US3833400A - Sheet with improved image durability - Google Patents
Sheet with improved image durability Download PDFInfo
- Publication number
- US3833400A US3833400A US00198316A US19831671A US3833400A US 3833400 A US3833400 A US 3833400A US 00198316 A US00198316 A US 00198316A US 19831671 A US19831671 A US 19831671A US 3833400 A US3833400 A US 3833400A
- Authority
- US
- United States
- Prior art keywords
- pressure
- color former
- sensitive recording
- dihydroquinoline
- recording sheet
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 40
- 239000001257 hydrogen Substances 0.000 claims abstract description 40
- -1 hydrogen quinoline compound Chemical class 0.000 claims abstract description 31
- SMWDFEZZVXVKRB-UHFFFAOYSA-N anhydrous quinoline Natural products N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 claims abstract description 27
- 239000003960 organic solvent Substances 0.000 claims description 9
- 239000002904 solvent Substances 0.000 claims description 8
- 150000001875 compounds Chemical class 0.000 claims description 7
- 150000004897 thiazines Chemical class 0.000 claims description 6
- 239000007795 chemical reaction product Substances 0.000 claims description 4
- CZZYITDELCSZES-UHFFFAOYSA-N diphenylmethane Chemical class C=1C=CC=CC=1CC1=CC=CC=C1 CZZYITDELCSZES-UHFFFAOYSA-N 0.000 claims description 4
- IRFSXVIRXMYULF-UHFFFAOYSA-N 1,2-dihydroquinoline Chemical compound C1=CC=C2C=CCNC2=C1 IRFSXVIRXMYULF-UHFFFAOYSA-N 0.000 claims description 3
- 238000002845 discoloration Methods 0.000 claims description 3
- LBUJPTNKIBCYBY-UHFFFAOYSA-N 1,2,3,4-tetrahydroquinoline Chemical compound C1=CC=C2CCCNC2=C1 LBUJPTNKIBCYBY-UHFFFAOYSA-N 0.000 claims description 2
- KSNRDYQOHXQKAB-UHFFFAOYSA-N 2,2,4-trimethyl-3,4-dihydro-1h-quinoline Chemical compound C1=CC=C2C(C)CC(C)(C)NC2=C1 KSNRDYQOHXQKAB-UHFFFAOYSA-N 0.000 claims description 2
- LUVSSHMDUIBQQQ-UHFFFAOYSA-N 6-methyl-1,2-dihydroquinoline Chemical compound N1CC=CC2=CC(C)=CC=C21 LUVSSHMDUIBQQQ-UHFFFAOYSA-N 0.000 claims description 2
- 235000019285 ethoxyquin Nutrition 0.000 claims description 2
- SMUPYXBYBBXXAH-UHFFFAOYSA-N n,n-diethyl-2,2,4-trimethyl-1h-quinolin-6-amine Chemical compound N1C(C)(C)C=C(C)C2=CC(N(CC)CC)=CC=C21 SMUPYXBYBBXXAH-UHFFFAOYSA-N 0.000 claims description 2
- 150000002894 organic compounds Chemical class 0.000 claims description 2
- NVXKDTVBVPMPAL-UHFFFAOYSA-N 1,2,2-trimethylquinoline Chemical compound C1=CC=C2C=CC(C)(C)N(C)C2=C1 NVXKDTVBVPMPAL-UHFFFAOYSA-N 0.000 claims 1
- QDGNTAWQJUIARL-UHFFFAOYSA-N 1-methyl-2-phenyl-2h-quinoline Chemical compound C1=CC2=CC=CC=C2N(C)C1C1=CC=CC=C1 QDGNTAWQJUIARL-UHFFFAOYSA-N 0.000 claims 1
- XYYAWTAAYUUQIO-UHFFFAOYSA-N 2,2,4-trimethyl-1h-quinolin-6-amine Chemical compound C1=C(N)C=C2C(C)=CC(C)(C)NC2=C1 XYYAWTAAYUUQIO-UHFFFAOYSA-N 0.000 claims 1
- WCNHRLSKBUSOKU-UHFFFAOYSA-N N-ethyl-2,2,4-trimethyl-1H-quinolin-6-amine Chemical compound C(C)NC=1C=C2C(=CC(NC2=CC1)(C)C)C WCNHRLSKBUSOKU-UHFFFAOYSA-N 0.000 claims 1
- DECIPOUIJURFOJ-UHFFFAOYSA-N ethoxyquin Chemical compound N1C(C)(C)C=C(C)C2=CC(OCC)=CC=C21 DECIPOUIJURFOJ-UHFFFAOYSA-N 0.000 claims 1
- 125000001834 xanthenyl group Chemical class C1=CC=CC=2OC3=CC=CC=C3C(C12)* 0.000 claims 1
- 125000004432 carbon atom Chemical group C* 0.000 description 29
- 230000000052 comparative effect Effects 0.000 description 28
- 239000002775 capsule Substances 0.000 description 27
- 239000003921 oil Substances 0.000 description 26
- 235000019198 oils Nutrition 0.000 description 26
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 21
- 125000000217 alkyl group Chemical group 0.000 description 16
- 238000000576 coating method Methods 0.000 description 16
- 239000011248 coating agent Substances 0.000 description 15
- 238000010521 absorption reaction Methods 0.000 description 12
- 230000005855 radiation Effects 0.000 description 11
- 238000007754 air knife coating Methods 0.000 description 10
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 10
- 238000001035 drying Methods 0.000 description 9
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 8
- 238000006243 chemical reaction Methods 0.000 description 8
- 239000000463 material Substances 0.000 description 8
- 239000000243 solution Substances 0.000 description 8
- 239000002253 acid Substances 0.000 description 7
- LIZLYZVAYZQVPG-UHFFFAOYSA-N (3-bromo-2-fluorophenyl)methanol Chemical compound OCC1=CC=CC(Br)=C1F LIZLYZVAYZQVPG-UHFFFAOYSA-N 0.000 description 6
- WNZQDUSMALZDQF-UHFFFAOYSA-N 2-benzofuran-1(3H)-one Chemical compound C1=CC=C2C(=O)OCC2=C1 WNZQDUSMALZDQF-UHFFFAOYSA-N 0.000 description 6
- 238000000034 method Methods 0.000 description 6
- BWLUMTFWVZZZND-UHFFFAOYSA-N Dibenzylamine Chemical compound C=1C=CC=CC=1CNCC1=CC=CC=C1 BWLUMTFWVZZZND-UHFFFAOYSA-N 0.000 description 5
- 125000003545 alkoxy group Chemical group 0.000 description 5
- 150000003973 alkyl amines Chemical class 0.000 description 5
- 125000003277 amino group Chemical group 0.000 description 5
- 125000005265 dialkylamine group Chemical group 0.000 description 5
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- ZKURGBYDCVNWKH-UHFFFAOYSA-N [3,7-bis(dimethylamino)phenothiazin-10-yl]-phenylmethanone Chemical compound C12=CC=C(N(C)C)C=C2SC2=CC(N(C)C)=CC=C2N1C(=O)C1=CC=CC=C1 ZKURGBYDCVNWKH-UHFFFAOYSA-N 0.000 description 4
- 229940027991 antiseptic and disinfectant quinoline derivative Drugs 0.000 description 4
- 230000003595 spectral effect Effects 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 239000004927 clay Substances 0.000 description 3
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical group C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 239000012188 paraffin wax Chemical class 0.000 description 3
- 229920000642 polymer Polymers 0.000 description 3
- PYWVYCXTNDRMGF-UHFFFAOYSA-N rhodamine B Chemical compound [Cl-].C=12C=CC(=[N+](CC)CC)C=C2OC2=CC(N(CC)CC)=CC=C2C=1C1=CC=CC=C1C(O)=O PYWVYCXTNDRMGF-UHFFFAOYSA-N 0.000 description 3
- 125000001424 substituent group Chemical group 0.000 description 3
- QNLZIZAQLLYXTC-UHFFFAOYSA-N 1,2-dimethylnaphthalene Chemical compound C1=CC=CC2=C(C)C(C)=CC=C21 QNLZIZAQLLYXTC-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- 108010010803 Gelatin Proteins 0.000 description 2
- 229920000084 Gum arabic Polymers 0.000 description 2
- 241000978776 Senegalia senegal Species 0.000 description 2
- 239000000205 acacia gum Substances 0.000 description 2
- 235000010489 acacia gum Nutrition 0.000 description 2
- 239000000427 antigen Substances 0.000 description 2
- 102000036639 antigens Human genes 0.000 description 2
- 108091007433 antigens Proteins 0.000 description 2
- JPIYZTWMUGTEHX-UHFFFAOYSA-N auramine O free base Chemical compound C1=CC(N(C)C)=CC=C1C(=N)C1=CC=C(N(C)C)C=C1 JPIYZTWMUGTEHX-UHFFFAOYSA-N 0.000 description 2
- 235000010290 biphenyl Nutrition 0.000 description 2
- 150000004074 biphenyls Chemical class 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 238000005660 chlorination reaction Methods 0.000 description 2
- 238000005354 coacervation Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- FWQHNLCNFPYBCA-UHFFFAOYSA-N fluoran Chemical class C12=CC=CC=C2OC2=CC=CC=C2C11OC(=O)C2=CC=CC=C21 FWQHNLCNFPYBCA-UHFFFAOYSA-N 0.000 description 2
- LNTHITQWFMADLM-UHFFFAOYSA-N gallic acid Chemical compound OC(=O)C1=CC(O)=C(O)C(O)=C1 LNTHITQWFMADLM-UHFFFAOYSA-N 0.000 description 2
- 239000008273 gelatin Substances 0.000 description 2
- 229920000159 gelatin Polymers 0.000 description 2
- 235000019322 gelatine Nutrition 0.000 description 2
- 235000011852 gelatine desserts Nutrition 0.000 description 2
- 239000003350 kerosene Chemical class 0.000 description 2
- 238000005259 measurement Methods 0.000 description 2
- 239000003094 microcapsule Substances 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 150000002790 naphthalenes Chemical class 0.000 description 2
- 239000007800 oxidant agent Substances 0.000 description 2
- IZUPBVBPLAPZRR-UHFFFAOYSA-N pentachlorophenol Chemical compound OC1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl IZUPBVBPLAPZRR-UHFFFAOYSA-N 0.000 description 2
- 150000001911 terphenyls Chemical class 0.000 description 2
- 150000003732 xanthenes Chemical class 0.000 description 2
- YJTKZCDBKVTVBY-UHFFFAOYSA-N 1,3-Diphenylbenzene Chemical group C1=CC=CC=C1C1=CC=CC(C=2C=CC=CC=2)=C1 YJTKZCDBKVTVBY-UHFFFAOYSA-N 0.000 description 1
- TUSDEZXZIZRFGC-UHFFFAOYSA-N 1-O-galloyl-3,6-(R)-HHDP-beta-D-glucose Natural products OC1C(O2)COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC1C(O)C2OC(=O)C1=CC(O)=C(O)C(O)=C1 TUSDEZXZIZRFGC-UHFFFAOYSA-N 0.000 description 1
- ABJAMKKUHBSXDS-UHFFFAOYSA-N 3,3-bis(6-amino-1,4-dimethylcyclohexa-2,4-dien-1-yl)-2-benzofuran-1-one Chemical compound C1=CC(C)=CC(N)C1(C)C1(C2(C)C(C=C(C)C=C2)N)C2=CC=CC=C2C(=O)O1 ABJAMKKUHBSXDS-UHFFFAOYSA-N 0.000 description 1
- RNRINRUTVAFUCG-UHFFFAOYSA-N 5-(dimethylamino)-3,3-bis(1,2-dimethylindol-3-yl)-2-benzofuran-1-one Chemical compound C1=CC=C2C(C3(C=4C5=CC=CC=C5N(C)C=4C)OC(=O)C4=CC=C(C=C43)N(C)C)=C(C)N(C)C2=C1 RNRINRUTVAFUCG-UHFFFAOYSA-N 0.000 description 1
- KJFCMURGEOJJFA-UHFFFAOYSA-N 5-(dimethylamino)-3,3-bis(9-ethylcarbazol-3-yl)-2-benzofuran-1-one Chemical compound C1=CC=C2C3=CC(C4(C5=CC(=CC=C5C(=O)O4)N(C)C)C=4C=C5C6=CC=CC=C6N(C5=CC=4)CC)=CC=C3N(CC)C2=C1 KJFCMURGEOJJFA-UHFFFAOYSA-N 0.000 description 1
- WYWMJBFBHMNECA-UHFFFAOYSA-N 6-(dimethylamino)-3,3-bis(1,2-dimethylindol-3-yl)-2-benzofuran-1-one Chemical compound C1=CC=C2C(C3(C=4C5=CC=CC=C5N(C)C=4C)OC(=O)C=4C3=CC=C(C=4)N(C)C)=C(C)N(C)C2=C1 WYWMJBFBHMNECA-UHFFFAOYSA-N 0.000 description 1
- GJCOSYZMQJWQCA-UHFFFAOYSA-N 9H-xanthene Chemical class C1=CC=C2CC3=CC=CC=C3OC2=C1 GJCOSYZMQJWQCA-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- 239000001263 FEMA 3042 Substances 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- 238000012695 Interfacial polymerization Methods 0.000 description 1
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical class C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 1
- LRBQNJMCXXYXIU-PPKXGCFTSA-N Penta-digallate-beta-D-glucose Natural products OC1=C(O)C(O)=CC(C(=O)OC=2C(=C(O)C=C(C=2)C(=O)OC[C@@H]2[C@H]([C@H](OC(=O)C=3C=C(OC(=O)C=4C=C(O)C(O)=C(O)C=4)C(O)=C(O)C=3)[C@@H](OC(=O)C=3C=C(OC(=O)C=4C=C(O)C(O)=C(O)C=4)C(O)=C(O)C=3)[C@H](OC(=O)C=3C=C(OC(=O)C=4C=C(O)C(O)=C(O)C=4)C(O)=C(O)C=3)O2)OC(=O)C=2C=C(OC(=O)C=3C=C(O)C(O)=C(O)C=3)C(O)=C(O)C=2)O)=C1 LRBQNJMCXXYXIU-PPKXGCFTSA-N 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- 239000002174 Styrene-butadiene Substances 0.000 description 1
- 235000010724 Wisteria floribunda Nutrition 0.000 description 1
- 229910021536 Zeolite Inorganic materials 0.000 description 1
- 238000010306 acid treatment Methods 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 229960000892 attapulgite Drugs 0.000 description 1
- 239000000440 bentonite Substances 0.000 description 1
- 229910000278 bentonite Inorganic materials 0.000 description 1
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- MTAZNLWOLGHBHU-UHFFFAOYSA-N butadiene-styrene rubber Chemical compound C=CC=C.C=CC1=CC=CC=C1 MTAZNLWOLGHBHU-UHFFFAOYSA-N 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 239000005018 casein Substances 0.000 description 1
- BECPQYXYKAMYBN-UHFFFAOYSA-N casein, tech. Chemical compound NCCCCC(C(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(CC(C)C)N=C(O)C(CCC(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(C(C)O)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(COP(O)(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(N)CC1=CC=CC=C1 BECPQYXYKAMYBN-UHFFFAOYSA-N 0.000 description 1
- 235000021240 caseins Nutrition 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000000084 colloidal system Substances 0.000 description 1
- 235000012343 cottonseed oil Nutrition 0.000 description 1
- 239000002385 cottonseed oil Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical compound O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 235000004515 gallic acid Nutrition 0.000 description 1
- 229940074391 gallic acid Drugs 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000004816 latex Substances 0.000 description 1
- 229920000126 latex Polymers 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052625 palygorskite Inorganic materials 0.000 description 1
- 239000005011 phenolic resin Substances 0.000 description 1
- 229920001568 phenolic resin Polymers 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 150000003248 quinolines Chemical class 0.000 description 1
- 238000001454 recorded image Methods 0.000 description 1
- 235000011121 sodium hydroxide Nutrition 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 150000003413 spiro compounds Chemical class 0.000 description 1
- 239000011115 styrene butadiene Substances 0.000 description 1
- 229920003048 styrene butadiene rubber Polymers 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 235000015523 tannic acid Nutrition 0.000 description 1
- LRBQNJMCXXYXIU-NRMVVENXSA-N tannic acid Chemical compound OC1=C(O)C(O)=CC(C(=O)OC=2C(=C(O)C=C(C=2)C(=O)OC[C@@H]2[C@H]([C@H](OC(=O)C=3C=C(OC(=O)C=4C=C(O)C(O)=C(O)C=4)C(O)=C(O)C=3)[C@@H](OC(=O)C=3C=C(OC(=O)C=4C=C(O)C(O)=C(O)C=4)C(O)=C(O)C=3)[C@@H](OC(=O)C=3C=C(OC(=O)C=4C=C(O)C(O)=C(O)C=4)C(O)=C(O)C=3)O2)OC(=O)C=2C=C(OC(=O)C=3C=C(O)C(O)=C(O)C=3)C(O)=C(O)C=2)O)=C1 LRBQNJMCXXYXIU-NRMVVENXSA-N 0.000 description 1
- 229940033123 tannic acid Drugs 0.000 description 1
- 229920002258 tannic acid Polymers 0.000 description 1
- 239000010457 zeolite Substances 0.000 description 1
Images
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B41—PRINTING; LINING MACHINES; TYPEWRITERS; STAMPS
- B41M—PRINTING, DUPLICATING, MARKING, OR COPYING PROCESSES; COLOUR PRINTING
- B41M5/00—Duplicating or marking methods; Sheet materials for use therein
- B41M5/124—Duplicating or marking methods; Sheet materials for use therein using pressure to make a masked colour visible, e.g. to make a coloured support visible, to create an opaque or transparent pattern, or to form colour by uniting colour-forming components
- B41M5/132—Chemical colour-forming components; Additives or binders therefor
- B41M5/136—Organic colour formers, e.g. leuco dyes
Definitions
- the oil was added to an aqueous solution consisting of 10 parts of gum arabic and 60 parts of warm water at 40C to form an oil-in-water type emulsion having a drop size of 6-10 microns.
- 10 parts of an acid-treated gelatin having an isoelectric point of 7.8 was dissolved in 80 parts of warm water at 40C and added thereto. With constant agitation 50% acetic acid was added thereto to adjust the pH to 4.2. 250 parts of warm water at 40C was further added to cause coacervation. During the same time, a thickened liquid film of gelatin and gum arabic was formed round the oil drop.
Landscapes
- Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Color Printing (AREA)
- Photoreceptors In Electrophotography (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP45099983A JPS492127B1 (enExample) | 1970-11-13 | 1970-11-13 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| US3833400A true US3833400A (en) | 1974-09-03 |
Family
ID=14261883
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US00198316A Expired - Lifetime US3833400A (en) | 1970-11-13 | 1971-11-12 | Sheet with improved image durability |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3833400A (enExample) |
| JP (1) | JPS492127B1 (enExample) |
| DE (1) | DE2156371C3 (enExample) |
| ES (1) | ES396953A1 (enExample) |
| GB (1) | GB1356128A (enExample) |
| IE (1) | IE36769B1 (enExample) |
Cited By (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4828741A (en) * | 1986-12-30 | 1989-05-09 | Ciba-Geigy Corporation | N-substituted tetrahydroquinolines for use as antioxidants in lubricants |
| US4919832A (en) * | 1986-12-30 | 1990-04-24 | Ciba-Geigy Corporation | N-substituted tetrahydroquinolines for use as antioxidants in lubricants |
| US5053078A (en) * | 1986-12-02 | 1991-10-01 | Canon Kabushiki Kaisha | Ink and ink-jet recording process employing the same |
| US5391748A (en) * | 1992-12-10 | 1995-02-21 | Bayer Aktiengesellschaft | Dihydroquinolines |
| US5696133A (en) * | 1994-12-22 | 1997-12-09 | Ligand Pharmaceuticals Incorporated | Steroid receptor modulator compounds and methods |
| EP1031431A3 (en) * | 1999-02-23 | 2000-10-04 | Canon Kabushiki Kaisha | Recording medium, and image formation and print employing the medium |
| US6498191B2 (en) | 1998-01-26 | 2002-12-24 | Mitokor | Mitochondria protecting agents for treating mitochondria associated diseases |
| US6696459B1 (en) | 1994-12-22 | 2004-02-24 | Ligand Pharmaceuticals Inc. | Steroid receptor modulator compounds and methods |
| US10414697B2 (en) | 2015-02-25 | 2019-09-17 | Pb Clermont | Tocopherol stabilisers for nitrocellulose-based propellants |
| WO2023235855A1 (en) * | 2022-06-02 | 2023-12-07 | Flexsys America L.P. | Quinolineamine antidegradant compounds and uses thereof |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2398025A1 (fr) * | 1977-07-19 | 1979-02-16 | Blum Albert | Procede et dispositif pour introduire de l'air dans des liquides, en particulier pour l'aeration des eaux residuaires |
| GB201505874D0 (en) | 2015-04-07 | 2015-05-20 | Greener Bryan And Active Device Dev Ltd | Pressure imaging and indicating materials and devices |
Citations (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB190715204A (en) * | 1907-07-02 | 1908-07-02 | Thomas Richard Shillito | Manufacture of Blue Colouring Matters of the Triphenylmethane Series. |
| US3121650A (en) * | 1960-07-28 | 1964-02-18 | Minnesota Mining & Mfg | Right-reading reproduction of printed originals |
| US3293061A (en) * | 1963-11-21 | 1966-12-20 | Man Res Lab Inc | Primary amine modified secondary or tertiary amine-polyketo reaction product in a heat developable copy sheet |
| US3501331A (en) * | 1967-01-27 | 1970-03-17 | Fuji Photo Film Co Ltd | Pressure sensitive fluoran derivative containing copying paper |
| US3514310A (en) * | 1966-11-18 | 1970-05-26 | Fuji Photo Film Co Ltd | Pressure sensitive fluoran derivative copying paper |
| US3565666A (en) * | 1968-04-01 | 1971-02-23 | Ncr Co | Capsule-coated record sheet (with subcoat of latex) |
| US3642514A (en) * | 1970-04-27 | 1972-02-15 | Nisso Kako Co Ltd | Pressure-sensitive copying sheet utilizing stabilized crystal violet lactone, method of making and method of making composition |
| US3669711A (en) * | 1969-05-23 | 1972-06-13 | Fuji Photo Film Co Ltd | Pressure-sensitive copying paper |
-
1970
- 1970-11-13 JP JP45099983A patent/JPS492127B1/ja active Pending
-
1971
- 1971-11-12 GB GB5276671A patent/GB1356128A/en not_active Expired
- 1971-11-12 ES ES396953A patent/ES396953A1/es not_active Expired
- 1971-11-12 DE DE2156371A patent/DE2156371C3/de not_active Expired
- 1971-11-12 US US00198316A patent/US3833400A/en not_active Expired - Lifetime
- 1971-11-15 IE IE1435/71A patent/IE36769B1/xx unknown
Patent Citations (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB190715204A (en) * | 1907-07-02 | 1908-07-02 | Thomas Richard Shillito | Manufacture of Blue Colouring Matters of the Triphenylmethane Series. |
| US3121650A (en) * | 1960-07-28 | 1964-02-18 | Minnesota Mining & Mfg | Right-reading reproduction of printed originals |
| US3293061A (en) * | 1963-11-21 | 1966-12-20 | Man Res Lab Inc | Primary amine modified secondary or tertiary amine-polyketo reaction product in a heat developable copy sheet |
| US3514310A (en) * | 1966-11-18 | 1970-05-26 | Fuji Photo Film Co Ltd | Pressure sensitive fluoran derivative copying paper |
| US3501331A (en) * | 1967-01-27 | 1970-03-17 | Fuji Photo Film Co Ltd | Pressure sensitive fluoran derivative containing copying paper |
| US3565666A (en) * | 1968-04-01 | 1971-02-23 | Ncr Co | Capsule-coated record sheet (with subcoat of latex) |
| US3669711A (en) * | 1969-05-23 | 1972-06-13 | Fuji Photo Film Co Ltd | Pressure-sensitive copying paper |
| US3642514A (en) * | 1970-04-27 | 1972-02-15 | Nisso Kako Co Ltd | Pressure-sensitive copying sheet utilizing stabilized crystal violet lactone, method of making and method of making composition |
Cited By (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5053078A (en) * | 1986-12-02 | 1991-10-01 | Canon Kabushiki Kaisha | Ink and ink-jet recording process employing the same |
| US4828741A (en) * | 1986-12-30 | 1989-05-09 | Ciba-Geigy Corporation | N-substituted tetrahydroquinolines for use as antioxidants in lubricants |
| US4919832A (en) * | 1986-12-30 | 1990-04-24 | Ciba-Geigy Corporation | N-substituted tetrahydroquinolines for use as antioxidants in lubricants |
| US4929732A (en) * | 1986-12-30 | 1990-05-29 | Ciba-Geigy Corporation | N-substituted tetrahydroquinolines for use as antioxidants in lubricants |
| US4965006A (en) * | 1986-12-30 | 1990-10-23 | Ciba-Geigy Corporation | N-substituted tetrahydroquinolines for use as antioxidants in lubricants |
| US5391748A (en) * | 1992-12-10 | 1995-02-21 | Bayer Aktiengesellschaft | Dihydroquinolines |
| US6093821A (en) * | 1994-12-22 | 2000-07-25 | Ligand Pharmaceuticals Incorporated | Process for preparing steroid receptor modulator compounds |
| US5994544A (en) * | 1994-12-22 | 1999-11-30 | Ligand Pharmaceuticals Incorporated | Steroid receptor modulator compounds and methods |
| US5696133A (en) * | 1994-12-22 | 1997-12-09 | Ligand Pharmaceuticals Incorporated | Steroid receptor modulator compounds and methods |
| US6121450A (en) * | 1994-12-22 | 2000-09-19 | Ligand Pharmaceuticals Incorporated | Intermediates for preparation of steroid receptor modulator compounds |
| US6448405B1 (en) | 1994-12-22 | 2002-09-10 | Ligand Pharmaceuticals Incorporated | Steroid receptor modulator compounds and methods |
| US6696459B1 (en) | 1994-12-22 | 2004-02-24 | Ligand Pharmaceuticals Inc. | Steroid receptor modulator compounds and methods |
| US20040186132A1 (en) * | 1994-12-22 | 2004-09-23 | Jones Todd K. | Steroid receptor modulator compounds and methods |
| US6498191B2 (en) | 1998-01-26 | 2002-12-24 | Mitokor | Mitochondria protecting agents for treating mitochondria associated diseases |
| US6511966B2 (en) | 1998-01-26 | 2003-01-28 | Mitokor | Mitochondria protecting agents for treating mitochondria associated diseases |
| EP1031431A3 (en) * | 1999-02-23 | 2000-10-04 | Canon Kabushiki Kaisha | Recording medium, and image formation and print employing the medium |
| US6391440B1 (en) | 1999-02-23 | 2002-05-21 | Canon Kabushiki Kaisha | Recording medium and image formation and print employing the medium |
| US10414697B2 (en) | 2015-02-25 | 2019-09-17 | Pb Clermont | Tocopherol stabilisers for nitrocellulose-based propellants |
| WO2023235855A1 (en) * | 2022-06-02 | 2023-12-07 | Flexsys America L.P. | Quinolineamine antidegradant compounds and uses thereof |
Also Published As
| Publication number | Publication date |
|---|---|
| IE36769B1 (en) | 1977-02-16 |
| ES396953A1 (es) | 1974-07-01 |
| JPS492127B1 (enExample) | 1974-01-18 |
| DE2156371C3 (de) | 1979-08-23 |
| DE2156371A1 (de) | 1972-05-18 |
| GB1356128A (en) | 1974-06-12 |
| DE2156371B2 (de) | 1978-12-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3952129A (en) | Coated pressure sensitive copying paper | |
| US4101690A (en) | Desensitizing composition | |
| US3619238A (en) | Pressure sensitive copying paper | |
| US3833400A (en) | Sheet with improved image durability | |
| US3193404A (en) | Associated dye salts and method of forming colored indicia therewith | |
| US4027065A (en) | Pressure-sensitive record material | |
| US3952117A (en) | Method of desensitizing | |
| KR860000446B1 (ko) | 기록재료용 색소함유 마이크로 캡슐 현탁액 | |
| US4007310A (en) | Method of desensitization using desensitizing composition | |
| US3900217A (en) | Pressure-sensitive copying paper | |
| US4239815A (en) | Method of producing recording sheets | |
| DE2142173A1 (de) | Selbstklebendes Aufzeichnungspapier | |
| KR860000463B1 (ko) | 기록재료용 색소 함유 마이크로 캡슐 분산액 | |
| JPS6021875B2 (ja) | 記録材料 | |
| US4181328A (en) | Recording element | |
| US3773542A (en) | Sensitizing sheet for pressure- or heat-sensitive copying paper | |
| US4447075A (en) | Pressure-sensitive recording material | |
| US5053277A (en) | Microcapsules and their production | |
| JPS6333478B2 (enExample) | ||
| JPS58222880A (ja) | 感圧記録用顕色層 | |
| JPH0553634B2 (enExample) | ||
| US4840927A (en) | Desensitizer composition | |
| US4792543A (en) | Pressure-sensitive recording sheet | |
| US5013708A (en) | Pressure-sensitive recording sheet and coating material therefor | |
| US4791094A (en) | Recording sheet |