SU563117A3 - Способ получени двух- или многоатомных спиртов - Google Patents
Способ получени двух- или многоатомных спиртовInfo
- Publication number
- SU563117A3 SU563117A3 SU1970268A SU1970268A SU563117A3 SU 563117 A3 SU563117 A3 SU 563117A3 SU 1970268 A SU1970268 A SU 1970268A SU 1970268 A SU1970268 A SU 1970268A SU 563117 A3 SU563117 A3 SU 563117A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- acetone
- hydrolysis
- epoxides
- epoxide
- salt
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 5
- 150000005846 sugar alcohols Polymers 0.000 title claims description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 claims description 24
- 238000006243 chemical reaction Methods 0.000 claims description 12
- 239000000203 mixture Substances 0.000 claims description 9
- 150000003839 salts Chemical class 0.000 claims description 9
- 230000007062 hydrolysis Effects 0.000 claims description 5
- 238000006460 hydrolysis reaction Methods 0.000 claims description 5
- 239000002904 solvent Substances 0.000 claims description 5
- 150000001991 dicarboxylic acids Chemical class 0.000 claims description 4
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 claims description 3
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 229910052700 potassium Inorganic materials 0.000 claims description 3
- 239000011591 potassium Substances 0.000 claims description 3
- 159000000011 group IA salts Chemical class 0.000 claims description 2
- -1 monocarboxylic acid salt Chemical class 0.000 claims description 2
- 150000002118 epoxides Chemical class 0.000 claims 3
- 150000001875 compounds Chemical class 0.000 claims 2
- 239000003513 alkali Substances 0.000 claims 1
- 125000000217 alkyl group Chemical group 0.000 claims 1
- 239000002585 base Substances 0.000 claims 1
- 239000003054 catalyst Substances 0.000 claims 1
- 238000004519 manufacturing process Methods 0.000 claims 1
- 239000002994 raw material Substances 0.000 claims 1
- 239000007864 aqueous solution Substances 0.000 description 13
- 150000002924 oxiranes Chemical class 0.000 description 12
- 239000004593 Epoxy Substances 0.000 description 4
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 4
- 150000001298 alcohols Chemical class 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- DSZTYVZOIUIIGA-UHFFFAOYSA-N 1,2-Epoxyhexadecane Chemical compound CCCCCCCCCCCCCCC1CO1 DSZTYVZOIUIIGA-UHFFFAOYSA-N 0.000 description 2
- MPGABYXKKCLIRW-UHFFFAOYSA-N 2-decyloxirane Chemical compound CCCCCCCCCCC1CO1 MPGABYXKKCLIRW-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 150000001336 alkenes Chemical class 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 238000003776 cleavage reaction Methods 0.000 description 2
- 150000002763 monocarboxylic acids Chemical class 0.000 description 2
- 229910052759 nickel Inorganic materials 0.000 description 2
- BDJRBEYXGGNYIS-UHFFFAOYSA-N nonanedioic acid Chemical compound OC(=O)CCCCCCCC(O)=O BDJRBEYXGGNYIS-UHFFFAOYSA-N 0.000 description 2
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 2
- 125000000466 oxiranyl group Chemical group 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 239000012266 salt solution Substances 0.000 description 2
- 230000007017 scission Effects 0.000 description 2
- KYKFCSHPTAVNJD-UHFFFAOYSA-L sodium adipate Chemical compound [Na+].[Na+].[O-]C(=O)CCCCC([O-])=O KYKFCSHPTAVNJD-UHFFFAOYSA-L 0.000 description 2
- LFKLPJRVSHJZPL-UHFFFAOYSA-N 1,2:7,8-diepoxyoctane Chemical compound C1OC1CCCCC1CO1 LFKLPJRVSHJZPL-UHFFFAOYSA-N 0.000 description 1
- QBJWYMFTMJFGOL-UHFFFAOYSA-N 2-hexadecyloxirane Chemical compound CCCCCCCCCCCCCCCCC1CO1 QBJWYMFTMJFGOL-UHFFFAOYSA-N 0.000 description 1
- XSNXNMMWBCZUSS-UHFFFAOYSA-N 2-pentadecyloxirane Chemical compound CCCCCCCCCCCCCCCC1CO1 XSNXNMMWBCZUSS-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 229920006051 Capron® Polymers 0.000 description 1
- 206010018498 Goitre Diseases 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 241001026509 Kata Species 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 229940067597 azelate Drugs 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- NCXUIEDQTCQZRK-UHFFFAOYSA-L disodium;decanedioate Chemical compound [Na+].[Na+].[O-]C(=O)CCCCCCCCC([O-])=O NCXUIEDQTCQZRK-UHFFFAOYSA-L 0.000 description 1
- QFYNUCAKHMSPCY-UHFFFAOYSA-L disodium;nonanedioate Chemical compound [Na+].[Na+].[O-]C(=O)CCCCCCCC([O-])=O QFYNUCAKHMSPCY-UHFFFAOYSA-L 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000006735 epoxidation reaction Methods 0.000 description 1
- 125000003700 epoxy group Chemical group 0.000 description 1
- JBKVHLHDHHXQEQ-UHFFFAOYSA-N epsilon-caprolactam Chemical compound O=C1CCCCCN1 JBKVHLHDHHXQEQ-UHFFFAOYSA-N 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 201000003872 goiter Diseases 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 229910003002 lithium salt Inorganic materials 0.000 description 1
- 159000000002 lithium salts Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- WWZKQHOCKIZLMA-UHFFFAOYSA-N octanoic acid Chemical compound CCCCCCCC(O)=O WWZKQHOCKIZLMA-UHFFFAOYSA-N 0.000 description 1
- KHIWWQKSHDUIBK-UHFFFAOYSA-N periodic acid Chemical compound OI(=O)(=O)=O KHIWWQKSHDUIBK-UHFFFAOYSA-N 0.000 description 1
- 238000005191 phase separation Methods 0.000 description 1
- 229920000647 polyepoxide Polymers 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 235000011049 sodium adipate Nutrition 0.000 description 1
- BTURAGWYSMTVOW-UHFFFAOYSA-M sodium dodecanoate Chemical compound [Na+].CCCCCCCCCCCC([O-])=O BTURAGWYSMTVOW-UHFFFAOYSA-M 0.000 description 1
- 229940082004 sodium laurate Drugs 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- LTOCMXUTASYUOC-UHFFFAOYSA-M sodium;nonanoate Chemical compound [Na+].CCCCCCCCC([O-])=O LTOCMXUTASYUOC-UHFFFAOYSA-M 0.000 description 1
- 230000003068 static effect Effects 0.000 description 1
- 238000004448 titration Methods 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
- 238000000844 transformation Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C29/00—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring
- C07C29/09—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by hydrolysis
- C07C29/10—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by hydrolysis of ethers, including cyclic ethers, e.g. oxiranes
- C07C29/103—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by hydrolysis of ethers, including cyclic ethers, e.g. oxiranes of cyclic ethers
- C07C29/106—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by hydrolysis of ethers, including cyclic ethers, e.g. oxiranes of cyclic ethers of oxiranes
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Epoxy Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2256907A DE2256907C3 (de) | 1972-11-20 | 1972-11-20 | Verfahren zur Herstellung von vicinalen Di- und Polyolen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU563117A3 true SU563117A3 (ru) | 1977-06-25 |
Family
ID=5862260
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU1970268A SU563117A3 (ru) | 1972-11-20 | 1973-11-16 | Способ получени двух- или многоатомных спиртов |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US3933923A (https=) |
| JP (1) | JPS4986307A (https=) |
| BE (1) | BE807480A (https=) |
| CA (1) | CA1017363A (https=) |
| DE (1) | DE2256907C3 (https=) |
| ES (1) | ES420673A1 (https=) |
| FR (1) | FR2207108B1 (https=) |
| GB (1) | GB1450703A (https=) |
| IT (1) | IT1001770B (https=) |
| NL (1) | NL7314557A (https=) |
| SU (1) | SU563117A3 (https=) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| RU2533420C1 (ru) * | 2013-08-27 | 2014-11-20 | Федеральное государственное бюджетное образовательное учреждение высшего профессионального образования "Волгоградский государственный технический университет" (ВолгГТУ) | Способ совместного получения 1,2-эпоксидодекана и 1,2-додекандиола |
Families Citing this family (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5118254Y1 (https=) * | 1974-07-20 | 1976-05-15 | ||
| DE2757278C2 (de) * | 1977-12-22 | 1984-06-20 | Henkel KGaA, 4000 Düsseldorf | Mono- und Dicarbonsäure-2-hydroxyalkylester und deren Verwendung als Emulgatoren |
| CA1133522A (en) * | 1978-06-20 | 1982-10-12 | Glenn A. Taylor | Process for hydrolyzing alkylene oxides to alkylene glycols |
| DE2829697C2 (de) * | 1978-07-06 | 1986-10-30 | Henkel KGaA, 4000 Düsseldorf | Detergenzzusammensetzung |
| CA1120955A (en) * | 1979-07-09 | 1982-03-30 | Toshihiko Kumazawa | Process for the production of alkylene glycols |
| DE2931753C2 (de) * | 1979-08-04 | 1984-10-04 | Akzo Gmbh, 5600 Wuppertal | Verfahren zur Herstellung von vicinalen Alkylenglykolen |
| DE2938154A1 (de) * | 1979-09-21 | 1981-04-09 | Degussa Ag, 6000 Frankfurt | Verfahren zur herstellung von 1,2-diolen hoeherer kohlenstoffzahl |
| DE2948100A1 (de) * | 1979-11-29 | 1981-06-11 | Henkel KGaA, 4000 Düsseldorf | Detergenzzusammensetzung |
| US4393248A (en) * | 1981-08-20 | 1983-07-12 | Pennwalt Corporation | Flame retarded halogenated polyol |
| DE3442938C2 (de) * | 1984-11-24 | 1986-11-06 | Degussa Ag, 6000 Frankfurt | Verfahren zur kontinuierlichen Herstellung vicinaler Diole |
| JPH0688922B2 (ja) * | 1985-11-25 | 1994-11-09 | 三井東圧化学株式会社 | エチレングリコ−ル及び/又はプロピレングリコ−ルの製造方法 |
| DE3683264D1 (de) * | 1985-11-18 | 1992-02-13 | Mitsui Toatsu Chemicals | Verfahren zur herstellung von ethylenglykol und/oder propylenglykol. |
| US4760200A (en) * | 1985-12-31 | 1988-07-26 | Union Carbide Corporation | Process for the production of alkylene glycols |
| DE3628674A1 (de) * | 1986-08-23 | 1988-02-25 | Degussa | Kontinuierliches verfahren zur herstellung von 1,2-diolen |
| US4982001A (en) * | 1987-10-19 | 1991-01-01 | The Dow Chemical Company | Process for the preparation of amino-1,3-benzenediol |
| US6153801A (en) | 1998-12-14 | 2000-11-28 | Shell Oil Company | Carboxylates in catalytic hydrolysis of alkylene oxides |
| PE20001571A1 (es) * | 1998-12-14 | 2001-01-26 | Shell Int Research | Carboxilatos en la hidrolisis catalitica de oxidos de alquileno |
| JP3544134B2 (ja) * | 1999-01-25 | 2004-07-21 | 花王株式会社 | グリセリルエーテルの製造法 |
| JP4262726B2 (ja) * | 2005-08-24 | 2009-05-13 | 任天堂株式会社 | ゲームコントローラおよびゲームシステム |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2650940A (en) * | 1953-09-01 | Manufacture of glycols | ||
| US2694077A (en) * | 1952-02-19 | 1954-11-09 | Union Carbide & Carbon Corp | Production of hydroxy derivatives of methacrolein dimer |
| US2983763A (en) * | 1956-04-12 | 1961-05-09 | Jefferson Chem Co Inc | Decolorizing the product of reacting an alkylene oxide with a hydroxylcontaining organic compound in the presence of an alkaline reacting catalyst |
| US2934505A (en) * | 1958-07-22 | 1960-04-26 | Dow Chemical Co | Process for polymerization of alkylene oxides with metal salts |
| US3020293A (en) * | 1959-04-24 | 1962-02-06 | Hoechst Ag | Process for the manufacture of olefin oxidation products from olefin-mercury complexes |
| DE2109453C3 (de) * | 1971-02-27 | 1974-01-10 | Deutsche Gold- Und Silber-Scheideanstalt Vormals Roessler, 6000 Frankfurt | Verfahren zur Herstellung von vicinalen Glykolen |
-
1972
- 1972-11-20 DE DE2256907A patent/DE2256907C3/de not_active Expired
-
1973
- 1973-10-23 NL NL7314557A patent/NL7314557A/xx not_active Application Discontinuation
- 1973-11-07 US US05/413,690 patent/US3933923A/en not_active Expired - Lifetime
- 1973-11-08 CA CA185,334A patent/CA1017363A/en not_active Expired
- 1973-11-15 IT IT31345/73A patent/IT1001770B/it active
- 1973-11-16 SU SU1970268A patent/SU563117A3/ru active
- 1973-11-16 GB GB5318673A patent/GB1450703A/en not_active Expired
- 1973-11-19 JP JP48129296A patent/JPS4986307A/ja active Pending
- 1973-11-19 BE BE137886A patent/BE807480A/xx unknown
- 1973-11-20 FR FR7341306A patent/FR2207108B1/fr not_active Expired
- 1973-11-20 ES ES420673A patent/ES420673A1/es not_active Expired
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| RU2533420C1 (ru) * | 2013-08-27 | 2014-11-20 | Федеральное государственное бюджетное образовательное учреждение высшего профессионального образования "Волгоградский государственный технический университет" (ВолгГТУ) | Способ совместного получения 1,2-эпоксидодекана и 1,2-додекандиола |
Also Published As
| Publication number | Publication date |
|---|---|
| JPS4986307A (https=) | 1974-08-19 |
| CA1017363A (en) | 1977-09-13 |
| BE807480A (fr) | 1974-05-20 |
| FR2207108B1 (https=) | 1976-04-30 |
| GB1450703A (en) | 1976-09-29 |
| US3933923A (en) | 1976-01-20 |
| NL7314557A (https=) | 1974-05-22 |
| DE2256907B2 (de) | 1981-05-07 |
| DE2256907C3 (de) | 1982-03-18 |
| DE2256907A1 (de) | 1974-05-22 |
| FR2207108A1 (https=) | 1974-06-14 |
| ES420673A1 (es) | 1976-04-16 |
| IT1001770B (it) | 1976-04-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU563117A3 (ru) | Способ получени двух- или многоатомных спиртов | |
| AU681937B2 (en) | Process for the preparation of alkylene glycols | |
| US2070990A (en) | Treatment of halogenated polyhydric alcohols | |
| US2070991A (en) | Process for the production of acid amides | |
| JPH0226610B2 (https=) | ||
| US3954884A (en) | Method for producing beta hydroxy ethylene glycol ethers | |
| US2061377A (en) | Conversion of polyhalogenated alcohols | |
| SU417935A3 (ru) | Способ получения аминов | |
| US4231937A (en) | Preparation of alkylene carbonates from alkylene iodohydrins | |
| KR860001856B1 (ko) | 알킬렌 탄산염의 제조방법 | |
| US4841072A (en) | Preparation of alkylene carbonates | |
| EP0094588B1 (en) | Process for preparing polyglycidyl compounds | |
| US2951854A (en) | Bis-epoxides obtained from 2, 2, 3, 3-tetrahalo-1, 4-butanediol and methods of manufacture of the same | |
| US4599467A (en) | Production of vicinal alkylene glycols | |
| US5138073A (en) | Preparation of alkylene carbonates | |
| US3956405A (en) | Process for manufacturing polyfluoroalkyl propanols | |
| US2106347A (en) | Production of carbonylic compounds | |
| US4095030A (en) | Isomerization of diacyloxyolefins | |
| US3956382A (en) | Process for the production of ether polycarboxylic acids | |
| US5023345A (en) | Preparation of alkylene carbonates | |
| US3897469A (en) | Process for the production of di- and polyhydroxycarboxylic acids | |
| US4182901A (en) | Diacyloxybutene isomerization with selenium dioxide | |
| Brimacombe et al. | Higher-carbon sugars. Part 6. The synthesis of some octose sugars via the epoxidation of unsaturated precursors | |
| US3717628A (en) | Method for the preparation of 2,3-dimethyl aziridine | |
| US3931259A (en) | Process for the preparation of carboxylic acids |