | ヒストン脱メチル化酵素の阻害剤 |
| HUE034906T2 (hu) | 2013-03-15 | 2018-03-28 | Quanticel Pharmaceuticals Inc | Hiszton-demetiláz inhibitorok |
| JP2017526675A (ja) | 2014-08-27 | 2017-09-14 | ギリアード サイエンシーズ, インコーポレイテッド | ヒストンデメチラーゼを阻害するための化合物および方法 |
| JP6552608B2 (ja) | 2014-09-17 | 2019-07-31 | セルジーン クオンティセル リサーチ,インク. | ヒストンデメチラーゼ阻害剤 |
| US10030017B2 (en) | 2014-09-17 | 2018-07-24 | Celgene Quanticel Research, Inc. | Histone demethylase inhibitors |
| WO2016068580A2 (en) | 2014-10-29 | 2016-05-06 | Dong-A Socio Holdings Co., Ltd. | Novel pyridopyrimidinone compounds for modulating the catalytic activity of histone lysine demethylases (kdms) |
| CN107406418B (zh) * | 2015-01-09 | 2021-10-29 | 基因泰克公司 | 4,5-二氢咪唑衍生物及其作为组蛋白脱甲基酶(kdm2b)抑制剂的用途 |
| WO2016112284A1 (en) * | 2015-01-09 | 2016-07-14 | Genentech, Inc. | (piperidin-3-yl)(naphthalen-2-yl)methanone derivatives and related compounds as inhibitors of the histone demethylase kdm2b for the treatment of cancer |
| US20170057955A1 (en) * | 2015-08-26 | 2017-03-02 | Dong-A Socio Holdings Co., Ltd. | Pyridopyrimidinone Compounds for Modulating the Catalytic Activity of Histone Lysine Demethylases (KDMs) |
| WO2017161012A1 (en) * | 2016-03-15 | 2017-09-21 | Celgene Quanticel Research, Inc. | Histone demethylase inhibitors |
| US10150754B2 (en) | 2016-04-19 | 2018-12-11 | Celgene Quanticel Research, Inc. | Histone demethylase inhibitors |
| BR102017010009A2 (pt) | 2016-05-27 | 2017-12-12 | Gilead Sciences, Inc. | Compounds for the treatment of hepatitis b virus infection |
| MX2018014377A (es) | 2016-05-27 | 2019-03-14 | Gilead Sciences Inc | Metodos para tratar infecciones por virus de hepatitis b usando inhibidores de proteina no estructural 5a (ns5a), proteina no estructural 5b (ns5b) o proteina no estructural 3 (ns3). |
| JOP20190024A1 (ar) | 2016-08-26 | 2019-02-19 | Gilead Sciences Inc | مركبات بيروليزين بها استبدال واستخداماتها |
| US10370342B2 (en) | 2016-09-02 | 2019-08-06 | Gilead Sciences, Inc. | Toll like receptor modulator compounds |
| US10640499B2 (en) | 2016-09-02 | 2020-05-05 | Gilead Sciences, Inc. | Toll like receptor modulator compounds |
| PE20191353A1 (es) | 2016-10-14 | 2019-10-01 | Prec Biosciences Inc | Meganucleasas disenadas especificamente para el reconocimiento de secuencias en el genoma del virus de la hepatitis b |
| TWI784370B (zh) | 2017-01-31 | 2022-11-21 | 美商基利科學股份有限公司 | 替諾福韋埃拉酚胺(tenofovir alafenamide)之晶型 |
| JOP20180008A1 (ar) | 2017-02-02 | 2019-01-30 | Gilead Sciences Inc | مركبات لعلاج إصابة بعدوى فيروس الالتهاب الكبدي b |
| WO2018175670A1 (en) | 2017-03-22 | 2018-09-27 | The Research Foundation For The State University Of New York | Matrix metalloproteinase-9 hemopexin domain inhibitors and methods of treatment using same |
| JOP20180040A1 (ar) | 2017-04-20 | 2019-01-30 | Gilead Sciences Inc | مثبطات pd-1/pd-l1 |
| JP7098748B2 (ja) | 2017-12-20 | 2022-07-11 | インスティチュート オブ オーガニック ケミストリー アンド バイオケミストリー エーエスシーアール,ヴイ.ヴイ.アイ. | Stingアダプタータンパク質を活性化するホスホン酸結合を有する2’3’環状ジヌクレオチド |
| AU2018392213B2 (en) | 2017-12-20 | 2021-03-04 | Institute Of Organic Chemistry And Biochemistry Ascr, V.V.I. | 3'3' cyclic dinucleotides with phosphonate bond activating the STING adaptor protein |
| CN118084940A (zh) | 2018-02-13 | 2024-05-28 | 吉利德科学公司 | Pd-1/pd-l1抑制剂 |
| AU2019223182B2 (en) | 2018-02-26 | 2021-08-19 | Gilead Sciences, Inc. | Substituted pyrrolizine compounds as HBV replication inhibitors |
| US10870691B2 (en) | 2018-04-05 | 2020-12-22 | Gilead Sciences, Inc. | Antibodies and fragments thereof that bind hepatitis B virus protein X |
| TW202005654A (zh) | 2018-04-06 | 2020-02-01 | 捷克科學院有機化學與生物化學研究所 | 2,2,─環二核苷酸 |
| TWI818007B (zh) | 2018-04-06 | 2023-10-11 | 捷克科學院有機化學與生物化學研究所 | 2'3'-環二核苷酸 |
| TWI833744B (zh) | 2018-04-06 | 2024-03-01 | 捷克科學院有機化學與生物化學研究所 | 3'3'-環二核苷酸 |
| US11142750B2 (en) | 2018-04-12 | 2021-10-12 | Precision Biosciences, Inc. | Optimized engineered meganucleases having specificity for a recognition sequence in the Hepatitis B virus genome |
| AU2019255750B2 (en) | 2018-04-19 | 2021-10-21 | Gilead Sciences, Inc. | PD-1/PD-L1 inhibitors |
| US20190359645A1 (en) | 2018-05-03 | 2019-11-28 | Institute Of Organic Chemistry And Biochemistry Ascr, V.V.I. | 2'3'-cyclic dinucleotides comprising carbocyclic nucleotide |
| PE20210642A1 (es) | 2018-07-13 | 2021-03-23 | Gilead Sciences Inc | Inhibidores de pd-1/pd-l1 |
| WO2020028097A1 (en) | 2018-08-01 | 2020-02-06 | Gilead Sciences, Inc. | Solid forms of (r)-11-(methoxymethyl)-12-(3-methoxypropoxy)-3,3-dimethyl-8-0x0-2,3,8,13b-tetrahydro-1h-pyrido[2,1-a]pyrrolo[1,2-c] phthalazine-7-c arboxylic acid |
| CN112955435B (zh) | 2018-10-24 | 2024-09-06 | 吉利德科学公司 | Pd-1/pd-l1抑制剂 |
| ES2979163T3 (es) | 2018-10-31 | 2024-09-24 | Gilead Sciences Inc | Compuestos de 6-azabenzimidazol sustituidos como inhibidores de HPK1 |
| TWI721624B (zh) | 2018-10-31 | 2021-03-11 | 美商基利科學股份有限公司 | 經取代之6-氮雜苯并咪唑化合物 |
| AU2020231115B2 (en) | 2019-03-07 | 2025-02-20 | Institute Of Organic Chemistry And Biochemistry Ascr, V.V.I. | 3'3'-cyclic dinucleotides and prodrugs thereof |
| WO2020178768A1 (en) | 2019-03-07 | 2020-09-10 | Institute Of Organic Chemistry And Biochemistry Ascr, V.V.I. | 3'3'-cyclic dinucleotide analogue comprising a cyclopentanyl modified nucleotide as sting modulator |
| AU2020231201B2 (en) | 2019-03-07 | 2025-02-20 | Institute Of Organic Chemistry And Biochemistry Ascr, V.V.I. | 2'3'-cyclic dinucleotides and prodrugs thereof |
| TWI751517B (zh) | 2019-04-17 | 2022-01-01 | 美商基利科學股份有限公司 | 類鐸受體調節劑之固體形式 |
| TW202210480A (zh) | 2019-04-17 | 2022-03-16 | 美商基利科學股份有限公司 | 類鐸受體調節劑之固體形式 |
| US11453681B2 (en) | 2019-05-23 | 2022-09-27 | Gilead Sciences, Inc. | Substituted eneoxindoles and uses thereof |
| UA129329C2 (uk) | 2019-06-25 | 2025-03-19 | Гіліад Сайєнсіз, Інк. | ЗЛИТІ БІЛКИ FLT3L-Fc |
| WO2021011891A1 (en) | 2019-07-18 | 2021-01-21 | Gilead Sciences, Inc. | Long-acting formulations of tenofovir alafenamide |
| EP4017476A1 (en) | 2019-08-19 | 2022-06-29 | Gilead Sciences, Inc. | Pharmaceutical formulations of tenofovir alafenamide |
| MX2022003658A (es) | 2019-09-30 | 2022-04-25 | Gilead Sciences Inc | Vacunas contra el virus de la hepatitis b (vhb) y metodos para tratar el vhb. |
| DK4069729T3 (da) | 2019-12-06 | 2025-04-07 | Prec Biosciences Inc | Optimerede, modificerede meganukleaser med specificitet for en genkendelsessekvens i hepatitis b-virusgenomet |
| AU2021237718B2 (en) | 2020-03-20 | 2023-09-21 | Gilead Sciences, Inc. | Prodrugs of 4'-C-substituted-2-halo-2'-deoxyadenosine nucleosides and methods of making and using the same |
| CN116194144A (zh) | 2020-08-07 | 2023-05-30 | 吉利德科学公司 | 膦酰胺核苷酸类似物的前药及其药物用途 |
| TWI815194B (zh) | 2020-10-22 | 2023-09-11 | 美商基利科學股份有限公司 | 介白素2-Fc融合蛋白及使用方法 |
| AU2022274607A1 (en) | 2021-05-13 | 2023-11-16 | Gilead Sciences, Inc. | COMBINATION OF A TLR8 MODULATING COMPOUND AND ANTI-HBV siRNA THERAPEUTICS |
| KR20240023628A (ko) | 2021-06-23 | 2024-02-22 | 길리애드 사이언시즈, 인코포레이티드 | 디아실글리세롤 키나제 조절 화합물 |
| CN117396478A (zh) | 2021-06-23 | 2024-01-12 | 吉利德科学公司 | 二酰基甘油激酶调节化合物 |
| US11932634B2 (en) | 2021-06-23 | 2024-03-19 | Gilead Sciences, Inc. | Diacylglycerol kinase modulating compounds |
| KR20240023629A (ko) | 2021-06-23 | 2024-02-22 | 길리애드 사이언시즈, 인코포레이티드 | 디아실글리세롤 키나제 조절 화합물 |
| US20250345390A1 (en) | 2024-05-13 | 2025-11-13 | Gilead Sciences, Inc. | Combination therapies |
| WO2025240243A1 (en) | 2024-05-13 | 2025-11-20 | Gilead Sciences, Inc. | Combination therapies with bulevirtide and an inhibitory nucleic acid targeting hepatitis b virus |
| WO2025240242A1 (en) | 2024-05-13 | 2025-11-20 | Gilead Sciences, Inc. | Combination therapies with ribavirin |
| WO2025240246A1 (en) | 2024-05-13 | 2025-11-20 | Gilead Sciences, Inc. | Combination therapies with ribavirin |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2012052390A1 (en) * | 2010-10-19 | 2012-04-26 | Glaxo Group Limited | N-2-(2-pyridinyl)-4-pyrimidinyl-beta-alanine derivatives as inhibitors of histone demethylase jmjd3 |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5034393A (en) * | 1989-07-27 | 1991-07-23 | Dowelanco | Fungicidal use of pyridopyrimidine, pteridine, pyrimidopyrimidine, pyrimidopyridazine, and pyrimido-1,2,4-triazine derivatives |
| HRP970371A2 (en) * | 1996-07-13 | 1998-08-31 | Kathryn Jane Smith | Heterocyclic compounds |
| WO2003078427A1 (en) | 2002-03-15 | 2003-09-25 | Vertex Pharmaceuticals, Inc. | Azolylaminoazines as inhibitors of protein kinases |
| WO2005007658A2 (en) * | 2003-07-14 | 2005-01-27 | Arena Pharmaceuticals, Inc. | Fused-aryl and heteroaryl derivatives as modulators of metabolism and the prophylaxis and treatment of disorders related thereto |
| JP2008510823A (ja) | 2004-08-23 | 2008-04-10 | メルク エンド カムパニー インコーポレーテッド | Akt活性阻害剤 |
| US20110319409A1 (en) * | 2010-06-23 | 2011-12-29 | Cox Christopher D | 7-aza-quinazoline pde10 inhibitors |
| HUE034906T2 (hu) | 2013-03-15 | 2018-03-28 | Quanticel Pharmaceuticals Inc | Hiszton-demetiláz inhibitorok |
| JP6552608B2 (ja) | 2014-09-17 | 2019-07-31 | セルジーン クオンティセル リサーチ,インク. | ヒストンデメチラーゼ阻害剤 |
-
2014
- 2014-03-12 HU HUE14768099A patent/HUE034906T2/hu unknown
- 2014-03-12 SI SI201430421T patent/SI2970211T1/sl unknown
- 2014-03-12 AU AU2014235280A patent/AU2014235280B2/en not_active Ceased
- 2014-03-12 DK DK14768099.5T patent/DK2970211T3/en active
- 2014-03-12 EP EP14768099.5A patent/EP2970211B1/en active Active
- 2014-03-12 JP JP2016501713A patent/JP6332654B2/ja not_active Expired - Fee Related
- 2014-03-12 WO PCT/US2014/024998 patent/WO2014151106A1/en not_active Ceased
- 2014-03-12 PL PL14768099T patent/PL2970211T3/pl unknown
- 2014-03-12 LT LTEP14768099.5T patent/LT2970211T/lt unknown
- 2014-03-12 ES ES14768099.5T patent/ES2644828T3/es active Active
- 2014-03-12 SM SM20170493T patent/SMT201700493T1/it unknown
- 2014-03-12 US US14/774,335 patent/US9994562B2/en active Active
- 2014-03-12 CA CA2903465A patent/CA2903465A1/en not_active Abandoned
- 2014-03-12 PT PT147680995T patent/PT2970211T/pt unknown
- 2014-03-12 HR HRP20171609TT patent/HRP20171609T1/hr unknown
- 2014-03-12 RS RS20171070A patent/RS56561B1/sr unknown
-
2017
- 2017-10-23 CY CY20171101101T patent/CY1119476T1/el unknown
-
2018
- 2018-05-04 US US15/971,912 patent/US10526327B2/en active Active
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2012052390A1 (en) * | 2010-10-19 | 2012-04-26 | Glaxo Group Limited | N-2-(2-pyridinyl)-4-pyrimidinyl-beta-alanine derivatives as inhibitors of histone demethylase jmjd3 |
Also Published As
| Publication number | Publication date |
|---|---|
| EP2970211A4 (en) | 2016-08-03 |
| JP2016512834A (ja) | 2016-05-09 |
| PT2970211T (pt) | 2017-10-31 |
| SMT201700493T1 (it) | 2017-11-15 |
| JP6332654B2 (ja) | 2018-05-30 |
| LT2970211T (lt) | 2017-10-25 |
| SI2970211T1 (sl) | 2017-12-29 |
| RS56561B1 (sr) | 2018-02-28 |
| AU2014235280A1 (en) | 2015-09-17 |
| EP2970211B1 (en) | 2017-07-26 |
| US9994562B2 (en) | 2018-06-12 |
| HUE034906T2 (hu) | 2018-03-28 |
| US20160039808A1 (en) | 2016-02-11 |
| PL2970211T3 (pl) | 2018-01-31 |
| US20180319793A1 (en) | 2018-11-08 |
| EP2970211A1 (en) | 2016-01-20 |
| US10526327B2 (en) | 2020-01-07 |
| CA2903465A1 (en) | 2014-09-25 |
| ES2644828T3 (es) | 2017-11-30 |
| DK2970211T3 (en) | 2017-10-16 |
| CY1119476T1 (el) | 2018-03-07 |
| WO2014151106A1 (en) | 2014-09-25 |
| HRP20171609T1 (hr) | 2017-12-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AU2014235280B2 (en) | Histone demethylase inhibitors | |
| US11028066B2 (en) | Inhibitors of lysine specific demethylase-1 | |
| US10385051B2 (en) | Inhibitors of lysine specific demethylase-1 | |
| JP6663866B2 (ja) | リジン特異的なデメチラーゼ−1の阻害剤 | |
| CA2894399A1 (en) | Histone demethylase inhibitors | |
| EP2934145A1 (en) | Histone demethylase inhibitors | |
| WO2017184491A1 (en) | Histone demethylase inhibitors | |
| HK1231860B (en) | Inhibitors of lysine specific demethylase-1 | |
| HK1231860A1 (en) | Inhibitors of lysine specific demethylase-1 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PC1 | Assignment before grant (sect. 113) |
Owner name: CELGENE QUANTICEL RESEARCH, INC. Free format text: FORMER APPLICANT(S): QUANTICEL PHARMACEUTICALS, INC. |
|
| FGA | Letters patent sealed or granted (standard patent) | ||
| MK14 | Patent ceased section 143(a) (annual fees not paid) or expired |