SU618033A3 - Способ получени диацетанов бутен2-диолов - Google Patents
Способ получени диацетанов бутен2-диоловInfo
- Publication number
- SU618033A3 SU618033A3 SU752128753A SU2128753A SU618033A3 SU 618033 A3 SU618033 A3 SU 618033A3 SU 752128753 A SU752128753 A SU 752128753A SU 2128753 A SU2128753 A SU 2128753A SU 618033 A3 SU618033 A3 SU 618033A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- diacetates
- acetic acid
- butene
- butadiene
- carried out
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 10
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 27
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 claims description 18
- 239000003054 catalyst Substances 0.000 claims description 8
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 claims description 6
- 239000007789 gas Substances 0.000 claims description 6
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 5
- 229910052760 oxygen Inorganic materials 0.000 claims description 5
- 239000001301 oxygen Substances 0.000 claims description 5
- 229910052787 antimony Inorganic materials 0.000 claims description 4
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 claims description 4
- 229910052714 tellurium Inorganic materials 0.000 claims description 4
- PORWMNRCUJJQNO-UHFFFAOYSA-N tellurium atom Chemical compound [Te] PORWMNRCUJJQNO-UHFFFAOYSA-N 0.000 claims description 4
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims description 3
- BUGBHKTXTAQXES-UHFFFAOYSA-N Selenium Chemical compound [Se] BUGBHKTXTAQXES-UHFFFAOYSA-N 0.000 claims description 3
- 229910052763 palladium Inorganic materials 0.000 claims description 3
- 229910052698 phosphorus Inorganic materials 0.000 claims description 3
- 239000011574 phosphorus Substances 0.000 claims description 3
- 229910052711 selenium Inorganic materials 0.000 claims description 3
- 239000011669 selenium Substances 0.000 claims description 3
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 claims description 2
- 229910002091 carbon monoxide Inorganic materials 0.000 claims description 2
- -1 mine Chemical compound 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims 1
- 239000007858 starting material Substances 0.000 claims 1
- 239000000203 mixture Substances 0.000 description 10
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- 229910052785 arsenic Inorganic materials 0.000 description 3
- RQNWIZPPADIBDY-UHFFFAOYSA-N arsenic atom Chemical compound [As] RQNWIZPPADIBDY-UHFFFAOYSA-N 0.000 description 3
- 229910052797 bismuth Inorganic materials 0.000 description 3
- JCXGWMGPZLAOME-UHFFFAOYSA-N bismuth atom Chemical compound [Bi] JCXGWMGPZLAOME-UHFFFAOYSA-N 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- CPLXHLVBOLITMK-UHFFFAOYSA-N Magnesium oxide Chemical compound [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 150000002941 palladium compounds Chemical class 0.000 description 2
- PIBWKRNGBLPSSY-UHFFFAOYSA-L palladium(II) chloride Chemical compound Cl[Pd]Cl PIBWKRNGBLPSSY-UHFFFAOYSA-L 0.000 description 2
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- SLVOVFVZZFUEAS-UHFFFAOYSA-N 2-[2-[2-[bis(carboxymethyl)amino]ethoxy]ethyl-(carboxymethyl)amino]acetic acid Chemical compound OC(=O)CN(CC(O)=O)CCOCCN(CC(O)=O)CC(O)=O SLVOVFVZZFUEAS-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- UEZVMMHDMIWARA-UHFFFAOYSA-N Metaphosphoric acid Chemical compound OP(=O)=O UEZVMMHDMIWARA-UHFFFAOYSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 229910001570 bauxite Inorganic materials 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 229910052570 clay Inorganic materials 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000004508 fractional distillation Methods 0.000 description 1
- 239000008246 gaseous mixture Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 150000002823 nitrates Chemical class 0.000 description 1
- HBEQXAKJSGXAIQ-UHFFFAOYSA-N oxopalladium Chemical class [Pd]=O HBEQXAKJSGXAIQ-UHFFFAOYSA-N 0.000 description 1
- YJVFFLUZDVXJQI-UHFFFAOYSA-L palladium(ii) acetate Chemical compound [Pd+2].CC([O-])=O.CC([O-])=O YJVFFLUZDVXJQI-UHFFFAOYSA-L 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 150000003018 phosphorus compounds Chemical class 0.000 description 1
- 235000011056 potassium acetate Nutrition 0.000 description 1
- 239000008262 pumice Substances 0.000 description 1
- 230000008929 regeneration Effects 0.000 description 1
- 238000011069 regeneration method Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 229940065287 selenium compound Drugs 0.000 description 1
- 150000003343 selenium compounds Chemical class 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- LAJZODKXOMJMPK-UHFFFAOYSA-N tellurium dioxide Chemical compound O=[Te]=O LAJZODKXOMJMPK-UHFFFAOYSA-N 0.000 description 1
- 239000005341 toughened glass Substances 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C67/00—Preparation of carboxylic acid esters
- C07C67/04—Preparation of carboxylic acid esters by reacting carboxylic acids or symmetrical anhydrides onto unsaturated carbon-to-carbon bonds
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C67/00—Preparation of carboxylic acid esters
- C07C67/04—Preparation of carboxylic acid esters by reacting carboxylic acids or symmetrical anhydrides onto unsaturated carbon-to-carbon bonds
- C07C67/05—Preparation of carboxylic acid esters by reacting carboxylic acids or symmetrical anhydrides onto unsaturated carbon-to-carbon bonds with oxidation
- C07C67/055—Preparation of carboxylic acid esters by reacting carboxylic acids or symmetrical anhydrides onto unsaturated carbon-to-carbon bonds with oxidation in the presence of platinum group metals or their compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Catalysts (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2421408A DE2421408A1 (de) | 1974-05-03 | 1974-05-03 | Verfahren zur herstellung von butendioldiacetaten |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU618033A3 true SU618033A3 (ru) | 1978-07-30 |
Family
ID=5914573
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU752128753A SU618033A3 (ru) | 1974-05-03 | 1975-04-30 | Способ получени диацетанов бутен2-диолов |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US4038307A (enExample) |
| JP (1) | JPS50154204A (enExample) |
| AT (1) | AT339872B (enExample) |
| BE (1) | BE828588A (enExample) |
| CA (1) | CA1061361A (enExample) |
| DE (1) | DE2421408A1 (enExample) |
| FR (1) | FR2269518B3 (enExample) |
| GB (1) | GB1501004A (enExample) |
| IT (1) | IT1037825B (enExample) |
| NL (1) | NL7505032A (enExample) |
| SU (1) | SU618033A3 (enExample) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4160115A (en) | 1977-09-22 | 1979-07-03 | Imperial Chemical Industries Limited | Process for the manufacture of butenediol |
| US4121039A (en) * | 1977-09-26 | 1978-10-17 | Gaf Corporation | Process for producing an unsaturated glycol diester using a catalyst comprising palladium containing thorium as a promotor |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS4827290B1 (enExample) * | 1969-03-18 | 1973-08-21 | ||
| DE2217452C3 (de) * | 1971-04-17 | 1978-03-16 | Mitsubishi Chemical Industries, Ltd., Tokio | Verfahren zur Herstellung von 1,4-Diacyloxybuten-(2) |
| JPS5212686B2 (enExample) * | 1973-05-22 | 1977-04-08 |
-
1974
- 1974-05-03 DE DE2421408A patent/DE2421408A1/de not_active Withdrawn
-
1975
- 1975-04-28 FR FR7513199A patent/FR2269518B3/fr not_active Expired
- 1975-04-28 NL NL7505032A patent/NL7505032A/xx not_active Application Discontinuation
- 1975-04-28 US US05/572,133 patent/US4038307A/en not_active Expired - Lifetime
- 1975-04-30 BE BE155950A patent/BE828588A/xx unknown
- 1975-04-30 CA CA225,888A patent/CA1061361A/en not_active Expired
- 1975-04-30 SU SU752128753A patent/SU618033A3/ru active
- 1975-05-02 GB GB18368/75A patent/GB1501004A/en not_active Expired
- 1975-05-02 AT AT338975A patent/AT339872B/de not_active IP Right Cessation
- 1975-05-02 IT IT22974/75A patent/IT1037825B/it active
- 1975-05-06 JP JP50053284A patent/JPS50154204A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| JPS50154204A (enExample) | 1975-12-12 |
| FR2269518B3 (enExample) | 1978-11-10 |
| US4038307A (en) | 1977-07-26 |
| DE2421408A1 (de) | 1975-11-13 |
| BE828588A (fr) | 1975-10-30 |
| GB1501004A (en) | 1978-02-15 |
| ATA338975A (de) | 1977-03-15 |
| AT339872B (de) | 1977-11-10 |
| NL7505032A (nl) | 1975-11-05 |
| IT1037825B (it) | 1979-11-20 |
| FR2269518A1 (enExample) | 1975-11-28 |
| CA1061361A (en) | 1979-08-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| Fisher et al. | Effects of zirconia promotion on the activity of Cu/SiO2 for methanol synthesis from CO/H2 and CO2/H2 | |
| RU2437871C2 (ru) | Способ уменьшения концентрации альдегида в целевом потоке | |
| US3689533A (en) | Production of carboxylic acids and esters | |
| EP0046598A1 (en) | Process for continuously preparing a diester of oxalic acid | |
| SU618033A3 (ru) | Способ получени диацетанов бутен2-диолов | |
| CA1103271A (en) | Process for producing an unsaturated glycol diester using a catalyst comprising palladium containing thorium as a promotor | |
| RU2315033C2 (ru) | Способ получения алкенилкарбоксилата (варианты) или алкилкарбоксилата | |
| US3792086A (en) | Process for the preparation of acrylic and methacrylic acids | |
| US4467109A (en) | Process for continuous preparation of diester of oxalic acid | |
| JPS6015609B2 (ja) | 不飽和カルボン酸エステルの製造方法 | |
| US4507494A (en) | Process for the production of a diester of oxalic acid | |
| US5177254A (en) | Method for producing an unsaturated glycol diester | |
| US3658888A (en) | Process for preparing vinyl acetate | |
| JPS6113689B2 (enExample) | ||
| US3758551A (en) | Process for the preparation of acrylate and methacrylate esters | |
| JP2519976B2 (ja) | 含酸素化合物の製造方法 | |
| JPS5929054B2 (ja) | 「さく」酸ビニルの製法 | |
| US3547983A (en) | Preparation of unsaturated esters | |
| CA1055519A (en) | Manufacture of butenediol diacetates | |
| US3766179A (en) | Cyclization process | |
| KR910003426B1 (ko) | 옥살산의 디에스테르의 제조방법 | |
| JPH0242815B2 (enExample) | ||
| JPH0625104A (ja) | 炭酸ジメチルの連続的製法 | |
| JPS5926611B2 (ja) | 無水酢酸の製造方法 | |
| US3965155A (en) | Process for preparing vinyl esters of carboxylic acids |