SU611590A3 - Способ получени производных бензо -пирона или их солей - Google Patents
Способ получени производных бензо -пирона или их солейInfo
- Publication number
- SU611590A3 SU611590A3 SU742098258A SU2098258A SU611590A3 SU 611590 A3 SU611590 A3 SU 611590A3 SU 742098258 A SU742098258 A SU 742098258A SU 2098258 A SU2098258 A SU 2098258A SU 611590 A3 SU611590 A3 SU 611590A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- carboxy
- group
- chromone
- flavone
- square
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 19
- 150000003839 salts Chemical class 0.000 title claims description 4
- -1 2-isopropoxyflavone-hydrochloride Chemical compound 0.000 claims description 101
- 150000001875 compounds Chemical class 0.000 claims description 38
- 239000002244 precipitate Substances 0.000 claims description 26
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 claims description 25
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 claims description 21
- GAMYVSCDDLXAQW-AOIWZFSPSA-N Thermopsosid Natural products O(C)c1c(O)ccc(C=2Oc3c(c(O)cc(O[C@H]4[C@H](O)[C@@H](O)[C@H](O)[C@H](CO)O4)c3)C(=O)C=2)c1 GAMYVSCDDLXAQW-AOIWZFSPSA-N 0.000 claims description 18
- 229930003944 flavone Natural products 0.000 claims description 18
- 235000011949 flavones Nutrition 0.000 claims description 18
- VHBFFQKBGNRLFZ-UHFFFAOYSA-N vitamin p Natural products O1C2=CC=CC=C2C(=O)C=C1C1=CC=CC=C1 VHBFFQKBGNRLFZ-UHFFFAOYSA-N 0.000 claims description 18
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 14
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 13
- 238000001914 filtration Methods 0.000 claims description 13
- 239000002253 acid Substances 0.000 claims description 12
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 9
- 239000000047 product Substances 0.000 claims description 9
- 150000002148 esters Chemical class 0.000 claims description 8
- 150000002212 flavone derivatives Chemical class 0.000 claims description 7
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 7
- 229910052757 nitrogen Inorganic materials 0.000 claims description 6
- URZKEHHDMLOHJU-UHFFFAOYSA-N 4-oxo-2-phenyl-2-propan-2-yloxy-3h-chromene-6-carboxylic acid Chemical compound C1C(=O)C2=CC(C(O)=O)=CC=C2OC1(OC(C)C)C1=CC=CC=C1 URZKEHHDMLOHJU-UHFFFAOYSA-N 0.000 claims description 5
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 5
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical compound BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 3
- 125000002883 imidazolyl group Chemical group 0.000 claims description 3
- 125000003373 pyrazinyl group Chemical group 0.000 claims description 3
- 125000004076 pyridyl group Chemical group 0.000 claims description 3
- ZWQMQNRKCRVLHW-UHFFFAOYSA-N 4-oxo-2-phenylchromene-6-carboxylic acid Chemical class C=1C(=O)C2=CC(C(=O)O)=CC=C2OC=1C1=CC=CC=C1 ZWQMQNRKCRVLHW-UHFFFAOYSA-N 0.000 claims description 2
- OHCNSTOLJWDQMJ-UHFFFAOYSA-N 4-oxo-2-phenylchromene-7-carboxylic acid Chemical compound C=1C(C(=O)O)=CC=C(C(C=2)=O)C=1OC=2C1=CC=CC=C1 OHCNSTOLJWDQMJ-UHFFFAOYSA-N 0.000 claims description 2
- 238000009835 boiling Methods 0.000 claims description 2
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- ZYGHJZDHTFUPRJ-UHFFFAOYSA-N coumarin Chemical group C1=CC=C2OC(=O)C=CC2=C1 ZYGHJZDHTFUPRJ-UHFFFAOYSA-N 0.000 claims description 2
- 125000002541 furyl group Chemical group 0.000 claims description 2
- 238000010438 heat treatment Methods 0.000 claims description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 2
- 239000012429 reaction media Substances 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims 10
- 125000003545 alkoxy group Chemical group 0.000 claims 7
- 125000004432 carbon atom Chemical group C* 0.000 claims 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 4
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 claims 3
- 229910052740 iodine Inorganic materials 0.000 claims 3
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 claims 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 claims 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 claims 2
- 229910052739 hydrogen Inorganic materials 0.000 claims 2
- 239000001257 hydrogen Substances 0.000 claims 2
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 claims 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims 2
- 229910052760 oxygen Inorganic materials 0.000 claims 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 claims 2
- MVXXQYNUNXJABR-UHFFFAOYSA-N 2,2-dimethylpropanoyloxymethyl 3-acetyl-4-hydroxybenzoate Chemical compound C(C)(=O)C=1C=C(C(=O)OCOC(C(C)(C)C)=O)C=CC=1O MVXXQYNUNXJABR-UHFFFAOYSA-N 0.000 claims 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims 1
- ZPSJGADGUYYRKE-UHFFFAOYSA-N 2H-pyran-2-one Chemical class O=C1C=CC=CO1 ZPSJGADGUYYRKE-UHFFFAOYSA-N 0.000 claims 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 claims 1
- MZVQCMJNVPIDEA-UHFFFAOYSA-N [CH2]CN(CC)CC Chemical group [CH2]CN(CC)CC MZVQCMJNVPIDEA-UHFFFAOYSA-N 0.000 claims 1
- 125000003342 alkenyl group Chemical group 0.000 claims 1
- 239000000460 chlorine Substances 0.000 claims 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 claims 1
- 239000007789 gas Substances 0.000 claims 1
- 229910052736 halogen Inorganic materials 0.000 claims 1
- 125000005843 halogen group Chemical group 0.000 claims 1
- 150000002367 halogens Chemical class 0.000 claims 1
- 150000002391 heterocyclic compounds Chemical class 0.000 claims 1
- 239000011976 maleic acid Substances 0.000 claims 1
- 150000002688 maleic acid derivatives Chemical class 0.000 claims 1
- TWIIRMSFZNYMQE-UHFFFAOYSA-N methyl pyrazine-2-carboxylate Chemical compound COC(=O)C1=CN=CC=N1 TWIIRMSFZNYMQE-UHFFFAOYSA-N 0.000 claims 1
- 125000004433 nitrogen atom Chemical group N* 0.000 claims 1
- 229910000029 sodium carbonate Inorganic materials 0.000 claims 1
- 125000001424 substituent group Chemical group 0.000 claims 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 56
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 42
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 37
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 24
- 239000000243 solution Substances 0.000 description 22
- 238000001816 cooling Methods 0.000 description 18
- 238000010992 reflux Methods 0.000 description 16
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 14
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 14
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 13
- 239000000203 mixture Substances 0.000 description 13
- OTAFHZMPRISVEM-UHFFFAOYSA-N chromone Chemical compound C1=CC=C2C(=O)C=COC2=C1 OTAFHZMPRISVEM-UHFFFAOYSA-N 0.000 description 12
- 238000002329 infrared spectrum Methods 0.000 description 11
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 10
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 10
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 9
- 238000002425 crystallisation Methods 0.000 description 9
- 230000008025 crystallization Effects 0.000 description 9
- 238000000354 decomposition reaction Methods 0.000 description 9
- 238000007865 diluting Methods 0.000 description 9
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 8
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 8
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 7
- 235000019253 formic acid Nutrition 0.000 description 7
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- 238000010790 dilution Methods 0.000 description 6
- 239000012895 dilution Substances 0.000 description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N pyridine Substances C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- 239000012074 organic phase Substances 0.000 description 5
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 5
- 235000017557 sodium bicarbonate Nutrition 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 4
- 229910052804 chromium Inorganic materials 0.000 description 4
- 239000011651 chromium Substances 0.000 description 4
- 230000020477 pH reduction Effects 0.000 description 4
- 229910000027 potassium carbonate Inorganic materials 0.000 description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- 229920002554 vinyl polymer Polymers 0.000 description 4
- BJXHFKRXQUJFIN-UHFFFAOYSA-N 2-(2-hydroxypropoxy)-4-oxo-2-phenyl-3H-chromene-6-carboxylic acid Chemical compound C(=O)(O)C=1C=C2C(CC(OC2=CC=1)(C1=CC=CC=C1)OCC(C)O)=O BJXHFKRXQUJFIN-UHFFFAOYSA-N 0.000 description 3
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 239000003208 petroleum Substances 0.000 description 3
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- FVEDLNFRVMHBDA-UHFFFAOYSA-N CCOC(=O)C1=CC2=C(C=C1)OC(CC2=O)(C3=CC=CC=C3)OC(C)C Chemical compound CCOC(=O)C1=CC2=C(C=C1)OC(CC2=O)(C3=CC=CC=C3)OC(C)C FVEDLNFRVMHBDA-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- MYTMXVHNEWBFAL-UHFFFAOYSA-L dipotassium;carbonate;hydrate Chemical compound O.[K+].[K+].[O-]C([O-])=O MYTMXVHNEWBFAL-UHFFFAOYSA-L 0.000 description 2
- RDAALIJZJHPRRP-UHFFFAOYSA-N methyl 2-propan-2-yloxybenzoate Chemical compound COC(=O)C1=CC=CC=C1OC(C)C RDAALIJZJHPRRP-UHFFFAOYSA-N 0.000 description 2
- FPYAQSSSRQZXMS-UHFFFAOYSA-N methyl 3-acetyl-4-hydroxybenzoate Chemical compound COC(=O)C1=CC=C(O)C(C(C)=O)=C1 FPYAQSSSRQZXMS-UHFFFAOYSA-N 0.000 description 2
- 230000003472 neutralizing effect Effects 0.000 description 2
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 2
- 150000003222 pyridines Chemical class 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- 150000003536 tetrazoles Chemical class 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 2
- KQLANERTLLUWGH-UHFFFAOYSA-N 2-(1h-imidazol-2-yl)-4-oxochromene-6-carboxylic acid Chemical compound C=1C(=O)C2=CC(C(=O)O)=CC=C2OC=1C1=NC=CN1 KQLANERTLLUWGH-UHFFFAOYSA-N 0.000 description 1
- LSTAHPMLLDYWKN-UHFFFAOYSA-N 2-(2-phenylethenyl)chromen-4-one Chemical compound O1C2=CC=CC=C2C(=O)C=C1C=CC1=CC=CC=C1 LSTAHPMLLDYWKN-UHFFFAOYSA-N 0.000 description 1
- KKFDCBRMNNSAAW-UHFFFAOYSA-N 2-(morpholin-4-yl)ethanol Chemical compound OCCN1CCOCC1 KKFDCBRMNNSAAW-UHFFFAOYSA-N 0.000 description 1
- VPSXHKGJZJCWLV-UHFFFAOYSA-N 2-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]-3-(1-ethylpiperidin-4-yl)oxypyrazol-1-yl]-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C=1C(=NN(C=1)CC(=O)N1CC2=C(CC1)NN=N2)OC1CCN(CC1)CC VPSXHKGJZJCWLV-UHFFFAOYSA-N 0.000 description 1
- GJVDYPVZKAYDQI-UHFFFAOYSA-N 2-phenyl-3-propan-2-yloxychromen-4-one Chemical compound C(C)(C)OC1=C(OC2=CC=CC=C2C1=O)C1=CC=CC=C1 GJVDYPVZKAYDQI-UHFFFAOYSA-N 0.000 description 1
- ACMZJMPKGUUSOJ-UHFFFAOYSA-N 2-pyridin-3-ylchromen-4-one Chemical compound O1C2=CC=CC=C2C(=O)C=C1C1=CC=CN=C1 ACMZJMPKGUUSOJ-UHFFFAOYSA-N 0.000 description 1
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- UWGVMPXQULQQMP-UHFFFAOYSA-N 3-[3-(4-fluorophenyl)-3-oxopropanoyl]-4-hydroxybenzoic acid Chemical compound OC1=C(C(=O)CC(C2=CC=C(C=C2)F)=O)C=C(C=C1)C(=O)O UWGVMPXQULQQMP-UHFFFAOYSA-N 0.000 description 1
- 125000001331 3-methylbutoxy group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])O* 0.000 description 1
- KNSPZJBQWIGKBI-UHFFFAOYSA-N 4-hydroxy-3-(3-oxo-3-pyrazin-2-ylpropanoyl)benzoic acid Chemical compound OC1=C(C(=O)CC(=O)C2=NC=CN=C2)C=C(C=C1)C(=O)O KNSPZJBQWIGKBI-UHFFFAOYSA-N 0.000 description 1
- GWZBOGOEJSMFIS-UHFFFAOYSA-N 4-hydroxy-3-[3-oxo-3-(2-propan-2-yloxyphenyl)propanoyl]benzoic acid Chemical compound OC1=C(C(=O)CC(C2=C(C=CC=C2)OC(C)C)=O)C=C(C=C1)C(=O)O GWZBOGOEJSMFIS-UHFFFAOYSA-N 0.000 description 1
- VYWUCVAGGWRNTJ-UHFFFAOYSA-N 4-oxo-2-(2-phenylethenyl)chromene-7-carboxylic acid Chemical compound C=1C(C(=O)O)=CC=C(C(C=2)=O)C=1OC=2C=CC1=CC=CC=C1 VYWUCVAGGWRNTJ-UHFFFAOYSA-N 0.000 description 1
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 241000380131 Ammophila arenaria Species 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- 241000204385 Pavona Species 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- 239000003377 acid catalyst Substances 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 150000003857 carboxamides Chemical class 0.000 description 1
- 229940089960 chloroacetate Drugs 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- ZGEGDOHAFHDXAU-UHFFFAOYSA-N ethyl 3-acetyl-4-hydroxybenzoate Chemical compound CCOC(=O)C1=CC=C(O)C(C(C)=O)=C1 ZGEGDOHAFHDXAU-UHFFFAOYSA-N 0.000 description 1
- LYCAIKOWRPUZTN-UHFFFAOYSA-N ethylene glycol Natural products OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 229940014425 exodus Drugs 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 125000001188 haloalkyl group Chemical group 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 229940071870 hydroiodic acid Drugs 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 125000002510 isobutoxy group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])O* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- CNMFHDIDIMZHKY-UHFFFAOYSA-N methyl 2,2-dimethylpropanoate Chemical class COC(=O)C(C)(C)C CNMFHDIDIMZHKY-UHFFFAOYSA-N 0.000 description 1
- JDGVFXOHSDRXGK-UHFFFAOYSA-N methyl 3-acetyl-4-hydroxy-5-propylbenzoate Chemical compound CCCC1=CC(C(=O)OC)=CC(C(C)=O)=C1O JDGVFXOHSDRXGK-UHFFFAOYSA-N 0.000 description 1
- LEQKWPMUVFBBAL-UHFFFAOYSA-N methyl 4-acetyl-3-hydroxybenzoate Chemical compound COC(=O)C1=CC=C(C(C)=O)C(O)=C1 LEQKWPMUVFBBAL-UHFFFAOYSA-N 0.000 description 1
- LTZXGXWGJXCHDR-UHFFFAOYSA-N methyl 4-hydroxy-3-(3-oxo-3-pyridin-3-ylpropanoyl)benzoate Chemical compound COC(=O)C1=CC=C(O)C(C(=O)CC(=O)C=2C=NC=CC=2)=C1 LTZXGXWGJXCHDR-UHFFFAOYSA-N 0.000 description 1
- IBJSHJADLVBFDA-UHFFFAOYSA-N methyl 4-hydroxy-3-(3-oxo-5-phenylpent-4-enoyl)benzoate Chemical compound COC(=O)C1=CC=C(O)C(C(=O)CC(=O)C=CC=2C=CC=CC=2)=C1 IBJSHJADLVBFDA-UHFFFAOYSA-N 0.000 description 1
- KLPRRBLWXBGSQG-UHFFFAOYSA-N methyl 4-hydroxy-3-[3-oxo-3-(2-phenylmethoxyphenyl)propanoyl]benzoate Chemical compound COC(=O)C1=CC=C(O)C(C(=O)CC(=O)C=2C(=CC=CC=2)OCC=2C=CC=CC=2)=C1 KLPRRBLWXBGSQG-UHFFFAOYSA-N 0.000 description 1
- MDIBGPICHUESMF-UHFFFAOYSA-N methyl 4-hydroxy-3-[3-oxo-3-(2-propan-2-yloxyphenyl)propanoyl]benzoate Chemical compound COC(=O)C1=CC=C(O)C(C(=O)CC(=O)C=2C(=CC=CC=2)OC(C)C)=C1 MDIBGPICHUESMF-UHFFFAOYSA-N 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 125000004307 pyrazin-2-yl group Chemical group [H]C1=C([H])N=C(*)C([H])=N1 0.000 description 1
- QJZUKDFHGGYHMC-UHFFFAOYSA-N pyridine-3-carbaldehyde Chemical compound O=CC1=CC=CN=C1 QJZUKDFHGGYHMC-UHFFFAOYSA-N 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D311/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings
- C07D311/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D311/04—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring
- C07D311/22—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms directly attached in position 4
- C07D311/26—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms directly attached in position 4 with aromatic rings attached in position 2 or 3
- C07D311/28—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms directly attached in position 4 with aromatic rings attached in position 2 or 3 with aromatic rings attached in position 2 only
- C07D311/30—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms directly attached in position 4 with aromatic rings attached in position 2 or 3 with aromatic rings attached in position 2 only not hydrogenated in the hetero ring, e.g. flavones
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/63—One oxygen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D311/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings
- C07D311/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D311/04—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring
- C07D311/22—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring with oxygen or sulfur atoms directly attached in position 4
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
- Pyrane Compounds (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT3208973 | 1973-12-27 | ||
| IT2477774A IT1045480B (it) | 1974-07-04 | 1974-07-04 | Acidi 2 vinil cromon carbossilici sostituiti |
| IT2524474 | 1974-07-17 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU611590A3 true SU611590A3 (ru) | 1978-06-15 |
Family
ID=27273401
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU742098258A SU611590A3 (ru) | 1973-12-27 | 1974-12-27 | Способ получени производных бензо -пирона или их солей |
Country Status (16)
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4160028A (en) * | 1977-08-02 | 1979-07-03 | Carlo Erba S.P.A. | Substituted 2-cyclopropyl-chromones and pharmaceutical compositions and use thereof |
| IT1134205B (it) * | 1980-11-11 | 1986-08-13 | Bonomelli Spa | Processo per la produzione di derivati flavonici ad attivita' medicinale |
| FR2516922A1 (fr) * | 1981-11-25 | 1983-05-27 | Lipha | Acides (oxo-4-4h-(1)-benzopyran-8-yl) alcanoiques, sels et derives, preparation et medicament les contenant |
| US4525356A (en) * | 1982-11-02 | 1985-06-25 | Hokuriku Pharmaceutical Co., Ltd. | N-substituted flavone-8-carboxamides |
| IL108841A0 (en) * | 1993-03-10 | 1994-06-24 | Pfizer Res & Dev | Benzopyrans |
| JP3957795B2 (ja) * | 1996-10-04 | 2007-08-15 | 興和株式会社 | フラボン誘導体及びこれを含有する医薬 |
| EP2855446A2 (en) * | 2012-04-27 | 2015-04-08 | Basf Se | Substituted n-(tetrazol-5-yl)- and n-(triazol-5-yl)arylcarboxamide compounds and their use as herbicides |
| WO2014184073A1 (en) * | 2013-05-15 | 2014-11-20 | Basf Se | Substituted n-(tetrazol-5-yl)- and n-(triazol-5-yl)arylcarboxamide compounds and their use as herbicides |
-
1974
- 1974-12-17 GB GB54453/74A patent/GB1479518A/en not_active Expired
- 1974-12-23 HU HU74EA00000142A patent/HU171874B/hu unknown
- 1974-12-23 SE SE7416231A patent/SE417427B/xx unknown
- 1974-12-23 DK DK680474A patent/DK680474A/da not_active Application Discontinuation
- 1974-12-24 NL NL7416873A patent/NL7416873A/xx not_active Application Discontinuation
- 1974-12-24 CH CH1731074A patent/CH616934A5/de not_active IP Right Cessation
- 1974-12-27 FR FR7443125A patent/FR2255894B1/fr not_active Expired
- 1974-12-27 CS CS749033A patent/CS202543B2/cs unknown
- 1974-12-27 CA CA216,961A patent/CA1061353A/en not_active Expired
- 1974-12-27 JP JP753008A patent/JPS5634595B2/ja not_active Expired
- 1974-12-27 SU SU742098258A patent/SU611590A3/ru active
- 1974-12-27 FI FI3742/74A patent/FI67080C/fi active
- 1974-12-27 DE DE19742461670 patent/DE2461670A1/de not_active Withdrawn
- 1974-12-27 NO NO744714A patent/NO144110C/no unknown
- 1974-12-27 AT AT1034174A patent/AT345830B/de not_active IP Right Cessation
-
1975
- 1975-01-10 IL IL46423A patent/IL46423A/xx unknown
-
1978
- 1978-03-13 CH CH388578A patent/CH616935A5/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| SE7416231L (enrdf_load_html_response) | 1975-06-30 |
| JPS50129568A (enrdf_load_html_response) | 1975-10-13 |
| CH616934A5 (en) | 1980-04-30 |
| FR2255894A1 (enrdf_load_html_response) | 1975-07-25 |
| NO744714L (enrdf_load_html_response) | 1975-07-21 |
| NO144110B (no) | 1981-03-16 |
| HU171874B (hu) | 1978-04-28 |
| CH616935A5 (en) | 1980-04-30 |
| NL7416873A (nl) | 1975-07-01 |
| CA1061353A (en) | 1979-08-28 |
| SE417427B (sv) | 1981-03-16 |
| NO144110C (no) | 1981-06-24 |
| ATA1034174A (de) | 1978-02-15 |
| JPS5634595B2 (enrdf_load_html_response) | 1981-08-11 |
| FR2255894B1 (enrdf_load_html_response) | 1978-07-21 |
| AU7687874A (en) | 1976-06-24 |
| DK680474A (enrdf_load_html_response) | 1975-08-25 |
| FI67080C (fi) | 1985-01-10 |
| DE2461670A1 (de) | 1975-07-10 |
| CS202543B2 (en) | 1981-01-30 |
| AT345830B (de) | 1978-10-10 |
| IL46423A0 (en) | 1975-05-22 |
| FI67080B (fi) | 1984-09-28 |
| GB1479518A (en) | 1977-07-13 |
| IL46423A (en) | 1979-03-12 |
| FI374274A7 (enrdf_load_html_response) | 1975-06-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3917624A (en) | Process for producing 2-amino-nicotinonitrile intermediates | |
| SU611590A3 (ru) | Способ получени производных бензо -пирона или их солей | |
| CN101945861A (zh) | 一种苯甲酰胺类化合物的制备方法 | |
| US6015905A (en) | Process for the preparation of 2-(6-substituted pyrid-2-yloxymethyl) phenylacetate | |
| NO152817B (no) | Fremgangsmaate og innretning for haandtering av vaeskeporsjoner | |
| CA1272484A (en) | Semicarbazones and thiosemicarbazones | |
| NO840557L (no) | Kinolonkarboksylsyrer, fremgangsmaate til deres fremstilling samt antibakterielle midler som inneholder disse | |
| WO2002002540A1 (fr) | Compose de benzoxazole, son procede de production, et desherbant | |
| NO157699B (no) | Fremgangsmte for fremstilling av kinolinkarboksylsyrederivater. | |
| CN115181116B (zh) | 具有含硫取代基的稠环化合物、制备方法、杀虫剂组合物及用途 | |
| FI92825B (fi) | Menetelmä terapeuttisesti käyttökelpoisten kromaanijohdannaisten valmistamiseksi | |
| CS247174B2 (en) | Herbicide and its active substance production | |
| SE445042B (sv) | Forfarande for framstellning av gamma-pyroner | |
| CA2182506C (en) | 4-(alpha-methoxy)methylene-2h-chromene-3(4h)-one and its use in agriculture | |
| NO164353B (no) | Analogifremgangsmaate til fremstilling av terapeutisk aktive pyridopyrimidiner. | |
| SU784766A3 (ru) | Способ получени бенз-ацил-бензимидазол(2)-производных | |
| WO1995018801A1 (en) | Benzimidazolyl quinoline-3-carboxylate derivatives, intermediates thereto, and their use as herbicides | |
| US4522647A (en) | Substituted phenoxyalkanediones and their herbicidal method of use | |
| CN117820253A (zh) | 3,6-二取代苯并噻唑类化合物及其合成与应用 | |
| BG60413B2 (bg) | Оксим естерни хербициди | |
| US5098462A (en) | Substituted semi-carbazones and related compounds | |
| CN108484614A (zh) | 吡唑并[3,4-d]嘧啶-4(5H)-酮衍生物及其制备方法和应用 | |
| US4233060A (en) | α-Phenoxy-thiolpropionic acids | |
| JPS63258467A (ja) | 2−フエノキシトリアジン誘導体及び除草剤 | |
| Moffett | Azacoumarins |