ZA89643B - Method for the preparation of o-carboxyarylimidazolinones - Google Patents
Method for the preparation of o-carboxyarylimidazolinonesInfo
- Publication number
- ZA89643B ZA89643B ZA89643A ZA89643A ZA89643B ZA 89643 B ZA89643 B ZA 89643B ZA 89643 A ZA89643 A ZA 89643A ZA 89643 A ZA89643 A ZA 89643A ZA 89643 B ZA89643 B ZA 89643B
- Authority
- ZA
- South Africa
- Prior art keywords
- alkyl
- preparation
- carboxyarylimidazolinones
- compounds
- dimethylpropyl
- Prior art date
Links
- 238000000034 method Methods 0.000 title abstract 4
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 abstract 2
- 239000000543 intermediate Substances 0.000 abstract 2
- 125000004400 (C1-C12) alkyl group Chemical group 0.000 abstract 1
- VIAIZAVDGKSNBY-UHFFFAOYSA-N 2-[[(1-amino-2,3-dimethyl-1-oxobutan-2-yl)amino]methyl]benzoic acid Chemical compound CC(C)C(C)(C(N)=O)NCC1=CC=CC=C1C(O)=O VIAIZAVDGKSNBY-UHFFFAOYSA-N 0.000 abstract 1
- 239000003795 chemical substances by application Substances 0.000 abstract 1
- 150000001875 compounds Chemical class 0.000 abstract 1
- 230000003647 oxidation Effects 0.000 abstract 1
- 238000007254 oxidation reaction Methods 0.000 abstract 1
- 230000001590 oxidative effect Effects 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/79—Acids; Esters
- C07D213/80—Acids; Esters in position 3
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C237/00—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups
- C07C237/02—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups having the carbon atoms of the carboxamide groups bound to acyclic carbon atoms of the carbon skeleton
- C07C237/04—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups having the carbon atoms of the carboxamide groups bound to acyclic carbon atoms of the carbon skeleton the carbon skeleton being acyclic and saturated
- C07C237/06—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by amino groups having the carbon atoms of the carboxamide groups bound to acyclic carbon atoms of the carbon skeleton the carbon skeleton being acyclic and saturated having the nitrogen atoms of the carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/48—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Plural Heterocyclic Compounds (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Pyridine Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Cosmetics (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US07/148,743 US4861887A (en) | 1988-01-27 | 1988-01-27 | Herbicidal o-(substituted, aminomethylbenzoic, nicotinic and quinoline-3-carboxylic acids, esters, and salts |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ZA89643B true ZA89643B (en) | 1989-10-25 |
Family
ID=22527159
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ZA89643A ZA89643B (en) | 1988-01-27 | 1989-01-26 | Method for the preparation of o-carboxyarylimidazolinones |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US4861887A (de) |
| EP (1) | EP0325730B1 (de) |
| JP (1) | JP2825517B2 (de) |
| KR (1) | KR0130975B1 (de) |
| AT (1) | ATE107288T1 (de) |
| AU (1) | AU618062B2 (de) |
| BR (1) | BR8900317A (de) |
| CA (1) | CA1338248C (de) |
| DE (1) | DE3850240T2 (de) |
| DK (3) | DK34089A (de) |
| ES (1) | ES2054777T3 (de) |
| HU (1) | HU205915B (de) |
| IE (1) | IE64510B1 (de) |
| IL (2) | IL88536A (de) |
| ZA (1) | ZA89643B (de) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5322948A (en) * | 1989-08-31 | 1994-06-21 | Hoechst Celanese Corporation | Process for preparing pyridinecarboxylic acid derivatives |
| US5062881A (en) * | 1989-12-20 | 1991-11-05 | American Cyanamid Company | 2-(1-substituted-2-imidazolin-2-yl)benzoic and nicotinic acids and a method for their preparation |
| EP0434965B1 (de) * | 1989-12-27 | 1998-05-20 | American Cyanamid Company | Alkylester von 5-heterocyclische-Pyridin-2,3-Dicarbonsäuren und 5-heterocyclische-2-(2-Imidazolin-2-yl)Pyridinen und Verfahren zu ihrer Herstellung |
| KR920003063B1 (ko) * | 1990-02-28 | 1992-04-13 | 재단법인 한국화학연구소 | 신규한2-(2-이미다졸린-2-일)-3-(아미노옥소아세틸)-피리딘유도체와그염 |
| US5108485A (en) * | 1990-08-31 | 1992-04-28 | American Cyanamid Company | Herbicidal 2-(2-imidazolin-2-yl)-benzazoles |
| IE913517A1 (en) * | 1991-04-29 | 1992-11-04 | Hoechst Celanese Corp | Process for preparing pyridinecarboxylic acid derivatives |
| JP2001081080A (ja) * | 1999-09-14 | 2001-03-27 | Nissan Chem Ind Ltd | ４（５）−クロロメチル−２−フェニル−１，２，３−トリアゾール誘導体の製造法 |
| AU2014201037B9 (en) * | 2010-04-06 | 2015-11-19 | Nippon Soda Co., Ltd. | Nitrogen-containing heterocyclic compound and method for producing same |
| JP5499160B2 (ja) | 2010-04-06 | 2014-05-21 | 日本曹達株式会社 | 含窒素複素環化合物及びその製造方法 |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| YU204274A (en) * | 1973-07-24 | 1982-06-30 | Hoechst Ag | Process for preparing new dibenzoxepin derivatives |
| US4188487A (en) * | 1977-08-08 | 1980-02-12 | American Cyanamid Company | Imidazolinyl benzoic acids, esters and salts and their use as herbicidal agents |
| US4297128A (en) * | 1978-06-09 | 1981-10-27 | American Cyanamid Co. | Use of imidazolinyl benzoates as herbicidal agents |
| US4638068A (en) * | 1981-04-09 | 1987-01-20 | American Cyanamid Company | 2-(2-imidazolin-2-yl)-pyridines and quinolines, process and intermediates for the preparation thereof, and use of said compounds as herbicidal agents |
| IL62794A0 (en) * | 1980-06-02 | 1981-07-31 | American Cyanamid Co | Substituted nicotinic acid esters and salts thereof and their use as herbicidal agents |
| WO1983004253A1 (en) * | 1982-05-25 | 1983-12-08 | American Cyanamid Company | Process for the preparation of 2-(5,5-disubstituted-4-oxo-2-imidazolin-2-yl)-nicotinic, quinoline-3-carboxylic and benzoic acids |
| DE3345901A1 (de) * | 1983-12-20 | 1985-06-27 | Hoechst Ag, 6230 Frankfurt | 1-acylimidazolinone, verfahren zu ihrer herstellung und ihre verwendung in der landwirtschaft |
| EP0158000B1 (de) * | 1984-02-10 | 1991-06-19 | American Cyanamid Company | Regio und optische Isomere von Imidazolinyl-Toluolsäure, deren Ester und Salze, Verfahren zu deren Herstellung und deren Anwendung als Herbizide |
| US4709036A (en) * | 1985-06-13 | 1987-11-24 | American Cyanamid Company | Process for the preparation of herbicidal 2-(4,4-disubstituted-5-oxo-2-imidazolin-2-yl)benzoic, nicotinic and quinoline-3-carboxylic acids, esters and salts |
| EP0261705A1 (de) * | 1986-08-25 | 1988-03-30 | Shell Internationale Researchmaatschappij B.V. | Herbizide Imidazolinylbenzoesäuren und Derivate |
| US4689425A (en) * | 1986-11-06 | 1987-08-25 | Stauffer Chemical Company | Photochlorination of aromatic compounds in the side chain |
-
1988
- 1988-01-27 US US07/148,743 patent/US4861887A/en not_active Expired - Lifetime
- 1988-11-29 ES ES88119865T patent/ES2054777T3/es not_active Expired - Lifetime
- 1988-11-29 IL IL88536A patent/IL88536A/xx not_active IP Right Cessation
- 1988-11-29 IL IL10346188A patent/IL103461A/en not_active IP Right Cessation
- 1988-11-29 AT AT88119865T patent/ATE107288T1/de not_active IP Right Cessation
- 1988-11-29 EP EP88119865A patent/EP0325730B1/de not_active Expired - Lifetime
- 1988-11-29 DE DE3850240T patent/DE3850240T2/de not_active Expired - Fee Related
-
1989
- 1989-01-24 JP JP1013331A patent/JP2825517B2/ja not_active Expired - Lifetime
- 1989-01-25 CA CA000589101A patent/CA1338248C/en not_active Expired - Fee Related
- 1989-01-25 HU HU89316A patent/HU205915B/hu not_active IP Right Cessation
- 1989-01-25 AU AU28787/89A patent/AU618062B2/en not_active Ceased
- 1989-01-26 DK DK034089A patent/DK34089A/da not_active Application Discontinuation
- 1989-01-26 IE IE23189A patent/IE64510B1/en not_active IP Right Cessation
- 1989-01-26 BR BR898900317A patent/BR8900317A/pt not_active IP Right Cessation
- 1989-01-26 ZA ZA89643A patent/ZA89643B/xx unknown
- 1989-01-26 KR KR1019890000811A patent/KR0130975B1/ko not_active IP Right Cessation
-
1993
- 1993-05-04 DK DK050793A patent/DK50793A/da unknown
- 1993-05-04 DK DK050693A patent/DK50693A/da not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| IE890231L (en) | 1989-07-27 |
| HU205915B (en) | 1992-07-28 |
| IE64510B1 (en) | 1995-08-09 |
| EP0325730A2 (de) | 1989-08-02 |
| EP0325730B1 (de) | 1994-06-15 |
| IL88536A0 (en) | 1989-06-30 |
| DE3850240T2 (de) | 1995-02-02 |
| DK50693D0 (da) | 1993-05-04 |
| KR890011873A (ko) | 1989-08-23 |
| DE3850240D1 (de) | 1994-07-21 |
| CA1338248C (en) | 1996-04-16 |
| AU618062B2 (en) | 1991-12-12 |
| IL103461A (en) | 1994-06-24 |
| JP2825517B2 (ja) | 1998-11-18 |
| KR0130975B1 (ko) | 1998-04-16 |
| DK50793D0 (da) | 1993-05-04 |
| JPH01224364A (ja) | 1989-09-07 |
| DK50793A (da) | 1993-05-04 |
| BR8900317A (pt) | 1989-09-19 |
| DK34089A (da) | 1989-07-28 |
| IL88536A (en) | 1993-02-21 |
| DK50693A (da) | 1993-05-04 |
| ATE107288T1 (de) | 1994-07-15 |
| HUT50133A (en) | 1989-12-28 |
| ES2054777T3 (es) | 1994-08-16 |
| AU2878789A (en) | 1989-07-27 |
| US4861887A (en) | 1989-08-29 |
| DK34089D0 (da) | 1989-01-26 |
| EP0325730A3 (de) | 1991-02-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0610958A3 (de) | Zwischenprodukte für die Herstellung von Derivaten der 4-Oxochinolin-3-carbonsäure. | |
| FI892787A (fi) | Analogiamenetelmä terapeuttisesti käyttökelpoisten 1-indolyylialkyyli-4-(substituoitu pyridinyyli)piperatsiinien valmistamiseksi | |
| AU1433588A (en) | 1-phenyl-3-naphthalenyloxypropanamines | |
| GB1527297A (en) | Pyrazine carboxamides | |
| DK0615549T3 (da) | Fremgangsmåde til fremstilling af farmaceutisk aktive thiazolidin- eller oxazolidinforbindelser med en gærreduktase | |
| ZA89643B (en) | Method for the preparation of o-carboxyarylimidazolinones | |
| EP0228845A3 (en) | N-containing heterocyclic compounds, processes for the preparation thereof and composition comprising the same | |
| GR3002692T3 (en) | Benzoxazine derivatives and processes for preparation thereof | |
| GR67005B (de) | ||
| EP0555479A4 (de) | ||
| AU8003594A (en) | Quinolinecarboxylic acid derivative and salt thereof | |
| AU7668087A (en) | Immunologically active phenyl and substituted carbonyl amino heterocyclic derivatives | |
| AU1586588A (en) | Fungicidal derivatives of propenoic acid and processes for their preparation | |
| CS292388A2 (en) | Herbicide and method of its efficient substance production | |
| GR3002688T3 (en) | Thiadiazolylacetamide derivatives, process for the preparation thereof and their use | |
| LU88449I2 (fr) | Fleroxacine et ses dérivés pharmaceutiquement acceptables. |