AT367268B - Mittel zum schutz von kulturpflanzen vor aggressiven herbiziden - Google Patents
Mittel zum schutz von kulturpflanzen vor aggressiven herbizidenInfo
- Publication number
- AT367268B AT367268B AT0635778A AT635778A AT367268B AT 367268 B AT367268 B AT 367268B AT 0635778 A AT0635778 A AT 0635778A AT 635778 A AT635778 A AT 635778A AT 367268 B AT367268 B AT 367268B
- Authority
- AT
- Austria
- Prior art keywords
- agent
- cultivated plants
- protecting cultivated
- herbicides
- aggressive
- Prior art date
Links
- 239000003795 chemical substances by application Substances 0.000 title 1
- 239000004009 herbicide Substances 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/16—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms
- C07D295/18—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms by radicals derived from carboxylic acids, or sulfur or nitrogen analogues thereof
- C07D295/182—Radicals derived from carboxylic acids
- C07D295/185—Radicals derived from carboxylic acids from aliphatic carboxylic acids
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N25/00—Biocides, pest repellants or attractants, or plant growth regulators, characterised by their forms, or by their non-active ingredients or by their methods of application, e.g. seed treatment or sequential application; Substances for reducing the noxious effect of the active ingredients to organisms other than pests
- A01N25/32—Ingredients for reducing the noxious effect of the active substances to organisms other than pests, e.g. toxicity reducing compositions, self-destructing compositions
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C259/00—Compounds containing carboxyl groups, an oxygen atom of a carboxyl group being replaced by a nitrogen atom, this nitrogen atom being further bound to an oxygen atom and not being part of nitro or nitroso groups
- C07C259/02—Compounds containing carboxyl groups, an oxygen atom of a carboxyl group being replaced by a nitrogen atom, this nitrogen atom being further bound to an oxygen atom and not being part of nitro or nitroso groups with replacement of the other oxygen atom of the carboxyl group by halogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C273/00—Preparation of urea or its derivatives, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C273/18—Preparation of urea or its derivatives, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups of substituted ureas
- C07C273/1854—Preparation of urea or its derivatives, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups of substituted ureas by reactions not involving the formation of the N-C(O)-N- moiety
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/56—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D307/68—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Health & Medical Sciences (AREA)
- Plant Pathology (AREA)
- Agronomy & Crop Science (AREA)
- Pest Control & Pesticides (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Toxicology (AREA)
- Engineering & Computer Science (AREA)
- Dentistry (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| AT203281A AT370091B (de) | 1978-09-01 | 1978-09-01 | Verfahren zur herstellung von neuen 2-cyano-2cyanomethyl-oximinoessigsaeurederivaten |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH928978A CH637268A5 (de) | 1978-09-04 | 1978-09-04 | Mittel zum schutz von pflanzenkulturen. |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| ATA635778A ATA635778A (de) | 1981-11-15 |
| AT367268B true AT367268B (de) | 1982-06-25 |
Family
ID=4350364
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT0635778A AT367268B (de) | 1978-09-01 | 1978-09-01 | Mittel zum schutz von kulturpflanzen vor aggressiven herbiziden |
Country Status (9)
| Country | Link |
|---|---|
| AT (1) | AT367268B (de) |
| AU (1) | AU533146B2 (de) |
| BE (1) | BE870067A (de) |
| CH (1) | CH637268A5 (de) |
| DE (1) | DE2837863A1 (de) |
| FR (1) | FR2434572A1 (de) |
| GB (1) | GB2029223B (de) |
| LU (1) | LU80181A1 (de) |
| NL (1) | NL7809000A (de) |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3036281A1 (de) * | 1980-09-26 | 1982-05-13 | Boehringer Mannheim Gmbh, 6800 Mannheim | 0-substituierte brenztraubensaeureoxime, verfahren zu ihrer herstellung, ihre verwendung sowie arzneimittel, die diese verbindungen enthalten |
| DE3041998A1 (de) | 1980-11-07 | 1982-06-09 | Bayer Ag, 5090 Leverkusen | Pyrazolsubstituierte oximino-cyan-acetamid-derivate, verfahren zu ihrer herstellung sowie ihre verwendung als fungizide |
| GR76342B (de) * | 1981-02-02 | 1984-08-06 | Fujisawa Pharmaceutical Co | |
| DE3133359A1 (de) * | 1981-08-22 | 1983-03-10 | Bayer Ag, 5090 Leverkusen | Substituierte anilinmonomethylen-oxime, verfahren zu ihrer herstellung sowie ihre verwendung als pflanzenschutzmittel |
| CH654979A5 (de) * | 1982-01-26 | 1986-03-27 | Sandoz Ag | Fungizide und ihre verwendung. |
| DE3206235A1 (de) * | 1982-02-20 | 1983-09-01 | Bayer Ag, 5090 Leverkusen | Substituierte oximinoacetanilide, verfahren zu ihrer herstellung sowie ihre verwendung als schaedlingsbekaempfungsmittel |
| DE3208329A1 (de) * | 1982-03-09 | 1983-09-15 | Basf Ag, 6700 Ludwigshafen | Oximinoessigsaeureamide, ihre herstellung und ihre verwendung zur bekaempfung von fungi und mittel dafuer |
| DE3539995A1 (de) * | 1985-11-12 | 1987-05-21 | Bayer Ag | Substituierte pyrazolin-5-one |
| IT1188653B (it) * | 1986-04-15 | 1988-01-20 | Montedison Spa | Cianoacetoammido-derivati ad azione antifungina |
| DE3719226A1 (de) * | 1987-06-09 | 1988-12-22 | Bayer Ag | (2-cyan-2-oximinoacetyl)-aminosaeure-derivate |
| US4938796A (en) * | 1987-07-06 | 1990-07-03 | Ici Americas Inc. | Herbicidal compositions of acylated 1,3-dicarbonyl herbicides and antidotes therefor |
| EP0387499B1 (de) * | 1989-02-16 | 1993-12-22 | Bayer Ag | Substituierte Oximether sowie deren Verwendung als Schädlingsbekämpfungsmittel |
| JPH09508373A (ja) * | 1994-01-27 | 1997-08-26 | チバーガイギー アクチェンゲゼルシャフト | パラジウム触媒による交差カップリング反応を経由するアリール酢酸エステル誘導体の製造方法 |
Family Cites Families (25)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3131509A (en) * | 1961-05-08 | 1964-05-05 | Spencer Chem Co | Compositions and methods for reducing herbicidal injury |
| LU41651A1 (de) * | 1962-05-04 | 1962-07-04 | ||
| DE1207139B (de) * | 1964-04-02 | 1965-12-16 | Basf Ag | Mittel zur Erzeugung von Zwergwuchs |
| US3575972A (en) * | 1966-12-05 | 1971-04-20 | Mobil Oil Corp | Morpholino carbonyl glyoxylonitrile oximino dialkyl carbamates |
| ZA731111B (en) * | 1972-03-15 | 1974-03-27 | Du Pont | 2-cyano-2-hydroxyiminoacetamides and acetates as plant disease control agents |
| DE2338010A1 (de) * | 1972-07-27 | 1974-02-14 | Ciba Geigy Ag | Verfahren zur regulierung des wachstums und der entwicklung von pflanzen |
| CH589414A5 (en) * | 1973-09-20 | 1977-07-15 | Ciba Geigy Ag | (Alpha)-cyano-(alpha)-hydroxyimino-acetamide derivs. - useful as pesticides, esp. against phytopathogenic bacteria and fungi, e.g. Phytophthora spp. |
| IE38344B1 (en) * | 1972-10-13 | 1978-02-15 | Ciba Geigy Ag | Cyano-hydroxyimino-acetamide derivatives as plant growth regulants and fungicides |
| CH580907A5 (en) * | 1973-03-28 | 1976-10-29 | Ciba Geigy Ag | Hydroximino-cyanoacetamide derivs - with antifungal activity |
| GB1419080A (en) * | 1972-12-29 | 1975-12-24 | Cheminova As | Chemical compounds having juvenile hormone activity |
| DE2436655A1 (de) * | 1973-08-02 | 1975-02-20 | Ciba Geigy Ag | (carbamoyl-oximino)-cyanacetyl-harnstoffe |
| US3923491A (en) * | 1973-08-09 | 1975-12-02 | Allied Chem | Growth regulants for plants |
| US4063921A (en) * | 1973-10-09 | 1977-12-20 | Ciba-Geigy Corporation | Method for the cultivation of plants employing α-cyano-α-hydroxyimino-acetamide derivatives |
| ZA757990B (en) * | 1975-01-30 | 1976-12-29 | Du Pont | Stabilized formulations of 2-alkoxyiminon-carbamoyl-2-cyanoacetamides |
| GB1452256A (en) * | 1975-02-26 | 1976-10-13 | Du Pont | Carbamoylacetamide derivatives |
| DD117586A6 (de) * | 1975-03-13 | 1976-01-20 | ||
| CH574710A5 (en) * | 1975-03-19 | 1976-04-30 | Du Pont | N-carbamoyl-2-cyano-2-oxyiminoacetamines - as plant disease control agents |
| GB1509034A (en) * | 1975-06-30 | 1978-04-26 | Shell Int Research | Herbicides |
| DK333276A (da) * | 1975-09-11 | 1977-03-12 | Du Pont | Fungicide, substituerede 2-cyanoacet-amidderivater |
| DE2623847A1 (de) * | 1976-05-28 | 1977-12-08 | Bayer Ag | Neue oximaether, verfahren zu ihrer herstellung sowie ihre verwendung als fungizide |
| DE2657145A1 (de) * | 1976-12-16 | 1978-06-22 | Bayer Ag | Neue oximaether, verfahren zu ihrer herstellung sowie ihre verwendung als fungizide |
| CH632130A5 (en) * | 1977-03-02 | 1982-09-30 | Ciba Geigy Ag | Compositions on the basis of oxime ethers, oxime esters or oxime carbamates which are suitable in agriculture for crop protection |
| DE2758108A1 (de) * | 1977-12-24 | 1979-07-05 | Bayer Ag | Neue omega-substituierte pentyl-harnstoff-derivate, verfahren zu ihrer herstellung sowie ihre verwendung als fungizide |
| DE2725315A1 (de) * | 1977-06-04 | 1978-12-14 | Bayer Ag | Neue cyanpentyl-harnstoff-derivate, verfahren zu ihrer herstellung sowie ihre verwendung als fungizide |
| AT365410B (de) * | 1978-08-31 | 1982-01-11 | Ciba Geigy Ag | Mittel zum schutz von kulturpflanzen vor aggressi-ven herbiziden |
-
1978
- 1978-08-30 BE BE190146A patent/BE870067A/xx not_active IP Right Cessation
- 1978-08-30 DE DE19782837863 patent/DE2837863A1/de not_active Withdrawn
- 1978-08-31 LU LU80181A patent/LU80181A1/de unknown
- 1978-08-31 FR FR7825142A patent/FR2434572A1/fr active Granted
- 1978-09-01 GB GB7835335A patent/GB2029223B/en not_active Expired
- 1978-09-01 NL NL7809000A patent/NL7809000A/nl not_active Application Discontinuation
- 1978-09-01 AU AU44641/79A patent/AU533146B2/en not_active Ceased
- 1978-09-01 AT AT0635778A patent/AT367268B/de not_active IP Right Cessation
- 1978-09-04 CH CH928978A patent/CH637268A5/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| AU533146B2 (en) | 1983-11-03 |
| GB2029223B (en) | 1982-09-15 |
| FR2434572A1 (fr) | 1980-03-28 |
| AU4464179A (en) | 1980-03-06 |
| FR2434572B1 (de) | 1981-12-11 |
| LU80181A1 (de) | 1979-05-15 |
| CH637268A5 (de) | 1983-07-29 |
| ATA635778A (de) | 1981-11-15 |
| DE2837863A1 (de) | 1980-03-13 |
| BE870067A (fr) | 1979-02-28 |
| NL7809000A (nl) | 1980-03-04 |
| GB2029223A (en) | 1980-03-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AT351855B (de) | Anlage zum ziehen von pflanzenkulturen | |
| NO791759L (no) | Plantevernforbindelser. | |
| AT354184B (de) | Mittel zum schutz von kulturpflanzen | |
| DK235278A (da) | Sproejteorgan for rengoeringsapparater plantebeskyttelsesapparater eller lignende | |
| DK87679A (da) | Herbicider | |
| AT365410B (de) | Mittel zum schutz von kulturpflanzen vor aggressi-ven herbiziden | |
| AT367268B (de) | Mittel zum schutz von kulturpflanzen vor aggressiven herbiziden | |
| DK379081A (da) | Herbicide praeparater indeholdende n-(phosphonmethyl)-glycin | |
| IT1115157B (it) | Erbicidi | |
| DK272479A (da) | Middel til beskyttelse af kulturplanter mod herbicidbeskadigelse | |
| AR222505A1 (es) | Herbicidas fluidos | |
| DE3382426D1 (de) | Verfahren zum schutz von kulturpflanzen vor der wirkung von nicht-selektiven herbiziden. | |
| BR8004694A (pt) | Processo para a obtencao de n-(alfa-cloropropionil)-1,2,3,4-tetrahidro-quinaldina,composicao para a protecao de plantas de cultura,sua aplicacao,composicao para o combate seletivo de ervas daninhas,sua aplicacao | |
| FI793387A7 (fi) | Palosuojelulaite suihkukuivauslaitteistoa varten. | |
| AT368678B (de) | Antidotum zum schutz von kulturpflanzen gegen die schaedigende wirkung von herbiziden | |
| AT384525B (de) | Pflanzenschutzmittel | |
| AT359334B (de) | Pflanzenschutzmittel | |
| AT357367B (de) | Pflanzenschutzmittel | |
| IT1113994B (it) | Erbicidi | |
| ATA631878A (de) | Pflanzenschutzmittel | |
| BG36355A1 (en) | Means for chemical therary of viruses on cultural plants | |
| NL7902100A (nl) | Herbicide product. | |
| AT368677B (de) | Antidotum zum schutz von kulturpflanzen gegen die schaedigende wirkung von herbiziden | |
| AT368679B (de) | Antidotum zum schutz von kulturpflanzen gegen die schaedigende wirkung von herbiziden | |
| ATE37266T1 (de) | Mittel zum schuetzen von kulturpflanzen vor der phytotoxischen wirkung von herbiziden. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| ELJ | Ceased due to non-payment of the annual fee |