SU432721A3 - Способ получения производных 3-формилрифамицина sv - Google Patents
Способ получения производных 3-формилрифамицина svInfo
- Publication number
- SU432721A3 SU432721A3 SU1789260A SU1789260A SU432721A3 SU 432721 A3 SU432721 A3 SU 432721A3 SU 1789260 A SU1789260 A SU 1789260A SU 1789260 A SU1789260 A SU 1789260A SU 432721 A3 SU432721 A3 SU 432721A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- derivatives
- formylrifamycin
- substituted
- mono
- formylrifamination
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 8
- -1 tsnkloalkil- Chemical group 0.000 claims description 69
- 125000000217 alkyl group Chemical group 0.000 claims description 7
- BBNQHOMJRFAQBN-UPZFVJMDSA-N 3-formylrifamycin sv Chemical compound OC1=C(C(O)=C2C)C3=C(O)C(C=O)=C1NC(=O)\C(C)=C/C=C/[C@H](C)[C@H](O)[C@@H](C)[C@@H](O)[C@@H](C)[C@H](OC(C)=O)[C@H](C)[C@@H](OC)\C=C\O[C@@]1(C)OC2=C3C1=O BBNQHOMJRFAQBN-UPZFVJMDSA-N 0.000 claims description 6
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- 125000003342 alkenyl group Chemical group 0.000 claims description 4
- 125000000304 alkynyl group Chemical group 0.000 claims description 4
- 125000000623 heterocyclic group Chemical group 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 3
- 125000005842 heteroatom Chemical group 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 229910052757 nitrogen Inorganic materials 0.000 claims description 3
- 239000003960 organic solvent Substances 0.000 claims description 3
- 229910052760 oxygen Inorganic materials 0.000 claims description 3
- 239000001301 oxygen Substances 0.000 claims description 3
- 125000001424 substituent group Chemical group 0.000 claims description 3
- 229910052717 sulfur Inorganic materials 0.000 claims description 3
- 239000011593 sulfur Substances 0.000 claims description 3
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 claims description 2
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 2
- 125000004181 carboxyalkyl group Chemical group 0.000 claims description 2
- 238000006243 chemical reaction Methods 0.000 claims description 2
- 238000007796 conventional method Methods 0.000 claims description 2
- JYEUMXHLPRZUAT-UHFFFAOYSA-N 1,2,3-triazine Chemical compound C1=CN=NN=C1 JYEUMXHLPRZUAT-UHFFFAOYSA-N 0.000 claims 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 claims 1
- 125000004429 atom Chemical group 0.000 claims 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims 1
- 230000003993 interaction Effects 0.000 claims 1
- 238000004519 manufacturing process Methods 0.000 claims 1
- 230000035515 penetration Effects 0.000 claims 1
- 238000006467 substitution reaction Methods 0.000 claims 1
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 6
- 150000001875 compounds Chemical class 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 125000000753 cycloalkyl group Chemical group 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 150000002443 hydroxylamines Chemical class 0.000 description 2
- 150000002923 oximes Chemical class 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- FPZWZCWUIYYYBU-UHFFFAOYSA-N 2-(2-ethoxyethoxy)ethyl acetate Chemical group CCOCCOCCOC(C)=O FPZWZCWUIYYYBU-UHFFFAOYSA-N 0.000 description 1
- 125000003006 2-dimethylaminoethyl group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- SXIFAEWFOJETOA-UHFFFAOYSA-N 4-hydroxy-butyl Chemical group [CH2]CCCO SXIFAEWFOJETOA-UHFFFAOYSA-N 0.000 description 1
- 229930189077 Rifamycin Natural products 0.000 description 1
- BTVYFIMKUHNOBZ-ZDHWWVNNSA-N Rifamycin S Natural products COC1C=COC2(C)Oc3c(C)c(O)c4C(=O)C(=CC(=O)c4c3C2=O)NC(=O)C(=C/C=C/C(C)C(O)C(C)C(O)C(C)C(OC(=O)C)C1C)C BTVYFIMKUHNOBZ-ZDHWWVNNSA-N 0.000 description 1
- BTVYFIMKUHNOBZ-ODRIEIDWSA-N Rifamycin S Chemical compound O=C1C(C(O)=C2C)=C3C(=O)C=C1NC(=O)\C(C)=C/C=C/[C@H](C)[C@H](O)[C@@H](C)[C@@H](O)[C@@H](C)[C@H](OC(C)=O)[C@H](C)[C@@H](OC)\C=C\O[C@@]1(C)OC2=C3C1=O BTVYFIMKUHNOBZ-ODRIEIDWSA-N 0.000 description 1
- TUCNEACPLKLKNU-UHFFFAOYSA-N acetyl Chemical compound C[C]=O TUCNEACPLKLKNU-UHFFFAOYSA-N 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 125000004103 aminoalkyl group Chemical group 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000005160 aryl oxy alkyl group Chemical group 0.000 description 1
- 125000002837 carbocyclic group Chemical group 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 125000004858 cycloalkoxyalkyl group Chemical group 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000004985 dialkyl amino alkyl group Chemical group 0.000 description 1
- 125000004663 dialkyl amino group Chemical group 0.000 description 1
- 230000008034 disappearance Effects 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 125000004971 nitroalkyl group Chemical group 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 125000005429 oxyalkyl group Chemical group 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000005344 pyridylmethyl group Chemical group [H]C1=C([H])C([H])=C([H])C(=N1)C([H])([H])* 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- HJYYPODYNSCCOU-ODRIEIDWSA-N rifamycin SV Chemical class OC1=C(C(O)=C2C)C3=C(O)C=C1NC(=O)\C(C)=C/C=C/[C@H](C)[C@H](O)[C@@H](C)[C@@H](O)[C@@H](C)[C@H](OC(C)=O)[C@H](C)[C@@H](OC)\C=C\O[C@@]1(C)OC2=C3C1=O HJYYPODYNSCCOU-ODRIEIDWSA-N 0.000 description 1
- BTVYFIMKUHNOBZ-QXMMDKDBSA-N rifamycin s Chemical class O=C1C(C(O)=C2C)=C3C(=O)C=C1NC(=O)\C(C)=C/C=C\C(C)C(O)C(C)C(O)C(C)C(OC(C)=O)C(C)C(OC)\C=C/OC1(C)OC2=C3C1=O BTVYFIMKUHNOBZ-QXMMDKDBSA-N 0.000 description 1
- 229940081192 rifamycins Drugs 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D498/00—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D498/02—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and oxygen atoms as the only ring hetero atoms in which the condensed system contains two hetero rings
- C07D498/08—Bridged systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Transition And Organic Metals Composition Catalysts For Addition Polymerization (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT2549371 | 1971-06-07 | ||
| IT8960771A IT1045053B (it) | 1971-06-24 | 1971-06-24 | Perivati della 3 fornil rifamicina sv |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU432721A3 true SU432721A3 (ru) | 1974-06-15 |
Family
ID=26328602
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU1789260A SU432721A3 (ru) | 1971-06-07 | 1972-06-05 | Способ получения производных 3-формилрифамицина sv |
Country Status (20)
| Country | Link |
|---|---|
| JP (1) | JPS517679B1 (enExample) |
| AR (1) | AR192938A1 (enExample) |
| BE (1) | BE784533A (enExample) |
| CA (1) | CA966481A (enExample) |
| CH (1) | CH562248A5 (enExample) |
| DD (1) | DD99782A5 (enExample) |
| DE (1) | DE2227087C2 (enExample) |
| DK (1) | DK137992B (enExample) |
| ES (1) | ES403548A1 (enExample) |
| FI (1) | FI58923C (enExample) |
| FR (1) | FR2140534B1 (enExample) |
| GB (1) | GB1338740A (enExample) |
| HU (1) | HU163900B (enExample) |
| IE (1) | IE37664B1 (enExample) |
| IL (1) | IL39305A (enExample) |
| LU (1) | LU65461A1 (enExample) |
| NL (1) | NL153202B (enExample) |
| NO (1) | NO135316C (enExample) |
| RO (1) | RO62437A (enExample) |
| SU (1) | SU432721A3 (enExample) |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR208F (enExample) * | 1964-07-31 |
-
1972
- 1972-04-25 IL IL39305A patent/IL39305A/xx unknown
- 1972-05-02 GB GB1945772A patent/GB1338740A/en not_active Expired
- 1972-05-04 AR AR241803A patent/AR192938A1/es active
- 1972-05-11 IE IE633/72A patent/IE37664B1/xx unknown
- 1972-05-16 NO NO1747/72A patent/NO135316C/no unknown
- 1972-05-24 FI FI1449/72A patent/FI58923C/fi active
- 1972-06-02 JP JP47054997A patent/JPS517679B1/ja active Pending
- 1972-06-03 DE DE2227087A patent/DE2227087C2/de not_active Expired
- 1972-06-05 CH CH827772A patent/CH562248A5/xx not_active IP Right Cessation
- 1972-06-05 CA CA143,914A patent/CA966481A/en not_active Expired
- 1972-06-05 SU SU1789260A patent/SU432721A3/ru active
- 1972-06-05 LU LU65461D patent/LU65461A1/xx unknown
- 1972-06-05 DD DD163437A patent/DD99782A5/xx unknown
- 1972-06-06 RO RO7200071158A patent/RO62437A/ro unknown
- 1972-06-06 HU HULE658A patent/HU163900B/hu unknown
- 1972-06-06 DK DK279572AA patent/DK137992B/da unknown
- 1972-06-06 ES ES403548A patent/ES403548A1/es not_active Expired
- 1972-06-07 BE BE784533A patent/BE784533A/xx not_active IP Right Cessation
- 1972-06-07 NL NL727207698A patent/NL153202B/xx not_active IP Right Cessation
- 1972-06-07 FR FR7220488A patent/FR2140534B1/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| GB1338740A (en) | 1973-11-28 |
| IE37664B1 (en) | 1977-09-14 |
| NO135316C (enExample) | 1977-03-23 |
| AR192938A1 (es) | 1973-03-21 |
| FI58923B (fi) | 1981-01-30 |
| CH562248A5 (enExample) | 1975-05-30 |
| NL7207698A (enExample) | 1972-12-11 |
| RO62437A (fr) | 1978-01-15 |
| FR2140534B1 (enExample) | 1975-10-31 |
| ES403548A1 (es) | 1975-05-01 |
| FI58923C (fi) | 1981-05-11 |
| DK137992C (enExample) | 1978-11-13 |
| IL39305A (en) | 1975-08-31 |
| DK137992B (da) | 1978-06-19 |
| BE784533A (fr) | 1972-10-02 |
| DE2227087A1 (de) | 1973-04-12 |
| IE37664L (en) | 1972-12-07 |
| DD99782A5 (enExample) | 1973-08-20 |
| HU163900B (enExample) | 1973-11-28 |
| NL153202B (nl) | 1977-05-16 |
| FR2140534A1 (enExample) | 1973-01-19 |
| IL39305A0 (en) | 1972-06-28 |
| DE2227087C2 (de) | 1982-09-02 |
| CA966481A (en) | 1975-04-22 |
| NO135316B (enExample) | 1976-12-13 |
| LU65461A1 (enExample) | 1972-10-23 |
| JPS517679B1 (enExample) | 1976-03-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU537626A3 (ru) | Способ получени производных алканоламина | |
| Nielsen et al. | Cyclic nitronic esters: Synthesis of substituted 5, 6-polymethylene-5, 6-dihydro-4H-1, 2-oxazine 2-oxides by reaction of enamines with nitroolefins | |
| SU432721A3 (ru) | Способ получения производных 3-формилрифамицина sv | |
| Lawson Jr | 2-Vinylimidazole and 1-methyl-2-vinylimidazole | |
| SU578884A3 (ru) | Способ получени производных триазолоизоиндола | |
| Bousquet et al. | Synthesis of 3, 3a-dihydro-8H-pyrazolo [5, 1-a] isoindol-8-ones and 8H-pyrazolo [5, 1-a] isoindol-8-ones | |
| CA2258539C (en) | Ring-fused dihydropyranes, process for the preparation and use thereof | |
| Orazi et al. | Substitution in the hydrantoin ring—I: Aminomethylation | |
| Mazurkiewicz | Novel synthesis and rearrangement of 3, 1, 5-benzoxadiazepines | |
| SAIKACHI et al. | Synthesis of Furan Derivatives. LIX. Synthesis of 5-Substituted-2-(2-furyl)-1, 3, 4-oxadiazoles from 1-Furoyl-2-arylidenehydrazine with Lead Tetraacetate | |
| Pinson et al. | Synthesis and structure of 1-methyl-2, 3-dihydro-1, 2, 4-triazolium salts and their free bases | |
| SU440841A1 (ru) | Способ получения гидразонов 3-формилрифамицина sv | |
| US4254259A (en) | 2-Amino-5-ethylovalyl-6H-1,3,4-thiadiazine oxime | |
| CN111646975A (zh) | N-甲基洛美沙星的丙烯酮衍生物及其制备方法和应用 | |
| Manske et al. | The Alkaloids of Fumariaceous Plants. XLVI. The Structure of Glaucentrine | |
| SU434657A3 (ru) | Способ получения производных рифамицина sv | |
| Lüönd et al. | Michael Reactions of α‐Unsubstituted Trisubstituted 1H‐Pyrroles | |
| Bolis et al. | v-Triazolines. Part 8. 1-Aryl-4-alkyl-and-aryl-thiomethyl-5-amino-v-triazolines: synthesis and reactions with bases | |
| SU462470A1 (ru) | Способ получени производных 2-аминофенотиазона-3 | |
| UEHARA | Synthesis of Furan Derivatives. LIX. Synthesis of 5-Substituted-2-(2-furyl)-1, 3, 4-oxadiazoles from 1-Furoyl-2-arylidenehydrazine with Lead Tetraacetate | |
| Moore et al. | Heterocyclic Studies. XXII. The Rearrangement of 2, 3-Dihydro-1, 2-diazepin-4-ols to Furfurylhydrazine1 | |
| SU721441A1 (ru) | Способ получени производных 1,2,3-триазоло/1,5-а/хиноксалона-4 | |
| CN110256462B (zh) | 对氟苯基取代含色酮结构的螺[吲唑-异噁唑]衍生物及制备方法与应用 | |
| SU1027166A1 (ru) | Способ получени 1,2-полиметиленкетоцианоазагетероциклов | |
| SU414247A1 (enExample) |