AT411372B - Bauelement und verfahren zu seiner herstellung - Google Patents
Bauelement und verfahren zu seiner herstellung Download PDFInfo
- Publication number
- AT411372B AT411372B AT0108501A AT10852001A AT411372B AT 411372 B AT411372 B AT 411372B AT 0108501 A AT0108501 A AT 0108501A AT 10852001 A AT10852001 A AT 10852001A AT 411372 B AT411372 B AT 411372B
- Authority
- AT
- Austria
- Prior art keywords
- layer
- spacer elements
- cover layer
- wood
- cover
- Prior art date
Links
- 238000004519 manufacturing process Methods 0.000 title claims description 43
- 238000000034 method Methods 0.000 title claims description 17
- 239000010410 layer Substances 0.000 claims description 482
- 125000006850 spacer group Chemical group 0.000 claims description 266
- 239000002023 wood Substances 0.000 claims description 129
- 239000000463 material Substances 0.000 claims description 123
- 239000012792 core layer Substances 0.000 claims description 89
- 238000005728 strengthening Methods 0.000 claims description 44
- 239000000945 filler Substances 0.000 claims description 31
- 239000003795 chemical substances by application Substances 0.000 claims description 24
- 239000000853 adhesive Substances 0.000 claims description 23
- 230000001070 adhesive effect Effects 0.000 claims description 23
- 230000036961 partial effect Effects 0.000 claims description 21
- 239000000835 fiber Substances 0.000 claims description 20
- 239000004033 plastic Substances 0.000 claims description 19
- 229920003023 plastic Polymers 0.000 claims description 19
- 239000011148 porous material Substances 0.000 claims description 17
- 238000007596 consolidation process Methods 0.000 claims description 14
- 238000005304 joining Methods 0.000 claims description 12
- 239000011093 chipboard Substances 0.000 claims description 10
- 239000012790 adhesive layer Substances 0.000 claims description 9
- 229920005989 resin Polymers 0.000 claims description 9
- 239000011347 resin Substances 0.000 claims description 9
- 230000008093 supporting effect Effects 0.000 claims description 9
- 239000011248 coating agent Substances 0.000 claims description 8
- 238000000576 coating method Methods 0.000 claims description 8
- 238000009833 condensation Methods 0.000 claims description 8
- 230000005494 condensation Effects 0.000 claims description 8
- 239000010408 film Substances 0.000 claims description 8
- 229910052751 metal Inorganic materials 0.000 claims description 8
- 239000002184 metal Substances 0.000 claims description 8
- 230000009471 action Effects 0.000 claims description 7
- 230000001681 protective effect Effects 0.000 claims description 7
- 229910052782 aluminium Inorganic materials 0.000 claims description 6
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 6
- 239000011094 fiberboard Substances 0.000 claims description 6
- 230000002787 reinforcement Effects 0.000 claims description 6
- 229920000877 Melamine resin Polymers 0.000 claims description 5
- 239000004744 fabric Substances 0.000 claims description 5
- 239000002657 fibrous material Substances 0.000 claims description 5
- 239000011810 insulating material Substances 0.000 claims description 5
- 239000007769 metal material Substances 0.000 claims description 5
- 239000002985 plastic film Substances 0.000 claims description 5
- 229920006255 plastic film Polymers 0.000 claims description 5
- 238000003825 pressing Methods 0.000 claims description 5
- 239000011230 binding agent Substances 0.000 claims description 4
- 229920001568 phenolic resin Polymers 0.000 claims description 4
- 229920001807 Urea-formaldehyde Polymers 0.000 claims description 3
- 239000011490 mineral wool Substances 0.000 claims description 3
- 239000003973 paint Substances 0.000 claims description 3
- 238000012805 post-processing Methods 0.000 claims description 3
- 230000005855 radiation Effects 0.000 claims description 3
- 239000000126 substance Substances 0.000 claims description 3
- JZLWSRCQCPAUDP-UHFFFAOYSA-N 1,3,5-triazine-2,4,6-triamine;urea Chemical compound NC(N)=O.NC1=NC(N)=NC(N)=N1 JZLWSRCQCPAUDP-UHFFFAOYSA-N 0.000 claims description 2
- KXGFMDJXCMQABM-UHFFFAOYSA-N 2-methoxy-6-methylphenol Chemical compound [CH]OC1=CC=CC([CH])=C1O KXGFMDJXCMQABM-UHFFFAOYSA-N 0.000 claims description 2
- 239000004640 Melamine resin Substances 0.000 claims description 2
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 claims description 2
- 239000010426 asphalt Substances 0.000 claims description 2
- 239000001913 cellulose Substances 0.000 claims description 2
- 229920002678 cellulose Polymers 0.000 claims description 2
- 239000003245 coal Substances 0.000 claims description 2
- IVJISJACKSSFGE-UHFFFAOYSA-N formaldehyde;1,3,5-triazine-2,4,6-triamine Chemical compound O=C.NC1=NC(N)=NC(N)=N1 IVJISJACKSSFGE-UHFFFAOYSA-N 0.000 claims description 2
- SLGWESQGEUXWJQ-UHFFFAOYSA-N formaldehyde;phenol Chemical compound O=C.OC1=CC=CC=C1 SLGWESQGEUXWJQ-UHFFFAOYSA-N 0.000 claims description 2
- 238000009415 formwork Methods 0.000 claims description 2
- 239000011521 glass Substances 0.000 claims description 2
- 238000000227 grinding Methods 0.000 claims description 2
- 229910010272 inorganic material Inorganic materials 0.000 claims description 2
- 239000011147 inorganic material Substances 0.000 claims description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 claims description 2
- 239000011707 mineral Substances 0.000 claims description 2
- 239000011368 organic material Substances 0.000 claims description 2
- 238000010422 painting Methods 0.000 claims description 2
- ODGAOXROABLFNM-UHFFFAOYSA-N polynoxylin Chemical compound O=C.NC(N)=O ODGAOXROABLFNM-UHFFFAOYSA-N 0.000 claims description 2
- 239000000843 powder Substances 0.000 claims description 2
- 239000002994 raw material Substances 0.000 claims description 2
- 239000011435 rock Substances 0.000 claims description 2
- 238000007711 solidification Methods 0.000 claims description 2
- 230000008023 solidification Effects 0.000 claims description 2
- 238000004381 surface treatment Methods 0.000 claims description 2
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 claims 2
- HANVTCGOAROXMV-UHFFFAOYSA-N formaldehyde;1,3,5-triazine-2,4,6-triamine;urea Chemical compound O=C.NC(N)=O.NC1=NC(N)=NC(N)=N1 HANVTCGOAROXMV-UHFFFAOYSA-N 0.000 claims 1
- 229910052755 nonmetal Inorganic materials 0.000 claims 1
- 238000013461 design Methods 0.000 description 19
- 239000003063 flame retardant Substances 0.000 description 14
- 210000004027 cell Anatomy 0.000 description 12
- RNFJDJUURJAICM-UHFFFAOYSA-N 2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene Chemical compound N=1P(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP=1(OC=1C=CC=CC=1)OC1=CC=CC=C1 RNFJDJUURJAICM-UHFFFAOYSA-N 0.000 description 11
- 230000008901 benefit Effects 0.000 description 9
- 230000008569 process Effects 0.000 description 8
- 230000004888 barrier function Effects 0.000 description 7
- 238000004026 adhesive bonding Methods 0.000 description 6
- 238000010276 construction Methods 0.000 description 6
- 230000003628 erosive effect Effects 0.000 description 6
- 239000003292 glue Substances 0.000 description 6
- 238000005452 bending Methods 0.000 description 5
- 230000005540 biological transmission Effects 0.000 description 5
- 239000002131 composite material Substances 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 230000009969 flowable effect Effects 0.000 description 5
- 230000015572 biosynthetic process Effects 0.000 description 4
- 238000009792 diffusion process Methods 0.000 description 4
- 239000000123 paper Substances 0.000 description 4
- 230000002829 reductive effect Effects 0.000 description 4
- 238000011161 development Methods 0.000 description 3
- 230000018109 developmental process Effects 0.000 description 3
- 230000007613 environmental effect Effects 0.000 description 3
- 238000009413 insulation Methods 0.000 description 3
- 239000012528 membrane Substances 0.000 description 3
- 238000005192 partition Methods 0.000 description 3
- 239000011120 plywood Substances 0.000 description 3
- 230000009467 reduction Effects 0.000 description 3
- 239000005871 repellent Substances 0.000 description 3
- 230000011218 segmentation Effects 0.000 description 3
- 239000002356 single layer Substances 0.000 description 3
- 239000002689 soil Substances 0.000 description 3
- 238000012360 testing method Methods 0.000 description 3
- 238000012546 transfer Methods 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- 238000000748 compression moulding Methods 0.000 description 2
- 238000013016 damping Methods 0.000 description 2
- 230000007423 decrease Effects 0.000 description 2
- 238000009826 distribution Methods 0.000 description 2
- 230000006872 improvement Effects 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 239000002984 plastic foam Substances 0.000 description 2
- 238000004064 recycling Methods 0.000 description 2
- 238000005096 rolling process Methods 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 229920003002 synthetic resin Polymers 0.000 description 2
- 239000000057 synthetic resin Substances 0.000 description 2
- 230000007704 transition Effects 0.000 description 2
- 238000009423 ventilation Methods 0.000 description 2
- BYHQTRFJOGIQAO-GOSISDBHSA-N 3-(4-bromophenyl)-8-[(2R)-2-hydroxypropyl]-1-[(3-methoxyphenyl)methyl]-1,3,8-triazaspiro[4.5]decan-2-one Chemical compound C[C@H](CN1CCC2(CC1)CN(C(=O)N2CC3=CC(=CC=C3)OC)C4=CC=C(C=C4)Br)O BYHQTRFJOGIQAO-GOSISDBHSA-N 0.000 description 1
- 241000289669 Erinaceus europaeus Species 0.000 description 1
- 229920002430 Fibre-reinforced plastic Polymers 0.000 description 1
- 239000004606 Fillers/Extenders Substances 0.000 description 1
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 229920005372 Plexiglas® Polymers 0.000 description 1
- 239000004111 Potassium silicate Substances 0.000 description 1
- 239000004115 Sodium Silicate Substances 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- -1 alkali metal salts Chemical class 0.000 description 1
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical group [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 1
- WNROFYMDJYEPJX-UHFFFAOYSA-K aluminium hydroxide Chemical class [OH-].[OH-].[OH-].[Al+3] WNROFYMDJYEPJX-UHFFFAOYSA-K 0.000 description 1
- 239000013590 bulk material Substances 0.000 description 1
- 239000011797 cavity material Substances 0.000 description 1
- 230000001413 cellular effect Effects 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000005253 cladding Methods 0.000 description 1
- 239000011362 coarse particle Substances 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 239000004567 concrete Substances 0.000 description 1
- 238000012937 correction Methods 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 230000002542 deteriorative effect Effects 0.000 description 1
- 229920006248 expandable polystyrene Polymers 0.000 description 1
- 239000011151 fibre-reinforced plastic Substances 0.000 description 1
- 239000011152 fibreglass Substances 0.000 description 1
- 210000001145 finger joint Anatomy 0.000 description 1
- 238000007667 floating Methods 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 238000005187 foaming Methods 0.000 description 1
- WSFSSNUMVMOOMR-UHFFFAOYSA-N formaldehyde Substances O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 1
- 230000001771 impaired effect Effects 0.000 description 1
- 239000000077 insect repellent Substances 0.000 description 1
- 230000010354 integration Effects 0.000 description 1
- 235000000396 iron Nutrition 0.000 description 1
- 230000002427 irreversible effect Effects 0.000 description 1
- 239000004922 lacquer Substances 0.000 description 1
- JDSHMPZPIAZGSV-UHFFFAOYSA-N melamine Chemical compound NC1=NC(N)=NC(N)=N1 JDSHMPZPIAZGSV-UHFFFAOYSA-N 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 230000010355 oscillation Effects 0.000 description 1
- 230000035699 permeability Effects 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 239000004848 polyfunctional curative Substances 0.000 description 1
- 210000001316 polygonal cell Anatomy 0.000 description 1
- 229920002689 polyvinyl acetate Polymers 0.000 description 1
- NNHHDJVEYQHLHG-UHFFFAOYSA-N potassium silicate Chemical compound [K+].[K+].[O-][Si]([O-])=O NNHHDJVEYQHLHG-UHFFFAOYSA-N 0.000 description 1
- 229910052913 potassium silicate Inorganic materials 0.000 description 1
- 235000019353 potassium silicate Nutrition 0.000 description 1
- 238000004382 potting Methods 0.000 description 1
- 238000010079 rubber tapping Methods 0.000 description 1
- 238000007789 sealing Methods 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 1
- 229910052911 sodium silicate Inorganic materials 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 230000003068 static effect Effects 0.000 description 1
- 239000002344 surface layer Substances 0.000 description 1
- 230000003746 surface roughness Effects 0.000 description 1
- 229920001187 thermosetting polymer Polymers 0.000 description 1
- 230000003313 weakening effect Effects 0.000 description 1
Classifications
-
- E—FIXED CONSTRUCTIONS
- E04—BUILDING
- E04C—STRUCTURAL ELEMENTS; BUILDING MATERIALS
- E04C2/00—Building elements of relatively thin form for the construction of parts of buildings, e.g. sheet materials, slabs, or panels
- E04C2/30—Building elements of relatively thin form for the construction of parts of buildings, e.g. sheet materials, slabs, or panels characterised by the shape or structure
- E04C2/34—Building elements of relatively thin form for the construction of parts of buildings, e.g. sheet materials, slabs, or panels characterised by the shape or structure composed of two or more spaced sheet-like parts
- E04C2/36—Building elements of relatively thin form for the construction of parts of buildings, e.g. sheet materials, slabs, or panels characterised by the shape or structure composed of two or more spaced sheet-like parts spaced apart by transversely-placed strip material, e.g. honeycomb panels
Landscapes
- Engineering & Computer Science (AREA)
- Architecture (AREA)
- Civil Engineering (AREA)
- Structural Engineering (AREA)
- Buildings Adapted To Withstand Abnormal External Influences (AREA)
- Laminated Bodies (AREA)
Priority Applications (12)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| AT0108501A AT411372B (de) | 2000-07-17 | 2001-07-11 | Bauelement und verfahren zu seiner herstellung |
| US10/333,174 US20040074205A1 (en) | 2000-07-17 | 2001-07-13 | Self-and load-supporting component |
| CA002427743A CA2427743A1 (en) | 2000-07-17 | 2001-07-13 | Self- and load-supporting component |
| HU0303121A HUP0303121A2 (en) | 2000-07-17 | 2001-07-13 | Self- and load-supporting component |
| EP01984255A EP1301669A1 (de) | 2000-07-17 | 2001-07-13 | Selbsttragendes und lastabtragendes bauelement |
| SK64-2003A SK642003A3 (en) | 2000-07-17 | 2001-07-13 | Self- and load-supporting component, its use and method for producing thereof |
| PCT/AT2001/000238 WO2002006606A1 (de) | 2000-07-17 | 2001-07-13 | Selbsttragendes und lastabtragendes bauelement |
| CZ2003131A CZ2003131A3 (cs) | 2000-07-17 | 2001-07-13 | Samonosný stavební dílec, jeho použití a způsob jeho výroby |
| HR20030021A HRP20030021A2 (en) | 2000-07-17 | 2001-07-13 | Self- and load-supporting component |
| AU2002222949A AU2002222949A1 (en) | 2000-07-17 | 2001-07-13 | Self- and load-supporting component |
| PL36070001A PL360700A1 (pl) | 2000-07-17 | 2001-07-13 | Samonośny element konstrukcyjny, przenoszący obciążenie |
| NO20030227A NO20030227L (no) | 2000-07-17 | 2003-01-17 | Selv- og lastb¶rende byggelement |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| AT12432000A AT411371B (de) | 2000-07-17 | 2000-07-17 | Bauelement |
| AT0108501A AT411372B (de) | 2000-07-17 | 2001-07-11 | Bauelement und verfahren zu seiner herstellung |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| ATA10852001A ATA10852001A (de) | 2003-05-15 |
| AT411372B true AT411372B (de) | 2003-12-29 |
Family
ID=25608492
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT0108501A AT411372B (de) | 2000-07-17 | 2001-07-11 | Bauelement und verfahren zu seiner herstellung |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US20040074205A1 (pl) |
| EP (1) | EP1301669A1 (pl) |
| AT (1) | AT411372B (pl) |
| AU (1) | AU2002222949A1 (pl) |
| CA (1) | CA2427743A1 (pl) |
| CZ (1) | CZ2003131A3 (pl) |
| HR (1) | HRP20030021A2 (pl) |
| HU (1) | HUP0303121A2 (pl) |
| NO (1) | NO20030227L (pl) |
| PL (1) | PL360700A1 (pl) |
| SK (1) | SK642003A3 (pl) |
| WO (1) | WO2002006606A1 (pl) |
Families Citing this family (40)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL1018380C2 (nl) * | 2001-06-25 | 2003-01-07 | Cfs Weert Bv | Koelmachine voor lolly's. |
| FR2857616B1 (fr) * | 2003-07-18 | 2007-04-06 | Solvay | Procede pour l'assemblage des elements d'une structure comprenant une ame en nid d'abeille |
| JP2007532669A (ja) | 2004-04-13 | 2007-11-15 | イカジェン インコーポレイテッド | カリウムイオンチャネル調節剤としての多環式ピリミジン |
| AT501521B1 (de) * | 2005-01-27 | 2013-07-15 | Krestel Stefan | Trägerartiges, aus einzelteilen zusammengesetztes bauelement sowie verfahren zur herstellung des bauelements |
| US20070178793A1 (en) * | 2006-01-27 | 2007-08-02 | Gerello Brian C | Wood panel with water vapor-permeable polyester layer |
| US20070234675A1 (en) * | 2006-03-17 | 2007-10-11 | Panel Resources, Inc. | Lightweight man-made board |
| NL1031585C2 (nl) * | 2006-04-13 | 2007-10-19 | Makers B V | Paneel en toepassing voor een dergelijk paneel als steigerplaat of bouwpaneel. |
| WO2008067366A2 (en) * | 2006-11-28 | 2008-06-05 | Usa As Represented By The Administrator Of The National Aeronautics And Space Administration | Composite panel with reinforced recesses |
| ES2329208B1 (es) * | 2007-04-11 | 2010-09-22 | Maria Elena Torondell Garcia | Atamborado rechapable con malla de mdf. |
| DE102007056619A1 (de) * | 2007-05-06 | 2008-12-04 | Blitzstrom Gmbh | Befestigungsunterlage für Photovoltaikmodule |
| GB2450359A (en) * | 2007-06-20 | 2008-12-24 | Ian De Haan | Multi-Core Structural Insulated Panels |
| US20110180351A1 (en) * | 2007-10-12 | 2011-07-28 | Cama Mark R | Treestand with folding leg support and method of making thereof |
| EP2063199B1 (de) * | 2007-11-23 | 2012-05-30 | BELECTRIC Trading GmbH | Anordnung bestehend aus einer Befestigungsunterlage mit Photovoltaikmodulen |
| WO2010042502A2 (en) * | 2008-10-06 | 2010-04-15 | University Of Florida Research Foundation, Inc. | Active fixturing for micro/mesoscale machine tool systems |
| US20140302277A1 (en) * | 2008-10-08 | 2014-10-09 | Makers B.V. | Panel and Use of Such a Panel As A Scaffolding Board or a Building Panel |
| WO2010078413A1 (en) | 2008-12-31 | 2010-07-08 | Apinee, Inc. | Preservation of wood, compositions and methods thereof |
| CH702932A1 (de) * | 2010-04-06 | 2011-10-14 | Akustik & Raum Ag | Absorbierende Lärmschutzwände. |
| EP2412885A1 (fr) * | 2010-07-28 | 2012-02-01 | Itech Wood S.A. | Structure de batiment en bois à plusieurs étages |
| DE102010062061A1 (de) * | 2010-11-26 | 2012-05-31 | Wacker Chemie Ag | Bauelemente in Plattenform |
| US9008884B2 (en) | 2010-12-15 | 2015-04-14 | Symbotic Llc | Bot position sensing |
| US9878464B1 (en) | 2011-06-30 | 2018-01-30 | Apinee, Inc. | Preservation of cellulosic materials, compositions and methods thereof |
| KR101250194B1 (ko) * | 2011-09-02 | 2013-04-02 | 계명대학교 산학협력단 | 다층 섬유시트를 이용한 복공판. |
| TWI622540B (zh) | 2011-09-09 | 2018-05-01 | 辛波提克有限責任公司 | 自動化儲存及取放系統 |
| SE536860C2 (sv) * | 2012-02-23 | 2014-10-07 | Noisetech Hb | En ljudabsorbent |
| AT13598U1 (de) * | 2012-07-06 | 2014-04-15 | Egger Michael Mag | Dämmelement |
| EP2917426B1 (de) * | 2012-11-08 | 2023-06-07 | IIS Institute for Independent Studies Zürich GmbH | Gebäudehülle und verfahren zur temperatureinstellung in einem gebäude |
| EP2804224A1 (de) | 2013-05-13 | 2014-11-19 | Fraunhofer Gesellschaft zur Förderung der angewandten Forschung e.V. | Verfahren zur Herstellung eines Photovoltaikmoduls |
| US10160533B2 (en) * | 2014-09-23 | 2018-12-25 | The Boeing Company | Aircraft cabin pressure regulating subfloor |
| DE102015108357A1 (de) * | 2015-05-27 | 2016-12-01 | Wedi Gmbh | Plattenförmiges Bauelement mit Außenmembran |
| US9797147B2 (en) * | 2015-07-08 | 2017-10-24 | Void Form Products, Inc. | Water proof construction unit |
| PL3208400T3 (pl) * | 2016-02-22 | 2025-05-26 | Wood Innovations Ltd. | Lekki element panelowy mający faliste elementy |
| RU2621240C1 (ru) * | 2016-03-18 | 2017-06-01 | Федеральное государственное бюджетное образовательное учреждение высшего образования "Юго-Западный государственный университет" (ЮЗГУ) | Трехслойная ресурсосберегающая железобетонная панель |
| AT520790B1 (de) * | 2017-12-21 | 2020-01-15 | Schmidt Michael | Bauelement |
| CN114457952A (zh) * | 2020-11-10 | 2022-05-10 | 茅金声 | 一种板状建筑物施工方法 |
| NL2027014B1 (en) * | 2020-11-30 | 2022-07-04 | Holland Composites Bv | Renewable lightweight composite assembly |
| US11911685B1 (en) * | 2021-05-11 | 2024-02-27 | RXD Global, LLC | Skateboard deck with longitudinal rigidity and torsional flexibility |
| USD1025259S1 (en) | 2021-06-14 | 2024-04-30 | RXD Global, LLC | Skateboard deck |
| USD1034868S1 (en) | 2021-06-14 | 2024-07-09 | RXD Global, LLC | Skateboard deck |
| AT526217B1 (de) * | 2022-05-16 | 2024-12-15 | Schmidt Michael | Trägerartiges, aus Einzelteilen zusammengeschweißtes Bauelement |
| WO2025083706A1 (en) * | 2023-10-16 | 2025-04-24 | Saint-Gobain Placo | Sheet metal, construction element and method of manufacturing the sheet metal |
Citations (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE925858C (de) * | 1953-03-18 | 1955-03-31 | Gerlach Horst | Holzgurttraeger |
| AT196113B (de) * | 1955-03-14 | 1958-02-25 | Josef Linecker | Zellenbaukörper |
| AT198000B (de) * | 1955-06-27 | 1958-05-27 | Bettinger Corp | Zellenkörper und Verfahren zu seiner Herstellung |
| AT202324B (de) * | 1956-04-03 | 1959-03-10 | Dufaylite Dev Ltd | Zellenkörper und Verfahren zu seiner Herstellung |
| AT208047B (de) * | 1958-02-25 | 1960-03-10 | Victor Jacques Barut | Netzartige Zellenanordnung und Verfahren zur Herstellung derselben |
| EP0314625A1 (de) * | 1987-10-30 | 1989-05-03 | Ciba-Geigy Ag | Verbundplatte für Verkleidungen von Oberflächen von Bauwerken |
| DE19521027A1 (de) * | 1994-06-23 | 1996-08-01 | Wellsteg Ag | WELLSTEG-"Kammern-Element" (WE-KA-EL) |
| EP0568270B1 (en) * | 1992-04-22 | 1997-07-09 | Tower Technologies (Proprietary) Limited | Composite panel |
| US5738924A (en) * | 1994-01-26 | 1998-04-14 | Sing; Peter | Sandwich construction building materials |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1281686A (en) * | 1968-09-04 | 1972-07-12 | Susanne Klara Atteck | Method of making a structural material |
| US4428993A (en) * | 1982-05-11 | 1984-01-31 | Baltek Corporation | Structural laminate with expanded wood core |
| DE3315246C2 (de) * | 1983-04-27 | 1986-05-07 | Messerschmitt-Bölkow-Blohm GmbH, 8000 München | Bauteil in Sandwichbauweise |
-
2001
- 2001-07-11 AT AT0108501A patent/AT411372B/de not_active IP Right Cessation
- 2001-07-13 CZ CZ2003131A patent/CZ2003131A3/cs unknown
- 2001-07-13 CA CA002427743A patent/CA2427743A1/en not_active Abandoned
- 2001-07-13 US US10/333,174 patent/US20040074205A1/en not_active Abandoned
- 2001-07-13 SK SK64-2003A patent/SK642003A3/sk unknown
- 2001-07-13 EP EP01984255A patent/EP1301669A1/de not_active Withdrawn
- 2001-07-13 AU AU2002222949A patent/AU2002222949A1/en not_active Abandoned
- 2001-07-13 HR HR20030021A patent/HRP20030021A2/xx not_active Application Discontinuation
- 2001-07-13 WO PCT/AT2001/000238 patent/WO2002006606A1/de not_active Ceased
- 2001-07-13 HU HU0303121A patent/HUP0303121A2/hu unknown
- 2001-07-13 PL PL36070001A patent/PL360700A1/pl unknown
-
2003
- 2003-01-17 NO NO20030227A patent/NO20030227L/no not_active Application Discontinuation
Patent Citations (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE925858C (de) * | 1953-03-18 | 1955-03-31 | Gerlach Horst | Holzgurttraeger |
| AT196113B (de) * | 1955-03-14 | 1958-02-25 | Josef Linecker | Zellenbaukörper |
| AT198000B (de) * | 1955-06-27 | 1958-05-27 | Bettinger Corp | Zellenkörper und Verfahren zu seiner Herstellung |
| AT202324B (de) * | 1956-04-03 | 1959-03-10 | Dufaylite Dev Ltd | Zellenkörper und Verfahren zu seiner Herstellung |
| AT208047B (de) * | 1958-02-25 | 1960-03-10 | Victor Jacques Barut | Netzartige Zellenanordnung und Verfahren zur Herstellung derselben |
| EP0314625A1 (de) * | 1987-10-30 | 1989-05-03 | Ciba-Geigy Ag | Verbundplatte für Verkleidungen von Oberflächen von Bauwerken |
| EP0568270B1 (en) * | 1992-04-22 | 1997-07-09 | Tower Technologies (Proprietary) Limited | Composite panel |
| US5738924A (en) * | 1994-01-26 | 1998-04-14 | Sing; Peter | Sandwich construction building materials |
| DE19521027A1 (de) * | 1994-06-23 | 1996-08-01 | Wellsteg Ag | WELLSTEG-"Kammern-Element" (WE-KA-EL) |
Also Published As
| Publication number | Publication date |
|---|---|
| ATA10852001A (de) | 2003-05-15 |
| PL360700A1 (pl) | 2004-09-20 |
| SK642003A3 (en) | 2003-10-07 |
| CZ2003131A3 (cs) | 2003-09-17 |
| CA2427743A1 (en) | 2002-01-24 |
| US20040074205A1 (en) | 2004-04-22 |
| AU2002222949A1 (en) | 2002-01-30 |
| HRP20030021A2 (en) | 2004-04-30 |
| WO2002006606A1 (de) | 2002-01-24 |
| EP1301669A1 (de) | 2003-04-16 |
| NO20030227L (no) | 2003-03-12 |
| HUP0303121A2 (en) | 2004-01-28 |
| NO20030227D0 (no) | 2003-01-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AT411372B (de) | Bauelement und verfahren zu seiner herstellung | |
| EP1528171B1 (de) | Holz-Beton-Verbundsysteme aus Holzbauteilen, Zwischenschichten und Betonbauteilen | |
| EP1640521B2 (de) | Verfahren zur Installation von Dämmplatten | |
| DE2320213A1 (de) | Bauplatte | |
| EP2216454B1 (de) | Dämmsystem | |
| EP1623078B1 (de) | Verfahren zum verbinden von bausteinen zur bildung eines bausteinverbundes sowie bausteinverbund | |
| EP1789640A1 (de) | Baumodul | |
| EP0848774A2 (de) | Fachwerk und gefacheelement und verfarhren zur herstellung eines gefacheelements | |
| DE20316376U1 (de) | Holz-Beton-Verbundsysteme aus Holzbauteilen, Zwischenschichten und Betonbauteilen | |
| EP1283926A1 (de) | Tafelförmiges holzverbundelement | |
| AT411371B (de) | Bauelement | |
| WO2011060468A1 (de) | Verbundelement und holzmauerstein | |
| DE19801370A1 (de) | Tafelelement | |
| EP1395719B2 (de) | Dachkonstruktion in flacher und/oder flach geneigter ausgestaltung sowie dämmstoffelement hierfür | |
| DE202008016581U1 (de) | Verkleidungssystem | |
| DE202023000351U1 (de) | Wärmegedämmte Leichtbauwand als Gebäudebekleidung für die serielle Sanierung von Bestandsgebäuden | |
| EP1799926B1 (de) | Gebäudedach sowie dämmschichtaufbau und mineralfaserdämmstoffelement für ein gebäudedach | |
| DE102008022600A1 (de) | Verfahren zur Herstellung einer Geschossdeckendämmung und entsprechende Geschossdeckendämmung | |
| EP3971361A1 (de) | Lehmbauwandscheibe | |
| AT509157A1 (de) | Verbundelement | |
| EP1335080A1 (de) | Dämmstoffplatte zur Wärme- und/oder Schalldämmung sowie Dämmschicht | |
| DE102006028841B4 (de) | Dämmanordnung und Verfahren zur Herstellung eines Dämmstoffstreifens | |
| AT409986B (de) | Vorsatzschale | |
| DE9313351U1 (de) | Plattenförmiges Bauteil | |
| CH698624B1 (de) | Verkleidungssystem. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| ELJ | Ceased due to non-payment of the annual fee |