SU429581A3 - Способ получения производных 2,4-диамино-5-бензил пиримидина12 - Google Patents
Способ получения производных 2,4-диамино-5-бензил пиримидина12Info
- Publication number
- SU429581A3 SU429581A3 SU1707802A SU1707802A SU429581A3 SU 429581 A3 SU429581 A3 SU 429581A3 SU 1707802 A SU1707802 A SU 1707802A SU 1707802 A SU1707802 A SU 1707802A SU 429581 A3 SU429581 A3 SU 429581A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- carbon atoms
- group
- alkoxy
- alkoxy group
- represent
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 6
- ZRALSGWEFCBTJO-UHFFFAOYSA-N Guanidine Chemical compound NC(N)=N ZRALSGWEFCBTJO-UHFFFAOYSA-N 0.000 claims description 12
- 125000004432 carbon atom Chemical group C* 0.000 claims description 11
- 150000001875 compounds Chemical class 0.000 claims description 11
- -1 atoms hydrogen Chemical class 0.000 claims description 9
- 125000003545 alkoxy group Chemical group 0.000 claims description 8
- 125000000217 alkyl group Chemical group 0.000 claims description 8
- CHJJGSNFBQVOTG-UHFFFAOYSA-N N-methyl-guanidine Natural products CNC(N)=N CHJJGSNFBQVOTG-UHFFFAOYSA-N 0.000 claims description 6
- SWSQBOPZIKWTGO-UHFFFAOYSA-N dimethylaminoamidine Natural products CN(C)C(N)=N SWSQBOPZIKWTGO-UHFFFAOYSA-N 0.000 claims description 6
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 5
- 150000003839 salts Chemical class 0.000 claims description 4
- 125000005530 alkylenedioxy group Chemical group 0.000 claims description 3
- 239000002904 solvent Substances 0.000 claims description 3
- 125000001931 aliphatic group Chemical group 0.000 claims description 2
- 125000004414 alkyl thio group Chemical group 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims description 2
- 125000000623 heterocyclic group Chemical group 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims 2
- 239000001257 hydrogen Substances 0.000 claims 2
- 239000005631 2,4-Dichlorophenoxyacetic acid Substances 0.000 claims 1
- 125000003277 amino group Chemical group 0.000 claims 1
- 125000004429 atom Chemical group 0.000 claims 1
- 238000002955 isolation Methods 0.000 claims 1
- 238000004519 manufacturing process Methods 0.000 claims 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 10
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 8
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 5
- 229960004198 guanidine Drugs 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 4
- FWGBYLOVKFIONM-UHFFFAOYSA-N 5-[(3,4,5-triethylphenyl)methyl]pyrimidine-2,4-diamine Chemical compound CCC1=C(CC)C(CC)=CC(CC=2C(=NC(N)=NC=2)N)=C1 FWGBYLOVKFIONM-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- 125000004036 acetal group Chemical group 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- SPEUIVXLLWOEMJ-UHFFFAOYSA-N 1,1-dimethoxyethane Chemical compound COC(C)OC SPEUIVXLLWOEMJ-UHFFFAOYSA-N 0.000 description 2
- UVSGKUPBGMJLPF-UHFFFAOYSA-N 3,4,5-triethylbenzoic acid Chemical compound CCC1=CC(C(O)=O)=CC(CC)=C1CC UVSGKUPBGMJLPF-UHFFFAOYSA-N 0.000 description 2
- GNKZMNRKLCTJAY-UHFFFAOYSA-N 4'-Methylacetophenone Chemical compound CC(=O)C1=CC=C(C)C=C1 GNKZMNRKLCTJAY-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 229960000789 guanidine hydrochloride Drugs 0.000 description 2
- PJJJBBJSCAKJQF-UHFFFAOYSA-N guanidinium chloride Chemical compound [Cl-].NC(N)=[NH2+] PJJJBBJSCAKJQF-UHFFFAOYSA-N 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- HHVIBTZHLRERCL-UHFFFAOYSA-N sulfonyldimethane Chemical compound CS(C)(=O)=O HHVIBTZHLRERCL-UHFFFAOYSA-N 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- LGGHAMIADSDYOH-UHFFFAOYSA-N 3,4,5-triethylbenzaldehyde Chemical compound CCC1=CC(C=O)=CC(CC)=C1CC LGGHAMIADSDYOH-UHFFFAOYSA-N 0.000 description 1
- JYRMTJGESFSOCI-UHFFFAOYSA-N 3,5-diethyl-4-methylbenzoic acid Chemical compound CC1=C(C=C(C(=O)O)C=C1CC)CC JYRMTJGESFSOCI-UHFFFAOYSA-N 0.000 description 1
- OOJLJEDKMZDNKK-UHFFFAOYSA-N 5-[(3,5-diethyl-4-methoxyphenyl)methyl]pyrimidine-2,4-diamine Chemical class CCC1=C(OC)C(CC)=CC(CC=2C(=NC(N)=NC=2)N)=C1 OOJLJEDKMZDNKK-UHFFFAOYSA-N 0.000 description 1
- BDJMGVKFSMHFAT-UHFFFAOYSA-N 5-[(3,5-diethyl-4-methylphenyl)methyl]pyrimidine-2,4-diamine Chemical compound CC1=C(C=C(CC=2C(=NC(=NC2)N)N)C=C1CC)CC BDJMGVKFSMHFAT-UHFFFAOYSA-N 0.000 description 1
- 101100537937 Caenorhabditis elegans arc-1 gene Proteins 0.000 description 1
- 101100037762 Caenorhabditis elegans rnh-2 gene Proteins 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 238000005727 Friedel-Crafts reaction Methods 0.000 description 1
- 238000006280 Rosenmund reaction Methods 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- 239000005708 Sodium hypochlorite Substances 0.000 description 1
- 125000002015 acyclic group Chemical group 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- RDHPKYGYEGBMSE-UHFFFAOYSA-N bromoethane Chemical compound CCBr RDHPKYGYEGBMSE-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- IOSYLQFJUCLFAH-UHFFFAOYSA-N methyl 3,4,5-triethylbenzoate Chemical compound CCC1=CC(C(=O)OC)=CC(CC)=C1CC IOSYLQFJUCLFAH-UHFFFAOYSA-N 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 description 1
- 239000003880 polar aprotic solvent Substances 0.000 description 1
- FVSKHRXBFJPNKK-UHFFFAOYSA-N propionitrile Chemical class CCC#N FVSKHRXBFJPNKK-UHFFFAOYSA-N 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- SUKJFIGYRHOWBL-UHFFFAOYSA-N sodium hypochlorite Chemical compound [Na+].Cl[O-] SUKJFIGYRHOWBL-UHFFFAOYSA-N 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/46—Two or more oxygen, sulphur or nitrogen atoms
- C07D239/48—Two nitrogen atoms
- C07D239/49—Two nitrogen atoms with an aralkyl radical, or substituted aralkyl radical, attached in position 5, e.g. trimethoprim
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/46—Two or more oxygen, sulphur or nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB963871*[A GB1375162A (enExample) | 1970-10-22 | 1970-10-22 | |
| GB963871 | 1971-04-16 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU429581A3 true SU429581A3 (ru) | 1974-05-25 |
Family
ID=26243063
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU1707802A SU429581A3 (ru) | 1970-10-22 | 1971-10-21 | Способ получения производных 2,4-диамино-5-бензил пиримидина12 |
Country Status (7)
| Country | Link |
|---|---|
| KR (1) | KR780000097B1 (enExample) |
| DE (1) | DE2152814A1 (enExample) |
| GB (1) | GB1375163A (enExample) |
| HU (1) | HU166528B (enExample) |
| PH (1) | PH9226A (enExample) |
| RO (1) | RO67383A (enExample) |
| SU (1) | SU429581A3 (enExample) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE792096A (fr) * | 1971-12-01 | 1973-05-30 | Hoffmann La Roche | Nouvelles benzylpyrimidines |
| GB1469521A (en) * | 1973-01-05 | 1977-04-06 | Wellcome Found | Antimicrobial preparations |
-
1971
- 1971-10-15 RO RO7168472A patent/RO67383A/ro unknown
- 1971-10-21 HU HUWE450A patent/HU166528B/hu unknown
- 1971-10-21 SU SU1707802A patent/SU429581A3/ru active
- 1971-10-21 PH PH12953*UA patent/PH9226A/en unknown
- 1971-10-22 DE DE19712152814 patent/DE2152814A1/de not_active Ceased
-
1972
- 1972-12-05 KR KR7201836A patent/KR780000097B1/ko not_active Expired
-
1974
- 1974-07-03 GB GB2955374A patent/GB1375163A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| PH9226A (en) | 1975-07-15 |
| HU166528B (enExample) | 1975-03-28 |
| DE2152814A1 (de) | 1972-05-04 |
| KR780000097B1 (en) | 1978-04-08 |
| GB1375163A (enExample) | 1974-11-27 |
| RO67383A (ro) | 1981-07-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4113731A (en) | Fused isoquinoline derivatives | |
| AU2014373959A1 (en) | 5-fluoro-4-imino-3-(alkyl/substituted alkyl)-1- (arylsulfonyl)-3,4-dihydropyrimidin-2(1H)-one and processes for their preparation | |
| CZ282922B6 (cs) | Způsob syntézy (4R-cis)-1,1-dimethylethyl-6-kyanomethyl-2,2-dimethyl-1,3-dioxan-4-acetátu a meziprodukty pro tento způsob | |
| SK281055B6 (sk) | Spôsob výroby fenoxypyrimidínových zlúčenín | |
| SE409705B (sv) | Vissa angivna nitrilforeningar till anvendning som mellanprodukter for framstellning av 2,4-diamino-5-bensylpyrimidiner med aktivitet mot malaria och bakterier | |
| MXPA05006425A (es) | Procedimiento para la preparacion de compuestos de pirimidina. | |
| SK694A3 (en) | Process for the preparation of diphenyl derivatives | |
| SU429581A3 (ru) | Способ получения производных 2,4-диамино-5-бензил пиримидина12 | |
| PL84115B3 (en) | 2-(furfuryl-methyl)-6,7-benzomorphans and acid addition salts thereof[us3823150a] | |
| US6187926B1 (en) | Process for producing quinolone derivatives | |
| SU1227111A3 (ru) | Способ получени производных гуанидина или их таутомерных соединений или их солей | |
| EP0298542B1 (en) | Process for preparing thiophene derivatives | |
| US4841086A (en) | Process for the preparation of 2-cyano-2-oximino-acetamide derivatives | |
| PL111221B1 (en) | Preparation of 2-/4-substituted piperazinyl-1/-4-aminoguinazolines | |
| US4010280A (en) | Phenoxyalkylamine derivatives and preparation thereof | |
| PL171743B1 (pl) | N-5-zabezpieczone2,5-diamino-4,6-dihydroksypirymidyny PL PL PL | |
| JP4138067B2 (ja) | メチン誘導体の製造方法 | |
| US4789743A (en) | Process for the preparation of 2,4-diamino-5-benzylpyrimidines | |
| US5643438A (en) | Process for the preparation of substituted diamino-dicarboxylic acid derivatives | |
| US4943675A (en) | Anilinopyrimidine derivatives | |
| HU195485B (en) | Process for producing aromatic carboxylic acid derivatives and -carboxamide derivatives | |
| JP2805114B2 (ja) | α,β−不飽和ケトエステル誘導体 | |
| HU194176B (en) | Process for production of derivatives of new 7-phormildekahydridinoline | |
| SU388406A1 (ru) | СR,10где Нз — атом галогена, гидроксильна групла, низший алкил с 1—4 атомами углерода, низша алкоксигруппа с 1—4 атомами углерода, трифторметильна группа;R-s — атом водорода, галогена, гидроксильна группа, низший алкил с 1—4 ато.чами углерода, заключающийс в том, что соединение общей формулы II1520Пе(_/Y^>&=" ^Л 11 .iЧхХ- | |
| US4798893A (en) | Process for producing 1-(5-substituted-2-ethynylphenyl)-2-propanones |