SU553928A3 - Способ получени производных 1-фенокси-3-аминопропан-2-ола или их солей - Google Patents
Способ получени производных 1-фенокси-3-аминопропан-2-ола или их солейInfo
- Publication number
- SU553928A3 SU553928A3 SU2085459A SU2085459A SU553928A3 SU 553928 A3 SU553928 A3 SU 553928A3 SU 2085459 A SU2085459 A SU 2085459A SU 2085459 A SU2085459 A SU 2085459A SU 553928 A3 SU553928 A3 SU 553928A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- salts
- aminopropan
- phenoxy
- obtaining derivatives
- butter
- Prior art date
Links
- 150000003839 salts Chemical class 0.000 title description 5
- 238000000034 method Methods 0.000 title description 2
- JZEHWMUIAKALDN-UHFFFAOYSA-N 1-amino-3-phenoxypropan-2-ol Chemical class NCC(O)COC1=CC=CC=C1 JZEHWMUIAKALDN-UHFFFAOYSA-N 0.000 title 1
- 150000001875 compounds Chemical class 0.000 description 10
- -1 methoxy- Chemical class 0.000 description 9
- 235000014121 butter Nutrition 0.000 description 7
- 239000002904 solvent Substances 0.000 description 6
- 239000002253 acid Substances 0.000 description 5
- 125000004432 carbon atom Chemical group C* 0.000 description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- 229910052799 carbon Inorganic materials 0.000 description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical group CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 239000002270 dispersing agent Substances 0.000 description 3
- 150000003944 halohydrins Chemical class 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- LPIQUOYDBNQMRZ-UHFFFAOYSA-N cyclopentene Chemical compound C1CC=CC1 LPIQUOYDBNQMRZ-UHFFFAOYSA-N 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 229940072033 potash Drugs 0.000 description 2
- 235000015320 potassium carbonate Nutrition 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Substances [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- LRRPGSMZYAPOCP-UHFFFAOYSA-N 1-(6-methylpyridin-3-yl)butane-1,3-dione Chemical compound CC(=O)CC(=O)C1=CC=C(C)N=C1 LRRPGSMZYAPOCP-UHFFFAOYSA-N 0.000 description 1
- NVJUHMXYKCUMQA-UHFFFAOYSA-N 1-ethoxypropane Chemical compound CCCOCC NVJUHMXYKCUMQA-UHFFFAOYSA-N 0.000 description 1
- KKOWXJFINYUXEE-UHFFFAOYSA-N 2-butoxyphenol Chemical compound CCCCOC1=CC=CC=C1O KKOWXJFINYUXEE-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- WHHCJVDCBWEZNY-UHFFFAOYSA-N 3-amino-1-(6-methylpyridin-3-yl)butan-1-ol Chemical compound CC(N)CC(O)C1=CC=C(C)N=C1 WHHCJVDCBWEZNY-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 238000004566 IR spectroscopy Methods 0.000 description 1
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical group CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 1
- AMQJEAYHLZJPGS-UHFFFAOYSA-N N-Pentanol Chemical compound CCCCCO AMQJEAYHLZJPGS-UHFFFAOYSA-N 0.000 description 1
- 238000005481 NMR spectroscopy Methods 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- 150000007513 acids Chemical group 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 150000001345 alkine derivatives Chemical class 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- SWLVFNYSXGMGBS-UHFFFAOYSA-N ammonium bromide Chemical compound [NH4+].[Br-] SWLVFNYSXGMGBS-UHFFFAOYSA-N 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000001273 butane Substances 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- GKIPXFAANLTWBM-UHFFFAOYSA-N epibromohydrin Chemical compound BrCC1CO1 GKIPXFAANLTWBM-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000006384 methylpyridyl group Chemical group 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- XTEGVFVZDVNBPF-UHFFFAOYSA-N naphthalene-1,5-disulfonic acid Chemical compound C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1S(O)(=O)=O XTEGVFVZDVNBPF-UHFFFAOYSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 150000002924 oxiranes Chemical class 0.000 description 1
- RGSFGYAAUTVSQA-UHFFFAOYSA-N pentamethylene Natural products C1CCCC1 RGSFGYAAUTVSQA-UHFFFAOYSA-N 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/28—Radicals substituted by singly-bound oxygen or sulphur atoms
- C07D213/30—Oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyridine Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| LU34571 | 1973-12-20 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU553928A3 true SU553928A3 (ru) | 1977-04-05 |
Family
ID=19722278
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU2085459A SU553928A3 (ru) | 1973-12-20 | 1974-12-19 | Способ получени производных 1-фенокси-3-аминопропан-2-ола или их солей |
| SU2084874A SU549078A3 (ru) | 1973-12-20 | 1974-12-19 | Способ получени производных 1фенокси-3-амино-пропан-2-ола или их солей |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU2084874A SU549078A3 (ru) | 1973-12-20 | 1974-12-19 | Способ получени производных 1фенокси-3-амино-пропан-2-ола или их солей |
Country Status (11)
| Country | Link |
|---|---|
| AR (2) | AR208072A1 (enExample) |
| AT (3) | AT339304B (enExample) |
| DK (1) | DK654674A (enExample) |
| ES (1) | ES433125A1 (enExample) |
| FI (1) | FI363074A7 (enExample) |
| HU (1) | HU170672B (enExample) |
| NO (1) | NO744529L (enExample) |
| RO (1) | RO64005A (enExample) |
| SE (1) | SE7415760L (enExample) |
| SU (2) | SU553928A3 (enExample) |
| ZA (2) | ZA748084B (enExample) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP3945090B1 (en) | 2020-07-27 | 2024-10-30 | Novaled GmbH | Metal complexes of 3-(2,3,5-trifluoro-6-(trifluoromethyl)pyridin-4-yl)pentane-2,4-dione and similar ligands as semiconductor materials for use in electronic devices |
| KR20230042494A (ko) * | 2020-07-27 | 2023-03-28 | 노발레드 게엠베하 | 화학식 (i)의 화합물, 적어도 하나의 화학식 (i)의 화합물을 포함하는 반도체 재료, 적어도 하나의 화학식 (i)의 화합물을 포함하는 반도체 층 및 적어도 하나의 화학식 (i)의 화합물을 포함하는 전자 장치 |
-
1974
- 1974-01-01 AR AR256997A patent/AR208072A1/es active
- 1974-01-01 AR AR256996A patent/AR208071A1/es active
- 1974-12-16 DK DK654674A patent/DK654674A/da unknown
- 1974-12-16 SE SE7415760A patent/SE7415760L/xx unknown
- 1974-12-16 FI FI3630/74A patent/FI363074A7/fi unknown
- 1974-12-16 NO NO744529A patent/NO744529L/no unknown
- 1974-12-19 SU SU2085459A patent/SU553928A3/ru active
- 1974-12-19 SU SU2084874A patent/SU549078A3/ru active
- 1974-12-19 HU HUCA377A patent/HU170672B/hu unknown
- 1974-12-19 AT AT1016074A patent/AT339304B/de not_active IP Right Cessation
- 1974-12-19 AT AT1016174A patent/AT338784B/de active
- 1974-12-19 ES ES433125A patent/ES433125A1/es not_active Expired
- 1974-12-19 RO RO7400080870A patent/RO64005A/ro unknown
- 1974-12-19 AT AT1015974A patent/AT338783B/de not_active IP Right Cessation
- 1974-12-19 ZA ZA00748084A patent/ZA748084B/xx unknown
- 1974-12-19 ZA ZA00748083A patent/ZA748083B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DK654674A (enExample) | 1975-08-25 |
| ATA1016074A (de) | 1977-02-15 |
| RO64005A (fr) | 1978-10-15 |
| HU170672B (enExample) | 1977-08-28 |
| ATA1015974A (de) | 1977-01-15 |
| AT338784B (de) | 1977-09-12 |
| ZA748084B (en) | 1976-01-28 |
| SE7415760L (enExample) | 1975-06-23 |
| ES433125A1 (es) | 1977-05-16 |
| AT338783B (de) | 1977-09-12 |
| AT339304B (de) | 1977-10-10 |
| SU549078A3 (ru) | 1977-02-28 |
| FI363074A7 (enExample) | 1975-06-21 |
| NO744529L (enExample) | 1975-07-14 |
| AR208072A1 (es) | 1976-11-30 |
| ZA748083B (en) | 1976-01-28 |
| AR208071A1 (es) | 1976-11-30 |
| ATA1016174A (de) | 1977-01-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| KR940001774B1 (ko) | 치환 및 이치환 피리딘-2,3-디카르복실레이트의 제조방법과 치환된 니코티네이트의 제조방법 | |
| US4466915A (en) | Non-catalytic ketoform syntheses | |
| DK149623B (da) | Fremgangsmaade til fremstilling af alfa-hydroxycarboxylsyreamider | |
| DE69915110T2 (de) | Verfahren zur herstellung von arylethern | |
| SU563120A3 (ru) | Способ получени производных 1-фенокси-3-аминопропан2-ола или их солей | |
| SU553928A3 (ru) | Способ получени производных 1-фенокси-3-аминопропан-2-ола или их солей | |
| KR100262250B1 (ko) | 3-알콕시메틸퀴놀린, 및 2-알콕시메틸아크롤레인으로부터이의 제조 방법 | |
| SU499806A3 (ru) | Способ получени производных пиперазина | |
| GB1594450A (en) | 1,3-oxathiolane sulphoxides and their use in the preparation of 5,6-dihydro-2-methyl-1,4-oxathiin derivatives | |
| FI92054B (fi) | Menetelmä 3-(o-metoksifenoksi)-1,2-propaanidioli-1-karbamaatin valmistamiseksi | |
| US4159271A (en) | Process for producing indoline derivatives | |
| HU220971B1 (hu) | Eljárás 0-(3-amino-2-hidroxi-propil)-hidroximsav-halogenidek előállítására | |
| SU507239A3 (ru) | Способ получени 2-гидразинобензотиазолов | |
| US4150039A (en) | 2,2'-Bis(3,4-Epoxy-5-oxotetrahydropyran)ethers | |
| KR0152518B1 (ko) | 히드록실아민 유도체 | |
| US4350819A (en) | 1-Hydroxypyrazole | |
| Ikeda et al. | Synthesis of cyclic aminimines with perfluoroalkyl groups. | |
| JP2659587B2 (ja) | 4―アジリジニルピリミジン誘導体及びその製造法 | |
| FR2484416A1 (fr) | Derives 4-(3-iodopropargyloxy) pyrimidine et procede pour la production de ces derives | |
| US4565870A (en) | Process for the preparation of a salt of 1-(γ-halopropyl)-1,2,3,4-β-carbolines | |
| EP0003316B1 (de) | Stereospezifisches Verfahren für die Herstellung von 2-Oxiranyl-1,4-benzodioxanen | |
| SU528870A3 (ru) | Способ получени производных 2-имидазолидинона или их солей | |
| US5229525A (en) | Method for preparing perfluoro-oxaziridines | |
| US20240409568A1 (en) | Method of preparing asymmetric phosphate-based compound | |
| EP0003866B1 (en) | 3-azabicyclo(3.1.0)hexane derivatives and a process for their preparation |