WO2022164268A1 - 가소제 조성물 및 이를 포함하는 수지 조성물 - Google Patents
가소제 조성물 및 이를 포함하는 수지 조성물 Download PDFInfo
- Publication number
- WO2022164268A1 WO2022164268A1 PCT/KR2022/001617 KR2022001617W WO2022164268A1 WO 2022164268 A1 WO2022164268 A1 WO 2022164268A1 KR 2022001617 W KR2022001617 W KR 2022001617W WO 2022164268 A1 WO2022164268 A1 WO 2022164268A1
- Authority
- WO
- WIPO (PCT)
- Prior art keywords
- composition
- isophthalate
- weight
- citrate
- hexyl
- Prior art date
Links
- 239000000203 mixture Substances 0.000 title claims abstract description 251
- 239000004014 plasticizer Substances 0.000 title claims description 103
- 239000011342 resin composition Substances 0.000 title claims description 13
- ZSIAUFGUXNUGDI-UHFFFAOYSA-N hexan-1-ol Chemical class CCCCCCO ZSIAUFGUXNUGDI-UHFFFAOYSA-N 0.000 claims abstract description 145
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 claims abstract description 61
- QQVIHTHCMHWDBS-UHFFFAOYSA-L isophthalate(2-) Chemical compound [O-]C(=O)C1=CC=CC(C([O-])=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-L 0.000 claims abstract description 57
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 claims abstract description 24
- 239000011347 resin Substances 0.000 claims abstract description 22
- 229920005989 resin Polymers 0.000 claims abstract description 22
- WXZOXVVKILCOPG-UHFFFAOYSA-N bis(2-ethylhexyl) benzene-1,3-dicarboxylate Chemical compound CCCCC(CC)COC(=O)C1=CC=CC(C(=O)OCC(CC)CCCC)=C1 WXZOXVVKILCOPG-UHFFFAOYSA-N 0.000 claims abstract description 11
- FGWAPOKSKMNBEN-UHFFFAOYSA-N dihexyl benzene-1,3-dicarboxylate Chemical compound CCCCCCOC(=O)C1=CC=CC(C(=O)OCCCCCC)=C1 FGWAPOKSKMNBEN-UHFFFAOYSA-N 0.000 claims abstract description 10
- AMMPRZCMKXDUNE-UHFFFAOYSA-N trihexyl 2-hydroxypropane-1,2,3-tricarboxylate Chemical compound CCCCCCOC(=O)CC(O)(C(=O)OCCCCCC)CC(=O)OCCCCCC AMMPRZCMKXDUNE-UHFFFAOYSA-N 0.000 claims abstract description 8
- IWTBVKIGCDZRPL-UHFFFAOYSA-N 3-methylpentanol Chemical compound CCC(C)CCO IWTBVKIGCDZRPL-UHFFFAOYSA-N 0.000 claims description 48
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 24
- 238000000034 method Methods 0.000 claims description 24
- PFNHSEQQEPMLNI-UHFFFAOYSA-N 2-methyl-1-pentanol Chemical compound CCCC(C)CO PFNHSEQQEPMLNI-UHFFFAOYSA-N 0.000 claims description 23
- 229920000642 polymer Polymers 0.000 claims description 23
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 claims description 18
- ISQVBYGGNVVVHB-UHFFFAOYSA-N cyclopentylmethanol Chemical compound OCC1CCCC1 ISQVBYGGNVVVHB-UHFFFAOYSA-N 0.000 claims description 17
- PCWGTDULNUVNBN-UHFFFAOYSA-N 4-methylpentan-1-ol Chemical compound CC(C)CCCO PCWGTDULNUVNBN-UHFFFAOYSA-N 0.000 claims description 15
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 claims description 12
- QXEGYZZQIKTFOX-UHFFFAOYSA-N 3-o-(2-ethylhexyl) 1-o-hexyl benzene-1,3-dicarboxylate Chemical compound CCCCCCOC(=O)C1=CC=CC(C(=O)OCC(CC)CCCC)=C1 QXEGYZZQIKTFOX-UHFFFAOYSA-N 0.000 claims description 9
- SXSWMAUXEHKFGX-UHFFFAOYSA-N 2,3-dimethylbutan-1-ol Chemical compound CC(C)C(C)CO SXSWMAUXEHKFGX-UHFFFAOYSA-N 0.000 claims description 5
- WFRBDWRZVBPBDO-UHFFFAOYSA-N 2-methyl-2-pentanol Chemical compound CCCC(C)(C)O WFRBDWRZVBPBDO-UHFFFAOYSA-N 0.000 claims description 5
- 239000001257 hydrogen Substances 0.000 claims description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- TZYRSLHNPKPEFV-UHFFFAOYSA-N 2-ethyl-1-butanol Chemical compound CCC(CC)CO TZYRSLHNPKPEFV-UHFFFAOYSA-N 0.000 claims description 4
- DUXCSEISVMREAX-UHFFFAOYSA-N 3,3-dimethylbutan-1-ol Chemical compound CC(C)(C)CCO DUXCSEISVMREAX-UHFFFAOYSA-N 0.000 claims description 4
- ZXNBBWHRUSXUFZ-UHFFFAOYSA-N 3-methyl-2-pentanol Chemical compound CCC(C)C(C)O ZXNBBWHRUSXUFZ-UHFFFAOYSA-N 0.000 claims description 4
- QNVRIHYSUZMSGM-UHFFFAOYSA-N hexan-2-ol Chemical compound CCCCC(C)O QNVRIHYSUZMSGM-UHFFFAOYSA-N 0.000 claims description 4
- ZOCHHNOQQHDWHG-UHFFFAOYSA-N hexan-3-ol Chemical compound CCCC(O)CC ZOCHHNOQQHDWHG-UHFFFAOYSA-N 0.000 claims description 4
- XRMVWAKMXZNZIL-UHFFFAOYSA-N 2,2-dimethyl-1-butanol Chemical compound CCC(C)(C)CO XRMVWAKMXZNZIL-UHFFFAOYSA-N 0.000 claims description 3
- WVYWICLMDOOCFB-UHFFFAOYSA-N 4-methyl-2-pentanol Chemical compound CC(C)CC(C)O WVYWICLMDOOCFB-UHFFFAOYSA-N 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 239000004793 Polystyrene Substances 0.000 claims description 3
- 125000004851 cyclopentylmethyl group Chemical group C1(CCCC1)C* 0.000 claims description 3
- 239000005038 ethylene vinyl acetate Substances 0.000 claims description 3
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 claims description 3
- 229920001200 poly(ethylene-vinyl acetate) Polymers 0.000 claims description 3
- 229920000747 poly(lactic acid) Polymers 0.000 claims description 3
- 229920000573 polyethylene Polymers 0.000 claims description 3
- 229920001470 polyketone Polymers 0.000 claims description 3
- 239000004626 polylactic acid Substances 0.000 claims description 3
- 229920001155 polypropylene Polymers 0.000 claims description 3
- 229920002223 polystyrene Polymers 0.000 claims description 3
- 229920002635 polyurethane Polymers 0.000 claims description 3
- 239000004814 polyurethane Substances 0.000 claims description 3
- 229920003051 synthetic elastomer Polymers 0.000 claims description 3
- 239000005061 synthetic rubber Substances 0.000 claims description 3
- 244000043261 Hevea brasiliensis Species 0.000 claims description 2
- 229920003052 natural elastomer Polymers 0.000 claims description 2
- 229920001194 natural rubber Polymers 0.000 claims description 2
- 239000000126 substance Substances 0.000 claims description 2
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims 1
- 229910052698 phosphorus Inorganic materials 0.000 claims 1
- 239000011574 phosphorus Substances 0.000 claims 1
- 238000013508 migration Methods 0.000 abstract description 13
- 230000005012 migration Effects 0.000 abstract description 13
- 230000001976 improved effect Effects 0.000 abstract description 12
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical class OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 abstract description 5
- SVROBUUKWJCEGI-UHFFFAOYSA-N 3-(5-ethyldodecan-6-yloxycarbonyl)benzoic acid Chemical compound CCCCCCC(C(CC)CCCC)OC(C1=CC(C(O)=O)=CC=C1)=O SVROBUUKWJCEGI-UHFFFAOYSA-N 0.000 abstract 1
- 230000000052 comparative effect Effects 0.000 description 52
- 238000002360 preparation method Methods 0.000 description 47
- 239000000047 product Substances 0.000 description 31
- 230000000704 physical effect Effects 0.000 description 17
- 238000012360 testing method Methods 0.000 description 15
- 238000006243 chemical reaction Methods 0.000 description 13
- -1 defoamers Substances 0.000 description 13
- YIWUKEYIRIRTPP-UHFFFAOYSA-N 2-ethylhexan-1-ol Chemical compound CCCCC(CC)CO YIWUKEYIRIRTPP-UHFFFAOYSA-N 0.000 description 12
- 239000003054 catalyst Substances 0.000 description 12
- 238000010521 absorption reaction Methods 0.000 description 9
- 238000004821 distillation Methods 0.000 description 9
- 230000000694 effects Effects 0.000 description 9
- 238000002156 mixing Methods 0.000 description 9
- 238000012545 processing Methods 0.000 description 9
- 230000008901 benefit Effects 0.000 description 8
- 238000003763 carbonization Methods 0.000 description 7
- 238000011156 evaluation Methods 0.000 description 7
- 238000010438 heat treatment Methods 0.000 description 7
- XNGIFLGASWRNHJ-UHFFFAOYSA-L phthalate(2-) Chemical compound [O-]C(=O)C1=CC=CC=C1C([O-])=O XNGIFLGASWRNHJ-UHFFFAOYSA-L 0.000 description 7
- 239000003381 stabilizer Substances 0.000 description 7
- 238000005809 transesterification reaction Methods 0.000 description 7
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 6
- 229920001944 Plastisol Polymers 0.000 description 6
- 125000000217 alkyl group Chemical group 0.000 description 6
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 6
- 238000005886 esterification reaction Methods 0.000 description 6
- 239000011521 glass Substances 0.000 description 6
- 230000006872 improvement Effects 0.000 description 6
- 238000005259 measurement Methods 0.000 description 6
- 229910052751 metal Inorganic materials 0.000 description 6
- 239000002184 metal Substances 0.000 description 6
- 239000004999 plastisol Substances 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 5
- 239000002253 acid Substances 0.000 description 5
- 150000001298 alcohols Chemical class 0.000 description 5
- RWPICVVBGZBXNA-UHFFFAOYSA-N bis(2-ethylhexyl) benzene-1,4-dicarboxylate Chemical compound CCCCC(CC)COC(=O)C1=CC=C(C(=O)OCC(CC)CCCC)C=C1 RWPICVVBGZBXNA-UHFFFAOYSA-N 0.000 description 5
- 125000004432 carbon atom Chemical group C* 0.000 description 5
- 150000002148 esters Chemical class 0.000 description 5
- 239000000945 filler Substances 0.000 description 5
- 238000010128 melt processing Methods 0.000 description 5
- 239000002245 particle Substances 0.000 description 5
- WZFUQSJFWNHZHM-UHFFFAOYSA-N 2-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperazin-1-yl]-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)N1CCN(CC1)CC(=O)N1CC2=C(CC1)NN=N2 WZFUQSJFWNHZHM-UHFFFAOYSA-N 0.000 description 4
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 4
- 239000003377 acid catalyst Substances 0.000 description 4
- 239000000654 additive Substances 0.000 description 4
- 230000007613 environmental effect Effects 0.000 description 4
- 238000000605 extraction Methods 0.000 description 4
- 238000004817 gas chromatography Methods 0.000 description 4
- 238000002347 injection Methods 0.000 description 4
- 239000007924 injection Substances 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 230000008569 process Effects 0.000 description 4
- 239000002994 raw material Substances 0.000 description 4
- 230000009467 reduction Effects 0.000 description 4
- 230000002195 synergetic effect Effects 0.000 description 4
- VXUYXOFXAQZZMF-UHFFFAOYSA-N titanium(IV) isopropoxide Chemical compound CC(C)O[Ti](OC(C)C)(OC(C)C)OC(C)C VXUYXOFXAQZZMF-UHFFFAOYSA-N 0.000 description 4
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 4
- 238000012546 transfer Methods 0.000 description 4
- 230000007704 transition Effects 0.000 description 4
- OHVLMTFVQDZYHP-UHFFFAOYSA-N 1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)-2-[4-[2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidin-5-yl]piperazin-1-yl]ethanone Chemical compound N1N=NC=2CN(CCC=21)C(CN1CCN(CC1)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F)=O OHVLMTFVQDZYHP-UHFFFAOYSA-N 0.000 description 3
- HMUNWXXNJPVALC-UHFFFAOYSA-N 1-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperazin-1-yl]-2-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)N1CCN(CC1)C(CN1CC2=C(CC1)NN=N2)=O HMUNWXXNJPVALC-UHFFFAOYSA-N 0.000 description 3
- VZSRBBMJRBPUNF-UHFFFAOYSA-N 2-(2,3-dihydro-1H-inden-2-ylamino)-N-[3-oxo-3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)propyl]pyrimidine-5-carboxamide Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C(=O)NCCC(N1CC2=C(CC1)NN=N2)=O VZSRBBMJRBPUNF-UHFFFAOYSA-N 0.000 description 3
- LDXJRKWFNNFDSA-UHFFFAOYSA-N 2-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)-1-[4-[2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidin-5-yl]piperazin-1-yl]ethanone Chemical compound C1CN(CC2=NNN=C21)CC(=O)N3CCN(CC3)C4=CN=C(N=C4)NCC5=CC(=CC=C5)OC(F)(F)F LDXJRKWFNNFDSA-UHFFFAOYSA-N 0.000 description 3
- IHCCLXNEEPMSIO-UHFFFAOYSA-N 2-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperidin-1-yl]-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C1CCN(CC1)CC(=O)N1CC2=C(CC1)NN=N2 IHCCLXNEEPMSIO-UHFFFAOYSA-N 0.000 description 3
- YLZOPXRUQYQQID-UHFFFAOYSA-N 3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)-1-[4-[2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidin-5-yl]piperazin-1-yl]propan-1-one Chemical compound N1N=NC=2CN(CCC=21)CCC(=O)N1CCN(CC1)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F YLZOPXRUQYQQID-UHFFFAOYSA-N 0.000 description 3
- AFCARXCZXQIEQB-UHFFFAOYSA-N N-[3-oxo-3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)propyl]-2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carboxamide Chemical compound O=C(CCNC(=O)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F)N1CC2=C(CC1)NN=N2 AFCARXCZXQIEQB-UHFFFAOYSA-N 0.000 description 3
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 3
- 239000006227 byproduct Substances 0.000 description 3
- 230000008859 change Effects 0.000 description 3
- 238000002845 discoloration Methods 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 229940098779 methanesulfonic acid Drugs 0.000 description 3
- 238000006116 polymerization reaction Methods 0.000 description 3
- 239000000376 reactant Substances 0.000 description 3
- 230000004580 weight loss Effects 0.000 description 3
- 238000004383 yellowing Methods 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- RWPICVVBGZBXNA-BGYRXZFFSA-N Bis(2-ethylhexyl) terephthalate Natural products CCCC[C@H](CC)COC(=O)C1=CC=C(C(=O)OC[C@H](CC)CCCC)C=C1 RWPICVVBGZBXNA-BGYRXZFFSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- 239000004807 Di(2-ethylhexyl)terephthalate Substances 0.000 description 2
- MQIUGAXCHLFZKX-UHFFFAOYSA-N Di-n-octyl phthalate Natural products CCCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCCC MQIUGAXCHLFZKX-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- MKYBYDHXWVHEJW-UHFFFAOYSA-N N-[1-oxo-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)propan-2-yl]-2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carboxamide Chemical compound O=C(C(C)NC(=O)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F)N1CC2=C(CC1)NN=N2 MKYBYDHXWVHEJW-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- IHBCFWWEZXPPLG-UHFFFAOYSA-N [Ca].[Zn] Chemical compound [Ca].[Zn] IHBCFWWEZXPPLG-UHFFFAOYSA-N 0.000 description 2
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- TZCXTZWJZNENPQ-UHFFFAOYSA-L barium sulfate Chemical compound [Ba+2].[O-]S([O-])(=O)=O TZCXTZWJZNENPQ-UHFFFAOYSA-L 0.000 description 2
- 230000033228 biological regulation Effects 0.000 description 2
- BJQHLKABXJIVAM-UHFFFAOYSA-N bis(2-ethylhexyl) phthalate Chemical compound CCCCC(CC)COC(=O)C1=CC=CC=C1C(=O)OCC(CC)CCCC BJQHLKABXJIVAM-UHFFFAOYSA-N 0.000 description 2
- 238000003490 calendering Methods 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 239000012159 carrier gas Substances 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 230000018044 dehydration Effects 0.000 description 2
- 238000006297 dehydration reaction Methods 0.000 description 2
- HBGGXOJOCNVPFY-UHFFFAOYSA-N diisononyl phthalate Chemical compound CC(C)CCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCC(C)C HBGGXOJOCNVPFY-UHFFFAOYSA-N 0.000 description 2
- 229910001873 dinitrogen Inorganic materials 0.000 description 2
- 238000007720 emulsion polymerization reaction Methods 0.000 description 2
- 238000001125 extrusion Methods 0.000 description 2
- 239000001307 helium Substances 0.000 description 2
- 229910052734 helium Inorganic materials 0.000 description 2
- SWQJXJOGLNCZEY-UHFFFAOYSA-N helium atom Chemical compound [He] SWQJXJOGLNCZEY-UHFFFAOYSA-N 0.000 description 2
- PQXKHYXIUOZZFA-UHFFFAOYSA-M lithium fluoride Chemical compound [Li+].[F-] PQXKHYXIUOZZFA-UHFFFAOYSA-M 0.000 description 2
- 229910044991 metal oxide Inorganic materials 0.000 description 2
- 150000004706 metal oxides Chemical class 0.000 description 2
- 238000006386 neutralization reaction Methods 0.000 description 2
- 125000002524 organometallic group Chemical group 0.000 description 2
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 2
- 239000011148 porous material Substances 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 238000010557 suspension polymerization reaction Methods 0.000 description 2
- 239000011701 zinc Substances 0.000 description 2
- FREKLZWQCVVJAI-UHFFFAOYSA-N 2-butyl-3-(2-ethylhexyl)terephthalic acid Chemical compound CCCCC(CC)Cc1c(CCCC)c(ccc1C(O)=O)C(O)=O FREKLZWQCVVJAI-UHFFFAOYSA-N 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- LQLQDKBJAIILIQ-UHFFFAOYSA-N Dibutyl terephthalate Chemical compound CCCCOC(=O)C1=CC=C(C(=O)OCCCC)C=C1 LQLQDKBJAIILIQ-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- KRADHMIOFJQKEZ-UHFFFAOYSA-N Tri-2-ethylhexyl trimellitate Chemical compound CCCCC(CC)COC(=O)C1=CC=C(C(=O)OCC(CC)CCCC)C(C(=O)OCC(CC)CCCC)=C1 KRADHMIOFJQKEZ-UHFFFAOYSA-N 0.000 description 1
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 description 1
- YKTSYUJCYHOUJP-UHFFFAOYSA-N [O--].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-] Chemical compound [O--].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-] YKTSYUJCYHOUJP-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- WNLRTRBMVRJNCN-UHFFFAOYSA-L adipate(2-) Chemical compound [O-]C(=O)CCCCC([O-])=O WNLRTRBMVRJNCN-UHFFFAOYSA-L 0.000 description 1
- 239000001361 adipic acid Substances 0.000 description 1
- 235000011037 adipic acid Nutrition 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- WNROFYMDJYEPJX-UHFFFAOYSA-K aluminium hydroxide Chemical compound [OH-].[OH-].[OH-].[Al+3] WNROFYMDJYEPJX-UHFFFAOYSA-K 0.000 description 1
- ILRRQNADMUWWFW-UHFFFAOYSA-K aluminium phosphate Chemical compound O1[Al]2OP1(=O)O2 ILRRQNADMUWWFW-UHFFFAOYSA-K 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 239000003957 anion exchange resin Substances 0.000 description 1
- SHLNMHIRQGRGOL-UHFFFAOYSA-N barium zinc Chemical compound [Zn].[Ba] SHLNMHIRQGRGOL-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 238000012662 bulk polymerization Methods 0.000 description 1
- QDHFHIQKOVNCNC-UHFFFAOYSA-N butane-1-sulfonic acid Chemical compound CCCCS(O)(=O)=O QDHFHIQKOVNCNC-UHFFFAOYSA-N 0.000 description 1
- AIYUHDOJVYHVIT-UHFFFAOYSA-M caesium chloride Chemical compound [Cl-].[Cs+] AIYUHDOJVYHVIT-UHFFFAOYSA-M 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- 239000003729 cation exchange resin Substances 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 150000001860 citric acid derivatives Chemical class 0.000 description 1
- 239000003245 coal Substances 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical class O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000009408 flooring Methods 0.000 description 1
- 239000004088 foaming agent Substances 0.000 description 1
- 239000002638 heterogeneous catalyst Substances 0.000 description 1
- 239000002815 homogeneous catalyst Substances 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- FBAFATDZDUQKNH-UHFFFAOYSA-M iron chloride Chemical compound [Cl-].[Fe] FBAFATDZDUQKNH-UHFFFAOYSA-M 0.000 description 1
- ZLNQQNXFFQJAID-UHFFFAOYSA-L magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 description 1
- 239000001095 magnesium carbonate Substances 0.000 description 1
- 229910000021 magnesium carbonate Inorganic materials 0.000 description 1
- VTHJTEIRLNZDEV-UHFFFAOYSA-L magnesium dihydroxide Chemical compound [OH-].[OH-].[Mg+2] VTHJTEIRLNZDEV-UHFFFAOYSA-L 0.000 description 1
- 239000000347 magnesium hydroxide Substances 0.000 description 1
- 229910001862 magnesium hydroxide Inorganic materials 0.000 description 1
- HCWCAKKEBCNQJP-UHFFFAOYSA-N magnesium orthosilicate Chemical compound [Mg+2].[Mg+2].[O-][Si]([O-])([O-])[O-] HCWCAKKEBCNQJP-UHFFFAOYSA-N 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 1
- 239000000391 magnesium silicate Substances 0.000 description 1
- 229910052919 magnesium silicate Inorganic materials 0.000 description 1
- 235000019792 magnesium silicate Nutrition 0.000 description 1
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 1
- 238000000691 measurement method Methods 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical class CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- 125000005498 phthalate group Chemical class 0.000 description 1
- 239000001103 potassium chloride Substances 0.000 description 1
- 235000011164 potassium chloride Nutrition 0.000 description 1
- KCXFHTAICRTXLI-UHFFFAOYSA-N propane-1-sulfonic acid Chemical compound CCCS(O)(=O)=O KCXFHTAICRTXLI-UHFFFAOYSA-N 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 239000005060 rubber Substances 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 229920002725 thermoplastic elastomer Polymers 0.000 description 1
- 229910052718 tin Inorganic materials 0.000 description 1
- 239000010936 titanium Substances 0.000 description 1
- 229910052719 titanium Inorganic materials 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- 125000005591 trimellitate group Chemical group 0.000 description 1
- YPDXSCXISVYHOB-UHFFFAOYSA-N tris(7-methyloctyl) benzene-1,2,4-tricarboxylate Chemical compound CC(C)CCCCCCOC(=O)C1=CC=C(C(=O)OCCCCCCC(C)C)C(C(=O)OCCCCCCC(C)C)=C1 YPDXSCXISVYHOB-UHFFFAOYSA-N 0.000 description 1
- VXYADVIJALMOEQ-UHFFFAOYSA-K tris(lactato)aluminium Chemical compound CC(O)C(=O)O[Al](OC(=O)C(C)O)OC(=O)C(C)O VXYADVIJALMOEQ-UHFFFAOYSA-K 0.000 description 1
- 238000005292 vacuum distillation Methods 0.000 description 1
- 229910052726 zirconium Inorganic materials 0.000 description 1
Images
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/04—Oxygen-containing compounds
- C08K5/10—Esters; Ether-esters
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/0008—Organic ingredients according to more than one of the "one dot" groups of C08K5/01 - C08K5/59
- C08K5/0016—Plasticisers
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/04—Oxygen-containing compounds
- C08K5/10—Esters; Ether-esters
- C08K5/11—Esters; Ether-esters of acyclic polycarboxylic acids
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/04—Oxygen-containing compounds
- C08K5/10—Esters; Ether-esters
- C08K5/12—Esters; Ether-esters of cyclic polycarboxylic acids
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L27/00—Compositions of homopolymers or copolymers of compounds having one or more unsaturated aliphatic radicals, each having only one carbon-to-carbon double bond, and at least one being terminated by a halogen; Compositions of derivatives of such polymers
- C08L27/02—Compositions of homopolymers or copolymers of compounds having one or more unsaturated aliphatic radicals, each having only one carbon-to-carbon double bond, and at least one being terminated by a halogen; Compositions of derivatives of such polymers not modified by chemical after-treatment
- C08L27/04—Compositions of homopolymers or copolymers of compounds having one or more unsaturated aliphatic radicals, each having only one carbon-to-carbon double bond, and at least one being terminated by a halogen; Compositions of derivatives of such polymers not modified by chemical after-treatment containing chlorine atoms
- C08L27/06—Homopolymers or copolymers of vinyl chloride
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K2201/00—Specific properties of additives
- C08K2201/014—Additives containing two or more different additives of the same subgroup in C08K
Abstract
Description
헥실 알코올의 이성질체 혼합물 조성(중량비) | 2-에틸헥산올:헥실 알코올 중량비 | |
제조예 1-1 | 2-메틸펜탄올:3-메틸펜탄올 = 5:5 | 66:34 |
제조예 1-2 | 2-메틸펜탄올:3-메틸펜탄올:1-헥산올 = 4:4:2 | 66:34 |
제조예 1-3 | 2-메틸펜탄올:3-메틸펜탄올:사이클로펜틸 메탄올 = 4:4:2 | 66:34 |
제조예 1-4 | 2-메틸펜탄올:3-메틸펜탄올:4-메틸펜탄올 = 4:4:2 | 66:34 |
제조예 1-5 | 2-메틸펜탄올:3-메틸펜탄올:4-메틸펜탄올:1-헥산올:사이클로펜틸 메탄올 = 38:41:4:11:6 | 66:34 |
제조예 1-6 | 2-메틸펜탄올:3-메틸펜탄올:4-메틸펜탄올:1-헥산올:사이클로펜틸 메탄올 = 38:41:4:11:6 | 30:70 |
제조예 1-7 | 2-메틸펜탄올:3-메틸펜탄올:4-메틸펜탄올:1-헥산올:사이클로펜틸 메탄올 = 38:41:4:11:6 | 70:30 |
제조예 1-8 | 2-메틸펜탄올:3-메틸펜탄올:4-메틸펜탄올:1-헥산올:사이클로펜틸 메탄올 = 38:41:4:11:6 | 90:10 |
헥실 알코올의 이성질체 혼합물 조성(중량비) | |
제조예 2-1 | 2-메틸펜탄올:3-메틸펜탄올:4-메틸펜탄올:1-헥산올:사이클로펜틸 메탄올 = 38:41:4:11:6 |
제조예 2-2 | 2-메틸펜탄올:3-메틸펜탄올 = 5:5 |
제조예 2-3 | 2-메틸펜탄올:3-메틸펜탄올:1-헥산올 = 4:4:2 |
이소프탈레이트계 조성물 | 시트레이트계 조성물 | 이소프탈레이트 : 시트레이트 중량비 | |
실시예 1-1 | 제조예 1-1 | 제조예 2-1 | 8 : 2 |
실시예 1-2 | 제조예 1-2 | 제조예 2-1 | 8 ; 2 |
실시예 1-3 | 제조예 1-3 | 제조예 2-1 | 8 : 2 |
실시예 1-4 | 제조예 1-4 | 제조예 2-1 | 8 : 2 |
실시예 1-5 | 제조예 1-5 | 제조예 2-1 | 8 : 2 |
실시예 2-1 | 제조예 1-6 | 제조예 2-1 | 8 : 2 |
실시예 2-2 | 제조예 1-7 | 제조예 2-1 | 8 : 2 |
실시예 2-3 | 제조예 1-8 | 제조예 2-1 | 8 : 2 |
실시예 3-1 | 제조예 1-5 | 제조예 2-2 | 8 : 2 |
실시예 3-2 | 제조예 1-5 | 제조예 2-3 | 8 : 2 |
실시예 4-1 | 제조예 1-5 | 제조예 2-1 | 1 : 9 |
실시예 4-2 | 제조예 1-5 | 제조예 2-1 | 3 : 7 |
실시예 4-3 | 제조예 1-5 | 제조예 2-1 | 5 : 5 |
실시예 4-4 | 제조예 1-5 | 제조예 2-1 | 9 : 1 |
구분 | 경도 | 기계적 물성 | 이행손실 (%) |
가열감량 (%) |
||
Shore A | Shore D | 인장강도 (kgf/cm2) |
신율 (%) |
|||
실시예 1-1 | 84.6 | 38.1 | 221.4 | 318.9 | 3.56 | 1.35 |
실시예 1-2 | 84.3 | 37.7 | 225.6 | 320.5 | 3.30 | 1.34 |
실시예 1-3 | 84.5 | 38.9 | 220.4 | 322.1 | 3.10 | 1.05 |
실시예 1-4 | 84.4 | 37.5 | 220.3 | 320.4 | 3.44 | 1.35 |
실시예 1-5 | 84.1 | 38.8 | 220.5 | 321.8 | 3.75 | 1.58 |
실시예 2-1 | 81.2 | 33.5 | 211.4 | 330.5 | 1.60 | 1.88 |
실시예 2-2 | 84.5 | 39.0 | 228.7 | 330.5 | 3.21 | 1.02 |
실시예 2-3 | 85.1 | 34.0 | 229.7 | 325.6 | 3.54 | 1.10 |
실시예 3-1 | 84.0 | 38.6 | 224.3 | 325.7 | 3.41 | 1.45 |
실시예 3-2 | 84.0 | 38.7 | 225.3 | 323.8 | 3.50 | 1.48 |
실시예 4-1 | 84.1 | 37.3 | 214.8 | 337.9 | 1.65 | 1.20 |
실시예 4-2 | 84.3 | 37.4 | 213.4 | 325.7 | 1.80 | 1.33 |
실시예 4-3 | 84.8 | 38.2 | 215.6 | 328.9 | 2.35 | 1.58 |
실시예 4-4 | 84.6 | 39.0 | 218.8 | 320.5 | 2.69 | 1.84 |
비교예 1 | 84.4 | 38.7 | 200.6 | 297.4 | 1.74 | 1.60 |
비교예 2 | 86.9 | 41.1 | 209.7 | 308.9 | 2.38 | 0.69 |
비교예 3 | 88.6 | 42.5 | 216.1 | 300.7 | 6.88 | 0.82 |
비교예 4 | 85.2 | 39.7 | 220.5 | 307.3 | 5.68 | 3.05 |
비교예 5 | 85.0 | 39.3 | 217.6 | 304.2 | 4.15 | 2.59 |
비교예 6 | 84.1 | 37.2 | 208.5 | 337.5 | 1.62 | 1.09 |
구분 | 스트레스 테스트 | 흡수 속도(mm:ss) |
실시예 1-1 | 0.5 | 5:25 |
실시예 1-2 | 0.5 | 5:20 |
실시예 1-3 | 0.5 | 5:25 |
실시예 1-4 | 0.5 | 5:20 |
실시예 1-5 | 0.5 | 5:25 |
실시예 2-1 | 0.0 | 4:15 |
실시예 2-2 | 0.5 | 5:50 |
실시예 2-3 | 1.0 | 6:00 |
실시예 3-1 | 0.5 | 5:30 |
실시예 3-2 | 0.5 | 5:35 |
실시예 4-1 | 0.5 | 5:55 |
실시예 4-2 | 0.5 | 5:55 |
실시예 4-3 | 0.5 | 5:50 |
실시예 4-4 | 0.5 | 5:49 |
비교예 1 | 0.5 | 5:30 |
비교예 2 | 0.5 | 6:50 |
비교예 3 | 3.0 | 7:30 |
비교예 4 | 1.5 | 5:30 |
비교예 5 | 1.5 | 5:40 |
비교예 6 | 0.5 | 5:35 |
구분 | △E | YI | |||
200시간 후 | 400시간 후 | 0시간 | 200시간 후 | 400시간 후 | |
실시예 1-5 | 0.94 | 1.06 | -7.87 | -8.63 | -9.08 |
비교예 1 | 0.52 | 0.78 | -8.44 | -8.49 | -7.39 |
비교예 2 | 0.47 | 0.71 | -8.23 | -9.51 | -7.21 |
비교예 3 | 3.43 | 8.77 | -8.31 | -3.29 | 5.45 |
비교예 4 | 2.86 | 8.93 | -8.23 | -4.12 | 5.09 |
Claims (15)
- 이소프탈레이트계 조성물 및 시트레이트계 조성물을 포함하고,상기 이소프탈레이트계 조성물은 다이헥실 이소프탈레이트, 헥실(2-에틸헥실) 이소프탈레이트 및 다이(2-에틸헥실) 이소프탈레이트를 포함하며,상기 시트레이트계 조성물은 트리헥실 시트레이트를 포함하고,상기 이소프탈레이트의 헥실기 및 시트레이트의 헥실기는 헥실 알코올의 이성질체 혼합물로부터 유래되며,상기 헥실 알코올의 이성질체 혼합물은 1-헥산올, 1-메틸펜탄올, 2-메틸펜탄올, 3-메틸펜탄올, 4-메틸펜탄올, 1,1-디메틸부탄올, 1,2-디메틸부탄올, 1,3-디메틸부탄올, 2,2-디메틸부탄올, 2,3-디메틸부탄올, 3,3-디메틸부탄올, 1-에틸부탄올, 2-에틸부탄올, 3-에틸부탄올 및 사이클로펜틸 메탄올로 이루어진 군에서 선택된 2 이상을 포함하는 것인 가소제 조성물.
- 제1항에 있어서,상기 이소프탈레이트계 조성물은, 다이헥실 이소프탈레이트 0.5 내지 50.0 중량%; 헥실(2-에틸헥실) 이소프탈레이트 3.0 내지 70.0 중량%; 및 다이(2-에틸헥실) 이소프탈레이트 0.5 내지 95.0 중량%;를 포함하는 것인 가소제 조성물.
- 제1항에 있어서,상기 이소프탈레이트계 조성물과 상기 시트레이트계 조성물을 95:5 내지 5:95의 중량비로 포함하는 것인 가소제 조성물.
- 제1항에 있어서,상기 이소프탈레이트계 조성물과 상기 시트레이트계 조성물을 95:5 내지 50:50의 중량비로 포함하는 것인 가소제 조성물.
- 제1항에 있어서,상기 헥실 알코올의 이성질체 혼합물은 2-메틸펜탄올 및 3-메틸펜탄올을 포함하는 것인 가소제 조성물.
- 제1항에 있어서,상기 헥실 알코올의 이성질체 혼합물은, 이성질체 혼합물 100 중량부에 대하여, 분지형 알코올이 40 중량부 이상으로 포함되는 것인 가소제 조성물.
- 제1항에 있어서,상기 헥실 알코올의 이성질체 혼합물은, 이성질체 혼합물 100 중량부에 대하여, 분지형 알코올이 50 내지 95 중량부로 포함되는 것인 가소제 조성물.
- 제6항에 있어서,상기 헥실 알코올의 이성질체 혼합물은 1-헥산올을 더 포함하는 것인 가소제 조성물.
- 제9항에 있어서,상기 헥실 알코올의 이성질체 혼합물은, 이성질체 혼합물 100 중량부에 대하여, 1-헥산올이 40 중량부 이하로 포함되는 것인 가소제 조성물.
- 제6항 또는 제9항에 있어서,상기 헥실 알코올의 이성질체 혼합물은 4-메틸펜탄올을 더 포함하는 것인 가소제 조성물.
- 제6항 또는 제9항에 있어서,상기 헥실 알코올올의 이성질체 혼합물은 사이클로펜틸 메탄올을 더 포함하는 것인 가소제 조성물.
- 제12항에 있어서,상기 헥실 알코올의 이성질체 혼합물은, 이성질체 혼합물 100 중량부에 대하여, 사이클로펜틸 메탄올이 20 중량부 이하로 포함되는 것인 가소제 조성물.
- 수지 100 중량부; 및 제1항의 가소제 조성물 5 내지 150 중량부;를 포함하는 수지 조성물.
- 제14항에 있어서,상기 수지는 스트레이트 염화비닐 중합체, 페이스트 염화비닐 중합체, 에틸렌 비닐 아세테이트 공중합체, 에틸렌 중합체, 프로필렌 중합체, 폴리케톤, 폴리스티렌, 폴리우레탄, 폴리젖산, 천연고무 및 합성고무로 이루어진 군에서 선택된 1 종 이상인 것인 수지 조성물.
Priority Applications (5)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
US18/029,723 US20230407049A1 (en) | 2021-01-29 | 2022-01-28 | Plasticizer composition and resin composition comprising the same |
JP2023520508A JP2023544052A (ja) | 2021-01-29 | 2022-01-28 | 可塑剤組成物およびこれを含む樹脂組成物 |
EP22746294.2A EP4286467A1 (en) | 2021-01-29 | 2022-01-28 | Plasticizer composition and resin composition comprising same |
CN202280006743.2A CN116419945A (zh) | 2021-01-29 | 2022-01-28 | 增塑剂组合物以及包含其的树脂组合物 |
MX2023004287A MX2023004287A (es) | 2021-01-29 | 2022-01-28 | Composicion plastificante y composicion de resina que comprende la misma. |
Applications Claiming Priority (2)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
KR20210013022 | 2021-01-29 | ||
KR10-2021-0013022 | 2021-01-29 |
Publications (1)
Publication Number | Publication Date |
---|---|
WO2022164268A1 true WO2022164268A1 (ko) | 2022-08-04 |
Family
ID=82653702
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
PCT/KR2022/001617 WO2022164268A1 (ko) | 2021-01-29 | 2022-01-28 | 가소제 조성물 및 이를 포함하는 수지 조성물 |
Country Status (8)
Country | Link |
---|---|
US (1) | US20230407049A1 (ko) |
EP (1) | EP4286467A1 (ko) |
JP (1) | JP2023544052A (ko) |
KR (1) | KR20220110125A (ko) |
CN (1) | CN116419945A (ko) |
MX (1) | MX2023004287A (ko) |
TW (1) | TW202246401A (ko) |
WO (1) | WO2022164268A1 (ko) |
Citations (5)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
KR20160119697A (ko) * | 2015-04-06 | 2016-10-14 | 주식회사 엘지화학 | 가소제 조성물, 수지 조성물 및 이들의 제조 방법 |
CN106187750A (zh) * | 2015-05-06 | 2016-12-07 | 中国科学院大连化学物理研究所 | 一种二甲苯液相催化氧化制备苯二甲酸的方法 |
KR20190022286A (ko) * | 2017-08-25 | 2019-03-06 | 애경유화주식회사 | 복합 가소제 조성물, 이의 제조방법 및 이를 이용한 고분자 수지 조성물 |
KR20200110104A (ko) * | 2019-03-12 | 2020-09-23 | 김영철 | 내한성능이 우수한 난연 수성 고무 아스팔트 프라이머 |
KR20200127877A (ko) * | 2019-05-02 | 2020-11-11 | 주식회사 엘지화학 | 가소제 조성물 및 이를 포함하는 수지 조성물 |
-
2022
- 2022-01-28 KR KR1020220013242A patent/KR20220110125A/ko unknown
- 2022-01-28 MX MX2023004287A patent/MX2023004287A/es unknown
- 2022-01-28 US US18/029,723 patent/US20230407049A1/en active Pending
- 2022-01-28 CN CN202280006743.2A patent/CN116419945A/zh active Pending
- 2022-01-28 JP JP2023520508A patent/JP2023544052A/ja active Pending
- 2022-01-28 EP EP22746294.2A patent/EP4286467A1/en active Pending
- 2022-01-28 WO PCT/KR2022/001617 patent/WO2022164268A1/ko active Application Filing
- 2022-01-28 TW TW111104092A patent/TW202246401A/zh unknown
Patent Citations (5)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
KR20160119697A (ko) * | 2015-04-06 | 2016-10-14 | 주식회사 엘지화학 | 가소제 조성물, 수지 조성물 및 이들의 제조 방법 |
CN106187750A (zh) * | 2015-05-06 | 2016-12-07 | 中国科学院大连化学物理研究所 | 一种二甲苯液相催化氧化制备苯二甲酸的方法 |
KR20190022286A (ko) * | 2017-08-25 | 2019-03-06 | 애경유화주식회사 | 복합 가소제 조성물, 이의 제조방법 및 이를 이용한 고분자 수지 조성물 |
KR20200110104A (ko) * | 2019-03-12 | 2020-09-23 | 김영철 | 내한성능이 우수한 난연 수성 고무 아스팔트 프라이머 |
KR20200127877A (ko) * | 2019-05-02 | 2020-11-11 | 주식회사 엘지화학 | 가소제 조성물 및 이를 포함하는 수지 조성물 |
Also Published As
Publication number | Publication date |
---|---|
MX2023004287A (es) | 2023-05-02 |
TW202246401A (zh) | 2022-12-01 |
EP4286467A1 (en) | 2023-12-06 |
JP2023544052A (ja) | 2023-10-19 |
CN116419945A (zh) | 2023-07-11 |
KR20220110125A (ko) | 2022-08-05 |
US20230407049A1 (en) | 2023-12-21 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
WO2014181922A1 (ko) | 에스테르계 조성물, 이의 제조방법, 및 이를 포함하는 수지 조성물 | |
WO2018048170A1 (ko) | 가소제 조성물 및 이를 포함하는 수지 조성물 | |
WO2021020878A1 (ko) | 시트레이트계 가소제 조성물 및 이를 포함하는 수지 조성물 | |
WO2018147690A1 (ko) | 가소제 조성물 및 이를 포함하는 수지 조성물 | |
WO2020222536A1 (ko) | 사이클로헥산 트리에스터계 가소제 조성물 및 이를 포함하는 수지 조성물 | |
WO2018216985A1 (ko) | 시트레이트계 가소제 및 이를 포함하는 수지 조성물 | |
WO2018008913A1 (ko) | 가소제 조성물, 수지 조성물 및 이들의 제조 방법 | |
WO2014058122A1 (ko) | 가소제, 가소제 조성물, 내열수지 조성물 및 이들의 제조 방법 | |
WO2020222500A1 (ko) | 가소제 조성물 및 이를 포함하는 수지 조성물 | |
WO2019088736A2 (ko) | 가소제 조성물 및 이를 포함하는 수지 조성물 | |
WO2017222232A1 (ko) | 가소제 조성물, 수지 조성물 및 이들의 제조 방법 | |
WO2020251266A1 (ko) | 가소제 조성물 및 이를 포함하는 수지 조성물 | |
WO2017018740A1 (ko) | 가소제 조성물, 수지 조성물 및 이들의 제조 방법 | |
WO2016182376A1 (ko) | 에스테르계 화합물, 이를 포함하는 조성물, 이의 제조방법, 및 이를 포함하는 수지 조성물 | |
WO2016153235A1 (ko) | 가소제 조성물, 수지 조성물 및 이들의 제조 방법 | |
WO2021145643A1 (ko) | 시트레이트계 가소제 조성물 및 이를 포함하는 수지 조성물 | |
WO2017074057A1 (ko) | 가소제 조성물, 수지 조성물 및 이들의 제조 방법 | |
WO2017091040A1 (ko) | 가소제 조성물, 수지 조성물 및 이들의 제조 방법 | |
WO2018110922A1 (ko) | 가소제 조성물 및 이를 포함하는 수지 조성물 | |
WO2017183877A1 (ko) | 가소제 조성물 및 이를 포함하는 수지 조성물 | |
WO2020222494A1 (ko) | 가소제 조성물 및 이를 포함하는 수지 조성물 | |
WO2022270911A1 (ko) | 트라이에스터계 가소제 조성물 및 이를 포함하는 수지 조성물 | |
WO2022270910A1 (ko) | 트라이에스터계 가소제 조성물 및 이를 포함하는 수지 조성물 | |
WO2022035138A1 (ko) | 아세틸 시트레이트계 가소제 조성물 및 이를 포함하는 수지 조성물 | |
WO2022164268A1 (ko) | 가소제 조성물 및 이를 포함하는 수지 조성물 |
Legal Events
Date | Code | Title | Description |
---|---|---|---|
121 | Ep: the epo has been informed by wipo that ep was designated in this application |
Ref document number: 22746294 Country of ref document: EP Kind code of ref document: A1 |
|
ENP | Entry into the national phase |
Ref document number: 2023520508 Country of ref document: JP Kind code of ref document: A |
|
REG | Reference to national code |
Ref country code: BR Ref legal event code: B01A Ref document number: 112023008127 Country of ref document: BR |
|
ENP | Entry into the national phase |
Ref document number: 112023008127 Country of ref document: BR Kind code of ref document: A2 Effective date: 20230427 |
|
WWE | Wipo information: entry into national phase |
Ref document number: 2022746294 Country of ref document: EP |
|
NENP | Non-entry into the national phase |
Ref country code: DE |
|
ENP | Entry into the national phase |
Ref document number: 2022746294 Country of ref document: EP Effective date: 20230829 |