AU2005283085B2 - Substituted imidazoquinolines, imidazopyridines, and imidazonaphthyridines - Google Patents
Substituted imidazoquinolines, imidazopyridines, and imidazonaphthyridines Download PDFInfo
- Publication number
- AU2005283085B2 AU2005283085B2 AU2005283085A AU2005283085A AU2005283085B2 AU 2005283085 B2 AU2005283085 B2 AU 2005283085B2 AU 2005283085 A AU2005283085 A AU 2005283085A AU 2005283085 A AU2005283085 A AU 2005283085A AU 2005283085 B2 AU2005283085 B2 AU 2005283085B2
- Authority
- AU
- Australia
- Prior art keywords
- group
- alkyl
- alkylene
- compound
- methyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Ceased
Links
- VFTLXHXYGQSOEN-UHFFFAOYSA-N 1h-imidazo[4,5-b][1,8]naphthyridine Chemical class C1=CN=C2NC3=NC=NC3=CC2=C1 VFTLXHXYGQSOEN-UHFFFAOYSA-N 0.000 title abstract description 3
- RHKWIGHJGOEUSM-UHFFFAOYSA-N 3h-imidazo[4,5-h]quinoline Chemical class C1=CN=C2C(N=CN3)=C3C=CC2=C1 RHKWIGHJGOEUSM-UHFFFAOYSA-N 0.000 title description 2
- 150000005232 imidazopyridines Chemical class 0.000 title description 2
- 150000001875 compounds Chemical class 0.000 claims abstract description 200
- 238000000034 method Methods 0.000 claims abstract description 82
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims abstract description 33
- 201000010099 disease Diseases 0.000 claims abstract description 31
- 241001465754 Metazoa Species 0.000 claims abstract description 29
- 102000004127 Cytokines Human genes 0.000 claims abstract description 22
- 108090000695 Cytokines Proteins 0.000 claims abstract description 22
- 230000015572 biosynthetic process Effects 0.000 claims abstract description 22
- 230000003612 virological effect Effects 0.000 claims abstract description 15
- 230000001613 neoplastic effect Effects 0.000 claims abstract description 12
- 239000008194 pharmaceutical composition Substances 0.000 claims abstract description 8
- 230000001939 inductive effect Effects 0.000 claims abstract description 6
- 125000000217 alkyl group Chemical group 0.000 claims description 186
- -1 nitro, hydroxy, mercapto Chemical group 0.000 claims description 116
- 229910052739 hydrogen Inorganic materials 0.000 claims description 110
- 239000001257 hydrogen Substances 0.000 claims description 110
- 125000002947 alkylene group Chemical group 0.000 claims description 95
- 150000003839 salts Chemical class 0.000 claims description 92
- 150000002431 hydrogen Chemical group 0.000 claims description 74
- 125000003118 aryl group Chemical group 0.000 claims description 73
- 125000001072 heteroaryl group Chemical group 0.000 claims description 65
- 125000000623 heterocyclic group Chemical group 0.000 claims description 61
- 125000003342 alkenyl group Chemical group 0.000 claims description 60
- 125000003545 alkoxy group Chemical group 0.000 claims description 55
- 229910052736 halogen Inorganic materials 0.000 claims description 49
- 150000002367 halogens Chemical class 0.000 claims description 49
- 125000005466 alkylenyl group Chemical group 0.000 claims description 46
- 125000000304 alkynyl group Chemical group 0.000 claims description 41
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 36
- 229920006395 saturated elastomer Polymers 0.000 claims description 32
- 125000000732 arylene group Chemical group 0.000 claims description 26
- 125000004450 alkenylene group Chemical group 0.000 claims description 25
- 125000004419 alkynylene group Chemical group 0.000 claims description 25
- 125000001188 haloalkyl group Chemical group 0.000 claims description 25
- 125000005549 heteroarylene group Chemical group 0.000 claims description 25
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 24
- 229910052757 nitrogen Inorganic materials 0.000 claims description 24
- 125000005842 heteroatom Chemical group 0.000 claims description 20
- 125000004414 alkyl thio group Chemical group 0.000 claims description 18
- 125000003282 alkyl amino group Chemical group 0.000 claims description 17
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 17
- 125000001424 substituent group Chemical group 0.000 claims description 17
- 229910052717 sulfur Inorganic materials 0.000 claims description 17
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 14
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 13
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 claims description 12
- 125000005529 alkyleneoxy group Chemical group 0.000 claims description 12
- 125000005532 aryl alkyleneoxy group Chemical group 0.000 claims description 12
- 125000004104 aryloxy group Chemical group 0.000 claims description 12
- 125000004438 haloalkoxy group Chemical group 0.000 claims description 12
- 125000005553 heteroaryloxy group Chemical group 0.000 claims description 12
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 12
- 238000004519 manufacturing process Methods 0.000 claims description 12
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 claims description 11
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 11
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 claims description 10
- 125000004043 oxo group Chemical group O=* 0.000 claims description 9
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 8
- 150000008575 L-amino acids Chemical class 0.000 claims description 5
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 5
- 239000003814 drug Substances 0.000 claims description 5
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 5
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 claims description 4
- 125000004214 1-pyrrolidinyl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 3
- 125000002252 acyl group Chemical group 0.000 claims description 3
- 150000001413 amino acids Chemical class 0.000 claims description 3
- 239000003937 drug carrier Substances 0.000 claims description 3
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 3
- 125000003396 thiol group Chemical class [H]S* 0.000 claims 2
- 238000011282 treatment Methods 0.000 abstract description 12
- 229940111121 antirheumatic drug quinolines Drugs 0.000 abstract description 3
- 150000003248 quinolines Chemical class 0.000 abstract description 3
- 150000003530 tetrahydroquinolines Chemical class 0.000 abstract description 3
- GAMYYCRTACQSBR-UHFFFAOYSA-N 4-azabenzimidazole Chemical compound C1=CC=C2NC=NC2=N1 GAMYYCRTACQSBR-UHFFFAOYSA-N 0.000 abstract description 2
- SQQXRXKYTKFFSM-UHFFFAOYSA-N chembl1992147 Chemical compound OC1=C(OC)C(OC)=CC=C1C1=C(C)C(C(O)=O)=NC(C=2N=C3C4=NC(C)(C)N=C4C(OC)=C(O)C3=CC=2)=C1N SQQXRXKYTKFFSM-UHFFFAOYSA-N 0.000 abstract description 2
- 229940124669 imidazoquinoline Drugs 0.000 abstract description 2
- 239000002955 immunomodulating agent Substances 0.000 abstract description 2
- 229940121354 immunomodulator Drugs 0.000 abstract description 2
- 150000003222 pyridines Chemical class 0.000 abstract description 2
- VMLKTERJLVWEJJ-UHFFFAOYSA-N 1,5-naphthyridine Chemical class C1=CC=NC2=CC=CN=C21 VMLKTERJLVWEJJ-UHFFFAOYSA-N 0.000 abstract 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 440
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 264
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 246
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 219
- 239000007787 solid Substances 0.000 description 200
- 238000006243 chemical reaction Methods 0.000 description 199
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 184
- 239000000243 solution Substances 0.000 description 181
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 175
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 171
- 239000000203 mixture Substances 0.000 description 140
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 111
- 239000011541 reaction mixture Substances 0.000 description 109
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 107
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 102
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 87
- 239000000463 material Substances 0.000 description 87
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 71
- 239000000047 product Substances 0.000 description 71
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 68
- 239000003921 oil Substances 0.000 description 68
- 235000019198 oils Nutrition 0.000 description 68
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical class CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 63
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 59
- 239000012043 crude product Substances 0.000 description 58
- 238000001914 filtration Methods 0.000 description 54
- 239000010410 layer Substances 0.000 description 52
- 239000002904 solvent Substances 0.000 description 52
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 50
- 239000012044 organic layer Substances 0.000 description 47
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 46
- 239000000706 filtrate Substances 0.000 description 42
- 150000001412 amines Chemical class 0.000 description 40
- 239000012267 brine Substances 0.000 description 40
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 40
- 238000007796 conventional method Methods 0.000 description 38
- 239000000741 silica gel Substances 0.000 description 34
- 229910002027 silica gel Inorganic materials 0.000 description 34
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 32
- 238000010992 reflux Methods 0.000 description 32
- 239000013078 crystal Substances 0.000 description 31
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 31
- 238000007429 general method Methods 0.000 description 31
- 239000011734 sodium Substances 0.000 description 31
- 235000017557 sodium bicarbonate Nutrition 0.000 description 29
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 29
- 238000003818 flash chromatography Methods 0.000 description 27
- 239000000843 powder Substances 0.000 description 27
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 26
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 26
- AOJFQRQNPXYVLM-UHFFFAOYSA-N pyridin-1-ium;chloride Chemical compound [Cl-].C1=CC=[NH+]C=C1 AOJFQRQNPXYVLM-UHFFFAOYSA-N 0.000 description 26
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical group C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 25
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 24
- 239000003795 chemical substances by application Substances 0.000 description 24
- ZPMWWAIBJJFPPQ-UHFFFAOYSA-N 2-ethoxyacetyl chloride Chemical compound CCOCC(Cl)=O ZPMWWAIBJJFPPQ-UHFFFAOYSA-N 0.000 description 23
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 23
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 23
- 239000002244 precipitate Substances 0.000 description 21
- 239000000725 suspension Substances 0.000 description 20
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 19
- HPXRVTGHNJAIIH-UHFFFAOYSA-N cyclohexanol Chemical compound OC1CCCCC1 HPXRVTGHNJAIIH-UHFFFAOYSA-N 0.000 description 19
- ZRFUZDDJSQVQBY-UHFFFAOYSA-N 4-chloro-3-nitroquinoline Chemical compound C1=CC=CC2=C(Cl)C([N+](=O)[O-])=CN=C21 ZRFUZDDJSQVQBY-UHFFFAOYSA-N 0.000 description 18
- 239000006260 foam Substances 0.000 description 18
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 18
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 17
- 239000000908 ammonium hydroxide Substances 0.000 description 17
- LMYJGUNNJIDROI-UHFFFAOYSA-N oxan-4-ol Chemical compound OC1CCOCC1 LMYJGUNNJIDROI-UHFFFAOYSA-N 0.000 description 17
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 16
- 235000019341 magnesium sulphate Nutrition 0.000 description 16
- 238000005481 NMR spectroscopy Methods 0.000 description 15
- 238000000746 purification Methods 0.000 description 15
- 238000003756 stirring Methods 0.000 description 15
- 238000003786 synthesis reaction Methods 0.000 description 15
- JAFMOTJMRSZOJE-UHFFFAOYSA-N 1,1,1-trimethoxybutane Chemical compound CCCC(OC)(OC)OC JAFMOTJMRSZOJE-UHFFFAOYSA-N 0.000 description 14
- 239000012065 filter cake Substances 0.000 description 14
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 13
- 239000000651 prodrug Substances 0.000 description 13
- 229940002612 prodrug Drugs 0.000 description 13
- 239000007858 starting material Substances 0.000 description 13
- 125000004432 carbon atom Chemical group C* 0.000 description 12
- 239000003153 chemical reaction reagent Substances 0.000 description 12
- 238000005984 hydrogenation reaction Methods 0.000 description 12
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 12
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 12
- 238000010189 synthetic method Methods 0.000 description 12
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 11
- 239000002253 acid Substances 0.000 description 11
- 125000004122 cyclic group Chemical group 0.000 description 11
- 238000010828 elution Methods 0.000 description 11
- HDPNBNXLBDFELL-UHFFFAOYSA-N 1,1,1-trimethoxyethane Chemical compound COC(C)(OC)OC HDPNBNXLBDFELL-UHFFFAOYSA-N 0.000 description 10
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 10
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 10
- 230000028993 immune response Effects 0.000 description 10
- NXJCBFBQEVOTOW-UHFFFAOYSA-L palladium(2+);dihydroxide Chemical compound O[Pd]O NXJCBFBQEVOTOW-UHFFFAOYSA-L 0.000 description 10
- 150000003573 thiols Chemical class 0.000 description 10
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 9
- 238000005576 amination reaction Methods 0.000 description 9
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 9
- 239000000543 intermediate Substances 0.000 description 9
- 125000001981 tert-butyldimethylsilyl group Chemical group [H]C([H])([H])[Si]([H])(C([H])([H])[H])[*]C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 9
- QMRGVILFWQUZKR-UHFFFAOYSA-N 1-(aminomethyl)cyclobutan-1-ol Chemical compound NCC1(O)CCC1 QMRGVILFWQUZKR-UHFFFAOYSA-N 0.000 description 8
- XUSXTHMTOSFZII-UHFFFAOYSA-N 1-(aminomethyl)cyclohexan-1-ol Chemical compound NCC1(O)CCCCC1 XUSXTHMTOSFZII-UHFFFAOYSA-N 0.000 description 8
- ITIRVXDSMXFTPW-UHFFFAOYSA-N 1H-imidazo[4,5-c]quinoline Chemical group C1=CC=CC2=C(NC=N3)C3=CN=C21 ITIRVXDSMXFTPW-UHFFFAOYSA-N 0.000 description 8
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 8
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 8
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 8
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 description 8
- 239000003054 catalyst Substances 0.000 description 8
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 8
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 8
- 150000002576 ketones Chemical class 0.000 description 8
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 8
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 8
- 239000003039 volatile agent Substances 0.000 description 8
- FGWYWKIOMUZSQF-UHFFFAOYSA-N 1,1,1-triethoxypropane Chemical compound CCOC(CC)(OCC)OCC FGWYWKIOMUZSQF-UHFFFAOYSA-N 0.000 description 7
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 7
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 7
- 206010028980 Neoplasm Diseases 0.000 description 7
- 229910052799 carbon Inorganic materials 0.000 description 7
- 125000000524 functional group Chemical group 0.000 description 7
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 7
- 239000012074 organic phase Substances 0.000 description 7
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 7
- 230000009467 reduction Effects 0.000 description 7
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 7
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 7
- OISVCGZHLKNMSJ-UHFFFAOYSA-N 2,6-dimethylpyridine Chemical compound CC1=CC=CC(C)=N1 OISVCGZHLKNMSJ-UHFFFAOYSA-N 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- 101150043532 CISH gene Proteins 0.000 description 6
- BWLUMTFWVZZZND-UHFFFAOYSA-N Dibenzylamine Chemical compound C=1C=CC=CC=1CNCC1=CC=CC=C1 BWLUMTFWVZZZND-UHFFFAOYSA-N 0.000 description 6
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 6
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 6
- 239000012346 acetyl chloride Substances 0.000 description 6
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 6
- 239000012230 colorless oil Substances 0.000 description 6
- KTHXBEHDVMTNOH-UHFFFAOYSA-N cyclobutanol Chemical compound OC1CCC1 KTHXBEHDVMTNOH-UHFFFAOYSA-N 0.000 description 6
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 6
- XCIXKGXIYUWCLL-UHFFFAOYSA-N cyclopentanol Chemical compound OC1CCCC1 XCIXKGXIYUWCLL-UHFFFAOYSA-N 0.000 description 6
- 239000000284 extract Substances 0.000 description 6
- 238000009904 heterogeneous catalytic hydrogenation reaction Methods 0.000 description 6
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 6
- DYHSDKLCOJIUFX-UHFFFAOYSA-N tert-butoxycarbonyl anhydride Chemical compound CC(C)(C)OC(=O)OC(=O)OC(C)(C)C DYHSDKLCOJIUFX-UHFFFAOYSA-N 0.000 description 6
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 6
- PYOKUURKVVELLB-UHFFFAOYSA-N trimethyl orthoformate Chemical compound COC(OC)OC PYOKUURKVVELLB-UHFFFAOYSA-N 0.000 description 6
- RDOOEPVOAVLQCG-UHFFFAOYSA-N 1-[[2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]methyl]cyclohexan-1-amine Chemical compound CCOCC1=NC2=CN=C3C=CC=CC3=C2N1CC1(N)CCCCC1 RDOOEPVOAVLQCG-UHFFFAOYSA-N 0.000 description 5
- 238000005160 1H NMR spectroscopy Methods 0.000 description 5
- LBUWKUXIRPCSPJ-UHFFFAOYSA-N 4-[[(3-aminoquinolin-4-yl)amino]methyl]oxan-4-ol Chemical compound NC1=CN=C2C=CC=CC2=C1NCC1(O)CCOCC1 LBUWKUXIRPCSPJ-UHFFFAOYSA-N 0.000 description 5
- CJMLFTFOFQMDKG-UHFFFAOYSA-N 4-chloro-3-nitro-1,8-naphthyridine Chemical compound N1=CC=CC2=C(Cl)C([N+](=O)[O-])=CN=C21 CJMLFTFOFQMDKG-UHFFFAOYSA-N 0.000 description 5
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N DMSO Substances CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 5
- 235000019502 Orange oil Nutrition 0.000 description 5
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 5
- 150000001408 amides Chemical class 0.000 description 5
- UORVGPXVDQYIDP-UHFFFAOYSA-N borane Chemical compound B UORVGPXVDQYIDP-UHFFFAOYSA-N 0.000 description 5
- 230000003197 catalytic effect Effects 0.000 description 5
- 150000002148 esters Chemical class 0.000 description 5
- 239000012452 mother liquor Substances 0.000 description 5
- 239000010502 orange oil Substances 0.000 description 5
- 125000006239 protecting group Chemical group 0.000 description 5
- 229910052708 sodium Inorganic materials 0.000 description 5
- 229910000104 sodium hydride Inorganic materials 0.000 description 5
- 229910052938 sodium sulfate Inorganic materials 0.000 description 5
- 235000011152 sodium sulphate Nutrition 0.000 description 5
- 238000012360 testing method Methods 0.000 description 5
- DXIAEURKHWGAFH-UHFFFAOYSA-N 1-(aminomethyl)cyclohexan-1-ol;hydron;chloride Chemical compound Cl.NCC1(O)CCCCC1 DXIAEURKHWGAFH-UHFFFAOYSA-N 0.000 description 4
- FEALJKFIUQDJAV-UHFFFAOYSA-N 1-(aminomethyl)cyclopentan-1-ol Chemical compound NCC1(O)CCCC1 FEALJKFIUQDJAV-UHFFFAOYSA-N 0.000 description 4
- JYQMHTBJVMBKGR-UHFFFAOYSA-N 1-[[(3-amino-1,5-naphthyridin-4-yl)amino]methyl]cyclohexan-1-ol Chemical compound NC1=CN=C2C=CC=NC2=C1NCC1(O)CCCCC1 JYQMHTBJVMBKGR-UHFFFAOYSA-N 0.000 description 4
- XDXRYOOTWLBTPN-UHFFFAOYSA-N 1-[[(3-nitroquinolin-4-yl)amino]methyl]cyclohexan-1-ol Chemical compound [O-][N+](=O)C=1C=NC2=CC=CC=C2C=1NCC1(O)CCCCC1 XDXRYOOTWLBTPN-UHFFFAOYSA-N 0.000 description 4
- MDVQVSNLODTHDE-UHFFFAOYSA-N 1-[[4-amino-2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]methyl]cyclopentan-1-ol Chemical compound CCOCC1=NC2=C(N)N=C3C=CC=CC3=C2N1CC1(O)CCCC1 MDVQVSNLODTHDE-UHFFFAOYSA-N 0.000 description 4
- GRNOZCCBOFGDCL-UHFFFAOYSA-N 2,2,2-trichloroacetyl isocyanate Chemical compound ClC(Cl)(Cl)C(=O)N=C=O GRNOZCCBOFGDCL-UHFFFAOYSA-N 0.000 description 4
- RSFJVCHKGRUCIC-UHFFFAOYSA-N 2,4-dichloro-3-nitroquinoline Chemical compound C1=CC=CC2=C(Cl)C([N+](=O)[O-])=C(Cl)N=C21 RSFJVCHKGRUCIC-UHFFFAOYSA-N 0.000 description 4
- HQBUPOAKJGJGCD-UHFFFAOYSA-N 3h-imidazo[4,5-c]quinolin-4-amine Chemical class NC1=NC2=CC=CC=C2C2=C1N=CN2 HQBUPOAKJGJGCD-UHFFFAOYSA-N 0.000 description 4
- CGPIFQOTBHKPNM-UHFFFAOYSA-N 4-(aminomethyl)oxan-4-ol Chemical compound NCC1(O)CCOCC1 CGPIFQOTBHKPNM-UHFFFAOYSA-N 0.000 description 4
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 4
- 108010063738 Interleukins Proteins 0.000 description 4
- 102000015696 Interleukins Human genes 0.000 description 4
- 150000001204 N-oxides Chemical class 0.000 description 4
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 4
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 4
- OKJPEAGHQZHRQV-UHFFFAOYSA-N Triiodomethane Natural products IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 description 4
- WLLIXJBWWFGEHT-UHFFFAOYSA-N [tert-butyl(dimethyl)silyl] trifluoromethanesulfonate Chemical compound CC(C)(C)[Si](C)(C)OS(=O)(=O)C(F)(F)F WLLIXJBWWFGEHT-UHFFFAOYSA-N 0.000 description 4
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 4
- 150000001414 amino alcohols Chemical class 0.000 description 4
- 125000003277 amino group Chemical group 0.000 description 4
- 229910021529 ammonia Inorganic materials 0.000 description 4
- VZTDIZULWFCMLS-UHFFFAOYSA-N ammonium formate Chemical compound [NH4+].[O-]C=O VZTDIZULWFCMLS-UHFFFAOYSA-N 0.000 description 4
- 150000008064 anhydrides Chemical class 0.000 description 4
- 150000001805 chlorine compounds Chemical class 0.000 description 4
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 4
- 125000005745 ethoxymethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])* 0.000 description 4
- 238000009472 formulation Methods 0.000 description 4
- 150000003840 hydrochlorides Chemical class 0.000 description 4
- 230000006698 induction Effects 0.000 description 4
- 208000015181 infectious disease Diseases 0.000 description 4
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 4
- 239000012948 isocyanate Substances 0.000 description 4
- 150000002513 isocyanates Chemical class 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 239000003607 modifier Substances 0.000 description 4
- 239000012299 nitrogen atmosphere Substances 0.000 description 4
- 229910000027 potassium carbonate Inorganic materials 0.000 description 4
- 238000002360 preparation method Methods 0.000 description 4
- UTOMICFLROGMAE-UHFFFAOYSA-N quinoline-3,4-diamine Chemical compound C1=CC=CC2=C(N)C(N)=CN=C21 UTOMICFLROGMAE-UHFFFAOYSA-N 0.000 description 4
- 239000012312 sodium hydride Substances 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 238000010792 warming Methods 0.000 description 4
- KMDAVIGMFNJEHI-UHFFFAOYSA-N 1-[2-[(3-aminoquinolin-4-yl)amino]ethyl]cyclopropan-1-ol Chemical compound NC1=CN=C2C=CC=CC2=C1NCCC1(O)CC1 KMDAVIGMFNJEHI-UHFFFAOYSA-N 0.000 description 3
- LCMXJURFBWGAQJ-UHFFFAOYSA-N 1-[4-[[2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]methyl]-4-hydroxypiperidin-1-yl]ethanone Chemical compound CCOCC1=NC2=CN=C3C=CC=CC3=C2N1CC1(O)CCN(C(C)=O)CC1 LCMXJURFBWGAQJ-UHFFFAOYSA-N 0.000 description 3
- QDSCXUFQYNSNAM-UHFFFAOYSA-N 1-[[4-amino-2-(chloromethyl)imidazo[4,5-c]quinolin-1-yl]methyl]cyclohexan-1-ol Chemical compound ClCC1=NC=2C(N)=NC3=CC=CC=C3C=2N1CC1(O)CCCCC1 QDSCXUFQYNSNAM-UHFFFAOYSA-N 0.000 description 3
- RTXYIHGMYDJHEU-UHFFFAOYSA-N 2,4-dichloro-3-nitropyridine Chemical compound [O-][N+](=O)C1=C(Cl)C=CN=C1Cl RTXYIHGMYDJHEU-UHFFFAOYSA-N 0.000 description 3
- GSLTVFIVJMCNBH-UHFFFAOYSA-N 2-isocyanatopropane Chemical compound CC(C)N=C=O GSLTVFIVJMCNBH-UHFFFAOYSA-N 0.000 description 3
- JIDPHLLCKDISON-UHFFFAOYSA-N 2h-pyran-4-ol Chemical compound OC1=CCOC=C1 JIDPHLLCKDISON-UHFFFAOYSA-N 0.000 description 3
- FDOIXMGDTOEUQL-UHFFFAOYSA-N 4-chloro-3-nitro-1,5-naphthyridine Chemical compound C1=CC=NC2=C(Cl)C([N+](=O)[O-])=CN=C21 FDOIXMGDTOEUQL-UHFFFAOYSA-N 0.000 description 3
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 3
- XQQPGLWXGOJSKA-UHFFFAOYSA-N 8-[[2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]methyl]-1,4-dioxaspiro[4.5]decan-8-ol Chemical compound CCOCC1=NC2=CN=C3C=CC=CC3=C2N1CC(CC1)(O)CCC21OCCO2 XQQPGLWXGOJSKA-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- 241000725303 Human immunodeficiency virus Species 0.000 description 3
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 3
- 208000036142 Viral infection Diseases 0.000 description 3
- 125000003158 alcohol group Chemical group 0.000 description 3
- CSKNSYBAZOQPLR-UHFFFAOYSA-N benzenesulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=CC=C1 CSKNSYBAZOQPLR-UHFFFAOYSA-N 0.000 description 3
- 229910000085 borane Inorganic materials 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- YOXHCYXIAVIFCZ-UHFFFAOYSA-N cyclopropanol Chemical compound OC1CC1 YOXHCYXIAVIFCZ-UHFFFAOYSA-N 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- AFMDCFOWHWNQBP-UHFFFAOYSA-N ethyl 2-(dibenzylamino)acetate Chemical compound C=1C=CC=CC=1CN(CC(=O)OCC)CC1=CC=CC=C1 AFMDCFOWHWNQBP-UHFFFAOYSA-N 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- 239000012467 final product Substances 0.000 description 3
- 229940047122 interleukins Drugs 0.000 description 3
- 150000002540 isothiocyanates Chemical class 0.000 description 3
- 239000011777 magnesium Substances 0.000 description 3
- 229910052749 magnesium Inorganic materials 0.000 description 3
- 230000001404 mediated effect Effects 0.000 description 3
- HNQIVZYLYMDVSB-UHFFFAOYSA-N methanesulfonimidic acid Chemical compound CS(N)(=O)=O HNQIVZYLYMDVSB-UHFFFAOYSA-N 0.000 description 3
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 3
- 229910003446 platinum oxide Inorganic materials 0.000 description 3
- 235000011056 potassium acetate Nutrition 0.000 description 3
- 238000002953 preparative HPLC Methods 0.000 description 3
- 150000003141 primary amines Chemical class 0.000 description 3
- 230000008569 process Effects 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- 150000003335 secondary amines Chemical class 0.000 description 3
- ARXOYSZUJBSQDM-UHFFFAOYSA-N tert-butyl 4-[[2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]methyl]-4-hydroxypiperidine-1-carboxylate Chemical compound CCOCC1=NC2=CN=C3C=CC=CC3=C2N1CC1(O)CCN(C(=O)OC(C)(C)C)CC1 ARXOYSZUJBSQDM-UHFFFAOYSA-N 0.000 description 3
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 3
- 150000003509 tertiary alcohols Chemical class 0.000 description 3
- 230000001225 therapeutic effect Effects 0.000 description 3
- 238000004809 thin layer chromatography Methods 0.000 description 3
- 230000009466 transformation Effects 0.000 description 3
- 125000002827 triflate group Chemical class FC(S(=O)(=O)O*)(F)F 0.000 description 3
- 230000009385 viral infection Effects 0.000 description 3
- 125000003088 (fluoren-9-ylmethoxy)carbonyl group Chemical group 0.000 description 2
- NDQXKKFRNOPRDW-UHFFFAOYSA-N 1,1,1-triethoxyethane Chemical compound CCOC(C)(OCC)OCC NDQXKKFRNOPRDW-UHFFFAOYSA-N 0.000 description 2
- XUXVVQKJULMMKX-UHFFFAOYSA-N 1,1,1-trimethoxypentane Chemical compound CCCCC(OC)(OC)OC XUXVVQKJULMMKX-UHFFFAOYSA-N 0.000 description 2
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 2
- PAAZPARNPHGIKF-UHFFFAOYSA-N 1,2-dibromoethane Chemical compound BrCCBr PAAZPARNPHGIKF-UHFFFAOYSA-N 0.000 description 2
- NPPUADHLTOJYKK-UHFFFAOYSA-N 1-(1-methoxycyclohexyl)-2-propylimidazo[4,5-c][1,5]naphthyridin-4-amine Chemical compound CCCC1=NC2=C(N)N=C3C=CC=NC3=C2N1C1(OC)CCCCC1 NPPUADHLTOJYKK-UHFFFAOYSA-N 0.000 description 2
- UHORUBYOVZVQKT-UHFFFAOYSA-N 1-(2-aminoethyl)cyclopropan-1-ol Chemical compound NCCC1(O)CC1 UHORUBYOVZVQKT-UHFFFAOYSA-N 0.000 description 2
- WSIGGNHFHXPCIJ-UHFFFAOYSA-N 1-(aminomethyl)cyclohexan-1-amine;dihydrochloride Chemical compound Cl.Cl.NCC1(N)CCCCC1 WSIGGNHFHXPCIJ-UHFFFAOYSA-N 0.000 description 2
- UFRDYBOWVGFYJB-UHFFFAOYSA-N 1-(nitromethyl)cyclobutan-1-ol Chemical compound [O-][N+](=O)CC1(O)CCC1 UFRDYBOWVGFYJB-UHFFFAOYSA-N 0.000 description 2
- BORHRVRLEZGVIM-UHFFFAOYSA-N 1-(nitromethyl)cyclopentan-1-ol Chemical compound [O-][N+](=O)CC1(O)CCCC1 BORHRVRLEZGVIM-UHFFFAOYSA-N 0.000 description 2
- ASOKPJOREAFHNY-UHFFFAOYSA-N 1-Hydroxybenzotriazole Chemical compound C1=CC=C2N(O)N=NC2=C1 ASOKPJOREAFHNY-UHFFFAOYSA-N 0.000 description 2
- UMVTWACRCMSNLN-UHFFFAOYSA-N 1-[(4-amino-2-ethylimidazo[4,5-c][1,5]naphthyridin-1-yl)methyl]cyclopropan-1-ol Chemical compound CCC1=NC2=C(N)N=C3C=CC=NC3=C2N1CC1(O)CC1 UMVTWACRCMSNLN-UHFFFAOYSA-N 0.000 description 2
- HOBAPPWIPRSTDE-UHFFFAOYSA-N 1-[(4-amino-2-methylimidazo[4,5-c]quinolin-1-yl)methyl]cyclobutan-1-ol Chemical compound CC1=NC2=C(N)N=C3C=CC=CC3=C2N1CC1(O)CCC1 HOBAPPWIPRSTDE-UHFFFAOYSA-N 0.000 description 2
- ACHLSHUFVZZWTJ-UHFFFAOYSA-N 1-[(4-amino-2-methylimidazo[4,5-c]quinolin-1-yl)methyl]cyclohexan-1-ol Chemical compound CC1=NC2=C(N)N=C3C=CC=CC3=C2N1CC1(O)CCCCC1 ACHLSHUFVZZWTJ-UHFFFAOYSA-N 0.000 description 2
- MCINRURJDOZTCP-UHFFFAOYSA-N 1-[(4-amino-2-propyl-6,7,8,9-tetrahydroimidazo[4,5-c][1,5]naphthyridin-1-yl)methyl]cyclopentan-1-ol Chemical compound CCCC1=NC2=C(N)N=C3CCCNC3=C2N1CC1(O)CCCC1 MCINRURJDOZTCP-UHFFFAOYSA-N 0.000 description 2
- OKSXWLLAULQKKC-UHFFFAOYSA-N 1-[(4-amino-2-propylimidazo[4,5-c][1,5]naphthyridin-1-yl)methyl]cyclopentan-1-ol Chemical compound CCCC1=NC2=C(N)N=C3C=CC=NC3=C2N1CC1(O)CCCC1 OKSXWLLAULQKKC-UHFFFAOYSA-N 0.000 description 2
- GNSZRKVUZUPOIU-UHFFFAOYSA-N 1-[(4-amino-2-propylimidazo[4,5-c][1,5]naphthyridin-1-yl)methyl]cyclopropan-1-ol Chemical compound CCCC1=NC2=C(N)N=C3C=CC=NC3=C2N1CC1(O)CC1 GNSZRKVUZUPOIU-UHFFFAOYSA-N 0.000 description 2
- NCUBYOWTMOCFKB-UHFFFAOYSA-N 1-[(4-amino-6,7-dimethyl-2-propylimidazo[4,5-c]pyridin-1-yl)methyl]cyclobutan-1-ol Chemical compound CCCC1=NC2=C(N)N=C(C)C(C)=C2N1CC1(O)CCC1 NCUBYOWTMOCFKB-UHFFFAOYSA-N 0.000 description 2
- DBUASXQVHQENAD-UHFFFAOYSA-N 1-[(4-amino-6,7-dimethyl-2-propylimidazo[4,5-c]pyridin-1-yl)methyl]cyclohexan-1-ol Chemical compound CCCC1=NC2=C(N)N=C(C)C(C)=C2N1CC1(O)CCCCC1 DBUASXQVHQENAD-UHFFFAOYSA-N 0.000 description 2
- QRKVEHCFWFUXMJ-UHFFFAOYSA-N 1-[(4-aminoimidazo[4,5-c]quinolin-1-yl)methyl]cyclobutan-1-ol Chemical compound C1=NC=2C(N)=NC3=CC=CC=C3C=2N1CC1(O)CCC1 QRKVEHCFWFUXMJ-UHFFFAOYSA-N 0.000 description 2
- NUQPXJMVJRBSGM-UHFFFAOYSA-N 1-[(4-chloro-2-propylimidazo[4,5-c]quinolin-1-yl)methyl]cyclobutan-1-ol Chemical compound CCCC1=NC2=C(Cl)N=C3C=CC=CC3=C2N1CC1(O)CCC1 NUQPXJMVJRBSGM-UHFFFAOYSA-N 0.000 description 2
- VVBNPSHMCCTHJX-UHFFFAOYSA-N 1-[2-(4-amino-2-methylimidazo[4,5-c]quinolin-1-yl)ethyl]cyclopropan-1-ol Chemical compound CC1=NC2=C(N)N=C3C=CC=CC3=C2N1CCC1(O)CC1 VVBNPSHMCCTHJX-UHFFFAOYSA-N 0.000 description 2
- WNZHHHQDNZDTCP-UHFFFAOYSA-N 1-[2-(4-amino-2-propylimidazo[4,5-c]quinolin-1-yl)ethyl]cyclohexan-1-ol Chemical compound CCCC1=NC2=C(N)N=C3C=CC=CC3=C2N1CCC1(O)CCCCC1 WNZHHHQDNZDTCP-UHFFFAOYSA-N 0.000 description 2
- ZXDZVERSDOMZHA-UHFFFAOYSA-N 1-[2-[4-amino-2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]ethyl]cyclohexan-1-ol Chemical compound CCOCC1=NC2=C(N)N=C3C=CC=CC3=C2N1CCC1(O)CCCCC1 ZXDZVERSDOMZHA-UHFFFAOYSA-N 0.000 description 2
- FFZGAYUQQLZOME-UHFFFAOYSA-N 1-[2-[4-amino-2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]ethyl]cyclopropan-1-ol Chemical compound CCOCC1=NC2=C(N)N=C3C=CC=CC3=C2N1CCC1(O)CC1 FFZGAYUQQLZOME-UHFFFAOYSA-N 0.000 description 2
- IKBBJYGVTOJGIL-UHFFFAOYSA-N 1-[3-(4-amino-2-propylimidazo[4,5-c]quinolin-1-yl)propyl]cyclohexan-1-ol Chemical compound CCCC1=NC2=C(N)N=C3C=CC=CC3=C2N1CCCC1(O)CCCCC1 IKBBJYGVTOJGIL-UHFFFAOYSA-N 0.000 description 2
- IZKUCZQUXWNXGE-UHFFFAOYSA-N 1-[3-[4-amino-2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]propyl]cyclohexan-1-ol Chemical compound CCOCC1=NC2=C(N)N=C3C=CC=CC3=C2N1CCCC1(O)CCCCC1 IZKUCZQUXWNXGE-UHFFFAOYSA-N 0.000 description 2
- NZVDSMJMIVUTKN-UHFFFAOYSA-N 1-[4-[[4-amino-2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]methyl]-4-(2-methylsulfonylethoxy)piperidin-1-yl]ethanone Chemical compound CCOCC1=NC2=C(N)N=C3C=CC=CC3=C2N1CC1(OCCS(C)(=O)=O)CCN(C(C)=O)CC1 NZVDSMJMIVUTKN-UHFFFAOYSA-N 0.000 description 2
- RRAYPGCZLBQJDN-UHFFFAOYSA-N 1-[[(2-chloro-5,6-dimethyl-3-nitropyridin-4-yl)amino]methyl]cyclohexan-1-ol Chemical compound CC1=NC(Cl)=C([N+]([O-])=O)C(NCC2(O)CCCCC2)=C1C RRAYPGCZLBQJDN-UHFFFAOYSA-N 0.000 description 2
- LNLNXIZDDYOCQD-UHFFFAOYSA-N 1-[[(3-aminoquinolin-4-yl)amino]methyl]cyclohexan-1-ol Chemical compound NC1=CN=C2C=CC=CC2=C1NCC1(O)CCCCC1 LNLNXIZDDYOCQD-UHFFFAOYSA-N 0.000 description 2
- NSSGBEGUHIHECL-UHFFFAOYSA-N 1-[[(3-aminoquinolin-4-yl)amino]methyl]cyclopropan-1-ol Chemical compound NC1=CN=C2C=CC=CC2=C1NCC1(O)CC1 NSSGBEGUHIHECL-UHFFFAOYSA-N 0.000 description 2
- HKDXGTDVUVVEGG-UHFFFAOYSA-N 1-[[(3-nitro-1,5-naphthyridin-4-yl)amino]methyl]cyclohexan-1-ol Chemical compound [O-][N+](=O)C=1C=NC2=CC=CN=C2C=1NCC1(O)CCCCC1 HKDXGTDVUVVEGG-UHFFFAOYSA-N 0.000 description 2
- ZWVSAAKVTUGQFR-UHFFFAOYSA-N 1-[[(3-nitroquinolin-4-yl)amino]methyl]cyclobutan-1-ol Chemical compound [O-][N+](=O)C=1C=NC2=CC=CC=C2C=1NCC1(O)CCC1 ZWVSAAKVTUGQFR-UHFFFAOYSA-N 0.000 description 2
- AJPFPTNCVOTWRH-UHFFFAOYSA-N 1-[[(3-nitroquinolin-4-yl)amino]methyl]cyclopentan-1-ol Chemical compound [O-][N+](=O)C=1C=NC2=CC=CC=C2C=1NCC1(O)CCCC1 AJPFPTNCVOTWRH-UHFFFAOYSA-N 0.000 description 2
- CMLYNYVNXSKHQY-UHFFFAOYSA-N 1-[[2-(ethoxymethyl)imidazo[4,5-c][1,5]naphthyridin-1-yl]methyl]cyclohexan-1-ol Chemical compound CCOCC1=NC2=CN=C3C=CC=NC3=C2N1CC1(O)CCCCC1 CMLYNYVNXSKHQY-UHFFFAOYSA-N 0.000 description 2
- FLKAWAFNTSAVJS-UHFFFAOYSA-N 1-[[4-(dibenzylamino)-2-(ethoxymethyl)-6,7-dimethylimidazo[4,5-c]pyridin-1-yl]methyl]cyclohexan-1-ol Chemical compound CCOCC1=NC2=C(N(CC=3C=CC=CC=3)CC=3C=CC=CC=3)N=C(C)C(C)=C2N1CC1(O)CCCCC1 FLKAWAFNTSAVJS-UHFFFAOYSA-N 0.000 description 2
- AJAGZBSDHNKXKZ-UHFFFAOYSA-N 1-[[4-amino-2-(chloromethyl)imidazo[4,5-c]quinolin-1-yl]methyl]cyclobutan-1-ol Chemical compound ClCC1=NC=2C(N)=NC3=CC=CC=C3C=2N1CC1(O)CCC1 AJAGZBSDHNKXKZ-UHFFFAOYSA-N 0.000 description 2
- PCGYREPASPCJJF-UHFFFAOYSA-N 1-[[4-amino-2-(ethoxymethyl)-6,7-dimethylimidazo[4,5-c]pyridin-1-yl]methyl]cyclobutan-1-ol Chemical compound CCOCC1=NC2=C(N)N=C(C)C(C)=C2N1CC1(O)CCC1 PCGYREPASPCJJF-UHFFFAOYSA-N 0.000 description 2
- FLJQYCOTUJLGSN-UHFFFAOYSA-N 1-[[4-amino-2-(ethoxymethyl)imidazo[4,5-c][1,5]naphthyridin-1-yl]methyl]cyclobutan-1-ol Chemical compound CCOCC1=NC2=C(N)N=C3C=CC=NC3=C2N1CC1(O)CCC1 FLJQYCOTUJLGSN-UHFFFAOYSA-N 0.000 description 2
- IVXUYBUKAFFWBF-UHFFFAOYSA-N 1-[[4-amino-2-(ethoxymethyl)imidazo[4,5-c][1,5]naphthyridin-1-yl]methyl]cyclohexan-1-ol Chemical compound CCOCC1=NC2=C(N)N=C3C=CC=NC3=C2N1CC1(O)CCCCC1 IVXUYBUKAFFWBF-UHFFFAOYSA-N 0.000 description 2
- HWBJXBIUTJFZPT-UHFFFAOYSA-N 1-[[4-amino-2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]methyl]cyclobutan-1-ol Chemical compound CCOCC1=NC2=C(N)N=C3C=CC=CC3=C2N1CC1(O)CCC1 HWBJXBIUTJFZPT-UHFFFAOYSA-N 0.000 description 2
- QOKHQNOTMQXTQZ-UHFFFAOYSA-N 1-[[4-amino-2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]methyl]cyclopropan-1-ol Chemical compound CCOCC1=NC2=C(N)N=C3C=CC=CC3=C2N1CC1(O)CC1 QOKHQNOTMQXTQZ-UHFFFAOYSA-N 0.000 description 2
- RPOAINYPQNKLKR-UHFFFAOYSA-N 1-[[4-amino-2-(hydroxymethyl)imidazo[4,5-c]quinolin-1-yl]methyl]cyclobutan-1-ol Chemical compound OCC1=NC=2C(N)=NC3=CC=CC=C3C=2N1CC1(O)CCC1 RPOAINYPQNKLKR-UHFFFAOYSA-N 0.000 description 2
- YMKWTWVPHJHFNS-UHFFFAOYSA-N 1-[[4-amino-2-(hydroxymethyl)imidazo[4,5-c]quinolin-1-yl]methyl]cyclohexan-1-ol Chemical compound OCC1=NC=2C(N)=NC3=CC=CC=C3C=2N1CC1(O)CCCCC1 YMKWTWVPHJHFNS-UHFFFAOYSA-N 0.000 description 2
- REUXKAQNJDAQJE-UHFFFAOYSA-N 1-[[[2-(dibenzylamino)-5,6-dimethyl-3-nitropyridin-4-yl]amino]methyl]cyclohexan-1-ol Chemical compound [O-][N+](=O)C=1C(NCC2(O)CCCCC2)=C(C)C(C)=NC=1N(CC=1C=CC=CC=1)CC1=CC=CC=C1 REUXKAQNJDAQJE-UHFFFAOYSA-N 0.000 description 2
- HUMMCZRNZCKXHL-UHFFFAOYSA-N 1-aminocyclohexane-1-carbonitrile Chemical compound N#CC1(N)CCCCC1 HUMMCZRNZCKXHL-UHFFFAOYSA-N 0.000 description 2
- WUIJTQZXUURFQU-UHFFFAOYSA-N 1-methylsulfonylethene Chemical compound CS(=O)(=O)C=C WUIJTQZXUURFQU-UHFFFAOYSA-N 0.000 description 2
- ZSLKGUQYEQVKQE-UHFFFAOYSA-N 1-prop-2-enylcyclohexan-1-ol Chemical compound C=CCC1(O)CCCCC1 ZSLKGUQYEQVKQE-UHFFFAOYSA-N 0.000 description 2
- UHUHBFMZVCOEOV-UHFFFAOYSA-N 1h-imidazo[4,5-c]pyridin-4-amine Chemical class NC1=NC=CC2=C1N=CN2 UHUHBFMZVCOEOV-UHFFFAOYSA-N 0.000 description 2
- CEGLXJGCOGYSFS-UHFFFAOYSA-N 2,4-dichloro-5,6-dimethyl-3-nitropyridine Chemical compound CC1=NC(Cl)=C([N+]([O-])=O)C(Cl)=C1C CEGLXJGCOGYSFS-UHFFFAOYSA-N 0.000 description 2
- VKIFKIOUKFOASD-UHFFFAOYSA-N 2-(ethoxymethyl)-1-[(1-methoxycyclopentyl)methyl]imidazo[4,5-c]quinolin-4-amine Chemical compound CCOCC1=NC2=C(N)N=C3C=CC=CC3=C2N1CC1(OC)CCCC1 VKIFKIOUKFOASD-UHFFFAOYSA-N 0.000 description 2
- UUOLETYDNTVQDY-UHFFFAOYSA-N 2-chloro-3-nitropyridine Chemical compound [O-][N+](=O)C1=CC=CN=C1Cl UUOLETYDNTVQDY-UHFFFAOYSA-N 0.000 description 2
- ULQQGOGMQRGFFR-UHFFFAOYSA-N 2-chlorobenzenecarboperoxoic acid Chemical compound OOC(=O)C1=CC=CC=C1Cl ULQQGOGMQRGFFR-UHFFFAOYSA-N 0.000 description 2
- XWKFPIODWVPXLX-UHFFFAOYSA-N 2-methyl-5-methylpyridine Natural products CC1=CC=C(C)N=C1 XWKFPIODWVPXLX-UHFFFAOYSA-N 0.000 description 2
- FWDYVLKHYYQFGA-UHFFFAOYSA-N 3-[1-[tert-butyl(dimethyl)silyl]oxycyclohexyl]propan-1-amine Chemical compound CC(C)(C)[Si](C)(C)OC1(CCCN)CCCCC1 FWDYVLKHYYQFGA-UHFFFAOYSA-N 0.000 description 2
- WNKMDJZQSYQGJK-UHFFFAOYSA-N 3-[1-[tert-butyl(dimethyl)silyl]oxycyclohexyl]propan-1-ol Chemical compound CC(C)(C)[Si](C)(C)OC1(CCCO)CCCCC1 WNKMDJZQSYQGJK-UHFFFAOYSA-N 0.000 description 2
- PBKXSAQAZBNXNT-UHFFFAOYSA-N 3-[1-[tert-butyl(dimethyl)silyl]oxycyclohexyl]propyl methanesulfonate Chemical compound CS(=O)(=O)OCCCC1(O[Si](C)(C)C(C)(C)C)CCCCC1 PBKXSAQAZBNXNT-UHFFFAOYSA-N 0.000 description 2
- JSMDUOFOPDSKIQ-UHFFFAOYSA-N 3-methoxypropanoyl chloride Chemical compound COCCC(Cl)=O JSMDUOFOPDSKIQ-UHFFFAOYSA-N 0.000 description 2
- HVAGLCLPZYKTQQ-UHFFFAOYSA-N 4-(nitromethyl)oxan-4-ol Chemical compound [O-][N+](=O)CC1(O)CCOCC1 HVAGLCLPZYKTQQ-UHFFFAOYSA-N 0.000 description 2
- YEJRWHAVMIAJKC-UHFFFAOYSA-N 4-Butyrolactone Chemical compound O=C1CCCO1 YEJRWHAVMIAJKC-UHFFFAOYSA-N 0.000 description 2
- QMQWFCWNCQZZIX-UHFFFAOYSA-N 4-[(4-amino-2-ethylimidazo[4,5-c][1,5]naphthyridin-1-yl)methyl]oxan-4-ol Chemical compound CCC1=NC2=C(N)N=C3C=CC=NC3=C2N1CC1(O)CCOCC1 QMQWFCWNCQZZIX-UHFFFAOYSA-N 0.000 description 2
- SMRIKXUKFHNOHZ-UHFFFAOYSA-N 4-[(4-amino-2-ethylimidazo[4,5-c]quinolin-1-yl)methyl]oxan-4-ol Chemical compound CCC1=NC2=C(N)N=C3C=CC=CC3=C2N1CC1(O)CCOCC1 SMRIKXUKFHNOHZ-UHFFFAOYSA-N 0.000 description 2
- ZIWZFHFYMAWHKZ-UHFFFAOYSA-N 4-[(4-amino-2-propylimidazo[4,5-c]quinolin-1-yl)methyl]oxan-4-ol Chemical compound CCCC1=NC2=C(N)N=C3C=CC=CC3=C2N1CC1(O)CCOCC1 ZIWZFHFYMAWHKZ-UHFFFAOYSA-N 0.000 description 2
- XVSYWWAKDBOYFW-UHFFFAOYSA-N 4-[(4-aminoimidazo[4,5-c][1,5]naphthyridin-1-yl)methyl]oxan-4-ol Chemical compound C1=NC=2C(N)=NC3=CC=CN=C3C=2N1CC1(O)CCOCC1 XVSYWWAKDBOYFW-UHFFFAOYSA-N 0.000 description 2
- DIWVJHHZCKZHIN-UHFFFAOYSA-N 4-[2-(4-amino-2-propylimidazo[4,5-c]quinolin-1-yl)ethyl]oxan-4-ol Chemical compound CCCC1=NC2=C(N)N=C3C=CC=CC3=C2N1CCC1(O)CCOCC1 DIWVJHHZCKZHIN-UHFFFAOYSA-N 0.000 description 2
- VHGHHUYSIWDFOY-UHFFFAOYSA-N 4-[[(3-amino-1,5-naphthyridin-4-yl)amino]methyl]oxan-4-ol Chemical compound NC1=CN=C2C=CC=NC2=C1NCC1(O)CCOCC1 VHGHHUYSIWDFOY-UHFFFAOYSA-N 0.000 description 2
- ONXUZOWZBGAAIL-UHFFFAOYSA-N 4-[[(3-nitroquinolin-4-yl)amino]methyl]oxan-4-ol Chemical compound [O-][N+](=O)C=1C=NC2=CC=CC=C2C=1NCC1(O)CCOCC1 ONXUZOWZBGAAIL-UHFFFAOYSA-N 0.000 description 2
- DZCSODIENATSOR-UHFFFAOYSA-N 4-[[2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]methyl]oxan-4-ol Chemical compound CCOCC1=NC2=CN=C3C=CC=CC3=C2N1CC1(O)CCOCC1 DZCSODIENATSOR-UHFFFAOYSA-N 0.000 description 2
- RZXHAJFRBLLWNF-UHFFFAOYSA-N 4-[[2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]methyl]piperidin-4-ol Chemical compound CCOCC1=NC2=CN=C3C=CC=CC3=C2N1CC1(O)CCNCC1 RZXHAJFRBLLWNF-UHFFFAOYSA-N 0.000 description 2
- BJZOWVMZSMQHQU-UHFFFAOYSA-N 4-[[4-amino-2-(2-methoxyethyl)imidazo[4,5-c]quinolin-1-yl]methyl]oxan-4-ol Chemical compound COCCC1=NC2=C(N)N=C3C=CC=CC3=C2N1CC1(O)CCOCC1 BJZOWVMZSMQHQU-UHFFFAOYSA-N 0.000 description 2
- JGFSLWFEJMPCDT-UHFFFAOYSA-N 4-[[4-amino-2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]methyl]-1-methylsulfonylpiperidin-4-ol Chemical compound CCOCC1=NC2=C(N)N=C3C=CC=CC3=C2N1CC1(O)CCN(S(C)(=O)=O)CC1 JGFSLWFEJMPCDT-UHFFFAOYSA-N 0.000 description 2
- FQYRLEXKXQRZDH-UHFFFAOYSA-N 4-aminoquinoline Chemical class C1=CC=C2C(N)=CC=NC2=C1 FQYRLEXKXQRZDH-UHFFFAOYSA-N 0.000 description 2
- 229960000549 4-dimethylaminophenol Drugs 0.000 description 2
- LXJYSQGCJGEDBZ-UHFFFAOYSA-N 8-(aminomethyl)-1,4-dioxaspiro[4.5]decan-8-ol Chemical compound C1CC(CN)(O)CCC21OCCO2 LXJYSQGCJGEDBZ-UHFFFAOYSA-N 0.000 description 2
- HUDVAVREBBQAOY-UHFFFAOYSA-N 8-(nitromethyl)-1,4-dioxaspiro[4.5]decan-8-ol Chemical compound C1CC(O)(C[N+]([O-])=O)CCC21OCCO2 HUDVAVREBBQAOY-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- ATRRKUHOCOJYRX-UHFFFAOYSA-N Ammonium bicarbonate Chemical compound [NH4+].OC([O-])=O ATRRKUHOCOJYRX-UHFFFAOYSA-N 0.000 description 2
- OJRUSAPKCPIVBY-KQYNXXCUSA-N C1=NC2=C(N=C(N=C2N1[C@H]3[C@@H]([C@@H]([C@H](O3)COP(=O)(CP(=O)(O)O)O)O)O)I)N Chemical compound C1=NC2=C(N=C(N=C2N1[C@H]3[C@@H]([C@@H]([C@H](O3)COP(=O)(CP(=O)(O)O)O)O)O)I)N OJRUSAPKCPIVBY-KQYNXXCUSA-N 0.000 description 2
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 2
- 241000606161 Chlamydia Species 0.000 description 2
- 206010008631 Cholera Diseases 0.000 description 2
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 2
- 206010012438 Dermatitis atopic Diseases 0.000 description 2
- 241000709661 Enterovirus Species 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- 108010002352 Interleukin-1 Proteins 0.000 description 2
- 102000000589 Interleukin-1 Human genes 0.000 description 2
- 102000013462 Interleukin-12 Human genes 0.000 description 2
- 108010065805 Interleukin-12 Proteins 0.000 description 2
- 108090001005 Interleukin-6 Proteins 0.000 description 2
- 102000004889 Interleukin-6 Human genes 0.000 description 2
- 229910017974 NH40H Inorganic materials 0.000 description 2
- MWUXSHHQAYIFBG-UHFFFAOYSA-N Nitric oxide Chemical compound O=[N] MWUXSHHQAYIFBG-UHFFFAOYSA-N 0.000 description 2
- 241001631646 Papillomaviridae Species 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- 241000725643 Respiratory syncytial virus Species 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- 241000700605 Viruses Species 0.000 description 2
- 208000003152 Yellow Fever Diseases 0.000 description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 2
- 150000008065 acid anhydrides Chemical class 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 125000004423 acyloxy group Chemical group 0.000 description 2
- YKIOKAURTKXMSB-UHFFFAOYSA-N adams's catalyst Chemical compound O=[Pt]=O YKIOKAURTKXMSB-UHFFFAOYSA-N 0.000 description 2
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 2
- 239000001099 ammonium carbonate Substances 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 239000003443 antiviral agent Substances 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 201000008937 atopic dermatitis Diseases 0.000 description 2
- 210000003719 b-lymphocyte Anatomy 0.000 description 2
- 230000001580 bacterial effect Effects 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 125000001589 carboacyl group Chemical group 0.000 description 2
- 125000002837 carbocyclic group Chemical group 0.000 description 2
- 239000003638 chemical reducing agent Substances 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 238000003776 cleavage reaction Methods 0.000 description 2
- 229940125758 compound 15 Drugs 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- BGTOWKSIORTVQH-UHFFFAOYSA-N cyclopentanone Chemical compound O=C1CCCC1 BGTOWKSIORTVQH-UHFFFAOYSA-N 0.000 description 2
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 2
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical group C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 2
- 208000035475 disorder Diseases 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- VFRSADQPWYCXDG-LEUCUCNGSA-N ethyl (2s,5s)-5-methylpyrrolidine-2-carboxylate;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.CCOC(=O)[C@@H]1CC[C@H](C)N1 VFRSADQPWYCXDG-LEUCUCNGSA-N 0.000 description 2
- CEIPQQODRKXDSB-UHFFFAOYSA-N ethyl 3-(6-hydroxynaphthalen-2-yl)-1H-indazole-5-carboximidate dihydrochloride Chemical compound Cl.Cl.C1=C(O)C=CC2=CC(C3=NNC4=CC=C(C=C43)C(=N)OCC)=CC=C21 CEIPQQODRKXDSB-UHFFFAOYSA-N 0.000 description 2
- BBDKGMMFFHIING-UHFFFAOYSA-N ethyl 3-(dibenzylamino)propanoate Chemical compound C=1C=CC=CC=1CN(CCC(=O)OCC)CC1=CC=CC=C1 BBDKGMMFFHIING-UHFFFAOYSA-N 0.000 description 2
- MEHDPHFVOFBZMT-UHFFFAOYSA-N ethyl 4-(aminomethyl)-4-hydroxypiperidine-1-carboxylate Chemical compound CCOC(=O)N1CCC(O)(CN)CC1 MEHDPHFVOFBZMT-UHFFFAOYSA-N 0.000 description 2
- LFPDKXBNISSQKO-UHFFFAOYSA-N ethyl 4-[[4-amino-2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]methyl]-4-hydroxypiperidine-1-carboxylate Chemical compound CCOCC1=NC2=C(N)N=C3C=CC=CC3=C2N1CC1(O)CCN(C(=O)OCC)CC1 LFPDKXBNISSQKO-UHFFFAOYSA-N 0.000 description 2
- REWMGYLEJYCGAM-UHFFFAOYSA-N ethyl 4-hydroxy-4-(nitromethyl)piperidine-1-carboxylate Chemical compound CCOC(=O)N1CCC(O)(C[N+]([O-])=O)CC1 REWMGYLEJYCGAM-UHFFFAOYSA-N 0.000 description 2
- PQJJJMRNHATNKG-UHFFFAOYSA-N ethyl bromoacetate Chemical compound CCOC(=O)CBr PQJJJMRNHATNKG-UHFFFAOYSA-N 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 2
- 208000032839 leukemia Diseases 0.000 description 2
- 239000012280 lithium aluminium hydride Substances 0.000 description 2
- 210000002540 macrophage Anatomy 0.000 description 2
- FRIJBUGBVQZNTB-UHFFFAOYSA-M magnesium;ethane;bromide Chemical compound [Mg+2].[Br-].[CH2-]C FRIJBUGBVQZNTB-UHFFFAOYSA-M 0.000 description 2
- DQEUYIQDSMINEY-UHFFFAOYSA-M magnesium;prop-1-ene;bromide Chemical compound [Mg+2].[Br-].[CH2-]C=C DQEUYIQDSMINEY-UHFFFAOYSA-M 0.000 description 2
- 230000007246 mechanism Effects 0.000 description 2
- PSHKMPUSSFXUIA-UHFFFAOYSA-N n,n-dimethylpyridin-2-amine Chemical compound CN(C)C1=CC=CC=N1 PSHKMPUSSFXUIA-UHFFFAOYSA-N 0.000 description 2
- LWIBIVLIPFTPFC-UHFFFAOYSA-N n-[(1-aminocyclohexyl)methyl]-3-nitroquinolin-4-amine Chemical compound [O-][N+](=O)C=1C=NC2=CC=CC=C2C=1NCC1(N)CCCCC1 LWIBIVLIPFTPFC-UHFFFAOYSA-N 0.000 description 2
- RNZIVWRWKFCVCS-UHFFFAOYSA-N n-[1-[[2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]methyl]cyclohexyl]methanesulfonamide Chemical compound CCOCC1=NC2=CN=C3C=CC=CC3=C2N1CC1(NS(C)(=O)=O)CCCCC1 RNZIVWRWKFCVCS-UHFFFAOYSA-N 0.000 description 2
- WDWYNJRWNXBTJJ-UHFFFAOYSA-N n-[1-[[4-amino-2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]methyl]cyclohexyl]methanesulfonamide Chemical compound CCOCC1=NC2=C(N)N=C3C=CC=CC3=C2N1CC1(NS(C)(=O)=O)CCCCC1 WDWYNJRWNXBTJJ-UHFFFAOYSA-N 0.000 description 2
- YVJDSNJBFUZDKA-UHFFFAOYSA-N n-[[4-amino-1-[(1-hydroxycyclohexyl)methyl]imidazo[4,5-c]quinolin-2-yl]methyl]cyclopropanecarboxamide Chemical compound C1CC1C(=O)NCC1=NC=2C(N)=NC3=CC=CC=C3C=2N1CC1(O)CCCCC1 YVJDSNJBFUZDKA-UHFFFAOYSA-N 0.000 description 2
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- XBXCNNQPRYLIDE-UHFFFAOYSA-M n-tert-butylcarbamate Chemical compound CC(C)(C)NC([O-])=O XBXCNNQPRYLIDE-UHFFFAOYSA-M 0.000 description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 description 2
- 125000002524 organometallic group Chemical group 0.000 description 2
- 150000002905 orthoesters Chemical class 0.000 description 2
- JMJRYTGVHCAYCT-UHFFFAOYSA-N oxan-4-one Chemical compound O=C1CCOCC1 JMJRYTGVHCAYCT-UHFFFAOYSA-N 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 230000003071 parasitic effect Effects 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- DNUTZBZXLPWRJG-UHFFFAOYSA-M piperidine-1-carboxylate Chemical compound [O-]C(=O)N1CCCCC1 DNUTZBZXLPWRJG-UHFFFAOYSA-M 0.000 description 2
- NTTOTNSKUYCDAV-UHFFFAOYSA-N potassium hydride Chemical compound [KH] NTTOTNSKUYCDAV-UHFFFAOYSA-N 0.000 description 2
- 229910000105 potassium hydride Inorganic materials 0.000 description 2
- 150000003138 primary alcohols Chemical class 0.000 description 2
- 102000004196 processed proteins & peptides Human genes 0.000 description 2
- 108090000765 processed proteins & peptides Proteins 0.000 description 2
- LZMATGARSSLFMQ-UHFFFAOYSA-N propan-2-ylurea Chemical compound CC(C)NC(N)=O LZMATGARSSLFMQ-UHFFFAOYSA-N 0.000 description 2
- 238000011321 prophylaxis Methods 0.000 description 2
- 102000004169 proteins and genes Human genes 0.000 description 2
- 108090000623 proteins and genes Proteins 0.000 description 2
- 238000009877 rendering Methods 0.000 description 2
- 230000007017 scission Effects 0.000 description 2
- 201000010153 skin papilloma Diseases 0.000 description 2
- JVBXVOWTABLYPX-UHFFFAOYSA-L sodium dithionite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])=O JVBXVOWTABLYPX-UHFFFAOYSA-L 0.000 description 2
- 125000003003 spiro group Chemical group 0.000 description 2
- 230000002194 synthesizing effect Effects 0.000 description 2
- XYWCDAFPRBDRER-UHFFFAOYSA-N tert-butyl 4-(aminomethyl)-4-hydroxypiperidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCC(O)(CN)CC1 XYWCDAFPRBDRER-UHFFFAOYSA-N 0.000 description 2
- JGJOYHKORNPHGO-UHFFFAOYSA-N tert-butyl 4-[[(3-aminoquinolin-4-yl)amino]methyl]-4-hydroxypiperidine-1-carboxylate Chemical compound C1CN(C(=O)OC(C)(C)C)CCC1(O)CNC1=C(N)C=NC2=CC=CC=C12 JGJOYHKORNPHGO-UHFFFAOYSA-N 0.000 description 2
- DBHFQZMFKNTFPT-UHFFFAOYSA-N tert-butyl 4-[[4-amino-2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]methyl]-4-hydroxypiperidine-1-carboxylate Chemical compound CCOCC1=NC2=C(N)N=C3C=CC=CC3=C2N1CC1(O)CCN(C(=O)OC(C)(C)C)CC1 DBHFQZMFKNTFPT-UHFFFAOYSA-N 0.000 description 2
- AJNCHUMJVPZDCG-UHFFFAOYSA-N tert-butyl 4-hydroxy-4-(nitromethyl)piperidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCC(O)(C[N+]([O-])=O)CC1 AJNCHUMJVPZDCG-UHFFFAOYSA-N 0.000 description 2
- IZKWBNMQQHJFGM-UHFFFAOYSA-N tert-butyl n-[1-[[(3-aminoquinolin-4-yl)amino]methyl]cyclohexyl]carbamate Chemical compound NC=1C=NC2=CC=CC=C2C=1NCC1(NC(=O)OC(C)(C)C)CCCCC1 IZKWBNMQQHJFGM-UHFFFAOYSA-N 0.000 description 2
- MQXHTRHTVPNRQJ-UHFFFAOYSA-N tert-butyl n-[1-[[(3-nitroquinolin-4-yl)amino]methyl]cyclohexyl]carbamate Chemical compound [O-][N+](=O)C=1C=NC2=CC=CC=C2C=1NCC1(NC(=O)OC(C)(C)C)CCCCC1 MQXHTRHTVPNRQJ-UHFFFAOYSA-N 0.000 description 2
- QCIWZIYBBNEPKB-UHFFFAOYSA-N tert-butyl(dimethyl)silane Chemical compound C[SiH](C)C(C)(C)C QCIWZIYBBNEPKB-UHFFFAOYSA-N 0.000 description 2
- BCNZYOJHNLTNEZ-UHFFFAOYSA-N tert-butyldimethylsilyl chloride Chemical compound CC(C)(C)[Si](C)(C)Cl BCNZYOJHNLTNEZ-UHFFFAOYSA-N 0.000 description 2
- 150000003512 tertiary amines Chemical class 0.000 description 2
- FPGGTKZVZWFYPV-UHFFFAOYSA-M tetrabutylammonium fluoride Chemical compound [F-].CCCC[N+](CCCC)(CCCC)CCCC FPGGTKZVZWFYPV-UHFFFAOYSA-M 0.000 description 2
- VXUYXOFXAQZZMF-UHFFFAOYSA-N titanium(IV) isopropoxide Chemical compound CC(C)O[Ti](OC(C)C)(OC(C)C)OC(C)C VXUYXOFXAQZZMF-UHFFFAOYSA-N 0.000 description 2
- 238000009901 transfer hydrogenation reaction Methods 0.000 description 2
- 238000000844 transformation Methods 0.000 description 2
- 241000701161 unidentified adenovirus Species 0.000 description 2
- 239000012646 vaccine adjuvant Substances 0.000 description 2
- 229940124931 vaccine adjuvant Drugs 0.000 description 2
- DTGKSKDOIYIVQL-WEDXCCLWSA-N (+)-borneol Chemical group C1C[C@@]2(C)[C@@H](O)C[C@@H]1C2(C)C DTGKSKDOIYIVQL-WEDXCCLWSA-N 0.000 description 1
- VCGRFBXVSFAGGA-UHFFFAOYSA-N (1,1-dioxo-1,4-thiazinan-4-yl)-[6-[[3-(4-fluorophenyl)-5-methyl-1,2-oxazol-4-yl]methoxy]pyridin-3-yl]methanone Chemical compound CC=1ON=C(C=2C=CC(F)=CC=2)C=1COC(N=C1)=CC=C1C(=O)N1CCS(=O)(=O)CC1 VCGRFBXVSFAGGA-UHFFFAOYSA-N 0.000 description 1
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 description 1
- 125000005988 1,1-dioxo-thiomorpholinyl group Chemical group 0.000 description 1
- LSRVEPKOAZIZPE-UHFFFAOYSA-N 1,2,3,4-tetrahydro-1,8-naphthyridin-4-amine Chemical class C1=CC=C2C(N)CCNC2=N1 LSRVEPKOAZIZPE-UHFFFAOYSA-N 0.000 description 1
- UZAOPTDGCXICDB-UHFFFAOYSA-N 1,2,3,4-tetrahydroquinolin-4-amine Chemical class C1=CC=C2C(N)CCNC2=C1 UZAOPTDGCXICDB-UHFFFAOYSA-N 0.000 description 1
- QWUWMCYKGHVNAV-UHFFFAOYSA-N 1,2-dihydrostilbene Chemical group C=1C=CC=CC=1CCC1=CC=CC=C1 QWUWMCYKGHVNAV-UHFFFAOYSA-N 0.000 description 1
- JPRPJUMQRZTTED-UHFFFAOYSA-N 1,3-dioxolanyl Chemical group [CH]1OCCO1 JPRPJUMQRZTTED-UHFFFAOYSA-N 0.000 description 1
- VKRKCBWIVLSRBJ-UHFFFAOYSA-N 1,4-dioxaspiro[4.5]decan-8-one Chemical compound C1CC(=O)CCC21OCCO2 VKRKCBWIVLSRBJ-UHFFFAOYSA-N 0.000 description 1
- 125000005962 1,4-oxazepanyl group Chemical group 0.000 description 1
- 150000005055 1,5-naphthyridines Chemical class 0.000 description 1
- YJKZDGOMTKOYQK-UHFFFAOYSA-N 1-(2-piperidin-4-ylethyl)imidazo[4,5-c]quinoline Chemical compound C1=NC2=CN=C3C=CC=CC3=C2N1CCC1CCNCC1 YJKZDGOMTKOYQK-UHFFFAOYSA-N 0.000 description 1
- JXJORHGRCCODBV-UHFFFAOYSA-N 1-(aminomethyl)cyclopropan-1-ol Chemical compound NCC1(O)CC1 JXJORHGRCCODBV-UHFFFAOYSA-N 0.000 description 1
- VCBYEQBFSSCIQJ-UHFFFAOYSA-N 1-(ethoxymethyl)imidazo[4,5-c]quinoline Chemical compound C1=CC=CC2=C3N(COCC)C=NC3=CN=C21 VCBYEQBFSSCIQJ-UHFFFAOYSA-N 0.000 description 1
- CKZFCCAINCLTIL-UHFFFAOYSA-N 1-[(2-methylimidazo[4,5-c]quinolin-1-yl)methyl]cyclohexan-1-ol Chemical compound CC1=NC2=CN=C3C=CC=CC3=C2N1CC1(O)CCCCC1 CKZFCCAINCLTIL-UHFFFAOYSA-N 0.000 description 1
- FGGAPCGVBJRFRB-UHFFFAOYSA-N 1-[(2-propylimidazo[4,5-c][1,5]naphthyridin-1-yl)methyl]cyclohexan-1-ol Chemical compound CCCC1=NC2=CN=C3C=CC=NC3=C2N1CC1(O)CCCCC1 FGGAPCGVBJRFRB-UHFFFAOYSA-N 0.000 description 1
- XZSGFEQHOZKSRO-UHFFFAOYSA-N 1-[(4-amino-2,6,7-trimethylimidazo[4,5-c]pyridin-1-yl)methyl]cyclobutan-1-ol Chemical compound CC1=NC2=C(N)N=C(C)C(C)=C2N1CC1(O)CCC1 XZSGFEQHOZKSRO-UHFFFAOYSA-N 0.000 description 1
- MYBXZSFOMBVWQL-UHFFFAOYSA-N 1-[(4-amino-2-propylimidazo[4,5-c][1,5]naphthyridin-1-yl)methyl]cyclohexan-1-ol Chemical compound CCCC1=NC2=C(N)N=C3C=CC=NC3=C2N1CC1(O)CCCCC1 MYBXZSFOMBVWQL-UHFFFAOYSA-N 0.000 description 1
- FZVXLZVLAJLNFL-UHFFFAOYSA-N 1-[(4-amino-2-propylimidazo[4,5-c]quinolin-1-yl)methyl]cyclobutan-1-ol Chemical compound CCCC1=NC2=C(N)N=C3C=CC=CC3=C2N1CC1(O)CCC1 FZVXLZVLAJLNFL-UHFFFAOYSA-N 0.000 description 1
- GQCCIMOHQFVWCW-UHFFFAOYSA-N 1-[(4-aminoimidazo[4,5-c]quinolin-1-yl)methyl]cyclohexan-1-ol Chemical compound C1=NC=2C(N)=NC3=CC=CC=C3C=2N1CC1(O)CCCCC1 GQCCIMOHQFVWCW-UHFFFAOYSA-N 0.000 description 1
- ZVVNOPWOHHMEQL-UHFFFAOYSA-N 1-[1-[[2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]methyl]cyclohexyl]-3-propan-2-ylurea Chemical compound CCOCC1=NC2=CN=C3C=CC=CC3=C2N1CC1(NC(=O)NC(C)C)CCCCC1 ZVVNOPWOHHMEQL-UHFFFAOYSA-N 0.000 description 1
- CCEVSNRMURGTKU-UHFFFAOYSA-N 1-[1-[[4-amino-2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]methyl]cyclohexyl]-1-propan-2-ylurea Chemical compound CCOCC1=NC2=C(N)N=C3C=CC=CC3=C2N1CC1(N(C(C)C)C(N)=O)CCCCC1 CCEVSNRMURGTKU-UHFFFAOYSA-N 0.000 description 1
- SOSMGPAAEJANJN-UHFFFAOYSA-N 1-[2-(2-ethylimidazo[4,5-c]quinolin-1-yl)ethyl]cyclopropan-1-ol Chemical compound CCC1=NC2=CN=C3C=CC=CC3=C2N1CCC1(O)CC1 SOSMGPAAEJANJN-UHFFFAOYSA-N 0.000 description 1
- JRGVNLNJSSJCLX-UHFFFAOYSA-N 1-[2-(4-amino-2-ethylimidazo[4,5-c]quinolin-1-yl)ethyl]cyclopropan-1-ol Chemical compound CCC1=NC2=C(N)N=C3C=CC=CC3=C2N1CCC1(O)CC1 JRGVNLNJSSJCLX-UHFFFAOYSA-N 0.000 description 1
- BPDGHTNVOYBQPH-UHFFFAOYSA-N 1-[2-(4-amino-2-methylimidazo[4,5-c]quinolin-1-yl)ethyl]cyclohexan-1-ol Chemical compound CC1=NC2=C(N)N=C3C=CC=CC3=C2N1CCC1(O)CCCCC1 BPDGHTNVOYBQPH-UHFFFAOYSA-N 0.000 description 1
- VXKDQBUZSZGESV-UHFFFAOYSA-N 1-[2-(dibenzylamino)ethyl]cyclopropan-1-ol Chemical compound C=1C=CC=CC=1CN(CC=1C=CC=CC=1)CCC1(O)CC1 VXKDQBUZSZGESV-UHFFFAOYSA-N 0.000 description 1
- LTAJRDYGXFEZRL-UHFFFAOYSA-N 1-[2-[(3-nitroquinolin-4-yl)amino]ethyl]cyclopropan-1-ol Chemical compound [O-][N+](=O)C=1C=NC2=CC=CC=C2C=1NCCC1(O)CC1 LTAJRDYGXFEZRL-UHFFFAOYSA-N 0.000 description 1
- LKVPDHUDSIPNQS-UHFFFAOYSA-N 1-[2-[2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]ethyl]cyclopropan-1-ol Chemical compound CCOCC1=NC2=CN=C3C=CC=CC3=C2N1CCC1(O)CC1 LKVPDHUDSIPNQS-UHFFFAOYSA-N 0.000 description 1
- ABJMONGPQSBKOI-UHFFFAOYSA-N 1-[3-(4-amino-2-methylimidazo[4,5-c]quinolin-1-yl)propyl]cyclopropan-1-ol Chemical compound CC1=NC2=C(N)N=C3C=CC=CC3=C2N1CCCC1(O)CC1 ABJMONGPQSBKOI-UHFFFAOYSA-N 0.000 description 1
- AVGIZPWNVUXSLH-UHFFFAOYSA-N 1-[3-[2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]propyl]cyclohexan-1-ol Chemical compound CCOCC1=NC2=CN=C3C=CC=CC3=C2N1CCCC1(O)CCCCC1 AVGIZPWNVUXSLH-UHFFFAOYSA-N 0.000 description 1
- JVJMTRVDFJISES-UHFFFAOYSA-N 1-[4-[[2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]methyl]-4-(2-methylsulfonylethoxy)piperidin-1-yl]ethanone Chemical compound CCOCC1=NC2=CN=C3C=CC=CC3=C2N1CC1(OCCS(C)(=O)=O)CCN(C(C)=O)CC1 JVJMTRVDFJISES-UHFFFAOYSA-N 0.000 description 1
- QMPDPPZINVLMPH-UHFFFAOYSA-N 1-[[(3-aminoquinolin-4-yl)amino]methyl]cyclobutan-1-ol Chemical compound NC1=CN=C2C=CC=CC2=C1NCC1(O)CCC1 QMPDPPZINVLMPH-UHFFFAOYSA-N 0.000 description 1
- ABAYXPDXUHPOJV-UHFFFAOYSA-N 1-[[(3-aminoquinolin-4-yl)amino]methyl]cyclopentan-1-ol Chemical compound NC1=CN=C2C=CC=CC2=C1NCC1(O)CCCC1 ABAYXPDXUHPOJV-UHFFFAOYSA-N 0.000 description 1
- VCHCXRBHJKJNCM-UHFFFAOYSA-N 1-[[(3-aminoquinolin-4-yl)amino]methyl]cyclopentan-1-ol;dichloromethane Chemical compound ClCCl.NC1=CN=C2C=CC=CC2=C1NCC1(O)CCCC1 VCHCXRBHJKJNCM-UHFFFAOYSA-N 0.000 description 1
- ACWCVMQOGWDIAS-UHFFFAOYSA-N 1-[[2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]methyl]cyclobutan-1-ol Chemical compound CCOCC1=NC2=CN=C3C=CC=CC3=C2N1CC1(O)CCC1 ACWCVMQOGWDIAS-UHFFFAOYSA-N 0.000 description 1
- OFCKYYPCUPWJMB-UHFFFAOYSA-N 1-[[2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]methyl]cyclopentan-1-ol Chemical compound CCOCC1=NC2=CN=C3C=CC=CC3=C2N1CC1(O)CCCC1 OFCKYYPCUPWJMB-UHFFFAOYSA-N 0.000 description 1
- DFEKZVQVPORRAS-UHFFFAOYSA-N 1-[[2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]methyl]cyclopropan-1-amine;hydrochloride Chemical compound Cl.CCOCC1=NC2=CN=C3C=CC=CC3=C2N1CC1(N)CC1 DFEKZVQVPORRAS-UHFFFAOYSA-N 0.000 description 1
- KCHRVYDXBGDBQE-UHFFFAOYSA-N 1-[[4-(dibenzylamino)-6,7-dimethyl-2-propylimidazo[4,5-c]pyridin-1-yl]methyl]cyclohexan-1-ol Chemical compound CCCC1=NC2=C(N(CC=3C=CC=CC=3)CC=3C=CC=CC=3)N=C(C)C(C)=C2N1CC1(O)CCCCC1 KCHRVYDXBGDBQE-UHFFFAOYSA-N 0.000 description 1
- LDVNPRBAKFWKOA-UHFFFAOYSA-N 1-[[4-amino-2-(ethoxymethyl)-6,7,8,9-tetrahydroimidazo[4,5-c]quinolin-1-yl]methyl]cyclopentan-1-ol Chemical compound CCOCC1=NC2=C(N)N=C3CCCCC3=C2N1CC1(O)CCCC1 LDVNPRBAKFWKOA-UHFFFAOYSA-N 0.000 description 1
- GSXJOYQIIRCYSV-UHFFFAOYSA-N 1-[[4-amino-2-(ethoxymethyl)imidazo[4,5-c][1,5]naphthyridin-1-yl]methyl]cyclopropan-1-ol Chemical compound CCOCC1=NC2=C(N)N=C3C=CC=NC3=C2N1CC1(O)CC1 GSXJOYQIIRCYSV-UHFFFAOYSA-N 0.000 description 1
- GGGZKSVJEXPXFH-UHFFFAOYSA-N 1-[[4-amino-2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]methyl]cyclohexan-1-ol Chemical compound CCOCC1=NC2=C(N)N=C3C=CC=CC3=C2N1CC1(O)CCCCC1 GGGZKSVJEXPXFH-UHFFFAOYSA-N 0.000 description 1
- SSNZHPQEXFYTTM-UHFFFAOYSA-N 1-[[4-amino-2-(hydroxymethyl)imidazo[4,5-c][1,5]naphthyridin-1-yl]methyl]cyclobutan-1-ol Chemical compound OCC1=NC=2C(N)=NC3=CC=CN=C3C=2N1CC1(O)CCC1 SSNZHPQEXFYTTM-UHFFFAOYSA-N 0.000 description 1
- HHIRBXHEYVDUAM-UHFFFAOYSA-N 1-chloro-3-isocyanatobenzene Chemical compound ClC1=CC=CC(N=C=O)=C1 HHIRBXHEYVDUAM-UHFFFAOYSA-N 0.000 description 1
- ADAKRBAJFHTIEW-UHFFFAOYSA-N 1-chloro-4-isocyanatobenzene Chemical compound ClC1=CC=C(N=C=O)C=C1 ADAKRBAJFHTIEW-UHFFFAOYSA-N 0.000 description 1
- LMDZBCPBFSXMTL-UHFFFAOYSA-N 1-ethyl-3-(3-dimethylaminopropyl)carbodiimide Chemical compound CCN=C=NCCCN(C)C LMDZBCPBFSXMTL-UHFFFAOYSA-N 0.000 description 1
- QTQLUUDYDWDXNA-UHFFFAOYSA-N 1-ethyl-4-(1-ethylpyridin-1-ium-4-yl)pyridin-1-ium Chemical compound C1=C[N+](CC)=CC=C1C1=CC=[N+](CC)C=C1 QTQLUUDYDWDXNA-UHFFFAOYSA-N 0.000 description 1
- ZXBJDSANDCPCLD-UHFFFAOYSA-L 1-ethyl-4-(1-ethylpyridin-1-ium-4-yl)pyridin-1-ium;diiodide Chemical compound [I-].[I-].C1=C[N+](CC)=CC=C1C1=CC=[N+](CC)C=C1 ZXBJDSANDCPCLD-UHFFFAOYSA-L 0.000 description 1
- NPOVTGVGOBJZPY-UHFFFAOYSA-N 1-isocyanato-3-methoxybenzene Chemical compound COC1=CC=CC(N=C=O)=C1 NPOVTGVGOBJZPY-UHFFFAOYSA-N 0.000 description 1
- CPPGZWWUPFWALU-UHFFFAOYSA-N 1-isocyanato-3-methylbenzene Chemical compound CC1=CC=CC(N=C=O)=C1 CPPGZWWUPFWALU-UHFFFAOYSA-N 0.000 description 1
- GVUBEJANEHZYPA-UHFFFAOYSA-L 1-octyl-4-(1-octylpyridin-1-ium-4-yl)pyridin-1-ium;dibromide Chemical compound [Br-].[Br-].C1=C[N+](CCCCCCCC)=CC=C1C1=CC=[N+](CCCCCCCC)C=C1 GVUBEJANEHZYPA-UHFFFAOYSA-L 0.000 description 1
- XEZNGIUYQVAUSS-UHFFFAOYSA-N 18-crown-6 Chemical compound C1COCCOCCOCCOCCOCCO1 XEZNGIUYQVAUSS-UHFFFAOYSA-N 0.000 description 1
- YBYIRNPNPLQARY-UHFFFAOYSA-N 1H-indene Chemical group C1=CC=C2CC=CC2=C1 YBYIRNPNPLQARY-UHFFFAOYSA-N 0.000 description 1
- UWDDPORBSKCZQD-UHFFFAOYSA-N 2-(2-methylsulfonylethoxy)piperidine-1-carboxylic acid Chemical compound CS(=O)(=O)CCOC1CCCCN1C(=O)O UWDDPORBSKCZQD-UHFFFAOYSA-N 0.000 description 1
- LEANCXGFUTZVNL-UHFFFAOYSA-N 2-(dibenzylazaniumyl)propanoate Chemical compound C=1C=CC=CC=1CN(C(C)C(O)=O)CC1=CC=CC=C1 LEANCXGFUTZVNL-UHFFFAOYSA-N 0.000 description 1
- XNPQIXOBJWIACG-UHFFFAOYSA-N 2-(ethoxymethyl)-1-(1-methoxycyclohexyl)imidazo[4,5-c][1,5]naphthyridin-4-amine Chemical compound CCOCC1=NC2=C(N)N=C3C=CC=NC3=C2N1C1(OC)CCCCC1 XNPQIXOBJWIACG-UHFFFAOYSA-N 0.000 description 1
- NOYBYBROZHXDCH-UHFFFAOYSA-N 2-(ethoxymethyl)-1-(1-methoxycyclohexyl)imidazo[4,5-c][1,5]naphthyridine Chemical compound CCOCC1=NC2=CN=C3C=CC=NC3=C2N1C1(OC)CCCCC1 NOYBYBROZHXDCH-UHFFFAOYSA-N 0.000 description 1
- OVOMLBFIHRXJFH-UHFFFAOYSA-N 2-(ethoxymethyl)-1-[(1-methoxycyclopentyl)methyl]imidazo[4,5-c]quinoline Chemical compound CCOCC1=NC2=CN=C3C=CC=CC3=C2N1CC1(OC)CCCC1 OVOMLBFIHRXJFH-UHFFFAOYSA-N 0.000 description 1
- SIRRAQQGGCNHQB-UHFFFAOYSA-N 2-chloro-1h-imidazo[4,5-b]pyridine Chemical compound C1=CC=C2NC(Cl)=NC2=N1 SIRRAQQGGCNHQB-UHFFFAOYSA-N 0.000 description 1
- PQZXGIIGQHCVAU-UHFFFAOYSA-N 2-chloro-3-nitroquinoline Chemical compound C1=CC=C2N=C(Cl)C([N+](=O)[O-])=CC2=C1 PQZXGIIGQHCVAU-UHFFFAOYSA-N 0.000 description 1
- NILLIUYSJFTTRH-UHFFFAOYSA-N 2-cyclopentylacetyl chloride Chemical compound ClC(=O)CC1CCCC1 NILLIUYSJFTTRH-UHFFFAOYSA-N 0.000 description 1
- SQUDOXXJNCERBW-UHFFFAOYSA-N 2-ethoxy-n-[4-[2-(1-hydroxycyclopropyl)ethylamino]quinolin-3-yl]acetamide;hydrochloride Chemical compound Cl.CCOCC(=O)NC1=CN=C2C=CC=CC2=C1NCCC1(O)CC1 SQUDOXXJNCERBW-UHFFFAOYSA-N 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- 125000004200 2-methoxyethyl group Chemical group [H]C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 1
- WHIHIKVIWVIIER-UHFFFAOYSA-N 3-chlorobenzoyl chloride Chemical compound ClC(=O)C1=CC=CC(Cl)=C1 WHIHIKVIWVIIER-UHFFFAOYSA-N 0.000 description 1
- RPESZQVUWMFBEO-UHFFFAOYSA-N 3-cyanobenzoyl chloride Chemical compound ClC(=O)C1=CC=CC(C#N)=C1 RPESZQVUWMFBEO-UHFFFAOYSA-N 0.000 description 1
- RUQIUASLAXJZIE-UHFFFAOYSA-N 3-methoxybenzoyl chloride Chemical compound COC1=CC=CC(C(Cl)=O)=C1 RUQIUASLAXJZIE-UHFFFAOYSA-N 0.000 description 1
- FULSSJUSJYSWAE-UHFFFAOYSA-N 3h-imidazo[4,5-c][1,5]naphthyridin-4-amine Chemical class NC1=NC2=CC=CN=C2C2=C1N=CN2 FULSSJUSJYSWAE-UHFFFAOYSA-N 0.000 description 1
- KGEGVJJFFQXJTG-UHFFFAOYSA-N 3h-imidazo[4,5-c][1,8]naphthyridin-4-amine Chemical compound NC1=NC2=NC=CC=C2C2=C1N=CN2 KGEGVJJFFQXJTG-UHFFFAOYSA-N 0.000 description 1
- ZBNWAYGRNUZHCX-UHFFFAOYSA-N 4-(imidazo[4,5-c][1,5]naphthyridin-1-ylmethyl)oxan-4-ol Chemical compound C1=NC2=CN=C3C=CC=NC3=C2N1CC1(O)CCOCC1 ZBNWAYGRNUZHCX-UHFFFAOYSA-N 0.000 description 1
- CQLIOIITJCEGJF-UHFFFAOYSA-N 4-[(2-ethylimidazo[4,5-c][1,5]naphthyridin-1-yl)methyl]oxan-4-ol Chemical compound CCC1=NC2=CN=C3C=CC=NC3=C2N1CC1(O)CCOCC1 CQLIOIITJCEGJF-UHFFFAOYSA-N 0.000 description 1
- OTCGROPABADPDN-UHFFFAOYSA-N 4-[(2-ethylimidazo[4,5-c]quinolin-1-yl)methyl]oxan-4-ol Chemical compound CCC1=NC2=CN=C3C=CC=CC3=C2N1CC1(O)CCOCC1 OTCGROPABADPDN-UHFFFAOYSA-N 0.000 description 1
- WVMDTOODNGNSBX-UHFFFAOYSA-N 4-[(2-methylimidazo[4,5-c]quinolin-1-yl)methyl]oxan-4-ol Chemical compound CC1=NC2=CN=C3C=CC=CC3=C2N1CC1(O)CCOCC1 WVMDTOODNGNSBX-UHFFFAOYSA-N 0.000 description 1
- FLGKIVSQDRTUPD-UHFFFAOYSA-N 4-[(2-propylimidazo[4,5-c]quinolin-1-yl)methyl]oxan-4-ol Chemical compound CCCC1=NC2=CN=C3C=CC=CC3=C2N1CC1(O)CCOCC1 FLGKIVSQDRTUPD-UHFFFAOYSA-N 0.000 description 1
- XYRZUKZIRPVUPG-UHFFFAOYSA-N 4-[(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)methyl]oxan-4-ol Chemical compound CCCCC1=NC2=C(N)N=C3C=CC=CC3=C2N1CC1(O)CCOCC1 XYRZUKZIRPVUPG-UHFFFAOYSA-N 0.000 description 1
- WIZUBLDHZBDUDG-UHFFFAOYSA-N 4-[(4-amino-2-methylimidazo[4,5-c]quinolin-1-yl)methyl]oxan-4-ol Chemical compound CC1=NC2=C(N)N=C3C=CC=CC3=C2N1CC1(O)CCOCC1 WIZUBLDHZBDUDG-UHFFFAOYSA-N 0.000 description 1
- VBVQSUGQGFFSQE-UHFFFAOYSA-N 4-[(4-amino-2-propylimidazo[4,5-c][1,5]naphthyridin-1-yl)methyl]oxan-4-ol Chemical compound CCCC1=NC2=C(N)N=C3C=CC=NC3=C2N1CC1(O)CCOCC1 VBVQSUGQGFFSQE-UHFFFAOYSA-N 0.000 description 1
- MWLSZQMMXZPRKP-UHFFFAOYSA-N 4-[2-(2-ethylimidazo[4,5-c]quinolin-1-yl)ethyl]oxan-4-ol Chemical compound CCC1=NC2=CN=C3C=CC=CC3=C2N1CCC1(O)CCOCC1 MWLSZQMMXZPRKP-UHFFFAOYSA-N 0.000 description 1
- POSIKGZRJGRJLO-UHFFFAOYSA-N 4-[2-(2-methylimidazo[4,5-c]quinolin-1-yl)ethyl]oxan-4-ol Chemical compound CC1=NC2=CN=C3C=CC=CC3=C2N1CCC1(O)CCOCC1 POSIKGZRJGRJLO-UHFFFAOYSA-N 0.000 description 1
- TZVNUCOKDFCWGG-UHFFFAOYSA-N 4-[2-(4-amino-2-ethylimidazo[4,5-c]quinolin-1-yl)ethyl]oxan-4-ol Chemical compound CCC1=NC2=C(N)N=C3C=CC=CC3=C2N1CCC1(O)CCOCC1 TZVNUCOKDFCWGG-UHFFFAOYSA-N 0.000 description 1
- JCFFFCQLGAWJPC-UHFFFAOYSA-N 4-[2-(4-amino-2-methylimidazo[4,5-c]quinolin-1-yl)ethyl]oxan-4-ol Chemical compound CC1=NC2=C(N)N=C3C=CC=CC3=C2N1CCC1(O)CCOCC1 JCFFFCQLGAWJPC-UHFFFAOYSA-N 0.000 description 1
- YEPRWDYFYQSGPO-UHFFFAOYSA-N 4-[2-[(3-nitroquinolin-4-yl)amino]ethyl]oxan-4-ol Chemical compound [O-][N+](=O)C=1C=NC2=CC=CC=C2C=1NCCC1(O)CCOCC1 YEPRWDYFYQSGPO-UHFFFAOYSA-N 0.000 description 1
- GDCJPIAJDKZTEF-UHFFFAOYSA-N 4-[[2-(2-methoxyethyl)imidazo[4,5-c]quinolin-1-yl]methyl]oxan-4-ol Chemical compound COCCC1=NC2=CN=C3C=CC=CC3=C2N1CC1(O)CCOCC1 GDCJPIAJDKZTEF-UHFFFAOYSA-N 0.000 description 1
- QRGAMOULNHJZTO-UHFFFAOYSA-N 4-[[2-(chloromethyl)imidazo[4,5-c]quinolin-1-yl]methyl]oxan-4-ol Chemical compound ClCC1=NC2=CN=C3C=CC=CC3=C2N1CC1(O)CCOCC1 QRGAMOULNHJZTO-UHFFFAOYSA-N 0.000 description 1
- YXIZJZHHUDNEMY-UHFFFAOYSA-N 4-[[2-(ethoxymethyl)imidazo[4,5-c][1,5]naphthyridin-1-yl]methyl]oxan-4-ol Chemical compound CCOCC1=NC2=CN=C3C=CC=NC3=C2N1CC1(O)CCOCC1 YXIZJZHHUDNEMY-UHFFFAOYSA-N 0.000 description 1
- DTHMZBIOXAAEOK-UHFFFAOYSA-N 4-[[4-amino-2-(2-hydroxyethyl)imidazo[4,5-c][1,5]naphthyridin-1-yl]methyl]oxan-4-ol Chemical compound OCCC1=NC=2C(N)=NC3=CC=CN=C3C=2N1CC1(O)CCOCC1 DTHMZBIOXAAEOK-UHFFFAOYSA-N 0.000 description 1
- GDPKTEKIQSSWSV-UHFFFAOYSA-N 4-[[4-amino-2-(2-hydroxyethyl)imidazo[4,5-c]quinolin-1-yl]methyl]oxan-4-ol Chemical compound OCCC1=NC=2C(N)=NC3=CC=CC=C3C=2N1CC1(O)CCOCC1 GDPKTEKIQSSWSV-UHFFFAOYSA-N 0.000 description 1
- FBFCNKMYYFQOEP-UHFFFAOYSA-N 4-[[4-amino-2-(2-methoxyethyl)imidazo[4,5-c][1,5]naphthyridin-1-yl]methyl]oxan-4-ol Chemical compound COCCC1=NC2=C(N)N=C3C=CC=NC3=C2N1CC1(O)CCOCC1 FBFCNKMYYFQOEP-UHFFFAOYSA-N 0.000 description 1
- BJBRZVHHGWSJIN-UHFFFAOYSA-N 4-[[4-amino-2-(3-hydroxypropyl)imidazo[4,5-c][1,5]naphthyridin-1-yl]methyl]oxan-4-ol Chemical compound OCCCC1=NC=2C(N)=NC3=CC=CN=C3C=2N1CC1(O)CCOCC1 BJBRZVHHGWSJIN-UHFFFAOYSA-N 0.000 description 1
- QSCFNEWNIDXPNP-UHFFFAOYSA-N 4-[[4-amino-2-(chloromethyl)imidazo[4,5-c]quinolin-1-yl]methyl]oxan-4-ol;hydrochloride Chemical compound Cl.ClCC1=NC=2C(N)=NC3=CC=CC=C3C=2N1CC1(O)CCOCC1 QSCFNEWNIDXPNP-UHFFFAOYSA-N 0.000 description 1
- QKVWBPILRJUACW-UHFFFAOYSA-N 4-[[4-amino-2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]methyl]oxan-4-ol Chemical compound CCOCC1=NC2=C(N)N=C3C=CC=CC3=C2N1CC1(O)CCOCC1 QKVWBPILRJUACW-UHFFFAOYSA-N 0.000 description 1
- ZKPWKBNDFAGPEO-UHFFFAOYSA-N 4-[[4-amino-2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]methyl]piperidin-4-ol Chemical compound CCOCC1=NC2=C(N)N=C3C=CC=CC3=C2N1CC1(O)CCNCC1 ZKPWKBNDFAGPEO-UHFFFAOYSA-N 0.000 description 1
- HQUNYGFYFGYNHV-UHFFFAOYSA-N 4-[[4-amino-2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]methyl]piperidin-4-ol;dihydrochloride Chemical compound Cl.Cl.CCOCC1=NC2=C(N)N=C3C=CC=CC3=C2N1CC1(O)CCNCC1 HQUNYGFYFGYNHV-UHFFFAOYSA-N 0.000 description 1
- DHIPEYBIPDXUEH-UHFFFAOYSA-N 4-[[4-amino-2-(hydroxymethyl)imidazo[4,5-c][1,5]naphthyridin-1-yl]methyl]oxan-4-ol Chemical compound OCC1=NC=2C(N)=NC3=CC=CN=C3C=2N1CC1(O)CCOCC1 DHIPEYBIPDXUEH-UHFFFAOYSA-N 0.000 description 1
- KSTMDRNZEJKAII-UHFFFAOYSA-N 4-[[4-amino-2-(hydroxymethyl)imidazo[4,5-c]quinolin-1-yl]methyl]oxan-4-ol Chemical compound OCC1=NC=2C(N)=NC3=CC=CC=C3C=2N1CC1(O)CCOCC1 KSTMDRNZEJKAII-UHFFFAOYSA-N 0.000 description 1
- KRKXGCJUNKZXOY-UHFFFAOYSA-N 4-acetamidobenzoyl chloride Chemical compound CC(=O)NC1=CC=C(C(Cl)=O)C=C1 KRKXGCJUNKZXOY-UHFFFAOYSA-N 0.000 description 1
- QZQHTOOINKDNDA-UHFFFAOYSA-N 4-n-[3-[1-[tert-butyl(dimethyl)silyl]oxycyclohexyl]propyl]quinoline-3,4-diamine Chemical compound NC=1C=NC2=CC=CC=C2C=1NCCCC1(O[Si](C)(C)C(C)(C)C)CCCCC1 QZQHTOOINKDNDA-UHFFFAOYSA-N 0.000 description 1
- CXEFZVVLTJQWBF-UHFFFAOYSA-N 4-phenylmethoxybutanoic acid Chemical compound OC(=O)CCCOCC1=CC=CC=C1 CXEFZVVLTJQWBF-UHFFFAOYSA-N 0.000 description 1
- YHQPYMQQMBVULM-UHFFFAOYSA-N 6,7,8,9-tetrahydro-3h-imidazo[4,5-c]quinolin-4-amine Chemical compound C1CCCC2=C1N=C(N)C1=C2NC=N1 YHQPYMQQMBVULM-UHFFFAOYSA-N 0.000 description 1
- CYJRNFFLTBEQSQ-UHFFFAOYSA-N 8-(3-methyl-1-benzothiophen-5-yl)-N-(4-methylsulfonylpyridin-3-yl)quinoxalin-6-amine Chemical compound CS(=O)(=O)C1=C(C=NC=C1)NC=1C=C2N=CC=NC2=C(C=1)C=1C=CC2=C(C(=CS2)C)C=1 CYJRNFFLTBEQSQ-UHFFFAOYSA-N 0.000 description 1
- HBNXMWLOQRUOOU-UHFFFAOYSA-N 8-[[(3-aminoquinolin-4-yl)amino]methyl]-1,4-dioxaspiro[4.5]decan-8-ol Chemical compound NC1=CN=C2C=CC=CC2=C1NCC(CC1)(O)CCC21OCCO2 HBNXMWLOQRUOOU-UHFFFAOYSA-N 0.000 description 1
- MVKQBRSVIRTRHJ-UHFFFAOYSA-N 8-[[(3-nitroquinolin-4-yl)amino]methyl]-1,4-dioxaspiro[4.5]decan-8-ol Chemical compound C1CC(O)(CNC=2C3=CC=CC=C3N=CC=2[N+]([O-])=O)CCC21OCCO2 MVKQBRSVIRTRHJ-UHFFFAOYSA-N 0.000 description 1
- ZWCNNQWURKJYGR-UHFFFAOYSA-N 8-[[4-amino-2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]methyl]-1,4-dioxaspiro[4.5]decan-8-ol Chemical compound CCOCC1=NC2=C(N)N=C3C=CC=CC3=C2N1CC(CC1)(O)CCC21OCCO2 ZWCNNQWURKJYGR-UHFFFAOYSA-N 0.000 description 1
- FEJUGLKDZJDVFY-UHFFFAOYSA-N 9-borabicyclo(3.3.1)nonane Chemical compound C1CCC2CCCC1B2 FEJUGLKDZJDVFY-UHFFFAOYSA-N 0.000 description 1
- 208000024827 Alzheimer disease Diseases 0.000 description 1
- 229910000013 Ammonium bicarbonate Inorganic materials 0.000 description 1
- 239000004254 Ammonium phosphate Substances 0.000 description 1
- 206010059313 Anogenital warts Diseases 0.000 description 1
- 201000002909 Aspergillosis Diseases 0.000 description 1
- 208000036641 Aspergillus infections Diseases 0.000 description 1
- 208000012657 Atopic disease Diseases 0.000 description 1
- 208000023275 Autoimmune disease Diseases 0.000 description 1
- 208000010839 B-cell chronic lymphocytic leukemia Diseases 0.000 description 1
- 208000003950 B-cell lymphoma Diseases 0.000 description 1
- 241000193830 Bacillus <bacterium> Species 0.000 description 1
- 241000894006 Bacteria Species 0.000 description 1
- 208000035143 Bacterial infection Diseases 0.000 description 1
- 206010004146 Basal cell carcinoma Diseases 0.000 description 1
- 241000588807 Bordetella Species 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- 241000589562 Brucella Species 0.000 description 1
- ZHLJRNXPGVFACY-UHFFFAOYSA-N CCN(CC1)CCC1(CNC(C1=CC=CC=C1N=C1)=C1[N+]([O-])=O)O Chemical compound CCN(CC1)CCC1(CNC(C1=CC=CC=C1N=C1)=C1[N+]([O-])=O)O ZHLJRNXPGVFACY-UHFFFAOYSA-N 0.000 description 1
- 101100135744 Caenorhabditis elegans pch-2 gene Proteins 0.000 description 1
- 241000589876 Campylobacter Species 0.000 description 1
- 241000222122 Candida albicans Species 0.000 description 1
- 206010007134 Candida infections Diseases 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 206010008263 Cervical dysplasia Diseases 0.000 description 1
- 201000006082 Chickenpox Diseases 0.000 description 1
- VGCXGMAHQTYDJK-UHFFFAOYSA-N Chloroacetyl chloride Chemical compound ClCC(Cl)=O VGCXGMAHQTYDJK-UHFFFAOYSA-N 0.000 description 1
- 241000588881 Chromobacterium Species 0.000 description 1
- 241000193403 Clostridium Species 0.000 description 1
- 208000035473 Communicable disease Diseases 0.000 description 1
- 208000000907 Condylomata Acuminata Diseases 0.000 description 1
- 241000711573 Coronaviridae Species 0.000 description 1
- 241000186216 Corynebacterium Species 0.000 description 1
- 208000006081 Cryptococcal meningitis Diseases 0.000 description 1
- 208000008953 Cryptosporidiosis Diseases 0.000 description 1
- 206010011502 Cryptosporidiosis infection Diseases 0.000 description 1
- LVZWSLJZHVFIQJ-UHFFFAOYSA-N Cyclopropane Chemical compound C1CC1 LVZWSLJZHVFIQJ-UHFFFAOYSA-N 0.000 description 1
- 241000701022 Cytomegalovirus Species 0.000 description 1
- 108010041986 DNA Vaccines Proteins 0.000 description 1
- 229940021995 DNA vaccine Drugs 0.000 description 1
- 208000001490 Dengue Diseases 0.000 description 1
- 206010012310 Dengue fever Diseases 0.000 description 1
- 241000725619 Dengue virus Species 0.000 description 1
- 206010014596 Encephalitis Japanese B Diseases 0.000 description 1
- 241000588914 Enterobacter Species 0.000 description 1
- 206010014950 Eosinophilia Diseases 0.000 description 1
- 241000588722 Escherichia Species 0.000 description 1
- 241000400611 Eucalyptus deanei Species 0.000 description 1
- 208000004729 Feline Leukemia Diseases 0.000 description 1
- 241000710831 Flavivirus Species 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 description 1
- 240000006927 Foeniculum vulgare Species 0.000 description 1
- 235000004204 Foeniculum vulgare Nutrition 0.000 description 1
- 108090000288 Glycoproteins Proteins 0.000 description 1
- 102000003886 Glycoproteins Human genes 0.000 description 1
- 241000606790 Haemophilus Species 0.000 description 1
- 241000589989 Helicobacter Species 0.000 description 1
- 241000711549 Hepacivirus C Species 0.000 description 1
- 241000700721 Hepatitis B virus Species 0.000 description 1
- 208000005176 Hepatitis C Diseases 0.000 description 1
- 201000002563 Histoplasmosis Diseases 0.000 description 1
- 241000700588 Human alphaherpesvirus 1 Species 0.000 description 1
- 241000701074 Human alphaherpesvirus 2 Species 0.000 description 1
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 1
- 206010020751 Hypersensitivity Diseases 0.000 description 1
- 208000002979 Influenza in Birds Diseases 0.000 description 1
- 102000003814 Interleukin-10 Human genes 0.000 description 1
- 108090000174 Interleukin-10 Proteins 0.000 description 1
- 108010002616 Interleukin-5 Proteins 0.000 description 1
- 201000005807 Japanese encephalitis Diseases 0.000 description 1
- 241000710842 Japanese encephalitis virus Species 0.000 description 1
- 208000007766 Kaposi sarcoma Diseases 0.000 description 1
- 241000588748 Klebsiella Species 0.000 description 1
- 208000004554 Leishmaniasis Diseases 0.000 description 1
- 241000713666 Lentivirus Species 0.000 description 1
- 241000186781 Listeria Species 0.000 description 1
- 208000031422 Lymphocytic Chronic B-Cell Leukemia Diseases 0.000 description 1
- 241000721701 Lynx Species 0.000 description 1
- 201000005505 Measles Diseases 0.000 description 1
- 241000712079 Measles morbillivirus Species 0.000 description 1
- 206010027209 Meningitis cryptococcal Diseases 0.000 description 1
- 208000034578 Multiple myelomas Diseases 0.000 description 1
- 208000005647 Mumps Diseases 0.000 description 1
- 241000711386 Mumps virus Species 0.000 description 1
- 241000186359 Mycobacterium Species 0.000 description 1
- 241000204031 Mycoplasma Species 0.000 description 1
- 208000031888 Mycoses Diseases 0.000 description 1
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 1
- 241000588653 Neisseria Species 0.000 description 1
- 101100030361 Neurospora crassa (strain ATCC 24698 / 74-OR23-1A / CBS 708.71 / DSM 1257 / FGSC 987) pph-3 gene Proteins 0.000 description 1
- 208000015914 Non-Hodgkin lymphomas Diseases 0.000 description 1
- 108091034117 Oligonucleotide Proteins 0.000 description 1
- 208000001388 Opportunistic Infections Diseases 0.000 description 1
- 241000700629 Orthopoxvirus Species 0.000 description 1
- 208000002606 Paramyxoviridae Infections Diseases 0.000 description 1
- QPFYXYFORQJZEC-FOCLMDBBSA-N Phenazopyridine Chemical compound NC1=NC(N)=CC=C1\N=N\C1=CC=CC=C1 QPFYXYFORQJZEC-FOCLMDBBSA-N 0.000 description 1
- 241000709664 Picornaviridae Species 0.000 description 1
- 206010035148 Plague Diseases 0.000 description 1
- 206010035226 Plasma cell myeloma Diseases 0.000 description 1
- 241000233870 Pneumocystis Species 0.000 description 1
- 206010035664 Pneumonia Diseases 0.000 description 1
- 208000000474 Poliomyelitis Diseases 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 241000588769 Proteus <enterobacteria> Species 0.000 description 1
- 241000588768 Providencia Species 0.000 description 1
- 241000589516 Pseudomonas Species 0.000 description 1
- 206010037742 Rabies Diseases 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 108010008281 Recombinant Fusion Proteins Proteins 0.000 description 1
- 102000007056 Recombinant Fusion Proteins Human genes 0.000 description 1
- 208000006265 Renal cell carcinoma Diseases 0.000 description 1
- 206010039085 Rhinitis allergic Diseases 0.000 description 1
- 241000702670 Rotavirus Species 0.000 description 1
- 241000607142 Salmonella Species 0.000 description 1
- 241000607720 Serratia Species 0.000 description 1
- 241000607768 Shigella Species 0.000 description 1
- 208000001203 Smallpox Diseases 0.000 description 1
- 241000191940 Staphylococcus Species 0.000 description 1
- 241000862969 Stella Species 0.000 description 1
- 241000194017 Streptococcus Species 0.000 description 1
- 230000024932 T cell mediated immunity Effects 0.000 description 1
- 208000031673 T-Cell Cutaneous Lymphoma Diseases 0.000 description 1
- 206010043376 Tetanus Diseases 0.000 description 1
- DHXVGJBLRPWPCS-UHFFFAOYSA-N Tetrahydropyran Chemical compound C1CCOCC1 DHXVGJBLRPWPCS-UHFFFAOYSA-N 0.000 description 1
- 208000005485 Thrombocytosis Diseases 0.000 description 1
- 201000005485 Toxoplasmosis Diseases 0.000 description 1
- RHQDFWAXVIIEBN-UHFFFAOYSA-N Trifluoroethanol Chemical compound OCC(F)(F)F RHQDFWAXVIIEBN-UHFFFAOYSA-N 0.000 description 1
- 206010054094 Tumour necrosis Diseases 0.000 description 1
- 208000037386 Typhoid Diseases 0.000 description 1
- 206010046865 Vaccinia virus infection Diseases 0.000 description 1
- 206010046980 Varicella Diseases 0.000 description 1
- 241000870995 Variola Species 0.000 description 1
- 241000607598 Vibrio Species 0.000 description 1
- 206010052428 Wound Diseases 0.000 description 1
- 208000027418 Wounds and injury Diseases 0.000 description 1
- 241000607734 Yersinia <bacteria> Species 0.000 description 1
- 241000607479 Yersinia pestis Species 0.000 description 1
- RZJLPCFJLHBIGX-UHFFFAOYSA-N [1-(3-azidopropyl)cyclohexyl]oxy-tert-butyl-dimethylsilane Chemical compound [N-]=[N+]=NCCCC1(O[Si](C)(C)C(C)(C)C)CCCCC1 RZJLPCFJLHBIGX-UHFFFAOYSA-N 0.000 description 1
- JLCPHMBAVCMARE-UHFFFAOYSA-N [3-[[3-[[3-[[3-[[3-[[3-[[3-[[3-[[3-[[3-[[3-[[5-(2-amino-6-oxo-1H-purin-9-yl)-3-[[3-[[3-[[3-[[3-[[3-[[5-(2-amino-6-oxo-1H-purin-9-yl)-3-[[5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(6-aminopurin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(6-aminopurin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(6-aminopurin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(6-aminopurin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(4-amino-2-oxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(6-aminopurin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(6-aminopurin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(4-amino-2-oxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(4-amino-2-oxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(4-amino-2-oxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(6-aminopurin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(4-amino-2-oxopyrimidin-1-yl)oxolan-2-yl]methyl [5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-yl] hydrogen phosphate Polymers Cc1cn(C2CC(OP(O)(=O)OCC3OC(CC3OP(O)(=O)OCC3OC(CC3O)n3cnc4c3nc(N)[nH]c4=O)n3cnc4c3nc(N)[nH]c4=O)C(COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3CO)n3cnc4c(N)ncnc34)n3ccc(N)nc3=O)n3cnc4c(N)ncnc34)n3ccc(N)nc3=O)n3ccc(N)nc3=O)n3ccc(N)nc3=O)n3cnc4c(N)ncnc34)n3cnc4c(N)ncnc34)n3cc(C)c(=O)[nH]c3=O)n3cc(C)c(=O)[nH]c3=O)n3ccc(N)nc3=O)n3cc(C)c(=O)[nH]c3=O)n3cnc4c3nc(N)[nH]c4=O)n3cnc4c(N)ncnc34)n3cnc4c(N)ncnc34)n3cnc4c(N)ncnc34)n3cnc4c(N)ncnc34)O2)c(=O)[nH]c1=O JLCPHMBAVCMARE-UHFFFAOYSA-N 0.000 description 1
- SFLPSECZOSUZMW-UHFFFAOYSA-N [4-amino-1-[(1-hydroxycyclohexyl)methyl]imidazo[4,5-c]quinolin-2-yl]methyl acetate Chemical compound CC(=O)OCC1=NC2=C(N)N=C3C=CC=CC3=C2N1CC1(O)CCCCC1 SFLPSECZOSUZMW-UHFFFAOYSA-N 0.000 description 1
- 239000002250 absorbent Substances 0.000 description 1
- 230000002745 absorbent Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 208000009621 actinic keratosis Diseases 0.000 description 1
- 230000003213 activating effect Effects 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 125000005042 acyloxymethyl group Chemical group 0.000 description 1
- 125000005073 adamantyl group Chemical group C12(CC3CC(CC(C1)C3)C2)* 0.000 description 1
- 230000033289 adaptive immune response Effects 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 150000001336 alkenes Chemical group 0.000 description 1
- 125000005206 alkoxycarbonyloxymethyl group Chemical group 0.000 description 1
- 125000005115 alkyl carbamoyl group Chemical group 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 150000001351 alkyl iodides Chemical class 0.000 description 1
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 1
- 150000001356 alkyl thiols Chemical class 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 208000026935 allergic disease Diseases 0.000 description 1
- 201000010105 allergic rhinitis Diseases 0.000 description 1
- 230000007815 allergy Effects 0.000 description 1
- 208000004631 alopecia areata Diseases 0.000 description 1
- 150000001409 amidines Chemical class 0.000 description 1
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 description 1
- 235000012538 ammonium bicarbonate Nutrition 0.000 description 1
- 235000012501 ammonium carbonate Nutrition 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 229910000148 ammonium phosphate Inorganic materials 0.000 description 1
- 235000019289 ammonium phosphates Nutrition 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 208000025009 anogenital human papillomavirus infection Diseases 0.000 description 1
- 201000004201 anogenital venereal wart Diseases 0.000 description 1
- 239000003242 anti bacterial agent Substances 0.000 description 1
- 230000003466 anti-cipated effect Effects 0.000 description 1
- 230000001773 anti-convulsant effect Effects 0.000 description 1
- 230000000259 anti-tumor effect Effects 0.000 description 1
- 230000000840 anti-viral effect Effects 0.000 description 1
- 229940088710 antibiotic agent Drugs 0.000 description 1
- 239000001961 anticonvulsive agent Substances 0.000 description 1
- 229960003965 antiepileptics Drugs 0.000 description 1
- 239000000427 antigen Substances 0.000 description 1
- 239000003430 antimalarial agent Substances 0.000 description 1
- 229940121357 antivirals Drugs 0.000 description 1
- 125000005251 aryl acyl group Chemical group 0.000 description 1
- 208000006673 asthma Diseases 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 208000010668 atopic eczema Diseases 0.000 description 1
- 208000027697 autoimmune lymphoproliferative syndrome due to CTLA4 haploinsuffiency Diseases 0.000 description 1
- 229940037642 autologous vaccine Drugs 0.000 description 1
- 125000003725 azepanyl group Chemical group 0.000 description 1
- 125000002393 azetidinyl group Chemical group 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- 125000004069 aziridinyl group Chemical group 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 1
- 125000005605 benzo group Chemical group 0.000 description 1
- 125000000499 benzofuranyl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 description 1
- 150000001558 benzoic acid derivatives Chemical class 0.000 description 1
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 description 1
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 1
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 230000036983 biotransformation Effects 0.000 description 1
- 239000004305 biphenyl Chemical group 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- 229940124630 bronchodilator Drugs 0.000 description 1
- 239000000168 bronchodilator agent Substances 0.000 description 1
- 229930188620 butyrolactone Natural products 0.000 description 1
- DVECBJCOGJRVPX-UHFFFAOYSA-N butyryl chloride Chemical compound CCCC(Cl)=O DVECBJCOGJRVPX-UHFFFAOYSA-N 0.000 description 1
- 201000011510 cancer Diseases 0.000 description 1
- 201000003984 candidiasis Diseases 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 125000000609 carbazolyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3NC12)* 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- ZDQWVKDDJDIVAL-UHFFFAOYSA-N catecholborane Chemical compound C1=CC=C2O[B]OC2=C1 ZDQWVKDDJDIVAL-UHFFFAOYSA-N 0.000 description 1
- 210000004027 cell Anatomy 0.000 description 1
- 229940030156 cell vaccine Drugs 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 1
- 125000002668 chloroacetyl group Chemical group ClCC(=O)* 0.000 description 1
- AOGYCOYQMAVAFD-UHFFFAOYSA-N chlorocarbonic acid Chemical class OC(Cl)=O AOGYCOYQMAVAFD-UHFFFAOYSA-N 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- 230000001684 chronic effect Effects 0.000 description 1
- 208000032852 chronic lymphocytic leukemia Diseases 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 230000001010 compromised effect Effects 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 150000003983 crown ethers Chemical class 0.000 description 1
- 239000013058 crude material Substances 0.000 description 1
- 201000007241 cutaneous T cell lymphoma Diseases 0.000 description 1
- 125000000392 cycloalkenyl group Chemical group 0.000 description 1
- SHQSVMDWKBRBGB-UHFFFAOYSA-N cyclobutanone Chemical compound O=C1CCC1 SHQSVMDWKBRBGB-UHFFFAOYSA-N 0.000 description 1
- KQWGXHWJMSMDJJ-UHFFFAOYSA-N cyclohexyl isocyanate Chemical compound O=C=NC1CCCCC1 KQWGXHWJMSMDJJ-UHFFFAOYSA-N 0.000 description 1
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- ZOOSILUVXHVRJE-UHFFFAOYSA-N cyclopropanecarbonyl chloride Chemical compound ClC(=O)C1CC1 ZOOSILUVXHVRJE-UHFFFAOYSA-N 0.000 description 1
- 125000004186 cyclopropylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 description 1
- 210000004443 dendritic cell Anatomy 0.000 description 1
- 208000025729 dengue disease Diseases 0.000 description 1
- 238000010511 deprotection reaction Methods 0.000 description 1
- MNNHAPBLZZVQHP-UHFFFAOYSA-N diammonium hydrogen phosphate Chemical compound [NH4+].[NH4+].OP([O-])([O-])=O MNNHAPBLZZVQHP-UHFFFAOYSA-N 0.000 description 1
- 125000005959 diazepanyl group Chemical group 0.000 description 1
- 230000004069 differentiation Effects 0.000 description 1
- HDRXZJPWHTXQRI-BHDTVMLSSA-N diltiazem hydrochloride Chemical compound [Cl-].C1=CC(OC)=CC=C1[C@H]1[C@@H](OC(C)=O)C(=O)N(CC[NH+](C)C)C2=CC=CC=C2S1 HDRXZJPWHTXQRI-BHDTVMLSSA-N 0.000 description 1
- UBHZUDXTHNMNLD-UHFFFAOYSA-N dimethylsilane Chemical compound C[SiH2]C UBHZUDXTHNMNLD-UHFFFAOYSA-N 0.000 description 1
- MKRTXPORKIRPDG-UHFFFAOYSA-N diphenylphosphoryl azide Chemical compound C=1C=CC=CC=1P(=O)(N=[N+]=[N-])C1=CC=CC=C1 MKRTXPORKIRPDG-UHFFFAOYSA-N 0.000 description 1
- 206010013023 diphtheria Diseases 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 238000009510 drug design Methods 0.000 description 1
- 230000002526 effect on cardiovascular system Effects 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 230000002708 enhancing effect Effects 0.000 description 1
- 230000002255 enzymatic effect Effects 0.000 description 1
- FRYHCSODNHYDPU-UHFFFAOYSA-N ethanesulfonyl chloride Chemical compound CCS(Cl)(=O)=O FRYHCSODNHYDPU-UHFFFAOYSA-N 0.000 description 1
- BGWMHFKCAUBYJJ-UHFFFAOYSA-N ethyl 2-chloroethanimidate;hydrochloride Chemical compound Cl.CCOC(=N)CCl BGWMHFKCAUBYJJ-UHFFFAOYSA-N 0.000 description 1
- ZIUSEGSNTOUIPT-UHFFFAOYSA-N ethyl 2-cyanoacetate Chemical compound CCOC(=O)CC#N ZIUSEGSNTOUIPT-UHFFFAOYSA-N 0.000 description 1
- CXVQSUBJMYZELD-UHFFFAOYSA-N ethyl 4-aminobutanoate;hydrochloride Chemical compound [Cl-].CCOC(=O)CCC[NH3+] CXVQSUBJMYZELD-UHFFFAOYSA-N 0.000 description 1
- YDUZWOVEDHQJGA-UHFFFAOYSA-N ethyl 4-hydroxy-4-[[(3-nitroquinolin-4-yl)amino]methyl]piperidine-1-carboxylate Chemical compound C1CN(C(=O)OCC)CCC1(O)CNC1=C([N+]([O-])=O)C=NC2=CC=CC=C12 YDUZWOVEDHQJGA-UHFFFAOYSA-N 0.000 description 1
- LUBGFMZTGFXIIN-UHFFFAOYSA-N ethyl 4-oxopiperidine-1-carboxylate Chemical compound CCOC(=O)N1CCC(=O)CC1 LUBGFMZTGFXIIN-UHFFFAOYSA-N 0.000 description 1
- OAYLNYINCPYISS-UHFFFAOYSA-N ethyl acetate;hexane Chemical class CCCCCC.CCOC(C)=O OAYLNYINCPYISS-UHFFFAOYSA-N 0.000 description 1
- WUDNUHPRLBTKOJ-UHFFFAOYSA-N ethyl isocyanate Chemical compound CCN=C=O WUDNUHPRLBTKOJ-UHFFFAOYSA-N 0.000 description 1
- 229960004979 fampridine Drugs 0.000 description 1
- 125000003983 fluorenyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3CC12)* 0.000 description 1
- 230000002538 fungal effect Effects 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 150000004676 glycans Chemical class 0.000 description 1
- 201000009277 hairy cell leukemia Diseases 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 208000005252 hepatitis A Diseases 0.000 description 1
- 208000002672 hepatitis B Diseases 0.000 description 1
- 239000002638 heterogeneous catalyst Substances 0.000 description 1
- 238000004128 high performance liquid chromatography Methods 0.000 description 1
- 230000028996 humoral immune response Effects 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 238000006197 hydroboration reaction Methods 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 1
- NSHFLKZNBPJNPA-UHFFFAOYSA-N imidazo[4,5-c]quinolin-2-one Chemical class C1=CC=C2C3=NC(=O)N=C3C=NC2=C1 NSHFLKZNBPJNPA-UHFFFAOYSA-N 0.000 description 1
- 125000002632 imidazolidinyl group Chemical group 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 230000002519 immonomodulatory effect Effects 0.000 description 1
- 230000036737 immune function Effects 0.000 description 1
- 230000036039 immunity Effects 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 125000003454 indenyl group Chemical group C1(C=CC2=CC=CC=C12)* 0.000 description 1
- 125000001041 indolyl group Chemical group 0.000 description 1
- 206010022000 influenza Diseases 0.000 description 1
- 208000037797 influenza A Diseases 0.000 description 1
- 208000037798 influenza B Diseases 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 230000015788 innate immune response Effects 0.000 description 1
- 230000010354 integration Effects 0.000 description 1
- 208000020082 intraepithelial neoplasia Diseases 0.000 description 1
- YDNLNVZZTACNJX-UHFFFAOYSA-N isocyanatomethylbenzene Chemical compound O=C=NCC1=CC=CC=C1 YDNLNVZZTACNJX-UHFFFAOYSA-N 0.000 description 1
- WBQFFOYISYSHLE-UHFFFAOYSA-N isoindole-1,3-dione Chemical compound C1=CC=C2C(=O)[N]C(=O)C2=C1 WBQFFOYISYSHLE-UHFFFAOYSA-N 0.000 description 1
- 125000000904 isoindolyl group Chemical group C=1(NC=C2C=CC=CC12)* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 description 1
- 125000004628 isothiazolidinyl group Chemical group S1N(CCC1)* 0.000 description 1
- 125000001786 isothiazolyl group Chemical group 0.000 description 1
- 125000000842 isoxazolyl group Chemical group 0.000 description 1
- 208000011379 keloid formation Diseases 0.000 description 1
- 150000002596 lactones Chemical class 0.000 description 1
- 230000003902 lesion Effects 0.000 description 1
- 230000021633 leukocyte mediated immunity Effects 0.000 description 1
- 239000007937 lozenge Substances 0.000 description 1
- 206010025135 lupus erythematosus Diseases 0.000 description 1
- RMGJCSHZTFKPNO-UHFFFAOYSA-M magnesium;ethene;bromide Chemical compound [Mg+2].[Br-].[CH-]=C RMGJCSHZTFKPNO-UHFFFAOYSA-M 0.000 description 1
- 201000004792 malaria Diseases 0.000 description 1
- 201000001441 melanoma Diseases 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229960005037 meningococcal vaccines Drugs 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- XMJHPCRAQCTCFT-UHFFFAOYSA-N methyl chloroformate Chemical compound COC(Cl)=O XMJHPCRAQCTCFT-UHFFFAOYSA-N 0.000 description 1
- HAMGRBXTJNITHG-UHFFFAOYSA-N methyl isocyanate Chemical compound CN=C=O HAMGRBXTJNITHG-UHFFFAOYSA-N 0.000 description 1
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 1
- 208000008588 molluscum contagiosum Diseases 0.000 description 1
- 125000002950 monocyclic group Chemical group 0.000 description 1
- 210000001616 monocyte Anatomy 0.000 description 1
- 125000002757 morpholinyl group Chemical group 0.000 description 1
- 201000006417 multiple sclerosis Diseases 0.000 description 1
- 208000010805 mumps infectious disease Diseases 0.000 description 1
- 201000005962 mycosis fungoides Diseases 0.000 description 1
- WZQCGYLBGVQKJP-UHFFFAOYSA-N n-[1-[[4-amino-2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]methyl]cyclohexyl]acetamide Chemical compound CCOCC1=NC2=C(N)N=C3C=CC=CC3=C2N1CC1(NC(C)=O)CCCCC1 WZQCGYLBGVQKJP-UHFFFAOYSA-N 0.000 description 1
- SHSUURUWMBZNNN-UHFFFAOYSA-N n-[1-[[4-amino-2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]methyl]cyclopropyl]methanesulfonamide Chemical compound CCOCC1=NC2=C(N)N=C3C=CC=CC3=C2N1CC1(NS(C)(=O)=O)CC1 SHSUURUWMBZNNN-UHFFFAOYSA-N 0.000 description 1
- BILKAIRIDCGKBO-UHFFFAOYSA-N n-[3-[1-[tert-butyl(dimethyl)silyl]oxycyclohexyl]propyl]-3-nitroquinolin-4-amine Chemical compound [O-][N+](=O)C=1C=NC2=CC=CC=C2C=1NCCCC1(O[Si](C)(C)C(C)(C)C)CCCCC1 BILKAIRIDCGKBO-UHFFFAOYSA-N 0.000 description 1
- YSBUANSGDLZTKV-UHFFFAOYSA-N n-phenylcarbamoyl chloride Chemical compound ClC(=O)NC1=CC=CC=C1 YSBUANSGDLZTKV-UHFFFAOYSA-N 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 150000005054 naphthyridines Chemical class 0.000 description 1
- 125000004593 naphthyridinyl group Chemical group N1=C(C=CC2=CC=CN=C12)* 0.000 description 1
- 210000000822 natural killer cell Anatomy 0.000 description 1
- 125000006574 non-aromatic ring group Chemical group 0.000 description 1
- 125000003518 norbornenyl group Chemical group C12(C=CC(CC1)C2)* 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 1
- 238000005580 one pot reaction Methods 0.000 description 1
- 230000001151 other effect Effects 0.000 description 1
- 125000001715 oxadiazolyl group Chemical group 0.000 description 1
- 125000002971 oxazolyl group Chemical group 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- DDBREPKUVSBGFI-UHFFFAOYSA-N phenobarbital Chemical compound C=1C=CC=CC=1C1(CC)C(=O)NC(=O)NC1=O DDBREPKUVSBGFI-UHFFFAOYSA-N 0.000 description 1
- DGTNSSLYPYDJGL-UHFFFAOYSA-N phenyl isocyanate Chemical compound O=C=NC1=CC=CC=C1 DGTNSSLYPYDJGL-UHFFFAOYSA-N 0.000 description 1
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 1
- 125000004193 piperazinyl group Chemical group 0.000 description 1
- 125000004482 piperidin-4-yl group Chemical group N1CCC(CC1)* 0.000 description 1
- 125000003386 piperidinyl group Chemical group 0.000 description 1
- 229960001973 pneumococcal vaccines Drugs 0.000 description 1
- 201000000317 pneumocystosis Diseases 0.000 description 1
- 125000003367 polycyclic group Chemical group 0.000 description 1
- 229920001282 polysaccharide Polymers 0.000 description 1
- 239000005017 polysaccharide Substances 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 1
- FYRHIOVKTDQVFC-UHFFFAOYSA-M potassium phthalimide Chemical compound [K+].C1=CC=C2C(=O)[N-]C(=O)C2=C1 FYRHIOVKTDQVFC-UHFFFAOYSA-M 0.000 description 1
- 208000025638 primary cutaneous T-cell non-Hodgkin lymphoma Diseases 0.000 description 1
- 230000035755 proliferation Effects 0.000 description 1
- KPBSJEBFALFJTO-UHFFFAOYSA-N propane-1-sulfonyl chloride Chemical compound CCCS(Cl)(=O)=O KPBSJEBFALFJTO-UHFFFAOYSA-N 0.000 description 1
- 230000000069 prophylactic effect Effects 0.000 description 1
- 239000012264 purified product Substances 0.000 description 1
- 125000000561 purinyl group Chemical group N1=C(N=C2N=CNC2=C1)* 0.000 description 1
- 125000003373 pyrazinyl group Chemical group 0.000 description 1
- 125000003226 pyrazolyl group Chemical group 0.000 description 1
- 125000002098 pyridazinyl group Chemical group 0.000 description 1
- GRJJQCWNZGRKAU-UHFFFAOYSA-N pyridin-1-ium;fluoride Chemical compound F.C1=CC=NC=C1 GRJJQCWNZGRKAU-UHFFFAOYSA-N 0.000 description 1
- NUKYPUAOHBNCPY-YZRHJBSPSA-N pyridin-4-amine Chemical compound NC1=CC=N[14CH]=C1 NUKYPUAOHBNCPY-YZRHJBSPSA-N 0.000 description 1
- ATBIAJXSKNPHEI-UHFFFAOYSA-N pyridine-3-carbonyl chloride Chemical compound ClC(=O)C1=CC=CN=C1 ATBIAJXSKNPHEI-UHFFFAOYSA-N 0.000 description 1
- 229940070891 pyridium Drugs 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 1
- 125000000168 pyrrolyl group Chemical group 0.000 description 1
- 125000002294 quinazolinyl group Chemical group N1=C(N=CC2=CC=CC=C12)* 0.000 description 1
- 125000004159 quinolin-2-yl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C([H])C(*)=NC2=C1[H] 0.000 description 1
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 1
- 125000001567 quinoxalinyl group Chemical group N1=C(C=NC2=CC=CC=C12)* 0.000 description 1
- 125000004621 quinuclidinyl group Chemical group N12C(CC(CC1)CC2)* 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 125000006413 ring segment Chemical group 0.000 description 1
- XMVJITFPVVRMHC-UHFFFAOYSA-N roxarsone Chemical group OC1=CC=C([As](O)(O)=O)C=C1[N+]([O-])=O XMVJITFPVVRMHC-UHFFFAOYSA-N 0.000 description 1
- 102200077464 rs398122966 Human genes 0.000 description 1
- 201000005404 rubella Diseases 0.000 description 1
- 230000037390 scarring Effects 0.000 description 1
- 230000028327 secretion Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 238000010898 silica gel chromatography Methods 0.000 description 1
- 125000003808 silyl group Chemical group [H][Si]([H])([H])[*] 0.000 description 1
- XGVXKJKTISMIOW-ZDUSSCGKSA-N simurosertib Chemical compound N1N=CC(C=2SC=3C(=O)NC(=NC=3C=2)[C@H]2N3CCC(CC3)C2)=C1C XGVXKJKTISMIOW-ZDUSSCGKSA-N 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- BEOOHQFXGBMRKU-UHFFFAOYSA-N sodium cyanoborohydride Chemical compound [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 description 1
- 239000012453 solvate Substances 0.000 description 1
- 238000003797 solvolysis reaction Methods 0.000 description 1
- 206010041823 squamous cell carcinoma Diseases 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
- 239000013589 supplement Substances 0.000 description 1
- 230000001629 suppression Effects 0.000 description 1
- 208000011580 syndromic disease Diseases 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 201000000596 systemic lupus erythematosus Diseases 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- BZPIPIMCAOJXDS-UHFFFAOYSA-N tert-butyl 4-[[4-amino-2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]methyl]-4-(2-methylsulfonylethoxy)piperidine-1-carboxylate Chemical compound CCOCC1=NC2=C(N)N=C3C=CC=CC3=C2N1CC1(OCCS(C)(=O)=O)CCN(C(=O)OC(C)(C)C)CC1 BZPIPIMCAOJXDS-UHFFFAOYSA-N 0.000 description 1
- HZCZUMIXVDWWPY-UHFFFAOYSA-N tert-butyl 4-hydroxy-4-[[(3-nitroquinolin-4-yl)amino]methyl]piperidine-1-carboxylate Chemical compound C1CN(C(=O)OC(C)(C)C)CCC1(O)CNC1=C([N+]([O-])=O)C=NC2=CC=CC=C12 HZCZUMIXVDWWPY-UHFFFAOYSA-N 0.000 description 1
- ROUYFJUVMYHXFJ-UHFFFAOYSA-N tert-butyl 4-oxopiperidine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCC(=O)CC1 ROUYFJUVMYHXFJ-UHFFFAOYSA-N 0.000 description 1
- VLEMHYPWKFLCDM-UHFFFAOYSA-N tert-butyl n-[1-[[2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]methyl]cyclohexyl]carbamate Chemical compound CCOCC1=NC2=CN=C3C=CC=CC3=C2N1CC1(NC(=O)OC(C)(C)C)CCCCC1 VLEMHYPWKFLCDM-UHFFFAOYSA-N 0.000 description 1
- ILMRJRBKQSSXGY-UHFFFAOYSA-N tert-butyl(dimethyl)silicon Chemical compound C[Si](C)C(C)(C)C ILMRJRBKQSSXGY-UHFFFAOYSA-N 0.000 description 1
- ALZHIRDVXYZAFR-UHFFFAOYSA-N tert-butyl-[1-[3-[2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]propyl]cyclohexyl]oxy-dimethylsilane Chemical compound CCOCC1=NC2=CN=C3C=CC=CC3=C2N1CCCC1(O[Si](C)(C)C(C)(C)C)CCCCC1 ALZHIRDVXYZAFR-UHFFFAOYSA-N 0.000 description 1
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 1
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 1
- 125000005247 tetrazinyl group Chemical group N1=NN=NC(=C1)* 0.000 description 1
- 125000003831 tetrazolyl group Chemical group 0.000 description 1
- 229940124597 therapeutic agent Drugs 0.000 description 1
- 125000001113 thiadiazolyl group Chemical group 0.000 description 1
- 125000001984 thiazolidinyl group Chemical group 0.000 description 1
- 125000000335 thiazolyl group Chemical group 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- 125000000101 thioether group Chemical group 0.000 description 1
- 125000004568 thiomorpholinyl group Chemical group 0.000 description 1
- 208000014754 thrombocytosis disease Diseases 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 239000003053 toxin Substances 0.000 description 1
- 231100000765 toxin Toxicity 0.000 description 1
- 108700012359 toxins Proteins 0.000 description 1
- 238000011269 treatment regimen Methods 0.000 description 1
- 125000004306 triazinyl group Chemical group 0.000 description 1
- 125000001425 triazolyl group Chemical group 0.000 description 1
- GKASDNZWUGIAMG-UHFFFAOYSA-N triethyl orthoformate Chemical compound CCOC(OCC)OCC GKASDNZWUGIAMG-UHFFFAOYSA-N 0.000 description 1
- 125000004044 trifluoroacetyl group Chemical group FC(C(=O)*)(F)F 0.000 description 1
- LEIMLDGFXIOXMT-UHFFFAOYSA-N trimethylsilyl cyanide Chemical compound C[Si](C)(C)C#N LEIMLDGFXIOXMT-UHFFFAOYSA-N 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- 201000008827 tuberculosis Diseases 0.000 description 1
- 229960002109 tuberculosis vaccine Drugs 0.000 description 1
- 230000004565 tumor cell growth Effects 0.000 description 1
- 201000008297 typhoid fever Diseases 0.000 description 1
- 241001529453 unidentified herpesvirus Species 0.000 description 1
- 241000712461 unidentified influenza virus Species 0.000 description 1
- 241001430294 unidentified retrovirus Species 0.000 description 1
- 208000007089 vaccinia Diseases 0.000 description 1
- 238000001291 vacuum drying Methods 0.000 description 1
- 239000003643 water by type Substances 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
- 230000029663 wound healing Effects 0.000 description 1
- 230000037314 wound repair Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/12—Antivirals
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P37/00—Drugs for immunological or allergic disorders
- A61P37/02—Immunomodulators
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/12—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains three hetero rings
- C07D471/14—Ortho-condensed systems
Landscapes
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Medicinal Chemistry (AREA)
- Pharmacology & Pharmacy (AREA)
- General Chemical & Material Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Immunology (AREA)
- Virology (AREA)
- Communicable Diseases (AREA)
- Oncology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US58127404P | 2004-06-18 | 2004-06-18 | |
| US60/581,274 | 2004-06-18 | ||
| PCT/US2005/021445 WO2006028545A2 (en) | 2004-06-18 | 2005-06-17 | Substituted imidazoquinolines, imidazopyridines, and imidazonaphthyridines |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| AU2005283085A1 AU2005283085A1 (en) | 2006-03-16 |
| AU2005283085B2 true AU2005283085B2 (en) | 2012-06-21 |
Family
ID=36036778
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AU2005283085A Ceased AU2005283085B2 (en) | 2004-06-18 | 2005-06-17 | Substituted imidazoquinolines, imidazopyridines, and imidazonaphthyridines |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US7884207B2 (OSRAM) |
| EP (1) | EP1765348B1 (OSRAM) |
| JP (1) | JP5128940B2 (OSRAM) |
| AU (1) | AU2005283085B2 (OSRAM) |
| CA (1) | CA2571360C (OSRAM) |
| WO (1) | WO2006028545A2 (OSRAM) |
Families Citing this family (71)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA2488801A1 (en) | 2002-06-07 | 2003-12-18 | 3M Innovative Properties Company | Ether substituted imidazopyridines |
| US20040265351A1 (en) | 2003-04-10 | 2004-12-30 | Miller Richard L. | Methods and compositions for enhancing immune response |
| EP1658076B1 (en) * | 2003-08-27 | 2013-03-06 | 3M Innovative Properties Company | Aryloxy and arylalkyleneoxy substituted imidazoquinolines |
| US20050054665A1 (en) | 2003-09-05 | 2005-03-10 | 3M Innovative Properties Company | Treatment for CD5+ B cell lymphoma |
| ES2544477T3 (es) | 2003-10-03 | 2015-08-31 | 3M Innovative Properties Company | Imidazoquinolinas sustituidas con alcoxi |
| KR20060120069A (ko) | 2003-10-03 | 2006-11-24 | 쓰리엠 이노베이티브 프로퍼티즈 컴파니 | 피라졸로피리딘 및 그의 유사체 |
| US7544697B2 (en) | 2003-10-03 | 2009-06-09 | Coley Pharmaceutical Group, Inc. | Pyrazolopyridines and analogs thereof |
| RU2409576C2 (ru) | 2003-11-25 | 2011-01-20 | 3М Инновейтив Пропертиз Компани | Системы, содержащие имидазольное кольцо с заместителями, и способы их получения |
| US8541438B2 (en) | 2004-06-18 | 2013-09-24 | 3M Innovative Properties Company | Substituted imidazoquinolines, imidazopyridines, and imidazonaphthyridines |
| WO2006065280A2 (en) | 2004-06-18 | 2006-06-22 | 3M Innovative Properties Company | Isoxazole, dihydroisoxazole, and oxadiazole substituted imidazo ring compounds and methods |
| PL1789042T3 (pl) | 2004-09-02 | 2012-09-28 | 3M Innovative Properties Co | Układy pierścieni 1-alkoksy 1H-imidazo i sposoby |
| CA2592904C (en) | 2004-12-30 | 2015-04-07 | 3M Innovative Properties Company | Chiral fused [1,2]imidazo[4,5-c] ring compounds |
| AU2005326708C1 (en) | 2004-12-30 | 2012-08-30 | 3M Innovative Properties Company | Substituted chiral fused [1,2]imidazo[4,5-c] ring compounds |
| US9248127B2 (en) | 2005-02-04 | 2016-02-02 | 3M Innovative Properties Company | Aqueous gel formulations containing immune response modifiers |
| JP2008530252A (ja) | 2005-02-09 | 2008-08-07 | コーリー ファーマシューティカル グループ,インコーポレイテッド | オキシムおよびヒドロキシルアミンで置換されたチアゾロ[4,5−c]環化合物ならびに方法 |
| WO2006086449A2 (en) | 2005-02-09 | 2006-08-17 | Coley Pharmaceutical Group, Inc. | Alkyloxy substituted thiazoloquinolines and thiazolonaphthyridines |
| WO2006091394A2 (en) * | 2005-02-11 | 2006-08-31 | Coley Pharmaceutical Group, Inc. | Substituted imidazoquinolines and imidazonaphthyridines |
| WO2006086634A2 (en) | 2005-02-11 | 2006-08-17 | Coley Pharmaceutical Group, Inc. | Oxime and hydroxylamine substituted imidazo[4,5-c] ring compounds and methods |
| WO2006098852A2 (en) * | 2005-02-23 | 2006-09-21 | Coley Pharmaceutical Group, Inc. | Hydroxyalkyl substituted imidazoquinolines |
| JP2008538203A (ja) * | 2005-02-23 | 2008-10-16 | コーリー ファーマシューティカル グループ,インコーポレイテッド | インターフェロンの生合成を優先的に誘導する方法 |
| EP1851218A2 (en) * | 2005-02-23 | 2007-11-07 | 3M Innovative Properties Company | Hydroxyalkyl substituted imidazoquinoline compounds and methods |
| EP1851220A2 (en) | 2005-02-23 | 2007-11-07 | 3M Innovative Properties Company | Hydroxyalkyl substituted imidazonaphthyridines |
| US7943610B2 (en) | 2005-04-01 | 2011-05-17 | 3M Innovative Properties Company | Pyrazolopyridine-1,4-diamines and analogs thereof |
| AU2006232375A1 (en) * | 2005-04-01 | 2006-10-12 | Coley Pharmaceutical Group, Inc. | 1-substituted pyrazolo (3,4-c) ring compounds as modulators of cytokine biosynthesis for the treatment of viral infections and neoplastic diseases |
| EA200800782A1 (ru) * | 2005-09-09 | 2008-08-29 | Коли Фармасьютикал Груп, Инк. | ПРОИЗВОДНЫЕ АМИДА И КАРБАМАТА N-{2-[4-АМИНО-2-(ЭТОКСИМЕТИЛ)-1Н-ИМИДАЗОЛО[4,5-c]ХИНОЛИН-1-IL]-1,1-ДИМЕТИЛЭТИЛ}МЕТАНСУЛЬФОНАМИДА И СПОСОБЫ |
| ZA200803029B (en) | 2005-09-09 | 2009-02-25 | Coley Pharm Group Inc | Amide and carbamate derivatives of alkyl substituted /V-[4-(4-amino-1H-imidazo[4,5-c] quinolin-1-yl)butyl] methane-sulfonamides and methods |
| WO2007056112A2 (en) | 2005-11-04 | 2007-05-18 | Coley Pharmaceutical Group, Inc. | Hydroxy and alkoxy substituted 1h-imidazoquinolines and methods |
| WO2007100634A2 (en) | 2006-02-22 | 2007-09-07 | 3M Innovative Properties Company | Immune response modifier conjugates |
| US8329721B2 (en) * | 2006-03-15 | 2012-12-11 | 3M Innovative Properties Company | Hydroxy and alkoxy substituted 1H-imidazonaphthyridines and methods |
| FR2902100A1 (fr) * | 2006-06-13 | 2007-12-14 | Sanofi Aventis Sa | Molecules duales contenant un derive peroxydique, leur synthese et leurs applications en therapeutique |
| US7906506B2 (en) | 2006-07-12 | 2011-03-15 | 3M Innovative Properties Company | Substituted chiral fused [1,2] imidazo [4,5-c] ring compounds and methods |
| WO2008030511A2 (en) * | 2006-09-06 | 2008-03-13 | Coley Pharmaceuticial Group, Inc. | Substituted 3,4,6,7-tetrahydro-5h, 1,2a,4a,8-tetraazacyclopenta[cd]phenalenes |
| TW200827340A (en) * | 2006-11-10 | 2008-07-01 | Astrazeneca Ab | Chemical compounds |
| US20080149123A1 (en) | 2006-12-22 | 2008-06-26 | Mckay William D | Particulate material dispensing hairbrush with combination bristles |
| WO2009125808A1 (ja) * | 2008-04-11 | 2009-10-15 | 第一三共株式会社 | アミノシクロヘキシル誘導体 |
| WO2009125809A1 (ja) * | 2008-04-11 | 2009-10-15 | 第一三共株式会社 | ピペリジン誘導体 |
| US8232409B2 (en) | 2008-10-15 | 2012-07-31 | Janssen Pharmaceutica N.V. | Heterocyclic benzimidazoles as TRPM8 modulators |
| KR20140015162A (ko) * | 2010-01-12 | 2014-02-06 | 에프. 호프만-라 로슈 아게 | 트라이사이클릭 헤테로사이클릭 화합물, 조성물 및 이의 사용 방법 |
| EP2397482A1 (en) | 2010-06-15 | 2011-12-21 | Almirall, S.A. | Heteroaryl imidazolone derivatives as jak inhibitors |
| HRP20170433T1 (hr) | 2010-08-17 | 2017-05-05 | 3M Innovative Properties Company | Pripravci spoja za izmjenu lipidiranog imunološkog odgovora, formulacije, i postupci |
| WO2012167081A1 (en) | 2011-06-03 | 2012-12-06 | 3M Innovative Properties Company | Hydrazino 1h-imidazoquinolin-4-amines and conjugates made therefrom |
| CN103582496B (zh) | 2011-06-03 | 2016-05-11 | 3M创新有限公司 | 具有聚乙二醇链段的异双官能连接基以及由其制成的免疫应答调节剂缀合物 |
| US8729263B2 (en) | 2012-08-13 | 2014-05-20 | Novartis Ag | 1,4-disubstituted pyridazine analogs there of and methods for treating SMN-deficiency-related conditions |
| CN105025854A (zh) | 2013-01-07 | 2015-11-04 | 宾夕法尼亚大学董事会 | 治疗皮肤t细胞淋巴瘤的组合物和方法 |
| WO2014139080A1 (en) * | 2013-03-12 | 2014-09-18 | Boehringer Ingelheim International Trading (Shanghai) Co., Ltd. | Novel process for the manufacture of 3-oxo-tetrahydrofuran |
| CA2918805C (en) | 2013-07-31 | 2023-02-28 | Novartis Ag | 1,4-disubstituted pyridazine derivatives and their use for treating smn-deficiency-related conditions |
| JP6469692B2 (ja) | 2013-12-09 | 2019-02-13 | ユーシービー バイオファルマ エスピーアールエル | Tnf活性のモジュレーターとしてのイミダゾピリジン誘導体 |
| CN107922416B (zh) | 2015-08-31 | 2021-07-02 | 3M创新有限公司 | 含有取代的胍基团的咪唑并[4,5-c]环化合物 |
| EP3344622B1 (en) | 2015-08-31 | 2021-07-07 | 3M Innovative Properties Company | Guanidine substituted, fused 1h-imidazo[4,5-c]pyridine compounds useful in the treatment of viral and neoplastic diseases |
| EP3356371A4 (en) * | 2015-09-29 | 2020-06-24 | The University of Chicago | POLYMER CONJUGATE VACCINES |
| US10526309B2 (en) | 2015-10-02 | 2020-01-07 | The University Of North Carolina At Chapel Hill | Pan-TAM inhibitors and Mer/Axl dual inhibitors |
| IL263616B2 (en) | 2016-07-07 | 2025-01-01 | Univ Leland Stanford Junior | Antibody-adjuvant conjugates |
| GB201617758D0 (en) * | 2016-10-20 | 2016-12-07 | Almac Discovery Limited | Pharmaceutical compounds |
| US10766896B2 (en) | 2017-03-01 | 2020-09-08 | 3M Innovative Properties Company | Imidazo[4,5-c] ring compounds containing guanidine substituted benzamide groups |
| EP4257198A3 (en) | 2017-08-22 | 2023-10-18 | Dynavax Technologies Corporation | Alkyl chain modified imidazoquinoline derivatives as tlr7/8 agonists and uses thereof |
| WO2019048036A1 (en) * | 2017-09-06 | 2019-03-14 | Biontech Ag | SUBSTITUTED IMIDAZOQUINOLINES |
| EP3710059A1 (en) | 2017-11-14 | 2020-09-23 | Dynavax Technologies Corporation | Cleavable conjugates of tlr7/8 agonist compounds, methods for preparation, and uses thereof |
| EP3728255B1 (en) | 2017-12-20 | 2022-01-26 | 3M Innovative Properties Company | Amide substituted imidazo[4,5-c]quinoline compounds with a branched chain linking group for use as an immune response modifier |
| KR20200128116A (ko) | 2018-02-28 | 2020-11-11 | 화이자 인코포레이티드 | Il-15 변이체 및 이의 용도 |
| CA3092545A1 (en) * | 2018-02-28 | 2019-09-06 | 3M Innovative Properties Company | Substituted imidazo[4,5-c]quinoline compounds with an n-1 branched group |
| DK3797121T3 (da) | 2018-05-23 | 2024-07-08 | Pfizer | Antistoffer, der er specifikke for CD3, og anvendelser deraf |
| KR20230146098A (ko) | 2018-05-23 | 2023-10-18 | 화이자 인코포레이티드 | GUCY2c에 특이적인 항체 및 이의 용도 |
| EP3802536B1 (en) * | 2018-05-24 | 2022-07-13 | 3M Innovative Properties Company | N-1 branched cycloalkyl substituted imidazo[4,5-c]quinoline compounds, compositions, and methods |
| WO2020128893A1 (en) | 2018-12-21 | 2020-06-25 | Pfizer Inc. | Combination treatments of cancer comprising a tlr agonist |
| AU2020241686A1 (en) | 2019-03-15 | 2021-11-04 | Bolt Biotherapeutics, Inc. | Immunoconjugates targeting HER2 |
| EP3946606B1 (en) | 2019-03-27 | 2025-01-01 | Insilico Medicine IP Limited | Bicyclic jak inhibitors and uses thereof |
| US12295970B2 (en) | 2019-04-17 | 2025-05-13 | University Of Kansas | Imidazoquinoline compounds and prodrugs thereof |
| CN116574099A (zh) * | 2019-09-23 | 2023-08-11 | 南京征祥医药有限公司 | 磷酸二酯酶抑制剂及用途 |
| PE20230160A1 (es) | 2019-12-17 | 2023-02-01 | Pfizer | Anticuerpos especificos para cd47, pd-l1 y sus usos |
| JP2023533793A (ja) | 2020-07-17 | 2023-08-04 | ファイザー・インク | 治療用抗体およびそれらの使用 |
| WO2025104289A1 (en) | 2023-11-17 | 2025-05-22 | Medincell S.A. | Antineoplastic combinations |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2005123079A2 (en) * | 2004-06-14 | 2005-12-29 | 3M Innovative Properties Company | Urea substituted imidazopyridines, imidazoquinolines, and imidazonaphthyridines |
Family Cites Families (95)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3314941A (en) * | 1964-06-23 | 1967-04-18 | American Cyanamid Co | Novel substituted pyridodiazepins |
| GR79630B (OSRAM) * | 1982-08-18 | 1984-10-31 | Falkenried Fahrzeug Gmbh | |
| IL73534A (en) * | 1983-11-18 | 1990-12-23 | Riker Laboratories Inc | 1h-imidazo(4,5-c)quinoline-4-amines,their preparation and pharmaceutical compositions containing certain such compounds |
| ZA848968B (en) * | 1983-11-18 | 1986-06-25 | Riker Laboratories Inc | 1h-imidazo(4,5-c)quinolines and 1h-imidazo(4,5-c)quinolin-4-amines |
| US5238944A (en) * | 1988-12-15 | 1993-08-24 | Riker Laboratories, Inc. | Topical formulations and transdermal delivery systems containing 1-isobutyl-1H-imidazo[4,5-c]quinolin-4-amine |
| US5756747A (en) * | 1989-02-27 | 1998-05-26 | Riker Laboratories, Inc. | 1H-imidazo 4,5-c!quinolin-4-amines |
| US4929624A (en) * | 1989-03-23 | 1990-05-29 | Minnesota Mining And Manufacturing Company | Olefinic 1H-imidazo(4,5-c)quinolin-4-amines |
| US5037986A (en) * | 1989-03-23 | 1991-08-06 | Minnesota Mining And Manufacturing Company | Olefinic 1H-imidazo[4,5-c]quinolin-4-amines |
| NZ232740A (en) | 1989-04-20 | 1992-06-25 | Riker Laboratories Inc | Solution for parenteral administration comprising a 1h-imidazo(4,5-c) quinolin-4-amine derivative, an acid and a tonicity adjuster |
| US4988815A (en) | 1989-10-26 | 1991-01-29 | Riker Laboratories, Inc. | 3-Amino or 3-nitro quinoline compounds which are intermediates in preparing 1H-imidazo[4,5-c]quinolines |
| ATE121088T1 (de) * | 1990-10-05 | 1995-04-15 | Minnesota Mining & Mfg | Verfahren zur herstellung von imidazo(4,5- c>chinolin-4-aminen. |
| US5175296A (en) * | 1991-03-01 | 1992-12-29 | Minnesota Mining And Manufacturing Company | Imidazo[4,5-c]quinolin-4-amines and processes for their preparation |
| HU222251B1 (hu) * | 1991-03-01 | 2003-05-28 | Minnesota Mining And Manufacturing Company | 1-és 2-helyzetben szubsztituált 1H-imidazo[4,5-c]kinolin-4-amin-származékok előállításában alkalmazható 1- és 2-helyzetben szubsztituált 1H-imidazo[4,5-c]kinolin-4-(szubsztituált)-származékok |
| US5389640A (en) * | 1991-03-01 | 1995-02-14 | Minnesota Mining And Manufacturing Company | 1-substituted, 2-substituted 1H-imidazo[4,5-c]quinolin-4-amines |
| US5268376A (en) * | 1991-09-04 | 1993-12-07 | Minnesota Mining And Manufacturing Company | 1-substituted 1H-imidazo[4,5-c]quinolin-4-amines |
| US5266575A (en) * | 1991-11-06 | 1993-11-30 | Minnesota Mining And Manufacturing Company | 2-ethyl 1H-imidazo[4,5-ciquinolin-4-amines |
| IL105325A (en) * | 1992-04-16 | 1996-11-14 | Minnesota Mining & Mfg | Immunogen/vaccine adjuvant composition |
| US5395937A (en) * | 1993-01-29 | 1995-03-07 | Minnesota Mining And Manufacturing Company | Process for preparing quinoline amines |
| CA2167042A1 (en) * | 1993-07-15 | 1995-01-26 | Kyle J. Lindstrom | Imidazo[4,5-c]pyridin-4-amines |
| US5352784A (en) | 1993-07-15 | 1994-10-04 | Minnesota Mining And Manufacturing Company | Fused cycloalkylimidazopyridines |
| US5482936A (en) * | 1995-01-12 | 1996-01-09 | Minnesota Mining And Manufacturing Company | Imidazo[4,5-C]quinoline amines |
| JPH09176116A (ja) * | 1995-12-27 | 1997-07-08 | Toray Ind Inc | 複素環誘導体およびその医薬用途 |
| JPH09208584A (ja) | 1996-01-29 | 1997-08-12 | Terumo Corp | アミド誘導体、およびそれを含有する医薬製剤、および合成中間体 |
| US5693811A (en) * | 1996-06-21 | 1997-12-02 | Minnesota Mining And Manufacturing Company | Process for preparing tetrahdroimidazoquinolinamines |
| US5741908A (en) * | 1996-06-21 | 1998-04-21 | Minnesota Mining And Manufacturing Company | Process for reparing imidazoquinolinamines |
| CZ294563B6 (cs) * | 1996-10-25 | 2005-02-16 | Minnesota Mining And Manufacturing Company | Sloučeniny představující modifikátory imunitní odezvy při léčení nemocí mediovaných TH2 buňkami a nemocí odvozených |
| US5939090A (en) * | 1996-12-03 | 1999-08-17 | 3M Innovative Properties Company | Gel formulations for topical drug delivery |
| US6069149A (en) * | 1997-01-09 | 2000-05-30 | Terumo Kabushiki Kaisha | Amide derivatives and intermediates for the synthesis thereof |
| JPH1180156A (ja) | 1997-09-04 | 1999-03-26 | Hokuriku Seiyaku Co Ltd | 1−(置換アリール)アルキル−1h−イミダゾピリジン−4−アミン誘導体 |
| UA67760C2 (uk) * | 1997-12-11 | 2004-07-15 | Міннесота Майнінг Енд Мануфакчурінг Компані | Імідазонафтиридин та тетрагідроімідазонафтиридин, фармацевтична композиція, спосіб індукування біосинтезу цитокінів та спосіб лікування вірусної інфекції, проміжні сполуки |
| JPH11222432A (ja) | 1998-02-03 | 1999-08-17 | Terumo Corp | インターフェロンを誘起するアミド誘導体を含有する外用剤 |
| US6110929A (en) * | 1998-07-28 | 2000-08-29 | 3M Innovative Properties Company | Oxazolo, thiazolo and selenazolo [4,5-c]-quinolin-4-amines and analogs thereof |
| JP2000119271A (ja) * | 1998-08-12 | 2000-04-25 | Hokuriku Seiyaku Co Ltd | 1h―イミダゾピリジン誘導体 |
| SK287112B6 (sk) * | 1999-01-08 | 2009-12-07 | 3M Innovative Properties Company | Použitie zlúčeniny modifikujúcej imunitnú odpoveď pri liečení cervikálnej dysplázie |
| US20020058674A1 (en) * | 1999-01-08 | 2002-05-16 | Hedenstrom John C. | Systems and methods for treating a mucosal surface |
| US6558951B1 (en) * | 1999-02-11 | 2003-05-06 | 3M Innovative Properties Company | Maturation of dendritic cells with immune response modifying compounds |
| JP2000247884A (ja) | 1999-03-01 | 2000-09-12 | Sumitomo Pharmaceut Co Ltd | アラキドン酸誘発皮膚疾患治療剤 |
| US6541485B1 (en) * | 1999-06-10 | 2003-04-01 | 3M Innovative Properties Company | Urea substituted imidazoquinolines |
| US6331539B1 (en) * | 1999-06-10 | 2001-12-18 | 3M Innovative Properties Company | Sulfonamide and sulfamide substituted imidazoquinolines |
| US6756382B2 (en) * | 1999-06-10 | 2004-06-29 | 3M Innovative Properties Company | Amide substituted imidazoquinolines |
| US6573273B1 (en) * | 1999-06-10 | 2003-06-03 | 3M Innovative Properties Company | Urea substituted imidazoquinolines |
| US6451810B1 (en) * | 1999-06-10 | 2002-09-17 | 3M Innovative Properties Company | Amide substituted imidazoquinolines |
| US6376669B1 (en) * | 1999-11-05 | 2002-04-23 | 3M Innovative Properties Company | Dye labeled imidazoquinoline compounds |
| US6894060B2 (en) * | 2000-03-30 | 2005-05-17 | 3M Innovative Properties Company | Method for the treatment of dermal lesions caused by envenomation |
| US20020055517A1 (en) * | 2000-09-15 | 2002-05-09 | 3M Innovative Properties Company | Methods for delaying recurrence of herpes virus symptoms |
| JP2002145777A (ja) | 2000-11-06 | 2002-05-22 | Sumitomo Pharmaceut Co Ltd | アラキドン酸誘発皮膚疾患治療剤 |
| US6667312B2 (en) * | 2000-12-08 | 2003-12-23 | 3M Innovative Properties Company | Thioether substituted imidazoquinolines |
| US6664265B2 (en) * | 2000-12-08 | 2003-12-16 | 3M Innovative Properties Company | Amido ether substituted imidazoquinolines |
| US6525064B1 (en) * | 2000-12-08 | 2003-02-25 | 3M Innovative Properties Company | Sulfonamido substituted imidazopyridines |
| US6677348B2 (en) * | 2000-12-08 | 2004-01-13 | 3M Innovative Properties Company | Aryl ether substituted imidazoquinolines |
| WO2002046749A2 (en) * | 2000-12-08 | 2002-06-13 | 3M Innovative Properties Company | Screening method for identifying compounds that selectively induce interferon alpha |
| UA75622C2 (en) * | 2000-12-08 | 2006-05-15 | 3M Innovative Properties Co | Aryl ether substituted imidazoquinolines, pharmaceutical composition based thereon |
| US6545017B1 (en) * | 2000-12-08 | 2003-04-08 | 3M Innovative Properties Company | Urea substituted imidazopyridines |
| US20020107262A1 (en) * | 2000-12-08 | 2002-08-08 | 3M Innovative Properties Company | Substituted imidazopyridines |
| US6677347B2 (en) * | 2000-12-08 | 2004-01-13 | 3M Innovative Properties Company | Sulfonamido ether substituted imidazoquinolines |
| US6664264B2 (en) * | 2000-12-08 | 2003-12-16 | 3M Innovative Properties Company | Thioether substituted imidazoquinolines |
| US6664260B2 (en) * | 2000-12-08 | 2003-12-16 | 3M Innovative Properties Company | Heterocyclic ether substituted imidazoquinolines |
| US6660735B2 (en) * | 2000-12-08 | 2003-12-09 | 3M Innovative Properties Company | Urea substituted imidazoquinoline ethers |
| US6545016B1 (en) * | 2000-12-08 | 2003-04-08 | 3M Innovative Properties Company | Amide substituted imidazopyridines |
| US6660747B2 (en) * | 2000-12-08 | 2003-12-09 | 3M Innovative Properties Company | Amido ether substituted imidazoquinolines |
| JP2005501550A (ja) * | 2001-08-30 | 2005-01-20 | スリーエム イノベイティブ プロパティズ カンパニー | 免疫反応調整剤分子を用いた形質細胞様樹状細胞を成熟させる方法 |
| ATE511840T1 (de) * | 2001-10-09 | 2011-06-15 | Amgen Inc | Imidazolderivate als entzündungshemmende mittel |
| EP1478371A4 (en) * | 2001-10-12 | 2007-11-07 | Univ Iowa Res Found | METHOD AND PRODUCTS FOR IMPROVING IMMUNE RESPONSES WITH IMIDAZOCHINOLINE COMPOUNDS |
| AU2002343728A1 (en) * | 2001-11-16 | 2003-06-10 | 3M Innovative Properties Company | Methods and compositions related to irm compounds and toll-like receptor pathways |
| EP1450804B9 (en) * | 2001-11-29 | 2009-04-01 | 3M Innovative Properties Company | Pharmaceutical formulations comprising an immune response modifier |
| US6677349B1 (en) * | 2001-12-21 | 2004-01-13 | 3M Innovative Properties Company | Sulfonamide and sulfamide substituted imidazoquinolines |
| EP1478327B1 (en) * | 2002-02-22 | 2015-04-29 | Meda AB | Method of reducing and treating uvb-induced immunosuppression |
| GB0211649D0 (en) * | 2002-05-21 | 2002-07-03 | Novartis Ag | Organic compounds |
| WO2003101949A2 (en) * | 2002-05-29 | 2003-12-11 | 3M Innovative Properties Company | Process for imidazo[4,5-c]pyridin-4-amines |
| CA2488801A1 (en) * | 2002-06-07 | 2003-12-18 | 3M Innovative Properties Company | Ether substituted imidazopyridines |
| ES2271650T3 (es) * | 2002-07-23 | 2007-04-16 | Teva Gyogyszergyar Zartkoruen Mukodo Reszvenytarsasag | Preparacion de 1h-imidazo (4,5-c) quinolin-4-aminas mediante los productos intermedios de 1h-imidazo (4,5-c) quinolin-4-ftalimida. |
| DE60312701T8 (de) * | 2002-07-26 | 2008-08-21 | Teva Gyógyszergyár Zártkörüen Müködö Részvénytársaság | Darstellung von 1h-imidazo[4,5-c]chinolin-4-aminen über neue 1h-imidazo[4,5-c] chinolin-4-cyano- und 1h-imidazo[4,5-c]chinolin-4-carboxamid intermediate |
| DK1545597T3 (da) * | 2002-08-15 | 2011-01-31 | 3M Innovative Properties Co | Immunstimulerende sammensætninger og fremgangsmåde til stimulering af en immunrespons |
| US6818650B2 (en) * | 2002-09-26 | 2004-11-16 | 3M Innovative Properties Company | 1H-imidazo dimers |
| AU2003287316A1 (en) * | 2002-12-11 | 2004-06-30 | 3M Innovative Properties Company | Assays relating to toll-like receptor activity |
| AU2003287324A1 (en) * | 2002-12-11 | 2004-06-30 | 3M Innovative Properties Company | Gene expression systems and recombinant cell lines |
| NZ540826A (en) * | 2002-12-20 | 2008-07-31 | 3M Innovative Properties Co | Aryl / hetaryl substituted imidazoquinolines |
| EP2572715A1 (en) * | 2002-12-30 | 2013-03-27 | 3M Innovative Properties Company | Immunostimulatory Combinations |
| JP2006517974A (ja) * | 2003-02-13 | 2006-08-03 | スリーエム イノベイティブ プロパティズ カンパニー | Irm化合物およびトル様受容体8に関する方法および組成物 |
| WO2004075865A2 (en) * | 2003-02-27 | 2004-09-10 | 3M Innovative Properties Company | Selective modulation of tlr-mediated biological activity |
| CA2517528A1 (en) * | 2003-03-04 | 2004-09-16 | 3M Innovative Properties Company | Prophylactic treatment of uv-induced epidermal neoplasia |
| JP2006519877A (ja) * | 2003-03-07 | 2006-08-31 | スリーエム イノベイティブ プロパティズ カンパニー | 1−アミノ1h−イミダゾキノリン |
| CA2518282C (en) * | 2003-03-13 | 2012-11-06 | 3M Innovative Properties Company | Methods of improving skin quality |
| US7179253B2 (en) * | 2003-03-13 | 2007-02-20 | 3M Innovative Properties Company | Method of tattoo removal |
| JP2006523212A (ja) * | 2003-03-13 | 2006-10-12 | スリーエム イノベイティブ プロパティズ カンパニー | 皮膚病変の診断方法 |
| EP1613956A2 (en) * | 2003-03-25 | 2006-01-11 | 3M Innovative Properties Company | Selective activation of cellular activities mediated through a common toll-like receptor |
| US20040192585A1 (en) * | 2003-03-25 | 2004-09-30 | 3M Innovative Properties Company | Treatment for basal cell carcinoma |
| EP1615665A4 (en) * | 2003-04-10 | 2010-10-06 | 3M Innovative Properties Co | DISTRIBUTION OF THE IMMUNE RESPONSE MODIFYING LINKS |
| US20040214851A1 (en) * | 2003-04-28 | 2004-10-28 | 3M Innovative Properties Company | Compositions and methods for induction of opioid receptors |
| AU2004266641A1 (en) | 2003-08-12 | 2005-03-03 | 3M Innovative Properties Company | Oxime substituted imidazo-containing compounds |
| WO2005018555A2 (en) | 2003-08-14 | 2005-03-03 | 3M Innovative Properties Company | Lipid-modified immune response modifiers |
| CA2537450C (en) * | 2003-09-05 | 2012-04-17 | Anadys Pharmaceuticals, Inc. | Administration of tlr7 ligands and prodrugs thereof for treatment of infection by hepatitis c virus |
| EP1668010A2 (en) * | 2003-10-01 | 2006-06-14 | Taro Pharmaceuticals U.S.A., Inc. | Method of preparing 4-amino-1h -imidazo(4,5- c )quinolines and acid addition salts thereof |
| ITMI20032121A1 (it) * | 2003-11-04 | 2005-05-05 | Dinamite Dipharma Spa In Forma Abbr Eviata Dipharm | Procedimento per la preparazione di imiquimod e suoi intermedi |
| WO2006038923A2 (en) * | 2004-06-18 | 2006-04-13 | 3M Innovative Properties Company | Aryl substituted imidazonaphthyridines |
-
2005
- 2005-06-17 US US11/570,707 patent/US7884207B2/en not_active Expired - Fee Related
- 2005-06-17 WO PCT/US2005/021445 patent/WO2006028545A2/en not_active Ceased
- 2005-06-17 JP JP2007516773A patent/JP5128940B2/ja not_active Expired - Fee Related
- 2005-06-17 EP EP05814989.9A patent/EP1765348B1/en not_active Expired - Lifetime
- 2005-06-17 CA CA2571360A patent/CA2571360C/en not_active Expired - Fee Related
- 2005-06-17 AU AU2005283085A patent/AU2005283085B2/en not_active Ceased
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2005123079A2 (en) * | 2004-06-14 | 2005-12-29 | 3M Innovative Properties Company | Urea substituted imidazopyridines, imidazoquinolines, and imidazonaphthyridines |
Also Published As
| Publication number | Publication date |
|---|---|
| JP2008503484A (ja) | 2008-02-07 |
| CA2571360A1 (en) | 2006-03-16 |
| US7884207B2 (en) | 2011-02-08 |
| WO2006028545A2 (en) | 2006-03-16 |
| AU2005283085A1 (en) | 2006-03-16 |
| WO2006028545A3 (en) | 2007-08-23 |
| CA2571360C (en) | 2014-11-25 |
| EP1765348A4 (en) | 2010-05-26 |
| EP1765348A2 (en) | 2007-03-28 |
| EP1765348B1 (en) | 2016-08-03 |
| JP5128940B2 (ja) | 2013-01-23 |
| US20070287724A1 (en) | 2007-12-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AU2005283085B2 (en) | Substituted imidazoquinolines, imidazopyridines, and imidazonaphthyridines | |
| AU2006311871B2 (en) | Hydroxy and alkoxy substituted 1H-imidazoquinolines and methods | |
| US7939526B2 (en) | Sulfone substituted imidazo ring ethers | |
| AU2005322898B2 (en) | Chiral fused (1,2)imidazo(4,5-c) ring compounds | |
| US9938275B2 (en) | Substituted imidazoquinolines, imidazopyridines, and imidazonaphthyridines | |
| AU2005282523A1 (en) | 2-amino 1H imidazo ring systems and methods | |
| AU2006216686A1 (en) | Method of preferentially inducing the biosynthesis of interferon | |
| AU2006216799A1 (en) | Hydroxyalkyl substituted imidazonaphthyridines | |
| AU2004278014A1 (en) | Alkoxy substituted imidazoquinolines | |
| AU2004312508A1 (en) | Imidazoquinolinyl, imidazopyridinyl, and imidazonaphthyridinyl sulfonamides | |
| WO2006009832A1 (en) | Substituted imidazo ring systems and methods | |
| WO2005123079A2 (en) | Urea substituted imidazopyridines, imidazoquinolines, and imidazonaphthyridines | |
| WO2006026760A2 (en) | 1-amino imidazo-containing compounds and methods | |
| AU2006232377A1 (en) | Pyrazolopyridine-1,4-diamines and analogs thereof | |
| AU2006213746A1 (en) | Oxime and hydroxylamine substituted imidazo(4,5-c) ring compounds and methods | |
| AU2006287157A1 (en) | Hydroxy substituted 1H-imidazopyridines and methods | |
| AU2004291101A1 (en) | Oxime substituted imidazo ring compounds |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| FGA | Letters patent sealed or granted (standard patent) | ||
| MK14 | Patent ceased section 143(a) (annual fees not paid) or expired |