DK137992B - Analogifremgangsmåde til fremstilling af 3-formylrifamycin SV-oximderivater. - Google Patents
Analogifremgangsmåde til fremstilling af 3-formylrifamycin SV-oximderivater.Info
- Publication number
- DK137992B DK137992B DK279572AA DK279572A DK137992B DK 137992 B DK137992 B DK 137992B DK 279572A A DK279572A A DK 279572AA DK 279572 A DK279572 A DK 279572A DK 137992 B DK137992 B DK 137992B
- Authority
- DK
- Denmark
- Prior art keywords
- formylrifamycin
- preparation
- oxime derivatives
- analogous process
- analogous
- Prior art date
Links
- GRDITWOBURDWBB-TZASWVIWSA-N 3-formylrifamycin sv oxime Chemical class OC=1C(C(O)=C2C)=C3C(=O)\C(=C\NO)C=1NC(=O)\C(C)=C\C=C\[C@H](C)[C@H](O)[C@@H](C)[C@@H](O)[C@@H](C)[C@H](OC(C)=O)[C@H](C)[C@@H](OC)\C=C\O[C@@]1(C)OC2=C3C1=O GRDITWOBURDWBB-TZASWVIWSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D498/00—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D498/02—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and oxygen atoms as the only ring hetero atoms in which the condensed system contains two hetero rings
- C07D498/08—Bridged systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Transition And Organic Metals Composition Catalysts For Addition Polymerization (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT2549371 | 1971-06-07 | ||
| IT8960771A IT1045053B (it) | 1971-06-24 | 1971-06-24 | Perivati della 3 fornil rifamicina sv |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DK137992B true DK137992B (da) | 1978-06-19 |
| DK137992C DK137992C (da) | 1978-11-13 |
Family
ID=26328602
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK279572AA DK137992B (da) | 1971-06-07 | 1972-06-06 | Analogifremgangsmåde til fremstilling af 3-formylrifamycin SV-oximderivater. |
Country Status (20)
| Country | Link |
|---|---|
| JP (1) | JPS517679B1 (da) |
| AR (1) | AR192938A1 (da) |
| BE (1) | BE784533A (da) |
| CA (1) | CA966481A (da) |
| CH (1) | CH562248A5 (da) |
| DD (1) | DD99782A5 (da) |
| DE (1) | DE2227087C2 (da) |
| DK (1) | DK137992B (da) |
| ES (1) | ES403548A1 (da) |
| FI (1) | FI58923C (da) |
| FR (1) | FR2140534B1 (da) |
| GB (1) | GB1338740A (da) |
| HU (1) | HU163900B (da) |
| IE (1) | IE37664B1 (da) |
| IL (1) | IL39305A (da) |
| LU (1) | LU65461A1 (da) |
| NL (1) | NL153202B (da) |
| NO (1) | NO135316C (da) |
| RO (1) | RO62437A (da) |
| SU (1) | SU432721A3 (da) |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR208F (da) * | 1964-07-31 |
-
1972
- 1972-04-25 IL IL39305A patent/IL39305A/xx unknown
- 1972-05-02 GB GB1945772A patent/GB1338740A/en not_active Expired
- 1972-05-04 AR AR241803A patent/AR192938A1/es active
- 1972-05-11 IE IE633/72A patent/IE37664B1/xx unknown
- 1972-05-16 NO NO1747/72A patent/NO135316C/no unknown
- 1972-05-24 FI FI1449/72A patent/FI58923C/fi active
- 1972-06-02 JP JP47054997A patent/JPS517679B1/ja active Pending
- 1972-06-03 DE DE2227087A patent/DE2227087C2/de not_active Expired
- 1972-06-05 CH CH827772A patent/CH562248A5/xx not_active IP Right Cessation
- 1972-06-05 LU LU65461D patent/LU65461A1/xx unknown
- 1972-06-05 DD DD163437A patent/DD99782A5/xx unknown
- 1972-06-05 CA CA143,914A patent/CA966481A/en not_active Expired
- 1972-06-05 SU SU1789260A patent/SU432721A3/ru active
- 1972-06-06 HU HULE658A patent/HU163900B/hu unknown
- 1972-06-06 ES ES403548A patent/ES403548A1/es not_active Expired
- 1972-06-06 RO RO7200071158A patent/RO62437A/ro unknown
- 1972-06-06 DK DK279572AA patent/DK137992B/da unknown
- 1972-06-07 BE BE784533A patent/BE784533A/xx not_active IP Right Cessation
- 1972-06-07 NL NL727207698A patent/NL153202B/xx not_active IP Right Cessation
- 1972-06-07 FR FR7220488A patent/FR2140534B1/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| IL39305A0 (en) | 1972-06-28 |
| DE2227087C2 (de) | 1982-09-02 |
| FR2140534A1 (da) | 1973-01-19 |
| NO135316C (da) | 1977-03-23 |
| GB1338740A (en) | 1973-11-28 |
| ES403548A1 (es) | 1975-05-01 |
| IE37664B1 (en) | 1977-09-14 |
| JPS517679B1 (da) | 1976-03-10 |
| AR192938A1 (es) | 1973-03-21 |
| CA966481A (en) | 1975-04-22 |
| BE784533A (fr) | 1972-10-02 |
| NL153202B (nl) | 1977-05-16 |
| RO62437A (fr) | 1978-01-15 |
| LU65461A1 (da) | 1972-10-23 |
| SU432721A3 (ru) | 1974-06-15 |
| NO135316B (da) | 1976-12-13 |
| NL7207698A (da) | 1972-12-11 |
| DD99782A5 (da) | 1973-08-20 |
| DK137992C (da) | 1978-11-13 |
| FR2140534B1 (da) | 1975-10-31 |
| DE2227087A1 (de) | 1973-04-12 |
| FI58923C (fi) | 1981-05-11 |
| FI58923B (fi) | 1981-01-30 |
| CH562248A5 (da) | 1975-05-30 |
| IL39305A (en) | 1975-08-31 |
| IE37664L (en) | 1972-12-07 |
| HU163900B (da) | 1973-11-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK138419B (da) | Fremgangsmåde til fremstilling af 1alfa-hydroxycholecalciferol. | |
| DK137329B (da) | Analogifremgangsmåde til fremstilling af 2-karbalkoksyaminobenzimidazolderivater. | |
| DK134316B (da) | Fremgangsmåde til fremstilling af methylsubstituerede cuinoner. | |
| DK136312B (da) | Analogifremgangsmåde til fremstilling af substituerede piperidinoalkanonoximderivater. | |
| DK136981B (da) | Analogifremgangsmåde til fremstilling af basisk substituerede benzylphthalazon-derivater. | |
| DK127119B (da) | Analogifremgangsmåde til fremstilling af 6-amino-9-benzylpurin-forbindelser. | |
| DK133470B (da) | Fremgangsmåde til fremstilling af 3alfa-hydroxy-5alfa-steroider. | |
| DK130212B (da) | Analogifremgangsmåde til fremstilling af 7-aminoindazolderivater. | |
| DK138796B (da) | Analogifremgangsmåde til fremstilling af 2-carboxypyrazin-4-oxidderivater. | |
| DK135122B (da) | Analogifremgangsmåde til fremstilling af 4-aryl-5-aminoalkyl-4-oxazolin-2-onderivater. | |
| DK131864B (da) | Fremgangsmåde til fremstilling af pregnan-21-syrederivater. | |
| DK133464B (da) | Analogifremgangsmåde til fremstilling af nitrosourinstofderivater. | |
| DK130957B (da) | Fremgangsmåde til fremstilling af pregnanderivater. | |
| DK129794B (da) | Analogifremgangsmåde til fremstilling af N-acyl-3-(piperazinoethyl)-pyrazoler. | |
| DK126998B (da) | Analogifremgangsmåde til fremstilling af amino-s-triazolylbenzensulfonamidforbindelser. | |
| DK138457B (da) | Analogifremgangsmåde til fremstilling af 3-formylrifamycin SV hydrazonderivater. | |
| DK137181B (da) | Analogifremgangsmåde til fremstilling af 3-amino-kinolinderivater. | |
| DK126780B (da) | Fremgangsmåde til fremstilling af flavon-7-oxyacetater. | |
| DK133902B (da) | Fremgangsmåde til fremstilling af Cephalosporin C. | |
| DK138021B (da) | Fremgangsmåde til fremstilling af aminopenicilliner. | |
| DK139871B (da) | Analogifremgangsmåde til fremstilling af 3-isonicotinoyl-benzofuranderivater. | |
| DK137860B (da) | Analogifremgangsmåde til fremstilling af triazolobenzodiazepin-5N-oxydderivater. | |
| DK125388B (da) | Fremgangsmåde til fremstilling af phenylaminoethanolderivater. | |
| DK137992B (da) | Analogifremgangsmåde til fremstilling af 3-formylrifamycin SV-oximderivater. | |
| DK129049B (da) | Analogifremgangsmåde til fremstilling af α-aminobenzylpenicillinderivater. |