SU460624A3 - Способ получени пиридилпиперазинов или их солей - Google Patents
Способ получени пиридилпиперазинов или их солейInfo
- Publication number
- SU460624A3 SU460624A3 SU1785482A SU1785482A SU460624A3 SU 460624 A3 SU460624 A3 SU 460624A3 SU 1785482 A SU1785482 A SU 1785482A SU 1785482 A SU1785482 A SU 1785482A SU 460624 A3 SU460624 A3 SU 460624A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- piperazine
- pyridyl
- salts
- pyridylpiperazines
- amidoethyl
- Prior art date
Links
- 238000000034 method Methods 0.000 title description 4
- 150000003839 salts Chemical class 0.000 title description 3
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 5
- RXSLHYTZMIUANX-UHFFFAOYSA-N 6-acetamidopyridine-3-carboxylic acid Chemical compound CC(=O)NC1=CC=C(C(O)=O)C=N1 RXSLHYTZMIUANX-UHFFFAOYSA-N 0.000 description 4
- 239000013078 crystal Substances 0.000 description 4
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 150000008064 anhydrides Chemical class 0.000 description 3
- 235000019441 ethanol Nutrition 0.000 description 3
- 229910052500 inorganic mineral Inorganic materials 0.000 description 3
- 239000011707 mineral Substances 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- SUMDYPCJJOFFON-UHFFFAOYSA-N isethionic acid Chemical compound OCCS(O)(=O)=O SUMDYPCJJOFFON-UHFFFAOYSA-N 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 235000005985 organic acids Nutrition 0.000 description 2
- -1 p-acetylaminated heterocyclic carboxylic acid Chemical class 0.000 description 2
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- IOJXSDNSPBIEPZ-UHFFFAOYSA-N 2-(4-pyridin-2-ylpiperazin-1-yl)ethanamine Chemical compound C1CN(CCN)CCN1C1=CC=CC=N1 IOJXSDNSPBIEPZ-UHFFFAOYSA-N 0.000 description 1
- WCRZRMVBDPUGRW-UHFFFAOYSA-N 2-[4-(4-methylpyridin-2-yl)piperazin-1-yl]ethanamine Chemical compound CC1=CC=NC(N2CCN(CCN)CC2)=C1 WCRZRMVBDPUGRW-UHFFFAOYSA-N 0.000 description 1
- 125000000022 2-aminoethyl group Chemical group [H]C([*])([H])C([H])([H])N([H])[H] 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid group Chemical group C(C1=CC=CC=C1)(=O)O WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229940045996 isethionic acid Drugs 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- 150000003016 phosphoric acids Chemical class 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- ILWRPSCZWQJDMK-UHFFFAOYSA-N triethylazanium;chloride Chemical compound Cl.CCN(CC)CC ILWRPSCZWQJDMK-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/14—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing three or more hetero rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pyridine Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB1487771 | 1971-05-14 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU460624A3 true SU460624A3 (ru) | 1975-02-15 |
Family
ID=10049096
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU1785482A SU460624A3 (ru) | 1971-05-14 | 1972-05-12 | Способ получени пиридилпиперазинов или их солей |
Country Status (17)
| Country | Link |
|---|---|
| US (1) | US3821225A (enExample) |
| JP (1) | JPS5111635B1 (enExample) |
| AT (1) | AT316561B (enExample) |
| AU (1) | AU458800B2 (enExample) |
| BE (1) | BE783420A (enExample) |
| CA (1) | CA957374A (enExample) |
| CH (1) | CH553198A (enExample) |
| DK (1) | DK137757B (enExample) |
| FR (1) | FR2137689B1 (enExample) |
| GB (1) | GB1345449A (enExample) |
| HU (1) | HU163334B (enExample) |
| IE (1) | IE36441B1 (enExample) |
| NL (1) | NL146500B (enExample) |
| NO (1) | NO134986C (enExample) |
| SE (1) | SE381468B (enExample) |
| SU (1) | SU460624A3 (enExample) |
| ZA (1) | ZA722735B (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| RU2156763C2 (ru) * | 1994-07-15 | 2000-09-27 | Мейдзи Сейка Кабусики Кайся | Азотсодержащие гетероциклические производные, фармацевтическая композиция на их основе и способ лечения или профилактики тромботических заболеваний |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4895846A (en) * | 1984-04-11 | 1990-01-23 | Bristol-Myers Company | Pharmaceutically useful dihydropyridinyldicarboxylate amides and esters incorporating arylpiperazinylalkyl moieties |
| US4755512A (en) * | 1984-04-11 | 1988-07-05 | Bristol-Myers Company | Pharmaceutically useful dihydropyridinyldicarboxylate amides and esters incorporating arylpiperazinylalkyl moities |
| DE4425143A1 (de) * | 1994-07-15 | 1996-01-18 | Basf Ag | Substituierte Pyrimidinverbindungen und deren Verwendung |
| EP1363702A4 (en) * | 2001-01-30 | 2007-08-22 | Cytopia Pty Ltd | PROCESS FOR INHIBITING KINASES |
| AU2002226197B2 (en) * | 2001-01-30 | 2006-02-16 | Cytopia Pty Ltd | Methods of inhibiting kinases |
| US7176310B1 (en) | 2002-04-09 | 2007-02-13 | Ucb Sa | Pyrimidinecarboxamide derivatives and their use as anti-inflammatory agents |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1279843A (en) * | 1969-05-23 | 1972-06-28 | Science Union & Cie | Benzamidoethyl-piperazines and process for their preparation |
-
1971
- 1971-05-14 GB GB1487771*[A patent/GB1345449A/en not_active Expired
-
1972
- 1972-04-24 ZA ZA722735A patent/ZA722735B/xx unknown
- 1972-05-02 AU AU41763/72A patent/AU458800B2/en not_active Expired
- 1972-05-05 US US00250567A patent/US3821225A/en not_active Expired - Lifetime
- 1972-05-09 CH CH684172A patent/CH553198A/fr not_active IP Right Cessation
- 1972-05-09 SE SE7206147A patent/SE381468B/xx unknown
- 1972-05-09 AT AT405672A patent/AT316561B/de not_active IP Right Cessation
- 1972-05-10 FR FR7216617A patent/FR2137689B1/fr not_active Expired
- 1972-05-11 IE IE630/72A patent/IE36441B1/xx unknown
- 1972-05-11 CA CA142,220*7A patent/CA957374A/en not_active Expired
- 1972-05-12 JP JP47046508A patent/JPS5111635B1/ja active Pending
- 1972-05-12 NL NL727206392A patent/NL146500B/xx unknown
- 1972-05-12 SU SU1785482A patent/SU460624A3/ru active
- 1972-05-12 DK DK237172AA patent/DK137757B/da unknown
- 1972-05-12 BE BE783420A patent/BE783420A/xx unknown
- 1972-05-12 NO NO1707/72A patent/NO134986C/no unknown
- 1972-05-13 HU HUSI1264A patent/HU163334B/hu unknown
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| RU2156763C2 (ru) * | 1994-07-15 | 2000-09-27 | Мейдзи Сейка Кабусики Кайся | Азотсодержащие гетероциклические производные, фармацевтическая композиция на их основе и способ лечения или профилактики тромботических заболеваний |
Also Published As
| Publication number | Publication date |
|---|---|
| DE2222934A1 (de) | 1972-11-30 |
| NL146500B (nl) | 1975-07-15 |
| NO134986C (enExample) | 1977-01-19 |
| NL7206392A (enExample) | 1972-11-16 |
| US3821225A (en) | 1974-06-28 |
| AU4176372A (en) | 1973-11-08 |
| IE36441B1 (en) | 1976-11-10 |
| ZA722735B (en) | 1973-05-30 |
| GB1345449A (en) | 1974-01-30 |
| AT316561B (de) | 1974-07-25 |
| CA957374A (en) | 1974-11-05 |
| FR2137689B1 (enExample) | 1975-10-31 |
| DE2222934B2 (de) | 1976-08-26 |
| CH553198A (fr) | 1974-08-30 |
| JPS5111635B1 (enExample) | 1976-04-13 |
| SE381468B (sv) | 1975-12-08 |
| BE783420A (fr) | 1972-11-13 |
| HU163334B (enExample) | 1973-07-28 |
| DK137757B (da) | 1978-05-01 |
| DK137757C (enExample) | 1978-10-02 |
| FR2137689A1 (enExample) | 1972-12-29 |
| IE36441L (en) | 1972-11-14 |
| AU458800B2 (en) | 1975-03-06 |
| NO134986B (enExample) | 1976-10-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| KR850000888B1 (ko) | 삼-치환 이미다졸 유도체의 제조방법 | |
| SU865125A3 (ru) | Способ получени производных имидазола или их солей | |
| SU460624A3 (ru) | Способ получени пиридилпиперазинов или их солей | |
| SU469246A3 (ru) | Способ получени 2-фурилметил/-6,7бензоморфанов | |
| US3432522A (en) | Pyrrole-2-carboxamido alkylene amidines | |
| US2569801A (en) | Preparation of azlactones of phenylacetamino acrylic acids | |
| SU784766A3 (ru) | Способ получени бенз-ацил-бензимидазол(2)-производных | |
| SU442601A1 (ru) | Способ получени производных азепина | |
| US5089616A (en) | Process for the preparation of [1S-(1R*,2S*,3R*)]-N-(4-morpholinylsulfonyl)-L-phenylalanyl-3-(2-amino-4-thiazolyl-N-[(1-cyclohexylmethyl)-2,3-dihydroxy-5-methylhexyl]-L-alaninamide | |
| DE3883891T2 (de) | Benzimidazol-Derivate und Verfahren zu deren Herstellung. | |
| SU468419A3 (ru) | Способ получени амидов лизергиновой кислоты или их солей | |
| SU500759A3 (ru) | Способ получени производных 2-/5-нитро-2-фурил/-тиено/2,3- д / пиримидина | |
| US2524838A (en) | Esters of pyridyl-3-carbinol | |
| SU451245A3 (ru) | Способ получени гетероциклически замещенных производных небуларина | |
| SU733517A3 (ru) | Способ получени триазинонов | |
| US3390150A (en) | Process for the preparation of 1-(beta-hydroxyethyl)-5-nitroimidazole-2-carboxylic acid gamma-lactone | |
| SU528878A3 (ru) | Способ получени производных (гетероарилметил)-дезоксинорморфина или- дезоксиноркодеина, или их солей | |
| US3245998A (en) | Processes for the production of picolinic acid dericatives | |
| DE2362687A1 (de) | Verfahren zur razematspaltung von d,l-penicillamin | |
| Laliberte et al. | IMPROVED SYNTHESIS OF N-ALKYL-ASPARTIC ACIDS | |
| JPS5852995B2 (ja) | フルフラ−ル誘導体の製造法 | |
| SU584781A3 (ru) | Способ получени производных 1-ацилгомопиримидазола или их солей | |
| US2724714A (en) | 2 methyl-3 acetyl-4, 5 pyridine dicarboxylic acid, lower alkyl esters thereof and intermediates | |
| HU195485B (en) | Process for producing aromatic carboxylic acid derivatives and -carboxamide derivatives | |
| SU143810A1 (ru) | Способ получени n-алкоксипроизводных n'-бис-(бета-хлорэтил)-аминометилазобензола |