TW382618B - Process of producing sulfuric acid - Google Patents
Process of producing sulfuric acid Download PDFInfo
- Publication number
- TW382618B TW382618B TW086109289A TW86109289A TW382618B TW 382618 B TW382618 B TW 382618B TW 086109289 A TW086109289 A TW 086109289A TW 86109289 A TW86109289 A TW 86109289A TW 382618 B TW382618 B TW 382618B
- Authority
- TW
- Taiwan
- Prior art keywords
- condenser
- sulfuric acid
- gas mixture
- temperature
- patent application
- Prior art date
Links
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 title claims abstract description 75
- 238000000034 method Methods 0.000 title claims abstract description 11
- 239000000203 mixture Substances 0.000 claims abstract description 37
- 239000012809 cooling fluid Substances 0.000 claims abstract description 15
- 230000003647 oxidation Effects 0.000 claims abstract description 8
- 238000007254 oxidation reaction Methods 0.000 claims abstract description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 12
- 239000007788 liquid Substances 0.000 claims description 8
- 238000004519 manufacturing process Methods 0.000 claims description 8
- 238000001816 cooling Methods 0.000 claims description 6
- 230000002079 cooperative effect Effects 0.000 claims description 5
- 239000012717 electrostatic precipitator Substances 0.000 claims description 4
- PCTMTFRHKVHKIS-BMFZQQSSSA-N (1s,3r,4e,6e,8e,10e,12e,14e,16e,18s,19r,20r,21s,25r,27r,30r,31r,33s,35r,37s,38r)-3-[(2r,3s,4s,5s,6r)-4-amino-3,5-dihydroxy-6-methyloxan-2-yl]oxy-19,25,27,30,31,33,35,37-octahydroxy-18,20,21-trimethyl-23-oxo-22,39-dioxabicyclo[33.3.1]nonatriaconta-4,6,8,10 Chemical compound C1C=C2C[C@@H](OS(O)(=O)=O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC2.O[C@H]1[C@@H](N)[C@H](O)[C@@H](C)O[C@H]1O[C@H]1/C=C/C=C/C=C/C=C/C=C/C=C/C=C/[C@H](C)[C@@H](O)[C@@H](C)[C@H](C)OC(=O)C[C@H](O)C[C@H](O)CC[C@@H](O)[C@H](O)C[C@H](O)C[C@](O)(C[C@H](O)[C@H]2C(O)=O)O[C@H]2C1 PCTMTFRHKVHKIS-BMFZQQSSSA-N 0.000 claims 2
- 230000015572 biosynthetic process Effects 0.000 claims 2
- 230000003197 catalytic effect Effects 0.000 abstract description 2
- 239000007789 gas Substances 0.000 description 49
- 229920006395 saturated elastomer Polymers 0.000 description 7
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 3
- 238000010521 absorption reaction Methods 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 238000011049 filling Methods 0.000 description 3
- 229910052717 sulfur Inorganic materials 0.000 description 3
- 239000011593 sulfur Substances 0.000 description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 238000002485 combustion reaction Methods 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 238000005245 sintering Methods 0.000 description 2
- 235000011149 sulphuric acid Nutrition 0.000 description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 239000003708 ampul Substances 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000002826 coolant Substances 0.000 description 1
- 239000000498 cooling water Substances 0.000 description 1
- 238000006477 desulfuration reaction Methods 0.000 description 1
- 230000023556 desulfurization Effects 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 description 1
- 239000010931 gold Substances 0.000 description 1
- 229910052737 gold Inorganic materials 0.000 description 1
- 239000008267 milk Substances 0.000 description 1
- 210000004080 milk Anatomy 0.000 description 1
- 235000013336 milk Nutrition 0.000 description 1
- 239000003595 mist Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 238000005201 scrubbing Methods 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 230000003068 static effect Effects 0.000 description 1
- 239000001117 sulphuric acid Substances 0.000 description 1
- 230000001960 triggered effect Effects 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01B—NON-METALLIC ELEMENTS; COMPOUNDS THEREOF; METALLOIDS OR COMPOUNDS THEREOF NOT COVERED BY SUBCLASS C01C
- C01B17/00—Sulfur; Compounds thereof
- C01B17/69—Sulfur trioxide; Sulfuric acid
- C01B17/74—Preparation
- C01B17/76—Preparation by contact processes
- C01B17/775—Liquid phase contacting processes or wet catalysis processes
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Inorganic Chemistry (AREA)
- Treating Waste Gases (AREA)
- Catalysts (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19628169A DE19628169A1 (de) | 1996-07-12 | 1996-07-12 | Verfahren zum Herstellen von Schwefelsäure |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| TW382618B true TW382618B (en) | 2000-02-21 |
Family
ID=7799676
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| TW086109289A TW382618B (en) | 1996-07-12 | 1997-07-01 | Process of producing sulfuric acid |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US6153168A (enExample) |
| EP (1) | EP0914293B1 (enExample) |
| KR (1) | KR100485866B1 (enExample) |
| AU (1) | AU722431B2 (enExample) |
| BR (1) | BR9710305A (enExample) |
| CA (1) | CA2259939C (enExample) |
| DE (2) | DE19628169A1 (enExample) |
| ES (1) | ES2146477T3 (enExample) |
| IN (1) | IN191895B (enExample) |
| TW (1) | TW382618B (enExample) |
| WO (1) | WO1998002380A1 (enExample) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EA005279B1 (ru) | 2000-07-25 | 2004-12-30 | Фелпс Додж Корпорейшн | Обработка содержащих элементарную серу материалов с использованием высокотемпературного автоклавного выщелачивания для производства серной кислоты и извлечения металла |
| US6955075B2 (en) * | 2002-11-04 | 2005-10-18 | Westinghouse Savannah River Co., Llc | Portable liquid collection electrostatic precipitator |
| DE102004012293B4 (de) * | 2004-03-12 | 2016-09-08 | Outotec Oyj | Verfahren und Anlage zur Herstellung von Schwefelsäure |
| DE102005008109A1 (de) * | 2005-02-21 | 2006-08-24 | Outokumpu Technology Oy | Verfahren und Anlage zur Herstellung von Schwefelsäure |
| US7361326B2 (en) * | 2005-11-15 | 2008-04-22 | Haldor Topsoe A/S | Process for the production of sulfuric acid |
| US8883106B2 (en) * | 2008-09-05 | 2014-11-11 | Alstom Technology Ltd | Method and a device for removing nitrogen oxides and sulphur trioxide from a process gas |
| EP2163515B1 (en) * | 2008-09-12 | 2015-03-25 | Haldor Topsoe A/S | Process for the production of sulphuric acid |
| CN105174231A (zh) * | 2015-08-25 | 2015-12-23 | 王卓 | 一种稀硫酸的浓缩和提纯工艺 |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE607216C (de) * | 1932-11-20 | 1934-12-19 | Metallgesellschaft Ag | Gewinnung von Schwefelsaeure durch Kondensation |
| DE1792015A1 (de) * | 1968-07-11 | 1971-10-21 | Metallgesellschaft Ag | Verfahren zur katalytischen Umsetzung von SO2 zu SO3 und Schwefelsaeureherstellung |
| ZA713248B (en) * | 1970-06-02 | 1972-01-26 | Bayer Ag | Catalytic oxidation of so2 to so3 |
| BE792061A (fr) * | 1971-12-02 | 1973-05-29 | Bayer Ag | Production d'anhydride sulfurique et d'acide sulfurique |
| DE2519928C3 (de) * | 1975-05-05 | 1981-04-02 | Metallgesellschaft Ag, 6000 Frankfurt | Verfahren zur Herstellung von Schwefelsäure |
| DE2945021A1 (de) * | 1979-11-08 | 1981-05-21 | Metallgesellschaft Ag, 6000 Frankfurt | Verfahren zur herstellung von konzentrierter schwefelsaeure |
| DE3109847A1 (de) * | 1981-03-07 | 1982-09-23 | Metallgesellschaft Ag, 6000 Frankfurt | Verfahren zum erzeugen eines so 3 -haltigen gases fuer die abgasreinigung im elektrofilter |
| KR890001483B1 (ko) * | 1981-03-07 | 1989-05-04 | 메탈게젤샤후트 아크치엔게젤샤후트 | So₃함유 가스의 제조방법 |
| DE3232446A1 (de) * | 1982-08-12 | 1984-02-16 | Metallgesellschaft Ag, 6000 Frankfurt | Verfahren zur herstellung von schwefelsaeure |
| US5118490A (en) * | 1989-06-21 | 1992-06-02 | Monsanto Company | Absorption of wet conversion gas |
| CA2075069C (en) * | 1990-03-23 | 1999-07-27 | Donald Ray Mcalister | Methods for recovering high grade process energy from a contact sulfuricacid process |
| DE19522927B4 (de) * | 1995-06-23 | 2006-05-24 | Outokumpu Oyj | Verfahren zur Herstellung von konzentrierter Schwefelsäure |
-
1996
- 1996-07-12 DE DE19628169A patent/DE19628169A1/de not_active Withdrawn
-
1997
- 1997-06-11 IN IN1103CA1997 patent/IN191895B/en unknown
- 1997-07-01 TW TW086109289A patent/TW382618B/zh not_active IP Right Cessation
- 1997-07-03 ES ES97931763T patent/ES2146477T3/es not_active Expired - Lifetime
- 1997-07-03 CA CA002259939A patent/CA2259939C/en not_active Expired - Lifetime
- 1997-07-03 EP EP97931763A patent/EP0914293B1/de not_active Expired - Lifetime
- 1997-07-03 US US09/214,776 patent/US6153168A/en not_active Expired - Lifetime
- 1997-07-03 KR KR10-1999-7000159A patent/KR100485866B1/ko not_active Expired - Fee Related
- 1997-07-03 WO PCT/EP1997/003520 patent/WO1998002380A1/de not_active Ceased
- 1997-07-03 BR BR9710305A patent/BR9710305A/pt not_active IP Right Cessation
- 1997-07-03 DE DE59701328T patent/DE59701328D1/de not_active Expired - Lifetime
- 1997-07-03 AU AU35408/97A patent/AU722431B2/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| CA2259939C (en) | 2005-09-13 |
| WO1998002380A1 (de) | 1998-01-22 |
| DE19628169A1 (de) | 1998-01-15 |
| ES2146477T3 (es) | 2000-08-01 |
| BR9710305A (pt) | 1999-08-17 |
| AU3540897A (en) | 1998-02-09 |
| CA2259939A1 (en) | 1998-01-22 |
| KR100485866B1 (ko) | 2005-04-28 |
| US6153168A (en) | 2000-11-28 |
| EP0914293A1 (de) | 1999-05-12 |
| DE59701328D1 (de) | 2000-04-27 |
| KR20000023700A (ko) | 2000-04-25 |
| IN191895B (enExample) | 2004-01-10 |
| AU722431B2 (en) | 2000-08-03 |
| EP0914293B1 (de) | 2000-03-22 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA2678416C (en) | Process for the production of sulphuric acid | |
| CA2387988A1 (en) | Method for making sulfur trioxide, sulfuric acid, and oleum from sulfur dioxide | |
| JP4202451B2 (ja) | 硫酸を濃縮する方法 | |
| TW382618B (en) | Process of producing sulfuric acid | |
| JPH07509649A (ja) | 廃ガスの脱硫 | |
| US7595035B2 (en) | Process for the recovery of sulfuric acid | |
| US3101996A (en) | Process for removal of acid gas from gas streams | |
| US3170766A (en) | Sulfur recovery apparatus | |
| US3172725A (en) | Production of sulfuric acid | |
| US4140751A (en) | Process for pressure stripping of sulfur dioxide from buffered solutions | |
| US3825657A (en) | Process for the cracking of sulfuric acid | |
| CN101626977A (zh) | 硫酸制造方法 | |
| US20110311433A1 (en) | Process and system for production of concentrated sulphuric acid from off-gas | |
| ES2818997T3 (es) | Procedimiento para la producción de ácido sulfúrico concentrado a partir de gas liberado | |
| US3959451A (en) | Recovery of sulfur dioxide from gas mixtures | |
| EP1899042A1 (en) | Treatment of fuel gas | |
| US3980759A (en) | Recovery of sulfur dioxide from gas mixtures | |
| US3519388A (en) | Production of sulfuric acid | |
| US3980760A (en) | Recovery of sulfur dioxide from gas mixtures | |
| US3475119A (en) | Production of sulphuric acid | |
| US3989809A (en) | Process for the recovery of sulfur | |
| US4769048A (en) | Regeneration of a scrubbing agent | |
| US2588331A (en) | Recovery of alkylation sludge acids | |
| CA1115933A (en) | Process for pressure stripping of sulfur dioxide from buffered solutions | |
| CA1075443A (en) | Recovery of sulfur dioxide from gas mixtures |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| GD4A | Issue of patent certificate for granted invention patent | ||
| MK4A | Expiration of patent term of an invention patent |