SU511832A3 - Фунгицид и микробицид - Google Patents
Фунгицид и микробицидInfo
- Publication number
- SU511832A3 SU511832A3 SU2027849A SU2027849A SU511832A3 SU 511832 A3 SU511832 A3 SU 511832A3 SU 2027849 A SU2027849 A SU 2027849A SU 2027849 A SU2027849 A SU 2027849A SU 511832 A3 SU511832 A3 SU 511832A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- cycloalkyl
- alkenyl
- aryl
- aralkyl
- active
- Prior art date
Links
- 239000000417 fungicide Substances 0.000 title description 6
- 230000003641 microbiacidal effect Effects 0.000 title description 5
- 229940124561 microbicide Drugs 0.000 title description 5
- 230000000855 fungicidal effect Effects 0.000 title description 2
- 239000002855 microbicide agent Substances 0.000 title 1
- 239000013543 active substance Substances 0.000 description 11
- 150000001875 compounds Chemical class 0.000 description 10
- 241000196324 Embryophyta Species 0.000 description 8
- 239000004480 active ingredient Substances 0.000 description 8
- -1 alkinkl Chemical group 0.000 description 5
- 238000002474 experimental method Methods 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- 241000233866 Fungi Species 0.000 description 4
- 235000013339 cereals Nutrition 0.000 description 4
- 230000003902 lesion Effects 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 230000001681 protective effect Effects 0.000 description 4
- 125000003342 alkenyl group Chemical group 0.000 description 3
- 125000000753 cycloalkyl group Chemical group 0.000 description 3
- 239000003814 drug Substances 0.000 description 3
- 239000003995 emulsifying agent Substances 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- 230000009885 systemic effect Effects 0.000 description 3
- 235000000832 Ayote Nutrition 0.000 description 2
- 240000008067 Cucumis sativus Species 0.000 description 2
- 235000009854 Cucurbita moschata Nutrition 0.000 description 2
- 240000001980 Cucurbita pepo Species 0.000 description 2
- 235000009804 Cucurbita pepo subsp pepo Nutrition 0.000 description 2
- 241000221785 Erysiphales Species 0.000 description 2
- 240000005979 Hordeum vulgare Species 0.000 description 2
- 235000007340 Hordeum vulgare Nutrition 0.000 description 2
- 241000209504 Poaceae Species 0.000 description 2
- 206010037888 Rash pustular Diseases 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 241000256856 Vespidae Species 0.000 description 2
- 125000002877 alkyl aryl group Chemical group 0.000 description 2
- 125000003710 aryl alkyl group Chemical group 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 125000000392 cycloalkenyl group Chemical group 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 239000002054 inoculum Substances 0.000 description 2
- 229940079865 intestinal antiinfectives imidazole derivative Drugs 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 229920000151 polyglycol Polymers 0.000 description 2
- 239000010695 polyglycol Substances 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 235000015136 pumpkin Nutrition 0.000 description 2
- 208000029561 pustule Diseases 0.000 description 2
- 239000002689 soil Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000000454 talc Substances 0.000 description 2
- 235000012222 talc Nutrition 0.000 description 2
- 229910052623 talc Inorganic materials 0.000 description 2
- 230000001225 therapeutic effect Effects 0.000 description 2
- 238000003971 tillage Methods 0.000 description 2
- NPZDCTUDQYGYQD-UHFFFAOYSA-N 1-tritylimidazole Chemical class C1=NC=CN1C(C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 NPZDCTUDQYGYQD-UHFFFAOYSA-N 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- 206010001497 Agitation Diseases 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 229920001131 Pulp (paper) Polymers 0.000 description 1
- 239000006004 Quartz sand Substances 0.000 description 1
- 206010039509 Scab Diseases 0.000 description 1
- 241000209140 Triticum Species 0.000 description 1
- 235000021307 Triticum Nutrition 0.000 description 1
- 230000000895 acaricidal effect Effects 0.000 description 1
- 239000000642 acaricide Substances 0.000 description 1
- CSCPPACGZOOCGX-UHFFFAOYSA-N acetone Substances CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- ZMXDDKWLCZADIW-UHFFFAOYSA-N dimethylformamide Substances CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 235000013312 flour Nutrition 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hcl hcl Chemical compound Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 239000004009 herbicide Substances 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 238000005286 illumination Methods 0.000 description 1
- 150000002460 imidazoles Chemical class 0.000 description 1
- 238000011534 incubation Methods 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- JEIPFZHSYJVQDO-UHFFFAOYSA-N iron(III) oxide Inorganic materials O=[Fe]O[Fe]=O JEIPFZHSYJVQDO-UHFFFAOYSA-N 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 230000003071 parasitic effect Effects 0.000 description 1
- 239000006072 paste Substances 0.000 description 1
- 230000008654 plant damage Effects 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000009331 sowing Methods 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 230000001629 suppression Effects 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/12—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/63—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by introduction of halogen; by substitution of halogen atoms by other halogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/67—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton
- C07C45/68—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms
- C07C45/70—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms by reaction with functional groups containing oxygen only in singly bound form
- C07C45/71—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms by reaction with functional groups containing oxygen only in singly bound form being hydroxy groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/56—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2325156A DE2325156A1 (de) | 1973-05-18 | 1973-05-18 | Fungizide und mikrobizide mittel |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU511832A3 true SU511832A3 (ru) | 1976-04-25 |
Family
ID=5881310
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU2027849A SU511832A3 (ru) | 1973-05-18 | 1974-05-16 | Фунгицид и микробицид |
Country Status (21)
| Country | Link |
|---|---|
| US (1) | US3898341A (enExample) |
| JP (1) | JPS5018633A (enExample) |
| AT (1) | AT335224B (enExample) |
| BE (1) | BE815110A (enExample) |
| BR (1) | BR7404029D0 (enExample) |
| CH (1) | CH563717A5 (enExample) |
| DD (1) | DD114498A5 (enExample) |
| DE (1) | DE2325156A1 (enExample) |
| DK (1) | DK133847C (enExample) |
| ES (1) | ES426401A1 (enExample) |
| FI (1) | FI151274A7 (enExample) |
| FR (1) | FR2229352B1 (enExample) |
| GB (1) | GB1419734A (enExample) |
| HU (1) | HU169482B (enExample) |
| IE (1) | IE39271B1 (enExample) |
| IL (1) | IL44821A (enExample) |
| LU (1) | LU70105A1 (enExample) |
| NL (1) | NL7406529A (enExample) |
| SU (1) | SU511832A3 (enExample) |
| TR (1) | TR18125A (enExample) |
| ZA (1) | ZA743155B (enExample) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2423987C2 (de) * | 1974-05-17 | 1986-01-16 | Bayer Ag, 5090 Leverkusen | Metallkomplexe von Azolyläthern, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Fungizide |
| DE2455954A1 (de) * | 1974-11-27 | 1976-08-12 | Bayer Ag | Diaryloxy-imidazolyl-o,n-acetale, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
| DE2600800C2 (de) * | 1976-01-10 | 1986-10-30 | Bayer Ag, 5090 Leverkusen | Verfahren zur Bekämpfung von Pilzen im Haushaltssektor |
| DE2635666A1 (de) * | 1976-08-07 | 1978-02-09 | Bayer Ag | 1-azolyl-4-hydroxy-butan-derivate, verfahren zu ihrer herstellung sowie ihre verwendung als fungizide und bakterizide |
| DK156408C (da) * | 1977-01-18 | 1990-01-22 | Bayer Ag | Fremgangsmaade til bekaempelse af svampe inden for husholdningssektoren ved hjaelp af 1-(4-chlorphenoxy)-1-imidazolyl-(1)-3,3-dimethyl-butan-2-on |
| NL185815C (nl) * | 1977-01-26 | 1990-08-01 | Bayer Ag | Werkwijze voor het bestrijden van micro-organismen alsmede gevormd voortbrengsel, geheel of ten dele bestaande uit materiaal, dat volgens deze werkwijze behandeld is. |
| DE2720868A1 (de) * | 1977-05-10 | 1978-11-23 | Bayer Ag | Antimikrobielle mittel |
| DE2720949A1 (de) * | 1977-05-10 | 1978-11-23 | Bayer Ag | Azolylaether-derivate, verfahren zu ihrer herstellung sowie ihre verwendung als fungizide |
| DE2832234A1 (de) * | 1978-07-21 | 1980-01-31 | Bayer Ag | Alpha -azolyl-keto-derivate, verfahren zu ihrer herstellung und ihre verwendung als fungizide |
| US4166854A (en) * | 1978-11-02 | 1979-09-04 | The Dow Chemical Company | Substituted 1-pyridinyloxy-1-(imidazolyl)-2-butanone compounds and their use as fungicides |
| DE2918893A1 (de) * | 1979-05-10 | 1980-11-20 | Bayer Ag | Fluorierte 1-imidazolyl-butan-derivate, verfahren zu ihrer herstellung und ihre verwendung als fungizide |
| DE3047726A1 (de) * | 1980-12-18 | 1982-07-15 | Basf Ag, 6700 Ludwigshafen | Wachstumsregulierende (alpha)-azolylglykole, ihre herstellung und verwendung |
| DE3132335A1 (de) * | 1981-08-17 | 1983-03-03 | Bayer Ag, 5090 Leverkusen | Substituierte azolyl-phenoxy-derivate, verfahren zu ihrer herstellung und ihre verwendung als fungizide |
| DE3150204A1 (de) * | 1981-12-18 | 1983-06-30 | Basf Ag, 6700 Ludwigshafen | Fungizide alpha-azolylglykole |
| DE3540523A1 (de) | 1985-11-15 | 1987-05-27 | Bayer Ag | Azolyletherketone und -alkohole |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3575999A (en) * | 1968-08-19 | 1971-04-20 | Janssen Pharmaceutica Nv | Ketal derivatives of imidazole |
| DE2105490C3 (de) * | 1971-02-05 | 1979-06-13 | Bayer Ag, 5090 Leverkusen | 1 -Imidazolylketonderivate |
-
1973
- 1973-05-18 DE DE2325156A patent/DE2325156A1/de active Pending
-
1974
- 1974-05-14 US US469938A patent/US3898341A/en not_active Expired - Lifetime
- 1974-05-14 IL IL44821A patent/IL44821A/en unknown
- 1974-05-15 NL NL7406529A patent/NL7406529A/xx not_active Application Discontinuation
- 1974-05-15 CH CH666374A patent/CH563717A5/xx not_active IP Right Cessation
- 1974-05-15 TR TR18125A patent/TR18125A/xx unknown
- 1974-05-16 DD DD178554A patent/DD114498A5/xx unknown
- 1974-05-16 FI FI1512/74A patent/FI151274A7/fi unknown
- 1974-05-16 BE BE144379A patent/BE815110A/xx unknown
- 1974-05-16 LU LU70105A patent/LU70105A1/xx unknown
- 1974-05-16 SU SU2027849A patent/SU511832A3/ru active
- 1974-05-17 HU HUBA3075A patent/HU169482B/hu unknown
- 1974-05-17 BR BR4029/74A patent/BR7404029D0/pt unknown
- 1974-05-17 IE IE1063/74A patent/IE39271B1/xx unknown
- 1974-05-17 FR FR7417259A patent/FR2229352B1/fr not_active Expired
- 1974-05-17 ZA ZA00743155A patent/ZA743155B/xx unknown
- 1974-05-17 AT AT410074A patent/AT335224B/de not_active IP Right Cessation
- 1974-05-17 DK DK271674A patent/DK133847C/da active
- 1974-05-17 GB GB2201974A patent/GB1419734A/en not_active Expired
- 1974-05-18 JP JP49055023A patent/JPS5018633A/ja active Pending
-
1976
- 1976-04-28 ES ES426401A patent/ES426401A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DK133847B (da) | 1976-08-02 |
| JPS5018633A (enExample) | 1975-02-27 |
| FI151274A7 (enExample) | 1974-11-19 |
| GB1419734A (en) | 1975-12-31 |
| ATA410074A (de) | 1976-06-15 |
| AU6899674A (en) | 1975-11-20 |
| AT335224B (de) | 1977-02-25 |
| ES426401A1 (es) | 1976-12-16 |
| IE39271L (en) | 1974-11-18 |
| BR7404029D0 (pt) | 1974-11-26 |
| ZA743155B (en) | 1975-05-28 |
| LU70105A1 (enExample) | 1975-02-24 |
| DD114498A5 (enExample) | 1975-08-12 |
| BE815110A (fr) | 1974-11-18 |
| FR2229352B1 (enExample) | 1978-11-17 |
| NL7406529A (enExample) | 1974-11-20 |
| IE39271B1 (en) | 1978-08-30 |
| DK133847C (da) | 1977-01-03 |
| IL44821A (en) | 1977-07-31 |
| IL44821A0 (en) | 1974-07-31 |
| HU169482B (enExample) | 1976-12-28 |
| CH563717A5 (enExample) | 1975-07-15 |
| TR18125A (tr) | 1977-03-01 |
| FR2229352A1 (enExample) | 1974-12-13 |
| DE2325156A1 (de) | 1974-12-05 |
| US3898341A (en) | 1975-08-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| KR100414385B1 (ko) | 살진균성 조성물 및 그의 제조방법 | |
| JP3682988B2 (ja) | 殺菌・殺カビ組成物 | |
| SU831050A3 (ru) | Способ борьбы с грибками | |
| JP2530590B2 (ja) | 殺菌・殺カビ剤 | |
| SU511832A3 (ru) | Фунгицид и микробицид | |
| AU592159B2 (en) | Fungicidal use of a cyanopyrrole derivative | |
| EA002598B1 (ru) | Фунгицидное синергитическое средство и способ борьбы с грибами | |
| JPH06329505A (ja) | 殺菌殺カビ活性を有する化合物の組み合わせ | |
| JPS60190770A (ja) | トリアゾリル−o,n−アセタ−ルジアステレオマ− | |
| KR100334348B1 (ko) | 살진균제 조성물 | |
| JPH0534322B2 (enExample) | ||
| SU515428A3 (ru) | Способ борьбы с грибковыми заболевани ми растений | |
| JPH058161B2 (enExample) | ||
| HU176746B (en) | Fungicide compositions comtaining 1-bracket-2-halogeno-2-phenyl-ethyl-bracket closed-triasole derivatives as active agents and process for producing the active agents | |
| AU639289B2 (en) | Fungicidal active compound combinations | |
| SU663262A3 (ru) | Фунгицидное средство | |
| US4164582A (en) | Synergistic fungicidal compositions | |
| US5126360A (en) | Fungicidal active compound combinations | |
| KR0179660B1 (ko) | 살충 및 살진균제 | |
| SU849976A3 (ru) | Фунгицидоинсектицидное средство | |
| TW478923B (en) | Fungicidal mixtures | |
| US4914119A (en) | Fungicidal agents | |
| KR100387586B1 (ko) | 살진균활성 화합물의 배합물 | |
| JP3624209B2 (ja) | 農園芸用殺菌剤 | |
| SU698513A3 (ru) | Фунгицидное средство |